Page 1

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Cơ bản - Bài toán đốt cháy este (Đề 1) Bài 1. (CB) Đốt cháy hoàn toàn 0,15 mol este thu được 19,8 gam CO2 và 0,45 mol H-2O. Công thức phân tử este là A. C2H4O2 B. C3H6O2 C. C4H8O2 D. C5H10O2 Bài 2. (CB)Khi đốt cháy hoàn toàn một este no, đơn chức thì số mol CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este là A. propyl axetat. B. metyl axetat C. etyl axetat. D. metyl fomat. Bài 3. ( CB) Đốt cháy hoàn toàn 7,8 gam este X thu được 11,44 gam CO2 và 4,68 gam H2O. Công thức phân tử của este là A. C4H8O4 B. C4H8O2 C. C2H4O2 D. C3H6O2 Bài 4. (CB) Đốt cháy hoàn toàn a gam hỗn hợp các este no, đơn chức, mạch hở. Sản phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong, thấy khối lượng bình tăng 6,2 gam, số mol của CO2 và H2O sinh ra lần lượt là A. 0,1 và 0,1 mol B. 0,1 và 0,01 mol C. 0,01 và 0,1 mol D. 0,01 và 0,01 mol Bài 5. Đốt cháy hoàn toàn m mol este X tạo bởi ancol no, đơn chức, mạch hở và axit không no (chứa một liên kết đôi C=C), đơn chức, mạch hở thu được 8,96 lít CO2 (đktc) và 5,4 gam nước. Giá trị của m là A. 0,05. B. 0,10. C. 0,15. D. 0,20. Bài 6. (CB) Đốt cháy hoàn toàn m gam hỗn hợp các este no, đơn chức, mạch hở. Sản phẩm cháy được dẫn vào bình đựng dung dịch Ca(OH)2 dư thấy khối lượng bình tăng 12,4 gam. Khối lượng kết tủa tạo ra tương ứng là A. 12,4 gam. B. 20 gam. C. 10 gam. D. 24,8 gam. Bài 7. (CB) Đốt cháy hoàn toàn 0,1 mol este X rồi dẫn sản phẩm cháy vào dung dịch Ca(OH)2 dư thu được 20 gam kết tủa. Công thức phân tử của X là A. HCOOCH3 B. HCOOC2H5 C. CH3COOCH3 D. CH3COOC2H5 Bài 8. (CB) Đốt cháy hoàn toàn 4,4 gam hỗn hợp este gồm metyl propionat và etyl axetat cần bao nhiêu lít khí oxi (đktc) ? A. 2,24 lít. B. 1,12 lít. C. 5,60 lít. D. 3,36 lít. Bài 9. Đốt cháy hoàn toàn 13,2 gam etyl axetat thu được V lít khí CO2 (đktc). Giá trị của V là A. 13,44. B. 3,36. C. 8,96. D. 4,48. Bài 10. (CB) Đốt cháy hoàn toàn este đơn chức X thấy VCO2 = VO2 cần dùng và gấp 1,5 lần VH2O ở cùng điều kiện nhiệt độ và áp suất. Tên gọi của X là A. metyl fomat. B. vinyl fomat. C. etyl fomat. D. vinyl axetat. Bài 11. (CB) Đốt cháy hoàn toàn 13 gam este đơn chức X. Sản phẩm thu được gồm 30,8 gam CO2 và 12,6 gam nước. CTPT của X là A. C5H8O2. B. C7H12O2. C. C6H12O2. D. C7H14O2. Bài 13. (CB) Đốt cháy hoàn toàn 4,4 gam một este no đơn chức E thu được 4,48 lít CO2 (ở đktc). Công thức của este đó là A. C5H10O2 B. C3H6O2 C. C4H8O2 D. C2H4O2 Bài 14. (CB) Đốt cháy hoàn toàn một lượng este no đơn chức E thì thể tích CO2 thu được bằng thể tích của oxi trong cùng điều kiện. Công thức của este đó là A. HCOOCH3 B. CH3COOCH3 C. CH3COOC2H5 D. HCOOC3H7 Bài 15. (CB) Đốt cháy hoàn toàn một lượng este no đơn chức thì thể tích khí CO2 sinh ra luôn bằng thể tích khí O2 cần cho phản ứng ở cùng điều kiện nhiệt độ và áp suất. Tên gọi của este đem đốt là A. etyl axetat. B. metyl fomat. C. metyl axetat. D. propyl fomat. Bài 16. (CB) Đốt cháy hoàn toàn 0,11 gam este thì thu được 0,22 gam CO2 và 0,09 gam H2O. Số đồng phân của chất này là A. 3 B. 4 C. 5 D. 6

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 17. (CB) Đốt cháy hoàn toàn 1 gam một este X đơn chức, mạch hở, có một nối đôi C=C thu được 1,12 lít khí CO2 (đktc) và 0,72 gam H2O. Công thức phân tử của X là A. C4H8O2 B. C5H10O2 C. C4H6O2 D. C5H8O2 Bài 18. (CB) Đốt cháy hoàn toàn m gam hỗn hợp 3 este thu được 8,8 gam CO2 và 2,7 gam H2O, biết trong 3 este thì oxi chiếm 25% về khối lượng. Khối lượng 3 este đem đốt là A. 2,7 gam. B. 3,6 gam. C. 6,3 gam. D. 7,2 gam. Bài 19. (CB) Đốt cháy hoàn toàn hỗn hợp các este của C3H6O2 và C4H8O2 thu được 8,96 lít CO2 (đktc) và m gam nước. Giá trị của m là A. 7,2. B. 3,6. C. 0,4. D. 0,8. Bài 20. Đốt cháy hoàn toàn 2,96 gam este X no đơn chức thu được 2,688 lít khí CO2 (ở đktc). CTPT của X là A. C2H4O2 B. C4H8O2 C. C3H6O2 D. C5H10O2 Bài 21. Đốt cháy este X tạo ra CO2 và H2O với số mol như nhau. Vậy X là A. este đơn chức B. este no, đa chức C. este no, đơn chức D. este có một nối đôi, đơn chức Bài 22. (CB) Để đốt cháy hết 1,62 gam hỗn hợp hai este đơn chức, no đồng đẳng kế tiếp cần vừa đủ 1,904 lít Oxi (đktc). CTPT hai este là A. C2H4O2 và C3H6O2. B. C4H8O2 và C5H10O2. C. C4H8O2 và C3H6O2. D. C2H4O2 và C5H10O2. Bài 23. (CB) Đốt cháy hoàn toàn a gam một este X thu được 9,408 lit CO2 (đktc) và 7,56 gam H2O. Khối lượng hỗn hợp CO2 và H2O thu được ở trên gấp 1,55 lần khối lượng oxi cần để đốt cháy hết X. X có công thức phân tử là A. C2H4O2 B. C3H6O2 C. C3H4O2 D. C4H8O2 Bài 24. (CB) Đốt cháy hoàn toàn 0,1 mol este đơn chức X cần 10,08 lit O2 (đktc) thu được 5,4 gam H2O. Hấp thụ toàn bộ sản phẩm vào bình đựng Ca(OH)2 dư thì thu được lượng kết tủa là A. 10 gam B. 20 gam C. 30 gam D. 40 gam Bài 25. Đốt cháy hoàn toàn 0,1 mol este đơn chức X cần 0,5 mol O2 thu được 8,96 lít CO2 và b mol H2O. Giá trị của b là A. 0,3. B. 0,35. C. 0,2. D. 0,4. Bài 26. Khi đốt cháy hoàn toàn một este no, đơn chức thì số mol CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este là A. metyl fomat. B. etyl axetat. C. metyl axetat. D. n-propyl axetat. Bài 27. Đốt cháy hoàn toàn 0,1 mol hỗn hợp gồm 1 este no đơn chức mạch hở và 1 este đơn chức, không no có 1 liên kết đôi C=C mạch hở cần vừa đủ V lít O2 (đktc) thu được 5,04 lít CO2 (đktc) và 3,6 gam H2O. Giá trị của V là A. 5,04 B. 2,8 C. 5,6 D. 10,08 Bài 28. Đốt cháy hoàn toàn 0,1 mol este hai chức X cần V lít O2 (đktc). Sản phẩm đốt cháy được dẫn lần lượt qua bình 1 đựng P2O5 (dư), bình 2 đựng Ca(OH)2 (dư), thấy khối lượng bình 1 tăng 5,4 gam, bình 2 tăng 17,6 gam. Giá trị của V là A. 7,84 B. 3,92. C. 15,68. D. 5,6. Bài 29. Đốt cháy hoàn toàn một lượng hỗn hợp hai este mạch hở, cho sản phẩm phản ứng cháy qua bình đựng P2O5 dư, khối lượng bình tăng thêm 6,21 gam, sau đó cho qua tiếp dung dịch Ca(OH)2 dư, thu được 34,5 gam kết tủa. Các este trên thuộc loại gì nào ? A. Este thuộc loại no B. Este thuộc loại không no đa chức C. Este thuộc loại no, đơn chức D. Este thuộc loại không no Bài 30. Đốt cháy một lượng este no đơn chức A cần dùng 0,35 mol oxi, thu được 0,3mol CO2. CTPT cuả este A là A. C3H6O2 B. C5H10O2 C. C2H4O2 D. C4H8O2

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 31. Hỗn hợp X gồm 2 este của 2 axit kế tiếp nhau trong dãy đồng đẳng: R’COOR và R’’COOR. Đốt cháy hoàn toàn 20,1 gam X cần 29,232 lít (đktc) O2 thu được 46,2 gam CO2. Hai este trong X là A. C5H8O2 và C6H10O2. B. C5H8O2 và C6H8O2. C. C5H10O2 và C6H12O2. D. C5H8O2 và C7H10O2. Bài 32. Hỗn hợp A gồm 2 este đơn chức, no, mạch hở là đồng phân của nhau. Khi trộn 0,1 mol hỗn hợp A với O2 vừa đủ rồi đốt cháy thu được 0,6 mol sản phẩm gồm CO2 và hơi nước. Công thức phân tử 2 este là: A. C3H6O2. B. C4H8O2. C. C5H10O2. D. C3H8O2. Bài 33. Đốt cháy hoàn toàn m gam hỗn hợp gồm các este no đơn chức, mạch hở. sản phẩm thu được dẫn vào nước vôi trong dư thấy bình tăng lên 6,2 gam. Số gam CO2 và số gam nước thu được lần lượt bằng A. 4,4 gam và 1,8 gam. B. 2,2 gam và 0,9 gam. C. 6,6 gam và 2,7 gam. D. 5,28 gam và 2,16 gam. Bài 34. Đốt cháy hoàn toàn 0,1 mol một este X (chứa C, H, O) đơn chức, mạch hở cần dùng vừa đủ V lít khí O2 (ở đktc) thu được 6,72 lít khí CO2 (ở đktc) và 3,6 gam H2O. Giá trị của V là A. 4,48 lít B. 6,72 lít C. 2,24 lít D. 8,96 lít Bài 35. Đốt cháy hoàn toàn 4,3 gam một este đơn chức được tạo ra từ axit no và ancol không no đều mạch hở cần 5,04 lit oxi ở đktc. Công thức cấu tạo của este là (biết C=12, O=16, H=1) A. HCOO-CH=CH2 B. CH3COO-CH2CH=CH2 C. CH3COO-CH=CH2 D. HCOO-CH2CH=CH2 Bài 36. (CB) Đốt cháy hoàn toàn 4,3 gam chất hữu cơ X, rồi dẫn toàn bộ sản phẩm đốt cháy vào dung dịch Ca(OH)2 dư có 20 gam kết tủa xuất hiện, độ giảm khối lượng dung dịch là 8,5 gam. Biết MX < 100. CTPT của X là A. C5H10O2. B. C3H6O2. C. C4H8O2. D. C4H6O2 LỜI GIẢI CHI TIẾT Câu 1: Đáp án: B nCO2 = nH 2O = 0, 45

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

C

0, 45 = 3 ⇒ C3 H 6O2 0,15

ÁN

-L

Í-

Câu 2: Đáp án: D Este sẽ có dạng: Cn H 2 mOm

H

Ó

A

Số C trong este:

ẤP

Như vậy, este là no đơn chức

2n + 2 − 2m =1⇒ n = m 2

G

TO

Do là no đơn chức nên π = 1 ⇒

Ỡ N

Do là đơn chức nên n = m = 2 ⇒ C2 H 4O2 ⇒ HCOOCH 3 ⇒ metylfomat

BỒ

ID Ư

Câu 3: Đáp án: C nCO2 = nH 2O = 0, 26

Như vậy, este là no, đơn chức Gọi công thức este là CnH2nO2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

7,8n = nCO2 = 0, 26 ⇒ n = 2 ⇒ C2 H 4O2 14n + 32 Câu 4: Đáp án: A 6, 2 ⇒ nCO2 = nH 2O = = 0,1 44 + 18

H Ơ

N

TP .Q

U

Y

N

Câu 5: Đáp án: B cái hay của bài này là xác định ra số π trong X. X tạo từ ancol no và axit không no có 1 nối đôi C=C, nhưng khi xác định số π

Đ

ẠO

rất nhiều bạn quên rằng trong X còn có 1π nữa là πC=O trong liên kết –COO.

Ư N

G

nghĩa là ∑πtrong X = 2 ||→ ∑CO2 – ∑H2O = nX = 0,4 – 0,3 = 0,1 mol.

H TR ẦN

www.daykemquynhon.ucoz.com

Câu 6: Đáp án: B 12, 4 ⇒ nCO2 = nH 2O = = 0, 2 44 + 18 ⇒ nCaCO3 = 0, 2.100 = 20

10

00

B

Câu 7: Đáp án: A nCO2 = 0, 2

2+

3

0, 2 =2 0,1

ẤP

Số C có trong X:

-L

Í-

H

Ó

A

C

Chỉ có 1 este duy nhất có 2C trong phân tử, đó là HCOOCH3 Câu 8: Đáp án: C 4, 4 neste = = 0, 05 ⇒ nCO2 = nH 2O = 0, 05.4 = 0, 2 88

BỒ

ID Ư

Ỡ N

G

TO

ÁN

0, 2.44 + 0, 2.18 − 4, 4 = 0, 25 ⇒ V = 5, 6 32 Câu 9: Đáp án: A 13, 2 neste = = 0,15 ⇒ nCO2 = 0,15.4 = 0, 6 ⇒ V = 13, 44 88 Câu 10: Đáp án: B Ta có tỉ lệ: H:O=2:1 ⇒ nO2 =

nC : nH 2O = 1,5 :1 = 3 : 2 ⇒ nC : nH : nO = 3 : 4 : 2 ⇒ C3 H 4O2

CTCT của X: HCOOCH = CH 2 ⇒ vinylfomat Câu 11: Đáp án: D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

nCO2 = 0, 7; nH 2O = 0, 7

Vậy, đây là este no đơn chức

13 − 0, 7.14 13 = 0,1 ⇒ M X = = 130 ⇒ C7 H14O2 32 0,1 Câu 12: Đáp án: B M Y = 72 ⇒ CH 2 = CH − COOH

U

Y

N

H Ơ

N

⇒ nX =

TP .Q

Như vậy, loại trừ được đáp án A và C

ẠO

* Đáp án B:

TR ẦN B

0,12 = 6 ⇒ thoa man 0, 02

10

Số C trong phân tử:

00

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

Este này có 2π trong phân tử

2+

3

* Đáp án D:

Í-

H

Ó

A

C

ẤP

Este này có 3π trong phân tử

TO

ÁN

-L

Số C trong phân tử: Câu 13: Đáp án: C Giả sử công thức este là CnH2nO2

4, 4n = nCO2 = 0, 2 ⇒ n = 4 ⇒ C4 H 8O2 14n + 32 Câu 14: Đáp án: A Este sẽ có dạng: Cn H 2 mOm

BỒ

ID Ư

Ỡ N

G

Do là no đơn chức nên π = 1 ⇒

2n + 2 − 2m =1⇒ n = m 2

Do là đơn chức nên n = m = 2 ⇒ C2 H 4O2 ⇒ HCOOCH 3 Câu 15: Đáp án: B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Este sẽ có dạng: Cn H 2 mOm

2n + 2 − 2m =1⇒ n = m 2

N

Do là no đơn chức nên π = 1 ⇒

H Ơ

Do là đơn chức nên n = m = 2 ⇒ C2 H 4O2 ⇒ HCOOCH 3 ⇒ metyl fomat

Y U

0,11 − (12 + 2).0, 005 0,11 = 0, 00125 ⇒ M = = 88 ⇒ C4 H 8O2 32 0, 00125

TP .Q

⇒ neste =

N

Câu 16: Đáp án: B nCO2 = nH 2O = 0, 005

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

Các đồng phân thỏa mãn

B

Câu 17: Đáp án: D Este có 2π trong phân tử

10

00

Vì vậy, n X = nCO2 − nH 2O = 0, 05 − 0, 04 = 0, 01 ⇒ M X = 100 ⇒ C5 H 8O2

2+

8,8.12 2, 7.2 + = 2, 7 ⇒ m = 3, 6 44 18

ẤP

0, 75m = mC + mH =

3

Câu 18: Đáp án: B

A

C

Câu 19: Đáp án: A ⇒ nCO2 = nH 2O = 0, 4 ⇒ mH 2O = 0, 4.18 = 7, 2

ÁN

2,96 − 0,12(12 + 2) 2,96 = 0, 04 ⇒ M este = = 74 ⇒ C3 H 6O2 32 0, 04

TO

⇒ neste =

-L

Í-

H

Ó

Câu 20: Đáp án: C Do đốt este no đơn chức nên nCO2 = nH 2O = 0,12

BỒ

ID Ư

Ỡ N

G

Câu 21: Đáp án: C Khi đốt este tạo nCO2=nH2O thì este đó phải là no, đơn chức ( có π + v = 1 ) Câu 22: Đáp án: C 1,904.32 1, 62 + 22, 4 Đốt este no đơn chức nên nCO2 = nH 2O = = 0, 07 44 + 88

⇒ neste =

1, 62 − 0, 07(12 + 2) = 0, 02 ⇒ M este = 81 32

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Do 2 este đồng đăng kế tiếp nên CTPT của 2 este là C4H8O2 và C3H6O2.

H Ơ

N

Câu 23: Đáp án: D nCO2 = nH 2O = 0, 42

0, 42.62 = 0,525 1,55.32

⇒ neste =

0, 42.3 − 0,525.2 = 0,105 2

0, 42.62 − 0,525.32 = 88 ⇒ C4 H 8O2 2 Câu 24: Đáp án: D 0,1.2 + 0, 45.2 − 0,3.1 = 0, 4 ⇒ nCaCO3 = 0, 4.100 = 40 nCO2 = 2 Câu 25: Đáp án: D Bảo toàn Oxi: nH 2O = 2neste + 2nO2 − 2nCO2 = 0, 4

ẠO

TP .Q

U

Y

N

⇒ nO2 =

Đ G Ư N H TR ẦN

www.daykemquynhon.ucoz.com

⇒ M este =

10

00

B

Câu 26: Đáp án: A Số mol CO2 bằng số mol O2 nên este có dạng Cn ( H 2O) m ⇒ Cn H 2 m Om

2+

3

Este no đơn chức nên π = 1 ⇒ dfrac 2n + 2 − 2m2 = 1 ⇒ n = m

A

H

Ó

⇒ HCOOCH 3 ⇒ metyl fomat

C

ẤP

Este đơn chức nên có 2O trong phân tử, ⇒ m = n = 2 ⇒ C2 H 4O2

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

Câu 27: Đáp án: A 2nCO2 + nCO2 − 2neste nO2 = = 0, 225 ⇒ V = 5, 04 2 Câu 28: Đáp án: A 17, 6 nCO2 = = 0, 4 44 5, 4 nH 2O = = 0,3 18 C x H y O4 + O2 → CO2 + H 2O Bảo toàn nguyên tử oxi 2nO2 = 2nCO2 + nH 2O − 4n X ⇒ nO2 = 0,35 ⇒ V = 7,84

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 29: Đáp án: C nCO2 = 0,345 nH 2O = 0, 345

H Ơ

N

nCO2 = nH 2O

TP .Q

U

Y

N

Este no, đơn chức, mạch hở Câu 30: Đáp án: A HD: quan sát thấy dùng bảo toàn nguyên tố Oxi là nhanh nhất:

ẠO

Nhận xét: A là este no đơn chức nên có 2 ng.t O và luôn nhớ:

G

Đ

đốt cháy cho: nCO2 = nH 2O = 0, 3mol

Ư N

Như vậy: có pt: 2.nA + 0,35.2 = 0,3.3 ⇒ nA = 0,1mol

H TR ẦN

www.daykemquynhon.ucoz.com

Do đó, số C bằng: 0,3 : 0,1 = 3 → là este: C3 H 6O2 Câu 31: Đáp án: A nO2 = 1,305 mol; nCO2 = 1,05 mol.

10

00

B

Vì hhX gồm 2 este của 2 axit kế tiếp nhau trong dãy đồng đẳng: R'COOR và R''COOR → hhX gồm 2 este cũng thuộc 1 dãy đồng đẳng.

2+

3

Theo BTKL: mH2O = 20,1 + 1,305 x 32 - 46,2 = 15,66 gam → nH2O = 0,87 mol.

C

ẤP

Theo BTNT O: nX = (1,05 x 2 + 0,87 - 1,305 x 2) : 2 = 0,18 mol.

Ó

A

Ta có: số C trung bình = 1,05 : 0,18 ≈ 5,83 → hhX gồm C5 và C6.

Í-

H

Vì nCO2 > nH2O → hh este không no, đơn chức.

TO

ÁN

-L

Dựa vào đáp án → hhX gồm C5H8O2 và C6H10O2 Câu 32: Đáp án: A Vì hhA gồm 2este đơn chức no, mạch hở nên đặt CTC của hhA là CnH2nO2

3n − 2 O2 → nCO2 + nH2O 2

Ỡ N

G

CnH2nO2 +

BỒ

ID Ư

Ta có: nCO2 = nH2O = 0,6 : 2 = 0,3 mol

→ số C = 0,3 : 0,1 = 3; số H = 0,3 x 2 : 0,1 = 6 → CT của 2 este là C3H6O2 Câu 33: Đáp án: A Nhận thấy este no đơn chức , mạch hở có công thức tổng quát là CnH2nO2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Khi đốt este luôn cho nCO2 = nH2O = x mol Ta có mbình tăng = mCO2 + mH2O = 6,2 → 44x + 18x = 6,2 → x = 0,1 mol

H Ơ

N

Vậy mCO2 = 4,4 gam, mH2O = 1,8 gam

Y

N

Câu 34: Đáp án: B Ta có nCO2 = 0,3 mol, nH2O = 0,2 mol

2n + n − 1 − 2 O2 → nCO2 + (n − 1) H 2O 2 4,3 .(3n − 3) = 0, 45 ⇒ n = 4 nO2 = 0, 225 ⇒ 14n + 30

TR ẦN

Gọi este có công thức đó là Cn H (2n − 2)O2

www.daykemquynhon.ucoz.com

TP .Q

H

→ V = 6,72 lít Câu 35: Đáp án: D Vì este đơn chức được tạo từ axitno và rượu không no nên loại A,C

ẠO

2.0,3 + 0, 2 − 0, 2 = 0,3 mol 2

Đ

2

=

G

nCO2 + nH 2O − 2nOX

Ư N

Bảo toàn nguyên tố O → nO2 =

U

Vì X là este đơn chức → nO(X) = 0,1.2 = 0,2 mol

Ó H Í-

Câu 36: Đáp án: D nCO2 = 0, 2

A

C

ẤP

2+

3

10

00

B

Cn H (2n − 2)O2 +

TO

ÁN

-L

Khối lượng dung dịch giảm: mCO2 + mH 2O − mCaCO3 = −8.5 ⇒ nH 2O = 0,15

4,3 − 0,15.2 − 0, 2.12 = 0,1 16 C : H : O = 0, 2 : 0,3 : 0,1 ⇒ (C2 H 3O)n

Ỡ N

G

nOX =

BỒ

ID Ư

⇒ 43n < 100 ⇒ n = 2 ⇒ C6 H 4O2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1. Đốt cháy hoàn toàn 0,15 mol hỗn hợp X gồm một axit hữu cơ A và một este B (B hơn A một nguyên tử cacbon trong phân tử) thu được 0,2 mol CO2. Vậy khi cho 0,2 mol X tác dụng hoàn toàn với AgNO3/NH3 dư thì khối lượng bạc thu được là: A. 16,2 gam B. 21,6 gam C. 43,2 gam D. 32,4 gam Câu 2. Đốt cháy hoàn toàn m gam một este mạch hở X (có CTPT dạng CnH2n – 4O2) thu được V lít CO2 (đktc) và x gam H2O. Biểu thức liên hệ giữa m với V, x là 7 A. m = (2,5V − .x) 9 9 B. m = (1, 25V − .x) 7 7 C. m = (1, 25V − .x) 9 7 D. m = (1, 25V + .x ) 9 Câu 3. Đốt cháy hoàn toàn 0,3 mol hỗn hợp gồm hai este có công thức phân tử lần lượt là C3H6O2 và C3H4O2. Toàn bộ sản phẩm sinh ra được hấp thụ vào bình đựng nước vôi trong thấy có 45 gam kết tủa và khối lượng dung dịch nước vôi trong tăng 7,2 gam so với ban đầu. khối lượng nước sinh ra do phản ứng cháy là A. 7,2 gam. B. 15,5 gam. C. 52,2 gam. D. 12,6 gam. Câu 4. Hóa hơi 3,35 gam X gồm CH3COOH, HCOOC2H5, CH3COOCH3, CH3COOC2H5 thu được 1,68 lít hơi X (ở 136,5oC và áp suất 1 atm). Đốt cháy hoàn toàn 3,35 gam hỗn hợp X trên thì thu được m gam H2O. Giá trị của m là A. 2,7 gam. B. 3,6 gam. C. 3,15 gam. D. 2,25 gam. Câu 5. (NC) Đốt cháy hoàn toàn 2,01 gam hỗn hợp gồm axit acrylic, vinyl axetat, metyl metacrylat. Toàn bộ sản phẩm cháy cho qua dung dịch Ca(OH)2 dư, sau phản ứng thu được 9 gam kết tủa và dung dịch X. Vậy khối lượng dung dịch X đã thay đổi so với dung dịch Ca(OH)2 ban đầu là A. giảm 3,87 gam. B. tăng 5,13 gam. C. tăng 3,96 gam. D. giảm 9 gam. Câu 6. (NC) Trong 1 bình kín chứa hơi chất hữu cơ X (CnH2nO2) mạch hở và O2 (số mol O2 gấp đôi số mol cần cho phản ứng cháy) ở 139,9oC, áp suất trong bình là 0,8 atm. Đốt cháy hoàn toàn X sau đó đưa về nhiệt độ ban đầu, áp suất trong bình lúc này là 0,95 atm. X có CTPT là A. C2H4O2. B. C3H6O2. C. C4H8O2. D. C5H10O2

N

Nâng cao - Bài toán đốt cháy este (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 7. (NC) Đốt cháy hoàn toàn 0,1 mol este đơn chức X, dẫn toàn bộ sản phẩm đốt cháy lần lượt qua bình 1 đựng 100 gam dung dịch H2SO4 98%; bình 2 đựng dung dịch KOH dư. Sau thí nghiệm bình 1 thu được dung dịch H2SO4 92,98%; bình 2 có 55,2 gam muối. CTPT của X là A. C4H4O2. B. C4H6O2. C. C4H8O2. D. C3H4O2. Câu 8. Đốt cháy hoàn toàn một lượng este X thấy thể tích CO2 thu được bằng thể tích O2 cần dùng và gấp 1,5 lần thể tích hơi nước (ở cùng điều kiện nhiệt độ, áp suất). Biết X tham gia phản ứng tráng gương. CTCT X là A. HCOOC≡CH. B. HCOOCH=CHCH3. C. HCOOCH=CH2. D. HCOOCH2CH3. Câu 9. X, Y là hai este đơn chức, đồng đẳng của nhau. Khi đốt cháy một mol X thu được a mol CO2 và b mol H2O. Còn khi đốt cháy 1 mol Y thu được a1 mol CO2 và b1 mol H2O. Biết a : a1 = b : b1. CTTQ dãy đồng đẳng este trên là A. CnH2nO2. B. CnH2n–2O2. C. CnH2n–4O2. D. CnH2n–2O4. Câu 10. (NC) P là hỗn hợp gồm ba hợp chất hữu cơ X, Y, Z đồng phân của nhau và đều tác dụng được với NaOH. Khi hóa hơi 3,7 gam X thu được 1,68 lít khí ở 136,5oC, 1atm. Mặt khác, dùng 2,52 lít (đktc) O2 để đốt cháy hoàn toàn 1,665 gam P sau phản ứng thu được V lít hỗn hợp khí (đktc). Giá trị V là A. 3,024. B. 1,512. C. 2,240. D. 2,268. Câu 11. Hai chất hữu cơ X và Y đều đơn chức là đồng phân của nhau. Đốt cháy hoàn toàn 5,8 gam hỗn hợp X và Y cần 8,96 lít oxi (đktc) thu được khí CO2 và hơi nước theo tỉ lệ VCO2 : VH2O = 1 : 1 (đo ở cùng điều kiện). Công thức đơn giản của X và Y là A. C4H8O B. C2H4O C. C3H6O D. C5H10O Câu 12. Chất X chứa C, H, O có khối lượng phân tử bằng 74. X tác dụng được với dung dịch NaOH và dung dịch AgNO3/NH3. Khi đốt cháy 7,4 gam X thấy thể tích CO2 thu được vượt quá 4,7 lít (đo ở đktc). Chất X là A. HCOOCH3 B. HCOOC2H5 C. HCOOH D. CH3COOCH3 Câu 13. Đốt cháy a gam một este sau phản ứng thu được 9,408 lít CO2 và 7,56 gam H2O, thể tích khí oxi cần dùng là 11,76 lít (các thể tích khí đều đo ở đktc). Biết este này do một axit đơn chức và một ancol đơn chức tạo nên. Công thức phân tử của este là A. C5H10O2 B. C4H8O2. C. C2H4O2.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. C3H6O2. Câu 14. E là este của axit cacboxylic no đơn chức (X) và ancol không no đơn chức có một nối đôi C=C (Y). Đốt a mol E thu được b mol CO2; đốt a mol X thu được c mol CO2; đốt a mol Y thu được 0,5b mol H2O. Quan hệ giữa b và c là A. b = c. B. b = 2c. C. c = 2b. D. b = 3c. Câu 15. (NC) X là hỗn hợp gồm 2 este cùng dãy đồng đẳng. Đốt cháy hoàn toàn 0,25 mol hỗn hợp X rồi hấp thụ hết sản phẩm cháy vào bình nước vôi trong dư thấy xuất hiện 70 gam kết tủa và khối lượng bình tăng m gam. Giá trị m là A. 37,8 B. 43,4 C. 31,2 D. 44,4 Câu 16. Đốt cháy hoàn toàn 0,99 gam hỗn hợp hai este đồng phân của nhau, đều tạo bời axit no đơn chức và ancol no đơn chức. Sản phẩm cháy cho qua dung dịch Ca(OH)2 dư, thấy sinh ra 4,5 gam kết tủa. Hai este đó là A. HCOOC2H5 và CH3COOCH3 B. CH3COOC2H5 và C2H5COOCH3 C. HCOOC3H7 và CH3COOC3H5 D. HCOOC4H9 và C2H5COOC2H5 Câu 17. Đốt cháy hoàn toàn 2,01 gam hỗn hợp gồm axit acrylic, vinyl axetat, metyl metacrylat. Toàn bộ sản phẩm cháy cho qua bình 1 đựng H2SO4 đặc thấy khối lượng bình 1 tăng m gam, bình 2 đựng Ca(OH)2 dư thu được 9 gam kết tủa. m có giá trị là A. 1,17. B. 1,71. C. 1,62. D. 1,26. Câu 18. Đốt cháy hoàn toàn 0,05 mol hỗn hợp M gồm anđehit X và este Y, cần dùng vừa đủ 0,155 mol O2, thu được 0,13 mol CO2 và 2,34 gam H2O. Mặt khác, cho 0,1 mol M phản ứng với lượng dư dung dịch AgNO3 trong NH3, kết thúc các phản ứng thu được 21,6 gam Ag. Công thức cấu tạo thu gọn của X, Y lần lượt là A. CH3CHO và HCOOCH3. B. CH3CHO và HCOOC2H5. C. HCHO và CH3COOCH3 D. CH3CHO và CH3COOCH3. Câu 19. Hỗn hợp X gồm 2 este đơn chức, mạch hở A và B (với MB = MA + 28). Đốt cháy hoàn toàn m gam hỗn hợp X cần vừa đủ 8,4 lít O2 (ở đktc) thu được 6,72 lít CO2 (ở đktc) và 5,4g H2O. Số đồng phân của este A là: A. 1 B. 4 C. 3 D. 2 Câu 20. Đốt cháy hoàn toàn 4,02 gam hỗn hợp X gồm axit acrylic, vinyl axetat và metyl metacrylat rồi cho toàn bộ sản phẩm cháy vào bình 1 đựng dung dịch H2SO4 đặc, bình 2 đựng dung dịch Ba(OH)2 dư thấy khối lượng bình 1 tăng m gam, bình 2 xuất hiên 35,46 gam kết tủa. Giá trị của m là: A. 3,24 gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 2,7 gam C. 3,6 gam D. 2,34 gam Câu 21. Đốt cháy hoàn toàn hỗn hợp M gồm : ancol X, axit cacboxylic Y và este Z (đều no đơn chức mạch hở và Y, Z có cùng số nguyên tử C) cần dùng vừa đủ 12,32 lít O2 (đkc) sinh ra 11,2 lít CO2 (đkc). Công thức của Z là : A. HCOOCH3 B. CH3COOCH3 C. HCOOC2H5 D. CH3COOC2H5 Câu 22. (CB) Đốt cháy hoàn toàn 0,1 mol este hai chức tạo bởi ancol no và axit đơn chức chưa no có một nối đôi ta thu được 17,92 lít khí CO2 (đktc) thì este đó được tạo ra từ ancol và axit nào sau đây ? A. etylen glicol và axit acrylic. B. propylen glicol và axit butenoic. C. etylen glicol, axit acrylic và axit butenoic. D. butanđiol và axit acrylic. Câu 23. Khi đốt 0,1 mol este X thu được 0,3 mol CO2 và a mol H2O. Giá trị của a là A. a = 0,3 B. 0,3 < a < 0,4 C. 0,1 ≤ a ≤ 0,3 D. 0,2 ≤ a ≤ 0,3 Câu 24. (CB) Hỗn hợp X gồm axit đơn chức Y, ancol đơn chức Z và este E được điều chế từ Y và Z. Đốt cháy 9,6 gam hỗn hợp X thu được 8,64 gam H2O và 8,96 lít khí CO2 (đktc). Biết trong X, ancol Z chiếm 50% về số mol. Số mol ancol Z trong 9,6 gam hỗn hợp X là A. 0,075. B. 0,08. C. 0,06. D. 0,09. Câu 25. Đốt cháy hoàn toàn 20,1 gam hỗn hợp X gồm 2 este đơn chức, không no (có 1 nối đôi C=C), kế tiếp nhau trong cùng dãy đồng đẳng cần 146,16 lít không khí (đktc), thu được 46,2 gam CO2. Biết rằng trong không khí oxi chiếm 20% về thể tích. Công thức phân tử của 2 este là A. C4H6O2 và C5H8O2. B. C5H8O2 và C6H10O2. C. C4H8O2 và C5H10O2. D. C5H10O2 và C6H12O2. Câu 26. Đốt cháy hoàn toàn 2,01 gam hỗn hợp gồm axit acrylic, vinyl axetat, metyl metacrylat. Toàn bộ sản phẩm cháy cho qua dung dịch Ca(OH)2 dư, sau phản ứng thu được 9 gam kết tủa và dung dịch X. Vậy khối lượng dung dịch X đã thay đổi so với dung dịch Ca(OH)2 ban đầu là: A. giảm 3,87 gam B. tăng 5,13 gam C. tăng 3,96 gam D. giảm 9 gam Câu 27. Hỗn hợp X gồm 1 este đơn chức, không no có một nối đôi (C=C) mạch hở (A) và 1 este no, đơn chức mạch hở (B). Đốt cháy hoàn toàn 0,15 mol X rồi cho toàn bộ sản phẩm cháy hấp thụ hoàn toàn vào bình đựng dung dịch Ca(OH)2 dư. Sau phản ứng thấy khối lượng bình tăng 23,9 gam và có 40 gam kết tủa. CTPT của 2 este là A. C2H4O2, C3H4O2. B. C3H6O2, C5H8O2.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

C. C2H4O2, C5H8O2. D. C2H4O2, C4H6O2. Câu 28. Hỗn hợp X gồm andehit Y và este T đều no, đơn chức, mạch hở. Đốt cháy hoàn toàn 0,1 mol hỗn hợp X cần vừa đủ 5,04 lit oxi, sản phẩm thu được có chứa 0,2 mol H2O. Khi cho 0,2 mol X trên tác dụng với AgNO3 dư trong NH3 đun nóng. Lượng bạc tối đa thu được (hiệu suất 100%) là?. A. 32,4 B. 64,8 C. 16,2 D. 43,2 Câu 29. Đốt cháy hoàn toàn 29,064 gam hỗn hợp gồm HOC–CHO, axit acrylic, vinyl axetat và metyl metacrylat rồi cho toàn bộ sản phẩm cháy vào bình 1 đựng dung dịch H2SO4 đặc, bình 2 đựng dung dịch Ba(OH)2 dư thấy khối lượng bình 1 tăng 13,608 gam, bình 2 xuất hiện m gam kết tủa. Giá trị của m là A. 318,549. B. 231,672. C. 220,64. D. 232,46. Câu 30. Đốt cháy hoàn toàn m gam hỗn hợp X gồm ancol etylic, axetanđehit, metyl fomat thu được 0,1 mol CO2 và 0,13 mol H2O. Cho m gam X trên vào một lượng dư dung dịch AgNO3 trong NH3 thu được a gam kết tủa. Giá trị của a là A. 4,32. B. 1,08. C. 10,08. D. 2,16.

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Câu 1: C

2+

3

LỜI GIẢI CHI TIẾT 0, 2 = 1,33 0,15 Suy ra A có 1 Cacbon (HCOOH) và B có 2 Cacbon (HCOOCH3) Khi tác dụng với AgNO3/NH3: + A phản ứng tạo Ag theo tỉ lệ 1:2 + B phản ứng tạo Ag theo tỉ lệ 1:2 Như vậy, khối lượng Ag thu được là: mAg = 0,15.2.108 = 32, 4 g Khi cho 0,15 mol hỗn hợp X tác dụng thu được 32,4 gam Ag, nên khi cho 0,2 mol hỗn hợp X tác dụng thu được khối lượng Ag là: 0, 2.32, 4 mAg = = 43, 2 0,15

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

Số nguyên tử Cacbon trung bình: nC =

BỒ

ID Ư

Ỡ N

G

Câu 2: C PP nhanh nhất xét 1 mol C5 H 6O2 (cái nào cũng đc) m=98g V = 112l ; x = 54 đến đây thử Câu 3: D nCO2 = 0, 3.3 = 0, 9 Khối lượng tăng: mCO2 + mH 2O − mCaCO3 = 7, 2 ⇒ mH 2O = 7, 2 + 45 − 0,9.44 = 12, 6

Câu 4: D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn nX =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

1, 68 = 0, 05 22, 4 .(273 + 136,5) 273

H Ơ

N

Nhận xét: tất cả các chất trong X đều có công thức dạng (CH 2 ) n O2

3,35 = 67 ⇒ 14n + 32 = 67 ⇒ n = 2,5 0, 05 ⇒ mH 2O = 2,5.0,05.18 = 2, 25

TP .Q

U

Y

N

MX =

2, 01 − 0, 09.12 − 2nH 2O

= 0, 09 − nH 2O ⇒ nH 2O = 0,065

Ư N

G

32

Đ

ẠO

Câu 5: A Cả 3 chất trên đều có 2π trong phân tử ⇒ nX = nCO2 − nH 2O

TR ẦN B

Í-

H

Ó

A

C

ẤP

2+

3

10

Vậy, khối lượng giảm 3,87 gam Câu 6: B 3n − 2 Cn H 2 n O2 + O2 → nCO2 + nH 2O 2 2x/(3n-2)<-------------------x------------->(2nx)/(3n-2) 2x ntr = 2 x + 3n − 2 2nx ns = 2 x − x + 2. 3n − 2 2x 2x + ntr ptr 16 3n − 2 = 16 ⇔ n = 3 = = ⇔ 4nx ns ps 19 19 x+ 3n − 2 =>X là C3 H 6O2

00

www.daykemquynhon.ucoz.com

H

Khối lượng dung dịch X thay đổi: ∆m = mCO2 + mH 2O − mCaCO3 = 0, 09.44 + 0, 065.18 − 9 = −3,87

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Câu 7: B Câu 8: C Do thể tích CO2 bằng thể tích O2 cần dùng nên X có dạng Cn(H2O)m Ta có : nCO2 = 1, 5nH 2O ⇒ n = 1,5m ⇒ C3 H 4O2 X có thể tham gia tráng gương nên X phải là HCOOCH = CH2 Câu 9: A Ta thấy tỉ lệ nCO2/nH2O luôn bằng nhau ở mọi chất => đồng đẳng của este no đơn chức => đáp án A Câu 10: D 1.1, 68 3, 7 nX = = 0, 05 ⇒ M X = = 74 ⇒ C3 H 6O2 22, 4 0, 05 .(273 + 136,5) 273 Khi đốt P nP = 0, 0225 ⇒ nCO2 = nH 2O = 0, 0225.3 = 0, 0675 ⇒ nO2 =

0, 0675.3 − 0, 0225.2 = 0, 07875 2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

Thể tích khí còn lại sau phản ứng: V = nCO2 + nO2 du = 22, 4(0, 0675 + 0,1125 − 0, 07875) = 2, 268 => Đáp án D Câu 11: C Bảo toàn khối lượng: 5,8 + 0, 4.32 mCO2 + mH 2O = mX + mO2 ⇒ nCO2 = nH 2O = = 0, 3 62 0,3.3 − 0, 4.2 nO = = 0,1 1 C : H : O = 0,3 : 0, 6 : 0,1 = 3 : 6 :1

G

Đ

ẠO

Câu 12: B 4, 7 nCO2 > = 0, 2098 22, 4

Ư N

Khối lượng phân tử bằng 74, xem trong 4 đáp án thì chỉ có 2O nên CTPT sẽ là C3H6O2

H TR ẦN

www.daykemquynhon.ucoz.com

X tác dụng được với NaOH nên có thể là axit hoặc este

00

B

X tác dụng được với AgNO3/NH3 nếu là axit thì chỉ có HCOOH (loại), nếu là este thì X sẽ là HCOOC2H5 Câu 13: B nCO2 = 0, 42; nH 2O = 0, 42

3 2+

0, 42 = 4 ⇒ C4 H 8O2 0,105

nCeste = nCaxit + nCancol ⇒ b = c + 0, 5b ⇒ b = 2c

Câu 15: B nCO2 = 0, 7

G

TO

-L

Bảo toàn C:

ÁN

Í-

H

Ó

Câu 14: B Đốt ancol: nCO2 = nH 2O = 0,5b

C

Số C trong este:

ẤP

0, 42.2 + 0, 42 − 0,525.2 = 0,105 2

A

⇒ neste =

10

Như vậy, đây là este no đơn chức

0, 7 = 2,8 0, 25

ID Ư

Ỡ N

Số C trung bình:

BỒ

Như vậy, X là các este no, đơn chức, mạch hở

Suy ra, đốt X sẽ thu được 0,7 mol CO2 và 0,7 mol H2O Khối lượng bình tăng: 0, 7(44 + 18) = 43, 4 Câu 16: B Gọi este là CnH2nO2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

0, 99 − 0, 045.12 − 0, 045.2 0, 045 = 0, 01125 ⇒ n = =4 32 0, 01125 Trong 4 đáp án thì chỉ có đáp án B thỏa mãn neste =

H Ơ

N

Câu 17: A Ta thấy, mỗi chất đều có 2π trong phân tử

32

= 0, 09 − nH 2O ⇒ nH 2O = 0, 065 ⇒ m = 1,17

U

2, 01 − 0, 09.12 − 2.nH 2O

TP .Q

Y

N

⇒ nhh = nCO2 − nH 2O

Đ

ẠO

Câu 18: B nCO2 = nH 2O = 0,13 ⇒ X , Y đều no, đơn chức, hở

H

Bảo toàn oxi: a + 2b + 0,155.2 = 0,13.2 + 0,13 ⇒ a + 2b = 0, 08

TR ẦN

=> a = 0,02 ; b = 0,03

www.daykemquynhon.ucoz.com

Ư N

G

n X = a; nY = b ⇒ a + b = 0, 05

B

nCO2 = an + bm ⇒ 0, 02n + 0, 03m = 0,13 ⇒ 2n + 3m = 13

10

00

⇒ n = 2; m = 3 ⇒ C2 H 4O; C3 H 6O2

2+

3

nAg = 0, 2 = 2nM ⇒ este cũng có phản ứng tráng bạc

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

CH 3 HCO; HCOOC2 H 5 Câu 19: D Số mol Oxi trong X: nO = 0,3.2 + 0,3 − 0, 75 = 0,15 n Do nCO2 = nH 2O ⇒ nX = O = 0, 075 2 2 este là no, đơn chức. 0,3 Số nguyên tử C trung bình: C = =4 0, 075 Do đó, 2 este sẽ có 3 và 5 C trong phân tử. A có công thức là C3H6O2. Các đồng phân este thỏa mãn. HCOOC2 H 5

BỒ

ID Ư

Ỡ N

CH 3COOCH 3

Câu 20: D Quan sát các chất trong X, axit acrylic: CH2=CHCOOH; axit vinyl axetat: CH3COOCH=CH2; metyl metacrylat: CH2=CH(CH3)2COOCH3 → đều có 2 liên kết pi ở nối đôi C=C và C=O.

Do đo, ở phản ứng đốt cháy: X + O2 → CO2 + H2O. ta có: n X = nCO2 - n H2O = 0,18 - x

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Lại thấy: bình 1 tăng do x mol H2O bị hấp bởi axit H2SO4 đặc, bình 2 xuất hiện 0,18 mol kết tủa BaCO3↓. Quay lại phản ứng đốt cháy:

N

bảo toàn O: 2 × ( 0,18 - x ) + 2n O2 = 0,18 × 2 + x → n O2 = 1,5x.

H Ơ

bảo toàn khối lượng: 4,02 + m O2 = 0,18 × 44 + 18x → m O2 = 3,9 + 18x.

Y

N

Do đó: 32 × (1,5x) = 3,9 + 18x → x = 0,13 mol → m = 0,13 × 18 = 2,34 gam → Chọn đáp án D.

ẠO

Câu 21: A Gọi công thức của ancol X là Cn H2n+2O và công thức của Y, Z là CmH2mO2 ( với m ≥ 2)

G

Đ

Cn H2n+2O + 1,5n O2 → nCO2 + (n+1) H2O

Ư N

CmH2mO2 + (1,5m- 1) O2 → m CO2 + mH2O

TR ẦN

H

Thấy nY+ nZ = 1,5nCO2 - nO2 = 1,5. 0,5 - 0,55= 0,2 mol

www.daykemquynhon.ucoz.com

TP .Q

U

► Note: sau kq trên có thể nhớ thêm khi đốt axit cacboxylic không no ( có 1 nối đôi C=C ) đơn chức mạch hở thì luôn có n O2 tham gia phản ứng = 1,5.n nước.

Luôn có 0,2.m < 0,5 → m < 2,5 → m = 2

ẤP

2+

Do este là đơn chức nên ancol phải là hai chức

3

10

00

B

Vậy công thức của Z là HCOOCH3. Câu 22: A 17, 92 Số C có trong este: =8 22, 4.0,1

C

Công thức este: ( R1COO) 2 R2

H

Ó

A

Nếu coi R1 và R2 là số C của axit và ancol, do axit có 1 nối đôi nên R1 ≥ 3

-L

Í-

Mặt khác, 2 R1 < 8 ⇒ R1 < 4

ÁN

Như vậy, R1 chỉ có thể bằng 3

TO

Este : (CH 2 = CHCOO )2 C2 H 4

Ỡ N

G

Như vậy, este tạo bởi etylen glicol và axit acrylic Câu 23: C

BỒ

ID Ư

Số C trong X:

0,3 =3 0,1

Giá trị của a phụ thuộc vào số liên kết π có trong X CTCT của este có 3C và ít π nhất: HCOOC2H5 ⇒ π = 1 ⇒ nH 2O = nCO2 = 0,3

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CTCT của este có 3C và nhiều π nhất: HCOOC≡CH ⇒ π = 3 ⇒ nH 2O = nCO2 − (3 − 1)nX = 0,1

⇒ 0,1 ≤ a ≤ 0,3

H Ơ

N

Câu 24: B nH 2O = 0, 48; nCO2 = 0, 4

Y

N

Chênh lệch số mol CO2 và H2O chính là số mol ancol có trong X

TP .Q

U

⇒ nancol = 0, 48 − 0, 4 = 0, 08 Câu 25: B nkhông khí = 6,525 mol → nO2 = 6,525 x 0,2 = 1,305 mol.

Đ

ẠO

nCO2 = 1,05 mol.

H

Ư N

3n − 3 O2 → nCO2 + (n - 1)H2O 2

TR ẦN

www.daykemquynhon.ucoz.com

CnH2n - 2O2 +

G

Giả sử hhX có CTC là CnH2n - 2O2

Theo BTKL: mH2O = 20,1 + 1,305 x 32 - 1,05 x 44 = 15,66 gam → nH2O = 0,87 mol.

B

nhhX = 1,05 - 0,87 = 0,18 mol → MCnH2n - 2O2 = 20,1 : 0,18 ≈ 111,67 → n ≈ 5,83

2+

3

10

00

→ hhX gồm C5H8O2 và C6H10O2 Câu 26: A nCO2 = 0,09 mol

C

3n − 3 O2 → nCO2 + (n - 1)H2O 2

A

CnH2n - 2O2 +

ẤP

Vì các chất đều gồm 2O và có 2π trong phân tử nên đặt CTC của hh là CnH2n - 2O2

H

Ó

(14n+30)gam---------------n mol

-L

Í-

2,01 gam------------------0,09 mol

ÁN

→ 2,01n = 0,09(14n + 30) → n = 3,6 → nH2O = 0,09 x 2,6 : 3,6 = 0,065 mol.

Ỡ N

G

TO

mdd giảm = m↓ - mCO2 - mH2O = 9 - 0,09 x 44 - 0,065 x 18 = 3,87 gam Câu 27: D A có công thức CnH2n-2O2 ( n≥ 3), và B có công thức CmH2mO2 ( m≥2)

ID Ư

Vì dung dịch Ca(OH)2 dư nên nCO2 = nCaCO3 = 0,4 mol

BỒ

mbình tăng = mCO2 + mH2O → nH2O =

23,9 − 0, 4.44 = 0,35 mol 18

Luôn có nA = nCO2 - nH2O = 0,05 mol → nB = 0,15 -0,05 = 0,1 mol → 0,05n + 0,1m = 0,4 → n + 2m = 8

Vậy chỉ có cặp nghiệm nguyên thỏa mãn là n = 4 và m= 2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Công thức của 2 este là C2H4O2, C4H6O2. Câu 28: B nO2 = 0,225 mol.

H Ơ Y

3m − 2 O2 → mCO2 + mH2O 2

U

CmH2mO2 +

N

3n − 1 O2 → nCO2 + nH2O 2

TP .Q

CnH2nO +

N

Giả sử hhX gồm CnH2nO và CmH2mO2

ẠO

Ta có: nCO2 = nH2O = 0,2 mol.

G

Đ

Giả sử số mol của anđehit và este lần lượt là x, y mol.

Ư N

nhhX = x + y = 0,1

TR ẦN

www.daykemquynhon.ucoz.com

H

Theo BTNT O: x + 2y = 0,2 x 2 + 0,2 - 0,225 x 2 → x = 0,05 mol; y = 0,05 mol số C trung bình = 0,2 : 0,1 = 2.

10

00

Để thu được ↓max thì hhX gồm HCHO, HCOOCH2CH3.

B

Ta có: 0,05n + 0,05m = 0,2 → n + m = 4

3

nHCHO = nHCOOCH2CH3 = 0,1 mol.

ẤP

2+

AgNO3 / NH 3 HCHO → 4Ag

H

Ó

A

AgNO3 / NH 3 HCOOCH2CH3 → 2Ag

C

0,1--------------------0,4

Í-

0,1----------------------------------0,2

TO

ÁN

-L

→ ∑nAg = 0,2 + 0,4 = 0,6 mol → mAg = 0,6 x 108 = 64,8 gam Câu 29: B nH2O = 0,756 mol.

G

Nhận thấy các chất đều có 2O và 2π trong phân tử nên ta đặt CTC của hỗn hợp là CnH2n - 2O2

Ỡ N

CnH2n - 2O2 + O2 → nCO2 + (n - 1)H2O

ID Ư

(14n+30) gam----------------------------(n-1) mol

BỒ

29,064 gam------------------------------0,756 mol → 0,756(14n + 30) = 29,064(n - 1) → n = 2,8 → nCO2 = 0,756 x 2,8 : 1,8 = 1,176 mol. → m = 1,176 x 197 = 231,672 gam Câu 30: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Nhận thấy nC2H5OH = nH2O - nCO2 = 0,13- 0,1 = 0,03 mol Có nC2H5OH + nCH3CHO + nHCOOCH3 = nCO2 : 2 = 0,05

H Ơ

N

→ nCH3CHO + nHCOOCH3 = 0,05- 0,03 = 0,02 mol

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

→ nAg = 2. (nCH3CHO + nHCOOCH3) = 0,04 mol → a = 4,32 gam.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Khi đốt cháy một este X thì thu được lượng CO2 và H2O có số mol bằng nhau. Khẳng định nào sau đây là đúng khi nói về X A. X là este không no, đơn chức B. X là este không no, đa chức C. X là este đơn chức D. X là este no, đơn chức Câu 2: Đốt cháy hoàn toàn 14.8 gam este X thu được 13.44 lit CO2 (đktc) và 10.8 gam H2O. CTPT của X là: A. C2H4O2 B. C3H6O2 C. C4-H8O2 D. C5H10O2 Câu 3: Thuỷ phân hoàn toàn một este no, đơn chức, mạch hở X với 200ml dung dịch NaOH 2M (vừa đủ) thu được 18,4 gam ancol Y và 32,8 gam một muối Z. Tên gọi của X là A. Etyl fomat B. Etyl axetat C. Metyl axetat D. Propyl axetat Câu 4: Hai chất hữu cơ X và Y đều đơn chức là đồng phân của nhau. Đốt cháy hoàn toàn 5,8 gam hỗn hợp X và Y cần 8,96 lít oxi (đktc) thu được khí CO2 và hơi nước theo tỉ lệ = 1 : 1 (đo ở cùng điều kiện). Công thức đơn giản của X và Y là: A. C2H4O B. C3H6O C. C4H8O D. C5H10O Câu 5: Khẳng định nào sau đây không đúng A. Este bị thủy phân trong môi trường axit hoặc bazơ B. Thủy phân este no, đơn chức mạch hở trong môi trường axit sẽ thu được muối và ancol C. Phản ứng thủy phân este trong dung dịch kiềm không phải là phản ứng thuận nghịch D. Phản ứng thủy phân este trong dung dịch kiềm còn được gọi là phản ứng xà phòng hóa Câu 6: Một este X có CTPT là C4H8O2. Khi cho 0,1 mol X tác dụng với dung dịch NaOH thu được 8,2 gam muối. Tên gọi của X là : A. Etylaxetat B. Metylpropionat C. Metylaxetat D. propylfomat Câu 7: Hợp chất hữu cơ X đơn chức có CTPT C4-H8O2.X có phản ứng tráng bạc. Số đồng phân có thể có của X là: A. 4 B. 3 C. 1 D. 2 Câu 8: Thuỷ phân hoàn toàn m gam este X đơn chức bằng NaOH thu được muối hữu cơ A và ancol B. Cho B vào bình Na dư thấy khối lượng bình tăng 3,1g và có 1,12 lít khí (đktc) thoát ra. Mặt khác cũng cho m gam este X phản ứng vừa đủ 16g brom thu được sản phẩm chứa 35,1% brom theo khối lượng. CTCT của X: A. C15H33COOCH3 B. C17H33COOCH3

N

Bài toán đốt cháy và thủy phân este

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. C17H31COOCH3 D. C17H33COOC2H5 Câu 9: X có CTPT C4H8O2. Cho 20g X tác dụng vừa đủ với NaOH được 15,44g muối. X là: A. C2H5COOCH3 B. HCOOC3H7 C. CH3COOC2H5 D. C3H7COOH Câu 10: Este X có các đặc điểm sau: - Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau - Thủy phân X trong môi trường axit được chất Y tham gia phản ứng tráng gương và chất Z có số nguyên tử các bon bằng một nửa số nguyên tử cácbon trong X. Phát biểu nào sau đây không đúng? A. Đốt cháy hoàn toàn 1 mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O B. Chất Y tan vô hạn trong nước C. Chất X thuộc loại este no, đơn chức D. Đun Z với dung dịch H2SO4 đặc ở 170 độ C thu được anken Câu 11: Thuỷ phân hoàn toàn 11,44 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,3M (vừa đủ) thu được 5,98 gam một ancol Y. Tên gọi của X là A. Etyl fomat B. Etyl axetat C. Etyl propionat D. Propyl axetat Câu 12: Cho sơ đồ sau (các chữ cái chỉ sản phẩm hữu

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

3

o

+

H 3O , t P2O5 C6 H 5OH NaOH du KCN  → X  → Y  → Z  → T   →M + N

2+

cơ): CH 3Cl

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

Công thức cấu tạo của M và N lần lượt là : A. CH3COONa và C6H5ONa. B. CH3COONa và C6H5CH2OH. C. CH3OH và C6H5COONa. D. CH3COONa và C6H5COONa. Câu 13: Đun nóng 0,1 mol este no, đơn chức mạch hở X với 30 ml dung dịch 20% (D = 1,2 g/ml) của một hiđroxit kim loại kiềm A. Sau khi kết thúc phản ứng xà phòng hoá, cô cạn dung dịch thì thu được chất rắn Y và 4,6 gam ancol Z, biết rằng Z bị oxi hoá bởi CuO thành sản phẩm có khả năng phản ứng tráng bạc. Đốt cháy chất rắn Y thì thu được 9,54 gam muối cacbonat, 8,26 gam hỗn hợp CO2 và hơi nước. Công thức cấu tạo của X là: A. CH3COOCH3 B. CH3COOC2H5 C. HCOOCH3 D. C2H5COOCH3 Câu 14: Đốt cháy hoàn toàn một este cho số mol CO2 và H2O bằng nhau. Thủy phân hoàn toàn 6 gam este trên cần vừa đủ 0,1 mol NaOH . CTPT của este là: A. C2H4O2 B. C3H6O2 C. C4-H6O2 D. C5H10O2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 15: Thuỷ phân este X có CTPT C4H8O2 trong dung dịch NaOH thu được hỗn hợp hai chất hữu cơ Y và Z trong đó Y có tỉ khối hơi so với H2 là 16. X có công thức là A. HCOOC3H7 B. CH3COOC2H5 C. HCOOC3H5 D. C2H5COOCH3 Câu 16: Xà phòng hoá hoàn toàn 37,0 gam hỗn hợp 2 este là HCOOC2H5 và CH3COOCH3 bằng dung dịch NaOH, đun nóng. Khối lượng NaOH cần dùng là A. 8,0g B. 20,0g C. 16,0g D. 12,0g Câu 17: Xà phòng hoá 22,2g hỗn hợp 2 este là HCOOC2H5 và CH3COOCH3 đã dùng hết 200 ml dd NaOH .Nồng độ mol/l của dd NaOH là. A. 0,5M B. 1M C. 1,5M D. 2M Câu 18: Thủy phân HCOOC6H5 trong dung dịch NaOH dư sẽ thu được hỗn hợp sản phẩm trong đó có chứa A. Một muối B. Phenol C. Hai muối D. Axit fomic Câu 19: Khi phân tích este E đơn chức mạch hở thấy cứ 1 phần khối lượng H thì có 7,2 phần khối lượng C và 3,2 phần khối lượng O. Thủy phân E thu được axit A và rượu R bậc 3. CTCT của E là A.HCOOC(CH3)2CH=CH2 B.CH3COOC(CH3)2CH3. C. CH2=CHCOOC(CH3)2CH3. D. CH2=CHCOOC(CH3)2CH=CH2. Câu 20: Cho ancol X tác dụng với axit Y thu được este Z. Làm bay hơi 4,30g Z thu được thể tích hơi bằng thể tích của 1,60g oxi (ở cùng to, p). Biết MX>MY, công thức cấu tạo thu gọn của Z là công thức nào? A. CH3COOCH=CH2 B. CH2=CHCOOCH3 C. HCOOCH=CHCH3 D. HCOOCH2CH=CH2 Câu 21: Cho este C3H6O2 xà phòng hoá bởi NaOH thu được muối có khối lượng bằng 41/37 khối lượng este. CTCT của este là A. HCOOC3H7 B. CH3COOC2H5 C. HCOOC3H5 D. CH3COOCH3 Câu 22: Tìm CTCT của este C4H8O2 biết rằng khi tác dụng hết với Ca(OH)2 thu được muối có khối lượng lớn hơn khối lượng của este. A. HCOOC3H7 B. CH3COOC2H5 C. HCOOC3H5 D. C2H5COOCH3

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 23: Một este đơn chức E có dE/O2 = 2,685. Khi cho 17,2g E tác dụng với 150ml dd NaOH 2M sau đó cô cạn được 17,6g chất rắn khan và 1 ancol. Tên gọi của E là: A. Vinyl axetat B. anlyl axetat C. Vinyl fomiat D. Anlyl fomiat Câu 24: X là một chất hữu cơ đơn chức có M = 88. Nếu đem đun 2,2 gam X với dung dịch NaOH dư, thu được 2,75 gam muối. Công thức cấu tạo thu gọn của chất nào sau đây phù hợp với X: A. HCOOCH2CH2CH3. B. CH3CH2CH2COOH. C. C2H5COOCH3. D.HCOOCH(CH3)2. Câu 25: Thực hiện phản ứng xà phòng hoá chất hữu cơ X đơn chức với dung dịch NaOH thu được một muối Y và ancol Z. Đốt cháy hoàn toàn 2,07 gam Z cần 3,024 lít O2 (đktc) thu được lượng CO2 nhiều hơn khối lượng nước là 1,53 gam. Nung Y với vôi tôi xút thu được khí T có tỉ khối so với không khí bằng 1,03. CTCT của X là: A. C2H5COOCH3 B. CH3COOC2H5 C. C2H5COOC3H7 D. C2H5COOC2H5 Câu 26: Hợp chất hữu cơ mạch hở X có công thức phân tử C5H10O. Chất X không phản ứng với Na, thoả mãn sơ đồ chuyển hoá sau:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

+ H 2 , Ni ,t + CH 2COOH , XtH 2 SO4 → Y  → Este có mùi chuối chín. X  Tên của X là A. pentanal. B. 2-metylbutanal. C. 3-metylbutanal. D. 2,2-đimetylpropanal Câu 27: Tổng số hợp chất hữu cơ no, đơn chức mạch hở, có cùng CTPT C5H10O2 phản ứng được với dung dịch NaOH nhưng không có phản ứng tráng bạc là A. 7 B. 9 C. 5 D. 8. Câu 28: Cho hỗn hợp X gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng với NaOH dư thu được 6,14 gam hỗn hợp hai muối và 3,68 gam rượu Y duy nhất có tỉ khối hơi so với oxi là 1,4375. Khối lượng mỗi este trong X lần lượt là A. 4,4 gam và 2,22 gam. B. 3,33 gam và 6,6 gam. C. 4,44 gam và 8,8 gam D. 5,6 gam và 11,2 gam. Câu 29: Đốt cháy este X đơn chức, mạch hở thu được số mol CO2 > số mol H2O và neste = nCO2 - nH2O. Công thức phân tử của X là A.CnH2nO2 ( n ≥ 2) B. CnH2n+2O2 ( n ≥ 4) C. CnH2n-2O2 ( n ≥ 4)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. CnH2n-2O2( n ≥ 3) Câu 30: Đun 20,4 gam một hợp chất hữu cơ đơn chức A với 300 ml dung dịch NaOH 1M thu được muối B và hợp chất hữu cơ C. Khi cho C tác dụng với Na dư cho 2,24 lít khí H2 (đktc). Biết rằng khi đun nóng muối B với NaOH (xt CaO, t˚) thu được khí K có tỉ khối đối với O2 bằng 0,5. C là hợp chất đơn chức khi bị oxi hóa bởi CuO (t˚) cho sản phẩm D không phản ứng với dung dịch AgNO3 /NH3 dư CTCT của A là: A. CH3COOCH2CH2CH3 B.CH3COOCH(CH3)CH3 C.HCOOCH(CH3)CH3 D. CH3COOCH2CH3 Câu 31: Trong số các este sau, este nào khi thủy phân trong dung dịch kiềm sẽ thu được sản phẩm có phản ứng tráng bạc A. CH3COOCH3 B. C6H5COOCH3 C. CH3COOCH=CH2 D. CH3COOCH2CH=CH2 Câu 32: Thuỷ phân hoàn toàn 8,8 gam một este đơn chức, mạch hở X với 100ml dung dịch KOH 1M (vừa đủ) thu được 4,6 gam một ancol Y. Tên gọi của X là: A. etyl fomat B. etyl propionat C. etyl axetat D. propyl axetat Câu 33: Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai este đồng phân cần dùng 27,44 lít khí O2, thu được 23,52 lít khí CO2 và 18,9 gam H2O. Nếu cho m gam X tác dụng hết với 400 ml dung dịch NaOH 1M , cô cạn dung dịch sau phản ứng thì thu được 27,9 gam chất rắn khan, trong đó có a mol muối Y và b mol muối Z (MY<MZ). Các thể tích khí đều đo ở điều kiện tiêu chuẩn. Tỉ lệ a:b là: A. 2:3 B. 4:3 C. 3:2 D. 3:5 Câu 34: Để thuỷ phân hoàn toàn este X no đơn chức mạch hở cần dùng 150 ml dung dịch NaOH 1M. Sau phản ứng thu được 14,4 gam muối và 4,8 gam ancol. Tên gọi của X là: A. etyl axetat B. propyl fomat C. metyl axetat D. metyl propionat Câu 35: ĐHA-10: Đốt cháy hoàn toàn một este đơn chức, mạch hở X (phân tử có số liên kết p nhỏ hơn 3), thu được thể tích khí CO2 bằng 6/7 thể tích khí O-2 đã phản ứng (các thể tích khí đo ở cùng điều kiện). Cho m gam X tác dụng hoàn toàn với 200 ml dung dịch KOH 0,7M thu được dung dịch Y. Cô cạn Y thu được 12,88 gam chất rắn khan. Giá trị của m là A. 7,2 B. 6,66. C. 8,88 D. 10,56

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT Câu 1: Đáp án: D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


o

H Ơ N Y U TP .Q ẠO Đ G

TR ẦN

www.daykemquynhon.ucoz.com

t → CO2 + H2O Ta có 5,8g (X, Y) + O2  0,4 Bảo toàn khối lượng => mCO2 = mH 2O = 5,8 + 0,4.32 = 18,6 (g).

Ư N

Khi đốt este thu được: nCO2 = nH 2O => k = 1 (theo độ bất bão hòa). Mà bản thân este luôn có k = 1 (liên kết π trong C = 0) => X là Este no, đơn chức, mạch hở. Câu 2: Đáp án: B Ta thấy : nCO2 = nH 2O = 0, 6 => Este no, đơn chức, mạch hở, goi CTPT của X là CnH2nO2 Bảo toàn khối lượng : 14,8 = mC + mH + mO => mO = 6,4 (g). => nO= 0,4 => neste = 0,2 (mol) 0,6 => n = = 3 => Este là C3H6O2. 0, 2 Câu 3: Đáp án: B nNaOH = 04 (mol) =>neste = 0,4 (mol) =>nx = ny = nz = 0,4 (mol). 18, 4 = 46 , Y là Y là C2H5OH Suy ra M Y = 0, 4 32,8 = 82 , Z là CH3COONa MZ = 0, 4 => X là CH3COOC2H5 (etyl axetat) Câu 4: Đáp án: B

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

18,6 = 0,3(mol ) 44 + 18 Bảo toàn nguyên tố oxi =>nO (X, Y)= 0,3.2 + 0,3 – 0,4.2 = 0,1 (mol) Trong X, Y thì nC : nH : nO = 3 : 6 : 1 => Công thức đơn giản nhất là C3H6O Câu 5: Đáp án: B Khẳng đinh B không đúng, vì thủy phân este trong môi trường axit thì không thu được muối mà thu được axit Câu 6: Đáp án: A Este C4H8O2 => este đơn chức. 8, 2 =>nmuối = 0,1 (mol) =>Mmuối = = 82 (CH3COONa) 0,1 => X là CH3COOC2H5 (Etylaxetat) Câu 7: Đáp án: D X đơn chức, có phản ứng tráng bạc => X là este của axit fomic. => X có thể là : HCOOCH2CH2CH3 hoặc HCOOCH(CH3)2 Câu 8: Đáp án: B Cho B + Na -> Bình tăng 3,1g + 0,05mol H2 => mB = 3,1 + mH 2 =3,2 (gam). Mà este đơn chức => A và B đơn chức.

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

Mà nCO2 = nH 2O =

BỒ

ID Ư

=> nB = 2nH 2 = 0,1 (mol) => B = 32 (CH3OH) Mặt khác m(g) X + Br2 (0,1 mol) => X có một nối đôi C = C 2.80 = 0, 456 (g). Sản phẩm tạo thành chứa 2Br => Msp = 0,351 => MX = 456 – 160 = 296. X có dạng CnH2n – 1COOCH3 => 12n + 2n – 1 + 59 = 296 => n = 17 Vậy X là C17H33COOCH3. Câu 9: Đáp án: B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


+

o

H 3O , t P2O5 KCN CH 3Cl  → CH 3CN   → CH 3COOH  →(CH 3CO )2 O

H Ơ N Y U TP .Q ẠO Đ G

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

C6 H 5OH NaOH du  → C6 H 5OOCCH 3   → C6 H 5ONa + CH 3COONa Vậy M, N là C6H5ONa và CH3COONa Câu 13: Đáp án: B Ta có : X + AOH -> Y + Z 0,1mol 7,2g 4,6g Vì X là este đơn chức => nZ = nX = 0,1 mol=> Z = 46 là C2H5OH Y (AOHdư , CnH2n+1COOA) + O2 -> A2CO3 + CO2 + H2O. 7, 2 9,54 .2 => A = 23. = Bảo toàn nguyên tố A : A + 17 2. A + 60 A là Na. NNaOH (dư) = 0,08 mol, nNa2CO3 = 0,09 mol. Bây giờ trong phản ứng đốt Y, ta thay Na bằng H thì :  HOH 0, 08mol Y  + O2 -> H2CO3 + CO2 + H2O Cn H 2 n +1COOH 0,1mol 0,09 mol 8,26 gam => Nếu đốt 0,1 mol CnH2n+1COOH sẽ tạo ra nCO2 = nH 2O

Ư N

Muối là HCOONa => X là HCOOC3H7. Câu 10: Đáp án: D Vì nCO2 = nH 2O => X là este no, đơn chức, mạch hở X -> Y + Z, mà Y có phản ứng tráng gương => Y là HCOOH. Z có số C bằng ½ trong X => Y cũng có số C bằng ½ trong X. Do đó X là HCOOCH3. Phát biểu D sai, vì đun CH3OH không tạo ra anken. Câu 11: Đáp án: B Vì este no, đơn chức, mạch hở => neste = nancol = nNaOH = 0,13 (mol). 11, 4 = 88 (C4H8O2) MX = 0,13 5,96 = 46 (C2H5OH) MY = 0,13 Vậy X là CH3COOC2H5 (Etylaxetat). Câu 12: Đáp án: A

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn 20 5 15, 44 Ta có nmuối= nX = = => Mmuối = = 68 (g). 88 22 5 / 22

ÁN

và mCO2 + mH 2O = 0,09.62 + 8,26 - 0,08.18 = 12,4 g.

BỒ

ID Ư

Ỡ N

G

TO

nCO2 = nH 2O = 0,2=> n = 1 hay axit là CH3COOH. Vậy X là CH3COOC2H5. Câu 14: Đáp án: A Ta có nCO2 = nH2O => este phải no, đơn chức, mạch hở CnH2nO2. 6 => neste = nNaOH = 0,1 => Meste = = 60 => n = 2. 0,1 Este là C2H4O2 Câu 15: Đáp án: D Ta có : dY/H2 = 16 => MY = 32 => Y là CH3OH Z là C2H5COOH => X là C2H5COOCH3 Câu 16: Đáp án: B Ta thấy este có chung phân tử khối PTK = 74, và đều phản ứng với NaOH theo tỉ lệ 1 : 1 37 => nNaOH = = 0,5 (mol). 74

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

=> mNaOH = 0,5. 40 = 20g. Câu 17: Đáp án: C Ta thấy este có chung phân tử khối PTK = 74, và đều phản ứng với NaOH theo tỉ lệ 1 : 1 22, 2 => nNaOH = = 0,3 (mol). 74 0,3 => [NaOH] = = 1,5M. 0, 2 Câu 18: Đáp án: C HCOOC6H5 + 2NaOH -> HCOONa + C6H5ONa + H2O Sản phẩm chứa hai muối. HCOONa và C6H5ONa Câu 19: Đáp án: A mC : mH : mO = 7,2 : 1 : 3,2 => nC : nH : nO = 0,6 : 1 : 0,2 => E là C6H10O2 (vì E là este đơn chức ). => E chứa một nối đôi C=C và một nối đôi C = O Rượu bậc ba nhỏ nhất là :

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

có 4C <=> axit có tối đa 2C => Nối đôi C = C phải nằm ở ancol. Rượu là : CH2=CH-C(CH3)2-OH E là HCOO(CH3)2CH= CH2. Câu 20: Đáp án: D 1, 6 4,3 = 0,05 => MZ = = 86 (C4H6O2). Ta có : nZ = 32 0, 05 => Z có một nối đôi C = C và một nối đôi C = O. Vì Mancol> Maxit, mà X + Y = Z + 18 (H2O) 104 => X + Y = 86 +18 = 104 => Y < = 52 2 => Y là HCOOH, X = 104 - 46 = 58 (CH2 = CH – CH2OH) Z là CH2 = CH – CH2OOCH. Câu 21: Đáp án: D 41.74 Mmuối = = 82 (CH3COONa) 37 Este : CH3COOCH3 Câu 22: Đáp án: D 2C4H8O2 + Ca(OH)2 -> Muối Ca(OOCCnH2n+1)2 + 2 ancol Theo đề bài, suy ra : 40 + 2.(14n + 45) > 2.88 23 => n > = 1, 6 => n = 2 (vì n ≤ 2) 14 => Muối là Ca(OOCC2H5)2 => este : C2H5COOCH3 Câu 23: Đáp án: D ME = 32.2,685 = 86 (C4H6O2) 17, 2 = 0, 2 (mol), => nE = 86 => nNaOH = 0,3 (mol). => 17,6g chất rắn (0,1 mol NaOH dư, 0,2 mol muối )

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

17, 6 − 0,1.40 = 68 0, 2 Muối là HCOONa => E là HCOOCH2-CH=CH2(Anlyl fomiat) Câu 24: Đáp án: B 2, 2 2, 75 nX = = 0, 025 => Mmuối = n X = = 110 88 0, 025 Muối là C3H7COONa => X là axit CH3CH2CH2COOH. Câu 25: Đáp án: D Z + O2 -> CO2 + H2 O 2,07g 0,135mol => mCO2 + mH2O = 2,07 + 0,135.32 = 6,39g. Mà m CO2 – mH2O = 1,53g => nCO2 = 0,09 (mol). nH2O = 0,135 (mol). 0,09 =2 nz = nH2O – nCO2 = 0,045 => Z có số C = 0, 045 => Z là CH3CH2OH. Khí T có dT/không khí = 1,03 => T = 30 (C2H6) => Y là C2H5COONa. => X là C2H5COOC2H5 Câu 26: Đáp án: C Este có mùi chuối chín là isoamylaxetat, tạo từ ancol isoamylic (CH3)2CHCH2CH2OH (Y) => X là (CH3)2CHCH2CHO (3-metyl butanal) Câu 27: Đáp án: B Các chất thỏa mãn là : - C4H9COOH Gồm 4 chất: C – C – C – C –COOH,

A

N H Ơ N Y U TP .Q ẠO Đ G Ư N H

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

=> Mmuối =

C-C(C)-COO-C

-L

Í-

H

Ó

- C3H7COOCH3 gồm 2 chất : C-C-C-COO-C và - C2H5COOC2H5 gồm 1 chất C-C-COOC-C

BỒ

ID Ư

Ỡ N

G

TO

ÁN

- CH3COOC3H7 gồm 2 chất C –COOC-C-C và => có 9 chất thỏa mãn Câu 28: Đáp án: A MY =32.1,4375 = 46 => Y là C2H5OH 2 este là (CH3COOC2H5 : x mol ; HCOOC2H5 : y mol) Ta có hệ : 3, 68  = 0, 08 x + y = 46  82 x + 68 y = 6,14

 x = 0, 05  m1 = 4, 4 g ⇔ =>   y = 0, 03  m2 = 2, 22 g Câu 29: Đáp án: D nCO2 − nH 2O neste = , suy ra k = 2. k −1 X là CnH2n+2-2kO2⇔ CnH2n-2O2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO Đ G

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Este nhỏ nhất thỏa mãn là HCOOCH=CH2 => n ≥ 3. Câu 30: Đáp án: B C + Na dư -> 0,1 mol H2 => nA = nC = 2nH2 = 0,2 mol(vì A đơn chức) 20, 4 => mA = = 102 (là C5H10O2) 0, 2 CaO → Khí K, mà dK/O2 = 0,5 => K =16 (CH4) B + NaOH  => B là CH3COOH => (C) : C3H7OH Do (C) không phải là ancol bậc 1 => (C) : (CH3)2CHOH => A là CH3COOCH(CH3)2 Câu 31: Đáp án: C CH3COOCH=CH2 + NaOH -> CH3COONa + CH3CHO Câu 32: Đáp án: C Ta có nKOH = 0,1 => nX = nY = 0,1 mol. =>MX = 88 (C4H8O2) =>MY = 46 (C2H5OH) X là CH3COOC2H5 (etyl axetat) Câu 33: Đáp án: B Ta có : nO2 = 1,225 (mol) nH2O = 1,05 mol nCO2 =1,05 mol nNaOH = 0,4 mol Nhận thấy nCO2 = nH2O => este là este no, đơn chức. Áp dụng định luật bảo toàn nguyên tố oxi, ta có : 2neste + 1,225.2 = 2.1,05 + 1,05 => neste = 0,35 mol. Số nguyên tử C = nCO2 : neste = 1,05 : 0,35 = 3 => Este X : C3H6O2 => Có 2 đồng phân : HCOOC2H5 và CH3COOCH3 HCOOC2H5 + NaOH -> HCOONa + C2H5OH a a CH3COOCH3 + NaOH -> CH3COONa + CH3OH b b = a + b =0,35 neste mchất rắn = 68a + 82b + 40(0,4 – 0,35) = 27,9 => a = 0,2 ; b = 0,15 a:b=4:3 Câu 34: Đáp án: D Ta có nmuối = nancol = nNaOH = 0,15 mol 14, 4 = 96 (C2H5COONa) => Mmuối = 0,15 4,8 => Mancol = (CH3OH) 0,15 => X là C2H5COOCH3. Câu 35: Đáp án: C Gọi CTPT của X là CnH2n+2-2kO2 (k < 3 => k = 1 hoặc k = 2) Đốt X : 3n − k − 1 Cn H 2 n + 2−2 k O2 + O2 → nCO2 + (n + k + 1) H 2O 2

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ư N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

6 3n − k − 1 =n . 7 2 + k = 1 => n = 3 =>

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

+ k = 2 => n = 9/2 (loại) => X là: C3H6O2 có hai đồng phân. * Nếu X là CH3COOCH3 => Y chứa (CH3COOK và KOH dư (có thể có)) nX = x => nKOH(dư) = 0,14 – x => (0,14 – x).56 + 98x = 12,88 => x = 0,12 => m = 8,88g. * Nếu X là HCOOC2H5 => Y chứa (HCOOK và KOH dư) => nX = x => nKOH(dư) = 0,14 – x (0,14 – x).56 + 84x = 12,88 => x = 0,18 > nKOH(loại) Vậy m = 8,88g

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1. Cho 8,8 gam CH3COOC2H5 phản ứng hết với dung dịch NaOH (dư), đun nóng. Khối lượng muối CH3COONa thu được là A. 12,3 gam. B. 16,4 gam. C. 4,1 gam. D. 8,2 gam. Câu 2. Cho 3,7 gam este no, đơn chức, mạch hở tác dụng hết với dung dịch KOH, thu được muối và 2,3 gam rượu etylic. Công thức của este là A. C2H5COOC2H5. B. C2H5COOCH3. C. HCOOC2H5. D. CH3COOC2H5. Câu 3. Xà phòng hóa hoàn toàn 17,6 gam CH3COOC2H5 trong dung dịch NaOH (vừa đủ), thu được dung dịch chứa m gam muối. Giá trị của m là A. 16,4. B. 19,2. C. 9,6. D. 8,2. Câu 4. Este X có công thức phân tử C2H4O2. Đun nóng 9,0 gam X trong dung dịch NaOH vừa đủ đến khi phản ứng xảy ra hoàn toàn thu được m gam muối. Giá trị của m là A. 10,2. B. 15,0. C. 12,3. D. 8,2. Câu 5. Đun nóng 0,1 mol este đơn chức X với 135 ml dung dịch NaOH 1M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được ancol etylic và 9,6 gam chất rắn khan. Công thức cấu tạo của X là A. C2H5COOCH3. B. C2H3COOC2H5. C. C2H5COOC2H5. D. CH3COOC2H5. Câu 6. Thủy phân este X có công thức phân tử C4H8O2 trong dung dịch NaOH thu được hỗn hợp 2 chất hữu cơ Y và Z trong đó Z có tỉ khối hơi so với H2 bằng 23. Tên của X là A. etyl axetat. B. Metyl axetat. C. metyl propionat. D. propyl fomat. Câu 7. Thuỷ phân hoàn toàn 22,2 gam hỗn hợp gồm hai este HCOOC2H5 và CH3COOCH3 bằng dung dịch NaOH 1M (đun nóng). Thể tích dung dịch NaOH tối thiểu cần dùng là A. 400 ml. B. 300 ml. C. 150 ml. D. 200 ml. Câu 8. Xà phòng hoá hoàn toàn 17,6 gam hỗn hợp 2 este là etyl axetat và metyl propionat bằng lượng vừa đủ V (ml) dung dịch NaOH 0,5M. Giá trị V là A. 200 ml. B. 500 ml. C. 400 ml.

N

Cơ bản - Bài toán thủy phân este

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 600 ml. Câu 9. Đun nóng 8,8 gam etyl axetat với 200 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn khan có khối lượng là A. 3,28 gam. B. 8,56 gam. C. 8,2 gam. D. 10,4 gam. Câu 10. Thuỷ phân hoàn toàn 11,44 gam este no, đơn chức, mạch hở X với 100 ml dung dịch NaOH 1,3M (vừa đủ) thu được 5,98 gam một ancol Y. Tên gọi của X là A. Etyl fomat. B. Etyl axetat. C. Etyl propionat. D. Propyl axetat. Câu 11. Đốt cháy hoàn toàn 0,1 mol este X thu được 0,3 mol CO2 và 0,3 mol nước. Nếu cho 0,1 mol X tác dụng hết với NaOH thì thu được 8,2 gam muối. Công thức cấu tạo của X là A. HCOOC2H3. B. CH3COOCH3. C. HCOOC2H5. D. CH3COOC2H5. Câu 12. Thủy phân hoàn toàn 8,8 gam este đơn chức, mạch hở X với 100ml dung dịch KOH 1M vừa đủ thu được 4,6 gam một ancol Y. Tên gọi của X là A. etyl fomat. B. etyl propionat. C. etyl axetat. D. propyl axetat. Câu 13. Để xà phòng hóa 17,4 gam một este no đơn chức cần dùng 300ml dung dịch NaOH 0,5M. Công thức phân tử của este là: A. C3H6O2. B. C4H10O2. C. C5H10O2. D. C6H12O2. Câu 14. Cho 2,96 gam este đơn chức X phản ứng vừa hết với 20 ml dung dịch NaOH 2M thu được 2 chất Z và T. Đốt cháy m gam T thu được 0,44 gam CO2 và 0,36 gam H2O. Chất X là: A. CH3COOCH3. B. HCOOC2H5. C. CH3COOC2H5. D. C2H5COOCH3. Câu 15. Thuỷ phân hoàn toàn 4,4 gam este no đơn chức E bằng dung dịch NaOH vừa đủ sau phản ứng thu được 4,1 gam chất rắn khan. Mặt khác đốt cháy hoàn toàn 4,4 gam E thu được 4,48 lít CO2 (ở đktc). Chất E là: A. CH3COOCH3. B. CH3COOC2H5. C. CH3COOC3H7. D. C2H5COOCH3. Câu 16. Cho 6,16 gam este đơn chức X phản ứng vừa hết dung dịch NaOH thu được 5,74 gam muối và 3,22 gam ancol Y. Tên gọi của X là: A. etyl fomat. B. vinyl fomat.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. etyl axetat. D. vinyl axetat. Câu 17. Cho 3,33 gam este đơn chức X phản ứng vừa hết với dung dịch KOH thu được muối và 2,07 gam ancol Y. Đốt cháy Y cần vừa đủ 3,024 lít oxi (đktc) thu được lượng CO2 có khối lượng nhiều hơn H2O là 1,53 gam. Tên gọi của X là: A. etyl fomat. B. vinyl fomat. C. etenyl metanoat. D. vinyl axetat. Câu 18. Thể tích hơi của 3 gam chất X (chứa C, H, O) bằng thể tích của 1,6 gam O2 (cùng điều kiện). Cho 3 gam X tác dụng với NaOH vừa đủ cô cạn dung dịch thu được 3,4 gam chất rắn. CTCT của X là: A. HCOOCH3. B. HCOOC2H5. C. CH3COOC2H5. D. C2H5COOCH3. Câu 19. Khi cho 3,96 gam một este đơn chức X phản ứng với 1 lượng dung dịch NaOH vừa đủ, thu được 3,69 gam muối và 2,07 gam ancol Y. Tên của X là A. etyl axetat. B. etenyl metanoat. C. vinyl fomat. D. metyl metanoat. Câu 20. Cho 4,4 gam hợp chất hữu cơ đơn chức X tác dụng vừa đủ với 50 ml dung dịch NaOH 1M, thu được 4,8 gam muối. Tên gọi của X là: A. propyl axetat. B. propyl fomat. C. etyl axetat. D. metyl propionat. Câu 21. Tỉ khối hơi của este X so với CO2 là 2. Khi thuỷ phân X trong môi trường axit thu được 2 chất hữu cơ Y, Z. Đốt cháy Y, Z cùng số mol thì thu được cùng thể tích CO2 ở cùng điều kiện. Tên gọi của X là: A. etyl propionat. B. metyl axetat. C. metyl fomat. D. etyl axetat. Câu 22. Thuỷ phân este X có CTPT C4H8O2 trong dung dịch NaOH thu được hỗn hợp hai chất hữu cơ Y và Z trong đó Y có tỉ khối hơi so với H2 là 16. X có công thức là A. HCOOC3H7. B. CH3COOC2H5. C. HCOOC3H5. D. C2H5COOCH3. Câu 23. Đun nóng 66,3 gam etyl propionat với 400 ml dung dịch NaOH 2M, cô cạn dung dịch sau phản ứng khối lượng chất rắn thu được là: A. 62,4 gam. B. 59,3 gam. C. 82,45 gam. D. 68,4 gam. Câu 24. Thủy phân hoàn toàn 0,2 mol một este thì cần vừa đúng 80 gam dung dịch NaOH 30% sau phản ứng thu được 54,8 gam muối của hai axit cacboxilic đơn chức. Hai axit đó là: A. C2H5COOH và C3H7COOH.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. HCOOH và C2H5COOH. C. CH3COOH và C3H7COOH. D. CH3COOH và C2H3COOH. Câu 25. Este X có công thức phân tử là C5H8O2. Đun nóng 0,1 mol X với 200 ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được 13,4 gam chất rắn khan. Công thức của este là A. CH3COO-CH2-CH=CH2. B. CH2=CH-COOC2H5. C. CH2=C(CH3)-COOCH3. D. HCOOCH=C(CH3)2. Câu 26. Thuỷ phân hoàn toàn 11,44 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,3M (vừa đủ) thu được 5,98 gam một ancol Y. Tên gọi của X là A. etyl axetat. B. etyl fomat. C. propyl axetat. D. etyl propionat. Câu 27. Xà phòng hóa hoàn toàn 9,7 gam hỗn hợp hai este đơn chức X, Y cần 100 ml dung dịch NaOH 1,50M. Sau phản ứng cô cạn dung dịch thu được hỗn hợp hai ancol đồng đẳng kế tiếp và một muối duy nhất. Công thức cấu tạo thu gọn của 2 este là A. H-COO-CH3 và H-COO-CH2CH3. B. CH3COO-CH3 và CH3COO-CH2CH3. C. C2H5COO-CH3 và C2H5COO-CH2CH3. D. C3H7COO-CH3 và C4H9COO-CH2CH3. Câu 28. X là este đơn chức có khả năng tham gia phản ứng tráng bạc. Để thuỷ phân hoàn toàn 6,6 gam chất X người ta dùng 34,1 ml dung dịch NaOH 10% (d = 1,1 g/ml; lượng NaOH này dư 25% so với lượng cần dùng cho phản ứng). Tên gọi của X là: A. metyl propionat. B. propyl fomat. C. etyl axetat. D. etyl propionat. Câu 29. Thủy phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng, thu được hai sản phẩm hữu cơ X, Y (chỉ chứa các nguyên tử C, H, O). Từ X có thể điều chế trực tiếp ra Y là phản ứng duy nhất. Chất X là A. axit fomic. B. etyl axetat. C. axit axetic. D. ancol etylic. Câu 30. Cho 1 gam este X có công thức HCOOCH2CH3 tác dụng với nước (xúc tác axit). Sau một thời gian, để trung hòa lượng axit hữu cơ bằng dung dịch NaOH 0,1M thấy cần đúng 45 ml. Tỉ lệ % este chưa bị thủy phân là A. 33,3% B. 50% C. 60% D. 66,7% Câu 31. Hỗn hợp X gồm etyl axetat và n-propyl axetat. Đun nóng hỗn hợp X với NaOH (vừa đủ) thu được 13,12 gam muối và 8,76 gam hỗn hợp rượu Y. Vậy % khối lượng của etyl axetat trong hỗn hợp X là : A. 56,85%. B. 45,47%. C. 39,8%.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 34,1%. Câu 32. Đốt cháy hoàn toàn 1,1 gam hợp chất hữu cơ đơn chức X, thu được 2,2 gam CO2 và 0,9 gam H2O. X có khả năng tham gia phản ứng với NaOH. Số đồng phân của X là: A. 3. B. 4. C. 5. D. 6. Câu 33. Xà phòng hoá hoàn toàn 0,3 mol mọt este X (chỉ chứa C, H, O) bằng một dung dịch có chứa 20 gam NaOH thu được một ancol và 28,4 chất rắn khan sau khi làm khô dung dịch. Mặt khác, nếu đốt cháy hoàn toàn 0,1 mol X, rồi cho sản phẩm cháy qua bình đựng dung dịch Ca(OH)2 dư thu được 30 gam kết tủa. Tên gọi của X là: A. metyl axetat. B. etyl fomat. C. vinyl fomat. D. vinyl axetat. Câu 34. Este X đơn chức tác dụng với NaOH đun nóng thu được muối Y có công thức phân tử là C3H5O2Na và ancol Y1. Oxi hóa Y1 bằng CuO nung nóng thu được anđehit Y2. Y2 tác dụng với AgNO3/NH3 dư, đun nóng thu được số mol Ag gấp 4 lần số mol Y2. Vậy tên gọi của X là A. etyl propionat. B. metyl propionat. C. metyl axetat. D. propyl propionat. Câu 35. Hỗn hợp gồm các este, đơn chức, no có công thức phân tử C4H8O2 và C5H10O2 khi thủy phân trong môi trường kiềm thì thu được tối đa 6 ancol khác nhau và một muối duy nhất. Vậy muối đó là: A. CH3COONa. B. HCOONa. C. C3H7COONa. D. C2H5COONa. Câu 36. Có 2 hợp chất hữu cơ (X), (Y) chứa các nguyên tố C, H, O, khối lượng phân tử đều bằng 74. Biết (X) tác dụng được với Na; cả (X), (Y) đều tác dụng được với dung dịch NaOH và dung dịch AgNO3 trong NH3. Vậy X, Y có thể là: A. CH3COOCH3 và HOC2H4CHO. B. C4H9OH và HCOOC2H5. C. OHC-COOH và C2H5COOH. D. OHC-COOH và HCOOC2H5. Câu 37. Có hai este là đồng phân của nhau và đều do các axit mạch hở no một lần và rượu mạch hở no một lần tạo thành. Để xà phòng hóa 22,2 gam hỗn hợp hai este nói trên phải dùng hết 12 gam NaOH nguyên chất. Các muối sinh ra sau khi xà phòng hóa được sấy đến khan và cân được 21,8 gam (giả thiết là hiệu suất phản ứng đạt 100%). Cho biết công thức cấu tạo của hai este? A. CH3COOC2H5 và C2H5COOCH3. B. HCOOC2H5 và CH3COOCH3. C. C3H7COOCH3 và CH3COOC3H7. D. HCOOC2H5 và CH3COOC2H5. Câu 38. Cho m gam chất hữu cơ đơn chức X tác dụng vừa đủ với 50 gam dung dịch NaOH 8%, sau khi phản ứng hoàn toàn thu được 9,6 gam muối của một axit hữu cơ và 3,2 gam một ancol. Công thức của X là: A. CH3COOC2H5. B. C2H5COOCH3. C. CH2=CHCOOCH3.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. CH3COOCH=CH2. Câu 39. Để xà phòng hoá hoàn toàn 52,8 gam hỗn hợp hai este no, đơn chức, mạch hở là đồng phân của nhau cần vừa đủ 600 ml dung dịch KOH 1M. Biết cả hai este này đều không tham gia phản ứng tráng bạc. Công thức của hai este là A. CH3COOC2H5 và HCOOC3H7. B. C2H5COOC2H5 và C3H7COOCH3. C. HCOOC4H9 và CH3COOC3H7. D. C2H5COOCH3 và CH3COOC2H5. Câu 40. Este X được tạo thành từ etylen glicol và hai axit cacboxylic đơn chức. Trong phân tử este, số nguyên tử cacbon nhiều hơn số nguyên tử oxi là 1. Khi cho m gam X tác dụng với dung dịch NaOH (dư) thì lượng NaOH đã phản ứng là 10 gam. Giá trị của m là A. 14,5. B. 17,5. C. 15,5. D. 16,5. Câu 41. X là một este no đơn chức, có tỉ khối hơi đối với CH4 là 5,5. Nếu đem đun 2,2 gam este X với dung dịch NaOH (dư), thu được 2,05 gam muối. Công thức cấu tạo thu gọn của X là A. HCOOCH2CH2CH3. B. HCOOCH(CH3)2. C. C2H5COOCH3. D. CH3COOC2H5. Câu 42. Khi đốt cháy hoàn toàn 4,4 gam chất hữu cơ X đơn chức thu được sản phẩm cháy chỉ gồm 4,48 lít CO2 (ở đktc) và 3,6 gam nước. Nếu cho 4,4 gam hợp chất X tác dụng với dung dịch NaOH vừa đủ đến khi phản ứng hoàn toàn, thu được 4,8 gam muối của axit hữu cơ Y và chất hữu cơ Z. Tên của X là A. etyl axetat. B. metyl propionat. C. isopropyl axetat. D. etyl propionat. Câu 43. Chất hữu cơ X có công thức phân tử là C5H8O2. Cho X tác dụng với dung dịch Br2 thu được chất hữu cơ Y có công thức là C5H8O2Br2. Đun nóng Y trong NaOH dư thu được glixerol, NaBr và muối cacboxylat của axit Z. Vậy công thức cấu tạo của X là: A. HCOOCH(CH3)-CH=CH2. B. CH3-COOCH=CH-CH3. C. CH2=CH-COOCH2CH3. D. CH3COOCH2-CH=CH2. Câu 44. Z là este tạo bởi ancol metylic và axit cacboxylic Y đơn chức, mạch hở, có mạch cacbon phân nhánh. Xà phòng hoá hoàn toàn 0,6 mol Z trong 300 ml dung dịch KOH 2,5M đun nóng, được dung dịch E. Cô cạn dung dịch E được chất rắn khan F. Đốt cháy hoàn toàn F bằng oxi dư, thu được 45,36 lít khí CO2 (đktc), 28,35 gam H2O và m gam K2CO3. Công thức cấu tạo của Y và giá trị của m là: A. CH3CH(CH3)COOH ; m = 51,75. B. CH2=C(CH3)COOH ; m = 51,75. C. CH3CH(CH3)COOH ; m = 41,40. D. CH2=C(CH3)COOH ; m = 41,40. Câu 45. Để xà phòng hoá hoàn toàn 19,4 gam hỗn hợp 2 este đơn chức X và Y cần 200ml dung dịch NaOH 1,5M. Sau khi phản ứng hoàn toàn, cô cạn dung dịch thu được hỗn hợp 2 ancol đồng đẳng kế tiếp nhau và 1 muối khan Z duy nhất. Công thức cấu tạo và % khối lượng của 2 este trong hỗn hợp đầu là: A. CH3COOCH3 66,67% và CH3COOC2H5 33,33%. B. HCOOCH3 61,85% và HCOOC2H5 38,15%.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. CH3COOCH3 61,85% và CH3COOC2H5 38,15%. D. HCOOCH3 66,67% và HCOOC2H5 33,33%. Câu 46. Chất hữu cơ X đơn chức, mạch hở có công thức phân tử là C4H6O2. Cho 12,9 gam X vào 200 ml dung dịch NaOH 1M, đun nóng. Sau phản ứng hoàn toàn cô cạn dung dịch thu được 16,1 gam chất rắn khan. Công thức của X là: A. CH2=CH-COO-CH3. B. H-COO-CH2-CH=CH2. C. CH3-COO-CH=CH2. D. CH2=C(CH3)-COOH. Câu 47. Cho 10,9 gam chất hữu cơ X chỉ chứa một loại nhóm chức tác dụng với 500ml dung dịch NaOH 0,5M thu được 12,3 gam muối của axit hữu cơ và 0,05 mol ancol. Lượng NaOH dư có thể trung hoà hết 0,5 lít dung dịch HCl 0,2M. Công thức cấu tạo thu gọn của X là: A. CH3COOC2H5. B. (CH3COO)3C3H5. C. C3H5(COOCH3)3. D. (HCOO)3C3H5. Câu 48. Thực hiện phản ứng xà phòng hoá giữa 0,1 mol một este đơn chức X với 200 ml dung dịch NaOH 1M thu được 8,8 gam ancol và dung dịch chứa 12,2 gam chất tan. Este X có tên gọi là: A. vinyl fomat. B. benzyl benzoat. C. isoamyl axetat. D. isopropyl axetat. Câu 49. Este E được điều chế từ axit đơn chức, mạch hở X và ancol đơn chức, mạch hở Y. Đốt cháy hoàn toàn 4,8 gam E, thu được 5,376 lít CO2 và 3,456 gam H2O. Mặt khác, khi cho 15 gam E tác dụng với 200 ml dung dịch KOH 1M, cô cạn dung dịch sau phản ứng thu được 17,5 gam chất rắn khan. Công thức của Y là A. CH3CH2OH. B. CH3CH2CH2OH. C. CH≡C-CH2OH. D. CH2=CHCH2OH. Câu 50. X là este tạo từ axit đơn chức và ancol đa chức. X không tác dụng với Na. Thủy phân hoàn toàn a gam X cần dùng vừa đủ 100 gam dung dịch NaOH 6% thu được 10,2 gam muối và 4,6 gam ancol. Công thức của X là A. (CH3COO)2C3H6. B. (HCOO)3C3H5. C. (C2H3COO)3C3H5. D. (HCOO)2C2H4.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

ID Ư

Ỡ N

Câu 1: D nCH3 COOC2H5 = 0,1(mol)

BỒ

PTTƯ CH3COOC2H5 + NaOH → CH3COONa + C2H5OH nCH3COOC2H5= nCH3COONa =0,1(mol). Vậy khối lượng muối là mCH3COONa= 0,1.82= 8,2g → Đáp án D. Câu 2: C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vì este no, đơn chức .Đặt CTPT CnH2nO2 Nhận thấy: Khi thủy phân este no đơn chức thì nC2H5OH = neste =0,05 mol.

H Ơ

N

→ Meste= 3,7: 0,05= 74=14n+ 32 → n=3. CTPT là C3H6O2

U

Y

N

Vậy CTCT là HCOOC2H5. Đáp án C. Câu 3: D nCH3 COOC2H5 = 0,1(mol)

TP .Q

PTTƯ CH3COOC2H5 + NaOH → CH3COONa + C2H5OH

ẠO

nCH3COOC2H5= nCH3COONa =0,1(mol).

G Ư N H

TR ẦN

C2H4O2 + NaOH→HCOONa + CH3OH

www.daykemquynhon.ucoz.com

Đ

Vậy khối lượng muối là mCH3COONa= 0,1.82= 8,2g → Đáp án D. Câu 4: A Este X có CTPT là C2H4O2 chỉ có một CTCT là HCOOCH3.

nHCOONa= nC2H4O2 = 0,15 mol.

ẤP

2+

ROOC2H5 + NaOH → RCOONa + C2H5OH

3

10

00

B

Vậy khối lượng muối thu được là: mHCOONa= 0,15.68=10,2 (g). Đáp án A. Câu 5: D Dựa đáp án tất cả đều là este đơn chức.X thủy phân tạo ancol etylic. Đặt CT este dạng RCOOC2H5.

A

C

nX= 0,1 mol< nNaOH= 0,135 mol. Vậy sau phản ứng NaOH còn dư.

H

Ó

Chất rắn khan gồm RCOONa 0,1 mol và NaOH dư 0,035 mol.

-L

Í-

→ mchất rắn= mRCOONa + mNaOH → 9,6 = 0,1( MR + 67)+ 0,035. 40→ MR= 15 (CH3).

TO

ÁN

Vậy CTCT CH3COOC2H5. Đáp án D Câu 6: A Đặt este X C4H8O2 có CTCT dạng RCOOR' ( với MR+MR'= 44).

Ỡ N

G

RCOOR' + NaOH → RCOONa + R'OH.

BỒ

ID Ư

MZ = 23.2= 46. Vậy Z là C2H5OH hay MR'=29.→ MR= 44-29=15 ( CH3).

CTCT của X là CH3COOC2H5.Tên gọi X là etyl axtetat. Đáp án A. Câu 7: B Nhận thấy 2 este đều no, đơn chức có cùng CTPT là C3H6O2. Vì 2 este no, đơn chức nên lượng NaOH tối thiểu để phản ứng thủy phân xảy ra hoàn toàn là → nNaOH = nC3H6O2= 0,3(mol).

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

N

Vậy VNaOH= 0,3/1= 0,3(lít)=300ml. Đáp án B. Câu 8: C CTPT của etyl axetat và metyl propionat đều là C4H8O2. 17,6 neste = = 0,2 mol. 88

N

nNaOH = neste = 0,2 mol.

Đ

ẠO

=> Đáp án C Câu 9: A Chú ý trong phản ứng thủy phân môi trường kiềm thì mchất rắn= mmuối + mNaOH dư( nếu có).

TP .Q

U

Y

0, 2 × 1000 = 400 ml. 0,5

VNaOH=

Ư N

G

CH3COOC2H5 + NaOH → CH3COONa + C2H5OH.

H TR ẦN

www.daykemquynhon.ucoz.com

Vì nCH3COOC2H5= 0,1 mol > nNaOH=0,04 mol → este còn dư.

00

B

Vậy nCH3COONa= 0,04 mol. → mCH3COONa= 0,04.82= 3,28 gam. Đáp án A. Câu 10: B RCOOR1 + NaOH → RCOONa + R1OH

10

neste = nNaOH = nR1OH = 0,1 × 1,3 = 0,13 mol.

2+

3

11, 44 = 88. C4H8O2. 0,13

ẤP

Meste =

C

5,98 = 46. MR1 = 29. C2H5-. 0,13

-L

Í-

=> Este là CH3COOC2H5.

H

Ó

A

Mancol = MR1 + 17 =

G

TO

ÁN

=> Đáp án B. Câu 11: B nCO2 = nH 2O ⇒ este no, đơn chức 0,3 = 3 ⇒ C3 H 6O2 0,1

ID Ư

Ỡ N

Số C trong este:

BỒ

M muoi = 82 ⇒ CH 3COONa ⇒ CH 3COOCH 3

=> Đáp án B Câu 12: C Đặt este X đơn chức dạng RCOOR' khi tham gia phản ứng thủy phân thì nX= nKOH = nancol= 0,1 mol. → Meste= 88. CTPT X là C4H8O2. và Mancol= 4,6:0,1= 46 → R' là C2H5.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vậy CTCT của X là CH3COOC2H5( etyl axetat). Đáp án C Câu 13: D Đặt CTPT este no đơn chức là CnH2nO2.

H Ơ

N

Nhận thấy khi xà phòng hóa este no đơn chức thì neste= nNaOH= 0,15 mol.

Y

N

→ Meste= 17,4 : 0,15= 116 → n=6.

ẠO

TP .Q

U

Vậy este có CTPT C6H12O2. Đáp án D. Câu 14: A nCO2 = 0, 01 < nH 2O = 0, 02

H

2,96 = 74 ⇒ CH 3COOCH 3 0, 02.2

00

B

MX =

0, 01 = 1 ⇒ CH 3OH 0, 01

TR ẦN

www.daykemquynhon.ucoz.com

Số C của ancol:

Ư N

G

Đ

Như vậy, T là ancol no đơn chức, mạch hở nancol = 0, 02 − 0, 01 = 0, 01

2+

3

10

=> Đáp án A Câu 15: B CnH2nO2 → nCO2.

C

ẤP

4, 4 0, 2 = 14.n + 32 n

Ó H

Í-

4, 4 = 0, 05 mol. 88

-L

neste =

A

=> n = 4. C4H8O2.

4,1 = 82. =>CH3COONa. 0, 05

TO

ÁN

Mmuối =

G

=> CH3COOC2H5.

BỒ

ID Ư

Ỡ N

=> Đáp án B. Câu 16: C Nhận thấy este X thủy phân trong NaOH tạo muối và ancol → loại B, D

Đặt CTCT este đơn chức là RCOOR'.

RCOOR' + NaOH → RCOONa + R'OH Bảo toàn khối lượng: mNaOH= mmuối + m ancol - meste = 2,8 gam → nNaOH= 0,07 mol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ta có nmuối= nancol= nNaOH= 0,07 mol. Vậy MRCOONa= 82 → R là CH3. MR'OH=3,22: 0,07= 46 → R' là C2H5.

TP .Q

U

Y

N

H Ơ

N

X có CTCT là CH3COOC2H5( etyl axetat).Đáp án C. Câu 17: A 3, 024.32  = 6,39 nCO2 = 0, 09 44nCO2 + 18nH 2O = 2, 07 + 22, 4 ⇒  nH 2O = 0,135 44nCO − 18nH O = 1,53  2 2 Như vậy, ancol no đơn chức

Đ Ư N

G

0, 09 = 2 ⇒ C2 H 5OH 0, 045

www.daykemquynhon.ucoz.com

3,33 = 74 ⇒ HCOOC2 H 5 0, 045 => Đáp án A Câu 18: A Trong cùng điều kiện nhiệt độ áp suất, thể tích thì nX =nO2= 0,05 mol.

10

00

B

TR ẦN

MX =

H

Số C của ancol:

ẠO

nancol = 0,135 − 0, 09 = 0, 045

2+

3

→ MX=3: 0,05 = 60 → X có CTPT là C2H4O2. loại C,D,B → đáp án A.

ẤP

Nhận thấy : X tác dụng vừa đủ NaOH cô cạn dung dịch thu được 3,4 g chất rắn nên

A

C

nX= nmuối= nchất rắn= 0,05 mol. → mmuối = 68 (HCOONa).

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

CTCT X là HCOOCH3. Đáp án A. Câu 19: A 3, 69 + 2, 07 − 3, 96 nNaOH = = 0, 045 40 3, 69 M muoi = = 82 ⇒ CH 3COONa 0, 045 2, 07 M ancol = = 46 ⇒ C − 2 H 2OH 0, 045

BỒ

ID Ư

Như vây, X là etyl axetat => Đáp án A Câu 20: D Nhận thấy các đáp án đều là este no, đơn chức. Đặt CT của X dạng RCOOR'. PTPU: RCOOR' + NaOH → RCOONa + R'OH. nX= nNaOH=nmuối = 0,05 mol.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ MX= 4,4: 0,05= 88. CTPT của X là C4H8O2 (loại A). Mmuối= 4,8 : 0,05 = 96 ( C2H5COONa)→ R làC2H5, R' là CH3

N

H Ơ

N

Vậy X có CTCT là C2H5COOCH3 ( metyl propionat).Đáp án D. Câu 21: D Nhận thấy đáp án đều là este no đơn chức, mạch hở. Đặt CTPT của X là CnH2nO2.

U

Y

Có MX= 2. 44= 88 → CTPT là C4H8O2.

ẠO

TP .Q

X thủy phân tạo chất Y, Z. Đốt cháy Y và Z thu được cùng số mol CO2 ở cùng điều kiện → Y và Z có cùng số nguyên tử C.

Ư N

G

Đ

→ CTCT của X là CH3COOC2H5 ( etyl axetat).Đáp án D. Câu 22: D Este X CTPT C4H8O2 có dạng RCOOR'

www.daykemquynhon.ucoz.com

H

PTPU: RCOOR'+ NaOH → RCOONa + R'OH.

10

00

B

Vậy CTCT là C2H5COOCH3. Đáp án D. Câu 23: D neste = 0, 65

TR ẦN

Có MZ= 32. vậy Z là CH3OH → R' là CH3 và R là C2H5

2+

3

Khối lượng ancol tạo thành: nC2 H5OH = 0, 65.46 = 29,9

Ó

A

C

ẤP

Khối lượng chất rắn: 66,3 + 0,8.40 − 29,9 = 68, 4 => Đáp án D Câu 24: C nNaOH = 0,6 mol.

Í-

H

neste : nNaOH = 1 : 3 → este 3 chức.

-L

(RCOO)2(R'COO)R1 + 3NaOH → 2RCOONa + R'COONa + R1(OH)3

TO

ÁN

nRCOONa + nR'COONa = 0,6 mol.

Ỡ N

G

Mtrung bình muối =

54,8 ≈ 91,33. Có một muối là CH3COONa (M = 82) hoặc HCOONa (M = 68). 0, 6

BỒ

ID Ư

2MRCOONa + MR'COONa =

54,8 = 274. 2MR + MR' = 274 - 67 × 2 - 67 × 1 = 73. 0, 2

•TH1: có một gốc là CH3COO-. + Giả sử R là CH3- => MR' = 73 - 15 × 2 = 43. => R' là C3H7-. Đáp án C.

+ Giả sử R' là CH3-. => MR =

73 − 15 = 29. => R là C2H5-. k có đáp án thỏa mãn. 2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

•TH2: có một gốc là HCOO-. làm tương tự không có trường hợp nào thỏa mãn. Câu 25: B RCOOR1 + NaOH → RCOONa + R1OH.

N

9, 4 = 94. MR = 27. => CH2=CH-. 0,1

U

Y

mRCOONa = 13,4 - mNaOHdư = 9,4 gam. MRCOONa = MR + 67 =

H Ơ

N

nNaOHdư = 0,2 - 0,1 = 0,1 mol.

ẠO

TP .Q

=> X là CH2=CH-COOC2H5. => Đáp án B Câu 26: A n X = nancol = nNaOH = 0,13

Đ

5,98 = 46 ⇒ C2 H 5OH 0,13 11, 44 + 0,13.40 − 5,98 = = 82 ⇒ CH 3COONa 0,13

Ư N H TR ẦN

www.daykemquynhon.ucoz.com

nmuoi

G

⇒ M ancol =

Như vậy, X là CH3COOC2H5

A

C

ẤP

9, 7 = 64,6. 0,15 => Có 1 este là HCOOCH3 (M = 60).

Meste trung bình =

2+

3

10

00

B

=> etyl axetat => Đáp án A Câu 27: A neste = nNaOH = 0,15 mol.

este còn lại là

-L

Í-

H

Ó

Mặt khác sau phản ứng thu được một muối duy nhất và 2 ancol đồng đẳng kế tiếp. HCOOCH2CH3.

ÁN

=> Đáp án A. Câu 28: B

34,1.1,1.0,1 = 0, 075 40,1.25

Ỡ N

G

TO

n X = nNaOH p/u =

6, 6 = 88 ⇒ C4 H 8O2 0, 075

ID Ư

⇒ MX =

BỒ

X có khả năng tráng bạc nên axit tạo X là HCOOH Như vậy X là propyl fomat => Đáp án B Câu 29: D Este E C4H8O2 có dạng RCOOR'.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Để từ X có thể điều chế trực tiếp ra Y là phản ứng duy nhất thì E có dạng CH3COOC2H5. Các phương trình:

N

CH3COOC2H5 + H2O ⇌ CH3COOH (Y) +C2H5OH(X). o

N

H Ơ

t C2H5OH (X) + O2  → CH3COOH (Y) + H2O. mengiam

U

Y

Câu 30: D nX = 0, 0135

0, 0045 = 66, 7% 0, 0135

ẠO

Tỉ lệ este chưa bị phân hủy: 1 −

TP .Q

nHCOOH = nNaOH = 0, 0045

H

Ư N

G

Đ

=>Đáp án D Câu 31: D Đặt nCH3COOC2H5 = a, nCH3COOC3H7 = b.

TR ẦN B

0, 06.88 × 100% = 34,1%. 0, 06.88 + 0,1.102

00

%CH3COOC2H5 =

10

www.daykemquynhon.ucoz.com

82a + 82b = 13,12 a = 0, 06 → Lập hpt:  46a + 60b = 8, 76 b = 0,1

2+ ẤP C

A

1,1 − 0, 05.12 − 0, 05.2 = 0,025 mol. 16

H

Ó

mX= mO + mC +mH. → nO=

3

→ Đáp án D. Câu 32: D Ta có:nCO2= nH2O= 0,05 mol →

-L

Í-

→ C : H : O = 0,05 : 0,1: 0,025 = 2:4:1

ÁN

X là hợp chất đơn chức tham gia phản ứng với NaOH → X có CTPT C4H8O2 ( este hoặc axit đơn chức)

TO

Các đồng phân:

Ỡ N

G

Este: -HCOOCH2CH2CH3; HCOOCH(CH3)CH3; CH3COOCH2CH3; CH3CH2COOCH3

BỒ

ID Ư

Axit -CH3CH2CH2COOH; CH3(CH3)CH2COOH

Đáp án D. Câu 33: B

Số C có trong X:

30 =3 100.0,1

nNaOH = 0, 5 ⇒ nNaOHdu = 0,5 − 0, 3 = 0, 2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CHất rắn khan gồm muối và NaOH 28, 4 − 0, 2.40 = 68 ⇒ HCOONa 0,3

N

⇒ M muoi =

N

TP .Q

U

Y

Dễ thấy, đáp án C loại do khi thủy phân thì không thu được ancol mà sẽ thu được andehit (CH3CHO) =>Đáp án B Câu 34: B RCOOR1 + NaOH → RCOONa + R1OH

H Ơ

Trong 4 đáp án, chỉ có B và C là este tạo từ HCOOH

ẠO

R1OH + CuO → RCHO + AgNO3 + NH3 → 4Ag.

G

Đ

=>Y2 là HCHO. =>Y1 là CH3OH.

H

Ư N

C3H5O2Na là muối CH3CH2COONa

TR ẦN B

www.daykemquynhon.ucoz.com

Vậy X là CH3CH2COOCH3. Đáp án B Câu 35: B Ta thấy, nếu axit có 2C (CH3COOH)

10

00

C4H8O2 sẽ tạo thành từ ancol là C2H5OH (1 đồng phân)

2+

3

C5H10O2 tạo ra từ ancol là C3H7OH (có 2 đồng phân)

ẤP

Nếu số C của axit tăng lên thì số đồng phân sẽ tiếp tục giảm

Í-

H

Ó

A

C

Như vậy, axit phải có 1C (HCOOH) Đáp án B Câu 36: D X tác dụng với Na, dung dịch NaOH, dung dịch AgNO3 trong NH3. Do đó, X là OHC-COOH.

ÁN

-L

Y tác dụng với dung dịch NaOH, dung dịch AgNO3 trong NH3. Do đó, Y là HCOOC2H5.

Ỡ N

G

TO

Đáp án D. Câu 37: B Đặt công thức chung của 2 este là RCOOR1.

ID Ư

nNaOH = 0,3 mol.

BỒ

Meste = 22,2 : 0,3 = 74. C3H6O2

MRCOONa = MR + 67 =

12,8 = 72,67. Suy ra, hai muối là HCOONa và CH3COONa. 0,3

Hai este là HCOOC2H5 và CH3COOCH3. Đáp án B.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 38: B nNaOH = 0,1( mol ) ⇒ nX = 0,1mol

N

Vì sau phản ứng chỉ thu được muối và ancol nên NaOH vừa đủ Dựa vào các đáp án nên X là este đơn chức M muoi = 96 ⇒ C2 H 5COONa

H Ơ

M ancol = 32 ⇒ CH 3OH

TP .Q

U

Y

N

Vậy đáp án B đúng Câu 39: D Este không tham gia tráng Ag nên loại A, C Ta có nKOH = 0, 6mol

Đ G Ư N

00

B

X phản ứng với NaOH theo tỉ lệ 1:2. n nX = Na = 0,125 2 mX = 0,125.132 = 16,5

C

ẤP

2+

3

10

Đáp án D Câu 41: D MX = 5,5 * 16 = 88. Suy ra C4H8O2. neste = 2,2 : 88 = 0,025 mol.

H

TR ẦN

www.daykemquynhon.ucoz.com

Gọi CT este là CnH2nO2 => n = 4 Vậy đáp án D đúng Câu 40: D Do este tạo từ etylen glicol nên là este 2 chức => có 4 nguyên tử Oxi. Suy ra có 5 nguyên tử cacbon. Công thức X là HCOO − CH 2 − CH 2 − OOCCH 3

ẠO

Vì các este đều là este no đơn chức ⇒ neste = nKOH = 0, 6mol ⇒ M este = 88

Ó

A

Đặt X là RCOOR1

Í-

H

MRCOONa = MR + 67 = 2,05 : 0,025 = 82. M = 15. R là -CH3.

ÁN

-L

Suy ra X là CH3COOCH2CH3.

TO

Câu 42: B nCO2 = 0, 2; nH 2O = 0, 2

(4, 4 − 0, 2.12 − 0, 2.2) = 0,1 16 X tác dụng với NaOH sinh muối thì X là este n X = 0, 5; nO = 0, 05

BỒ

ID Ư

Ỡ N

G

⇒ nO =

MX =

4, 4 = 88 0, 05

M có CTPT là C4 H 8O2 M muoi =

4,8 = 96 ⇒ C2 H 5COONa ⇒ X : C2 H 5COOCH 3 ⇒ metyl propionat. 0, 05

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Đáp án B Câu 43: D X có phản ứng cộng với Br2 nên X phải có nối đôi ở mạch C

H Ơ

N

Đun nóng Y thu được ancol 3 chức nên nối đôi ở ancol tạo este

Y

N

Công thức este; CH 3COOCH 2CH = CH 2

ẠO

TP .Q

U

Đáp án D Câu 44: B Bảo toàn nguyên tố K → nK2CO3 = 0,5nKOH = 0,375 mol → m = 51,75 gam

H

Ư N

Bảo toàn nguyên tố C → nC( muối) = nCO2 + nK2CO3 = 2,025 + 0,375 = 2,4 mol

G

Đ

Vì neste = 0,6 mol < nKOH = 0,75 mol nên chất rắn sau phản ứng gồm RCOOK và KOH dư: 0,75 - 0,6 = 0,15 mol

TR ẦN

www.daykemquynhon.ucoz.com

Bảo toàn nguyên tố H → nH ( muối) = 2nH2O - nKOH dư = 2. 1,575 - 0,15 = 3 mol

B

→ C: H = 2,4 : 3 = 4 :5 → công công thức của muối là C4H5O2K

3

19, 4 = 64, 667 0,3

2+

neste = nNaOH = 0, 3 ⇒ M este =

10

00

Đáp án B. Câu 45: B

C

ẤP

=> phải có 1 etse có M < 64, 667 ⇒ HCOOCH 3

Ó

A

Vì thu được 2 ancol đồng đẳng kế tiếp và 1 muối khan nên este còn lại là HCOOCH 3

Í-

H

meste = 19, 4; neste = 0,3 ⇒ nHCOOCH 3 = 0, 2; nCH 3COOCH 3 = 0,1

-L

0, 2.60 .100 = 61,85 % 19, 4

TO

ÁN

% HCOOCH 3 =

ID Ư

Ỡ N

G

Chọn B Câu 46: A Gọi X có dạng R1COOR2

BỒ

nX =

12,9 = 0,15 86

Sau phản ứng thu được 0,15 mol muối và 0,05 mol NaOH dư. ⇒ 0,15( R1 + 44 + 23) + 0, 05.4 = 16,1 ⇒ R1 = 27 ⇒ CH 2 = CH − Vậy, X là CH2=CHCOOCH3.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ N Y U

12, 2 − 0,1.40 = 82 ⇒ CH − 3COONa 0,1

TP .Q

M muoi =

N

=> Đáp án A Câu 47: B Số mol NaOH pứ= 0,4.0,5-0,25.0,2=0,15 mol Mà ta có: nNaOH pứ= 1/3nY => este X có 3 nhóm chức => Khối lượng mol của este X: M=10,9/0,05=218 => X: (CH3COO)3C3H5 => Đáp án B Câu 48: C M ancol = 88 ⇒ C5 H11OH

ẠO

Axit là CH3COOH

Ư N

G

Đ

Như vậy, trong 4 đáp án chỉ C thỏa mãn

H TR ẦN

www.daykemquynhon.ucoz.com

Đáp án C Câu 49: D xác định este E: có: nCO2 = 0, 24mol , nH 2O = 0,192mol

10

2+

3

Chú ý E đơn chức nên bảo toàn nguyên tố Oxi: 2.nE + 0,576 = 0, 24.2 + 0,192 → nE = 0, 048mol

00

B

Bảo toàn khối lượng: mO2 = 3, 456 + 0, 24.44 − 4,8 = 9, 216 gam → nO = Ans :16 = 0, 576mol

C

ẤP

Từ số mol oxi, số mol C, số mol H tính là ngay CTPT của E là: C5 H 8O2 .

H

Ó

A

Xác định axit: 15 gam E có số mol là: 0,15 mol. KOH dùng 0,2 mol nên chất rằn thu được sau pư(2): gồm 0,05 mol KOH dư và 0,15 gam muối RCOOK.

-L

Í-

Do đó: 0, 05.56 +0,15.( R + 44 + 39) = 17,5 → R = 15

TO

ÁN

Vậy axit là: CH 3COOH và este E:

Ỡ N

G

CH 3COOC3 H 5

BỒ

ID Ư

Đến đây, phải đọc lại gt, E được tạo từ ancol + axit nên trong 2 đáp án B và D thì chỉ có D thỏa mãn là ancol. ( vì B là ancol kém bền, sẽ bị hổ biến thành anđehit ngay, do đó B ko thỏa mãn). Theo suy luận trắc nghiệm, loại ngay B đầu tiên, tìm nhanh ra CTPT của este và axit nên ancol phải không no và dĩ nhiên thấy ngay chỉ D thỏa mãn. Câu 50: B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

naxit = nNaOH = 0,15 ⇒ M muoi = 68 ⇒ HCOONa

0,15 92 x ⇒ M ancol = ⇒ x = 3 ⇒ CH 2OH − CHOH − CH 2OH x 3

N

Giả sử ancol x chức: ⇒ nancol =

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

=> Đáp án B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1. Tên gọi của este có mạch cacbon không phân nhánh có công thức phân tử C4H8O2 có thể tham gia phản ứng tráng gương là: A. propyl fomat B. isopropyl fomat C. etyl axetat D. metyl propionat Câu 2. Cho dãy các chất: benzyl axetat, vinyl axetat, metyl fomat, anlyl clorua, phenyl fomat, isopropyl clorua, triolein. Số chất trong dãy khi thủy phân trong dung dịch NaOH (dư), đun nóng sinh ra ancol là A. 4 B. 6 C. 5 D. 3 Câu 3. Có bao nhiêu este mạch hở có công thức phân tử là C5H8O2 mà khi thủy phân trong môi trường kiềm cho 1 muối và một anđehit ? A. 8 B. 7 C. 6 D. 5 Câu 4. Cho axit salixylic (X) (axit o-hiđroxibenzoic) phản ứng với metanol có H2SO4 đặc xúc tác thu được metyl salixylat (Y) dùng làm thuốc giảm đau. Cho Y phản ứng với dung dịch NaOH dư thu được hỗn hợp sản phẩm trong đó có muối Z. Công thức cấu tạo của Z là A. o-NaOC6H4COOCH3. B. o-HOC6H4COONa. C. o-NaOOCC6H4COONa. D. o-NaOC6H4COONa. Câu 5. Một este X (MX < 200). Lấy 1,22 gam X phản ứng vừa đủ với 100ml dung dịch KOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn cô cạn dung dịch sau phản ứng thu được phần hơi (chỉ có nước) và phần rắn là 2,16 gam muối Y. Đốt cháy hoàn toàn lượng Y thu được 2,64 gam CO2, 0,54 gam H2O, a gam K2CO3. Giá trị của a và tên gọi của X là A. 1,38 và phenyl fomat. B. 2,76 và phenyl axetat. C. 2,4 và phenyl fomat. D. 1,38 và phenyl axetat. Câu 6. Hỗn hợp X gồm hai este đơn chức. Xà phòng hoá hoàn toàn 0,3 mol X cần dùng vừa hết 200ml dung dịch NaOH 2M, thu được anđehit Y và dung dịch Z. Cô cạn dung dịch Z thu được 32 gam hai chất rắn. Biết % khối lượng oxi trong anđehit Y là 27,59%. Công thức của hai este là A. HCOOC6H4CH3 và HCOOCH=CH-CH3. B. HCOOC6H4CH3 và CH3COOCH=CH-CH3. C. C3H5COOCH=CHCH3 và C4H7COOCH=CH-CH3. D. HCOOC6H5 và HCOOCH=CH-CH3. Câu 7. Thủy phân este X mạch hở có công thức phân tử C4H6O2, sản phẩm thu được có khả năng tráng bạc. Số este X thỏa mãn tính chất trên là A. 6 B. 4 C. 5 D. 3

N

Cơ Bản - Bài toán thủy phân este đặc biệt (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 8. X là este có công thức phân tử là C9H10O2, a mol X tác dụng với dung dịch NaOH thì có 2a mol NaOH phản ứng và sản phẩm không tham gia phản ứng tráng gương. Số đồng phân cấu tạo của X thỏa mãn các tính chất trên là A. 4 B. 6 C. 5 D. 9 Câu 9. Một este đơn chức có %O = 37,21%. Số đồng phân của este mà sau khi thủy phân chỉ cho một sản phẩm tham gia phản ứng tráng gương là A. 1 B. 2 C. 3 D. 4 Câu 10. Một este đơn chức, mạch hở có tỉ khối so với H2 bằng 50. Khi thủy phân trong môi trường kiềm không tạo ra sản phẩm có khả năng tham gia phản ứng tráng gương. Số đồng phân este thõa mãn là A. 4 B. 5 C. 6 D. 7 Câu 11. Một hỗn hợp X gồm 2 este X, Y có cùng công thức phân tử C8H8O2 và đều chứa vòng benzen. Xà phòng hóa hết 0,2 mol X, ta cần 0,3 lít dung dịch NaOH 1M thu được 3 muối. Khối lượng mỗi muối là A. 8,2 gam CH3COONa; 14,4 gam C6H5COONa; 11,6 gam C6H5ONa B. 4,1 gam CH3COONa; 14,4 gam C6H5COONa; 11,6 gam C6H5ONa C. 8,2 gam CH3COONa; 7,2 gam C6H5COONa; 17,4 gam C6H5ONa D. 4,1 gam CH3COONa; 7,2 gam C6H5COONa; 17,4 gam C6H5ONa Câu 12. Este nào sau đây khi tác dụng với dung dịch NaOH tạo muối và anđehit ? A. CH3–COO–CH2–CH=CH2. B. CH3–COO–C(CH3)=CH2. C. CH2=CH–COO–CH2–CH3. D. HCOO–CH=CH–CH3. Câu 13. Thủy phân phenyl axetat trong dung dịch NaOH dư thu được sản phẩn hữu cơ là A. natri axetat và natri phenolat. B. axit axetic và natri axetat. C. natri axetat và phenol. D. axit axetic và phenol. Câu 14. Một este có công thức phân tử là C4H6O2 khi thủy phân trong môi trường axit thu được đimetyl xeton. Công thức cấu tạo thu gọn của C4H6O2 là A. HCOO-C(CH3)=CH2. B. CH3COO-CH=CH2. C. HCOO-CH=CH-CH3. D. CH2=CH-COOCH3. Câu 15. Khi thủy phân vinyl axetat trong môi trường axit thu được sản phẩm là A. Axit axetic và ancol etylic. B. Axit axetic và anđehit axetic. C. Axit axetic và ancol vinylic. D. Anđehit axetic và ancol vinylic. Câu 16. Thủy phân este (E) C4H6O2 trong môi trường kiềm: (E) + NaOH → muối (M) + chất (X) Cho biết cả M và X đều tham gia phản ứng tráng gương. Công thức đúng của E là:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. HCOOCH=CH-CH3. B. HCOOCH2-CH=CH2. C. CH2=CH-COOCH3. D. CH3COOCH=CH2. Câu 17. Một este có công thức phân tử C4H6O2. Thuỷ phân hết X thành hỗn hợp Y. X có công thức cấu tạo nào để Y cho phản ứng tráng gương tạo ra lượng Ag lớn nhất ? A. CH3COOCH = CH2. B. HCOOCH2CH = CH2. C. HCOOCH = CHCH3. D. CH2 = CHCOOCH3. Câu 18. Cho phản ứng: C4H7O2Cl (X) + 2NaOH → CH3COONa + CH3CH=O + NaCl + H2O. Công thức cấu tạo của X là A. Cl-CH2-COOCH2-CH3. B. CH3-COO-CH(Cl)-CH3. C. CH3-COOCH2-CH2Cl. D. CH3-CHCl-COOCH3. Câu 19. Este X (C8H8O2) tác dụng với lượng dư dung dịch KOH thu được 2 muối hữu cơ và H2O. X có tên gọi là A. metyl benzoat. B. benzyl fomat. C. phenyl fomat. D. phenyl axetat. Câu 20. Khi thủy phân (trong môi trường axit) một este có công thức phân tử C7H6O2 sinh ra hai sản phẩm X và Y. X khử được AgNO3 trong amoniac, còn Y tác dụng với nước brom sinh ra kết tủa trắng. Tên gọi của este đó là A. phenyl fomat. B. benzyl fomat. C. vinyl pentanoat. D. anlyl butyrat. Câu 21. Cho sơ đồ chuyển hóa sau: C3H4O2 + NaOH → X + Y ; X + H2SO4 loãng → Z + T. Biết Y và Z đều có phản ứng tráng gương. Hai chất Y, Z tương ứng là A. HCHO, CH3CHO. B. HCHO, HCOOH. C. CH3CHO, HCOOH. D. HCOONa, CH3CHO. Câu 22. Hai este X, Y là dẫn xuất của benzen có công thức phân tử là C9H8O2. X và Y đều cộng hợp với Br2 theo tỉ lệ mol là 1:1. X tác dụng với NaOH cho một muối và một anđehit. Y tác dụng với dung dịch NaOH dư cho hai muối và nước, các muối đều có phân tử khối lớn hơn phân tử khối của CH3COONa. Công thức thu gọn của X, Y lần lượt là. A. HOOCC6H4CH=CH2 và CH2=CHCOO-C6H5. B. C6H5COOCH=CH2 và C6H5CH=CHCOOH. C. HCOOC6H4CH=CH2 và HCOOCH=CH-C6H5. D. C6H5COOCH=CH2 và CH2=CHCOO-C6H5. Câu 23. Hợp chất hữu cơ C4H7O2Cl khi thuỷ phân trong môi trường kiềm được các sản phẩm trong đó có hai chất có khả năng tham gia phản ứng tráng gương. Công thức cấu tạo của chất hữu cơ là: A. HCOOCHCl-CH2-CH3.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


TP .Q

U

Y

N

B. CH3-COO-CH2-CH2Cl. C. HCOO-CH2-CHCl-CH3. D. HCOOC(CH3)Cl-CH3. Câu 24. Bốn este có công thức phân tử: C3H4O2, C3H6O2, C4H6O2, C4H8O2. Công thức phân tử ứng với 2 este khi bị thuỷ phân cho ra hai chất hữu cơ đều có khả năng tham gia phản ứng tráng gương là A. C3H4O2 và C4H8O2. B. C3H4O2 và C4H6O2. C. C3H4O2 và C3H6O2. D. C4H6O2 và C4H8O2. Câu 25. Phản ứng giữa hai chất tạo sản phẩm là muối và ancol là:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

o

360 c ,315 atm A. C6H5Cl (phenyl clorua) + NaOH  → o

t B. CH3COOCH=CH2 (vinyl axetat) + dung dịch NaOH  →

ẠO

o

t C. C6H5COOCH3 (metyl benzoat) + dung dịch NaOH  → o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

t D. CH3COOC6H5 (phenyl axetat) + dung dịch NaOH  → Câu 26. Cho este X (C4H6O2) phản ứng với dung dịch NaOH theo sơ đồ sau : X + NaOH → muối Y + anđehit Z Cho biết khối lượng phân tử của Y nhỏ hơn 70. Công thức cấu tạo đúng của X là: A. CH3-COOCH=CH2. B. HCOO-CH=CH-CH3. C. HCOOCH2-CH=CH2. D. CH2=CH-COOCH3. Câu 27. Khi thủy phân este C7H6O2 trong môi trường axit thu được 2 sản phẩm hữu cơ X và Y, trong đó X cho phản ứng tráng gương, còn Y không có phản ứng tráng gương nhưng tác dụng với dung dịch Br2 cho kết tủa trắng. CTCT của este là: A. CH≡C-COOC≡C-C2H5. B. CH3COOCH=CH-C≡CH. C. HCOOC6H5. D. HCOOCH=CH-C≡C-CH-CH2. Câu 28. Hai chất X và Y cùng có CTPT C9H8O2, cùng là dẫn xuất của benzen, đều làm mất màu nước Br2. X tác dụng với dung dịch NaOH cho 1 muối và 1 anđehit ; Y tác dụng với dung dịch NaOH cho 2 muối và nước. Các muối sinh ra đều có phân tử khối lớn hơn phân tử khối của CH3COONa. X và Y tương ứng là: A. C2H3COOC6H5 và HCOO-C6H4-C2H3. B. C6H5COOC2H3 và C2H3COOC6H5. C. HCOO-C2H2-C6H5 và HCOO-C6H4-C2H3. D. C6H5COOC2H3 và HCOO-C6H4-C2H3. Câu 29. Đun 0,1 mol este X đơn chức với NaOH dư sau đó cho tác dụng với Cu(OH)2, to thu được 0,2 mol Cu2O. Công thức của X là: A. R’-COO-CH=CR2. B. HCOO-CH=CR2. C. HCOOR. D. H-COO-CR=CH2. Câu 30. Hợp chất X (chứa C, H, O) trong phân tử chỉ chứa 1 nhóm chức, X không tác dụng với Na, X phản ứng với NaOH theo tỉ lệ 1:2. Đốt cháy 1 lít X thu được 7 lít CO2 ở cùng điều kiện. Cấu tạo nào sau đây là phù hợp với X ? A. (CH3COO)2C3H6. B. HCOOC6H5. C. CH2(COOC2H5)2.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. C6H5COOH. Câu 31. Thuỷ phân 11,18 gam este X đơn chức, mạch hở (có xúc tác axit) đến khi phản ứng hoàn toàn thu được hỗn hợp hai chất hữu cơ Y và Z. Cho Y, Z phản ứng với dung dịch AgNO3/NH3 dư thu được 56,16 gam Ag. Công thức cấu tạo của X là: A. HCOOC(CH3)=CH2. B. CH3COOCH=CH2. C. HCOOCH=CHCH3. D. HCOOCH2CH=CH2. Câu 32. Thủy phân 4,3 gam este X đơn chức, mạch hở có xúc tác axit đến khi phản ứng hoàn toàn thu được hỗn hợp 2 chất hữu cơ Y và Z. Cho Y và Z phản ứng với dung dịch AgNO3/NH3 thu được 21,6 gam Ag. CTCT của X là A. CH3COO-CH=CH2. B. HCOO-CH=CH-CH3. C. HCOO-CH2-CH=CH2. D. HCOOC(CH3)=CH2. Câu 33. Một este đơn chức, mạch hở có khối lượng là 12,9 gam tác dụng đủ với 150 ml dung dịch KOH 1M. Sau phản ứng thu một muối và anđehit. Công thức cấu tạo của este là: A. HCOOCH=CH-CH3. B. CH3COOCH=CH2. C. C2H5COOCH=CH2. D. HCOOCH=CH-CH3 và CH3COOCH=CH2. Câu 34. Cho 12,2 gam X có CTPT là C7H6O2 mạch hở phản ứng với 0,2 mol KOH thấy phản ứng xảy ra vừa đủ. Sản phẩm sẽ có muối A. HCOOK. B. C2H5COOK. C. CH3COOK. D. C7H4O2K2. Câu 35. Cho 10 gam chất X (chỉ chứa nhóm chức este có phân tử khối là 100 đvC) tác dụng với 150 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 11,6 gam chất rắn khan và một chất hữu cơ Y. Công thức của Y là: A. CH3OH. B. C2H5OH. C. CH3CHO. D. CH3COCH3. Câu 36. Hỗn hợp X gồm hai este đơn chức là đồng phân của nhau. Đung nóng m gam X với 300 ml dung dịch NaOH 1M, kết thúc các phản ứng thu được dung dịch Y và (m – 8,4) gam hỗn hợp hơi gồm hai anđehit no, đơn chức, đồng đẳng kế tiếp có tỉ khối hơi so với H2 là 26,2. Cô cạn dung dịch Y thu được (m – 1,1) gam chất rắn. Công thức của hai este là A. CH3COOCH=CH-CH3 và CH3COOC(CH3)=CH2. B. HCOOC(CH3)=CH2 và HCOOCH=CH-CH3. C. C2H5COOCH=CH2 và CH3COOCH=CH-CH3. D. HCOOCH=CH-CH3 và CH3COOCH=CH2. Câu 37. Hỗn hợp gồm phenyl axetat và metyl axetat có khối lượng 7,04 gam thủy phân trong NaOH dư, sau phán ứng thu được 9,22 gam hỗn hợp muối. % theo khối lượng của hai este trong hỗn hợp ban đầu là: A. 64,53% và 35,47%. B. 53,65% và 46,35%. C. 54,44% và 45,56%. D. 57,95% và 42,05%.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 38. Cho este sau đây: C6H5OOC-CH2-COOCH3. Để phản ứng hết với 19,4 gam este này thì một dung dịch chứa ít nhất bao nhiêu gam KOH ? A. 16,8 gam. B. 11,2 gam. C. 12,0 gam. D. 8,0 gam. Câu 39. Hợp chất hữu cơ X có thành phần C, H, O và chỉ chứa 1 nhóm chức trong phân tử. Đun nóng X với NaOH thì được X1 có thành phần C, H, O, Na và X2 có thành phần C, H, O. Biết MX1 = 82%MX; X2 không tác dụng Na, không cho phản ứng tráng gương. Đốt 1 thể tích X2 thu được 3 thể tích CO2 cùng điều kiện. CTCT của X là: A. CH3–COO–CH2–CH=CH2. B. CH3–COO–C(CH3)=CH2. C. H–COO–CH=CH–CH2–CH3. D. CH3–COO–CH=CH–CH3. Câu 40. Đốt cháy 0,8 gam một este X đơn chức được 1,76 gam CO2 và 0,576 gam H2O. Cho 5 gam X tác dụng với lượng NaOH vừa đủ, cô cạn dung dịch sau phản ứng được 7 gam muối khan Y. Cho Y tác dụng với dung dịch axit loãng thu được Z không phân nhánh. Công thức cấu tạo của X là:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

B

A.

10

00

B.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

C. D. CH2=CH-COOC2H5. Câu 41. Cho 10,4 gam hợp chất hữu cơ X (chứa chức este, có công thức phân tử là C4H8O3) tác dụng vừa đủ với dung dịch chứa 0,1 mol NaOH thì thu được 9,8 gam muối. Công thức cấu tạo đúng của X là: A. CH3-COOCH2-CH2-OH. B. H-COO-CH2-CH2 -CHO. C. HO-CH2-COO-C2H5. D. CH3-CH(OH)-COO-CH3. Câu 42. Một este X có công thức là: CxHyCOOC6Hn (dX/O2 < 4,5). Khi xà phòng hóa X bằng dung dịch NaOH dư thu được hai muối có tỉ lệ khối lượng là 1,4146. CTCT của X là A. HCOOC6H5. B. CH3COOC6H5. C. CH3COOC6H13. D. C2H5COOC6H5. Câu 43. Hợp chất hữu cơ X có công thức phân tử C9H10O2. Xà phòng hóa hoàn toàn 0,5 mol X cần vừa đủ là 1 lít NaOH 1M và thu được sản phẩm là hỗn hợp hai muối. Công thức cấu tạo của este là A. CH3–CH2–COOC6H5. B. CH3–COOCH2–C6H5. C. HCOOCH2CH2C6H5. D. HCOOCH2–C6H4–CH3. Câu 44. Để phản ứng hoàn toàn với m gam metyl salixylat cần vừa đủ 1,08 lít dung dịch NaOH 1M. Giá trị của m là A. 97,2.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 82,08. C. 64,8. D. 164,16. Câu 45. Cho axit salixylic (axit o-hiđroxibenzoic) phản ứng với metanol có axit sunfuric xúc tác, thu được metyl salixylat (o-CH3OOC-C6H4-OH) dùng làm thuốc xoa bóp giảm đau. Để phản ứng hoàn toàn với 30,4 gam metyl salixylat cần vừa đủ V lít dung dịch NaOH 0,5M. Giá trị của V là A. 0,1. B. 0,2. C. 0,4. D. 0,8. Câu 46. Xà phòng hóa hoàn toàn 13,6 gam một este X cần vừa đủ 50ml dung dịch NaOH 4M, thu được 19,8 gam 2 muối có số mol bằng nhau (khối lượng mol mỗi muối đều lớn hơn 68). CTCT của X có thể là A. CH3COO-(CH2)3-OOCC2H5. B. HCOOC6H4CH3. C. CH3COOC6H4CH3. D. CH3COOC6H5. Câu 47. Đun nóng 4,08 gam phenyl axetat với 100ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng được m gam chất rắn, biết rằng hiệu suất phản ứng đạt 100%. Giá trị của m là A. 7,54. B. 5,94. C. 6,28. D. 8,08. Câu 48. Cho 4,48 gam hỗn hợp gồm CH3COOC2H5 và CH3COOC6H5 (có tỉ lệ mol 1:1) tác dụng với 800 ml dung dịch NaOH 0,1 M thu được dung dịch X. Cô cạn dung dịch X thì khối lượng chất rắn thu được là A. 6,40 gam. B. 4,88 gam. C. 5,60 gam. D. 3,28 gam. Câu 49. Thuỷ phân hoàn toàn 0,08 mol hỗn hợp hai este đơn chức X, Y (MX < MY) cần dùng hết 110 ml dung dịch NaOH 1M thu được 10,46 gam hỗn hợp hai muối, đồng thời thu được 2,9 gam ancol Z, ancol này không bền chuyển hóa ngay thành anđehit. Công thức cấu tạo của hai este lần lượt là A. CH3–COO–CH=CH–CH3 và CH3–COO–C6H4–CH3. B. CH3–COO–CH2–CH=CH3 và CH3–COO–C6H4–CH3. C. CH3–COO–CH=CH2 và CH3–COO–CH2–C6H5. D. CH3–COO–CH=CH2 và CH3–COO–C6H4–CH3. Câu 50. Cho 10,0 gam este X có công thức phân tử C5H8O2 tác dụng với lượng NaOH vừa đủ, cô cạn dung dịch sau phản ứng thu được 14,0 gam muối khan Y. Cho Y tác dụng vừa đủ với dung dịch axit loãng thu được hợp chất hữu cơ Z không phân nhánh. Công thức phân tử của X là A. CH2=CH-CH2-COOCH3. B. CH2=C(CH3)-COOCH3.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

C.

D.

LỜI GIẢI CHI TIẾT Câu 1: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

N

Vì este có phản ứng tráng gương => loại C,D Mà este có mạch C không phân nhánh => loại B => đáp án A Câu 2: C Các chất khi thủy phân trong dung dịch NaOH dư, đun nóng sinh ra ancol là: benzyl axetat, metyl fomat, anlyl clorua,

U TP .Q ẠO Đ G

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Chọn C Câu 3: C Các este thỏa mãn là: HCOOC = C – C – C (cis- trans) ; HCOOC = C(C) – C CH3COOC = C – C (cis – trans) ; C2H5COOC = C (6) Chọn C Câu 4: D o − OHC6 H 4COOH → o − OHC6 H 4COOCH 3 → o − NaOC6 H 4COONa => Đáp án D Câu 5: A Do phần hơi chỉ có H2O nên este có nhóm axit đính trực tiếp vào vòng benzen.

Y

N

isopropyl clorua, triolein (5)

nKOH = 0, 01 ⇒ M X = 122 → HCOOC6H5 2

3

10

Như vậy, X sẽ phản ứng với KOH tỉ lệ 1 : 2 → n X =

00

B

Từ 4 đáp án => là este của phenol ( gốc phenyl).

ẤP

2+

Bảo toàn nguyên tố cacbon: 7 nX = nCO2 + nK2CO3 = 0, 01 ⇒ a = 0, 01.138 = 1,38

Ó

A

C

→ Đáp án A. Câu 6: D Do este đơn chức, mà n X < nNaOH < 2nX nên 1 trong 2 este có gốc axit đính trực tiếp với vòng benzen →

Í-

H

loại C.

16 = 58(C3 H 6O ) 0, 2759

G

TO

M andehit =

ÁN

-L

Vì este đơn chức nên anđehit tạo thành cũng phải đơn chức (có 1O)

ID Ư

Ỡ N

Thu được 2 chất rắn, mà NaOH vừa đủ, nên 2 chất rắn là 2 muối → 2 este có chung gốc axit → loại B.

BỒ

Giả sử nX1 = x mol; nX2 = y mol

 x + y = 0,3  x = 0,1 ⇔ Ta có hệ:  2 x + y = 0, 4  y = 0, 2

Nếu đáp án A đúng:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn Ta có: 0,1.68 + 0,1.130 + 0, 2.68 = 33, 4 ≠ 32 → Loại A.

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Nếu đáp án D đúng:

N

Ta có: 0,1.68 + 0,1.116 + 0, 2.68 = 32 → Đáp án D đúng.

N

H Ơ

Câu 7: C Các este thỏa mãn HCOOCH 2CH = CH 2

U

Y

HCOOCH = CHCH 3 (cis − trans )

TP .Q

HCOOC (CH 3 ) = CH 2

Đ

Ư N

G

=> Đáp án C Câu 8: A Tác dụng với NaOH tỉ lệ 1:2 mà chỉ có 2O trong phân tử nên X là este của phenol

ẠO

CH 3COOCH = CH 2

H TR ẦN

www.daykemquynhon.ucoz.com

Các đồng phân thỏa mãn o, m, p − CH 3 − C6 H 4 − OOCCH 3

B

C2 H 5COOC6 H 5

10

00

Như vậy, có 4 đồng phân

C

ẤP

2+

3

=> Đáp án A Câu 9: C 32 M este = = 86 ⇒ C4 H 6O2 0, 3721

ÁN

-L

CH 3COOCH = CH 2

Í-

HCOOC (CH 3 ) = CH 2

H

Ó

A

Các đồng phân chỉ cho 1 sản phẩm tráng gương: HCOOCH 2CH = CH 2

Ỡ N

G

TO

=> Đáp án C Câu 10: D M este = 100 ⇒ C5 H 8O2

ID Ư

Các đồng phân este thỏa mãn: CH 3COOC − C = C ; CH 3COOC (C ) = C ;

BỒ

C = C − C − COOCH 3 ; C − C = C − COOCH 3 (c is − trans)

C = C (C ) − COOCH 3 ; C = C − COOC2 H 5 (7)

Chọn D Câu 11: A Y và Z đều là este đơn chức

→ 0,2 mol X cần 0,3 mol NaOH → có 1 chất là este của phenol ; mặt khác sản phẩm không có phản ứng

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

tráng gương → 1 chất là C6H5OOCCH3 0,1 mol

→ chất còn lại là C6H5COOCH3 0,1 mmol

Y

N

H Ơ

N

mCH3COONa = 0,1.82 = 8, 2  Các muối thu được và khối lượng: mC6 H5COONa = 0,1.144 = 14, 4  nC6 H5ONa = 116.0,1 = 11, 6

ẠO

TP .Q

U

=> Đáp án A Câu 12: D HCOO-CH=CH-CH3 + H2O → HCOONa + CH3-CH2-CHO.

H

Ư N

G

Đ

Đáp án D Câu 13: A Thủy phân phenyl axetat sẽ thu được natri axetat và natri phenolat (do phenol sinh ra tiếp tục phản ứng với NaOH)

3

10

00

B

Đáp án A Câu 15: B CH3COOCH=CH2 + H2O → CH3COOH + CH3CHO.

TR ẦN

www.daykemquynhon.ucoz.com

=> Đáp án A Câu 14: A HCOO-C(CH3)=CH2 + H2O → HCOOH + C(CH3)2=O

C

ẤP

2+

Đáp án B. Câu 16: A M và X đều tham gia phản ứng tráng gương nên E là este có dạng HCOOR.

H

Ó

A

→ muối M là muối HCOONa, chất X là andehit.

-L

Í-

HCOOCH=CH-CH3 + NaOH → HCOONa + CH3CH2CHO.

G

TO

ÁN

Đáp án A. Câu 17: C Để Y tham gia tráng gương tạo ra lượng Ag lớn nhất thì Y phải là muối HCOONa và andehit

BỒ

ID Ư

Ỡ N

HCOOCH=CHCH3 + H2 → HCOONa + CH3CH2CHO

Đáp án A Câu 18: B Sản phẩm có CH3COONa nên X là este có : dạng CH3COOR. X no mà sản phẩm có CH3CH=O và NaCl nên đáp án B thỏa mãn

CH3-COOCH(Cl)-CH3 + 2NaOH → CH3-COONa + CH(OH)2-CH3 + 2NaCl + H2O

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CH(OH)2 -CH3 không bền → CH3CH=O + H2O.

N

Câu 19: D Thu được 2 muối hữu cơ nên este được tạo thành từ phenol

Y U

ẠO

Y tác dụng với Br2 sinh kết tủa trắng nên Y là phenol (C6H5OH)

TP .Q

=> Đáp án D Câu 20: A Dễ dàng nhận ra, X khử được AgNO3 (phải có gốc CHO) thì X chắc chắn phải là HCOOH

N

H Ơ

Trong 4 đáp án thì chỉ có D thỏa mãn

G

Đ

Như vậy este là: HCOOC6 H 5

Ư N

=> phenyl fomat

ẤP

2+

3

10

2HCOONa + H2SO4 → 2HCOOH + Na2SO4 Hai chất Y và Z là CH3CHO và HCOOH

TR ẦN

00

HCOOCH=CH2 + NaOH → HCOONa + CH3CHO.

B

www.daykemquynhon.ucoz.com

H

=> Đáp án A Câu 21: C Vì Y và Z đều có phản ứng tráng gương nên C3H4O2 là este của axit fomic : HCOOCH=CH2.

H

Ó

A

C

Đáp án C Câu 22: D X, Y cộng hợp với Br2 theo tỷ lệ 1:1 nên loại A

-L

Í-

Y tác dụng với NaOh dư cho 2 muối và nước nên loại B và C

G

TO

ÁN

Chọn D Câu 23: A Do thu được tới 2 chất có khả năng tráng gương nên thủy phân chất trên chắc chắn thu được andehit và axit tạo este phải là HCOOH

BỒ

ID Ư

Ỡ N

Như vậy, công thức của chất hữu cơ là: HCOOCHCl − C2 H 5

=> Đáp án A Câu 24: B Gọi công thức este R1COOR2

Để thu được 2 sản phẩm cùng có khả năng tráng gương thì axit phải là HCOOH và R2 phải có nối đôi C=C ngay cạnh nhóm COO Các CTCT có thể có của các este trên:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

NaOH C3 H 4O2 : HCOOCH = CH 2  → HCOONa + CH 3CHO

C3 H 6O2 : Do chỉ có 1π nên không thỏa mãn

H Ơ

N

NaOH C4 H 6O2 : HCOOCH = CH − CH 3  → HCOONa + C2 H 5CHO

N

C4 H 6O2 : chỉ có 1π nên không thỏa mãn

TP .Q

U

Y

=> Đáp án B Câu 25: C C6 H 5Cl + 2 NaOH → C6 H 5ONa + NaCl + H 2O

CH 3COOCH = CH 2 + NaOH → CH 3COONa + CH 3CHO + H 2O

ẠO

C6 H 5COOCH 3 + NaOH → C6 H 5COONa + CH 3OH

Ư N H

TR ẦN

www.daykemquynhon.ucoz.com

=> Đáp án C Câu 26: B Muối có khối lượng phân tử nhỏ hơn 70 thì chỉ có thể là HCOONa

G

Đ

CH 3COOC6 H 5 + NaOH → CH 3COONa + C6 H 5ONa + H 2O

Vậy công thức X sẽ là: HCOOCH = CH − CH 3

2+

3

10

00

B

=> Đáp án B Câu 27: C * Đáp án A CH ≡ COOC ≡ C − C2 H 5 → CH ≡ COONa + C2 H 5COONa + H 2O

C

ẤP

Loại do C2H5COONa không tác dụng với Br2 cho kết tủa trắng

H

Ó

A

* Đáp án B CH 3COOCH = CH − C ≡ CH → CH 3COONa + CH ≡ C − CHO

-L

Í-

Loại do CH3COONa không có phản ứng tráng gương

TO

ÁN

* Đáp án C HCOOC6 H 5 → HCOONa + C6 H 5OH

Ỡ N

G

Thỏa mãn đề bài

BỒ

ID Ư

=> Đáp án C Câu 28: B Loại đáp án A do C2H3COOC6H5 tác dụng với NaOH không cho andehit

Loại đáp án C do HCOO-C2H2-C6H5 tác dụng với NaOH cho muối HCOONa có khối lượng bé hơn của CH3COONa Loại đáp án D do HCOO-C6H4-C2H3 tác dụng với NaOH cho muối HCOONa có khối lượng bé hơn của CH3COONa

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Đáp án B đúng Câu 29: B Ta có: R − CHO + 2Cu (OH ) 2 + NaOH → RCOONa + Cu2O + H 2O

H Ơ

N

⇒ n− CHO = 2nCu2O = 0, 2

N

Như vậy, khi thủy phân X thu được 2 chất có nhóm CHO

TP .Q

U

Y

Suy ra, công thức của X phải là HCOOCH=CHR2

G

Đ

ẠO

=> Đáp án B Câu 30: B X sẽ có 7 C trong phân tử X không phản ứng với Na nên sẽ không có nhóm OH hoặc COOH

Ư N

X phản ứng với NaOH tỉ lệ 1:2 (mà chỉ có 1 nhóm chức) nên X là este của phenol

H TR ẦN

www.daykemquynhon.ucoz.com

Vậy, công thức X là HCOOC6H5

ẤP

2+

3

10

Nếu chỉ có 1 chất (Y hoặc Z) tác dụng với AgNO3: nAg ⇒ neste = = 0, 26 ⇒ M este = 43 ⇒ loai 2

00

B

=> Đáp án B Câu 31: C n Ag = 0,52

H

Ó

A

C

Nếu cả Y và Z đều tác dụng nAg ⇒ neste = = 0,13 ⇒ M este = 86 ⇒ C4 H 6O2 4

TO

ÁN

=> Đáp án C Câu 32: B nAg = 0, 2

-L

Í-

Do cả 2 chất đều tác dụng nên CTCT của X là: HCOOCH = CHCH 3

BỒ

ID Ư

Ỡ N

G

Nếu chỉ có 1 chất (Y hoặc Z) tác dụng với AgNO3: nAg ⇒ neste = = 0,1 ⇒ M este = 43 ⇒ loai 2

Nếu cả Y và Z đều tác dụng nAg ⇒ neste = = 0, 05 ⇒ M este = 86 ⇒ C4 H 6O2 4

Do cả 2 chất đều tác dụng nên CTCT của X là:

Tổng hợp bởi GV. Nguyễn Thanh Tú

D escription: C :\U sers\plantronics\D esktop\M oon\H óa\2. este\M oon.v n - Thi O nline!_files\latex(47).php

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

=> Đáp án B Câu 33: D M este = 86 ⇒ C4 H 6O2

Y

N

H Ơ

 HCOOCH = CH − CH 3 Do thu được andehit nên CTCT là:  CH 3COOCH = CH 2

ẠO

TP .Q

U

=> Đáp án D Câu 34: A n n X = 0,1 = NaOH 2

G

Đ

Như vậy, đây là este của phenol

H

Ư N

CÔng thức của X: HCOOC6 H 5

TR ẦN

www.daykemquynhon.ucoz.com

Muối thu được sẽ có HCOONa và C6H5ONa => Đáp án A Câu 35: C

00

B

4, 4 = 44 ⇒ CH 3CHO 10 :100

10

mY = 10 + 0,15.40 − 11, 6 = 4, 4 ⇒ M Y =

ẤP

2+

3

=> Đáp án C Câu 36: D nNaOH = 0,3mol ⇒ mNaOH = 12

H

Í-

Gọi CT andehit CnH2nO

Ó

A

C

Bảo toàn khối lượng: m + 12 = m − 8, 4 + mmuoi ⇒ mmuoi = 20, 4

ÁN

-L

2 andehit có M = 52, 4 ⇒ n = 2, 6 ⇒ C2 , C3

TO

Loại A và B ( do tạo xeton)

Ỡ N

G

Dễ dàng tìm được số mol 2 andehit lần lượt là 0,12 và 0,18 mol

BỒ

ID Ư

Dựa vào khối lượng muối ta dễ dàng suy ra được đáp án D đúng Câu 37: D Đặt số mol phenyl axetat và metyl axetat lần lượt là x và y Khi thủy phân thu được x+y mol CH3COONa và x mol C6H5ONa

136 x + 74 y = 7, 04  x = 0, 03 ⇒ ⇒ 196 x + 82 y = 9, 22  y = 0, 04

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

⇒ mCH3COOC6 H5 = 4, 08 ⇒ %mCH3COOC6 H5 = 57,95%

H Ơ

N

=> Đáp án D Câu 38: A neste = 0,1

N

KOH có thể phản ứng với 2 gốc COO và C6H5OH tạo thành

TP .Q

U

Y

⇒ nKOH = 3neste = 0,3 ⇒ m = 0,3.56 = 16,8

G

Đ

ẠO

=> Đáp án A Câu 39: B Dễ dàng nhận ra X là este. Theo bài ra thấy X2 là xeton và có 3C: CH3-CO-CH3

H

Ư N

⇒ X : RCOO − C (CH 3 ) = CH 2 ; X 1 : RCOONa

TR ẦN

www.daykemquynhon.ucoz.com

⇒ R + 67 = 0,82( R + 85) ⇒ R = 15

B

Vậy X là: CH3-COO-C(CH3)=CH2

10 3

2+

0,8 − 0,04.12 − 0, 032.2 = 0, 008 ⇒ M este = 100 ⇒ C5 H 8O2 32

ẤP

⇒ neste =

00

=> Đáp án B Câu 40: C nCO2 = 0, 04; nH 2O = 0, 032

Ó

A

C

Khi thủy phân

Í-

H

nNaOH = neste = 0, 05

ÁN

-L

Nhận xét: meste + mNaOH = mmuoi

TO

Như vậy, đây là este vòng

Ỡ N

G

Khi tác dụng với axit thu được chất không phân nhánh nên đây là vòng không phân nhánh

BỒ

ID Ư

=> Đáp án C Câu 41: C n X = 0,1 Bảo toàn khối lượng: M ancol =

10, 4 + 40.0, 4 − 9,8 = 46 ⇒ C2 H 5OH 0,1

M muoi = 98 ⇒ CH 2OH − COONa ⇒ CH 2OH − COO − C2 H 5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

=> Đáp án C Câu 42: B Do thu được 2 muối nên đây là este của phenol, như vậy n=5 (gốc C6H5)

H Ơ

N

NaOH C x H y COOC6 H n  → Cx H y COONa + C6 H 5ONa

116 = 82 ⇒ CH 3COONa 1,14146 ⇒ CH 3COOC6 H 5

U

Y

N

⇒M =

ẠO

TP .Q

=> Đáp án B Câu 43: A nNaOH = 2nX ⇒ X là este của phenol, loại B,C và D

G Ư N H

nNaOH = 0,54 ⇒ m = 0,54.152 = 82,08 2

TR ẦN

www.daykemquynhon.ucoz.com

⇒ neste =

Đ

Chọn A Câu 44: B Công thức của mytyl salixulat là o − CH 3OOC − C6 H 4 − OH

=> Đáp án B Câu 45: D

00

B

0, 4 = 0,8 0, 5

10

nNaOH = 2neste = 0, 4 ⇒ V =

A

nNaOH = 0,01 ⇒ M este = 136 ⇒ C8 H 8O2 2

H

Ó

⇒ neste =

C

ẤP

2+

3

=> Đáp án D Câu 46: D Hòa tan este chỉ thu được 2 muối với số mol bằng nhau thì este đó là este của phenol

-L

Í-

Do mỗi muối đều có khối lượng phân tử lớn hơn 68 nên không thể là HCOONa

ÁN

Như vậy, X chỉ có thể là CH3COOC6H5

Ỡ N

G

TO

=> Đáp án D Câu 47: A nH 2O = nCH3COOC6 H5 = 0, 03

ID Ư

Bảo toàn khối lượng: m = mhh + mNaOH − mH 2O

BỒ

⇒ m = 4,08 + 0,1.40 − 0, 03.18 = 7,54( g )

Chọn A Câu 48: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

4, 48 = 0, 02 88 + 136 = 0, 02 + 0, 02.2 = 0, 06 ⇒ nNaOH ( du ) = 0, 08 − 0, 06 = 0, 02

nCH3COOC2 H5 = nCH3COOC6 H5 = nNaOH ( pu )

mr = mCH3COONa + mC6 H 5ONa + mNaOH ( du )

H Ơ

N

= 0, 04.82 + 0, 02.116 + 0, 02.40 = 6, 4( g )

TP .Q

U

Y

N

Chọn A Câu 49: A Từ 4 đáp án, nhận thấy không có este 2 chức

ẠO

Mặt khác neste > nNaOH < 2neste

Đ

Như vậy, có 1 este là este của phenol (sẽ là este Y vì MX <my).

H

Ư N

G

Thủy phân chỉ thu được 2 muối (trong đó có 1 muối của phenol) nên 2 este tạo thành từ 1 gốc axit, trong 4 đáp án thì axit đều là CH3COOH. nY = nNaOH − 0, 08 = 0, 03 ⇒ nX = 0, 05 ⇒ M Z = 58 ⇒ CH 3 − CH = CH − OH

TR ẦN

10, 46 − 0, 08.82 = 130 ⇒ CH 3 − C6 H 4ONa 0, 03

00

⇒M =

B

www.daykemquynhon.ucoz.com

Như vậy, muối thu được sẽ gồm 0,08 mol CH3COONa và 0,03 mol muối của phenol

ẤP

2+

3

10

=> Đáp án A Câu 50: D Do X đơn chức nên X phản ứng với NaOH tỉ lệ 1:1 (không thể là trường hợp este của phenol vì số cacbon là 5) nNaOH = nX = 0,1

A

C

Ta thấy mX + mNaOH = mY

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

=> X là este vòng. Do hợp chất Z không phân nhánh nên vòng X cũng không có nhánh Vậy, đáp án D đúng

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1. Một este vòng X được tạo từ ancol nhị chức và axit hai chức. Lấy 13,0 gam X cho phản ứng với một lượng dung dịch NaOH vừa đủ thu được 14,8 gam muối và 6,20 gam ancol. X có tên gọi là A. etylenglicol oxalat. B. etylenglicol ađipat. C. etylenglicol succinat (axit succinic còn gọi là axit butanđioic). D. etylenglicol malonat (axit malonic còn gọi là axit propanđioic). Câu 2. (NC) Cho 3,92 gam một este đơn chức X tác dụng vừa đủ với 100ml KOH 0,4M thu được 6,16 gam muối Y. Axit hóa Y thu được chất Z. Z có công thức phân tử là A. C5H6O2 B. C5H8O3 C. C6H12O2 D. C6H12O3 Câu 3. Một este E mạch hở có công thức phân tử C5H8O2. Đun nóng E với dung dịch NaOH thu được hai sản phẩm hữu cơ X, Y; trong đó Y làm mất màu dung dịch nước Br2. Có các kết luận sau về X, Y: (1) X là muối, Y là anđehit. (2) X là muối, Y là ancol không no. (3) X là muối, Y là xeton. (4) X là ancol, Y là muối của axit không no. Số kết luận đúng là: A. 1 B. 3 C. 2 D. 4 Câu 4. X và Y là hai hợp chất hữu cơ đồng phân của nhau cùng có công thức phân tử C5H6O4Cl2. Thủy phân hoàn toàn X trong NaOH dư thu được hỗn hợp các sản phẩm trong đó có 3 muối và 1 ancol. Thủy phân hoàn toàn Y trong KOH dư thu được hỗn hợp các sản phẩm trong đó có 2 muối và 1 anđehit. X và Y lần lượt có công thức cấu tạo là A. HCOOCH2COOCH2CHCl2 và CH3COOCH2COOCHCl2 B. CH3COOCCl2COOCH3 và ClCH2COOCH2COOCH2Cl C. HCOOCH2COOCCl2CH3 và CH3COOCH2COOCHCl2 D. CH3COOCH2COOCHCl2 và ClCH2COOCHClCOOCH3 Câu 5. Thuỷ phân este X đơn chức, no chỉ thu được một chất hữu cơ Y chứa Na. Cô cạn dung dịch, sau đó thêm vôi tôi xút vào rồi nung ở điều kiện nhiệt độ cao được một ancol Z và một muối vô cơ T. Đốt cháy hoàn toàn ancol Z được CO2 và hơi nước theo tỉ lệ số mol là 2 : 3. Số công thức cấu tạo thỏa mãn X là A. 1 B. 2 C. 3 D. 4 Câu 6. Hỗn hợp H gồm X, Y (MX < MY) là 2 este đơn chức có chung gốc axit. Đun nóng m gam H với 400 ml dung dịch KOH 1M dư thu được dung dịch D và (m – 12,6) gam hỗn hợp hơi gồm 2 anđehit no, đơn chức đồng đẳng kế tiếp có tỉ khối hơi so với H2 là 26,2. Cô cạn dung dịch D thu được (m + 6,68) gam chất rắn khan. % khối lượng của X trong H là A. 54,66%. B. 45,55%. C. 36,44%. D. 30,37%.

N

Nâng Cao - Bài toán thủy phân este đặc biệt (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 7. Hợp chất hữu cơ X đơn chức chứa các nguyên tố (C, H, O) và không có khả năng tráng bạc. X tác dụng vừa đủ với 96 gam dung dịch KOH 11,66%. Sau phản ứng cô cạn dung dịch thu được 23 gam chất rắn Y và 86,6 gam nước. Đốt cháy hoàn toàn Y thu được sản phẩm gồm 15,68 lít CO2 (đktc); 7,2 gam nước và một lượng K2CO3. CTCT của X là A. CH3-COO-C6H5. B. HCOO-C6H4-CH3. C. CH3-C6H4-COOH. D. HCOO-C6H5. Câu 8. Cho 3,44 gam este đơn chức X tác dụng vừa đủ với 40 ml dung dịch NaOH 1M thu được 5,04 gam muối Y. Cho Y tác dụng với axit HCl thu được chất hữu cơ Z. Công thức phân tử của Z là A. C4H6O2 B. C5H8O2 C. C4H8O3 D. C5H10O3 Câu 9. Cho 34 gam hỗn hợp X gồm 2 este đơn chức và đều thuộc loại hợp chất thơm (tỉ khối hơi của X đối với O2 luôn bằng 4,25 với mọi tỉ lệ số mol giữa 2 este) tác dụng vừa đủ với 175 ml dung dịch NaOH 2M. Cô cạn dung dịch sau phản ứng thu được hỗn hợp Y gồm 2 muối khan. Thành phần phần trăm về khối lượng của 2 muối trong Y là A. 55,43% và 44,57%. B. 56,67% và 43,33%. C. 46,58% và 53,42%. D. 35,6% và 64,4%. Câu 10. Tỉ khối hơi của este X, mạch hở (chứa C, H, O) đối với hỗn hợp khí (CO, C2H4) có giá trị trong khoảng (2,5 ; 2,6). Cho 10,8 gam este X tác dụng với dung dịch NaOH dư (hiệu suất bằng 80%) thu được hỗn hợp Y. Cho Y tác dụng hoàn toàn với lượng dư dung dịch AgNO3/NH3 thu được khối lượng bạc là A. 51,84 gam. B. 32,4 gam. C. 58,32 gam. D. 25,92 gam. Câu 11. Một hỗn hợp X gồm 2 este Y và Z có cùng công thức phân tử C8H8O2 và đều chứa vòng benzen. Xà phòng hoá hết 0,2 mol X cần 0,3 mol NaOH thu được dung dịch T. Biết rằng trong T chứa 3 muối và T không có khả năng tham gia phản ứng tráng gương. Cô cạn T thu được m gam muối khan. Giá trị của m là A. 39,2 gam. B. 35,6 gam. C. 21,1 gam. D. 34,2 gam. Câu 12. Xà phòng hóa 1 este X đơn chức, no mạch cacbon không phân nhánh bằng một lượng vừa đủ dung dịch NaOH thu được dung dịch Y chỉ chứa một sản phẩm duy nhất. Cô cạn dung dịch Y thu được chất rắn Z. Nung Z với vôi tôi xút được ancol T. Đốt cháy T được VCO2 : VH2O = 3 : 4. Biết Z tác dụng CuO, to thu được sản phẩm tham gia phản tráng gương. CTCT của X là

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

A. B. HCOOCH2CH3

C.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. Câu 13. Một este X (MX < 200). Lấy 1,22 gam X phản ứng vừa đủ với 100ml dung dịch KOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn cô cạn dung dịch sau phản ứng thu được phần hơi (chỉ có nước) và phần rắn là 2,16 gam muối Y. Đốt cháy hoàn toàn lượng Y thu được 2,64 gam CO2, 0,54 gam H2O, a gam K2CO3. Giá trị của a và tên gọi của X là A. 1,38 và phenyl fomat. B. 2,76 và phenyl axetat. C. 2,4 và phenyl fomat. D. 1,38 và phenyl axetat. Câu 14. Xà phòng hóa hoàn toàn 0,15 mol este đơn chức E cần vừa đủ 150 ml dung dịch NaOH 2M. Cô cạn dung dịch sau phản ứng được 31,8 gam rắn khan. E có công thức phân tử là A. C7H6O2 B. C8H8O2 C. C9H10O2 D. C10H10O2 Câu 15. Đốt cháy hoàn toàn 18 gam một este X đơn chức thu được 20,16 lít CO2 (đktc) và 12,96 gam nước. Mặt khác nếu cho 21 gam X tác dụng với 200ml dung dịch KOH 1,2M sau đó cô cạn dung dịch thu được 34,44 gam chất rắn khan. Công thức phân của axit tạo ra X là A. C5H6O3. B. C5H8O3. C. C5H10O3. D. C5H10O2. Câu 16. X là một este đơn chức. Thủy phân 0,01 mol X với 300ml NaOH 0,1M đến khi phản ứng xảy ra hoàn toàn thu được dung dịch Y. Cô cạn Y thu được phần hơi (chỉ có nước) và 2,38 gam chất rắn khan. Số CTCT có thể có của X là A. 1 B. 2 C. 3 D. 4 Câu 17. Số đồng phân ứng với công thức phân tử C9H8O2 (đều là dẫn xuất của benzen) tác dụng với NaOH dư cho 2 muối và tác dụng với nước Br2 theo tỉ lệ 1 : 1 là A. 1 B. 2 C. 3 D. 4 Câu 18. Hợp chất este X (không chứa nhóm chức khác) có công thức phân tử C5H8Ox, cho 0,1 mol X tác dụng với dung dịch NaOH vừa đủ thu được dung dịch Y, cho dung dịch Y tác dụng với dung dịch AgNO3 dư trong NH3 đun nóng thu được 43,2 gam Ag. Số đồng phân cấu tạo của X là A. 7 B. 9 C. 6 D. 8 Câu 19. Este X không no, mạch hở, có tỉ khối hơi so với oxi bằng 3,125 và khi tham gia phản ứng xà phòng hoá tạo ra một chất hữu cơ Y và một muối của axit hữu cơ. Chất Y không tác dụng với Na và không có khả năng làm mất màu dung dịch brom. Có bao nhiêu đồng phân cấu tạo phù hợp với X ? A. 4

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 2 C. 5 D. 3 Câu 20. Khi cho 0,15 mol este đơn chức X tác dụng với dung dịch NaOH dư, sau khi phản ứng kết thúc thì lượng NaOH phản ứng là 12 gam và tổng khối lượng sản phẩm hữu cơ thu được là 29,7 gam. Số đồng phân cấu tạo của X thỏa mãn các tính chất trên là A. 1 B. 2 C. 3 D. 4 Câu 21. Xà phòng hoá este X đơn chức, no chỉ thu được một chất hữu cơ Y chứa Na. Cô cạn, sau đó thêm NaOH/CaO rồi nung nóng thu được một ancol Z và một muối vô cơ. Đốt cháy hoàn toàn ancol này thu được CO2 và hơi nước theo tỉ lệ về thể tích là 2 : 3. Công thức phân tử của este X là A. C4H6O2 B. C3H6O2 C. C2H4O2 D. C3H4O2 Câu 22. Đốt cháy 1,7 gam este X cần 2,52 lít oxi (đktc), chỉ sinh ra CO2 và H2O với tỉ lệ số mol nCO2 : nH2O = 2 : 1. Đun nóng 0,01 mol X với dung dịch NaOH thấy 0,02 mol NaOH tham gia phản ứng. X không có chức ete, không phản ứng với Na trong điều kiện bình thường và không khử được AgNO3 trong amoniac ngay cả khi đun nóng. Biết MX < 140 đvC. Công thức cấu tạo của X là A. HCOOC6H5 B. CH3COOC6H5 C. C2H5COOC6H5 D. C2H3COOC6H5 Câu 23. Cho 27,6 gam hợp chất thơm X có CT C7H6O3 tác dụng với 800 ml dung dịch NaOH 1M được dung dịch Y. Trung hòa Y cần 100 ml dung dịch H2SO4 1M được dung dịch Z. Khối lượng chất rắn thu được khi cô cạn dung dịch Z là A. 31,1 gam B. 56,9 gam C. 58,6 gam D. 62,2 gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

Câu 24. Một mol chất phản ứng được với dung dịch chứa tối đa bao nhiêu mol NaOH? A. 3 B. 4 C. 2 D. 1 Câu 25. Cho 4,48 gam hỗn hợp gồm CH3COOC2H5 và CH3COOC6H5 (có tỷ lệ mol là 1:1) tác dụng với 800 ml dung dịch NaOH 0,1 M thu được dung dịch X. Cô cạn dung dịch X thì khối lượng chất rắn thu được là A. 5,6 gam. B. 3,28 gam. C. 6,4 gam. D. 4,88 gam.

LỜI GIẢI CHI TIẾT Câu 1: D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Bảo toàn khối lượng: mNaOH = 14,8 + 6, 2 − 13 = 8 ⇒ nNaOH = 0, 2

⇒ nancol = 0,1 ⇒ M ancol = 62 ⇒ C2 H 4 (OH ) 2 nmuoi = 0,1 ⇒ M muoi = 148 ⇒ CH 2 (COONa) 2 ⇒ axit : CH 2 (COOH ) 2 (malonic)

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Cách giải khác : áp dụng bảo toàn khối lượng ta có m NaOH = 8g  n NaOH = 0.2 mol Este 2 chức nên tỉ lệ NaOH : n Este = 2 đẳh công thức R(COO)2R' + 2 NaOH = R(COONa)2 + R'(OH)2 ta có M muối = 14.8:0.1= 148 => R = 148-67x2=14 (CH2) => Axit malonat Lưu ý: một số axit thường dùng (CH2)n(COOH)2(mạck thẳng) n=0: axit oxalic n=1: axit malonic n=2 axit succinic n=3 axit glutaric n=4 axit adipic tương tự tìm được M AnCol= 62--> etilen glicol vậy tên este là etilenglicol malonat Cách giải khác : cách làm là ta gọi este có công thức là R24M2 +4NaOH >>> 2R2 +2M2 ta co khối lượng NaOH= khối lượng muối+ khối lượng ancol - khối lượng este >> số mol NaoH=0.2mol >> số mol este >> khối lượng mol este >> R+M=42 sau đó lập bảng ta tìm đc R a` M. chọn D Câu 2: B Nhận thấy: meste + mKOH = mmuoi

N

=> X: etylenglicol malonat

Ó

A

C

Như vậy, X là este vòng 3, 92 = 98 ⇒ C5 H 6O2 0, 04 ⇒ C5 H 6O2 + H 2O → C5 H 8O3

-L

Í-

H

⇒ MX =

TO

ÁN

=> Đáp án B Câu 3: B (1) đúng: CH 3COOCH = CH − CH 3

G

(2) đúng: CH 3COOCH 2 − CH = CH 2

Ỡ N

(3) sai: CH 3COOC (CH 3 ) = CH 2 (Y không làm mất màu Br2 (xeton chỉ làm mất màu Brom khan trong

BỒ

ID Ư

CH3COOH)) (4) đúng: CH 2 = CHCOOC2 H 5 => Đáp án B Câu 4: B Nhìn đáp án thử với phản ứng thủy phân X, đáp án A, C, D đều không thu được ancol

HCOOCH2COOCH2CHCl2 + 4NaOH → HCOONa + HOCH2COONa + HO-CH2CHO + 2NaCl + H2O → không thu được ancol → loại A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

HCOOCH2COOCCl2CH3 + 5NaOH → HCOONa + HO-CH2COONa + CH3COONa + 2NaCl + 2H2O → không thu được ancol → loại C

H Ơ

N

CH3COOCH2COOCHCl2 + 5NaOH → CH3COONa + HO-CH2COONa + HCOONa + 2NaCl + 2H2O → không thu được ancol → Loại D

N

Đáp án B

TP .Q

U

Y

CH3COOCCl2COOCH3 + 5NaOH → CH3COONa ( muối) + NaOOC-COONa ( muối) + CH3OH + 2NaCl ( muối) + 2H2O

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

ClCH2COOCH2COOCH2Cl + 4KOH → HO-CH2COOK + HO-CH2COOK + HCHO + 2KCl + H2O. Câu 5: B Thủy phân X chỉ cho 1 chất hữu cơ nên X là este vòng. Ancol Z: nCO2 : nH 2O = 2 : 3 ⇒ nC : nH = 2 : 6 X đơn chức nên ancol cũng đơn chức => C2H5OH => Muối là OH − CH 2 − CH 2COONa hoặc CH 3 − CHOH − COONa Như vậy, X có 2 công thức Câu 6: C Có Mtb = 52,4 mà 2 andehit là đồng đẳng kế tiếp → CH3CHO và C2H5CHO

3

→ nH = nmuối = nandehit = 28,32 : 52,4 = 0,3 mol

10

00

→ m + 0,4. 56 = m + 6,68 + m - 12,6 → m= 28,32 gam

B

Bảo toàn khối lượng → mH + mKOH = mchất rắn + mandehit

ẤP

2+

Vì nKOH = 0,4 mol > nH = 0,3 mol → KOH dư : 0,1 mol 28,32 + 6, 68 − 0,1.56 = 98 (CH3COOK) 0, 3

Ó

A

C

→ Mmuối=

H

Vậy X là CH3COOCH=CH2 : x mol và Y là CH3COOCH=CH-CH3 : y mol

0,12.86 × 100% = 36,44%. 28,32

TO

→ % X=

ÁN

-L

Í-

 x + y = 0,3  x = 0,12 Ta có hệ  → 86 x + 100 y = 28,32  y = 0,18

Ỡ N

G

Câu 7: A Khối lượng nước trong ddKOH: mH 2O = 96.(1 − 0,1166) = 84,8

BỒ

ID Ư

Sô mol H2O tạo thành trong phản ứng của X với KOH nH 2O =

86,6 − 84,8 = 0,1 18

nKOH = 0, 2

Sản phẩm thủy phân chỉ có chất rắn (muối) và H2O nên X có thể là axit hoặc este có gốc axit đính trực tiếp vào vòng benzen. Nếu X là axit(đơn chức) thì số mol H2O phải bằng số mol KOH ( loại) Vậy, X là este.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

Từ 4 đáp án: do X không tráng bạc nên loại đáp án B và D Suy ra đáp án A Câu 8: C mX + mNaOH = mY

Y

N

3, 44 = 86 ⇒ C4 H 6O2 0, 04

Ta có: +

ẠO

NaOH H C4 H 6O2  CH 2OHCH 2CH 2COOH ⇒ C4 H 8O3 → CH 2OHCH 2CH 2COONa →

TP .Q

U

MX =

H Ơ

Như vậy, đây là este vòng

Ư N

G

Đ

=> Đáp án C Câu 9: B mX + mNaOH = mY

TR ẦN

MX =

3, 44 = 86 ⇒ C4 H 6O2 0, 04

B

www.daykemquynhon.ucoz.com

H

Như vậy, đây là este vòng

00

Ta có: +

ẤP

2+

3

=> Đáp án C Câu 10: C 2,5 < d ( X / CO, C2 H 4 ) < 2,6 ⇔ 70 < M X < 72,8

10

NaOH H C4 H 6O2  CH 2OHCH 2CH 2COOH ⇒ C4 H 8O3 → CH 2OHCH 2CH 2COONa →

C

M X = 72(C3 H 4O2 )

A

Công thức cấu tạo của X: HCOOCH = CH 2

Ó

AgNO3 / NH 3  HCOONa → 2 Ag HCOOCH = CH 2 →  AgNO3 / NH 3 CH 3CHO → 2 Ag

Í-

H

NaOH , H =80%

-L

AgNO3 / NH 3 HCOOCH = CH 2 ( du ) → 2 Ag

ÁN

mAg = 108(0,15.0,8.2.2 + 0,15.0, 2.2) = 58,32

Ỡ N

G

TO

=> Đáp án C Câu 11: D T chứa 3 muối và không có phản ứng tráng gương nên Y : CH 3COOC6 H 5

ID Ư

Z : C6 H 5COOCH 3

BỒ

Giải hệ ta được: nY = nZ = 0,1 mT = mCH 3COONa + mC6 H 5ONa + mC6 H 5COONa = 0,1.82 + 0,1.116 + 0,1.144 = 34, 2( g )

Chọn D Câu 12: C Nung Z với vôi tôi xút thu được ancol nên Z sẽ có nhóm COONa

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Z tác dụng với CuO cho andehit nên Z có nhóm OH Mặt khác, X tác dụng với NaOH thu được chất Z duy nhất.

N

3 =3 4−3

Y

Số C trong ancol:

H Ơ

N

Vì vậy, X sẽ là este vòng, không nhánh

TP .Q

U

Như vậy, ancol sẽ có dạng CH 2OH − CH 2 − CH 2OH ứng với công thức Z là: CH 2OH − CH 2 − CH 2COONa

Đ G

Ư N

=> Đáp án C Câu 13: A Do phần hơi chỉ có H2O nên este có nhóm axit đính trực tiếp vào vòng benzen.

ẠO

Như vậy, công thức của Z là công thức của đáp án C

Như vậy, X sẽ phản ứng với KOH tỉ lệ 1 : 2 → n X =

TR ẦN

www.daykemquynhon.ucoz.com

H

Từ 4 đáp án => là este của phenol ( gốc phenyl).

nKOH = 0, 01 ⇒ M X = 122 → HCOOC6H5 2

10

00

B

Bảo toàn nguyên tố cacbon: 7 nX = nCO2 + nK 2CO3 ⇔ nK 2CO3 = 0, 01 ⇒ a = 0, 01.138 = 1,38

2+

3

Câu 14: C Số mol NaOH phản ứng lớn gấp 2 lần số mol este nên este là este của phenol

A

C

ẤP

Bảo toàn khối lượng: meste = 31,8 + 0,15.18 − 0,3.40 = 22,5 ⇒ M = 150 ⇒ C9 H10O2

H

Ó

Câu 15: C nCO2 = 0, 09

-L

Í-

mH 2O = 0, 72

⇒ mO ( X ) = 18 − 0,9.12 − 0, 72.2 = 5, 76( g ) ⇒ nO = 0,36

ÁN

nC : nH : nO = 0,9 :1, 44 : 0,36 = 5 : 8 : 2 ⇒ X : C5 H 8O2

TO

18 gX : nX = 0,18 ⇒ 21gX : n X = 0, 21 ⇒ nKOH ( du ) = 0, 03

Ỡ N

G

mmuoi = 34, 44 − mKOH ( du ) = 34, 44 − 0, 03.56 = 32, 76 = mX + mKOH ( pu )

BỒ

ID Ư

=> X là este mạch vòng nên CTPT của axit tạo ra X là: C5 H10O3 (OH − (CH 2 ) 4 − COOH ) Câu 16: D Cô cạn Y thu được phân hơi chỉ có nước nên X là este của phenol nX = nH 2O = 0,1 Bảo toàn khối lượng: mX = mr + mH 2O − mNaOH = 2, 38 + 0, 01.18 − 0, 03.40 = 1, 36( g ) ⇒ M X = 136 ⇒ C8 H 8O2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Các CTCT phù hợp: (o, m, p ) − CH 3C6 H 4OOCH ; CH 3COOC6 H 5 (4)

H Ơ

N

Câu 17: A Chỉ có 1 đồng phân thỏa mãn là: C2 H 3COOC6 H 5

N

Loại HCOOC6 H 4C2 H 3 vì có nhóm HCOO- có thể tác dụng với brom nên tỷ lệ phải là 2:1

TP .Q

U

Y

Chọn A Câu 18: C Nhận thấy nAg = 0,4 mol = 4nX → trong Y có các TH sau

ẠO

TH1: Y chứa 0,1 mol HCOONa và 0,1 mol andehit đơn chức

G

Đ

x= 2 có HCOOC=CH-CH2-CH3, HCOOC=C(CH3)2

H

TR ẦN

www.daykemquynhon.ucoz.com

TH2: Y chứa 2 mol HCOONa và không chứa andehit nào khác

Ư N

x= 4 có HCOO-CH(CH3) -OOCCH3

x = 4 có HCOOCH2-CH2-CH2 -OOCH, HCOO-CH2-CH(CH3)-OOCH.

B

TH3: Y chứa 1 mol HCHO

10

00

x= 4 có CH3COO-CH2-OOCCH3

ẤP

2+

3

Câu 19: D M X = 3,125.32 = 100 ⇒ C5 H 8O2

C

Y không tác dụng với Na và không có khả năng làm mất màu brom nên Y là xeton

Í-

HCOOC(=C)-C-C (3)

H

Ó

A

đồng phân cấu tạo của X phù hợp là: HCOOC(C)=C-C; CH3COOC(C)=C

TO

ÁN

-L

Không tính đồng phân hình học Câu 20: D nNaOH = 0,3 = 2nX

Ỡ N

G

Mà X đơn chức, nên X là este của phenol

ID Ư

Ta có: X + NaOH → R1COONa + R2C6 H 5ONa + H 2O

BỒ

Bảo toàn khối lượng: mX = 29, 7 + 0,15.18 − 12 = 20, 4 ⇒ M X = 136 ⇒ C8 H 8O2 Các CTCT có thể có:

o, m, p − CH 3 − C6 H 4 − OOCH CH 3COOC6 H 5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

=> Đáp án D Câu 21: D Xà phòng hóa este X đơn chức, no chỉ thu được một chất hữu cơ Y chứa Na nên X là este vòng nCO2 : nH 2O = 2 : 3 ⇒ Z : C2 H 6Ox

H Ơ

N

⇒ OH − CH 2 − CH 2 − COONa + NaOH / CaO ⇒ OH − CH 2 − CH 2 − OH

N

⇒ X : *O − CH 2 − CH 2 − C * O

U

Y

(* biểu thị liên kết vòng, O nối với C) ⇒ X : C3 H 4O2

ẠO

TP .Q

Chọn D Câu 22: B Phản ứng với NaOH tỉ lệ 1:2 nên X có thể là este của phenol hoặc este 2 chức.

Đ

Ở đây, từ 4 đáp án ta kết luận X là este của phenol.

1, 7 = 136 ⇒ C8 H 8O2 1, 7 − 0,1.12 − 0,05.2 32

B

⇒ MX =

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

44nCO2 + 18nH 2O = 1, 7 + 3, 6 nCO2 = 0,1 ⇒ ⇒ nCO2 = 2nH 2O nH 2O = 0, 05

2+

3

10

00

X không có phản ứng tráng gương nên CTCT là CH 3COOC6 H 5 => Đáp án B Câu 23: C HO − C6 H 4 − COOH (0, 2); H 2 SO4 (0,1) + NaOH (0,8) → NaO − C6 H 4 − COONa (0, 2); Na2 SO4 (0,1);

ẤP

NaOH (0, 2)

A

C

Khối lượng chất rắn khan thu được khi cô cạn dung dịch Z là

G

TO

ÁN

-L

Í-

H

Ó

m = 182.0, 2 + 142.0,1 + 40.0, 2 = 58, 6( g ) Câu 24: B đây là este của phenol vs este vòng để ý 1 tý là thấy 4 Câu 25: C Số mol CH3COOC2H5 = số mol CH3COOC6H5 = 0,02 (mol) → Chất rắn gồm : CH3COONa ; C6H5ONa ; NaOH dư → Khối lượng chất rắn = 0,02 × 82 + 0,02 × 82 + 0,02 × 116 + 0,02 × 40 = 6,4

BỒ

ID Ư

Ỡ N

Đáp án C.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1. Cho sơ đồ chuyển hoá sau: (1). C3H4O2 + NaOH → (X) + (Y) (2). (X) + H2SO4 loãng → (Z) + (T) (3). (Z) + AgNO3 + NH3 + H2O → (E) + Ag ↓ + NH4NO3 (4). (Y) + AgNO3 + NH3 + H2O → (F) + Ag ↓ + NH4NO3 Các chất Y và Z có thể là: A. HCHO và HCOOH. B. CH3CHO và HCOONa. C. HCOOH và CH3CHO. D. HCHO và CH3CHO. Câu 2. Cho 0,01 mol một este X của axit hữu cơ phản ứng vừa đủ với 100 ml dung dịch NaOH 0,2 M, sản phẩm tạo thành chỉ gồm một ancol Y và một muối Z với số mol bằng nhau. Mặt khác, khi xà phòng hoá hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ là 60 ml dung dịch KOH 0,25 M, sau khi phản ứng kết thúc đem cô cạn dung dịch được 1,665 gam muối khan. Công thức của este X là: A. C2H4(COO)2C4H8. B. C4H8(COO)2C2H4. C. C2H4(COOC4H9)2. D. C4H8(COOC2H5)2. Câu 3. Đun nóng a gam một hợp chất hữu cơ X chứa C, H, O mạch không phân nhánh với dung dịch chứa 11,2 gam KOH đến khi phản ứng hoàn toàn thu được dung dịch Y. Để trung hòa hết KOH dư cần 40 ml dung dịch HCl 1M. Làm bay hơi hỗn hợp sau khi trung hòa thu được 7,36 gam hỗn hợp 2 ancol đơn chức và 18,34 gam rắn khan. CTCT của X là: A. CH3OOCCH2COOC2H5. B. CH3OOCCH2COOC3H7. C. CH3OOCCH=CHCOOC3H7. D. CH3OOCCH2-CH2COOC3H7. Câu 4. Hỗn hợp M gồm axit cacboxylic X, ancol Y (đều đơn chức, số mol X gấp hai lần số mol Y) và este Z được tạo ra từ X và Y. Cho một lượng M tác dụng vừa đủ với dung dịch chứa 0,2 mol NaOH, tạo ra 16,4 gam muối và 8,05 gam ancol. Công thức của X và Y là A. HCOOH và CH3OH. B. CH3COOH và CH3OH. C. HCOOH và C3H7OH. D. CH3COOH và C2H5OH. Câu 5. Este đơn chức X có tỉ khối hơi so với CH4 là 6,25. Cho 20 gam X tác dụng với 300 ml dung dịch KOH 1M (đun nóng). Cô cạn dung dịch sau phản ứng thu được 28 gam chất rắn khan. Công thức cấu tạo của X là A. CH2=CH-CH2-COO-CH3. B. CH2=CH-COO-CH2-CH3. C. CH3-COO-CH=CH-CH3. D. CH3-CH2-COO-CH=CH2. Câu 6. Chất hữu cơ X có công thức phân tử C4H6O4 tác dụng với dung dịch NaOH (đun nóng) theo phương trình phản ứng: C4H6O4 + 2NaOH → 2Z + Y. Để oxi hoá hết a mol Y thì cần vừa đủ 2a mol CuO (đun nóng), sau phản ứng tạo thành a mol chất T (biết Y, Z, T là các hợp chất hữu cơ). Khối lượng phân tử của T là A. 44 đvC.

N

Nâng Cao - Bài toán thủy phân este

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 58 đvC. C. 82 đvC. D. 118 đvC. Câu 7. Đốt cháy hoàn toàn 2,76 gam hỗn hợp X gồm CxHyCOOH, CxHyCOOCH3, CH3OH thu được 2,688 lít CO2 (đktc) và 1,8 gam H2O. Mặt khác, cho 2,76 gam X phản ứng vừa đủ với 30 ml dung dịch NaOH 1M, thu được 0,96 gam CH3OH. Công thức của CxHyCOOH là A. C2H5COOH. B. CH3COOH. C. C2H3COOH. D. C3H5COOH. Câu 8. Để phản ứng hết với một lượng hỗn hợp gồm hai chất hữu cơ đơn chức X và Y (MX < MY) cần vừa đủ 300 ml dung dịch NaOH 1M. Sau khi phản ứng xảy ra hoàn toàn thu được 24,6 gam muối của một axit hữu cơ và m gam một ancol. Đốt cháy hoàn toàn lượng ancol trên thu được 4,48 lít CO2 (đktc) và 5,4 gam H2O. Công thức của Y là: A. CH3COOC2H5. B. CH3COOCH3. C. CH2=CHCOOCH3. D. C2H5COOC2H5. Câu 9. Xà phòng hoá một hợp chất có công thức phân tử C10H14O6 trong dung dịch NaOH (dư), thu được glixerol và hỗn hợp gồm ba muối (không có đồng phân hình học). Công thức của ba muối đó là: A. CH2=CH-COONa, CH3-CH2-COONa và HCOONa. B. HCOONa, CH≡C-COONa và CH3-CH2-COONa. C. CH2=CH-COONa, HCOONa và CH≡C-COONa. D. CH3-COONa, HCOONa và CH3-CH=CH-COONa. Câu 10. Thuỷ phân hoàn 0,15 mol este X của 1 axit đa chức và 1 ancol đơn chức cần 100 ml dung dịch NaOH 10% (d = 1,2 g/ml) thu được ancol Y và 22,2 gam muối. Lấy hết Y tác dụng với CuO dư, sản phẩm sinh ra cho tác dụng với dung dịch AgNO3/NH3 dư thì thu được 129,6 gam kết tủa. Vậy X là A. (COOCH3)2. B. (COOC2H5)2. C. CH2(COOCH3)2. D. CH2(COOC2H5)2. Câu 11. Khi xà phòng hoá 1 mol este cần 120 gam NaOH nguyên chất. Mặt khác khi xà phòng hoá 1,27 gam este đó thì cần 0,6 gam NaOH và thu được 1,41 gam muối duy nhất. Biết ancol hoặc axit là đơn chức. Công thức cấu tạo của este là A. C3H5(COOCH=CH2)3. B. C3H5(COOCH3)3. C. (CH3COO)3C3H5. D. (CH2=CHCOO)3C3H5. Câu 12. Hóa hơi hoàn toàn m gam hỗn hợp X gồm 2 este là đồng phân của nhau thu được thể tích bằng thể tích của 6,4 gam O2 đo ở cùng điều kiện. Đốt cháy X ta có nCO2 : nH 2O = 1:1 . Mặt khác đun nóng m gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

hỗn hợp X trên trong NaOH dư cho đến khi phản ứng xảy ra hoàn toàn thu được t gam hỗn hợp hai muối và p gam hỗn hợp hai rượu là đồng đẳng liên tiếp. Biết p = 7,8 ; t − p < 8. Hai este đó là A. HCOOC2H5 và CH3COOCH3. B. CH3COOC2H5 và C2H5COOCH3. C. C2H5COOC2H5 và CH3COOC3H7. D. C2H5COOC3H7 và C3H7COOC2H5. Câu 13. Hỗn hợp X gồm 2 este đơn chức. Cho 0,5 mol X tác dụng với dung dịch AgNO3/NH3 dư thu được 43,2 gam Ag. Cho 14,08 gam X tác dụng với dung dịch KOH vừa đủ thu được hỗn hợp 2 muối của 2 axit

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

đồng đẳng liên tiếp và 8,256 gam hỗn hợp 2 ancol no đơn chức đồng đẳng liên tiếp, mạch hở. Công thức của 2 ancol là: A. C4H9OH và C5H11OH. B. CH3OH và C2H5OH. C. C2H5OH và C3H7OH. D. C3H7OH và C4H9OH. Câu 14. Cho 27,3 gam hỗn hợp H gồm hai este no, đơn chức tác dụng vừa đủ với dung dịch KOH, thu được 30,8 gam hỗn hợp hai muối của 2 axit kế tiếp và 16,1 gam một ancol. Khối lượng của este có khối lượng phân tử nhỏ có trong hỗn hợp H là A. 21 gam. B. 22 gam. C. 17,6 gam. D. 18,5 gam. Câu 15. Hợp chất hữu cơ X chứa một loại nhóm chức có công thức phân tử C8H14O4. Khi đun nóng X trong dung dịch NaOH được một muối và hỗn hợp hai ancol Y, Z. Phân tử ancol Z có số nguyên tử cacbon nhiều gấp đôi số nguyên tử cacbon trong phân tử ancol Y. Khi đun nóng với H2SO4 đặc, Y cho một olefin, Z cho hai olefin đồng phân cấu tạo. Công thức cấu tạo của X là: A. CH3OOCCH2CH2COOC3H7. B. C2H5 OOC-COO[CH2]3CH3. C. C2H5OOCCH2COOCH(CH3)2. D. C2H5OOC-COOCH(CH3)C2H5. Câu 16. Hỗn hợp X gồm 2 chất hữu cơ đơn chức. Cho 0,1 mol X tác dụng vừa đủ 0,1 mol NaOH, cô cạn dung dịch sau phản ứng thu được ancol Y và 7,36 gam hỗn hợp muối. Oxi hóa hoàn toàn ancol Y bằng CuO thu được anđehit. Cho toàn bộ lượng anđehit đó tác dụng với AgNO3/NH3 thu được 25,92 gam Ag. Công thức của 2 chất trong hỗn hợp X là: A. CH3COOH và HCOOCH3. B. CH3COOCH3 và CH3COOC3H7. C. HCOOH và CH3COOCH3. D. CH3COOH và HCOOC2H5. Câu 17. Cho 0,15 mol este X mạch hở vào 150 gam dung dịch NaOH 8%, đun nóng để phản ứng thuỷ phân este xảy ra hoàn toàn thu được 165 gam dung dịch Y. Cô cạn dung dịch Y thu được 22,2 gam chất rắn khan. Có bao nhiêu công thức cấu tạo của X thoả mãn điều kiện trên ? A. 1. B. 2. C. 3. D. 4. Câu 18. Khi cho 0,15 mol một este X (tạo bởi một axit cacboxylic chứa 2 nhóm -COOH và ancol đơn chức Y) tác dụng hoàn toàn với NaOH đun nóng thu được 13,8 gam Y và một muối có khối lượng ít hơn khối lượng X là 7,5%. Công thức cấu tạo của X là: A. (COOC2H5)2. B. CH2(COOCH3)2. C. CH2(COOC2H5)2. D. (COOCH3)2. Câu 19. Đốt cháy hoàn toàn hỗn hợp gồm 2 este no đơn chức cần 5,68 gam khí oxi và thu được 3,248 lít khí CO2 (đktc). Cho hỗn hợp este trên tác dụng vừa đủ với KOH thu được 2 ancol là đồng đẳng kế tiếp và 3,92 gam muối của một axit hữu cơ. CTCT của 2 este là: A. HCOOCH3 và HCOOC2H5. B. CH3COOCH3 và CH3COOC2H5.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. C3H7COOCH3 và CH3COOC2H5. D. C2H5COOCH3 và CH3COOCH3. Câu 20. Xà phòng hóa hòan toàn 16,4 gam hỗn hợp hai este đơn chức cần 250 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được hỗn hợp hai ancol đồng đẳng kế tiếp và một muối duy nhất. Thành phần phần trăm về khối lượng của hai este trong hỗn hợp là: A. 67,683% và 32,317%. B. 60% và 40%. C. 54,878% và 45,122%. D. 51,064% và 48,936%. Câu 21. Thuỷ phân hoàn toàn m gam este đơn chức X bằng NaOH. Cô cạn dung dịch thu được, cho phần hơi lần lượt qua bình (1) đựng P2O5 dư, bình (2) đựng Na dư thì thấy khối lượng bình (2) tăng 13,5 gam. Khí thoát ra khỏi bình (2) cho tác dụng với CuO dư, đun nóng thu được 9,6 gam Cu. Mặt khác, m gam este X tác dụng vừa vừa hết với 0,3 mol H2 (xúc tác Ni, to) thu được 93,6 gam Y. Công thức của X là A. C17H35COOC2H3. B. C17H33COOC2H5. C. C18H35COOC2H5. D. C18H37COOC2H3. Câu 22. Xà phòng hóa 15,8 gam chất hữu cơ Y có CTPT C7H10O4 bằng dung dịch NaOH vừa đủ thu được một muối của axit hữu cơ đa chức và 9 gam hỗn hợp 2 ancol mạch hở. CTCT thu gọn của Y là: A. CH3OOCCH2COOCH2CH=CH2. B. CH3CH2OOCCH2COOCH=CH2. C. CH3OOCCH=CHCOOCH2CH3. D. CH3OOCCH2COOCH=CH-CH3. Câu 23. Đốt cháy hoàn toàn một lượng hỗn hợp hai este đơn chức no, mạch hở cần 3,976 lít oxi (đktc) thu được 6,38 gam CO2. Đun lượng este này với 50ml dd KOH 1M rồi cô cạn dd sau phản ứng thu được hỗn hợp hai ancol kế tiếp và 4,48 gam hỗn hợp chất rắn gồm 2 chất. Công thức của hai este trong hỗn hợp đầu là A. CH3COOCH3 và CH3COOC2H5. B. CH3COOCH3 và C2H5COOC2H5. C. HCOOC3H7 và HCOOC2H5. D. CH3COOC2H5 và CH3COOC3H7. Câu 24. Hỗn hợp X gồm hai este đồng phân của nhau. Lấy 0,3 mol X tác dụng với 400 ml dung dịch NaOH 1M, sau phản ứng hoàn toàn thu được 12,75 gam hỗn hợp hai ancol đồng đẳng kế tiếp, cô cạn dung dịch sau phản ứng được chất rắn Y. Nung Y trong không khí đến phản ứng hoàn toàn thu được 17,36 lít CO2 (ở đktc); 10,35 gam nước và một lượng Na2CO3. Công thức phân tử của hai este là: A. C2H3COOC2H5, C3H5COOCH3. B. C2H3COOC3H7, C3H5COOC2H5. C. C2H5COOC2H5, C3H7COOCH3. D. C2H5COOC3H7, C3H7COOCH3. Câu 25. Đốt a mol X là trieste của glixerol và axit đơn chức, mạch hở thu được b mol CO2 và c mol H2O, biết b – c = 4a. Hiđro hóa hoàn toàn m gam X cần 6,72 lít H2 (đktc) thu được 39 gam Y. Nếu đun m gam X với dung dịch chứa 0,7 mol NaOH đến phản ứng hoàn toàn; cô cạn dung dịch sau phản ứng thì thu được bao nhiêu gam chất rắn ? A. 57,2 gam. B. 52,6 gam. C. 53,2 gam. D. 61,48 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 26. Đốt cháy hoàn toàn m gam hỗn hợp gồm hai este X, Y là đồng phân của nhau cần dùng 19,6 gam O2, thu được 11,76 lít CO2 (đktc) và 9,45 gam H2O. Mặt khác, nếu cho m gam hỗn hợp trên tác dụng hết với 200 ml dung dịch NaOH 1M rồi cô cạn dung dịch thu được sau phản ứng thì còn lại 13,95 gam chất rắn khan. Tỉ lệ mol của X và Y là: A. 2 : 3. B. 3 : 5. C. 4 : 3. D. 3 : 2. Câu 27. Cho 6,825 gam hỗn hợp X gồm hai este no, đơn chức tác dụng vừa đủ với dung dịch KOH, thu được 7,70 gam hỗn hợp hai muối của 2 axit kế tiếp và 4,025 gam một ancol. Khối lượng của este có khối lượng phân tử nhỏ hơn trong hỗn hợp X là A. 4,625 gam. B. 5,55 gam. C. 1,275 gam. D. 2,20 gam. Câu 28. E là este mạch không nhánh chỉ chứa C, H, O, không chứa nhóm chức nào khác. Đun nóng một lượng E với 150 ml dung dịch NaOH 1M đến kết thúc phản ứng. Để trung hoà dung dịch thu được cần 60ml dung dịch HCl 0,5M. Cô cạn dung dịch sau khi trung hoà được 11,475 gam hỗn hợp hai muối khan và 5,52 gam hỗn hợp 2 ancol đơn chức. Công thức cấu tạo của este là A. CH3CH2CH2-OOC-CH2CH2COOCH3. B. HCOOCH3 và CH3COOC2H5. C. C2H5-COO-C2H5. D. CH3-CH2-OOC-CH2COOCH3. Câu 29. Chất hữu cơ X có công thức phân tử C11H20O4. X tác dụng với dung dịch NaOH tạo ra muối của axit hữu cơ Y mạch thẳng và hai ancol là etanol và propan-2-ol. Công thức cấu tạo của X là A. C2H5COO[CH2]4COOCH(CH3)2. B. C2H5OOC[CH2]4COOCH2CH2CH3. C. (CH3)2CHOOC[CH2]3COOC2H5. D. C2H5OOC[CH2]4COOCH(CH3)2. Câu 30. Este X 3 chức ( không có nhóm chức nào khác ). Xà phòng hóa hoàn toàn 2,4 gam X bằng NaOH được chất hữu cơ Y không nhánh, dễ bay hơi và 2,7 gam hỗn hợp 3 muối của 1 axit cacboxylic no, đơn chức, mạch hở và 2 axit cacboxylic không nhánh đồng đẳng kế tiếp trong dãy đồng đẳng của axit acrylic . Chuyển toàn bộ hỗn hợp muối thành các axit tương ứng rồi đốt cháy hỗn hợp axit đó thu được 4,6 gam hỗn hợp CO2 và H2O. Đốt cháy hoàn toàn 2,4 gam X thu được tổng khối lượng nước và CO2 là A. 6,10g B. 5,92g C. 5,04g D. 5,22g

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

BỒ

ID Ư

Câu 1: C HCOOCH=CH2 + NaOH → HCOONa + CH3CHO 2HCOONa + H2SO4 → 2HCOOH + Na2SO4.

HCOOH + 2AgNO3 + 4NH3 + H2O → (NH4)2CO3 + 2Ag + 2NH4NO3 CH3CHO + 2AgNO3 + 3NH3 + H2O → CH3COONH4 + 2Ag + 2 NH4NO3.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

=>Đáp án C. Câu 2: B Ta thấy, nX : nNaOH = 1:2 nên este có 2 chức este

H Ơ

1, 665 = 222 ⇒ C4 H 8 (COOK ) 2 0, 06.0, 25 : 2 1, 29 = = 172 ⇒ C4 H 8 (COO) 2 C2 H 4 0, 06.0, 25 : 2

TP .Q

U

Y

N

M muoi =

M este

N

Mặt khác, sản phẩm thu được chỉ gồm 1 ancol và 1 muối nên este tạo thành từ ancol 2 chức và axit 2 chức

Ư N

G

Đ

ẠO

=> Đáp án B Câu 3: C Từ đáp án đặt công thức chung của X là (RCOO)2R1R2.

nKOHphản ứng =

H

11, 2 - 0,04 = 0,16 mol. 56

TR ẦN

www.daykemquynhon.ucoz.com

R(COO)2R1R2 + 2 KOH → 2 R(COOK)2 + R1OH + R2OH.

7,36 = 92. 0, 08

10

00

B

nmột ancol = 0,16 : 2 = 0,08 mol. MR1OH + MR2OH = MR1 + MR2 + 17 × 2 =

2+

3

→ 2ancol là CH3OH và C3H7OH.

ẤP

mR(COOK)2 = 18,34 - mKCl = 18,34 - 0,04 × 74,5 = 15,36 gam

A

C

15,36 = 192. MR = 26. 0, 08

-CH=CH- (R).

H

Ó

MR(COOK)2 = MR + 2 × 83 =

ÁN

→ Đáp án C. Câu 4: D

-L

Í-

→ X là CH3OOCCH=CHCOOC3H7.

16, 4 = 82 → CH3COONa → axit là CH3COOH ( Loại A, C) 0, 2

Ỡ N

G

TO

Đặt CT muối là RCOONa ⇒ M muoi =

BỒ

ID Ư

nancol < naxit + neste = 0, 2mol → M ancol >

8, 05 = 40, 25 → loại B 0, 2

Đáp án D. Câu 5: D Ta có M X = 100

Theo các đáp án đều là este có 5C và có 1 nối đôi nên CT este là C5H8O2 → ⇒ nX = 0, 2mol Hốn hợp sau sản phẩm gồm chất rắn khan và chất G ( có thể là ancol hoặc andehit)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Bảo toàn khối lượng mX + mKOH = mran + mG ⇒ mG = 8,8 g → M G =

8,8 = 44 ⇒ CH3CHO 0, 2

H Ơ

Đáp án D. Câu 6: B Nhận thấy oxi hóa a mol Y cần 2a mol CuO → Y là ancol 2 chức → X có công thức HCOOCH2-CH2OOCH

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Y

N

HCOOCH2-CH2OOCH (X)+ 2NaOH → 2HCOOH (Z)+ HOCH2-CH2OH (Y)

TP .Q

U

HOCH2-CH2OH + 2CuO → HOC-CHO (T) + 2Cu + 2H2O

H

www.daykemquynhon.ucoz.com

Gọi số mol của axit, este, ancol lần lượt là x, y, z mol

Ư N

Trong X có mX = mC + mH + mO ⇒ mO = 1,12 g ⇒ nO = 0, 07mol

G

Đ

ẠO

Phân tử khối của T là 58. Đáp án B. Câu 7: C Ta có nCO2 = 0,12mol và nH 2O = 0,1mol , nCH3OH = 0,03 mol

00

B

TR ẦN

a + b = 0, 03 a = 0, 01   Ta có hệ b + c = 0, 03 → b = 0, 02 2a + 2b + c = 0, 07 c = 0, 01  

3

10

→ 0,01. ( MCxHy + 45) + 0,02. ( MCxHy + 44 + 15) + 0,01. 32 = 2,76 → MCxHy = 27 (C2H3)

C

ẤP

2+

Công thức axit là C2H3COOH. Đáp án C. Câu 8: A Nhận thấy đáp án khi thủy phân đều tạo ancol no, đơn chức

Ó

A

→ nancol = nH2O - nCO2 = 0,3- 0,2 = 0,1 mol → C = 0,2:0,1 = 2 → ancol là C2H5OH ( loại B,C)

Í-

H

Ta có nNaOH = nmuối = 0,3 mol → Mmuối = 82 ( CH3COONa)

ÁN

-L

Vậy X là CH3COOH : 0,2 mol và Y là CHCOOC2H5: 0,1 mol

Ỡ N

G

TO

Đáp án A. Câu 9: A 10.2 + 2 − 14 =4 π +v = 2

BỒ

ID Ư

Tổng C trong mạch C của 3 axit là 10-3=7

Như vậy, sẽ có 1 axit có 1C, 1 axit có 3C và 1 axit có 3C kèm theo nối đôi trong mạch C  HCOONa  Công thức 3 muối sẽ là CH 3CH 2COONa CH = CHCOONa  2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

Đáp án A Câu 10: C nNaOH = 0,3

H Ơ

Gọi CT este là R1(COOR2)2

N

R1 (COOR2 )2 + 2 NaOH → R1 (COONa ) 2 + 2 R2OH

U

Y

⇒ nR2OH = 0, 3

TP .Q

nAg = 1, 2 nAg : nR2OH = 4 :1 ⇒ CH 3OH (ancol ) 22, 2 = 148 ⇒ CH 2 (COONa )2 0,15 ⇒ X : CH 2 (COOCH 3 )2

Ư N

G

Đ

ẠO

M muoi =

H TR ẦN

www.daykemquynhon.ucoz.com

Đáp án C Câu 11: D neste : nNaOH = 1 : 3. Suy ra,este 3 chức.

B

- TH1: Giả sử este có dạng (RCOO)3R1

10

00

nNaOH = 0,015 mol. Suy ra, nR(OH)3 = 0,005 mol

2+

3

mancol = 1,27 + 0,6 - 1,41 = 0,46 gam

C

ẤP

MR1 (OH)3 = MR + 3 × 17 = 0,46 : 0,005 = 92 MR1 = 41 C3H5-.

H

Ó

A

Meste = 1,27 : 0,005 = 254. Do đó MR = 27. CH2=CH-.

-L

Í-

Vậy (CH2=CHCOO)3C3H5

ÁN

Đáp án D

Ỡ N

G

TO

- TH2: Giả sử R(COOR1)3 không có chất nào phù hợp. Câu 12: A neste = 0, 2

BỒ

ID Ư

nCO2=nH2O nên este no đơn chức

M ancol =

CH 3OH 7,8 = 39 ⇒  0, 2 C2 H 5OH

t < 8 + 7,8 = 15,8 ⇒ M muoi <

 HCOONa 15,8 = 79 ⇒  0, 2 CH 3COONa

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Như vậy, 2 este là HCOOC2H5 và CH3COOCH3.

H Ơ

N

Đáp án A Câu 13: C 0,5 mol X cho ra 0,4 mol Ag nên trong X có 1 este là HCOOR → nHCOOR = 0,4:2 = 0,2 mol

Y

N

Mặt khác khi thủy phân X trong KOH cho hỗn hợp hai muối của 2 axit đồng đẳng kế tiếp nên este còn lại là CH3COOR1

TP .Q

U

→ nCH3COOR1 = 0,5- 0.2 = 0,3 mol → nHCOOR : nCH3COOR1 = 2:3

ẠO

Trong 14,8 gam X gọi số mol của HCOOR là 2x, số mol của CH3COOR1: 3x mol

Đ

Bảo toàn khối lượng : mX + mKOH = mmuoi + mancol

8, 256 = 51, 6 0,16 → mà 2 ancol kế tiếp nhau có công thức C2H5OH và C3H7OH

TR ẦN

www.daykemquynhon.ucoz.com

⇒ M ancol =

H

⇒ x = 0, 32 ⇒ nancol = (3 + 2).x = 0,16

Ư N

G

14, 08 + (0, 2 x + 0,3 x).56 = 0, 2 x.M HCONa + 0,3 x.M CH3COONa + 8, 256

3

10

00

B

Đáp án C. Câu 14: D 30,8 + 16,1 − 27,3 nKOH = = 0,35 56

ẤP

2+

⇒ M ancol = 46 ⇒ C2 H 5OH

C

 HCOOC2 H 5  HCOOK 30,8 = 88 ⇒  ⇒ 0,35 CH 3COOK CH 3COOC2 H 5

H

Ó

A

M muoi =

-L

Í-

⇒ nHCOOC2 H 5 = 0, 25 ⇒ m = 18, 5

TO

ÁN

=> Đáp án D Câu 15: D Đun nóng với H2SO4 Z cho 1 olefin nên Z có thể là C2H5OH hoặc C3H7OH.

Ỡ N

G

+Nếu Z là C3H7OH thì Y là C6H13OH. Loại phương án này vì tổng số nguyên tử cacbon trong X và Y đã lớn hơn 8

BỒ

ID Ư

+Nếu Z là C2H5OH thì Y là C4H9OH. Thỏa mãn điều kiện tạo 2 đồng phân cấu tạo khi công thức cấu tạo của Y là CH 3 − CH (OH ) − CH 2 − CH 3

Vậy công thức X là CH 3CH 2OOCCOOCH (CH 3 )CH 2CH 3 =>. Đáp án D. Câu 16: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

N

 nHCOOH = 0, 06  HCOONa  HCOOH M muoi = 73, 6 ⇒  ⇒ ⇒  nCH3COOH = 0,04 CH 3COONa CH 3COOH n Ag = 0, 24

N

Từ 4 đáp án, Y là ancol đơn chức

U

Y

Nếu Y là CH3OH

TP .Q

⇒ nCH 3OH = 0, 06

Đ

ẠO

Như vậy, 2 chất là HCOOCH3 và CH3COOH

Ư N

G

Nếu Y không phải CH3OH

www.daykemquynhon.ucoz.com

H

⇒ nY = 0,12 > 0,1 ⇒ loai

16, 2 = 108 ⇒ C3 H 5COONa 0,15 ⇒ X : C3 H 5COOCH 3

C

ẤP

⇒ M muoi =

2+

3

10

0,15 = 100 ⇒ X phải là este đơn chưc 15 = 22, 2 − (0, 3 − 0,15).40 = 16, 29( g )

mX = mY − mddNaOH = 165 − 150 = 15( g ) ⇒ M X = mY = mmuoi + mNaOH ⇒ mmuoi

00

B

TR ẦN

=>Đáp án A Câu 17: C nNaOH = 0,3

H

Ó

A

C = C − C − COOCH 3 , C − C = C − COOCH 3 , C = C (C ) − COOCH 3 (3)

-L

Í-

Do đề bài hỏi có bao nhiêu CTCT nên không tính đồng phân hình học

G

TO

ÁN

Chọn C Câu 18: C R(COOR1)2 + 2 NaOH → R(COONa)2 + 2 R1OH. 13,8 nancol = 2 × 0,15 = 0,3 mol. MROH = MR1 + 17 = = 46. MR1 = 29. =>C2H5-. 0,3

Ỡ N

92,5 × (MR + 146). MR = 14. 100 => CH2(COOC2H5)2. Đáp án C Câu 19: B Vì este no đơn chức nên nH2O = nCO2 = 0,145 mol

R là -CH2-.

BỒ

ID Ư

Mà MR + 67 × 2 =

Bảo toàn nguyên tố O → nO( este) = 0,145. 2 + 0,145 - 2. 0,1775 = 0,08 mol → neste = 0,04 mol Luôn có nmuối = neste = 0,04 mol → Mmuối = 98 (CH3COOK)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Khi thủy phân este tạo một muối và 2 ancol đồng đằng kế tiếp → 2 este là đồng đẳng kế tiếp nhau. Ctb = 0,145 : 0,04 = 3,625 → 2 este là CH3COOCH3 và CH3COOC2H5.

Y

N

H Ơ

N

Đáp án B. Câu 20: C nNaOH = 0,25 mol.

TP .Q

U

Mtrung bình của este = 16,4 : 0,25 = 65.6. Do đó có một este là HCOOCH3

ẠO

Cô cạn dung dịch thu được hỗn hợp hai ancol đồng đẳng kế tiếp và một muối : suy ra este còn lại là HCOOCH2CH3.

G

Đ

Lập hpt ta tính được nHCOOCH3 = 0,15 mol

H

Ư N

%HCOOCH3 = (0,15 * 60) / 16,4 = 54,878%.

TR ẦN

www.daykemquynhon.ucoz.com

Đáp án C Câu 21: B HD: ♦1. phân tích: este đơn chức pư với NaOH:

10

00

B

.Este + 1.NaOH  muối + ancol

2+

3

chú ý, sp phải là ancol bởi phần hơi thu được gồm nước là sản phẩm hơi thủy phân, nhưng bình (1) đã hấp thụ nước nên bình (2) tăng phải là do ancol.

A

C

ẤP

1 . ROH + Na → RONa + H 2 2

Í-

H

Ó

sau đó: . H 2 + CuOdu → Cu + H 2O

ÁN

-L

do đó: . nancol = 2.nH 2 = 2.nCu =

13,5 = 45 → nên R là C2H5 ( ancol etylic) 0,3

G

TO

. ⇒ ROH − 1(cua.H 2 .bay.ra ) =

2.9, 6 = 0, 3mol. 64

ID Ư

Ỡ N

♦ 2. . nX = nH 2 = 0, 3mol. → nên este dạng RCOOC2H5 và có gốc R có 1 nối đôi C=C.

BỒ

khi đó, . M Y =

93, 6 = 312 ⇒ R + 2 = 312 − 29 − 44 = 239 0,3

suy ra R là C17H33. CT của X cần tìm là: . C17 H 33COOC2 H 5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

→ ta chọn đáp án B. ♦ Câu 22: A nY = 0,1 mol. R(COO)2R1R2 + 2NaOH → R(COONa)2 + R1OH + R2OH 9 MR1OH + MR2OH = MR1 + MR2 + 17 × 2 = = 90 0,1 MR1 + MR2 = 56. => R1 là CH3-, R2 là CH2=CH-CH2-. Vậy Y là CH3OOCCH2COOCH2CH=CH2. Đáp án A Câu 23: A este đơn chức no nên nCO2 = nH2O = 0,145 mol.

ẠO

bảo toàn nguyên tố oxi: neste = 1,5.0,145 - 0,1775 = 0,04 mol.

Ư N

H

mmuối = 4,48 - 0,01.56 = 3,92 gam, suy ra M = 98 là CH3COOK ( loại C).

G

Đ

nKOH = 0,05 mol nên chất rắn gồm 1 muối duy nhất và 0,01 mol KOH dư. ( loại được B).

TR ẦN

www.daykemquynhon.ucoz.com

lại có 2 este tạo 2 ancol đồng đẳng kế tiếp và nC = 0,145 : 0,04 = 3,625 nên 2 este là C3 và C4.

3

ẤP

2+

 x + y = 0,3  x = 0, 075 Ta có hệ  → 32 x + 46 y = 12, 75  y = 0, 225

10

00

B

từ đó ta thấy chỉ đáp án A thỏa mãn. Câu 24: A Có Mancol = 12,75 : 0,3 = 42, 5 mà 2 ancol đồng đẳng kế tiếp là CH3OH : x mol và C2H5OH : y mol ( Loại B, D)

A

C

Bảo toàn nguyên tố Na → nNa2CO3 = 0,5.nNaOH = 0,2 mol

Í-

H

Ó

Bảo toàn nguyên tố C → nC = 0,2 + 0,775 = 0,975 mol

-L

Vì nX = 0,3 mol < nNaOH = 0,4 mol → Hỗn hợp Y gồm NaOH dư: 0,1 mol và 0,3 mol RtbCOONa

TO

ÁN

Luôn có mY= mC + mH + mNa + mO

Ỡ N

G

→ 0,3. ( Rtb + 67) + 0,1. 40 = 0,975. 12 + 2. 0,575 + 23. 0,4 + 16. ( 0,3.2 + 0,1 ) → Rtb = 30,5 27.0, 225 + 41.0, 075 0,3

BỒ

ID Ư

Nhận thấy: Rtb = 30,5 =

Vậy 2 este là C2H3COOC2H5: 0,225 mol và C3H5COOCH3: 0,075 mol. Đáp án A. Câu 25: B Nhận thấy b-c= 4a → trong X có 5 liên kết π trong đó có 3 liên kết π ở gốc COO và 2 liên kết π ở gốc hidrocacbon C=C Như vậy để hidro hóa hoàn toàn 1 mol X cần dùng 2 mol H2 → nX = 0,3 : 2 = 0,15 mol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Bảo toàn khối lương → mX = 39 - 0,3. 2= 38,4 gam Khi tham gia phản ứng thủy phân → nC3H5(OH)3 = nX = 0,15 mol

H Ơ

N

Bảo toàn khối lượng → mchất rắn = mX + mNaOH - mC3H5(OH)3

N

→ mchât rắn = 38,4 + 0,7. 40 - 0,15. 92 = 52,6 gam.

TP .Q

U

Y

Đáp án B. Câu 26: C có: nCO2 = nH2O = 0,525 mol → 2 este là no, đơn chức ↔ có 2 O trong phân tử.

ẠO

Bào toàn nguyên tố oxi: 2.n hh + 19,6 ÷ 16 = 0,525 × 3 → nhh = 0,175.

Đ

Suy ra: n C trung bình = 0,525 ÷ 0,175 = 3 → este là C3H6O2.

Ư N

G

X1, X2 là 2 đồng phân nên lần lượt là: HCOOC2H5 và CH3COOCH3

www.daykemquynhon.ucoz.com

H

Gọi số mol X1, X2 lần lượt là x và y mol. thì x + y = 0,175 mol.

TR ẦN

Mặt khác: gt (2), số mol NaOH là 0,2 mol nên sau pư còn dư 0,025 mol.

00

10

68 x + 82 y + 0, 025.40 = 13,95 ⇒ 68 x + 82 y = 12,95

B

chất rắn gồm: x mol HCOONa, y mol CH3COONa và 0,025 mol NaOH dư, từ gt khối lượng có:

2+

3

 x + y = 0,175  x = 0,1mol ⇒ ta có hệ phương trình:  68 x + 82 y = 12,95  y = 0, 075mol

H

Ó

A

C

ẤP

Vậy tỉ lệ số mol X1 và X2 là 4 : 3. ta chọn đáp án C.♣♣♣ Câu 27: A 7, 7 + 4, 025 − 6,825 nKOH = = 0, 0875 ⇒ M ancol = 46 ⇒ C2 H 5OH 56

-L

Í-

M muoi = 88 ⇒ M axit = 88 − 28 = 50

TO

ÁN

Như vậy 2 axit là HCOOH x mol và CH3COOH y mol

Ỡ N

G

84 x + 98 y = 7, 7  x = 0, 0625 Hệ:  ⇒  x + y = 0, 0875  y = 0, 025

BỒ

ID Ư

=> m = 74.0,0625 = 4,625

=>Đáp án A Câu 28: A nNaOH = 0,15 − 0, 03 = 0,12 2 muối thu được là muối hữu cơ và NaCl. MẶt khác, thu được 2 ancol nên axit hữu cơ phải là 2 chức

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn ⇒ M muoi =

11, 475 − 0, 03.58,5 = 162 ⇒ NaOOC − CH 2CH 2COOCH 3 0,12 : 2

N

C3 H 7OH 5, 52 = 46 ⇒  0,12 CH 3OH

H Ơ

M ancol =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

N

=> CH3CH2CH2-OOC-CH2CH2COOCH3.

ẠO

TP .Q

U

Đáp án A Câu 29: D Số C trong axit là 11-2-3=6

Đ

Công thức axit: HOOC − [CH 2 ]4 − COOH

Ư N

G

Công thức X C2 H 5OOC[CH 2 ]4 COOCH (CH 3 )2

H TR ẦN

www.daykemquynhon.ucoz.com

Đáp án D Câu 30: A Nhận thấy A + 3NaOH → muối + Y

00

B

Gọi số mol của NaOH là 3x thì số mol Y là x mol.

120 x − 0,3 0,3 = 120 x x

2+

3

10

Bảo toàn khối lượng → 2,4 + 120x = 2,7 + xMY (1) → MB=

C

ẤP

→ MB < 120 mà trong Y chứa 3 nhóm OH, không phân nhánh → nên Y có thể là C3H8O3, C4H10O3, C5HaO3( không no)

H

Ó

A

Nếu là C3H8O3 thay vào (1) → x = 0,01

-L

Í-

Nhận thấy khi thủy phân tạo 1 axit cacboxylic no, đơn chức, mạch hở 0,01 mol và 0,02 mol 2 axit cacboxylic không nhánh đồng đẳng kế tiếp trong dãy đồng đẳng của axit acrylic .

TO

ÁN

Gọi số mol CO2, H2O lần lượt là a, b mol

Ỡ N

G

44a + 18b = 4, 6  a = 0, 08 Ta có hệ  → a − b = 0, 02 b = 0, 06

BỒ

ID Ư

Khi đốt cháy X tạo ra ∑nCO2 = 0,08 + 0,01.3 = 0,11 mol, ∑nH2O =0,06 - 0,015 + 0,01(8-3):2= 0,07 mol → m= 6,1 gam. Nhận thấy nếu Y là C4H10O3 hoặc C5HaO3( không no)thay vào (1) thì x càng lớn → mCO2 + mH2O > 6,1 gam

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Chỉ số xà phòng hoá của chất béo là A. số mg KOH cần để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong 1 gam chất béo. B. số mg NaOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong 1 gam chất béo C. số gam KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong 100 gam chất béo D. số mg KOH để trung hoà hết lượng axit tự do và xà phòng hoá hết lượng este trong 1 gam lipit. Câu 2: Chỉ số axit của chất béo là A. số mg OH- dùng để trung hoà axit tự do có trong 1 gam chất béo. B. số gam KOH dùng để trung hoà axit tự do có trong 100 gam chất béo. C. số miligam KOH dùng để trung hoà axit tự do có trong 1 gam chất béo. D. số mg NaOH dùng để trung hoà axit tự do có trong 1 gam chất béo. Câu 3: Chỉ số este là A. số mg KOH dùng để xà phòng hoá hết lượng este có trong 1 gam chất béo. B. số gam KOH dùng để trung hoà axit tự do có trong 100 gam chất béo. C. số mg KOH dùng để trung hoà axit tự do có trong 1 gam chất béo. D. số mg NaOH dùng để trung hoà axit tự do có trong 1 gam chất béo. Câu 4: Chỉ số iôt là: A. Số gam iốt có thể kết hợp với 100 gam chất béo B. Số gam iôt có thể kết hợp với 1 gam chất béo C. Số mg iôt có thể phản ứng với 10 gam chất béo D. Số mg iôt có thể phản ứng với 1 gam chất béo Câu 5: Để trung hoà 4 g chất béo có chỉ số axit là 7. Khối lượng của KOH là: A. 28 mg B. 280 mg C. 2,8 mg D. 0,28 mg Câu 6: Xà phòng hoá 100 gam chất béo cần 19,72 gam KOH. Chỉ số xà phòng hoá của chất béo là A. 1,792 B. 17,92 C. 197,2 D. 1792 Câu 7: Xà phòng hoá hoàn toàn 2,5 gam chất béo cần 50 ml dung dịch KOH 0,1 M. Chỉ số xà phòng hoá của chất béo là: A. 280 B. 140 C. 112 D. 224 Câu 8: Muốn trung hoà 2,8 gam chất béo cần 3 ml dung dịch KOH 0,1M. Chỉ số axit của chất béo là A. 2 B. 5 C. 6 D. 10 Câu 9: Để trung hoà 10 gam một chất béo có chỉ số axit là 5,6 thì khối lượng NaOH cần dùng là bao nhiêu? A. 0,05g B. 0,06g C. 0,04g D. 0,08g Câu 10: Khối lượng của Ba(OH)2 cần để trung hòa 4 gam chất béo có chỉ số axit bằng 9 là:

N

Chỉ số axit, chỉ số este

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. 36mg B. 20mg C. 50mg D. 54,96mg Câu 11: Để trung hoà 140 gam 1 chất béo cần 15ml dung dịch KOH1M. Chỉ số axit của chất béo đó bằng bao nhiêu? A. 5 B. 6 C. 7 D. 8 Câu 12: Xà phòng hoá 1 kg chất béo có chỉ số axit bằng 7, chỉ số xà phòng hoá 200. Khối lượng glixerol thu được là A. 352,43 gam B. 105,69 gam C. 320,52 gam D. 193 gam Câu 13: Để xà phòng hoá 10 kg chất béo có chỉ số axit bằng 7 người ta đun chất béo với dung dịch chứa 1,42 kg NaOH. Sau phản ứng hoàn toàn muốn trung hoà hỗn hợp cần 50 ml dung dịch HCl 1M. Tính khối lượng glixerol và khối lượng xà phòng nguyên chất đã tạo ra. A. 1035 g và 10342,5 g B. 1200 g và 11230,3 g C. 1048,8 g và 10346,7 g D. 1452 g và 10525,2 g Câu 14: Khi xà phòng hoá 2,52 gam chất béo A cần 90 ml dung dịch KOH 0,1 M. Mặt khác khi xà phòng hoá hoàn toàn 5,04 gam chất béo A thu được 0,53 gam glixerol. Tìm chỉ số xà phòng hoá và chỉ số axit của chất béo A. A. 200 và 8 B. 198 và 7 C. 211 và 6 D. 196 và 5 Câu 15: Số mg KOH dùng để xà phòng hoá hết lượng triglixerit có trong 1 gam chất béo được gọi là chỉ số este của loại chất béo đó. Tính chỉ số este của một loại chất béo chứa 89% tristearin? A. 168 B. 168 C. 1,68 D. 33,6 Câu 16: Để xà phòng hoá 35 kg triolein cần 4,939 kg NaOH thu được 36,207 kg xà phòng. Chỉ số axit của mẫu chất béo trên là: A. 7 B. 8 C. 9 D. 10 Câu 17: Một loại chất béo có chỉ số xà phòng hoá là 189,003 chứa axit stearic và tristearin. Để trung hoà axit tự do có trong 100 g mẫu chất béo trên thì cần bao nhiêu ml dung dịch NaOH 0,05 M A. 100 ml B. 675 ml C. 200 ml D. 125 ml

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 18: Cho 200 gam một loại chất béo có chỉ số axit bằng 7 tác dụng vừa đủ với một lượng NaOH, thu được 207,55 gam hỗn hợp muối khan. Khối lượng NaOH đã tham gia phản ứng là: A. Câu 18: Cho 200 gam một loại chất béo có chỉ số axit bằng 7 tác dụng vừa đủ với một lượng NaOH, thu được 207,55 gam hỗn hợp muối khan. Khối lượng NaOH đã tham gia phản ứng là: B. 32,36 gam C. 30 gam D. 31,45 gam Câu 19: Xà phòng hoá 1kg chất béo có chỉ số axit là 2,8 người ta cần dùng 350 ml KOH 1M. Khối lượng glixerol thu được là bao nhiêu? A. 9,2gam B. 18,4 gam C. 32,2 gam D. 16,1 gam Câu 20: Một loại mỡ chứa 40% triolein, 20% tripanmitin, 40% tristearin (về số mol). Xà phòng hoá hoàn toàn m gam mỡ trên bằng NaOH thu được 138 gam glixerol. Giá trị của m là? A. 1209 B. 1304,27 C. 1306,2 D. 1335 Câu 21: Khi cho 58,5 gam một chất béo có thành phần chính là những axit béo chưa bão hòa phản ứng với dung dịch iôt thì thấy cần một dung dịch chứa 9,91 gam iôt. Chỉ số iôt của mẫu chất béo trên là A. 16,94 B. 16,39 C. 19,63 D. 13,69 Câu 22: Một loại chất béo chứa 4,23% axit oleic, 1,6% axit panmitic còn lại là triolein. Chỉ số xà phòng hóa của mẫu chất béo trên là: A. 109,6 B. 163,2 C. 190,85 D. 171,65 Câu 23: Xà phòng hóa hoàn toàn 10 gam một chất béo trung tính cần 1,68 gam KOH. Từ 1 tấn chất béo trên điều chế được bao nhiêu tấn xà phòng natri loại 72% A. 1,028 B. 1,428 C. 1,513 D. 1,628 Câu 24: Đốt cháy a mol X là trieste của glixerol với axit đơn chức mạch hở thu được b mol CO2 và c mol H2O, biết b - c = 4a. Hiđro hóa m gam X cần 6,72 lít H2 (đktc) thu được 39 gam một sản phẩm. Nếu đun m gam X với dung dịch chứa 0,7 mol NaOH đến phản ứng hoàn toàn, cô cạn dung dịch sau phản ứng thu được chất rắn khan có khối lượng là A. 57,2 gam B. 52,6 gam C. 61,48 gam D. 53,2 gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Đáp án: A Chỉ số xà phòng hóa của chất béo là số miligam KOH cần để trung hòa hết lượng axit béo tự do và xà phòng hóa hoàn toàn lượng este có trong 1 gam chất béo Câu 2: Đáp án: C Chỉ số axit của chất béo là số miligam KOH cần để trung hòa hết lượng axit béo tự do trong 1 gam chất béo Câu 3: Đáp án: A Chỉ số xà phòng hóa là số miligam KOH cần để xà phòng hóa hoàn toàn lượng este trong 1 gam chất béo. Câu 4: Đáp án: A Chỉ số Iot là số gam I2 có thể kết hợp với 100 gam chất béo Câu 5: Đáp án: A Chỉ số axit = 7 => Trung hòa 1 gam chất béo cần 7 mg KOH => Trung hòa 4 gam chất béo cần 7.4 = 28 mg KOH Câu 6: Đáp án: C 19, 72 Xà phòng hóa 1 gam chất béo đó, cần mKOH = = 0,1972 g = 197,2 mg 100 => Chỉ số xà phòng hóa là 197,2 Câu 7: Đáp án: C Xà phòng hóa 2,5 mg chất béo à cần 0,05.0,1.56 = 0,28 g KOH 0, 28 => Xà phòng hóa 1 g chất béo cần mKOH = = 0,112 g = 112 mg 2,5 => Chỉ số xà phòng hóa là 112 Câu 8: Đáp án: C Trung hòa 2,8 g chất béo, cần nKOH = = 3.10-4 mol => mKOH = 3.10-4 . 56 = 0,0168 g 0, 0168 => Trung hòa 1 g chất béo cần mKOH = = 6.10-3 g = 6 mg 2,8 Câu 9: Đáp án: C Trung hòa 10 g chất béo cần mKOH = 5,6 . 10 = 56 mg = 0,056 g => nKOH = 1. 10-3 mol => nNaOH = 10-3 mol => mNaOH = 10-3 .40 = 0,04 g Câu 10: Đáp án: D Trung hòa 1 g chất béo cần mKOH = 4.9 = 36 mg 36.10−3 => nKOH = mol 56 1 => nBa(OH)2 = nKOH 2 1 36.10−3 => mBa(OH)2 = 171. . = 0,05496 g = 54,96 mg 2 56 Câu 11: Đáp án: B nKOH = 0,015 mol => mKOH = 0,015.56 = 0,84 g = 840 mg 840 => Chỉ số axit là : =6 140 Câu 12: Đáp án: B Chỉ số xà phòng hóa là 200 => Xà phòng hóa hoàn toàn 1 kg chất béo cần: 200.10−3 25 nKOH = .100 = mol 56 7 Mà, KOH tham gia 2 phản ứng :

N

LỜI GIẢI CHI TIẾT

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

H Ơ N Y U TP .Q ẠO Đ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

+) Xà phòng hóa trriglixerit trung tính 25 193 => nKOH (pứ với triglyxerit ) = − 0,125 = mol 7 56 1 92 193 Mà nC3H5(OH)3 = nKOH => mC3H5(OH)3 = . = 105,69 g 3 3 56 Câu 13: Đáp án: C 1420 = 35,5 mol ; nHCl = 0,05 mol Tổng nNaOH = 40 => nNaOH (pứ với chất béo) = 35,5 - 0,05 = 35,45 mol NaOH tham gia 2 pứ : RCOOH + NaOH → RCOONa + H2O (1) (R'COO)3C3H5 + 3NaOH → 3R'COONa + C3H5(OH)3 (2) 7.10−3 nNaOH (1) = .10000 = 1,25 mol => nNaOH (2) = 34,2 mol 56 34, 2 => mC3H5(OH)3 = . 92 = 1048,8 g 3 Bảo toàn KL: m chất béo + mNaOH = m xà phòng + mC3H5(OH)3 + mH2O <=> 10000 + 35,45.40 = m xà phòng + 1048,8 + 1,25.18 => m xà phòng = 10346,7 g Câu 14: Đáp án: A Ta coi chất béo chứa triglyxerit (RCOO)3C3H5 và axit béo tự do R'COOH (RCOO)3C3H5 + 3KOH → 3RCOOK + C3H5(OH)3 (1) R'COOH + KOH → R'COOK + H2O (2) mKOH ( mg ) 0, 09.0,1.56.1000 Chỉ số xà phòng hóa = = = 200 mCB ( g ) 2,52 Khi xà phòng hóa hoàn toàn 5,04 g chất béo, nKOH = 0,009.2 = 0,018 mol 0, 53 nC3H5(OH)3 = => nKOH (2) = 3nC3H5(OH)3 92 => nKOH (1) = 0,018 - 3nC3H5(OH)3 0, 53 (0, 018 − 3 ).56.1000 92 Do đó, chỉ số axit là: =8 5, 04 Câu 15: Đáp án: A Giả sử có 100 g chất béo => m(C17H35COO)3C3H5 = 89g => n tristeanin = 0,1 mol (C17H35COO)3C3H5 + 3KOH → 3C17H35COOK + C3H5(OH)3 => nKOH = 0,3 mol 0,3,.56.1000 => chỉ số este = = 168 100 Câu 16: Đáp án: A Giả sử axit béo tự do có công thức RCOOH RCOOH + NaOH → RCOONa + H2O (1) (C17H33COO)3C3H5 + 3NaOH → 3C17H33COONa + C3H5(OH)3 (2) Để cho tiện, ta coi tất cả các đơn vị đã cho là gam (thay vì kg) 4,939 4,939 nNaOH = ; gọi nNaOH (1) = x => nNaOH (2) = - x (mol) 40 40 1 Suy ra:nH2O = x mol; nC3H5(OH)3 = nNaOH (2) 3

N

7.10−3 .100 56

G

+) Trung hòa axit béo tự do: nKOH =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

92 4, 939 ( − x) 3 40 => x = 4,31.10-3 mol => nKOH = nNaOH (1) = 4,31.10-3 mol 241, 36 = 6,896 ≈ 7 => mKOH = 241,36 mg => chỉ số axit = 35 Câu 17: Đáp án: C Giả sử trong 100g chất béo có x mol C17H35COOH và y mol (C17H35COO)3C3H5 C17H35COOH + NaOH → C17H35COONa + H2O (C17H35COO)3C3H5 + 3NaOH → 3C17H35COONa + C3H5(OH)3 284 x + 890 y = 100  x = 0, 01  =>  <=>  189, 003.10−3 .100  y = 0,1092 x + 3y = 56  => nNaOH = 0,01 mol 0, 01 => V = = 0,2 lít = 200 ml 0, 05 Câu 18: Đáp án: A Coi rằng chất béo chứa RCOOH và (R'COO)3C3H5 RCOOH + NaOH → RCOONa + H2O (1) (R'COO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3 (2) Gọi lượng NaOH phản ứng là x mol 7.10 −3 .200 = 0, 025 mol nNaOH (1) = 56 x − 0, 025 => nNaOH (2) = x - 0,025 => nC3H5(OH)3 = 3 x − 0, 025 Bảo toàn khối lượng => 200 + 40x = 207,55 + . 92 + 0,025.18 3 => x = 0,775 mol => mNaOH = 31 g Câu 19: Đáp án: A KOH + RCOOH → RCOOK + H2O (1) 3KOH + (R'COO)3C3H5 → 3R'COOK + C3H5(OH)3 (2)

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

Bảo toàn khối lượng, ta có: 35 + 4,939 = 36,207 + x.18 +

Ó

2,8.10−3 .1000 = 0,05 mol 56 => nKOH (2) = 0,35 - 0,05 = 0,3 mol 1 => nC3H5(OH)3 = nKOH (2) = 0,1 mol 3 => mC3H5(OH)3 =9,2 gam Câu 20: Đáp án: C Gọi số mol của triolein, tripanmitin, tristearin lần lượt là 2x; x; 2x Ta có: Triglyxerit + 3NaOH → 3muối + C3H5(OH)3 ntriglyxerit = 2x + x + 2x => nC3H5(OH)3 = 5x Do đó, 5x.92 = 138 => x = 0,3 mol => m = 884.0,6 + 806.0,3 + 890.0,6 = 1306,2 g Câu 21: Đáp án: A Chỉ số I2 là số gam I2 cần để cộng với 100g chất béo 9,91 .100 = 16, 94 => Chỉ số iot là: 58, 5 Câu 22: Đáp án: C Giả sử có 100g chất béo => mC17H33COOH = 4,23 g; mC15H31COOH = 1,6 g;

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

nKOH (1) =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U TP .Q ẠO Đ

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

m(C17H33COO)3C3H5 = 94,17g Để phản ứng hết với 100g chất béo trên cần: nKOH = nC17H33COOH + nC15H31COOH + 3n(C17H33COO)3C3H5 4, 23 1, 6 94,17 = + + 3. = 0,3408 mol 282 256 884 => mKOH = 19,085 g = 19085 mg 19085 => Chỉ số xà phòng hóa là: = 190,85 100 Câu 23: Đáp án: B Xà phòng hóa 1 tấn chất béo cần 1.106 .1, 68 = 0,168.106 g = 0,168T mKOH = 10 Để tiện tính toán, ta coi rằng : Xà phòng hóa 1 g chất béo cần 0,168g KOH (RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3 0,168 nNaOH = nKOH = = 3.10−3 mol 56 => nC3H5(OH)3 = 10-3 mol Bảo toàn khối lượng => 1 + 3.10-3.40 = mRCOONa + 10-3.92 => mRCOONa = 1,028 g 1, 028 => Khối lượng xà phòng 72% là: = 1,428 0, 72 Câu 24: Đáp án: B Gọi độ bất bão hòa của X là k nCO2 − nH 2O b−c => a = ( nX = ) k −1 k −1 Do đó, k - 1 = 4 => k = 5, mà X chứa 3 nối đôi C=O => X có 2 nối đôi C=C => nH2 = 2nX Mà nH2 = 0,3 mol => nX = 0,15 mol Bảo toàn khối lượng : mX = 39 - mH2 = 39 - 0,3.2 = 38,4 g Gọi công thức của X là ( RCOO)3 C3 H 5

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

C

3RCOONa + C3H5(OH)3 + NaOH →   NaOHdu nX = 0,15 mol => nC3H5(OH)3 = 0,15 mol Bảo toàn khối lượng : mX + mNaOH = m chất rắn + mC3H5(OH)3 <=> 38,4 + 0,7.40 = m chất rắn + 0,15.92 => m chất rắn = 52,6 g

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

( RCOO)3 C3 H 5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Hợp chất hữu cơ X có công thức phân tử là C4H8O3. X có khả năng tham gia phản ứng với Na, với dung dịch NaOH và phản ứng tráng bạc. Sản phẩm thủy phân của X trong môi trường kiềm có khả năng hoà tan Cu(OH)2 tạo thành dung dịch màu xanh lam. Công thức cấu tạo của X có thể là A. CH3COOCH2CH2OH. B. HCOOCH2CH(OH)CH3. C. HCOOCH2CH2CH2OH. D. CH3CH(OH)CH(OH)CHO. Câu 2: Hợp chất hữu cơ C4H7O2Cl khi thủy phân trong môi trường kiềm được các sản phẩm trong đó có hai chất có khả năng tráng gương. Công thức cấu tạo đúng là: A. HCOO-CH2-CHCl-CH3 B. CH3COO-CH2Cl C. C2H5COO-CH2-CH3 D. HCOOCHCl-CH2-CH3 Câu 3: X là ancol bậc ba, mạch hở có công thức là C5H10O. Từ X người ta thực hiện sơ đồ biến hóa sau: X C5H10OBr2  C5H9Br3  C5H12O3  Y(C8H12O6). Hãy cho biết trong các chất sau : Na, Ag2O/ NH3, t0 ; Cu(OH)2/ dd NaOH,t0 ; NaOH t0 ; CH3COOH (xt H2SO4 đặc, t0) ; CH3OH (xt H2SO4 đặc, t0 ) ; NaHCO3 . Chất Y tác dụng được với bao nhiêu chất ? A. 6 B. 3 C. 4 D. 5 Câu 4: Cho các chất sau : CH3-COOCH=CH2 ; CH2=CH-Cl ; CH3-CHCl2 ; (CH3COO)2CH-CH3 ; CH3CCl3 ; CH3COOCH=CH-CH3. Hãy cho biết có bao nhiêu chất khi đun nóng với dung dịch NaOH thu được muối và anđehit ? A. 5 B. 6 C. 4 D. 3 Câu 5: Cho 2 chất X và Y có công thức phân tử là C4H7ClO2 thoả mãn : X + NaOH muối hữu cơ X1 + C2H5OH + NaCl. Y+ NaOH muối hữu cơ Y1 + C2H4(OH)2 + NaCl. X và Y là A. CH2ClCOOC2H5 và HCOOCH2CH2CH2Cl. B. CH3COOCHClCH3 và CH2ClCOOCH2CH3. C. CH2ClCOOC2H5 và CH3COOCH2CH2Cl. D. CH3COOC2H4Cl và CH2ClCOOCH2CH3.

N

Este và các hợp chất khác

o

o

CaO ,t Y + 2NaOH  → T + 2Na2CO3

BỒ

o

t CH3CHO + 2Cu(OH)2 + NaOH  →Z +…

ID Ư

Ỡ N

G

t Câu 6: Cho các phản ứng: X + 3NaOH  → C6H5ONa + Y + CH3CHO + H2O

o

CaO ,t Z + NaOH  → T + Na2CO3 Công thức phân tử của X là A. C12H20O6 B. C12H14O4 C. C11H10O4 D. C11H12O4 Câu 7: Cho sơ đồ biến hóa sau:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

o

xt ,t CH3COOH + CH≡CH  → A trunghop → B nA 

+ NaOH B → C+D

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

o

CaO ,t C + NaOH  → E+F Các chất A và C có thể là: A. CH3COOCH=CH2 và C2H5COONa B. CH2=CHCOOCH3 và CH3COONa C. CH2=CHCOOCH3 và C2H5COONa D. CH3COOCH=CH2 và CH3COONa Câu 8: Hợp chất hữu cơ X tác dụng được với dung dịch NaOH đun nóng và với dung dịch AgNO3 trong NH3. Thể tích của 3,7 gam hơi chất X bằng thể tích của 1,6 gam khí O2 (cùng điều kiện về nhiệt độ và áp suất). Khi đốt cháy hoàn toàn 1 gam X thì thể tích khí CO2 thu được vượt quá 0,7 lít (ở đktc). Công thức cấu tạo của X là A. CH3COOCH3 B. O=CH-CH2-CH2OH C. HOOC-CHO D. HCOOC2H5 Câu 9: X và Y là hai hợp chất hữu cơ đồng phân của nhau cùng có công thức phân tử C5H6O4Cl2.Thủy phân hoàn toàn X trong NaOH dư thu được hỗn hợp các sản phẩm trong đó có 2 muối hữu cơ và 1 ancol .Thủy phân hoàn toàn Y trong KOH dư thu được hỗn hợp các sản phẩm trong đó có 1 muối hữu cơ và 1 anđehit. X và Y lần lượt có công thức cấu tạo là A. HCOOCH2COOCH2CHCl2 và CH3COOCH2COOCHCl2. B. CH3COOCCl2COOCH3 và CH2ClCOOCH2COOCH2Cl. C. HCOOCH2COOCCl2CH3 và CH3COOCH2COOCHCl2. D. CH3COOCH2COOCHCl2 và CH2ClCOOCHClCOOCH3. Câu 10: Thủy phân este A bằng dung dịch NaOH thu được muối B và chất D. Biết: - B tác dụng với dung dịch AgNO3/NH3 thu được Ag kết tủa và dung dịch X. Cho dung dịch X tác dụng với dung dịch H2SO4 loãng thu được khí CO2. o

Ó

A

+ HCl Ni ,t → F - D có công thức (CH2O)n. Biết D  → E  + H2

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

- F có công thức (CH2Cl)n. Công thức cấu tạo của A, B, D, E, F lần lượt là: A. HCOOCH=CH2, HCOONa, CH3CHO, C2H5OH, C2H5Cl B. HCOOCH2CHO, HCOONa, HOCH2CHO, HO(CH2)2OH, Cl(CH2)2Cl C. CH3COOCH=CH2, CH3COONa, CH3CHO, C2H5OH, C2H5Cl D. Cả A, B, C đều đúng Câu 11: ĐHA -2011: Cho axit salixylic (axit o-hiđroxibenzoic) phản ứng với anhiđrit axetic, thu được axit axetylsalixylic (o-CH3COO-C6H4-COOH) dùng làm thuốc cảm (aspirin). Để phản ứng hoàn toàn với 43,2 gam axit axetylsalixylic cần vừa đủ V lít dung dịch KOH 1M. Giá trị của V là A. 0,72 B. 0,48. C. 0,96. D. 0,24. Câu 12: Đốt cháy 1,6 gam một este X đơn chức thu được 3,52 gam CO2 và 1,152 gam H2O. Cho 10 gam X tác dụng với dung dịch NaOH (vừa đủ), cô cạn dung dịch sau phản ứng thu được 14 gam muối khan Y. Cho Y tác dụng với axit vô cơ loãng thu được Z không phân nhánh. Công thức cấu tạo của Z là A. CH3(CH2)3COOH. B. CH2 = CH(CH2)2COOH.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. HO(CH2)4COOH. D. HO(CH2)4OH. Câu 13: Xà phòng hóa 2,76 gam một este X bằng dung dịch NaOH vừa đủ, thu được 4,44 gam hỗn hợp hai muối của natri. Nung nóng hai muối này trong oxi dư, sau khi phản ứng hoàn toàn, thu được 3,18 gam Na2CO3, 2,464 lít khí CO2 ( ở đktc) và 0,9 gam nước.Công thức đơn giản cũng là công thức phân tử của X. Vậy CTCT thu gọn của X là: A. HCOOC6H5. B. CH3COOC6H5 C. HCOOC6H4OH. D. C6H5COOCH3 Câu 14: Chất hữu cơ X mạch hở, phân nhánh có chứa C, H, Br. MX = 135. Thủy phân X trong dung dịch NaOH đun nóng thu được anđehit Y. Vậy công thức cấu tạo của X là: A. CH2=C(CH3)-CHBr2 B. CH2=C(CH3)-CH=CH-Br C. Br-CH=C(CH3)2 D. Br2CH-CH=C(CH3)2 Câu 15: Cho sơ đồ phản ứng sau: C4H6O2Cl2 + dd NaOH dư(t0) muối của axit X (đơn chức) + H2O + NaCl. CTCT của muối là: A. CH3COONa B. HCOONa C. HO-CH2-COONa D. C2H3COONa. Câu 16: Cho sơ đồ sau : C4H7ClO2 + NaOH muối X + Y + NaCl. Biết rằng cả X, Y đều tác dụng với Cu(OH)2 . Vậy công thức cấu tạo của chất có công thức phân tử C4H7ClO2 là : A. Cl-CH2-COOCH=CH2 B. CH3COO-CHCl-CH3 C. HCOOCH2-CH2-CH2Cl D. HCOO-CH2-CHCl-CH3 Câu 17: Đốt cháy hoàn toàn 2,76 gam hỗn hợp X gồm CxHyCOOH, CxHyCOOCH3, CH3OH thu được 2,688 lít CO2 (đktc) và 1,8 gam H2O. Mặt khác, cho 2,76 gam X phản ứng vừa đủ với 30 ml dung dịch NaOH 1M, thu được 0,96 gam CH3OH. Công thức của CxHyCOOH là A. C2H5COOH. B. CH3COOH. C. C3H5COOH. D. C2H3COOH. Câu 18: Hỗn hợp X gồm axit axetic, etyl axetat và metyl axetat. Cho m gam hỗn hợp X tác dụng vừa đủ với 200 ml dung dịch NaOH 1M. Mặt khác, đốt cháy hoàn toàn m gam hỗn hợp X cần V lít O2(đktc) sau đó cho toàn bộ sản phẩm cháy vào dung dịch NaOH dư thấy khối lượng dung dịch tăng 40,3 gam. Xác định V? A. 19,04 lít B. 17,36 lít C. 19,60 lít D. 15,12 lít Câu 19: Đun nóng 14,8 gam hỗn hợp X gồm (CH3COOCH3, HCOOC2H5, C2H5COOH) trong 100,0 ml dung dịch chứa NaOH 1,0M và KOH aM (phản ứng vừa đủ) thì thu được 4,68 gam hỗn hợp hai ancol (tỷ lệ mol 1 : 1) và m gam muối. Vậy giá trị m là: A. 18,28 gam B. 16,72 gam C. 14,96 gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 19,72 gam Câu 20: Chất hữu cơ X có công thức phân tử là C5H-8O2. Cho X tác dụng với dung dịch Br2 thu được chất hữu cơ Y có công thức là C5H8O2Br2. Đun nóng Y trong NaOH dư thu được glixerol, NaBr và muối cacboxylat của axit Z. Vậy công thức cấu tạo của X là : A. CH3COOCH2-CH=CH2 B. CH3-COOCH=CH-CH3 C. CH2=CH-COOCH2CH3 D. HCOOCH(CH3)-CH=CH2 Câu 21: Hỗn hợp M gồm axit cacboxylic X, ancol Y (đều đơn chức, số mol X gấp hai lần số mol Y) và este Z được tạo ra từ X và Y. Cho một lượng M tác dụng vừa đủ với dung dịch chứa 0,2 mol NaOH, tạo ra 16,4 gam muối và 8,05 gam ancol. Công thức của X và Y là A. HCOOH và CH3OH. B. HCOOH và C3H7OH. C. CH3COOH và CH3OH. D. CH3COOH và C2H5OH. Câu 22: Cho m gam hỗn hợp gồm hai chất hữu cơ đơn chức, mạch hở tác dụng vừa đủ với dung dịch chứa 11,2 gam KOH, thu được muối của một axit cacboxylic và một ancol X. Cho toàn bộ X tác dụng hết với Na thu được 3,36 lít khí H2 (ở đktc). Hai chất hữu cơ đó là A. một este và một axit. B. hai axit. C. hai este. D. một este và một ancol. Câu 23: Cho hỗn hợp X gồm hai hợp chất hữu cơ no, đơn chức tác dụng vừa đủ với 100 ml dung dịch KOH 0,4M, thu được một muối và 336 ml hơi một ancol (ở đktc). Nếu đốt cháy hoàn toàn lượng hỗn hợp X trên, sau đó hấp thụ hết sản phẩm cháy vào bình đựng dung dịch Ca(OH)2 (dư) thì khối lượng bình tăng 6,82 gam. Công thức của hai hợp chất hữu cơ trong X là A. HCOOH và HCOOC2H5 B. CH3COOH và CH3COOC2H5 C. C2H5COOH và C2H5COOCH3 D. HCOOH và HCOOC3H7 Câu 24: Một hỗn hợp X gồm 2 chất hữu cơ đơn chức. Cho X phản ứng vừa đủ với 500ml dung dịch KOH 1M. Sau phản ứng thu được hỗn hợp Y gồm 2 muối của hai axit cacboxylic và một ancol. Cho toàn bộ lượng ancol thu được ở trên tác dụng với Na dư, sinh ra 3,36 lit H2( đktc). Hỗn hợp X gồm: A. một axit và một este B. một este và một ancol C. hai este D. một axit và một ancol Câu 25: Cho hỗn hợp M gồm 2 hợp chất hữu cơ mạch thẳng X, Y (chỉ chứa C, H, O) tác dụng vừa đủ với 8 gam NaOH thu được một rượu đơn chức và hai muối của hai axit hữu cơ đơn chức kế tiếp nhau trong dãy đồng đẳng. Lượng rượu thu được cho tác dụng với Na dư tạo ra 2,24 lít khí (đktc). X, Y thuộc loại hợp chất gì? A. axit B. 1 axit và 1 este C. 2 este D. 1 rượu và 1 axit Câu 26: Cho hỗn hợp M gồm 2 chất hữu cơ no, đơn chức chứa các nguyên tố C, H, O tác dụng vừa đủ với 20ml dung dịch NaOH 2M thu được 1 muối và một rượu. Đun nóng lượng rượu thu được ở trên với H2SO4

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

đặc ở 1700C tạo ra 369,6ml olefin khí ở 27,30C và 1atm. Nếu đốt cháy hoàn toàn lượng hỗn hợp M trên rồi cho sản phẩm qua bình đựng CaO dư thì khối lượng bình tăng 7,75 gam. Hãy chọn câu trả lời đúng? A. 1 este và 1 axit có gốc hiđrocacbon giống gốc axit trong este. B. 1 axit và 1 rượu C. 1 este và 1 rượu có gốc hiđrocacbon giống gốc rượu trong este. D. Cả A, B, C đều đúng. Câu 27: Hỗn hợp X gồm 2 chất hữu cơ đơn chức. Để tác dụng với 0,1 mol hỗn hợp X cần 0,1 mol NaOH thu được dung dịch chứa 2 muối và một ancol. Tách lấy toàn bộ lượng ancol rồi cho phản ứng với Na dư thu được 1,12 lít H2 (đktc). Hãy cho biết kết luận nào sau đây đúng ? A. X gồm 1 axit và 1 este. B. X gồm 2 este C. X gồm một axit và một ancol. D. X gồm 1 este và một ancol. Câu 28: Cho hỗn hợp X gồm hai chất hữu cơ tác dụng vừa đủ với 50ml dung dịch NaOH 0,4M, thu được một muối và 168 ml hơi một ancol(đktc). Mặt khác đốt cháy hoàn toàn hỗn hợp trên, rồi hấp thụ hết sản phẩm cháy vào bình đựng dung dịch Ba(OH)2 dư, khối lượng bình tăng 3,41 gam. Công thức của hai chất hữu cơ trong X là A. CH3COOH và CH3COOC2H5 B. C2H5COOH và C2H5COOCH3 C. HCOOH và HCOOC2H5 D. HCOOH và HCOOC3H7 Câu 29: Cho X, Y là hai chất thuộc dãy đồng đẳng của axit acrylic và MX < MY; Z là ancol có cùng số nguyên tử cacbon với X; T là este hai chức tạo bởi X, Y và Z. Đốt cháy hoàn toàn 11,16 gam hỗn hợp E gồm X, Y, Z, T cần vừa đủ 13,216 lít khí O2(đktc) , thu được khí CO2 và 9,36 gam nước. Mặt khác 11,16 gam E tác dụng tối đa với dung dịch chứa 0,04 mol Br2. Khối lượng muối thu được khi cho cùng lượng E trên tác dụng với KOH dư là : A. 5,44 gam B. 5,04 gam C. 5,80 gam D. 4,68 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

-L

Í-

Câu 1: Đáp án: B X có thể là HCOOCH2CH(OH)CH3

1 H2 2 +) Tác dụng với NaOH : HCOOCH2CH(OH)CH3 + NaOH HCOONa + CH2OHCHOHCH3 +) X chứa nhóm HCOO- nên có khả năng tráng bạc +) Ancol CH2OHCHOHCH3 có 2 nhóm -OH kề => Hòa tan Cu(OH)2/ NaOH Câu 2: Đáp án: D HCOOCHCl-CH2-CH3 + 2NaOH  HCOONa + CH3CH2CHO + NaCl Cả HCOONa và CH3CH2CHO đều có khả năng tráng gương Câu 3: Đáp án: B Ancol bậc 3 có CTCT C5H10O => X là CH2=CH-C(CH3)2OH Dãy chuyển hóa: Br2 → CH2Br - CHBr - C(CH3)2OH CH2=CH-C(CH3)2OH  + HBr + NaOH / H 2O → CH2Br - CHBr - C(CH3)2Br  → HOCH2 - CH(OH)C(CH3)2OH LO  HCOOH  → HCOO-CH2 - CH(OOCH)- C(CH3)2COOH (Y) => Y tác dụng được với Ag2O/NH3 ; Cu(OH)2/NaOH ; NaOH Câu 4: Đáp án: C

BỒ

ID Ư

Ỡ N

G

TO

ÁN

+) Tác dung với Na: HCOOCH2CH(OH)CH3 + Na  HCOOCH2CH(ONa)CH3 +

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

U

Y

N

H Ơ

N

Các chất thỏa mãn là: +) CH3-COOCH=CH2 ; tạo CH3COONa và CH3CHO +) CH3-CHCl2 , tạo CH3CHO và NaCl +) (CH3COO)2CH-CH3 , tạo CH3COONa và CH3CHO +) CH3COOCH=CH-CH3 , tạo CH3COONa và CH3CH2CHO Câu 5: Đáp án: C X, Y sẽ là CH2ClCOOC2H5 và CH3COOCH2-CH2Cl CH2ClCOOC2H5 + 2NaOH  HO-CH2-COONa + C2H5OH + NaCl CH3COOCH2-CH2Cl + 2NaCl CH3COONa + C2H4(OH)2 + NaCl Câu 6: Đáp án: C Ta viết ngược từ cuối :

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

o

CaO ,t → CH4 (T) + Na2CO3 CH3COONa + NaOH  Y sẽ là NaOOC-CH2-COONa , vì Y tác dụng với 2NaOH tạo CH4 Từ đó suy ra: X + 3NaOH C6H5ONa + CH2(COONa)2 + CH3CHO + H2O Cân bằng nguyên tố 2 vế, ta được X là C11H10O4 Câu 7: Đáp án: D CH3COOH + CH≡CH  CH3COOCH=CH2 trunghop → (- CH(OOCCH3) - CH2 -)n n CH3COOCH=CH2  + nNaOH → (-CH(OH)-CH2-)n + n CH3COONa (-CH(OOCCH3)-CH2-)n  Vậy, A là CH3COOCH=CH2 ; C là CH3COONa Câu 8: Đáp án: D 1, 6 Theo đề bài, 3,7g X ứng với = 0,05 mol => MX = 74 32 0, 7 1 Gọi số cacbon của X là n => n. > => n > 2,3125 74 22, 4 Kết hợp với các phương án lựa chọn => X là HCOOCH2CH3

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

(Thỏa mãn có phản ứng tráng gương và phản ứng với NaOH) Câu 9: Đáp án: B X, Y là CH3COOCCl2COOCH3 và CH2ClCOOCH2COOCH2Cl +) Thủy phân X: CH3COOCCl2COOCH3 + 5NaOH  CH3COONa + NaOOC - COONa + CH3OH + 2NaCl +) Thủy phân Y: CH2ClCOOCH2COOCH2Cl + 3NaOH  2 HO-CH2COONa + HCHO + NaCl Câu 10: Đáp án: B Ta thấy phương án B thỏa mãn: HCOOCH2CHO + NaOH  HCOONa + HO-CH2-CHO (A) (B) (D) HCOONa + 2AgNO3 + 3NH3 + H2O  2Ag + NaNO3 + (NH4)2CO3 (X) + NH4NO3 o

TO

+ HCl Ni ,t → HO-CH2-CH2-OH  → CH2Cl-CH2Cl HO-CH2-CHO  + H2

BỒ

ID Ư

Ỡ N

G

(D) (E) (F) Câu 11: Đáp án: A Khi cho axit axetyl salixylic phản ứng với KOH: CH3COO - C6H4 - COOH + 3KOH  KO-C6H4 - COOK + CH3COOK + 2H2O => nKOH = 3. = 0,72 mol => V = 0,72 lít Câu 12: Đáp án: C nCO2 = 0,08 mol ; nH2O = 0,064 mol Bảo toàn khối lượng => mO (trong X) = 1,6 - 0,08.12 - 0,064.2 = 0,512 g => nO = 0,032 mol Mà X đơn chức => nX = 0,016 mol => công thức X là : C5H8O2 10 g X ứng với nX = 0,1 mol => nNaOH = 0,1 mol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO Đ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Ta thấy mY = mX + mNaOH => X là este nội phân tử => Z chứa nhóm -OH và -COOH . Mà Z không phân nhánh => Z là HO-(CH2)4-COOH Câu 13: Đáp án: C X + NaOH  muối ; Muối + O2  Na2CO3 + CO2 + H2O 2,76 g 4,44g 0,03 mol 0,11 mol 0,05 mol Giả sử X tạo bởi x mol C, y mol H , z mol O => 12x + y + 16z = 2,76 Bảo toàn nguyên tố C => x = 0,11 + 0,03 = 0,14 nNa2CO3 = 0,03 => nNaOH = 0,06 => X + NaOH sinh ra H2O (bên cạnh muối) Vì mX + mNaOH = 2,76 + 0,06.40 = 5,16 = 4,44 + 0,72 => mH2O = 0,72 => nH2O = 0,04 Bảo toàn nguyên tố H => y = (0,04 + 0,05).2 - 0,06 = 0,12 mol 2, 76 − 0,14 − 0,12.1 => z = = 0,06 16 => x : y : z = 7 : 6 : 3 => X là C7H6O3 Câu 14: Đáp án: C MX = 135 => X là C4H7Br Theo các phương án đã cho => X là Br - CH = CH(CH3)2 Br - CH = CH(CH3)2 + NaOH  (CH3)2 - CH2 - CHO + NaBr Câu 15: Đáp án: A C4H6O2Cl2 có CTCT là: CH3COOCCl2CH3 CH3OOCCl2CH3 + 4NaOH  2CH3COONa + 2 NaCl + 2H2O Muối là: CH3COONa Câu 16: Đáp án: D Ta thấy: HCOOCH2CHClCH3 + 2NaOH  HCOONa + OH-CH2-CHOHCH3 + H2O Cả HCOONa và CH3CHOHCH2OH đều phản ứng với Cu(OH)2 Câu 17: Đáp án: D Đặt nCxHyCOOH = a ; nCxHyCOOCH3 = b ; nCH3OH = c nCO2 = 0,12 mol ; nH2O = 0,1 mol Bảo toàn khối lượng => mO (trong X) = 2,76 - 0,12.12 - 0,1.2 = 1,12 g 1,12 => nO (trong X) = = 0,07 mol => 2a + 2b + c = 0,07 16 X phản ứng vừa đủ với 0,03 mol NaOH => CxHyCOOH và CxHyCOOCH3 phản ứng => a + b = 0,03 mol nCH3OH = 0,03 mol => b +c = 0,03 Giải hệ phương trình: a = 0,01 ; b = 0,02 ; c = 0,01 Đặt CxHy = R mX = 2,76 => 0,01.(R + 45) + 0,02.(R + 59) + 0,01.32 = 2,76 => R = 27 (C2H3-) Câu 18: Đáp án: B Đặt CT chung của X là CnH2nO2 => Đốt cháy X tạo nCO2 = nH2O Mà mCO2 + mH2O = 40,3 40,3 => nCO2 = nH2O = = 0,65 mol 44 + 18 nNaOH = 0,2 mol => nX = 0,2 => nO(trong X) = 0,4 mol Bảo toàn khối lượng => mX = 0,4.16 + 0,65.(12+2) = 15,5

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO Đ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Câu 19: Đáp án: A Đặt nCH3COOCH3 = x ; nHCOOC2H5 = y ; nC2H5COOH = z 14,8 => x + y + z = = 0,2 (Do 3 chất cùngPTK) 74 4, 68 Mặc khác, nCH3OH = nC2H5OH => x = y = = 0,06 32 + 46 => z = 0,08 nNaOH = 0,1 mol => nKOH = x + y + z - 0,1 = 0,1 mol Bảo toàn khối lượng: mX + mKOH + mNaOH = mmuối + m ancol + mH2O <=> 14,8 + 0,1.(56 + 40) = m + 4,68 + 0,08.18 => m = 18,28 g Câu 20: Đáp án: A X là CH3COOCH2CH=CH2 CH3COOCH2CH=CH2 + Br2  CH3COOCH2 - CHBr - CH2Br CH3COOCH2CHBrCH2Br + 3NaOH  CH3COONa + C3H5(OH)3 + 2NaBr Câu 21: Đáp án: D Gọi X là RCOOH , Y là R'OH => Z là RCOOR' Đặt nX = 2x => nY = x => nZ = y nNaOH = 0,2 => 2x + y = 0,2 16, 4 m muối = 16,4 => nRCOONa = ; mà nRCOONa = nNaOH = 0,2 R + 67 => R =15 (CH3-) 8, 05 8, 05 => x + y = nR'OH = R '+ 17 R '+ 17 8, 05 Rõ ràng +) 2x + y < 2x + 2y => 0,2 < 2. => R' < 63,5 R '+ 17 8, 05 +) x + y < 2x + y => 0,2 > => R' > 23,25 R '+ 17 => R' = 29 (C2H5-) ; 43 (C3H7-) ; 59(C4H9-) Câu 22: Đáp án: D nKOH = 0,2 mol ; nH2 = 0,15 mol Nếu cả 2 chất trong hỗn hợp đầu đều phản ứng với KOH => n ban đầu = 0,2 mol 0, 2 => nH2 = = 0,1 ≠ 0,15 2 => Hỗn hợp đầu chứa ancol (không phản ứng với KOH) => Hỗn hợp chứa 1 este và 1 ancol Câu 23: Đáp án: B nKOH = 0,04 mol ; n ancol = 0,015 mol => X chứa 1 axit cacboxylic và 1 este . Trong đó: n axit = 0,04 - 0,015 = 0,025 mol n este = n ancol = 0,015 mol Gọi CT axit : CnH2n+1COOH , ancol : CmH2m+1OH => Este : CnH2n+1COOCmH2m+1 Khi đốt, thu được nCO2 = nH2O ; mà mCO2 + mH2O = 6,82 g => nCO2 = nH2) = = 0,11 mol => 0,025.( n + 1) + 0,015.(cn + 1 + m) = 0,11 <=> n + 0,015m = 0,07

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn V Mà X + mol O2  CO2 + H2O 22, 4 V .32 = 40,3 => V = 17,36 Bảo toàn khối lượng => 15,5 + 22, 4

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

=> n = 1 ; m = 2 => X chứa CH3COOC2H5 và CH3COOH Câu 24: Đáp án: A nKOH = 0,5 mol ; nH2 = 0,15 mol => n ancol = 0,3 mol => X chứa 1 este và 1 axit cacboxylic (với 2 gốc axit khác nhau) Câu 25: Đáp án: C 8 nNaOH = = 0,2 mol ; nH2 = 0,1 mol => n ancol = 0,2 mol 40 => X, Y là 2 este (cấu tạo từ cùng 1 loại gốc ancol) Câu 26: Đáp án: A PV = 0,015 mol nNaOH = 0,04 mol ; n olein = RT => M chứa 1 este và 1 axit cacboxylic (có gốc hidrocacbon giống gốc axit trong este - vì chỉ tạo thành 1 muối) Câu 27: Đáp án: B nH2 = 0,05 mol => n ancol = 0,1 mol Ta có: 0,1 mol X + 0,1 mol NaOH  0,1 mol ancol + 2 muối => X gồm 2 este với cấu tạo gốc hidrocacbon của axit khác nhau Câu 28: Đáp án: A nNaOH = 0,02 mol , n ancol = 7,5.10-3 mol => X chứa 1 este và 1 axit với n este = 7,5.10-3 mol n axit = 0,02 - 7,5.10-3 = 0,0125 mol Dụa vào 4 đáp án => Axit và ancol đều no, hở, đơn chức. Đặt CT axit là CnH2n+1COOH , CT ancol là CmH2m+1OH => Este là CnH2n+1COOCmH2m+1 Đốt X thu được nCO2 = nH2O mà mCO2 + mH2O = 3,41 => nCO2 = nH2O = = 0,055 => 0,0125.(n +1) + 7,5.10-3.(n + 1 + m) = 0,055 <=> 0,02n + 7,5.10-3.nm = 0,035 => n = 1, m = 2 => X chứa CH3COOH và CH3COOC2H5 Câu 29: Đáp án: D Xét phản ứng đốt cháy E: nO2 = 0,59 mol Bảo toàn khối lượng => mCO2 = 11, 16 + 0,59.32 - 9,36 = 20,68 g => nCO2 = 0,47 mol Mà nH2O = 0,52 > nCO2 => Tồn tại ít nhất 1 chất có độ bão hòa bằng 0 trong E => Z là ancol 2 chức, no. Gọi số mol 2 axit là x, số mol este là y => x + 2y = nBr2 = 0,04 (1) +) Khi đốt 2 axit , vì các axit có k = 2 => nCO2 - nH2O = n axit = x +) Khi đốt este vì este có k = 4 => nCO2 - nH2O = 3 n este = 3y +) Nếu đốt X, Y, T số mol CO2 sẽ lớn hơn H2O là x + 3y Gọi số mol ancol Z là z , đốt Z tạo nH2O - nCO2 = z Vì cuối cùng , khi đốt E, số mol H2O > nCO2 => z - (x + 3y) = 0,52 - 0,47 <=> z - x - 3y = 0,05 (2) Cũng từ phản ứng đốt E, bảo toàn nguyên tố oxi => nO (trong E) = 0,47.2 + 0,52 - 0,59.2 = 0,28 Do đó, 2x + 4y + 2z = 0,28 (3) Từ (1) (2)(3) => x = 0,02 ; y = 0,01 ; z = 0,1 0, 47 => nE = 0,13 mol => C = = 3, 6 0,13 => Tồn tại chất có số C < 3,6 => X phải là CH2=CH-COOH

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

=> Z là C3H6(OH)2 Khi cho E + KOH : +) 0,02 mol axit + KOH  muối + 0,02 mol H2O +) 0,01 mol este + 2KOH  muối + 0,01 mol C3H6(OH)2 +) 0,1 mol ancol C3H6(OH)2 không phản ứng => nKOH = 0,02 + 0,01.2 = 0,04 mol Bảo toàn khối lượng: mE + mKOH = m muối + mH2O + mC3H6(OH)2 <=> 11,16 + 0,04.56 = m muối + 0,02.18 + (0,01 + 0,1).76 => m muối = 4,68 g

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Hỗn hợp este đồng đẳng, đồng phân

H Ơ

N

Câu 1: Hai chất hữu cơ X1 và X2 đều có khối lượng phân tử bằng 60 đvc. X1 có khả năng phản ứng với : Na; NaOH; Na2CO3 . X2 phản ứng với NaOH đun nóng nhưng không phản ứng với Na. Công thức cấu tạo của X1 và X2 lần lượt là:

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

A. CH3COOH; CH3COOCH3 B. (CH3)2CH-OH; HCOOCH3 C. HCOOCH3; CH3COOH D. CH3COOH; HCOOCH3 Câu 2: X là hỗn hợp của hai este đồng phân với nhau. Ở cùng điều kiện nhiệt độ và áp suất, 1 lít hơi X nặng gấp 2 lần 1 lít khí CO2. Xác định CTPT của các este. A. C2H4O2 B. C3H6O2 C. C4H8O2 D. C5H10O2 Câu 3: Hai este đơn chức X và Y là đồng phân của nhau. Khi hoá hơi 1,85 gam X, thu được thể tích hơi đúng bằng thể tích của 0,7 gam N2 ( đo ở cùng điều kiện). Công thức cấu tạo thu gọn của X, Y là:

ẤP

2+

3

10

00

B

A. C2H5COOCH3 và HCOOCH(CH3)2 B. HCOOC2H5 và CH3COOCH3 C. C2H3COOC2H5 và C2H5COOC2H3 D. HCOOCH2CH2CH3 và CH3COOC2H5 Câu 4: Cho 35,2 gam hỗn hợp gồm 2 este no, đơn chức, mạch hở là đồng phân của nhau có tỉ khối hơi đối với H2 bằng 44 tác dụng với 2 lít dung dịch NaOH 0,4 M, rồi cô cạn dung dịch vừa thu được, ta được 44,6 gam chất rắn B. Công thức của 2 este là:

-L

Í-

H

Ó

A

C

A. HCOOC2H5 và CH3COOCH3 B. C2H5COOCH3 và CH3COOC2H5 C. HCOOC3H7 và CH3COOC2H5 D. HCOOC3H7 và CH3COOCH3 Câu 5: Đốt cháy hoàn toàn 3,7g hỗn hợp 2 este đồng phân X và Y ta thu được 3,36 lít khí CO2 (đktc) và 2,7g H2O. X và Y có công thức cấu tạo là:

BỒ

ID Ư

Ỡ N

G

TO

ÁN

A. CH2=CHCOOCH3 và HCOOCH2CH=CH2 B. CH3COOCH3 và HCOOC2H5 C. CH2=CHCOOC2H5 và C2H5COOCH=CH2 D. Kết quả khác. Câu 6: Xà phòng hóa hoàn toàn 66,6 gam hỗn hợp hai este HCOOC2H5 và CH3COOCH3 bằng dung dịch NaOH, thu được hỗn hợp X gồm hai ancol. Đun nóng hỗn hợp X với H-2SO4 đặc ở 1400C, sau khi phản ứng xảy ra hoàn toàn thu được m gam nước. Giá trị của m là A. 18,00. B. 8,10. C. 16,20. D. 4,05. Câu 7: Để xà phòng hoá hoàn toàn 2,22g hỗn hợp 2 este đồng phân X và Y cần dùng hết 30ml dung dịch KOH 1M. Khi đốt cháy hoàn toàn hỗn hợp 2 este đó thì thu được khí CO2 và hơi nước có thể tích bằng nhau và đo ở cùng điều kiện. Công thức phân tử của X, Y là:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. CH3COOCH3 và HCOOC2H5 B. C2H5COOCH3 và CH3COOC2H5 C. C3H7COOCH3 và CH3COOC3H7 D. Kết quả khác. Câu 8: Hỗn hợp Y gồm hai este đơn chức mạch hở là đồng phân của nhau. Cho m gam hỗn hợp Y tác dụng vừa đủ với 100ml dung dịch NaOH 0,5M, thu được một muối của một axit cacboxylic và hỗn hợp hai rượu. Mặt khác đốt cháy hoàn toàn m gam hỗn hợp Y cần dùng 5,6 lít O2 và thu được 4,48 lít CO2 (các thể tích khí đo ở điều kiện tiêu chuẩn). Công thức cấu tạo của 2 este trong hỗn hợp Y là: A. CH3COOCH3 và HCOOC2H5 B. C2H5COOCH3 và HCOOCH3 C. CH3COOCH3 và CH3COOC2H5 D. HCOOCH2CH2CH3 và HCOO-CH(CH3)2 Câu 9: Xà phòng hóa hoàn toàn 22,2 gam hỗn hợp gồm hai este HCOOC2H5 và CH3COOCH3 bằng dung dịch NaOH 1 M đun nóng. Tính thể tích dung dịch NaOH tối thiểu cần dùng.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

A. 200 ml B. 300 ml C. 400 ml D. 250 ml Câu 10: Hỗn hợp A gồm ba chất hữu cơ X, Y, Z đơn chức đồng phân của nhau, đều tác dụng được với NaOH. Đun nóng 13,875 gam hỗn hợp A với dung dịch NaOH vừa đủ thu được 15,375 gam hỗn hợp muối và hỗn hợp ancol có tỉ khối hơi so với H2 bằng 20,67. Ở 136,50C, 1 atm thể tích hơi của 4,625 gam X bằng 2,1 lít. Phần trăm khối lượng của X, Y, Z (theo thứ tự KLPT gốc axit tăng dần) lần lượt là:

-L

Í-

H

Ó

A

C

ẤP

2+

3

A. 40%; 40%; 20% B. 40%; 20%; 40% C. 25%; 50%; 25% D. 20%; 40%; 40% Câu 11: Hỗn hợp A gồm 2 este ta đồng phân của nhau và đều tạo thành từ các axit đơn chức và ancol đơn chức khác nhau. Cho 2,2 gam hỗn hợp A bay hơi ở 136,50C và 1 atm thì thu được 840 ml este. Mặt khác đem thủy phân hoàn toàn 26,4 gam hỗn hợp A bằng dung dịch NaOH vừa đủ rồi đem cô cạn thì thu được 21,8 gam chất rắn khan. Công thức cấu tạo 2 este là:

BỒ

ID Ư

Ỡ N

G

TO

ÁN

A. HCOOC3H7 và CH3COOC2H5 B. HCOOC3H7 và C2H5COOCH3 C. HCOOC4H9 và CH3COOC3H7 D. A và B đều đúng Câu 12: Để xà phòng hoá hoàn toàn 52,8 gam hỗn hợp hai este no, đơn chức , mạch hở là đồng phân của nhau cần vừa đủ 600 ml dung dịch KOH 1M. Biết cả hai este này đều không tham gia phản ứng tráng bạc. Công thức của hai este là A. CH3COOC2H5 và HCOOC3H7 B. C2H5COOC2H5 và C3H7COOCH3 C. HCOOC4H9 và CH3COOC3H7 D. C2H5COOCH3 và CH3COOC2H5 Câu 13: Làm bay hơi 5,98 gam hỗn hợp 2 este của axit axetic và 2 ancol là đồng đẳng kế tiếp của metanol. Nó chiếm thể tích 1,344 lít (đktc). Công thức cấu tạo của 2 este đó là A. HCOOC2H5 và HCOOC3H7

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

B. CH3COOCH3 và CH3COOC2H5 C. CH3COOC2H5 và CH3COOC3H7 D. CH3COOCH3 và CH3COOC2H5 Câu 14: Xà phòng hóa hoàn toàn 9,7 gam hỗn hợp hai este đơn chức X, Y cần 150 ml dung dịch KOH 1M. Sau phản ứng cô cạn dung dịch thu được hỗn hợp hai ancol đồng đẳng kế tiếp và một muối duy nhất. Công thức cấu tạo thu gọn của X, Y lần lượt là

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

A. HCOOCH3, HCOOC2H5. B. C2H5COOCH3, C2H5COOC2H5. C. CH3COOCH3, CH3COOC2H5 D. C2H3COOCH3, C2H3COOC2H5. Câu 15: Để phản ứng hết với một lượng hỗn hợp gồm hai chất hữu cơ đơn chức X và Y (Mx < MY) cần vừa đủ 300 ml dung dịch NaOH 1M. Sau khi phản ứng xảy ra hoàn toàn thu được 24,6 gam muối của một axit hữu cơ và m gam một ancol. Đốt cháy hoàn toàn lượng ancol trên thu được 4,48 lít CO2 (đktc) và 5,4 gam H2O. Công thức của Y là : A. CH3COOC2H5 B. CH3COOCH3 C. CH2=CHCOOCH3 D. C2H5COOC2H5 Câu 16: Thủy phân hoàn toàn hỗn hợp X gồm 2 este đơn chức A, B cần dùng 100 ml dung dịch NaOH 1M thu được 6,8 gam muối duy nhất và 4,04 gam hỗn hợp 2 ancol là đồng đẳng liên tiếp nhau. Công thức cấu tạo của 2 este là:

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

A. HCOOCH3 và HCOOC2H5B. CH3COOCH3 và CH3COOC2H5 C. C2H3COOCH3 và C2H3COOC2H5 D. HCOOC-2H5 và HCOOC3H7 Câu 17: Hỗn hợp Z gồm hai este X và Y tạo bởi cùng một ancol và hai axit cacboxylic kế tiếp nhau trong dãy đồng đẳng (MX < MY). Đốt cháy hoàn toàn m gam Z cần dùng 6,16 lít khí O2 (đktc), thu được 5,6 lít khí CO2 (đktc) và 4,5 gam H2O. Công thức este X và giá trị của m tương ứng là A. HCOOCH3 và 6,7. B. CH3COOCH3 và 6,7. C. HCOOC2H5 và 9,5. D. (HCOO)2C2H4 và 6,6. Câu 18: Hỗn hợp X gồm hai este no, đơn chức, mạch hở. Đốt cháy hoàn toàn một lượng X cần dùng vừa đủ 3,976 lít khí O2 (ở đktc), thu được 6,38 gam CO2. Mặt khác, X tác dụng với dung dịch NaOH, thu được một muối và hai ancol là đồng đẳng kế tiếp. Công thức phân tử của hai este trong X là . A. C3H6O2 và C4H8O2. B. C2H4O2 và C5H10O2. C. C3H4O2 và C4H6O2. D. C2H4O2 và C3H6O2 Câu 19: Đốt cháy hoàn toàn một lượng hỗn hợp hai este cơ đơn chức no, mạch hở cần 3,976 lít oxi (đo ở điều kiện tiêu chuẩn) thu được 6,38 g CO2. Cho lượng este này tác dụng vừa đủ với KOH thu được hỗn hợp hai rượu kế tiếp và 3,92 g muối của một axit hữu cơ. Công thức cấu tạo của hai chất hữu cơ trong hỗn hợp đầu là: A. HCOOCH3 và C2H5COOCH3 B. CH3COOC3H7 và CH3COOC4H9

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

H Ơ

C. CH3COOCH3 và CH3COOC2H5 D. CH3COOC2H5 và CH3COOC3H7 Câu 20: Hỗn hợp E gồm hai chất hữu cơ A, B có cùng chức hóa học. Đun nóng hỗn hợp E với dung dịch NaOH dư thu được sản phẩm gồm một muối duy nhất của một axit đơn chức, không no và hỗn hợp hai rượu đơn chức, no kế tiếp nhau trong dãy đồng đẳng. Đốt cháy hoàn toàn 27,2 gam hỗn hợp E phải dùng hết 33,6 lít khí oxi thu được 29,12 lít khí CO2 và hơi nước (các khí đo ở cùng điều kiện tiêu chuẩn). CTPT của A, B có thể là:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

A. C3H4O2 và C4H6O2 B. C2H2O2 và C3H4O2 C. C4H6O2 và C5H8O2 D. C4H8O2 và C5H10O2 Câu 21: Xà phòng hóa hoàn toàn 1,99 gam hỗn hợp hai este bằng dung dịch NaOH thu được 2,05 gam muối của một axit cacboxylic và 0,94 gam hỗn hợp hai ancol là đồng đẳng kế tiếp nhau. Công thức của hai este đó là: A. HCOOCH3 và HCOOC2H5. B. C2H5COOCH3 và C2H5COOC2H5. C. CH3COOC2H5 và CH3COOC3H7. D. CH3COOCH3 và CH3COOC2H5. Câu 22: Thuỷ phân hoàn toàn hỗn hợp gồm hai este đơn chức X, Y là đồng phân cấu tạo của nhau cần 100 ml dung dịch NaOH 1M, thu được 7,85 gam hỗn hợp hai muối của 2 axit là đồng đẳng kế tiếp và 4,95 gam hai ancol bậc I. CTCT và phần trăm khối lượng của 2 este là

Ó

A

C

ẤP

2+

3

10

A. HCOOC2H5 : 55% và CH3COOCH3 : 45%. B. HCOOC2H5 : 45% và CH3COOCH3 : 55%. C. HCOOCH2CH2CH3:25% và CH3COOC2H5:75% D. HCOOCH2CH2CH3 75% và CH3COOC2H5: 25%. Câu 23: Thủy phân hoàn toàn hỗn hợp X gồm 2 este đơn chức cần dùng 100 ml dung dịch NaOH 1M thu được 8,2 gam muối duy nhất và 4,04 gam hỗn hợp 2 ancol là đồng đẳng liên tiếp nhau. Công thức cấu tạo của 2 este là:

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

A. HCOOCH3 và HCOOC2H5 B. CH3COOCH3 và CH3COOC2H5 C. C2H3COOCH3 và C2H3COOC2H5 D. HCOOC-2H5 và HCOOC3H7 Câu 24: Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai este đồng phân cần dùng 27,44 lít khí O2, thu được 23,52 lít khí CO2 và 18,9 gam H2O. Nếu cho m gam X tác dụng hết với 400 ml dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng thì thu được 27,9 gam chất rắn khan, trong đó có a mol muối Y và b mol muối Z (My < Mz). Các thể tích khí đều đo ở điều kiện tiêu chuẩn. Tỉ lệ a : b là A. 2 : 3 B. 4 : 3 C. 3 : 2 D. 3 : 5 Câu 25: Xà phòng hóa hoàn toàn 9,7 gam hỗn hợp hai este đơn chức X, Y cần 150 ml dung dịch KOH 1M. Sau phản ứng cô cạn dung dịch thu được hỗn hợp hai ancol đồng đẳng kế tiếp và một muối duy nhất. Công thức cấu tạo thu gọn của X, Y lần lượt là A. HCOOCH3, HCOOC2H5.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. C2H5COOCH3, C2H5COOC2H5. C. CH3COOCH3, CH3COOC2H5 D. C2H3COOCH3, C2H3COOC2H5. Câu 26: Một hỗn hợp A gồm 2 este đơn chức X, Y (MX < My). Đun nóng 12,5 gam hỗn hợp A với một lượng dung dịch NaOH vừa đủ thu được 7,6 gam hỗn hợp ancol no B, đơn chức có khối lượng phân tử hơn kém nhau 14 đvC và hỗn hợp hai muối Z. Đốt cháy 7,6 gam B thu được 7,84 lít khí CO2 (đktc) và 9 gam H2O. Phần trăm khối lượng của X, Y trong hỗn hợp A lần lượt là: A. 59,2%; 40,8% B. 50%; 50% C. 40,8%; 59,2% D. 66,67%; 33,33% Câu 27: Hỗn hợp X gồm 2 chất A, B mạch hở (MA < MB) , đều chứa các nguyên tố C, H, O và đều không tác dụng Na. Cho 10,7g hh X tác dụng vừa đủ NaOH rồi cô cạn sản phẩm thu được phần rắn gồm 2 muối natri của 2 axít đơn chức no đồng đẳng liên tiếp và phần hơi bay ra chỉ có một rượu E duy nhất. Cho E tác dụng với Na dư thu được 1,12lít H2 (đktc). Oxi hoá E bằng CuO đun nóng và cho sản phẩm có thể tham gia phản ứng tráng gương .Biết dE/KK = 2. CTCT A, B là A. CH3COOCH2-CH=CH2, C2H5COOCH2-CH=CH2 B. CH3COOCH=CH2, C2H5COOCH=CH2 C. CH3COOCH=CH-CH3, C2H5COOCH=CH-CH D. HCOOCH2-CH=CH2, CH3COOCH2-CH=CH2 Câu 28: Một hỗn hợp X gồm 2 este đơn chức thủy phân hoàn toàn trong môi trường NaOH dư cho hỗn hợp Y gồm 2 rượu đồng đẳng liên tiếp và hỗn hợp muối Z - Đốt cháy hỗn hợp Y thì thu được CO2 và hơi H2O theo tỉ lệ thể tích 7:10 - Cho hỗn hợp Z tác dụng với lượng vừa đủ axit sunfuric được 2,08 gam hỗn hợp A gồm 2 axit hữu cơ no. Hai axit này vừa đủ để phản ứng với 1,59 gam natricacbonat Biết rằng các este đều có số nguyên tử cacbon < 6 và không tham gia phản ứng với AgNO3/NH3. Công thức cấu tạo của 2 este là A. C2H5COOC2H5 và CH3COOC3H7 B. CH2=CHCOOCH3, CH2=CHCOOC2H5 C. CH3COOCH=CH-CH3, C2H5COOCH=CH2 D. HCOOC4H9 , CH3COOC3H7 Câu 29: Một hỗn hợp X gồm 2 este A, B đơn chức, mạch hở, khi bị xà phòng hoá cho ra 2 muối của axit cacboxylic là đồng đẳng liên tiếp và 1 ancol. Thể tích dung dịch NaOH 1M cần dùng để xà phòng hoá este này là 0,3 lít. Xác định CTCT và số mol mỗi este trong hỗn hợp X. Biết rằng khối lượng mX=23,6 gam và trong 2 axit A, B không có axit nào cho phản ứng tráng gương. A. 0,1 mol CH3COOCH3 và 0,2 mol CH3COOC2H5 B. 0,2 mol CH3COOCH3 và 0,1 mol CH3COOC2H5 C. 0,2 mol CH3COOCH3 và 0,1 mol C2H5COOCH3 D. 0,2 mol HCOOCH3 và 0,2 mol CH3COOC2H5 ·

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

Câu 1: Đáp án: D X1 và X2 đều có khối lượng phân tử = 60 đvc => X1 và X2 có cùng CTPT: C2H4O2. + X1 có khả năng phản ứng với Na; NaOH; Na2CO3 => X1 là axit => CT: CH3COOH. + X2 phản ứng với NaOH đun nóng mà không phản ứng với Na => X2 là este => CTCT: HCOOCH3. Câu 2: Đáp án: C Cứ 1 lít hơi X nặng bằng 2 lít CO2 => Mx = 2.MCO2 = 88 => CTPT của X là C4H8O2.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

Câu 3: Đáp án: B 1,85 0, 7 nN2 = = 0,025 mol => nx = 0,025 => Mx = = 74 0, 025 14.2 => X và Y có cùng CTPT là C3H6O2 <=> HCOOC2H5 và CH3COOCH3 Câu 4: Đáp án: C Este có tỉ khối với H2 là 44 => Meste = 88 (C4H8O2). C4H8O2 + NaOH → CmH2m +1COONa + CnH2n+1OH, với m + n = 4. 35, 2 nC4H8O2 = = 0,4 mol => NaOH dư => B gồm muối và NaOH dư. 88 mB = m muối + m NaOH dư => m muối = 44,6 – 0,4.40 = 28,6 (g) => Mmuoi = 7,15 => hai muối là HCOONa và CH3COONa => Este là HCOOC3H7 và CH3COOC2H5 Câu 5: Đáp án: B nCO2 = nH2O = 0,15 mol => X, Y là este no, đơn chức, mạch hở Áp dụng bảo toàn khối lượng => 3,7 = mO + mC + mH => mO = 3,7 – 0,15.(12 + 2) = 1,6 (g) =>nO = 0,1 mol => neste = 0,05 mol. 0,15 => Số C trung bình = = 3 => 2 este là HCOOC2H5 và CH3COOCH3 0, 05 Câu 6: Đáp án: B Ta thấy khối lượng phân tử : M HCOOC2H5 = M CH3COOCH3 = 74 66, 6 =>neste = = 0,9 mol => n ancol = 0,9 mol. 74 H 2 SO4 → 1ete + 1H2O Khi đun ancol với H2SO4, 1400C thì ta có: cứ 2 ancol  140o C

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

B

1 n ancol = 0,45 mol => m H2O = 8,1 g. 2 Câu 7: Đáp án: A Vì V CO2 = V H2O ở cùng điều kiện thể tích=> số mol nCO2 = nH2O => X và Y là những este no, đơn chức mạch hở => n este = n KOH = 0,03 mol. 2, 22 =>Meste = = 74 ( tương ứng với CTPT : C3H6O2) => X và Y là CH3COOCH3 và HCOOC2H5 0,03 Câu 8: Đáp án: D Theo đề bài: y + 0,05 mol NaOH → một muối + 2 ancol => n y = n NaOH = 0,05 mol. Y có dạng CxHyOz, khi đốt Y: CxHyOz + O2 → CO2 + H2O. Bảo toàn oxi => 2.ny + 2.nO2 = 2.nCO2 + nH2O => nH2O = 0,2 mol. Vì nCO2 = nH2O => este no, hở, đơn chức. 0, 2 Số C = = 4, mà hai este có chung gốc axit 0, 05 =>Este là HCOOCH2CH2CH3; HCOOCH(CH3)2 Câu 9: Đáp án: B Hai este HCOOC2H5 và CH3COOCH3 có cùng CTPT là C3H6O2 2, 22 n 2este = = 0,3 mol. 74 Vì 2 este đều no, đơn chức => phản ứng với NaOH theo tỉ lệ mol: 1 : 1 => nNaOH = n 2este = 0,3 mol. =>Vd2NaOH = 0,3/1 = 0,3 (l) = 300 ml. Câu 10: Đáp án: B P.V 1.2,1 Ta có: 4,625 g X có số nx = = = 0,0625 mol n.R.T 0,082.(136,5 + 273) 4, 625 =>Mx = = 74 => X, y, z là C3H6O2. 0, 0625 Giả sử X là HCOOCH2CH3; Y là CH3COOCH3; Z là C2H5COOH (theo thứ tự KLPT gốc axit tăng dần).

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

=>nH2O =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

 HCOOCH 2CH 3 : x  HCOONa : x CH 3CH 2OH : x   13,875 CH 3COOCH 3 : y + NaOH → CH 3COONa : y +  C H COONa : z C H COONa : z CH 3OH : y  2 5  2 5 Đặt số mol của X, Y, Z lần lượt là x, y, z, ta được: ( x + y + z ).74 = 13,875  68 x + 82 y + 96 z = 15,375 vì tỉ khối ancol/ H2 = 20,67  46 + 32 y = 20, 67.2( x + y ) Suy ra x = z = 0,075; y = 0,0375. Do X,Y,Z có cùng PTK => % KL = % số mol 0, 075 => %X = %Z = = 40%; % Y = 20%. 0,1875 Câu 11: Đáp án: D Với 2,2g A => nA = 0,025 mol. 2, 2 =>M A = = 88 => A là C4H8O2. 0, 025 26, 4 Với 26,4 g A => nA = = 0,3 mol => n muối = 0,3 mol. 88 21,8 =>M muối = = 72,67 0,3 => muối là HCOONa và CH3COONa; hoặc HCOONa và C2H5COONa => Este là HCOOC3H7 và CH3COOC2H5; hoặc HCOOC3H7 và C2H5COOCH3. Câu 12: Đáp án: D Vì este đơn chức => nKOH = neste = 0,6 mol. 52,8 =>M este = = 88 (C4H8O2) 0, 6 Cả 2 este không tráng bạc => không chứa gốc axit HCOO=>Hai este là CH3COOCH2CH3; C2H5COOCH3. Câu 13: Đáp án: C 5,98 n este= 1,344/22,4 = 0,06 mol => M este = = 99,67. 0,06 Este có dạng CH 3COOCn H 2 n +1 => n = 2,83 => Ancol có số C là 2 và 3 => Este là CH3COOC2H5 và CH3COOC3H7. Câu 14: Đáp án: A X 9, 7 g  + KOH → hai ancol + 1 muối Y 0,15 mol 9, 7 = 64,66 => X là C2H4O2 (60) và Y là C3H6O2 (74) => M x, y = 0,15 Vì X, Y chung gốc axit => HCOOCH3 và HCOOC2H5 Câu 15: Đáp án: A X  + NaOH → 1 ancol + 1 muối Y =>X là axit cacbonxylic; Y là este có chứa gốc axit giống X. 24,6 nNaOH = 0,3 => n muối = 0,3 mol => M muối = = 82 (CH3COONa) 0,3 0, 2CO2 Đốt ancol →  => Ancol no, n ancol = 0,3 – 0,2 = 0,1 mol 0,3H 2O

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Đ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

=> Ancol là C2H5OH. => Y là CH3COOC2H5 Câu 16: Đáp án: A n muối = n ancol = n NaOH = 0,1 mol (vì A, B đơn chức). => M muối = 68 (HCOONa) M ancol = 40,4 mà ancol đồng đẳng kế tiếp => Ancol là CH3OH và C2H5OH. => Este là HCOOCH3 và HCOOC2H5 Câu 17: Đáp án: A Z + O2 → CO2 + H2O 0,275 0,25 0,25 Bảo toàn oxi => nO (trong Z) = 2nCO2 +nH2O- 2nO2 = 0,2 mol 0, 25 => nZ = 0,1 mol => nC = = 2,5 => X là HCOOCH3; Y là CH3COOCH3 0,1 Bảo toàn khối lượng: m = mCO2 + mH2O -mO2 = 6,7 (g) Câu 18: Đáp án: A X + O2 → CO2 + H2O Vì este no, hở, đơn chức => nH2O = nCO2 = 0,145 (mol) Bảo toàn oxi => nO (trong X) = 2nCO2 + nH2O – 2nO2 = 0,08 mol 0,145 => nX = 0,04 mol => C = = 3,625 0, 04 Mà các este tạo từ một axit và 2 ancol kế tiếp => Este là C3H6O2 và C4H8O2 Câu 19: Đáp án: C Este + O2 → CO2 + H2O Vì este no, hở, đơn, chức => nH2O = nCO2 = 0,145 mol. Bảo toàn oxi => nO (trong este) = 2nCO2 + nH2O – 2nO2 = 0,08 mol 0,145 = 3,625. => n este = 0,04 mol => C = 0, 04 3,92 Mmuối = = 98 (CH3COOK) 0,04 Do đó, 2 chất ban đầu là: CH3COOCH3 và CH3COOC2H5. Câu 20: Đáp án: C E + O2 → CO2 + H2O Bảo toàn khối lượng => mH2O = mE + mO2 – mCO2 = 18 g. => nH2O = 1 mol; nCO2 = 1,3 mol. Bảo toàn oxi => nO (trong E) = 1,3.2 + 1 – 1,5.2 = 0,6 mol 1,3 => nE = 0,3 mol => C = = 4,33 => Số C là 4 và 5. 0,3 2 H= = 6,67 => Số H là 6 và 8 (vì A, B kế tiếp nhau trong dãy đồng đẳng) 0,3 => A, B là C4H6O2 và C5H8O2. Câu 21: Đáp án: D Este + NaOH → Muối + Ancol 1,99g 2,05 g 0,94 g Bảo toàn khối lượng => mNaOH = 1 g => n NaOH = = 0,25 mol 2, 05 =>M muối = = 82 (CH3COONa) 0, 025 M ancol = 0,94/0,025 = 36,7 => CH3OH và C2H5OH =>Este là CH3COOCH3 và CH3COOC2H5. Câu 22: Đáp án: C X, Y + NaOH → Muối + Ancol

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

U

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

0,1 mol Vì X, Y đơn chức => n muối = n ancol = 0,1 mol. 7,85 => M muối = = 78,5 <=> CH3COONa và HCOONa 0,1 4,95 M ancol = = 49,5 <=> CH3CH2OH và CH3CH2CH2OH (vì là ancol bậc 1) 0,1 => Este là CH3COOCH2CH3 và HCOOCH2CH2CH3 Gọi phần trăm khối lượng CH3COOCH2CH3 là x là => phần trăm số mol cũng là x => nCH3COONa = 0,1.x ; n HCOONa = 0,1(1- x) Do đó: 82.0,1.x + 68.0,1.(1- x) = 7,85 => x = 0,75 = 75% Vậy CH3COOCH2CH3: 75% và HCOOCH2CH2CH3: 25%. Câu 23: Đáp án: B Vì este đơn chức => n muối = n ancol = 0,1 mol 8, 2 => M muối = = 82 (CH3COONa) 0,1 4, 04 M ancol = = 40,4 => Ancol là C2H5OH và CH3OH => Este: CH3COOC2H5 và CH3COOCH3 0,1 Câu 24: Đáp án: B → CO2 X + O2 + H2O 1,225 mol 1,05 mol 1,05 mol BTKL => m X = 25,9 g BT oxi => n O (trong X) = 1,05.2 + 1,05 – 1,225.2 = 0,7 mol => n X = 0,35 mol => M X = 74 => gồm CH3COOCH3 và HCOOC2H5 Muối Y là HCOONa (a mol); muối Z là CH3COONa (b mol) => a + b = nX =0,35 Mặt khác, chất rắn = m y + m z + m NaOH dư => 68a + 82b + (0,4 – 0,35).40 = 27,9 a 4 => a = 0,2; b = 0,15 => = b 3 Câu 25: Đáp án: A n este = nKOH = 0,15 mol 9, 7 => M = = 64,67 => C2H4O2 và C3H6O2 0,15 Mà X, Y tạo bởi 1 axit và 2 ancol => X, Y là HCOOCH3 và HCOOC2H5 Câu 26: Đáp án: A B chứa 2 ancol hơn kém nhau 14 đvc có 1 nhóm - CH20,35CO2 Đốt 7,6g B →  => nB = nH2O - nCO2 = 0,15 mol. 0,5H 2O

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

0,35 = 2,33 => B chứa C2H5OH và C3H7OH 0,15 nB = nNaOH => nNaOH = 0,15 mol. BTKL => mZ = m A + m NaOH – m B = 10,9 (g) 10,9 => M Z = = 72,66 => Một trong 2 muối là HCOONa 0,15  x + y = 0,15  x = 0,1 Gọi nC2H5OH = x; nC3H7OH = y =>  <=>  2 x + 3 y = 0,35  y = 0, 05 Xét 2 trường hợp:  HCOOC2 H 5 0,1mol + A chứa  , mà mA = 12,5  RCOOC3 H 7 0, 05mol

BỒ

ID Ư

Ỡ N

G

=> nC =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

=> 0,1.74 + (R + 87).0,05 = 12,5 => R = 15 (CH3) 0,1.74 => %HCOOC2H5 = = 59,2%; %CH3COOC3H7 = 40,8%. 12,5  HCOOC2 H 5 0,1mol +) A chứa   RCOOC3 H 7 0, 05mol => 0,05.88 + 0,1 (R + 73) = 12,5 => R = 8, loại. Câu 27: Đáp án: A 10,7 g X + NaOH → 2 muối natri + ancol E ddE/k2 = 2 => M E = 29.2 = 58 => E là CH2=CH-CH2OH 1 E + Na → H2, mà nH2 = 0,05 2 => nE = 2.nH2 = 0,1 mol. 10,7 => n X = 0,1 mol => M x = = 107. 0,1 X có cấu tạo: Cn H 2 n +1COOCH 2CH = CH 2 => n = 1,5 => X gồm C2H5COOCH2CH=CH2; CH3COOCH2CH=CH2. Câu 28: Đáp án: A Khi đốt Y, n CO2 : n H2O = 7 : 10, đặt nCO2 = 7, nH2O = 10 7 => Ancol no; nAncol = 10 – 7 = 3 => C = = 2,33 3 => Y chứa C2H5OH và C3H7OH. 1,59 * Vì acid đơn chức => n axit = 2n Na2CO3 = = 0,03 mol. 106 2,08 =>Phân tử khối trung bình của axit: M = = 69,33 0,03 => Tồn tại 1 axit 1 axit có M < 69,33 => CH3COOH hoặc HCOOH (loại). Giả sử axit còn lại có số C = x => x ≥ 3. => Este của axit này có số C tối thiểu là x + 2 (khi nó kết hợp với C2H5OH) Mà theo đề => x + 2 < 6 => x < 4, mà x ≥ 3 => x = 3. Hai este là: C2H5COOC2H5 và CH3COOC3H7. Câu 29: Đáp án: C nNaOH = 0,3 mol, mà A, B đơn chức => nX = 0,3 mol. 23, 6 => M z = = 78,67 => X chứa C3H6O2 và C4H8O2. 0,3 Mà A, B không có phản ứng tráng gương => A,B là CH3COOCH3; C2H5COOCH3. Đặt số mol 2 este lần lượt là x và y. => { x + y = 0,374 x + 88 y = 23, 6 => x=0,2 và y = 0,1

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

H Ơ N

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

Bài 1. Benzyl axetat là một este có mùi thơm của hoa nhài. Công thức của benzyl axetat là A. C6H5-COO-CH3 B. CH3-COO-CH2-C6H5 C. CH3-COO-C6H5 D. C6H5-CH2-COO-CH3 Bài 2. Este nào sau đây khi thủy phân trong môi trường kiềm tạo ra 2 muối hữu cơ ? A. C6H5COOCH2CH=CH2. B. CH2=CHCH2COOC6H5. C. CH3COOCH=CHC6H5. D. C6H5CH2COOCH=CH2. Bài 3. Este nào sau đây thủy phân cho hỗn hợp 2 chất hữu cơ đều tham gia phản ứng tráng bạc ? A. CH3COOC2H5. B. CH3COOCH=CH2. C. HCOOCH2CH=CH2. D. HCOOCH=CH-CH3. Bài 4. Mệnh đề nào sau đây không đúng ? A. Metyl fomat có CTPT là C2H4O2. B. Metyl fomat là este của axit etanoic. C. Metyl fomat có thể tham gia phản ứng tráng bạc. D. Thuỷ phân metyl fomat tạo thành ancol metylic và axit fomic. Bài 5. Hợp chất X có CTPT C4H6O2. Khi thủy phân X thu được 1 axit Y và 1 anđehit Z. Oxi hóa Z thu được Y. Trùng hợp X cho ra 1 polime. CTCT của X là A. HCOOC3H5. B. C2H3COOCH3. C. CH3COOC2H3. D. C3H5COOH. Bài 6. Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần đúng là A. C2H5Cl < CH3COOH < C2H5OH. B. C2H5Cl < CH3COOCH3 < C2H5OH < CH3COOH. C. CH3OH < CH3CH2OH < NH3 < HCl. D. HCOOH < CH3OH < CH3COOH < C2H5F. Bài 7. Lần lượt cho các chất: phenol, axit acrylic, axit fomic, metyl axetat phản ứng với Na, dung dịch NaOH đun nóng. Số trường hợp có phản ứng xảy ra là A. 5. B. 6. C. 7. D. 8. Bài 8. Este mạch hở X có CTPT là C4H6O2. Số đồng phân tối đa có thể có của X là: A. 3. B. 4. C. 5. D. 6.

N

KIỂM TRA HẾT CHƯƠNG ESTE - LIPIT (Đề 1)

+ H 2O + O2 → Y1 + Y2 ; Y1   → Y2. Tên gọi của X là: Bài 9. Este X có CTPT C4H8O2. Biết: X  xt H+

A. isopropyl fomat. B. etyl axetat. C. metyl propionat.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. n-propyl fomat. Bài 10. Chất hữu cơ X mạch hở có CTPT C4H6O2, biết rằng:

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. CH2=CH-CH2-COOH. B. CH2=CHCOOCH3. C. HCOOCH2–CH=CH2. D. CH3 COOCH=CH2. Bài 11. Chất hữu cơ X có CTPT là C4H6O2Cl2. Khi cho X phản ứng với dung dịch NaOH thu được HOCH2-COONa, etylenglicol và NaCl. CTCT của X là A. CH2Cl-COO-CHCl-CH3. B. CH3-COO-CHCl-CH2Cl. C. CHCl2-COO-CH2CH3. D. CH2Cl-COO-CH2-CH2Cl. Bài 12. Hai este X, Y là dẫn xuất của benzen, đều có CTPT là C9H8O2; X và Y đều cộng hợp với Brom theo tỉ lệ mol 1:1. X tác dụng với dung dịch NaOH cho một muối và một anđehit. Y tác dụng với dung dịch NaOH dư cho 2 muối và nước, các muối đều có phân tử khối lớn hơn phân tử khối của CH3COONa. CTCT của X và Y lần lượt là A. HOOC-C6H4-CH=CH2 và CH2=CH-COOC6H5. B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH. C. HCOO-C6H4-CH=CH2 và HCOOCH=CH-C6H5. D. C6H5COO-CH=CH2 và CH2=CH-COOC6H5. Bài 13. Tổng số hợp chất hữu cơ no, đơn chức, mạch hở, có cùng công thức phân tử C5H10O2, phản ứng được với dung dịch NaOH nhưng không có phản ứng tráng bạc là A. 4 B. 5. C. 8. D. 9. Bài 14. Cho các chất: etyl axetat, ancol etylic, axit acrylic, phenol, phenylamoni clorua, ancol benzylic, pcrezol. Trong các chất này, số chất tác dụng được với dung dịch NaOH là A. 4. B. 6. C. 5. D. 3. Bài 15. Cho các phản ứng:

N

+ ddNaOH + NaOH → muối Y → X  etilen . CTCT của X là : Cao ,t o

ÁN

o

t X + 3 NaOH  → C6 H 5ONa + Y + CH 3CHO + H 2O o

TO

CaO ,t Y + 2 NaOH  → T + 2 Na2CO3 o

Ỡ N

G

t CH 3CHO + 2Cu (OH ) 2 + NaOH  → Z + ... o

CaO ,t Z + NaOH  → T + Na2CO3

BỒ

ID Ư

Công thức phân tử của X là A. C12H20O6. B. C12H14O4 C. C11H10O4. D. C11H12O4. Bài 16. Cho sơ đồ chuyển hóa: o

o

ddBr2 O2 , xt CH 3OH ( H 2 SO4 dac ,t ) NaOH CuO ,t C3 H 6  → X  → Y  → Z  → T  → E (este đa chức)

Tên gọi của Y là:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. propan-1,3-điol. B. propan-1,2-điol. C. propan-2-ol. D. glixerol. Bài 17. Cho công thức chất X là C3H5Br3. Khi X tác dụng với dung dịch NaOH dư tạo ra một hợp chất tạp chức của ancol bậc I và anđehit. Công thức cấu tạo của X là A. CH3-CHBr-CHBr2. B. CH2Br-CH2-CHBr2. C. CH2Br-CHBr-CH2Br. D. CH3-CBr2-CH2Br. Bài 18. Ba hợp chất hữu cơ mạch hở X, Y, Z có cùng công thức phân tử C3H6O2 và có các tính chất sau: X, Y đều tham gia phản ứng tráng bạc; X, Z đều tác dụng được với dung dịch NaOH. Các chất X, Y, Z lần lượt là A. CH2(OH)-CH2-CHO, C2H5-COOH, CH3-COO-CH3. B. HCOO-C2H5, CH3-CH(OH)-CHO, OHC-CH2-CHO. C. CH3-COO-CH3, CH3-CH(OH)-CHO, HCOO-C2H5. D. HCOO-C2H5, CH3-CH(OH)-CHO, C2H5-COOH. Bài 19. Cho sơ đồ phản ứng sau: Este X + NaOH  CH3COONa + Chất hữu cơ Y

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

xt → Y1 Y + O2  Y1 + NaOH  CH3COONa + H2O Có tất cả bao nhiêu chất X thỏa mãn sơ đồ trên ? A. 1. B. 4. C. 2. D. 3. Bài 20. Dãy nào sau đây sắp xếp các chất theo trật tự tăng dần nhiệt độ sôi? A. HCOOCH3 < CH3COOCH3 < C3H7OH < CH3COOH < C2H5COOH B. CH3COOCH3 < HCOOCH3 < C3H7OH < CH3COOH < C2H5COOH C. HCOOCH3 < CH3COOCH3 < C3H5OH < C2H5COOH < CH3COOH D. C2H5COOH < CH3COOH < C3H7OH < CH3COOCH3 < HCOOCH3 Bài 21. Cho 10 gam chất X (chỉ chứa nhóm chức este có phân tử khối là 100 đvC) tác dụng với 150 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 11,6 gam chất rắn khan và một chất hữu cơ Y. Công thức của Y là A. CH3OH. B. C2H5OH. C. CH3CHO. D. CH3COCH3. Bài 22. Thủy phân 4,3 gam este X đơn chức mạch hở (có xúc tác axit) đến khi phản ứng hoàn toàn thu được hỗn hợp hai chất hữu cơ Y và Z. Cho Y, Z phản ứng với dung dịch dư AgNO3/NH3 thu được 21,6 gam bạc. Công thức cấu tạo của X là A. CH3COOCH=CH2. B. HCOOCH=CH-CH3. C. HCOOCH2CH=CH2. D. HCOOC(CH3)=CH2. Bài 23. Cho 0,1 mol phenyl axetat tác dụng với 250ml dung dịch NaOH 1M thu được dung dịch X. Cô cạn X được m gam chất rắn. Giá trị của m là A. 21,8.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 8,2. C. 19,8. D. 14,2. Bài 24. Cho 10,2 gam một este đơn chức X tác dụng vừa đủ với 40 gam dung dịch NaOH 15%. Số đồng phân cấu tạo thỏa mãn điều kiện trên của X là A. 3. B. 4. C. 5. D. 6. Bài 25. Hỗn hợp M gồm hai chất hữu cơ X và Y. Cho M tác dụng vừa đủ với 150 ml dung dịch NaOH 1M đun nóng, thu được 14,1 gam một muối và 2,3 gam một ancol no, mạch hở. Nếu đốt cháy hoàn toàn lượng M trên thì thu được 0,55 mol CO2. Công thức của X và Y lần lượt là A. CH2=CHCOOH và CH2=CH-COO-CH3. B. CH≡C-COOH và CH≡C-COO-CH3. C. CH≡C-COOH và CH≡C-COO-C2H5. D. CH2=CHCOOH và CH2=CH-COO-C2H5. Bài 26. Chất X có công thức phân tử C4H6O2. Cho m gam X phản ứng vừa đủ với dung dịch chứa 2 gam NaOH, tạo ra 4,1 gam muối. Kết luận nào sau đây là đúng cho chất X ? A. X có phản ứng tráng bạc và có làm mất màu nước brom B. X có khả năng làm đổi màu quỳ tím thành đỏ C. X không tham gia phản ứng tráng bạc nhưng có làm mất màu nước brom D. X có phản ứng tráng bạc nhưng không làm mất màu nước brom Bài 27. Cho a gam chất hữu cơ X chứa C, H, O tác dụng với dung dịch NaOH vừa đủ, sau đó chưng khô thì phần bay hơi chỉ có 1,8 gam nước, phần chất rắn khan còn lại chứa hai muối của natri có khối lượng 11,8 gam. Nung hai muối này trong oxi dư, sau khi phản ứng hoàn toàn, ta thu được 7,95 gam Na2CO3; 7,28 lít khí CO2 (đktc) và 3,15 gam nước. Công thức đơn giản nhất của X là: A. C8H8O3. B. C8H8O2. C. C6H6O2. D. C7H8O3. Bài 28. Khi thuỷ phân 0,1 mol este X được tạo bởi một ancol đa chức với một axit cacboxylic đơn chức cần dùng vừa đủ 12 gam NaOH. Mặt khác để thuỷ phân 6,35 gam X cần dùng 3 gam NaOH và thu được 7,05 gam muối. Công thức của X là: A. (CH3COO)3C3H5 B. (HCOO)3C3H5 C. (C2H3COO)3C3H5 D. (CH3COO)2C2H4 Bài 29. Hỗn hợp X gồm hai chất hữu cơ. X phản ứng với dung dịch KOH vừa đủ, cần dùng 100ml dung dịch KOH 5M. Sản phẩm phản ứng gồm muối của một axit cacboxylic đơn chức và hai ancol đơn chức. Cho toàn bộ lượng ancol tác dụng hết với Na thu được 8,96 lít H2 (đktc). X gồm: A. 1 axit và 1 ancol B. 1 este và 1 axit C. 2 este D. 1 este và 1 ancol Bài 30. X là một este đơn chức không tham gia phản ứng tráng bạc, khi thủy phân hoàn toàn 4,3 gam X bằng dung dịch NaOH vừa đủ rồi chưng cất sản phẩm được muối Y và phần bay hơi Z. Cho Z phản ứng với Cu(OH)2 dư trong điều kiện thích hợp thu được 7,2 gam kết tủa đỏ gạch. Khối lượng của muối thu được là: A. 3,4 gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 6,8 gam C. 3,7 gam D. 4,1 gam Bài 31. Este X (chứa C, H, O và không có nhóm chức khác) có tỉ khối hơi đối với metan bằng 6,25. Cho 25 gam X phản ứng vừa đủ với dung dịch KOH thu được dung dịch Y. Cô cạn dung dịch Y thu được 39 gam chất rắn khan Z. Phần trăm khối lượng của oxi trong Z là A. 20,51%. B. 30,77%. C. 32%. D. 20,15%. Bài 32. Thủy phân hoàn toàn 9,46 gam một este X (đơn chức) trong lượng dư dung dịch NaOH thì thu được 10,34 gam muối. Mặt khác 9,46 gam chất X có thể làm mất màu vừa hết 88 gam dung dịch Br2 20%. Biết rằng trong phân tử của X có chứa 2 liên kết π. Tên gọi của X là A. metyl acrylat. B. vinyl propionat. C. metyl metacrylat. D. vinyl axetat. Bài 33. Xà phòng hóa 2,76 gam một este X bằng dung dịch NaOH vừa đủ, thu được 4,44 gam hỗn hợp hai muối của natri. Nung nóng hai muối này trong oxi dư, sau khi phản ứng hoàn toàn, thu được 3,18 gam Na2CO3, 2,464 lít khí CO2 (ở đktc) và 0,9 gam nước. Công thức đơn giản cũng là công thức phân tử của X. Vậy CTCT thu gọn của X là: A. HCOOC6H5. B. CH3COOC6H5. C. HCOOC6H4OH. D. C6H5COOCH3. Bài 34. X là một este 3 chức mạch hở. Đun nóng 7,9 gam X với NaOH dư. Đến khi phản ứng hoàn toàn thu được ancol Y và 8,6 gam hỗn hợp muối Z. Tách nước từ Y có thể thu được anđehit acrylic (propenal). Cho Z tác dụng với dung dịch H2SO4 loãng dư thu được 3 axit no, mạch hở, đơn chức, trong đó 2 axit có khối lượng phân tử nhỏ là đồng phân của nhau. Công thức phân tử của axit có khối lượng phân tử lớn là A. C5H10O2. B. C7H16O2. C. C4H8O2. D. C6H12O2. Bài 35. Hỗn hợp Y gồm 2 este đơn chức mạch hở là đồng phân của nhau. Cho m gam hỗn hợp Y tác dụng vừa đủ với 100ml dung dịch NaOH 0,5M thu được muối của 1 axit cacbonxylic và hỗn hợp 2 ancol. Mặt khác đốt cháy hoàn toàn m gam hỗn hợp Y cần dùng 5,6 lít O2 và thu được 4,48 lít CO2 (các thể tích đo ở đkc). Công thức cấu tạo của 2 este trong hỗn hợp Y là: A. CH3COOCH3 và HCOOC2H5. B. C2H5COOCH3 và HCOOC3H7. C. CH3COOCH3 và CH3COOC2H5. D. HCOOCH2-CH2-CH3 và HCOO-CH(CH3)-CH3. Bài 36. Đốt cháy hoàn toàn 0,05 mol hỗn hợp M gồm anđehit X và este Y, cần dùng vừa đủ 0,155 mol O2, thu được 0,13 mol CO2 và 2,34 gam H2O. Mặt khác, cho 0,1 mol M phản ứng với lượng dư dung dịch AgNO3 trong NH3, kết thúc các phản ứng thu được 21,6 gam Ag. Công thức cấu tạo thu gọn của X, Y lần lượt là A. CH3CHO và HCOOCH3. B. CH3CHO và HCOOC2H5. C. HCHO và CH3COOCH3

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. CH3CHO và CH3COOCH3. Bài 37. Hỗn hợp X gồm 2 este đơn chức. Cho 0,5 mol X tác dụng với dung dịch AgNO3/NH3 dư thu được 43,2 gam Ag. Cho 14,08 gam X tác dụng với dung dịch KOH vừa đủ thu được hỗn hợp 2 muối của 2 axit đồng đẳng liên tiếp và 8,256 gam hỗn hợp 2 ancol no đơn chức đồng đẳng liên tiếp, mạch hở. Công thức của 2 ancol là: A. C3H7OH và C4H9OH B. CH3OH và C2H5OH C. C2H5OH và C3H7OH D. C4H9OH và C5H11OH Bài 38. Cho axit oxalic tác dụng với hỗn hợp 2 ancol đơn chức no đồng đẳng liên tiếp thu được 5,28 gam hỗn hợp 3 este đa chức. Thuỷ phân lượng este trên bằng dung dịch NaOH dư thu được 5,36 gam muối. 2 ancol có công thức là A. CH3OH và C2H5OH B. C2H5OH và C3H7OH C. C3H7OH và C4H9OH D. C4H9OH và C5H11OH Bài 39. Đốt cháy 1,7 gam este X cần 2,52 lít oxi (đktc), chỉ sinh ra CO2 và H2O với tỉ lệ số mol . Đun nóng 0,01 mol X với dung dịch NaOH thấy 0,02 mol NaOH tham gia phản ứng. X không có chức ete, không phản ứng với Na trong điều kiện bình thường và không khử được AgNO3, trong amoniac ngay cả khi đun nóng. Biết MX < 140 đvC. Công thức cấu tạo của X là: A. HCOOC6H5. B. CH3COOC6H5. C. C2H5COOC6H5. D. C2H3COOC6H5. Bài 40. Đun nóng 21,8 gam chất X với 0,25 lít dung dịch NaOH 1,2M thì thu được 24,6 gam muối của axit đơn chức và một lượng ancol Y. Nếu cho lượng ancol đó bay hơi thì chiếm thể tích là 2,24 lít (đktc). CTPT của X là A. C2H4(CH3COO)2. B. C3H5(CH3COO)3. C. C3H6(CH3COO)2. D. C3H8(CH3COO)2. Bài 41. Cho dãy các chất: phenyl axetat, anlyl axetat, metyl axetat, etyl fomat, tripanmitin. Số chất trong dãy khi thủy phân trong dung dịch NaOH (dư), đun nóng sinh ra ancol là A. 5. B. 2. C. 4. D. 3. Bài 42. Hỗn hợp X gồm 2 este đơn chức là đồng phân của nhau. Đun nóng m gam X với 300 ml dung dịch NaOH 1M, kết thúc phản ứng thu được dung dịch Y và (m-8,4) gam hỗn hợp hơi gồm hai anđehit no, đơn chức, đồng đẳng kế tiếp có tỉ khối hơi so với H2 bằng 26,2. Cô cạn dung dịch Y thu được (m -1,1) gam chất rắn khan. Công thức của 2 este là A. CH3COOCH=CH2 và C2H5COOCH=CH2 B. CH3COOCH=CH-CH3 và C2H5COOCH=CH2. C. CH3COOCH2CH=CH2 và C2H5COOCH=CH2 D. HCOOCH=CH-CH3 và CH3COOCH=CH2. Bài 43. Xà phòng hòa hoàn toàn 2,22 gam hỗn X gồm 2 este đồng phân của nhau cần dùng vừa hết 30 ml dung dịch NaOH 1M. Mặt khác khi đốt cháy hoàn toàn hỗn hợp X thu được CO2 và hơi nước với thể tích bằng nhau (ở cùng điều kiện). Công thức cấu tạo của 2 este trên là

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. HCOOCH2CH2CH3 và HCOOCH(CH3)CH3 B. HCOOC2H5 và CH3COOCH3. C. CH3COOCH=CH2 và CH2=CHCOOCH3. D. CH3COOC2H5 và C2H5COOCH3 Bài 44. Hỗn hợp X gồm 2 este đơn chức là đồng phân của nhau. Cho 5,7 gam hỗn hợp X tác dụng vừa đủ với 100 ml dung dịch NaOH 0,5M thu được hỗn hợp Y có 2 ancol bền, cùng số nguyên tử cacbon. Cho Y tác dụng với dung dịch Br2 dư thấy có 6,4 gam Brom tham gia phản ứng. Công thức của 2 este là A. C3H7COOC3H5 và C3H5COOC3H7. B. C2H3COOC3H3 và C3H5COOC3H7. C. C2H5COOC3H5 và C2H3COOC3H7. D. C2H5COOC2H3 và C2H5COOC3H3. Bài 45. Hợp chất X có công thức phân tử C4H8O3. Cho 10,4 gam X tác dụng với dung dịch NaOH (vừa đủ) thu được 9,8 gam muối. công thức cấu tạo đúng của X là A. CH3COOCH2CH2OH B. HOCH2COOC2H5. C. HCOOCH2CH2CHO D. CH3CH(OH)-COOCH3. Bài 46. Một hỗn hợp X gồm 2 chất hữu cơ đơn chức. Cho X phản ứng vừa đủ với 500ml dung dịch KOH 1M. Sau phản ứng thu được hỗn hợp Y gồm 2 muối của hai axit cacboxylic và một ancol. Cho toàn bộ lượng ancol thu được ở trên tác dụng với Na dư, sinh ra 3,36 lit H2 (đktc). Hỗn hợp X gồm A. một este và một ancol. B. một axit và một este. C. một axit và một ancol D. hai este Bài 47. Hợp chất hữu cơ X có công thức phân tử là C7H6O3, X chứa nhân thơm. X tác dụng với NaOH theo tỉ lệ mol 1:2, X tham gia phản ứng tráng gương. Số đồng phân của X là: A. 6. B. 3. C. 9. D. 12. Bài 48. Hợp chất hữu cơ X có công thức phân tử là C6H10O4. X tác dụng với NaOH với tỉ lệ 1:2. Khi cho X tác dụng với NaOH sinh ra 3 sản phẩm hữu cơ, trong đó không có sản phẩm nào là tạp chức và có ít nhất 1 ancol. Số đồng phân của X là: A. 7. B. 5. C. 6. D. 11. Bài 49. Cho các chất sau: CH3COOCH2CH2Cl, ClH3N-CH2COOH, C6H5Cl (thơm), HCOOC6H5 (thơm), C6H5COOCH3 (thơm), HO-C6H4-CH2OH (thơm), CH3CCl3, CH3COOC(Cl2)-CH3. Có bao nhiêu chất khi tác dụng với NaOH đặc dư, ở nhiệt độ và áp suất cao cho sản phẩm có 2 muối ? A. 7. B. 4. C. 5. D. 6. Bài 50. X là este được tạo bởi axit 2 chức, mạch hở và ancol no, 2 chức, mạch hở có công thức đơn giản nhất là C3H2O2. Để hiđro hóa hoàn toàn 1 mol X (Ni, to) cần bao nhiêu mol H2 ? A. 2 mol B. 3 mol

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 1 mol D. 4 mol

LỜI GIẢI CHI TIẾT

H Ơ

N

Câu 1: Đáp án B benzyl axetat lại là mùi hoa nhài.

N

theo tên ta cũng có thế viết được CTCT của nó là CH3COOCH2C6H5

TP .Q

U

Y

Vậy ta chọn đáp án D.

► Thêm: một số mùi este thông dụng khác

Đ

ẠO

isoamyl axetat: đây là mùi chuối chín: CTPT: CH3COOCH2CH2CH(CH3)2.

H

TR ẦN

www.daykemquynhon.ucoz.com

geranyl axetat: mùi hoa hồng. Câu 2: Đáp án B C6H5COOCH2CH=CH2 + NaOH → C6H5COONa + CH2=CH-CH2OH

Ư N

G

etyl butirat và etyl propionat: là mùi dứa.

CH2=CHCH2COOC6H5 + 2NaOH → CH2=CHCOONa + C6H5ONa + H2O

00

B

CH3COOCH=CHC6H5 + NaOH → CH3COONa + C6H5CH2CHO

2+

3

10

C6H5CH2COOCH=CH2 + NaOH → C6H5CH2COONa + CH3CHO

C

ẤP

Câu 3: Đáp án D CH3COOC2H5 + NaOH → CH3COONa + C3H5OH

Ó

A

CH3COOCH=CH2 + NaOH → CH3COONa + CH3CHO

H

HCOOCH2CH=CH2 + NaOH → HCOONa + CH2=CHCH2OH

-L

Í-

HCOOCH=CH-CH3 + NaOH → HCOONa + CH3-CH2CHO

TO

ÁN

Este thủy phân cho hỗn hợp hai chất hữu cơ đều tham gia phản ứng tráng bạc là HCOOCH=CH-CH3 Câu 4: Đáp án B Đáp án A đúng. Metyl fomat là HCOOCH3 có CTPT là C2H4O2.

Ỡ N

G

Đáp án B sai vì metyl fomat là este của axit fomic. o

BỒ

ID Ư

t Đáp án C đúng. HCOOCH3 + 2AgNO3 + 3NH3  → CH3COONH4 + 2Ag↓ + 3NH3 + H2O

o

t → HCOOH + CH3OH. Đáp án D đúng. HCOOCH3 + H2O  Câu 5: Đáp án C to → HCOOH + C3H5OH HCOOC3H5 + H2O 

Oxi hóa C3H5OH không thu được HCOOH → không thỏa mãn.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

o

t → C2H3COOH + CH3OH • C2H3COOCH3 + H2O 

Oxi hóa CH3OH không thu được C2H3COOH → không thỏa mãn. o

H Ơ

N

t → CH3COOH + CH3CHO • CH3COOC2H3 + H2O  o

N

xt ,t CH3CHO + 0,5O2  → CH3COOH o

U

Y

xt ,t → -(-CH(OCOCH3)-CH2-)nnCH3COOCH=CH2 

TP .Q

→ thỏa mãn.

Ư N

Đáp án A sai vì C2H5Cl < C2H5OH < CH3COOH.

TR ẦN

H

Đáp án B thỏa mãn.

www.daykemquynhon.ucoz.com

Đ

G

Câu 6: Đáp án B Ta có thứ tự tăng dần nhiệt độ sôi : ankan < este < anđehit < amin < ancol < axit.

ẠO

• C3H5COOH không bị thủy phân → không thỏa mãn.

Đáp án C sai vì CH3OH < CH3CH2OH < HCl < NH3.

10

00

B

Đáp án D sai vì CH3OH < C2H5F < HCOOH < CH3COOH Câu 7: Đáp án C Có 3 chất phản ứng với Na là phenol, axit acrylic, axit fomic.

2+

3

Có 4 chất phản ứng với dung dịch NaOH đun nóng là phenol, axit acrylic, axit fomic, metyl axetat.

A

C

ẤP

→ Có 7 trường hợp có phản ứng xảy ra Câu 8: Đáp án D Este mạch hở X có CTPT là C4H6O2 trong phân tử có một liên kết π

-L

Í-

H

Ó

Các đồng phân thỏa mãn gồm HCOOCH=CH-CH3(1), HCOO-CH2-CH=CH2 (2), HCOOC(CH3)=CH2(3), CH3COOCH=CH2 (4), CH2=CH-COOCH3 (5)

TO

ÁN

Chú ý (1) có đồng phân hình học. Vậy có 6 đồng phân thỏa mãn. Câu 9: Đáp án B X là etyl axetat.

Ỡ N

G

CH3COOC2H5 + H2O ⇔ CH3COOH + C2H5OH o

ID Ư

xt ,t CH3CH2OH + O2  → CH3COOH + H2O

BỒ

Câu 10: Đáp án B CaO ,t o → CH2=CH2 Muối Y + NaOH  Mà Y có CTPT là C4H6O2 → X là CH2=CHCOONa.

→ Y là CH2=CHCOOCH3 → Chọn B. CH2=CHCOOCH3 + NaOH → CH2=CHCOONa (Y) + CH3OH

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

o

N

CaO ,t → CH2=CH2 + Na2CO3. CH2=CHCOONa + NaOH  Câu 11: Đáp án D CH2Cl-COO-CHCl-CH3 + 3NaOH → HO-CH2-COONa + CH3CHO + 2NaCl + H2O

H Ơ

CH3-COO-CHCl-CHCl + 3NaOH → CH3COONa + CH2OH-CHO + 2NaCl + H2O

Y

N

CHCl2-COO-CH2-CH3 + 3NaOH → CHO-COONa + 2NaCl + CH3CH2OH

TP .Q

U

CH2Cl-COO-CH2-CH2Cl + 3NaOH → HO-CH2-COONa + CH2OH-CH2OH + 2NaCl

Đ

ẠO

→ X là CH2Cl-COO-CH2-CH2Cl → Chọn D. Câu 12: Đáp án D Đáp án A loại vì HOOC-C6H4-CH=CH2 (X) tác dụng với NaOH cho hai muối và một nước.

Ư N

G

• Đáp án B loại vì C6H5-CH=CH-COOH (Y) tác dụng với NaOH dư cho 1 muối và nước.

TR ẦN

www.daykemquynhon.ucoz.com

H

• Đáp án C loại vì HCOO-C6H4-CH=CH2 (X) tác dụng với NaOH cho hai muối và một nước; HCOOCH=CH-C6H4 (Y) tác dụng với NaOH dư cho một muối và 1 anđehit.

B

• Đáp án D thỏa mãn.

10

00

C6H5COOCH=CH2 (X) + NaOH → C6H5COONa + CH3CHO

ẤP

2+

3

CH2=CH-COOC6H5 + 2NaOH → CH2=CH-COONa + C6H5ONa + H2O. Câu 13: Đáp án D Có 9 hợp chất hữu cơ thỏa mãn là

A

C

1, CH2=CH-CH2-CH2-COOH.

H

Ó

2, 3, CH3-CH=CH-CH2-COOH (cis - trans).

-L

Í-

4, CH2=C(CH3)-COOH.

ÁN

5, CH3COOCH2CH2CH3

G

TO

6, CH3COOCH(CH3)2

Ỡ N

7, CH3CH2COOCH2CH3

BỒ

ID Ư

8, CH3CH2CH2COOCH3

9, (CH3)2CHCOOCH3

→ Chọn D. Câu 14: Đáp án C Có 5 chất thỏa mãn là etyl axetat, axit acrylic, phenol, phenylamoni clorua, ancol benzylic, p-crezol → Chọn C.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 15: Đáp án C CaO ,t o → T + Na2CO3 Y + 2NaOH  → Y là muối natri của axit hai chức. o

H Ơ

N

t CH3CHO + 2Cu(OH)2 + NaOH  → Z + ...

N

Z là CH3COONa

Y

o

TP .Q

U

CaO ,t → CH4 + Na2CO3 Z + NaOH 

Vậy Y là NaOCO-CH2-COONa. o

ẠO

t X + 3NaOH  → C6H5ONa + NaOCO-CH2-COONa + CH3CHO + H2O

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

X có CTCT là C6H5OCO-CH2-COOCH=CH2 → X có CTPT là C11H10O4 Câu 16: Đáp án A Vì E là este đa chức nên T là axit đa chức → C3H6 phải là xiclopropan ( nếu là anken thì không thể tạo hợp chất đa chức) o

TR ẦN

Br2 t NaOH → CH2Br-CH2-CH2Br  → CH2OH-CH2-CH2OH  → HOC-CH2-CHO C3H6 (xiclopropan)  CuO

B

+ CH 3OH O2 , xt  → HOOC-CH2-COOH  → CH3OOC-CH2-COOCH3 H 2 SO4

10

00

Câu 17: Đáp án B Muốn tạo ra andehit cần có 2 nhóm Br đính vào C bậc 1 → loại C, D

2+

3

Vì X khi X tạo ancol bậc 1 nên 1 nhóm Br còn lại đính với C bậc 1 → loại A

Ó

A

C

ẤP

CH2Br-CH2-CHBr2 + 3NaOH → CH2(OH)-CH2-CHO + H2O + 3NaBr. Đáp án B. Câu 18: Đáp án D Đáp án A loại vì C2H5-COOH (Y) không tham gia phản ứng tráng bạc.

Í-

H

Đáp án B loại vì OHC-CH2-CHO (Z) không tác dụng được với dung dịch NaOH.

ÁN

-L

Đáp án C loại vì CH3COOCH3 (X) không tham gia phản ứng tráng bạc.

Ỡ N

G

TO

Đáp án D thỏa mãn. Câu 19: Đáp án C Y1 là CH3COOH; X có dạng là CH3COOR

BỒ

ID Ư

Y + O2 → Y1 nên Y có thể là CH3CHO.

Có 2 chất X thỏa mãn là CH3COOCH=CH2 và CH3COOCH(OH)CH3 → Chọn C. Câu 20: Đáp án A Nhận thấy C3H7OH, CH3COOH, C2H5COOH là hợp chất có liên kết hidro, HCOOCH3 và CH3COOCH3 là hợp chất không có liên kết hidro → nhiệt độ sôi của C3H7OH, CH3COOH, C2H5COOH) > nhiệt độ sôi ( HCOOCH3 và CH3COOCH3) Trong COOH có nhóm C=O làm liên kết hidro của các hợp chất có nhóm COOH bền hơn → ts(CH3COOH, C2H5COOH) > ts (C3H7OH)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C2H5COOH có phân tử khối lớn hơn CH3COOH → ts (C2H5COOH) > ts (CH3COOH)

H Ơ

N

Vậy nhiệt độ sôi sắp xếp theo thứ tự HCOOCH3 < CH3COOCH3 < C3H7OH < CH3COOH < C2H5COOH. Câu 21: Đáp án C Ta có MX = 100 → X có công thức phân tử C5H8O2

N

CH3COOCH3 có phân tử khối lớn hơn HCOOCH3→ ts CH3COOCH3 > t HCOOCH3

TP .Q

U

Y

Ta có nX = 10 : 100 = 0,1 mol < nNaOH = 0,15 mol→ chất rắn khan chứa muối RCOONa : 0,1 mol và NaOH dư: 0,05 mol

→ 0,1. (R + 67) + 0,05. 40 = 11,6 → R= 29 (C2H5)

ẠO

Vậy X có công thức C2H5COOCH=CH2. Khi thủy phân X thu được C2H5COONa và CH3CHO

Ư N

G

Đ

Câu 22: Đáp án B • nAg = 0, 2

⇒ neste =

nAg

2

TR ẦN

www.daykemquynhon.ucoz.com

H

Nếu chỉ có 1 chất (Y hoặc Z) tác dụng với AgNO3: = 0,1 ⇒ M este = 43 ⇒ loai

00 = 0, 05 ⇒ M este = 86 ⇒ C4 H 6O2

10

4

3

n Ag

2+

⇒ neste =

B

Nếu cả Y và Z đều tác dụng

ẤP

Do cả 2 chất đều tác dụng nên CTCT của X là: HCOOCH = CHCH 3

Ó

A

C

Câu 23: Đáp án A nCH3COOC6H5 = 0,1 mol; nNaOH = 0,25 mol

Í-

H

CH3COOC6H5 + 2NaOH → CH3COONa + C6H5ONa + H2O

-L

nNaOH dư = 0,25 - 0,1 x 2 = 0,05 mol

TO

ÁN

Sau phản ứng thu được chất rắn gồm 0,1 mol CH3COONa; 0,1 mol C6H5ONa và 0,05 mol NaOH dư.

Ỡ N

G

Vậy m = 0,1 x 82 + 0,1 x 116 + 0,05 x 40 = 21,8 gam Câu 24: Đáp án B nX = nNaOH = 0,15 mol → MX = 13,2 : 0,15 = 88 → X là C4H8O2.

BỒ

ID Ư

Có 4 CTCT thỏa mãn là HCOOCH2CH2CH3, HCOOCH(CH3)2, CH3COOCH2CH3, CH3CH2COOCH3. Câu 25: Đáp án D Từ 4 đáp án, ta xác định được ngay X là axit và Y là este. Este Y được tạo thành từ axit X và 1 ancol no đơn chức (CnH2n+1OH) M muoi =

14,1 = 94 ⇒ CH 2 = CHCOONa 0,15

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Gọi x và n lần lượt là số mol và số nguyên tử C của ancol.

H Ơ

N

nx + 0,15.3 = 0,55  x = 0, 05  Ta có:  2,3 ⇔ ⇒ C2 H 5OH n = 2 = x  14n.18

N

Vậy công thức của X là CH2=CHCOOH, công thức của Y: CH2=CHCOOC2H5

Giả sử muối là RCOONa

ẠO

nRCOONa = 0,05 mol → MRCOONa = 4,1 : 0,05 = 82 → MR = 15 → Muối là CH3COONa

G

Đ

Vậy X là CH3COOCH=CH2.

Ư N

Đáp án A sai vì X không có phản ứng tráng bạc.

TR ẦN

H

Đáp án B sai vì X không làm quỳ tím đổi màu.

www.daykemquynhon.ucoz.com

TP .Q

U

Y

Câu 26: Đáp án C nNaOH = 0,05 mol.

Đáp án C thỏa mãn.

10

00

B

Đáp án D sai vì X không có phản ứng tráng bạc nhưng làm mất màu nước brom Câu 27: Đáp án A nH2O = 0,1 mol

2+

3

nNa2CO3 = 0,075 mol; nCO2 = 0,325 mol; nH2O = 0,175 mol.

ẤP

nNaOH = 2 x nNa2CO3 = 2 x 0,075 = 0,15 mol.

Ó

A

C

nC trong X = nNa2CO3 + nCO2 = 0,075 + 0,325 = 0,4 mol.

Í-

H

Bảo toàn H trong X: nH trong X = 0,1 x 2 + 0,175 x 2 - 0,15 = 0,4.

7, 6 − 0, 4.12 − 0, 4.1 = 0,15 16

ÁN

-L

Theo BTKL: a = 11,8 + 1,8 - 0,15 x 40 = 7,6 gam → nOX =

TO

Giả sử X là CxHyOz

Ỡ N

G

Vậy x : y : z = 0,4 : 0,4 : 0,15 = 8 : 8 : 3

BỒ

ID Ư

Vậy CTĐGN của X là C8H8O3 → Chọn A. Câu 28: Đáp án C 0,1 mol este X + 0,3 mol NaOH → X là este 3 chức.

• 6,35 gam X + 0,075 mol NaOH → 7,05 gam muối nX = 0,075 : 3 = 0,025 mol, nancol = 0,025 mol Theo BTKL: mancol = 6,35 + 3 - 7,05 = 2,3 gam → Mancol = 2,3 : 0,025 = 92 → glyxerol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ X có dạng (RCOO)3C3H5 MX = 6,35 : 0,025 = 254 → MR = 27 → R là C2H3-

H Ơ

N

Vậy X là (C2H3COO)3C3H5 Câu 29: Đáp án D hhX gồm hai chất hữu cơ đơn chức.

U

Y

N

X + 0,5 mol KOH → muối của hai axit cacboxylic và một ancol

TP .Q

ancol + Na dư → 0,15 mol H2.

ẠO

• nKOH = 0,5 mol

G

Đ

nancol = 2 x nH2 = 2 x 0,15 = 0,3 mol < nKOH

TR ẦN

www.daykemquynhon.ucoz.com

H

Mà thu được 2 muối → Có một chất là este và 1 chất là axit → Chọn A. Câu 30: Đáp án D Z + Cu(OH)2 → 0,05 mol ↓Cu2O

Ư N

Chỉ có 1 chất phản ứng sinh ra rượu.

00

B

Vậy Z là anđehit (Z có số C ≥ 2 vì Z là sản phẩm của phản ứng thủy phân X)

10

→ nZ = 0,05 mol.

2+

3

nX = nZ = 0,05 mol → MX = 4,3 : 0,05 = 86 → X là C4H6O2.

A

C

→ mCH3COONa = 0,05 x 82 = 4,1 gam Câu 31: Đáp án B

ẤP

Mà X không tham gia phản ứng tráng bạc → X là CH3COOCH=CH2

H

Ó

M X = 6, 25.16 = 100 ⇒ X : C5 H 8O2 ; n X = 0, 25mol

-L

Í-

mX + mKOH = 25 + 0, 25.56 = 39 = mZ ⇒ X − la − este − vong

ÁN

⇒ Z : OH − (CH 2 ) 4 COOK

BỒ

ID Ư

Ỡ N

G

TO

48 .100 = 30, 77% 156 Câu 32: Đáp án A 88.0, 2 nX = nBr2 = = 0,11mol 160 ⇒ M X = 86 ⇒ C4 H 6O2

%O =

M muoi = 94 ⇒ C2 H 3COONa ⇒ X : C2 H 3COOCH 3 Câu 33: Đáp án C nNa2CO3 = 0,03 mol; nCO2 = 0,11 mol; nH2O = 0,05 mol.

X là este, khi thủy phân tạo 2 muối (do phần bay hơi chỉ có nước) nên nhóm axit liên kết trực tiếp với vòng benzen.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Do vậy, loại đáp án D ( chỉ tạo 1 muối) nNaOH = 2nNa2CO3 = 0, 06

N

2, 76 = 0, 0226 122

H Ơ

• Xét đáp án A: nX =

2, 76 = 0, 02029 136

TP .Q

• Xét đáp án B: nX =

U

Y

N

Chất HCOOC6H5 phản ứng với NaOH theo tỉ lệ 1 : 2 nên loại đáp án này

Đ G

2, 76 = 0, 02 138

Ư N

• Xét đáp án C: n X =

ẠO

Chất CH3COOC6H5 phản ứng với NaOH theo tỉ lệ 1 : 2 nên loại đáp án này

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Chất HCOOC6H4OH phản ứng với NaOH theo tỉ lệ 1 : 3 nên đáp án này đúng. Câu 34: Đáp án A Ta có este là 3 chức mà khi B tách nước ra được propenal và D tác dụng với H2SO4 tạo ra 3 axit đồng đẳng với HCOOH

10

8, 6 − 7,9 = 0, 025mol 23.3 − 41

3

Tăng giảm khối lượng: neste =

00

→ Este là (CnH2n + 1COO)3C3H5

ẤP

2+

⇒ M este = 316 ⇒ n = 3,33

C

Vậy, axit lớn nhất phải là C4H9COOH

Í-

H

Ó

A

Câu 35: Đáp án D Do hỗn hợp Y gồm hai este đơn chức mạch hở: nY = nNaOH = 0,1 x 0,5 = 0,05 mol.

-L

Theo ĐLBT nguyên tố O: 2nY + 2nO2 = 2nCO2 + nH2O

TO

ÁN

→ nH2O = 2 x 0,05 + 2 x 0,25 - 2 x 0,2 = 0,2 mol.

G

→ nCO2 : nH2O = 0,2 : 0,2 = 1 : 1

ID Ư

Ỡ N

→ Y là hỗn hợp este no đơn chức với số C = nCO2: nY = 4 → C4H8O2

BỒ

Mà 2 este là đồng phân của nhau + NaOH → 1 muối của axit cacboxylic và hỗn hợp 2 rượu

→ 2 este là HCOOCH2CH2CH3 và HCOOCH(CH3)2 → Chọn D. Câu 36: Đáp án B nCO2 = nH 2O = 0,13 ⇒ X và Y đều là no, đơn chức, hở

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

nX = a; nY = b ⇒ a + b = 0,05

H Ơ

N

Bảo toàn oxi: a + 2b + 0,155.2 = 0,13.2 + 0,13 ⇒ a + 2b = 0, 08 ⇒ a = 0, 02; b = 0, 03 X : Cn H 2 n O; Y : Cm H 2 mO2

N

nCO2 = 0, 02n + 0, 03m = 0,13 ⇒ 2n + 3m = 13

U

Y

⇒ n = 2; m = 3 ⇒ C2 H 4O(CH 3CHO ); C3 H 6O2

TP .Q

nAg = 0, 2 = 2n X ( nX = 0,1) ⇒ Y : HCOOC2 H 5

ẠO

Câu 37: Đáp án C 0,5 mol X cho ra 0,4 mol Ag nên trong X có 1 este là HCOOR → nHCOOR = 0,4:2 = 0,2 mol

www.daykemquynhon.ucoz.com

H

→ nCH3COOR1 = 0,5- 0.2 = 0,3 mol → nHCOOR : nCH3COOR1 = 2:3

Ư N

G

Đ

Mặt khác khi thủy phân X trong KOH cho hỗn hợp hai muối của 2 axit đồng đẳng kế tiếp nên este còn lại là CH3COOR1

TR ẦN

Trong 14,8 gam X gọi số mol của HCOOR là 2x, số mol của CH3COOR1: 3x mol

B

Bảo toàn khối lượng : mX + mKOH = mmuoi + mancol

00

14, 08 + (0, 2 x + 0,3x).56 = 0, 2 x.M HCONa + 0,3x.M CH3COONa + 8, 256

3

10

⇒ x = 0,32 ⇒ nancol = (3 + 2).x = 0,16

2+

8, 256 = 51, 6 → mà 2 ancol kế tiếp nhau có công thức C2H5OH và C3H7OH 0,16

ẤP

⇒ M ancol =

A

C

Câu 38: Đáp án A

H

Ó

R1 − OOC − COOR2 + 2 NaOH → (COONa)2 + R1 − OH + R2 − OH

Í-

R1 − OOC − COOR1 + 2 NaOH → (COONa)2 + 2 R1 − OH

-L

R2 − OOC − COOR2 + 2 NaOH → (COONa)2 + 2 R2 − OH

TO

ÁN

Trong phản ứng thủy phân este bằng NaOH thì Na đã thay thế các gốc -R1 và -R2

Ỡ N

G

Sau phản ứng ta thấy khối lượng muối lớn hơn khối lượng este ban đầu → có ít nhất 1 trong 2 gốc R1 và R2 có KLPT nhỏ hơn Na(23).

BỒ

ID Ư

Mặt khác 2 gốc -R1, R2 là no → có 1 gốc là metyl → gốc còn lại là etyl → 2 ancol là CH3OH và C2H5OH Câu 39: Đáp án B Phản ứng với NaOH tỉ lệ 1 : 2 nên X có thể là este của phenol hoặc este 2 chức.

Ở đây, từ 4 đáp án ta kết luận X là este của phenol. 44nCO2 + 18nH 2O = 1, 7 + 3, 6 nCO2 = 0,1 Ta có hpt:  ⇒ nCO2 = 2nH 2O nH 2O = 0, 05

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn ⇒ MX =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

1, 7 = 136 ⇒ C8 H 8O2 1,7 − 0,1.12 − 0,05.2 32

H Ơ

N

X không có phản ứng tráng gương nên CTCT là CH3COOC6H5.

U

Y

N

Câu 40: Đáp án B nNaOH = 0,3 mol; nancol = 0,1 mol.

TP .Q

Theo BTKL: mancol = 21,8 + 0,3 x 40 - 24,6 = 9,2 gam → Mancol = 9,2 : 0,1 = 92

ẠO

→ Ancol là C3H5(OH)3.

G

Đ

X + NaOH → muối + C3H5(OH)3

Ư N

Vậy X là trieste của glixerol.

H TR ẦN

www.daykemquynhon.ucoz.com

Giả sử X là (RCOO)3C3H5

nX = nancol = 0,1 mol → MX = 21,8 : 0,1 = 218 → MR = 15 → R là CH3-

3

10

00

B

Vậy X là (CH3COO)3C3H5 → Chọn B. Câu 41: Đáp án C CH3COOC6H5 ( phenyl axetat) + 2NaOH → CH3COONa + C6H5ONa + H2O (1)

2+

CH3COOCH2-CH=CH2 (anlyl axetat,)+ NaOH → CH3COONa + CH2=CH-CH2OH (2)

C

ẤP

CH3COOCH3 (metyl axetat) + NaOH → CH3COONa + CH3OH (3)

H

Ó

A

HCOOC2H5 (etyl fomat) + NaOH → HCOONa + C2H5OH (4)

-L

Í-

C3H5(OOCC15H15)3 ( tripanmitin) + 3NaOH → C3H5(OH)3 + 3C15H31COONa (5)

TO

ÁN

Như vậy có 4 chất anlyl axetat, metyl axetat, etyl fomat, tripanmitin thủy phân tạo ancol. Đáp án C. Câu 42: Đáp án D Bảo toàn khối lượng : m + 0,3 × 40 = m - 8,4 + m - 1,1→ m = 21,5 gam.

Ỡ N

G

44 < Mtrung bình andehit = 52,4 < 58 → 2 andehit là CH3CHO và C2H5CHO

BỒ

ID Ư

nandehit =

21, 5 − 8, 4 = 0,25 mol → nNaOH dư = 0,3- 0,25 = 0,05 mol 52, 4

21, 5 − 1,1 − 0, 05.40 = 73,6 > 68 → trong muối chắc chắn có HCOONa→ đáp án D. 0, 25 Câu 43: Đáp án B Khi đốt cháy hoàn toàn hỗn hợp X thu được CO2 và hơi nước với thể tích bằng nhau (ở cùng điều kiện) → 2 este thuộc loại no đơn chức

→ Mmuối =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Luôn có nX = nNaOH = 0,03 mol → MX = 74 (C3H6O2)

H Ơ

N

Các đông phân của X là HCOOC2H5 và CH3COOCH3. Đáp án B. Câu 44: Đáp án C Nhận thấy C2H3COOC3H33 và C2H5COOC2H3 khi thủy phân không thu được ancol bền → loại B, D

N

Ta có este đơn chức → nNaOH = neste = 0,05 mol → M X = 5,7 : 0,05 = 114 ( C6H10O2)

TP .Q

U

Y

Chỉ có hợp chất ở C mới thỏa mãn → đáp án C. Câu 45: Đáp án B Ta có nX = 0,1 mol .

ẠO

Luôn có nmuối = nX = 0,1 mol → Mmuối = 98 ( HO-CH2-COONa)

H

Ư N

G

Đ

Vậy X có cấu tạo HO-CH2COOC2H5. Đáp án B. Câu 46: Đáp án B Nhận thấy nếu X là hỗn hợp của axit và ancol khi tham gia phản ứng thủy phân không sinh được 2 muối của hai axit cacboxylic → loại C

TR ẦN

www.daykemquynhon.ucoz.com

Ta có X là hỗn hợp đơn chức nên khi tham gia phản ứng thủy phân sinh ancol đơn chức → Trong X chứa este và nancol = 2nH2 = 0,3 mol

B

Thấy nancol = 0,3 mol < nKOH = 0,5 mol → X chứa este : 0,3 mol và axit : 0,2 mol

2+

3

10

00

Câu 47: Đáp án A Chú ý X tham gia phản ứng với NaOH theo tỉ lệ 1:2 nên dạng HCOOC6H4OH không được ( phản ứng với NaOH theo tỉ lệ 1:3)

-L

Í-

H

Ó

A

C

ẤP

Các đồng phân thỏa mãn đề bài là

TO

ÁN

Đáp án A. Câu 48: Đáp án A Các đồng phân X thỏa mãn là:

G

HCOO − C2 H 4 − OOCC2 H 5

Ỡ N

HCOO − CH 2CH 2CH 2 − OOCCH 3

ID Ư

HCOO − CH 2 − CH (CH 3 ) − OOCCH 3

BỒ

CH 3COO − CH 2 − CH (CH 3 ) − OOCH

CH 3OC − COOCH 2C2 H 5 CH 3OOC − COOCH (CH 3 ) 2 CH 3OOC − CH 2 − COOC2 H 5

Câu 49: Đáp án D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Điều kiện NaOH đặc, dư, ở nhiệt độ và áp suất cao thì có thể phản ứng trong tất cả các trường hợp. Phương trình:

N

NaOH CH 3COOCH 2CH 2Cl  → CH 3COONa + NaCl + CH 2OH − CH 2OH (1)

H Ơ

NaOH NH 3Cl − CH 2COOH  → NH 2 − CH 2COONa + NaCl + H 2O (2)

N

NaOH C6 H 5Cl  → C6 H 5ONa + NaCl + H 2O (3)

Y

NaOH HCOOC6 H 5  → HCOONa + C6 H 5ONa + H 2O(4)

TP .Q

U

NaOH C6 H 5 − COOCH 3  → C6 H 5COONa + CH 3OH (5) NaOH OH − C6 H 4 − CH 2OH  → ONa − C6 H 4 − CH 2OH + H 2O (6)

ẠO

NaOH CH 3CCl3  → CH 3COONa + NaCl + H 2O (7)

Đ

NaOH CH 3COOC (Cl )2 − CH 3  → CH 3COONa + NaCl + H 2O (8)

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Vậy có 6 chất tạo 2 muối ( trừ (5) và (6) . Câu 50: Đáp án A X là este được tạo bởi axit 2 chức, mạch hở và ancol no, 2 chức, mạch hở → X là este 2 chức và có 1 vòng → công thức của X là CnHmO4

00

6.2 + 2 − 4 = 5 = 2π COO + 1 vòng + 2π C=C 2

10

Luôn có π + v=

B

Mà X có công thức đơn giản nhất là C3H2O2 → công thức phân tử của X là C6H4O4 ( Do X là este 2 chức)

2+

3

→ Để hiđro hóa hoàn toàn 1 mol X (Ni, t0): nH2 = 2π C=C = 2 mol.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

Đáp án A.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1. Số đồng phân este ứng với công thức phân tử C4H8O2 là A. 6. B. 5. C. 2. D. 4. Câu 2. Đốt cháy hoàn toàn m gam chất béo X (chứa triglixerit của axit stearic, axit panmitic và các axit béo tự do đó). Sau phản ứng thu được 6,72 lít CO2 (đktc) và 5,22 gam nước. Xà phòng hoá m gam X (H = 90%) thì thu được khối lượng glixerol là A. 0,414 gam B. 1,242 gam C. 0,828 gam D. 0,46 gam Câu 3. Cho các phát biểu sau: (1) Nguyên nhân làm dầu mỡ bị ôi thiu là do các liên kết pi trong gốc hiđrocacbon của axit béo không no. (2) Các triglixerit chứa chủ yếu các gốc axit béo no thường là chất lỏng ở nhiệt độ thường (3) Thủy phân este trong môi trường axit luôn là phản ứng thuận nghịch. (4) Các este đều có nhiệt độ sôi cao hơn axit có cùng số nguyên tử cacbon. (5) Các chất béo đều không tan trong nước nhưng tan nhiều trong các dung môi hữu cơ. (6) Cho metyl axetat hoặc tristearin vào dung dịch NaOH đun nóng đều xảy ra phản ứng xà phòng hóa. Số phát biểu đúng là: A. 5 B. 4 C. 3 D. 2 Câu 4. Cho các chất sau: axit propionic (X), axit axetic (Y), ancol etylic (Z) và etyl propionat (T). Dãy gồm các chất được sắp xếp theo chiều tăng của nhiệt độ sôi là ? A. Y, T, X, Z. B. T, X, Y, Z. C. T, Z, Y, X. D. Z, T, Y, X. Câu 5. Cho glixerol tác dụng với hỗn hợp ba axit C17H35COOH, C17H33COOH và C15H31COOH. Số loại trieste có thể được tạo thành chứa hai gốc axit trong số ba axit béo trên là A. 9 B. 6 C. 12 D. 10 Câu 6. Cho dãy các chất: phenyl axetat, metyl benzoat, metyl metacrylat, anlyl axetat, metyl axetat, etyl fomat, triolein, vinyl axetat, tristearin. Số chất trong dãy khi thủy phân trong dung dịch NaOH loãng (dư), đun nóng sinh ra ancol là A. 6. B. 7. C. 5. D. 8. Câu 7. Cho các phát biểu sau: (a) Chất béo được gọi chung là triglixerit hay triaxylglixerol. (b) Chất béo nhẹ hơn nước, không tan trong nước nhưng tan nhiều trong dung môi hữu cơ. (c) Phản ứng thủy phân chất béo trong môi trường axit là phản ứng thuận nghịch.

N

KIỂM TRA HẾT CHƯƠNG ESTE - LIPIT (Đề 2)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

(d) Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5. Số phát biểu đúng là A. 4 B. 1 C. 3 D. 2 Câu 8. Từ ancol etylic và các chất vô cơ cần thiết, ta có thể điều chế trực tiếp ra các chất nào sau đây ? (1). Axit axetic (2). Axetanđehit (3). Buta-1,3-đien (4). Etyl axetat A. (1), (2) và (3) B. (1), (2) và (4) C. (1), (3) và (4) D. (1), (2),(3) và (4) Câu 9. Hợp chất CH3(CH2)7CH=CH(CH2)7COOCH3 có tên gọi là A. Metyl oleat B. Metyl panmitat C. Metyl stearat D. Metyl acrylat Câu 10. Có các nhận định sau: (1) Axit salixylic còn có tên gọi khác là axit o-hiđroxibenzoic (2) Axit oleic và axit linoleic là đồng phân của nhau (3) Axit axetylsalixylic tác dụng được với dung dịch NaOH theo tỉ lệ 1:2 về số mol (4) Khi thủy phân chất béo luôn thu được glixerol Số nhận định sai là A. 1 B. 4 C. 2 D. 3 Câu 11. Mệnh đề không đúng là: A. CH3CH2COOCH=CH2 cùng dãy đồng đẳng với CH2=CHCOOCH3. B. CH3CH2COOCH=CH2 tác dụng với dung dịch NaOH thu được anđehit và muối. C. CH3CH2COOCH=CH2 tác dụng được với dung dịch Br2. D. CH3CH2COOCH=CH2 có thể trùng hợp tạo polime. Câu 12. Số hợp chất là đồng phân cấu tạo, có cùng công thức phân tử C4H8O2, tác dụng được với dung dịch NaOH nhưng không tác dụng được với Na là A. 3 B. 2 C. 4 D. 1 Câu 13. Phát biểu đúng là: A. Phản ứng thủy phân este trong môi trường axit là phản ứng thuận nghịch. B. Phản ứng giữa axit và ancol khi có H2SO4 đặc là phản ứng một chiều. C. Tất cả các este phản ứng với dung dịch kiềm luôn thu được sản phẩm cuối cùng là muối và ancol. D. Khi thủy phân chất béo luôn thu được C2H4(OH)2. Câu 14. Phát biểu nào sau đây sai ? A. Nhiệt độ sôi của este thấp hơn hẳn so với ancol có cùng phân tử khối. B. Trong công nghiệp có thể chuyển hoá chất béo lỏng thành chất béo rắn. C. Số nguyên tử hiđro trong phân tử este đơn và đa chức luôn là một số chẵn. D. Sản phẩm của phản ứng xà phòng hoá chất béo là axit béo và glixerol.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

o

N

Câu 15. Cho glixerin trioleat (hay triolein) lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, CH3OH, dung dịch Br2, dung dịch NaOH. Trong điều kiện thích hợp, số phản ứng xảy ra là A. 4 B. 2 C. 3 D. 5 Câu 16. Cho sơ đồ chuyển hoá: o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

+ H 2 du ,( Ni ,t ) + NaOHdu ,t + HCl Triolein  → X  → Y  →Z Tên của Z là A. axit oleic. B. axit linoleic. C. axit stearic. D. axit panmitic. Câu 17. Hợp chất hữu cơ mạch hở X có công thức phân tử C6H10O4. Thuỷ phân X tạo ra hai ancol đơn chức có số nguyên tử cacbon trong phân tử gấp đôi nhau. Công thức của X là A. CH3OCO-CH2-COOC2H5. B. C2H5OCO-COOCH3. C. CH3OCO-COOC3H7. D. CH3OCO-CH2-CH2-COOC2H5. Câu 18. Khi đốt cháy hoàn toàn một este no, đơn chức thì số mol CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este là A. metyl fomat. B. etyl axetat. C. metyl axetat. D. n-propyl axetat. Câu 19. Este X có các đặc điểm sau: - Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau; - Thuỷ phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z (có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X). Phát biểu không đúng là: A. Chất X thuộc loại este no, đơn chức. B. Đốt cháy hoàn toàn 1 mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O. C. Chất Y tan vô hạn trong nước. D. Đun Z với dung dịch H2SO4 đặc ở 170oC thu được anken. Câu 20. Thuỷ phân este Z trong môi trường axit thu được hai chất hữu cơ X và Y (MX < MY). Bằng một phản ứng có thể chuyển hoá X thành Y. Chất Z không thể là A. metyl propionat. B. metyl axetat. C. etyl axetat. D. vinyl axetat. Câu 21. Thuỷ phân chất hữu cơ X trong dung dịch NaOH (dư), đun nóng, thu được sản phẩm gồm 2 muối và ancol etylic. Chất X là A. CH3COOCH2CH3. B. CH3COOCH2CH2Cl. C. CH3COOCH(Cl)CH3. D. ClCH2COOC2H5. Câu 22. Xà phòng hoá một hợp chất có công thức phân tử C10H14O6 trong dung dịch NaOH (dư), thu được glixerol và hỗn hợp gồm ba muối (không có đồng phân hình học). Công thức của ba muối đó là:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. CH2=CH-COONa, CH3-CH2-COONa và HCOONa. B. HCOONa, CH≡C-COONa và CH3-CH2-COONa. C. CH2=CH-COONa, HCOONa và CH≡C-COONa. D. CH3-COONa, HCOONa và CH3-CH=CH-COONa. Câu 23. Cho chất X tác dụng với một lượng vừa đủ dung dịch NaOH, sau đó cô cạn dung dịch thu được chất rắn Y và chất hữu cơ Z. Cho Z tác dụng với AgNO3 trong dung dịch NH3 thu được chất hữu cơ T. Cho chất T tác dụng với dung dịch NaOH lại thu được chất Y. Chất X có thể là A. HCOOCH3. B. HCOOCH=CH2. C. CH3COOCH=CH-CH3. D. CH3COOCH=CH2. Câu 24. Chất hữu cơ X có công thức phân tử C4H6O4 tác dụng với dung dịch NaOH (đun nóng) theo phương trình phản ứng: C4H6O4 + 2NaOH  2Z + Y. Để oxi hoá hết a mol Y thì cần vừa đủ 2a mol CuO (đun nóng), sau phản ứng tạo thành a mol chất T (biết Y, Z, T là các hợp chất hữu cơ). Khối lượng phân tử của T là A. 44 đvC. B. 58 đvC. C. 82 đvC. D. 118 đvC. Câu 25. Chất X có công thức phân tử CxHyOz. Cho X tác dụng với NaOH thu được Y và Z. Biết Z không tác dụng được với Na và có sơ đồ chuyển hóa sau: + O2 + NaOH + NaOH ankan đơn giản nhất → T → Z  Y → xt ,t o CaO ,t o

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

Thành phần phần trăm theo khối lượng của cacbon trong X là A. 55,81%. B. 48,65%. C. 40,00%. D. 54,55%. Câu 26. Một hỗn hợp X gồm hai chất hữu cơ đơn chức. Cho X phản ứng vừa đủ với 500 ml dung dịch KOH 1M. Sau phản ứng, thu được hỗn hợp Y gồm hai muối của hai axit cacboxylic và một ancol. Cho toàn bộ lượng ancol thu được ở trên tác dụng với Na (dư), sinh ra 3,36 lít H2 (ở đktc). Hỗn hợp X gồm A. một axit và một este. B. một este và một ancol. C. hai este. D. một axit và một ancol. Câu 27. Cho 10 gam chất X (chỉ chứa nhóm chức este có phân tử khối là 100 đvC) tác dụng với 150 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 11,6 gam chất rắn khan và một chất hữu cơ Y. Công thức của Y là A. CH3OH. B. C2H5OH. C. CH3CHO. D. CH3COCH3. Câu 28. Cho m gam một este E vào một lượng vừa đủ KOH đun nóng thu được dung dịch X. Cô cạn X thu được 16,5 gam muối khan của một axit đơn chức và 6,9 gam một ancol đơn chức Y. Cho toàn bộ Y tác dụng với Na dư thu được 1,68 lít khí (ở đktc). Tên của E là A. etyl propionat B. etyl acrylat C. metyl metacrylat D. etyl axetat

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 29. Cho 10,2 gam một este đơn chức X tác dụng vừa đủ với 40 gam dung dịch NaOH 15%. Số đồng phân cấu tạo thỏa mãn điều kiện trên của X là A. 3 B. 4 C. 5 D. 6 Câu 30. Cho 2,07 gam chất hữu cơ X (có công thức phân tử C7H6O3) tác dụng với dung dịch NaOH vừa đủ, sau đó làm khô, phần bay hơi chỉ có nước, phần rắn khan còn lại chứa hỗn hợp hai muối. Nung hai muối này trong oxi dư, thu được 2,385 gam Na2CO3 và m gam hỗn hợp khí và hơi. Số đồng phân cấu tạo của X là A. 3 B. 2 C. 5 D. 4 Câu 31. Đốt cháy hoàn toàn a mol một este no, đơn chức mạch hở X, cần b mol O2, tạo ra c mol hỗn hợp CO2 và H2O. Biết c = 2(b-a). Số đồng phân este của X là A. 4 B. 3 C. 2 D. 6 Câu 32. Đốt cháy 1,6 gam một este E đơn chức được 3,52 gam CO2 và 1,152 gam H2O. Nếu cho 10 gam E tác dụng với 150ml dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng thu được 16 gam chất rắn khan. Công thức của chất chứa chức axit tạo nên este trên có thể là A. HOOC(CH2)3CH2OH B. HOOC-CH2-CH(OH)-CH3 C. CH2=C(CH3)-COOH D. CH2=CH-COOH Câu 33. Hai este X, Y có cùng công thức phân tử C8H8O2 và chứa vòng benzen trong phân tử. Cho 6,8 gam hỗn hợp gồm X và Y tác dụng với NaOH dư, đun nóng, lượng NaOH phản ứng tối đa là 0,07 mol, thu được dung dịch Z chứa 6,0 gam ba muối. Khối lượng muối của axit cacboxylic có phân tử khối lớn hơn trong Z là A. 1,64 gam. B. 2,04 gam. C. 2,32 gam. D. 2,46 gam. Câu 34. Cho sơ đồ phản ứng sau: Este X + NaOH → CH3COONa + chất hữu cơ Y

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

xt Y + O2  → Y1 ; Y1 + NaOH → CH3COONa + H2O Số chất X thỏa mãn sơ đồ trên là: A. 1. B. 4. C. 2. D. 3. Câu 35. Cho các este: vinyl axetat, etyl axetat, isoamyl axetat, phenyl axetat, anlyl axetat, vinyl benzoat. Số este có thể điều chế trực tiếp bằng phản ứng của axit và ancol tương ứng (có H2SO4 đặc làm xúc tác) là A. 5. B. 3. C. 4. D. 2.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 36. Từ hai axit béo: axit stearic; axit panmitic có thể tạo ra tối đa x triglixerit. Giá trị của x là A. 4. B. 2. C. 3. D. 6. Câu 37. Cho 17,68 gam triolein làm mất màu vừa đủ V (ml) nước brom 0,2M. Giá trị của V là A. 100 B. 600 C. 300 D. 274,53 Câu 38. Thuỷ phân hoàn toàn 1,8 gam một este đơn chức X, rồi cho toàn bộ sản phẩm tác dụng với lượng dư dung dịch AgNO3/NH3 sau khi phản ứng xong thu được 10,8 gam Ag. Công thức phân tử của X là: A. C3H4O2 B. C4H4O2 C. C4H6O2 D. C2H4O2 Câu 39. Cho 2,496 gam p-CH3COOC6H4COOC2H5 vào 200 ml NaOH 0,2M đun nóng thu được dung dịch X. Cô cạn X thu được a gam chất rắn khan. Giá trị của a là A. 4,096 B. 3,328 C. 3,168 D. 3,544 Câu 40. Đốt cháy hoàn toàn 16,6 gam hỗn hợp G gồm một axit no, đơn chức, mạch hở X và một ancol đơn chức Y (MX < MY) thu được 15,68 lít CO2 và 16,2 gam H2O. Cho toàn bộ hỗn hợp G ở trên vào H2SO4 đặc, đun nóng thu được 6,6 gam este. Hiệu suất phản ứng este hóa là A. 75% B. 37,5% C. 64,7% D. 32,35% Câu 41. Hỗn hợp X gồm axit panmitic, axit stearic và axit linoleic. Để trung hòa m gam X cần 40 ml dung dịch NaOH 1M. Mặt khác, nếu đốt cháy hoàn toàn m gam X thì thu được 15,232 lít khí CO2 (đktc) và 11,7 gam H2O. Số mol của axit linoleic trong m gam hỗn hợp X là A. 0,015. B. 0,01. C. 0,02. D. 0,005. Câu 42. Cho 4,48 gam hỗn hợp gồm CH3COOC2H5 và CH3COOC6H5 (có tỉ lệ mol là 1:1) tác dụng với 800 ml dung dịch NaOH 0,1M thu được dung dịch X. Cô cạn dung dịch X thì khối lượng chất rắn thu được là A. 5,6 gam. B. 6,4 gam C. 4,88 gam. D. 3,28 gam. Câu 43. Cho 18,3 gam hỗn hợp X gồm hai hợp chất hữu cơ đơn chức là dẫn xuất của benzen có cùng công thức phân tử C7H6O2 tác dụng hết với dung dịch AgNO3 trong NH3 thu được 10,8 gam Ag. Vậy khi cho 9,15 gam X nói trên tác dụng với 300 ml dung dịch NaOH 1M, rồi cô cạn dung dịch sau phản ứng sẽ thu được bao nhiêu gam chất rắn khan ? A. 19,8 gam. B. 20,8 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. 16,4 gam. D. 8,0 gam. Câu 44. Đốt cháy hoàn toàn m gam hỗn hợp H gồm: axit acrylic; metyl acrylat; metyl metacrylat thu được hỗn hợp sản phẩm X. Cho X hấp thụ hoàn toàn trong 130ml Ba(OH)2 1M thu được 5,91 gam chất rắn đồng thời thu được dung dịch Y có khối lượng dung dịch tăng lên so với dung dịch Ba(OH)2 ban đầu là 7,27 gam. Đun nóng Y lại thu thêm kết tủa nữa. Giá trị của m là A. 5,02 B. 1,67 C. 13,18 D. 4,85 Câu 45. Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai este đồng phân của nhau cần dùng 0,525 mol O2 và thu được 0,45 mol CO2, 0,45 mol H2O. Nếu cho m gam X tác dụng hết với 0,2 mol NaOH, rồi cô cạn dung dịch tạo thành còn lại 12,9 gam chất rắn khan. Phần trăm khối lượng của este có số nguyên tử cacbon trong gốc axit nhỏ hơn trong X là A. 33,33%. B. 66,67%. C. 60,00%. D. 50,00%. Câu 46. Xà phòng hóa hoàn toàn 66,6 gam hỗn hợp hai este HCOOC2H5 và CH3COOCH3 bằng dung dịch NaOH, thu được hỗn hợp X gồm hai ancol. Đun nóng hỗn hợp X với H2SO4 đặc ở 140oC, sau khi phản ứng xảy ra hoàn toàn thu được m gam nước. Giá trị của m là A. 4,05. B. 8,10. C. 16,20. D. 18,00. Câu 47. Hỗn hợp X gồm HCOOH và CH3COOH (tỉ lệ mol 1:1); hỗn hợp Y gồm CH3OH và C2H5OH (tỉ lệ mol 3 : 2). Lấy 11,13 gam hỗn hợp X tác dụng với 7,52 gam hỗn hợp Y có xúc tác H2SO4 đặc, đun nóng. Khối lượng của este thu được là (biết hiệu suất các phản ứng este đều 75%) A. 11,43 gam B. 10,89 gam C. 14,52 gam D. 15,25 gam Câu 48. Khi thuỷ phân 0,1 mol este X được tạo bởi một ancol đa chức với một axit cacboxylic đơn chức cần dùng vừa đủ 12 gam NaOH. Mặt khác để thuỷ phân 6,35 gam X cần dùng 3 gam NaOH và thu được 7,05 gam muối. Công thức của X là: A. (CH3COO)3C3H5 B. (HCOO)3C3H5 C. (C2H3COO)3C3H5 D. (CH3COO)2C2H4 Câu 49. Đun nóng m gam hỗn hợp X gồm các chất có cùng một loại nhóm chức với 600 ml dung dịch NaOH 1,15M, thu được dung dịch Y chứa muối của một axit cacboxylic đơn chức và 15,4 gam hơi Z gồm các ancol. Cho toàn bộ Z tác dụng với Na dư, thu được 5,04 lít khí H2 (đktc). Cô cạn dung dịch Y, nung nóng chất rắn thu được với CaO cho đến khi phản ứng xảy ra hoàn toàn, thu được 7,2 gam một chất khí. Giá trị của m gần nhất với A. 22,5 B. 34,0 C. 34,5 D. 40,5

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 50. Cho sơ đồ chuyển hóa: o

NaOHdac + HCl t cao , pcao CuOdu → X  → Y  → Z  →T Phenyl clorua  t o cao , pcao to

N

H Ơ

N

Biết X, Y, Z, T là các chất hữu cơ. Phát biểu nào sau đây đúng ? A. Dung dịch của X làm quỳ tím chuyển sang màu đỏ. B. Y làm mất màu nước brom. C. Z là ancol no, đơn chức, mạch hở. D. T có phản ứng tráng gương.

U

Y

LỜI GIẢI CHI TIẾT

TP .Q

Câu 1: D HCOO − CH 2 − CH 2 − CH 3

HCOO − CH (CH 3 ) − CH 3

ẠO

CH 3COO − CH 2 − CH 3

H

Ư N

G

Đ

C2 H 5COO − CH 3  Có 4 đồng phân Câu 2: A • nCO2 = 0,3 mol; nH2O = 0,29 mol

TR ẦN

3

n(CnH2n + 1COO)3C3H5 = nC3H5(OH)3 = 0,005 mol

10

00

 x(3n + 6) + x(n + 1) = 0,3 Ta có hpt:  → x = 0,005 mol  x(3n + 4) + y (n + 1) = 0, 29

B

www.daykemquynhon.ucoz.com

Gọi công thức trung bình của triglixerit và axit tự do là (CnH2n + 1COO)3C3H5 và CnH2n + 1 với số mol lần lượt là x, y mol.

A

C

ẤP

2+

Do H = 90% → mC3H5(OH)3 = 0,005 x 92 x 90% = 0,414 gam Câu 3: B Nguyên nhân làm dầu mỡ bị ôi thiu là do liên kết πC=C bị oxi hóa chậm bởi oxi không khí tạo thành peoxit, chất này bị phân hủy thành các sản phẩm có mùi khó chịu → (1) đúng

H

Ó

Các triglixerit chứa chủ yếu các gốc axit béo no thường là chất rắn ở nhiệt độ thường → (2) sai

-L

Í-

Phản ứng thủy phân este trong axit là thuận nghịch, phản ứng thủy phân trong môi trường kiềm là phản ứng 1 chiều → (3) đúng

TO

ÁN

Các axit tồn tại liên kết hidro, este không chứa liên kết hidro nên các este đều có nhiệt độ sôi thấp hơn axit có cùng số nguyên tử cacbon → (4) sai

Ỡ N

G

Chất béo là trieste của glixerol và axit béo → chất béo là hợp chất không phân cực , không tan trong nước nhưng tan nhiều trong các dung môi hữu cơ → (5) đúng

BỒ

ID Ư

Phản ứng thủy phân este trong môi trường kiềm là phản ứng xà phòng hóa → (6) đúng

Câu 4: C Etyl propionat là hợp chất không chứ liên kết hidro là chất có nhiệt độ sôi thấp nhất → nhiệt độ sôi của T < X, Y, Z

Do có nhóm CO hút e trong phân tử nên X, Y có độ bền liên kết hidro lớn hơn trong ancol Z → nhiệt độ sôi của Z < X, Y Do MX > MY → nên nhiệt độ sôi của X>Y

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Thứ tự nhiệt độ sôi của các chất là T< Z< Y< X. Câu 5: C Chọn 2 trong 3 axit có C32 = 3 cách chọn

H Ơ

N

Có 4 cách sắp xếp trieste tạo bởi axit A,B và glixerol . ( A-A-B, A-B-A, B-B-A, B-A-B)

Y

TP .Q

U

Câu 6: B Các chất trong dãy khi thủy phân trong dung dịch NaOH loãng (dư), đun nóng sinh ra ancol là: metyl benzoat, metyl metacrylat, anlyl axetat, metyl axetat, etyl fomat, triolein, tristearin

N

Số loại trieste có thể được tạo thành chứa hai gốc axit trong số ba axit béo trên là : 3. 4= 12 .

www.daykemquynhon.ucoz.com

Đ G Ư N H

mengiam (1) CH3COOH: C2H5OH + O2  → CH3COOH + H2O 25− 30o C

ẠO

Vậy có 7 chất. Đáp án B Câu 7: A Câu 8: A • Từ ancol và các chất vô cơ cần thiết, ta có thể điều chế trực tiếp

TR ẦN

o

t → CH3CHO + Cu + H2O (2) CH3CH2OH + CuO  o

00

B

Al2O3 ,450 C (3) 2C2H5OH  → CH2=CH-CH=CH2 + 2H2O + H2

2+

3

10

CH3COOC2H5 điều chế trực tiếp từ C2H5OH và CH3COOH nên không thỏa mãn. Câu 9: A • Giả sử este là RCOOR'. Tên este gồm: tên gốc hiđrocacbon R' + tên anion gốc axit (đuôi "at")

ẤP

Metyl oleat là CH3(CH2)7CH=CH(CH2)7COOCH3

C

Metyl panmitat là CH3(CH2)14COOCH3

H

Ó

A

Metyl stearat là CH3(CH2)16COOCH3

-L

Í-

Metyl acrylat là CH2=CHCOOCH3.

TO

ÁN

Câu 10: C • (2) sai vì axit oleic là C17H33COOH, axit linoleic là C17H31COOH nên hai chất không là đồng phân của nhau.

Ỡ N

G

(3) sai vì axit axetylsalixylic tác dụng được với dung dịch NaOH theo tỉ lệ 1 : 3 về số mol: o-CH3COO-C6H4-COOH + 3KOH → CH3COOK + KO-C6H4-COOK + 2H2O

BỒ

ID Ư

(1), (4) đúng.

Câu 11: A • Đáp án A sai. CH3CH2COOCH=CH2 có nối đôi gắn vào gốc hiđrocacbon còn CH2=CHCOOCH3 có nối đôi gắn vào anion gốc axit nên không cùng dãy đồng đẳng. Đáp án B đúng. CH3CH2COOCH=CH2 + NaOH → CH3CH2COONa + CH3CHO

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Đáp án C đúng. CH3CH2COOCH=CH2 + Br2 → CH3CH2COOCHBr-CH2Br o

H Ơ

N

t , xt Đáp án D đúng. nCH3CH2COOCH=CH2  → -(-CH(OCOCH2CH3)-CH2-)n-. Câu 12: C • Có 4 đồng phân cấu tạo thỏa mãn là

N

1, HCOOCH2CH2CH3

U

Y

2, HCOOCH(CH3)2

TP .Q

3, CH3COOCH2CH3

ẠO

4, CH3CH2COOCH3

Ư N

G

Đ

Câu 13: A • Đáp án A đúng.

www.daykemquynhon.ucoz.com

H

Đáp án B sai vì phản ứng giữa axit và ancol khi có H2SO4 đặc là phản ứng hai chiều.

TR ẦN

Đáp án C sai vì este CH3COOCH=CH2 phản ứng với dung dịch kiềm thu được sản phẩm cuối cùng là muối và anđehit.

3

10

00

B

Đáp án D sai vì khi thủy phân chất béo luôn thu được C3H5(OH)3. Câu 14: D • Đáp án A đúng vì ancol có liên kết hiđro nên có nhiệt độ sôi cao hơn este có cùng phân tử khối.

ẤP

2+

Đáp án B đúng. Trong công nghiệp có thể chuyển hóa chất béo lỏng thành chất béo rắn bằng phản ứng hiđro hóa.

Ó

A

C

Đáp án C đúng. CTC của este là CnH2n + 2 - 2k - 2xO2x nên este đơn chức và đa chức luôn là một số chẵn.

-L

Í-

H

Đáp án D sai. Sản phẩm của phản ứng xà phòng hóa chất béo là xà phòng và glixerol. Câu 15: B • Trong điều kiện thích hợp, triolein phản ứng được với Br2 và NaOH:

ÁN

(C17H33COO)3C3H5 + 3Br2 → (C17H33Br2COO)3C3H5

G

TO

(C17H33COO)3C3H5 + 3NaOH → 3C17H33COONa + C3H5(OH)3

BỒ

ID Ư

Ỡ N

Câu 16: C Ni ,t o • (C17H33COO)3C3H5 + 3H2  → (C17H35COO)3C3H5 (X) o

t (C17H35COO)3C3H5 + 3NaOH  → 3C17H35COONa (Y) + C3H5(OH)3

C17H35COONa + HCl → C17H35COOH (Z) + NaCl Vậy Z là C17H35COOH → Chọn C. Câu 17: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn • C6H10O4 có độ bất bão hòa k =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

6.2 + 2 − 10 =2 2

Thủy phân X thu được 2 ancol → X là este hai chức.

H Ơ

N

Hai ancol có số C gấp đôi nhau → C1 và C2 (dựa vào đáp án)

Y U TP .Q

3n − 2 O2 → nCO2 + nH2O 2

3n − 2 = n → n = 2 → C2H4O2 → HCOOCH3 → metyl fomat 2 Câu 19: D • Đốt cháy X tạo thành CO2 và H2O có số mol bằng nhau → X là este no, đơn chức.

Ư N

G

Đ

Ta có:

ẠO

Ta có CnH2nO2 +

N

→ X là CH3OCO-COOC2H5 Câu 18: A • Giả sử este có dạng CnH2nO2

TR ẦN

www.daykemquynhon.ucoz.com

H

Thủy phân X trong môi trường axit được chất Y tham gia phản ứng tráng gương → Y là HCOOH. Z có số nguyên tử C bằng một nửa số nguyên tử cacbon trong X → X là HCOOCH3.

B

→ Đốt cháy 1 mol HCOOCH3 sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O.

10

00

Y là HCOOH nên tan vô hạn trong nước.

2+

3

Z là CH3OH nên khi đun với H2SO4 đặc ở 170oC không thu được anken.

ẤP

Câu 20: A • Xét CH3CH2COOCH3

A

C

CH3CH2COOCH3 + H2O <=> CH3CH2COOH + CH3OH

-L

• Xét CH3COOCH3

Í-

H

Ó

Tuy nhiên từ CH3OH (X) không thể điều chế CH3CH2COOH (Y) bằng một phản ứng.

ÁN

CH3COOCH3 + H2O <=> CH3COOH + CH3OH o

TO

xt ,t CH3OH (X) + CO  → CH3COOH (Y)

Ỡ N

G

Vậy Z có thể là CH3COOCH3.

ID Ư

• Xét CH3COOCH2CH3

BỒ

CH3COOCH2CH3 + H2O <=> CH3COOH + CH3CH2OH mengiam → CH3COOH (Y) + H2O CH3CH2OH (X) + O2  25− 30o C

Vậy Z có thể là CH3COOCH2CH3 • Xét CH3COOCH=CH2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CH3COOCH=CH2 + H2O <=> CH3COOH + CH3CHO o

xt ,t 2CH3CHO (X) + O2  → 2CH3COOH (Y)

H Ơ

N

Vậy Z có thể là CH3COOCH=CH2

Y

N

Câu 21: D CH3COOCH2CH3 + NaOH → CH3COONa + CH3CH2OH o

TP .Q

U

t CH3COOCH2CH2Cl + 2NaOH  → CH3COONa + NaCl + C2H4(OH)2

ẠO

CH3COOCH(Cl)CH3 + 2NaOH → CH3COONa + NaCl + CH3CHO + H2O

Đ

ClCH2COOC2H5 + 2NaOH → HOCH2COOH + NaCl + CH3CH2OH

G Ư N H

Vì X là trieste nên trong mạch còn một nối đôi → loại B, C.

B

Vì ba muối không có đồng phân hình học → loại D.

2+

3

10

00

Câu 23: D RCOOR1 + NaOH → RCOONa + R1OH Z + AgNO3 → T

TR ẦN

www.daykemquynhon.ucoz.com

→ X thỏa mãn là ClCH2COOC2H5 → Chọn D. Câu 22: A 10.2 + 2 − 14 =4 • C10H14O6 có độ bất bão hòa k = 2

ẤP

T + NaOH → Y

A

C

Do đó, Z và Y cùng số nguyên tử cacbon trong phân tử.

H

Ó

CH3COOCH=CH2 + NaOH → CH3COONa + CH3CHO

-L

Í-

CH3CHO + 2AgNO3 + 4NH3 + H2O → CH3COONH4 + 2Ag↓ + 2NH4NO3.

TO

Câu 24: B

ÁN

CH3COONH4 + NaOH → CH3COONa + NH3 + H2O

4.2 + 2 − 6 =2 2

Ỡ N

G

C4H6O4 có độ bất bão hòa k =

ID Ư

Vậy X là đieste no, mạch hở.

BỒ

Oxi hóa a mol Y cần vừa đủ 2a mol cuO → a mol T. Vậy Y là ancol hai chức.

Vậy X là HCOOCH2CH2OCOH HCOOCH2CH2OCOH + 2NaOH → 2HCOONa (X) + CH2OH-CH2OH (Y) o

t CH2OH-CH2OH (Y) + 2CuO  → OHC-CHO (T) + 2Cu + 2H2O

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

OHC-CHO (T) có M = 58 Câu 25: A Ankan đơn giản nhất là CH4 o

H Ơ

N

CaO ,t Y + NaOH  → CH4

N

Vậy Y là CH3COONa

U

Y

T + NaOH → CH3COONa (Y). Vậy T là CH3COOH.

TP .Q

o

xt ,t → CH3COOH (T). Z + O2 

ẠO

Mà Z không tác dụng với Na → Z là CH3CHO.

G

48 = 55,81% 86

Ư N

Vậy X là CH3COOCH=CH2. %C (T ) =

Đ

X + NaOH → CH3COONa (Y) + CH3CHO (Z)

H TR ẦN

www.daykemquynhon.ucoz.com

Câu 26: A hhX gồm hai chất hữu cơ đơn chức.

X + 0,5 mol KOH → muối của hai axit cacboxylic và một ancol

00

B

ancol + Na dư → 0,15 mol H2.

ẤP

Chỉ có 1 chất phản ứng sinh ra rượu.

2+

nancol = 2 x nH2 = 2 x 0,15 = 0,3 mol < nKOH

3

10

• nKOH = 0,5 mol

H

Ó

A

C

Mà thu được 2 muối → Có một chất là este và 1 chất là axit Câu 27: C Ta có MX = 100 → X có công thức phân tử C5H8O2

ÁN

-L

Í-

Ta có nX = 10 : 100 = 0,1 mol < nNaOH = 0,15 mol→ chất rắn khan chứa muối RCOONa : 0,1 mol và NaOH dư: 0,05 mol

TO

→ 0,1. (R + 67) + 0,05. 40 = 11,6 → R= 29 (C2H5)

G

Vậy X có công thức C2H5COOCH=CH2. Khi thủy phân X thu được C2H5COONa và CH3CHO

ID Ư

Ỡ N

Câu 28: B Giả sử E là RCOOR'

BỒ

Cô cạn X thu được 16,5 gam muối RCOOK và 6,9 gam R'OH

6,9 gam R'OH + Na → 0,075 mol H2 nR'OH = 0,075 x 2 = 0,15 mol → MR'OH = 6,9 : 0,15 = 46 → MR' = 29 → R' là C2H5-. nRCOOK = nR'OH = 0,15 mol → MRCOOK = 16,5 : 0,15 = 110 → MR = 27 → R là CH2=CH-

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

X + KOH → CH2=CHCOOK + CH3CH2OH

N

Vậy X là CH2=CHCOOCH2CH3 → etyl acrylat Câu 29: B Ta có nNaOH = 0,15 mol

H Ơ

Nếu X là este đơn chức của phenol → nX = 0,5nNaOH = 0,075 mol→ MX = 136 (C8H8O2)

Y

N

Các đồng phân thỏa mãn là HCOOC6H5-CH3 (o,p,m) và CH3COOC6H5

TP .Q

U

Nếu X là este đơn chức không chứa gốc phenol → nX = nNaOH = 0,15 mol → MX = 68. Không tìm được este đơn chức thỏa mãn.

ẠO

Câu 30: A Ta có nNa2CO3 = 0,0225 mol → nNaOH = 0,045 mol, nX = 0,015 mol

H

3n − 2 O2 → nCO2 + nH 2O 2

10

3n − 2 − 1) → n = 4. 2

3

Giả sử có 1 mol X → 2n = 2(

00

B

Cn H 2 nO2 +

TR ẦN

www.daykemquynhon.ucoz.com

Câu 31: A Giả sử X là CnH2nO2

Ư N

HCOOC6H4OH + 3NaOH → HCOONa + C6H4(ONa)2 + 2H2O

G

Đ

Thấy nNaOH = 3 nX → X có cấu tạo HCOOC6H4OH (o, m, p)

ẤP

2+

Vậy X là C4H8O2.

C

Có 4 đồng phân este của X là

Ó H

-L

3. CH3COOCH2CH3

Í-

2. HCOOCH(CH3)2

A

1. HCOOCH2CH2CH3

TO

ÁN

4. CH3CH2COOCH3

Ỡ N

G

Câu 32: A Ta có nCO2 = 0,08 mol, nH2O = 0,064 mol

BỒ

ID Ư

→ nO(E)=

1,6 − 0, 08.12 − 0,064.2 = 0,032 mol 16

→ C: H : O = 0,08 : (0,064.2) : 0,032 = 5: 8 : 2. Vì E là este đơn chức công thức phân tử của E là C5H8O2.

Nhận thấy mE + mNaOH = mchất rắn khan → E phải là este dạng vòng chứa 5 C. CH2-CH2-C=O | |

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CH2-CH2-O

H Ơ

N

Vậy chỉ có A mới thỏa mãn. Câu 33: A Vì 2 este mà có 3 muối nên có 1 este của phenol hoặc đồng đẳng của phenol (Y) n X = a; nY = b

N

→ a + b = 0, 05, a + 2b = 0, 07 → a = 0, 03, b = 0, 02

ẠO Đ

TR ẦN

H

Câu 34: A Nhận thấy Y1 là CH3COOH → Y là CH3CHO

www.daykemquynhon.ucoz.com

G

Ư N

Với Y, khối lượng muối tạo ra luôn là 0,02(136+40.2-18)=3,96 -> Muối X: 6 − 3,96 M= = 68 → X : HCOOCH 2C6 H 5 → Y : CH 3COOC6 H 5 (3muoi) 0, 03 → mCH3COONa = 82.0, 02 = 1, 64

TP .Q

U

Y

C6 H 5COOCH 3  HCOOC6 H 4CH 3 X : ;Y :   HCOOCH 2C6 H 5 CH 3COOC6 H 5

→ X là CH3COOC=CH2

00

B

Chú ý nếu Y là C2H5OH thì quá trình lên men giấm ngoài Y1 còn chứa thêm H2O

10

X không thể là dạng CH3COOCH(OH)-CH3 vì quá trình thùy phân tạo CH3COONa + CH3CHO và nước.

C

ẤP

2+

3

Câu 35: B Số este có thể điều chế trực tiếp bằng phản ứng của axit và ancol tương ứng (có H2SO4 đặc làm xúc tác) là: etyl axetat, isoamyl axetat, anlyl axetat

Í-

H

Ó

A

Có 3 chất. Đáp án B Câu 36: D - Triglixerit chỉ chứa cùng 1 gốc axit béo : có 2 đồng phân ( (C17H35COO)3C3H5 và(C15H31COO)3C3H5 )

-L

-Triglixerit tạo bởi 2 gốc axit stearic và 1 gốc axit panmitic : có 2 đồng phân

ÁN

-Triglixerit tạo bởi 1 gốc axit stearic và 2 gốc axit panmitic : có 2 đồng phân

G

TO

Câu 37: C (C17H33COO)3C3H5 + 3Br2 → (C17H33Br6COO)3C3H5

BỒ

ID Ư

Ỡ N

nBr2 = 3 x ntriolein = 3 x 17,68 : 884 = 0,06 mol → VBr2 = 0,06 : 0,2 = 0,3 lít = 300 ml Câu 38: A nAg = 0,1 mol.

+) TH1: tạo ra cả 2 chất tác dụng với Ag 0,1 1,8 ⇒ nX = = 0, 025 ⇒ M X = = 72 ⇒ C3 H 4O2 4 0, 025

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn +) TH2: chỉ có 1 chất ⇒ nX =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

0,1 1,8 = 0, 05 ⇒ M X = = 36 (loại) 2 0, 05

N

Câu 39: B p-CH3COOC6H4COOC2H5 + 3NaOH → CH3COONa + p-NaO-C6H4-COONa + C2H5OH + H2O

H Ơ

np-CH3COOC6H4COOC2H5 = 0,012 mol; nNaOH = 0,04 mol → NaOH dư.

TP .Q

U

Y

N

Theo BTKL: mrắn khan = 2,496 + 0,04 x 40 - 0,012 x 46 - 0,012 x 18 = 3,328 gam Câu 40: A • 16,6 gam hhG gồm CnH2nO2 và R-OH + O2 → 0,7 mol CO2 + 0,9 mol H2O

ẠO

Vì nH2O > nCO2 → ancol no, đơn chức → nancol = 0,9 - 0,7 = 0,2 mol.

Đ

Giả sử có x mol axit; ancol có dạng CmH2m + 2O.

Ư N

G

mG = mC + mH + mO → (2x + 0,2) x 16 = 16,6 - 0,7 x 12 - 0,9 x 2 → x = 0,1 mol.

H TR ẦN

www.daykemquynhon.ucoz.com

nCO2 = 0,1n + 0,2m = 0,7 → n + 2m =7. Biện luận → n = 1; m = 3 thỏa mãn (Maxit < Mancol)

10

6, 6 = 75% → Chọn A. 8,8

3

Theo lý thuyết meste = 0,1 x 88 = 8,8 gam → H =

00

B

• 0,1 mol HCOOH và 0,2 mol C3H7OH vào H2SO4 đặc.

ẤP

2+

Câu 41: A Giả sử số mol của C15H31COOH, C17H35COOH, C17H31COOH lần lượt là a, b, c

C

Khi đốt cháy C15H31COOH và C17H35COOH thì đều thu được nCO2 = nH2O.

Í-

H

Ó

A

→ nC17H33COOH = (nCO2 - nH2O) : 2 = (0,68 - 0,65) : 2 = 0,015 mol Câu 42: B • 0,02 mol CH3COOC2H5 và 0,02 mol CH3COOC6H5 + 0,08 mol NaOH

ÁN

-L

CH3COOC2H5 + NaOH → CH3COONa + C2H5OH

TO

0,02----------------0,02----------------0,02----------------0,02

G

CH3COOC6H5 + 2NaOH → CH3COONa + C6H5ONa + H2O

Ỡ N

0,02----------------0,04-----------------0,02----------------0,02

BỒ

ID Ư

mrắn = mCH3COONa + mC6H5ONa + mNaOH dư = 0,04 x 82 + 0,02 x 116 + 0,02 x 40 = 6,4 gam Câu 43: A Ta có nX = 18,3 : 122 = 0,15 mol

X có công thức C7H6O2 chứa vòng benzen có π + v = 5 , X tác dụng với AgNO3/NH3 sinh Ag và tham gia phản ứng NaOH → X có cấu tạo HCOOC6H5 và C6H5COOH Luôn có nHCOOC6H5 = nAg : 2 = 0,1 :2 = 0,05 mol → nC6H5COOH = 0,1 mol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ 9,15 gam hỗn hợp X chứa 0,05 mol C6H5COOH và 0,025 mol HCOOC6H5 Vì nNaOH > 2nHCOOC6H5 + nC6H5COOH → nH2O = nHCOOC6H5 + nC6H5COOH = 0,075 mol

N

→ Bảo toàn khối lượng → mchất rắn = 9,15 + 0,3. 40 - 0,075. 18 =19,8 gam

N

H Ơ

Câu 44: A Nhận thấy H đều có công thức CnH2n-2O2

TP .Q

U

Y

Khi đun nóng Y lại thu được thêm kết tủa → chứng tỏ hình thành BaCO3 : 0,03 mol và Ba(HCO3)2 : 0,130,03 = 0,1 mol Bảo toàn nguyên tố C → nCO2 = nBaCO3 + 2nBa(HCO3)2 = 0,03 + 0,2 = 0,23 mol

ẠO

7, 27 + 5,91 − 0, 23.44 = 0,17 mol 18

Đ

mdd tăng = mCO2 + mH2O - mBaCO3 → nH2O =

H

0, 45.3 − 0,525.2 = 0,15 mol → C = 0,45 : 0,15 = 3 → C3H6O2 2

00

B

Bảo toàn nguyên tố O → nX =

TR ẦN

www.daykemquynhon.ucoz.com

mhỗn hợp = mC + mH + mO = 0,23.12 + 0,17.2 + 0,06.2.16 = 5,02 gam. Câu 45: B Nhận thấy nCO2 = nH2O → X là este no đơn chức

Ư N

G

→ nH = nCO2 - nH2O = 0,23- 0,17 = 0,06 mol

10

X có 2 đồng phân HCOOC2H5 : x mol và CH3COOCH3 : y mol

C

0,1.74 ×100% = 66,67%. 0,15.74

Ó

A

%HCOOC2H5=

ẤP

2+

3

 x + y = 0,15  x = 0,1 Ta có hệ  → 0,15.74 + 0, 2.40 = 12,9 + 46 x + 32 y  y = 0, 05

-L

Í-

H

Câu 46: B Nhận thấy nC2H5OH + nCH3OH= neste = 66,6: 74 = 0, 9 mol

ÁN

Luôn có nH2O = 0,5.[nC2H5OH + nCH3OH ]= 0,45 mol

TO

→ mH2O = 8,1 gam. Câu 47: B

ID Ư

Ỡ N

G

Coi hỗn hợp X thành RCOOH với MRCOOH=

BỒ

Coi hỗn hợp Y thành R'OH với MR'OH = RCOOH + R'OH

46 + 60 = 53 → MR = 8. nX = 11,13: 53= 0,21 mol 2

32.3 + 46.2 = 37,6 → MR' = 20,6. nY = 7,52: 37,6 = 0,2 mol 5

RCOOR' + H2O

Vì nX > nY thì hiệu suất được tính Y → neste = 0,75. 0,2 = 0,15 mol → m = 0,15 .( 8 + 44+ 20,6) = 10,89 gam

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 48: C nNaOH = 0, 3 → Este 3 chức nNaOH = 0,075 → nX = 0, 025, nancol = 0, 025

H Ơ

N

mancol = 6,35 + 3 − 7, 05 = 2,3 → M ancol = 92 → Glycerin

ẠO

Gọi công thức của muối là RCOONa → nRCOONa = nNaOH pư = 0,45 mol

TP .Q

Luôn có nNaOH phản ứng = nOH(ancol) = 2nH2= 0,45 mol → nNaOH dư = 0,69- 0,45 = 0,24 mol

U

Y

N

M X = 254 : ( RCOO)3 C3 H 5 → R = 27 → C2 H 3 Câu 49: D Ta có nNaOH = 0,69 mol, nH2 = 0,225 mol

Đ

RCOONa + NaOH → RH + Na2CO3

Ư N

G

Vì nRCOONa > nNaOH dư → nRH= nNaOH dư= 0,24 mol → MRH = 7,2 : 0,24 = 30 (C2H6)

www.daykemquynhon.ucoz.com

H

Bảo toàn khối lượng → m + mNaOH pu = mmuối + mancol

B

TR ẦN

→ m + 0,45. 40 = 0,45. ( 29 + 67) + 15,4 → m = 40,6 gam. Câu 50: B t o cao , pcao → C6H5ONa (X) + NaCl + H2O • Ca6H5Cl + 2NaOH 

10

00

C6H5ONa + HCl → C6H5OH (Y) + NaCl o

2+

3

t cao , pcao C6H5OH + 3H2  → C6H11OH (Z)

C

ẤP

CuOdu → C6H10O (T) + Cu + H2O C6H11OH + CuO  to

Ó

A

(X) là C6H5ONa có tính bazơ nên làm quỳ tím chuyển xanh.

-L

Í-

H

(Y) là C6H5OH có phản ứng mất màu nước brom.

ÁN

Z là C6H11OH, là ancol vòng, đơn chức, no.

BỒ

ID Ư

Ỡ N

G

TO

C6H10O là xeton nên không có phản ứng tráng gương.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Hãy chọn nhận định đúng: A. Lipit là chất béo. B. Lipit là tên gọi chung cho dầu mỡ động, thực vật. C. Lipit là este của glixerol với các axit béo. D. Lipit là những hợp chất hữu cơ có trong tế bào sống, không hoà tan trong nước, nhưng hoà tan trong các dung môi hữu cơ không phân cực. Lipit bao gồm chất béo, sáp, sterit, photpholipit.... Câu 2: Có các nhận định sau: 1. Chất béo là trieste của glixerol với các axit monocacboxylic có mạch C dài không phân nhánh. 2. Lipit gồm chất béo, sáp, sterit, photpholipit, . . . 3. Chất béo là các chất lỏng. 4. Chất béo chứa các gốc axit không no thường là chất lỏng ở nhiệt độ thường và được gọi là dầu. 5. Phản ứng thuỷ phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. 6. Chất béo là thành phần chính của dầu mỡ động, thực vật. Các nhận định đúng là A. 1, 2, 4, 5. B. 1, 2, 4, 6. C. 1, 2, 3. D. 3, 4, 5. Câu 3: Có các nhận định sau: 1. Chất béo là những este. 2. Các este không tan trong nước do chúng nhẹ hơn nước. 3. Các este không tan trong nước và nổi trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. 4. Khi đun chất béo lỏng với hiđro có xúc tác Ni trong nồi hấp thì chúng chuyển thành chất béo rắn. 5. Chất béo lỏng thường là những triglixerit chứa gốc axit không no trong phân tử. Các nhận định đúng là A. 1, 3, 4, 5. B. 1, 2, 3, 4, 5. C. 1, 2, 4. D. 1, 4, 5. Câu 4: Natri lauryl sunfat (X) có công thức: CH3(CH2)10CH2OSO3Na, X thuộc loại chất nào? A. Chất béo. B. Xà phòng. C. Chất giặt rửa tổng hợp. D. Chất tẩy màu. Câu 5: Chọn câu đúng trong các câu sau. A. Chất béo là chất rắn không tan trong nước. B. Chất béo không tan trong nước, nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. C. Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. D. Chất béo là trieste của glixerol với axit. Câu 6: Chọn câu sai trong các câu sau. A. Xà phòng là sản phẩm của phản ứng xà phòng hoá. B. Muối natri của axit hữu cơ là thành phần chính của xà phòng. C. Khi đun nóng chất béo với dung dịch NaOH hoặc KOH ta được muối để sản xuất xà phòng. D. Từ dầu mỏ có thể sản xuất được chất giặt rửa tổng hợp và xà phòng. Câu 7: Nguyên nhân nào làm cho bồ kết có khả năng giặt rửa: A. vì bồ kết có thành phần là este của glixerol.

N

Lipit-chất béo-chất giặt rửa

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. vì trong bồ kết có những chất oxi hóa mạnh (hoặc khử mạnh). C. vì bồ kết có những chất có cấu tạo kiểu “đầu phân cực gắn với đuôi không phân cực”. D. Cả B và C. Câu 8: Không nên dùng xà phòng khi giặt rửa bằng nước cứng vì nguyên nhân nào sau đây? A. Vì xuất hiện kết tủa làm giảm tác dụng giặt rửa và ảnh hưởng đến chất lượng sợi vải. B. Vì gây hại cho da tay. C. Vì gây ô nhiễm môi trường. D. Cả A, B, C. Câu 9: Nhận định nào sau đây không đúng về chất giặt rửa tổng hợp? A. Chất giặt rửa tổng hợp cũng có cấu tạo “đầu phân cực, đuôi không phân cực”. B. Chất giặt rửa tổng hợp có ưu điểm là dùng được với nước cứng vì chúng ít bị kết tủa bởi ion canxi và magie. C. Chất giặt rửa tổng hợp được điều chế từ các sản phẩm của dầu mỏ. D. Chất giặt rửa có chứa gốc hiđrocacbon phân nhánh không gây ô nhiễm môi trường vì chúng bị các vi sinh vật phân huỷ. Câu 10: Chọn phát biểu sai A. Chất béo là trieste của glixerol với các axit béo. B. Ở động vật, chất béo tập trung nhiều trong mô mỡ. Ở thực vật, chất béo tập trung nhiều trong hạt,quả... C. Khi đun nóng glixerol với các axit béo, có H2SO4, đặc làm xúc tác, thu được chất béo. D. Axit panmitic, axit stearic là các axit béo chủ yếu thường gặp trong thành phần của chất béo trong hạt ,quả Câu 11: Ở ruột non cơ thể người, nhờ tác dụng xúc tác củacác enzim như lipaza và dịch mật chất béo bị thuỷ phân thành A. axit béo và glixerol B. axit cacboxylic và glixerol C. CO2 và H2O D. NH3, CO2, H2O Câu 12: Khi đun nóng chất béo với dung dịch H2SO4 loãng thu được A. glixerol và axit béo B. glixerol và muối natri của axit béo C. glixerol và axit cacboxylic D. glixerol và muối natri của axit cacboxylic Câu 13: Phản ứng nào sau đây dùng để điều chế xà phòng? A. Đun nóng axit béo với dung dịch kiềm. B. Đun nóng chất béo với dung dịch kiềm. C. Đun nóng glixerol với các axit béo. D. Cả A, B đều đúng. Câu 14: Loại dầu nào sau đây không phải là este của axit béo và glixerol? A. Dầu vừng (mè) B. Dầu lạc (đậu phộng) C. Dầu dừa D. Dầu luyn. Câu 15: Cho glixerol phản ứng với hỗn hợp axit béo gồm C17H35COOH và C15H31COOH, số loại trieste tối đa được tạo ra là A. 3 B. 4 C. 5 D. 6

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

Câu 16: Khi xà phòng hóa tristearin ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H35COOH và glixerol. C. C15H31COOH và glixerol. D. C17H35COONa và glixerol. Câu 17: Khi xà phòng hóa tripanmitin ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H35COOH và glixerol. C. C15H31COONa và glixerol. D. C17H35COONa và glixerol. Câu 18: Khi xà phòng hóa triolein ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H35COOH và glixerol. C. C15H31COONa và glixerol. D. C17H33COONa và glixerol. Câu 19: Khi thuỷ phân trong môi trường axit trilinolein ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H31COOH và glixerol. C. C15H31COOH và glixerol. D. C17H35COONa và glixerol. Câu 20: ĐHB -2011: Triolein không tác dụng với chất (hoặc dung dịch) nào sau đây? A. H2O (xúc tác H2SO4 loãng, đun nóng) B. Cu(OH)2 (ở điều kiện thường) C. Dung dịch NaOH (đun nóng) D. H2 (xúc tác Ni, đun nóng) Câu 21: ĐHA-10: Cho sơ đồ chuyển hoá:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

o

o

ẤP

+ H 2 du , Ni ,t C + NaOHdu ,t C + HCl → X  → Y  →Z Tên của Z là : Triolein 

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

A. axit linoleic. B. axit oleic. C. axit panmitic. D. axit stearic. Câu 22: Số trieste khi thủy phân đều thu được sản phẩm gồm glixerol, axit C17H35COOH và axit C17H33COOH là A. 9 B. 4 C. 6 D. 2 Câu 23: Đun glixerol với hỗn hợp các gồm n axit béo khác nhau (có xúc tác H2SO4) có thể thu được bao nhiêu loại trieste (chỉ tính đồng phân cấu tạo) ? A. n2(n+1)/2. B. n(n+1)/2. C. n2(n+2)/2. D. n(n+2)/2. Câu 24: Đốt cháy hoàn toàn 1 mol chất béo, thu được lượng CO2 và H2O hơn kém nhau 6 mol. Mặt khác a mol chất béo trên tác dụng tối đa với 600 ml dung dịch Br2 1M. Giá trị của a là : A. 0,20 B. 0,30

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. 0,18. D. 0,15. Câu 25: Khi đun nóng glixerol với hỗn hợp 3 axit béo C17H35COOH, C17H33-COOH, C17H31COOH để thu được các chất béo khác nhau. Số CTCT có thể có là bao nhiêu? A. 21 B. 18 C. 16 D. 19 Câu 26: Khi thuỷ phân hỗn hợp các chất béo đều thấy sinh ra muối của 3 axit C17H35COOH, C17H33-COOH, C17H31COOH. Số CTCT có thể có của các chất béo là bao nhiêu? A. 1 B. 3 C. 6 D. 9 Câu 27: Cho các chất lỏng sau: axit axetic, glixerol, triolein. Để phân biệt các chất lỏng trên, có thể chỉ cần dùng A. nước và quỳ tím B. nước và dung dịch NaOH C. dung dịch NaOH D. nước brom Câu 28: Cho 45 gam trieste của glixerol với axit béo tác dụng vừa đủ với 100 ml dung dịch NaOH 1,5M được m1 gam xà phòng và m2 gam glixerol. Giá trị m1, m2 là A. m1 = 46,4; m2 = 4,6. B. m1 = 4,6; m2 = 46,4. C. m1 = 40,6; m2 = 13,8. D. m1 = 15,2; m2 = 20,8. Câu 29: Khối lượng glixerol thu được khi đun nóng 2,225 kg tristearin có chứa 20% tạp chất với dung dịch NaOH ( coi như phản ứng này xảy ra hoàn toàn ) là bao nhiêu kg? A. 1,78 kg B. 0,184 kg C. 0,89 kg D. 1,84 kg Câu 30: Thể tích H2 (đktc) cần để hiđrohoá hoàn toàn 1 tấn triolein nhờ xúc tác Ni là bao nhiêu lit? A. 76018 lit B. 760,18 lit C. 7,6018 lit D. 7601,8 lit Câu 31: Khối lượng olein cần để sản xuất 5 tấn stearin là bao nhiêu kg? A. 4966,292 kg B. 49600 kg C. 49,66 kg D. 496,63 kg Câu 32: Đun sôi a gam một triglixerit (X) với dung dịch KOH đến khi phản ứng hoàn toàn được 0,92 gam glixerol và hỗn hợp Y gồm m gam muối của axit oleic với 3,18 gam muối của axit linoleic (C17H31COOH). Giá trị của m là A. 3,2. B. 6,4. C. 4,6

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 7,5. Câu 33: Thuỷ phân hoàn toàn chất béo A bằng dung dịch NaOH thu được 1,84g glixerol và 18,24g một muối của axit béo duy nhất. Chất béo đó có công thức là A. (C17H33COO)3C3H5 B. (C17H35COO)3C3H5 C. (C15H31COO)3C3H5 D. (C15H29COO)3C3H5 Câu 34: Thuỷ phân hoàn toàn 444 gam một lipit thu được 46 gam glixerol và hai loại axit béo. Hai loại axit béo đó là A. C15H31COOH và C17H35COOH. B. C17H33COOH và C15H31COOH. C. C17H31COOH và C17H33COOH. D. C17H33COOH và C17H35COOH. Câu 35: Thuỷ phân hoàn toàn một lipit trung tính bằng NaOH thu được 46 gam glixerol (glixerin) và 429 gam hỗn hợp 2 muối. Hai loại axit béo đó là A. C15H31COOH và C17H35COOH. B. C17H33COOH và C15H31COOH. C. C17H31COOH và C15H31COOH. D. C17H33COOH và C17H35COOH.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

Câu 1: Đáp án: D Lipit là tên gọi chung của các hợp chất hữu cơ có trong tế bào sống, không hòa tan trong nước nhưng hòa tan trong các dung môi hữu cơ không phân cực. Một cách tổng quát, lipit là este hoặc amid của ancol hoặc aminoancol. Lipit bao gồm : Triglycerid (chất béo), sáp, phospholipit,... Câu 2: Đáp án: B Nhận định sai là : +) 3 :sai vì Chất béo có thể là chất rắn. +) 5 : sai vì Thủy phân chất béo trong môi trường kiềm là phản ứng 1 chiều. Câu 3: Đáp án: A Nhận định sai là : +) 2 : Este không tan trong nước vì chúng có gốc hidrocacbon, kỵ nước và không tạo liên kết hidro. Câu 4: Đáp án: C Nhận định sai là : +) 2 : Este không tan trong nước vì chúng có gốc hidrocacbon, kỵ nước và không tạo liên kết hidro. Câu 5: Đáp án: B Chất béo không tan trong nước, nhẹ hơn nước (cả chất béo lỏng và chất béo rắn). Chúng tan trong các dung môi không phân cực (benzen,...) Câu 6: Đáp án: B Xà phòng là muối natri của các axit béo. Câu 7: Đáp án: C Bồ kết có chứa các chất cấu tạo tương tự xà phòng : RCOONa  Đầu phân cực ↑ Đuôi không phân cực. Câu 8: Đáp án: A Nước cứng chứa ion Ca2+ ; Mg2+, nếu giặt với xà phòng (là muối natri của các axit béo), sẽ sinh ra kết tủa (VD : canxi stearat) làm giảm khả năng tẩy rửa, kết tủa đọng lại trên sợi vải, làm bục sợi vải. Câu 9: Đáp án: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

+

o

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

H ,t → 3RCOOH + C3H5(OH)3 (RCOO)3C3H5  Câu 13: Đáp án: D Xà phòng là muối của natri của các axit béo (RCOONa). Khi đun axit béo với kiềm : RCOOH + NaOH -> RCOONa + H2O. Khi đun chất béo với kiềm : C3H5(OOCR)3 + 3NaOH -> C3H5(OH)3 + 3RCOONa. Câu 14: Đáp án: D Dầu luyn có thành phần chính là các ankan mạch dài. Thành phần chính của dầu vừng là axit oleic, axit linoleic, dầu lạc chứa axit arachidonic (CH3(CH2)18COOH). Câu 15: Đáp án: D

TP .Q

U

Y

N

H Ơ

Những axit béo gốc hidrocacbon phân nhánh rất khó bị phân hủy (do chúng không bị Beta – oxi hóa một cách thông thường) bởi các vi sinh vật. Do đó sẽ gây ô nhiễm môi trường. Câu 10: Đáp án: D Axit panmitic, axit stearic là các axit béo no, thường gặp trong các thành phần của mỡ động vật (như mỡ bò, mỡ lợn,...) Câu 11: Đáp án: A Một cách tổng quát : enzim Chất béo (RCOO)3C3H5  → -> 3RCOOH + C3H5(OH)3 Muối mật có khả năng nhũ hóa chất béo. Câu 12: Đáp án: A Đun chất béo với H2SO4, xảy ra phản ứng thủy phân :

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

n 2 ( n + 1) =6 2

Số trieste có thể được tạo thành là

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

Câu 16: Đáp án: D Xà phòng hóa tristearin : (C17H35COO)3C3H5 + 3NaOH -> 3C17H35COONa + C3H5(OH)3 Câu 17: Đáp án: C Tripanmitin : (C15H31COO)3C3H5 + 3NaOH -> 3C15H31COONa + C3H5(OH)3 Câu 18: Đáp án: D Triolein : (C17H33COO)3C3H5 + 3NaOH -> 3C17H33COONa + C3H5(OH)3 Axit oleic có một nối đôi C = C ở cacbon số 9. Câu 19: Đáp án: B Trilinolein : (C17H31COO)3C3H5 + 3NaOH -> 3C17H31COONa + C3H5(OH)3 Axit linoleic có hai nối đôi C = C ở cacbon số 9 và số 12. Câu 20: Đáp án: B Trilinolein : [CH3(CH2)7CH=CH(CH2)7COO]3C3H5, Viết gọn là (C17H31COO)3C3H5. (C17H31COO)3C3H5 + 3H2O  3C17H31COOH + C3H5(OH)3. (trong môi trường H+) (C17H31COO)3C3H5 + 3NaOH -> 3C17H31COONa + C3H5(OH)3. o

TO

ÁN

Ni ,t → (C17H35COO)3C3H5 . (C17H31COO)3C3H5 + 6H2  Câu 21: Đáp án: D o

BỒ

ID Ư

Ỡ N

G

H 2 du , Ni ,t + NaOH du → (C17H35COO)3C3H5  → (C17H33COO)3C3H5  + HCl C17H35COONa +  → C17H35COOH (axit stearic). Câu 22: Đáp án: B Kí hiệu C17H35 – là R1, C17H33 – R2. Các Trieste thỏa mãn là :

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ N Y U TP .Q ẠO Đ G

Ư N H TR ẦN

www.daykemquynhon.ucoz.com

Số đồng phân là : 1. Cn1 +4. Cn2 +3. Cn3 n! n! = n + 4. + 3. 2!(n − 2)! 3!( n − 3)! n(n − 1)(n − 2) = n + 2n(n - 1) + 2 2 n ( n + 1) = 2 Câu 24: Đáp án: D Gọi độ bất bão hòa của chất béo đó là k nCO2 − nH 2 O 6 Ta có nchất béo = ⇔ 1= => k = 7. k −1 k −1 Do đó chất béo có 7 - 3 = 4 liên kết π C=C a mol chất béo phản ứng tối đa với 4a mol Br2. => 4a = 0,6 => a = 0,15. Câu 25: Đáp án: B

N

Có 4 chất. Câu 23: Đáp án: A Ta thấy rằng +) Trieste gồm 1 loại axit béo -> có 1 đồng phân. +) Trieste gồm 2 loại axit béo -> có 4 đồng phân. + Trieste gồm 3 loại axit béo -> có 3 đồng phân. Lần lượt chọn 1 trong n, 2 trong n, 3 trong n (ứng với 3 loại Trieste kể trên) : Cn1 ; Cn2 ; Cn3

B

n 2 (n + 1) 9.4 = = 18 2 2 Câu 26: Đáp án: B Vì sản phẩm chứa cả 3 axit béo, nên chất béo phải cấu tạo từ 3 gốc axit béo khác nhau => chỉ có 3 đồng phân. Câu 27: Đáp án: A

H

Ó

A

C

ẤP

2+

3

10

00

Số CTCT là

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

Câu 28: Đáp án: A (RCOO)3C3H5 + 3NaOH -> 3RCOONa + C3H5(OH)3. nNaOH = 0,15 mol => nC3H5(OH)3 = 1/3 .0,15 = 0,05 (mol). => m2 = 4,6 gam. BTKL : 45 + 0,15.40 = mxà phòng + mC3H5(OH)3 => mxp = 46,4g. Câu 29: Đáp án: B Tristearin : (C17H35COO)3C3H5 2, 225 .0,8 = 0,184 kg. mglixerol = 92.nglixerol = 92.ntristearin = 92. 890 Câu 30: Đáp án: A o

Ni .t → (C17H35COO)3C3H5 (C17H33COO)3C3H5 + 3H2  1000000 .3 = 76018 (lít). VH2 = 22, 4. 884 Câu 31: Đáp án: A Cứ 1 mol stearin cần 1 mol olein. 5.106 5.106 => nolein = => molein = .884 = 4966292 g 890 890

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ N Y U TP .Q ẠO Đ

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Câu 32: Đáp án: B Ta có nC3H5(OH)3 = 0,01 mol; nC17H33COOK = 0,01 mol Mà cứ 0,01 mol chất béo tạo ra 0,03 mol muối => nC17H33COOK = 0,02 mol => m = 0,02. (282 + 38) = 6,4 g. Câu 33: Đáp án: A (RCOO)3C3H5 + 3NaOH -> 3RCOONa + C3H5(OH)3. Ta có nC3H5(OH)3 = 0,02 mol => nRCOONa = 0,06 mol. => MRCOONa = 304 => MRCOOH = 282 (axit oleic). Câu 34: Đáp án: D Ta có nglyxerol =0,5 => Mlipit = 888 => 2.( R + 44) + R’ + 44 + 41 = 888 => 2R + R’ = 715 => R = 239 (C17H35 - ) và R’ = 237 (C17H33 - ) Câu 35: Đáp án: C Gọi hai muối lần lượt là RCOONa và R’COONa. => 0,5. (RCOOH + 22) + 1.(R’COOH + 22) = 229 ⇔ RCOOH + 2R’COOH = 792 => RCOOH = 280 (C17H31COOH) R’COOH = 256 (C15H31COOH)

N

= 4966,292 kg.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

H Ơ N Y

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Bài 1. Este mạch hở có công thức tổng quát là A. CnH2n+2-2a-2bO2b. B. CnH2n-2O2. C. CnH2n + 2-2bO2b. D. CnH2nO2. Bài 2. (CB) Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là: A. CnH2nOz. B. RCOOR’. C. CnH2n-2O2. D. Rb(COO)abR’a. Bài 3. (CB) Este no, đơn chức, mạch hở có công thức tổng quát là: A. CnH2nO2 (n ≥ 2). B. CnH2n-2O2 (n ≥ 2). C. CnH2n+2O2 (n ≥ 2). D. CnH2nO (n ≥ 2). Bài 4. Este no, đơn chức, đơn vòng có công thức tổng quát là: A. CnH2nO2 (n ≥ 2). B. CnH2n-2O2 (n ≥ 2). C. CnH2n+2O2 (n ≥ 2). D. CnH2nO (n ≥ 2). Bài 5. Công thức phân tử tổng quát của este tạo bởi ancol no, đơn chức mạch hở và axit cacboxylic không no, có một liên kết đôi C=C, đơn chức mạch hở là: A. CnH2nO2. B. CnH2n+2O2. C. CnH2n-2O2. D. CnH2n+1O2. Bài 6. (CB) Este tạo bởi axit axetic và glixerol có công thức cấu tạo là là: A. (C3H5COO)3C3H5. B. C3H5OOCCH3. C. (CH3COO)3C3H5. D. (CH3COO)2C2H4. Bài 7. (CB) Công thức phân tử tổng quát của este tạo bởi ancol no, 2 chức mạch hở và axit cacboxylic không no, có một liên kết đôi C=C, đơn chức mạch hở là: A. CnH2n-2O4. B. CnH2n+2O2. C. CnH2n-6O4. D. CnH2n-4O4. Bài 8. Công thức của este tạo bởi axit benzoic và ancol etylic là: A. C6H5COOC2H5. B. C2H5COOC6H5. C. C6H5CH2COOCH3.

N

CƠ BẢN – LÝ THUYẾT TRỌNG TÂM VỀ ESTE (ĐỀ 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

D. C2H5COOCH2C6H5. Bài 9. (CB) C3H6O2 có bao nhiêu đồng phân đơn chức mạch hở ? A. 4. B. 5. C. 6. D. 3. Bài 10. C4H8O2 có bao nhiêu đồng phân este ? A. 4. B. 5. C. 6. D. 7. Bài 11. (CB) Có bao nhiêu chất đồng phân cấu tạo của nhau có CTPT C4H8O2 đều tác dụng được với NaOH ? A. 8. B. 5. C. 4. D. 6. Bài 12. (CB) Ứng với CTPT C4H6O2 có bao nhiêu este mạch hở ? A. 4. B. 3. C. 5. D. 6. Bài 13. (CB) Từ các ancol C3H8O và các axit C4H8O2 có thể tạo ra tối đa bao nhiêu este đồng phân cấu tạo của nhau ? A. 3. B. 5. C. 4. D. 6. Bài 14. Ứng với CTPT C4H6O2 có bao nhiêu đồng phân đơn chức mạch hở ? A. 10. B. 9. C. 8. D. 7. Bài 15. (CB) Số đồng phân của hợp chất este đơn chức có CTPT C4H8O2 tác dụng với dung dịch AgNO3/NH3 sinh ra Ag là: A. 4. B. 2. C. 1. D. 3. Bài 16. (CB) Trong các este có công thức phân tử là C4H6O2, có bao nhiêu este không thể điều chế trực tiếp từ axit và ancol ? A. 3. B. 1. C. 4.

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

D. 2. Bài 17. (CB) Trong phân tử este X no, đơn chức, mạch hở, oxi chiếm 36,36% khối lượng. Số CTCT thoả mãn CTPT của X là A. 2. B. 3. C. 4. D. 5. Bài 18. (CB) Phân tích định lượng 1 este X nhận thấy %O = 53,33%. Este X có thể là A. Este 2 chức. B. Este không no. C. HCOOCH3. D. CH3COOCH3. Bài 19. Phân tích este X người ta thu được kết quả: %C = 40 và %H = 6,66. Este X là A. metyl axetat. B. metyl acrylat. C. metyl fomat. D. etyl propionat. Bài 20. (CB) Este X điều chế từ ancol metylic có tỉ khối so với oxi là 2,3125. Công thức của X là A. CH3COOCH3. B. C2H5COOCH3. C. CH3COOC2H5. D. C2H5COOC2H5. Bài 21. (CB) Hợp chất hữu cơ mạch hở X có CTPT C3H6O2. X có thể là A. Axit hay este đơn chức no. B. Ancol 2 chức, không no, có 1 liên kết pi. C. Xeton hay anđehit no 2 chức. D. Tất cả đều đúng. Bài 22. Hợp chất hữu cơ mạch hở X có CTPT C4H8O2. Chất X có thể là A. Axit hay este đơn chức no. B. Ancol 2 chức, không no, có 1 liên kết pi. C. Xeton hay anđehit no 2 chức. D. A và B đúng. Bài 23. (CB) Mệnh đề không đúng là: A. CH3CH2COOCH=CH2 có thể trùng hợp tạo polime. B. CH3CH2COOCH=CH2 tác dụng với dung dịch NaOH thu được anđehit và muối. C. CH3CH2COOCH=CH2 cùng dãy đồng đẳng với CH2=CHCOOCH3. D. CH3CH2COOCH=CH2 tác dụng được với dung dịch Br2. Bài 24. (CB) Hợp chất nào sau đây là este ? A. CH3CH2Cl. B. HCOOC6H5. C. CH3CH2NO2. D. Tất cả đều đúng. Bài 25. (CB) Cho các chất có công thức cấu tạo sau đây:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

(1) CH3CH2COOCH3; (2) CH3OOCCH3; (3) HCOOC2H5; (4) CH3COOH; (5) CH3OCOC2H3; (6) HOOCCH2CH2OH; (7) CH3OOC-COOC2H5. Những chất thuộc loại este là A. (1), (2), (3), (4), (5), (6). B. (1), (2), (3), (5), (7). C. (1), (2), (4), (6), (7). D. (1), (2), (3), (6), (7). Bài 26. Chất X có công thức phân tử C3H6O2, là este của axit axetic. Công thức cấu tạo thu gọn của X là: A. C2H5COOH. B. HO-C2H4-CHO. C. CH3COOCH3. D. HCOOC2H5. Bài 27. Chất nào dưới đây không phải là este ? A. HCOOC6H5. B. HCOOCH3. C. CH3COOH. D. CH3COOCH3. Bài 28. (CB) Chất nào sau đây không phải là este ? A. HCOOCH3. B. C2H5OC2H5. C. CH3COOC2H5. D. C3H5(COOCH3)3. Bài 29. (CB) Hợp chất X có công thức cấu tạo: CH3CH2COOCH3. Tên gọi của X là A. etyl axetat. B. metyl propionat. C. metyl axetat. D. propyl axetat. Bài 30. Este etyl fomat có công thức là A. CH3COOCH3. B. HCOOC2H5. C. HCOOCH=CH2. D. HCOOCH3. Bài 31. Este vinyl axetat có công thức là A. CH3COOCH=CH2. B. CH3COOCH3. C. CH2=CHCOOCH3. D. HCOOCH3. Bài 32. Este metyl acrilat có công thức là A. CH3COOCH3. B. CH3COOCH=CH2. C. CH2=CHCOOCH3. D. HCOOCH3. Bài 33. (CB) Cho este có công thức cấu tạo: CH2=C(CH3)COOCH3. Tên gọi của este đó là

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

A. Metyl acrylat. B. Metyl metacrylat. C. Metyl metacrylic. D. Metyl acrylic. Bài 34. (CB) Trong thành phần nước dứa có este tạo bởi ancol isoamylic và axit isovaleric. CTPT của este là A. C10H20O2. B. C9H14O2. C. C10H18O2. D. C10H16O2. Bài 35. Công thức cấu tạo của este isoamyl isovalerat là A. CH3CH2COOCH(CH3)2. B. (CH3)2CHCH2CH2OOCCH2CH(CH3)2. C. (CH3)2CHCH2CH2COOCH2CH(CH3)2. D. CH3CH2COOCH3. Bài 36. (CB) Điểm nào sau đây không đúng khi nói về metyl fomat ? A. Có CTPT C2H4O2. B. Là đồng đẳng của axit axetic. C. Là đồng phân của axit axetic. D. Là hợp chất este. Bài 37. (CB) Dầu chuối là este có tên isoamyl axetat, được điều chế từ A. CH3OH, CH3COOH. B. (CH3)2CH-CH2OH, CH3COOH. C. CH3COOH, (CH3)2CH-OH. D. CH3COOH, (CH3)2CH-CH2-CH2OH. Bài 38. Số đồng phân este ứng với công thức phân tử C4H8O2 là A. 6. B. 5. C. 2. D. 4. Bài 39. Số hợp chất là đồng phân cấu tạo, có cùng công thức phân tử C4H8O2, tác dụng được với dung dịch NaOH nhưng không tác dụng được với Na là A. 3. B. 2. C. 4. D. 1. Bài 40. Benzyl axetat là một este có mùi thơm của hoa nhài. Công thức của benzyl axetat là A. CH3-COO-C6H5 B. C6H5-COO-CH3 C. C6H5-CH2-COO-CH3 D. CH3-COO-CH2-C6H5 Bài 41. Cho hợp chất hữu cơ no X tác dụng với hiđro dư (Ni, to) thu được chất hữu cơ Y. Cho chất Y tác dụng với chất Z trong điều kiện thích hợp thu được este có mùi chuối chín. Tên thay thế của X là:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

A. axit etanoic B. 3-metylbutanal C. 2-metylbutanal D. anđehit isovaleric Bài 42. Este nào sau đây có công thức phân tử C4H8O2 ? A. Phenyl axetat. B. Vinyl axetat. C. Etyl axetat. D. Propyl axetat. Bài 43. Công thức phân tử của metyl metacrylat là A. C5H10O2. B. C4H8O2. C. C5H8O2. D. C4H6O2. Bài 44. Có bao nhiêu este đồng phân cấu tạo của nhau có cùng công thức phân tử C5H10O2 ? A. 6. B. 7. C. 8. D. 9. Bài 45. Đốt cháy hoàn toàn 3,7 gam một este đơn chức X thu được 3,36 lít khí CO2 (đktc) và 2,7 gam nước. Công thức phân tử của X là A. C2H4-O2 B. C3H6O2 C. C4H8O2 D. C5H8O2 Bài 46. (CB) Đốt cháy hoàn toàn m gam este đơn chức X cần 5,6 lít khi oxi (đktc), thu được 12,4 gam hỗn hợp CO2 và nước có tỉ khối so với H2 là 15,5. CTPT của X là A. C2H4O2. B. C3H6O2. C. C4H8O2. D. C5H10O2. Bài 47. Đốt cháy hoàn toàn 10 ml hơi một este X cần vừa đủ 45 ml O2, sau phản ứng thu được hỗn hợp khí CO2 và hơi nước có tỉ lệ thể tích là 4 : 3. Ngưng tụ sản phẩm cháy thì thể tích giảm đi 30 ml. Biết các thể tích đo ở cùng điều kiện. Công thức của este X là A. C4H6O2. B. C4H6O4. C. C4H8O2. D. C8H6O4. Bài 48. (CB) Đốt cháy một este hữu cơ X thu được 13,2 gam CO2 và 5,4 gam H2O. X thuộc loại este A. no, đơn chức. B. mạch vòng, đơn chức . C. hai chức, no. D. có 1 liên kết đôi, chưa xác định nhóm chức

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


LỜI GIẢI CHI TIẾT

H Ơ N

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Câu 1: Đáp án: A Cứ 1 nhóm COO có một liên kết π → có b nhóm COO có b liên kết π

G

Đ

ẠO

TP .Q

U

Bài 49. Đốt cháy hoàn toàn 7,4 gam hỗn hợp hai este đồng phân, thu được 6,72 lít CO2 (ở đktc) và 5,4 gam H2O. CTPT của hai este là A. C3H6O2 B. C2H4O2 C. C4H6O2 D. C4H8O2 Bài 50. Số công thức cấu tạo este mạch hở, có công thức phân tử C5H8O2 có đồng phân hình học là: A. 4 B. 2 C. 5 D. 3

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Gọi số liên kết liên kết π trong mạch C là a → tổng số liên kết π trong este là a +b

3

Rb(COO)abR'a + abH2O

2+

bR(COOH)a + aR'(OH)b

10

00

B

Vậy công thức tổng quát của este mạch hở là CH2n+2-2a-2bO2b Câu 2: Đáp án: D Công thức chung của axit là R(COOH)a, công thức chung của ancol là R'(OH)b

Ó

A

C

ẤP

Công thức tổng quát của este tạo bởi một axit cacboxylic và một ancol là Rb(COO)abR'a. Câu 3: Đáp án: A CnH2n + 2O2 là CTTQ của este no, đơn chức, mạch hở.

-L

Í-

H

CnH2n - 2O2 là CTTQ của este không no, có một nối đôi, đơn chức, mạch hở.

ÁN

CnH2n + 2O2 không thể là este vì có độ bất bão hòa k =

2n + 2 − (2n + 2) =0 2

BỒ

ID Ư

Ỡ N

G

TO

CnH2nO không thể là este vì có số nguyên tử O = 1. Câu 4: Đáp án: B Este no, đơn chức, đơn vòng có độ bất bão hòa k = 1π + 1v = 2.

CnH2nO2 có CTTQ của este no, đơn chức, mạch hở.

CnH2n - 2O2 là CTTQ của este không no, có một nối đôi, đơn chức, mạch hở hoặc CTTQ của este no, đơn chức, đơn vòng.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

2n + 2 − (2n + 2) =0 2

N

CnH2n + 2O2 không thể là este vì có độ bất bão hòa k =

TP .Q

U

Y

N

H Ơ

CnH2nO không thể là este vì có số nguyên tử O = 1 Câu 5: Đáp án: C Este tạo bởi ancol no, đơn chức mạch hở và axit không no, có một liên kết đôi C=C, đơn chức, mạch hở là

Đ

ẠO

CnH2n - 1COOCmH2m + 1 ≡ Cn + m + 1H2n + 2mO2 ≡ CxH2x - 2O2 Câu 6: Đáp án: C Este tạo bởi axit axetic và glixerol:

B

TR ẦN

(CxH2x - 1COO)2CyH2y ≡ Cx + 2 + yH2x - 2 + 2yO4 ≡ CnH2n - 6O4 Câu 8: Đáp án: A Este tạo bởi axit benzoic và ancol etylic là

H

www.daykemquynhon.ucoz.com

Ư N

G

3CH3COOH + C3H5(OH)3 <=> (CH3COO)3C3H5 + 3H2O Câu 7: Đáp án: C Este tạo bởi ancol no, 2 chức mạch hở và axit cacboxylic không no, có một nối đôi C=C là

2+

3

10

00

C6H5COOH + C2H5OH <=> C6H5COOC2H5 + H2O Câu 9: Đáp án: D C3H6O2 có 3 đồng phân đơn chức mạch hở:

ẤP

1. CH3CH2COOH

Ó

A

C

2. HCOOCH2CH3

TO

ÁN

-L

Í-

H

3. CH3COOCH3 Câu 10: Đáp án: A C4H8O2 có 4 đồng phân este: HCOOCH2CH2CH3, HCOOCH(CH3)CH3, CH3COOCH2CH3, CH3CH2COOCH3. Câu 11: Đáp án: D Có 6 đồng phân cấu tạo của nhau có CTPT C4H8O2 đều tác dụng với NaOH là

Ỡ N

G

1. HCOOCH2CH2CH3

BỒ

ID Ư

2. HCOOCH(CH3)2

3. CH3COOCH2CH3 4. CH3CH2COOCH3

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

5. CH3CH2CH2COOH

N

H Ơ

N

6. (CH3)2CHCOOH Câu 12: Đáp án: D số liên kết π = (2 × 4 + 2 - 6) : 2 = 2.

TP .Q

U

Y

Các đồng phân: HCOO-CH=CH2CH3 ( tính cả đồng phân hình học)

Đ

ẠO

HCOO-CH2CH=CH2

Ư N

G

HCOO-C(CH3)=CH2

H

CH3COOCH=CH2

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

CH2=CHCOOCH3 Câu 13: Đáp án: C Các đồng phân este là: CH3CH2CH2COOCH2CH2CH3, CH3CH2CH2COOCH(CH3)CH3, CH3CH(CH3)COOCH2CH2CH3, CH3CH(CH3)COOCH(CH3)CH3. Đáp án C.

Í-

H

Ó

CH2=CH-CH2-COOH,

A

C

ẤP

2+

3

Chú ý : Có thể giải như sau C4H8O2 có 2 đồng phân axit. C3H8O có 2 đồng phân ancol. Vậy số đồng phân este là 2 × 2 = 4. Câu 14: Đáp án: A + axit

-L

CH3-CH=CH-COOH (tính cả đồng phân hình học)

TO

ÁN

CH2=C(CH3)-COOH. + este

Ỡ N

G

HCOOCH=CH-CH3 (tính cả đồng phân hình học)

BỒ

ID Ư

HCOO-CH2-CH=CH2, HCOOC(CH3)=CH2.

CH3COOCH=CH2 CH2=CH-COOCH3

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

Câu 15: Đáp án: B Este đơn chức tác dụng với dung dịch AgNO3/NH3 là este của axit fomic HCOOH.

U

Y

N

H Ơ

Các đồng phân thỏa mãn là : HCOOCH2CH2CH3, HCOOCH(CH3)CH3. Câu 16: Đáp án: C Các este không thể điều chế trực tiếp từ axit và ancol là:

TP .Q

HCOOCH=CHCH3 (tính cả đồng phân hình học)

ẠO

HCOOC(CH3)=CH2

G Ư N

B

Các đồng phân este là

H

36.36 ⇒ n = 4 (C4H8O2) 100

TR ẦN

www.daykemquynhon.ucoz.com

%O = 32 : (14n + 32) =

Đ

CH3COOCH=CH2 Câu 17: Đáp án: C Đặt công thức chung của X là CnH2nO2.

10

00

HCOOCH2CH2CH3

2+

3

HCOOCH(CH3)CH3

ẤP

CH3COOCH2CH3

Í-

H

Ó

A

C

CH3CH2COOCH3. Câu 18: Đáp án: C Giả sử este đơn chức. Đặt CTC là CxHyO2

53.53 100

ÁN

-L

%O = 32 / (12 × x + y + 32) =

TO

Suy ra 12 × x + y = 28. Biện luận x = 2, y= 4.

BỒ

ID Ư

Ỡ N

G

Este là HCOOCH3

Câu 19: Đáp án: C %O = 100 - 40 - 6,66 = 53,34%. nC : nH : nO =

40 6, 66 53,34 : : = 3,33 : 6,33 : 3,33 = 1 : 2 : 1 12 1 16

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ẠO

TP .Q

U

Y

N

H Ơ

N

Suy ra, este là C2H4O2. HCOOCH3 Câu 20: Đáp án: A Este X có dạng RCOOCH3. MX = MR + 59 = 2,3125 × 32 = 74. MR = 15. R là -CH3. Vậy este X là CH3COOCH3. Đáp án A Câu 21: Đáp án: A 3.2 + 2 − 6 = 1 → X có 1π trong phân tử. C3H6O2 có độ bất bão hòa: k = 2

G

Đ

X có thể là axit: CH3CH2COOH hoặc este HCOOCH2CH3 hoặc CH3COOCH3.

www.daykemquynhon.ucoz.com

H

Ư N

X không thể là ancol hai chức, không no, có 1 liên kết pi vì không tồn tại CH2=C(OH)CH2OH hoặc CH2=CH-CH(OH)2.

10

00

B

TR ẦN

X không thể là xeton hay anđehit no 2 chức vì xeton hay anđehit no 2 chức có độ bất bão hòa k = 2. Câu 22: Đáp án: D 4.2 + 2 − 8 C4H8O2 có độ bất bão hòa k = =1 2

2+

3

Đáp án A thỏa mãn.

ẤP

X cũng có thể là ancol 2 chức, không no, có 1 liên kết pi: HOCH2-CH=CH-CH2OH.

D escription: C :\U sers\duo ng\D esktop\ duongngu\C ơ bản - Lý thuy ết trọng tâm v ề este (Đề 1)_file…

Í-

H

Ó

A

C

X không thể là xeton hay anđehit no 2 chức có độ bất bão hòa k = 2 nên không thỏa mãn. Câu 23: Đáp án: C nCH3CH2COOCH=CH2 -(-CH(OOCCH2CH3)-CH2-)n-

ÁN

-L

CH3CH2COOCH=CH2 + NaOH → CH3CH2COONa + CH3CHO

TO

CH3CH2COOCH=CH2 có nối đôi gắn vào gốc ancol còn CH2=CHCOOCH3 có nối đôi gắn vào gốc axit → hai chất không cùng dãy đồng đẳng.

BỒ

ID Ư

Ỡ N

G

CH3CH2COOCH=CH2 + Br2 → CH3CH2COOCHBr-CH2Br Câu 24: Đáp án: B Khi thay nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR thì được este.

Este đơn giản có CTCT là RCOOR' (với R, R' là gốc hiđrocacbon no, không no hoặc thơm) → Hợp chất HCOOC6H5 là este → Chọn B.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

CH3CH2Cl là dẫn xuất halogen, CH3CH2NO2 là dẫn xuất nitro Câu 25: Đáp án: B Este có dạng RCOOR1. Trong đó R có thể là H hoặc nhóm hidrocacbon. R1 là nhóm hidrocacbon. Câu 26: Đáp án: C C2H5COOH là axit propionic. HO-C2H4-CHO là hợp chất tạp chức của ancol và anđehit.

Đ

ẠO

CH3COOCH3 là este của axit axetic.

TR ẦN

www.daykemquynhon.ucoz.com

HCOOC6H5, HCOOCH3, CH3COOCH3 là các este.

H

Ư N

G

HCOOC2H5 là este của axit fomic. Câu 27: Đáp án: C Khi thay nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR thì được este.

10

00

B

CH3COOH là axit. Câu 28: Đáp án: B Khi thay nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR thì được este.

ẤP

C3H5(COOCH3)3 là este đa chức.

2+

3

HCOOCH3, CH3COOC2H5 là các este đơn chức.

Í-

H

Ó

A

C

C2H5OC2H5 là ete. Câu 29: Đáp án: B Etyl axetat có CTCT: CH3COOCH2CH3

-L

Metyl propionat có CTCT: CH3CH2COOCH3.

TO

ÁN

Metyl axetat có CTCT: CH3COOCH3.

BỒ

ID Ư

Ỡ N

G

Propyl axetat có CTCT: CH3COOCH2CH2CH3 Câu 30: Đáp án: B CH3COOCH3 là metyl axetat.

HCOOC2H5 là etyl fomat. HCOOCH=CH2 là vinyl fomat. HCOOCH3 là metyl fomat. Câu 31: Đáp án: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Giả sử este có CTCT RCOOR'

H Ơ

N

Tên este gồm: tên gốc hiđrocacbon R' + tên anion gốc axit (đuôi "at")

N

→ R' của este vinyl axetat là -CH=CH2; RCOO của este là CH3COO

TP .Q

U

Y

→ Công thức thỏa mãn là CH3COOCH=CH2 Câu 32: Đáp án: C CH3COOCH3 là metyl axetat.

Đ

ẠO

CH3COOCH=CH2 là vinyl axetat.

Ư N

G

CH2=CHCOOCH3 là metyl acrilat.

H TR ẦN

www.daykemquynhon.ucoz.com

HCOOCH3 là metyl fomat. Câu 33: Đáp án: B Metyl acrylat là CH2=CHCOOCH3

B

Metyl metacrylat là CH2=C(CH3)COOCH3.

ẤP

2+

3

10

00

Metyl metacrylic, metyl acrylic là những danh pháp sai. Câu 34: Đáp án: A Este này có dạng CH3CH(CH3)CH2COO-CH2CH2CH(CH3)CH3 Câu 35: Đáp án: B Axit isovaleric có công thức (CH3)2CHCH2COOH

A

C

Ancol Isoamylic có công thức (CH3)2CHCH2CH2OH

TO

ÁN

-L

Í-

H

Ó

Este isoamyl isovalerat được tạo từ axit isovaleric và ancol isoamylic có cấu tạo (CH3)2CHCH2CH2OOCCH2CH(CH3)2 Câu 36: Đáp án: C Metyl fomat là este no đơn chức,có công thức cấu tạo HCOOCH3, CTPT C2H4O2 → A , D đúng

BỒ

ID Ư

Ỡ N

G

Axit axetic CH3COOH và metyl fomat HCOOCH3 có cùng công thức phân tử khác nhau công thức cấu tạo nên là đồng đẳng của nhau Câu 37: Đáp án: D Isoamyl axetat có cấu tạo CH3COOCH2-CH2-CH(CH3)2 được tổng hợp từ ancol isoamylic ((CH3)2CH-CH2-CH2OH) và axit axetic CH3COOH. Câu 38: Đáp án: D . .

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Y

Ư N

G

Đ

ẠO

TP .Q

dụng với Na nên chất X chỉ có thể là este. Các đồng phân thỏa mãn là:

U

⇒ Có 4 đồng phân Câu 39: Đáp án: C CTPT chất X C4 H8O2 có π + v = 1 , có 2 nguyên tử O mà X tác dụng với NaOH , không tác

H Ơ

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Câu 40: Đáp án: D Công thức của benzyl axetat là CH3-COO-CH2-C6H5 Câu 41: Đáp án: B Este có mùi chuối chín là isoamyl axetat : CH3COOCH2CH2CH(CH3)2 o

10

00

Ni ,t CH3-CH(CH3)-CH2-CHO (X) + H2  → CH3-CH(CH3)-CH2-CH2OH (Y)

CH3COOCH2CH2CH(CH3)2 + H2O.

2+

3

CH3-CH(CH3)-CH2-CH2OH (Y) + CH3COOH (Z)

A

C

ẤP

Chú ý hỏi tên thay thế của X là 3-metylbutanal ( đánh số từ nhóm chức). anđehit isovaleric là tên gốc chức Câu 42: Đáp án: C Phenyl axetat : CH3COOC6H5

H

Ó

Vinyl axetat : CH3COOCH=CH2

-L

Í-

Etyl axetat : CH3COOCH2CH3 → CTPT là C4H8O2

TO

ÁN

Propyl axetat: CH3COOCH2CH2CH3 Câu 43: Đáp án: C Este metyl metacrylat là este không no 1 nối đôi, đơn chức có cấu tạo CH2=C(CH3)-COOCH3

BỒ

ID Ư

Ỡ N

G

Vậy công thức phân tử của metyl metacrylat là C5H8O2 Câu 44: Đáp án: D Độ bất bão hòa của este =1 Este có 1 nối đôi nằm trong nhóm cacbonyl Các đồng phân este thỏa mãn là:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

3, 7 − 0,15.12 − 0,15.2 = 0, 05 32 3, 7 ⇒ MX = = 74 ⇒ C3 H 6O2 0, 05 Câu 46: Đáp án: C nO2 = 0, 25  12, 4  nCO = 0, 25 = 0, 4 ⇒  2 n H2O + nCO2 = 15, 5.2 nCO2 = nH 2O = 0, 2  44nCO + 18nH O = 12, 4  2 2

ẠO

Câu 45: Đáp án: B nCO2 = nH 2O = 0,15

Đ G Ư N H TR ẦN

3

10

Như vậy, đây là este no, đơn chức

2+

0, 2.3 − 0, 25.2 = 0, 05 2

ẤP

⇒ nX =

B

00

www.daykemquynhon.ucoz.com

nX =

C

0, 2 = 4 ⇒ C4 H 8O2 0, 05 Câu 47: Đáp án: A VH 2O = 30 ⇒ VCO2 = 40

-L

Í-

H

Ó

A

Số C trong X:

TO

ÁN

Số C trong este:

Ỡ N

G

Số H trong este:

BỒ

ID Ư

Số O trong este:

40 =4 10 30.2 =6 10 40.2 + 30 − 45.2 =2 10

Vậy, công thức este là C4H6O2 Câu 48: Đáp án: A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

nCO2 = nH 2O = 0, 3

N

H Ơ

N

Như vậy, este là no, đơn chức. Câu 49: Đáp án: A nCO2 = nH 2O = 0, 3

U

Y

7, 4 − 0,3(12 + 2) = 0,1 ⇒ M este = 74 ⇒ C3 H 6O2 2.16

TP .Q

neste =

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

Câu 50: Đáp án: C π + v = 2; v = 0 ⇒ π = 2 Do có 1 liên kết π nằm trong nhóm chức este nên còn 1 liên kết π nằm ngoài mạch. Số đồng phân este có đồng phân hình học là:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

H Ơ N Y

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Bài 1. (NC) Công thức tổng quát của este được tạo bởi axit no, 2 chức, mạch hở và ancol no, 3 chức, mạch hở là A. CnH2n-10O12 (n ≥ 12). B. CnH2n-14O12 (n ≥ 12). C. CnH2n-14O12 (n ≥ 8). D. CnH2n-10O12 (n ≥ 8). Bài 2. (Đề NC)Este X có mùi thơm của hoa nhài. Công thức của X là A. C6H5-COO-CH3. B. CH3-COO-CH2-C6H5. C. CH3-COO-C6H5. D. C6H5-CH2-COO-CH3. Bài 3. Khi đốt 0,1 mol este X thu được 0,3 mol CO2 và a mol H2O. Giá trị của a là A. a = 0,3 B. 0,3 < a < 0,4 C. 0,1 ≤ a ≤ 0,3 D. 0,2 ≤ a ≤ 0,3 Bài 4. X, Y là hai este đơn chức, đồng đẳng của nhau. Khi đốt cháy một mol X thu được a mol CO2 và b mol H2O. Còn khi đốt cháy 1 mol Y thu được a1 mol CO2 và b1 mol H2O. Biết a : a1 = b : b1. CTTQ dãy đồng đẳng este trên là A. CnH2nO2. B. CnH2n–2O2. C. CnH2n–4O2. D. CnH2n–2O4. Bài 5. (NC) P là hỗn hợp gồm ba hợp chất hữu cơ X, Y, Z đồng phân của nhau và đều tác dụng được với NaOH. Khi hóa hơi 3,7 gam X thu được 1,68 lít khí ở 136,5oC, 1atm. Mặt khác, dùng 2,52 lít (đktc) O2 để đốt cháy hoàn toàn 1,665 gam P sau phản ứng thu được V lít hỗn hợp khí (đktc). Giá trị V là A. 3,024. B. 1,512. C. 2,240. D. 2,268. Bài 6. E là este của axit cacboxylic no đơn chức (X) và ancol không no đơn chức có một nối đôi C=C (Y). Đốt a mol E thu được b mol CO2; đốt a mol X thu được c mol CO2; đốt a mol Y thu được 0,5b mol H2O. Quan hệ giữa b và c là A. b = c. B. b = 2c. C. c = 2b. D. b = 3c. Bài 7. Đốt cháy hoàn toàn 0,30 gam chất hữu cơ X thu được 224,0 ml CO2 (ở đktc) và 0,18 gam H2O. Khi cho X tác dụng với LiAlH4 thì một phân tử X tạo ra hai phân tử hữu cơ Y. Vậy công thức cấu tạo của X là A. CH3COOH

N

Nâng Cao - Lý thuyết trọng tâm về este (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

B. HCOOCH3 C. OH–CH2–CHO D. CH3COOCH3 Bài 8. Tỉ khối của một este so với hiđro là 44. Khi thuỷ phân este đó tạo nên hai hợp chất. Nếu đốt cháy cùng lượng mỗi hợp chất tạo ra sẽ thu được cùng thể tích CO2 (cùng t0,p). Công thức cấu tạo thu gọn của este là A. H-COO-CH3 B. CH3COO-CH3 C. CH3COO-C2H5 D. C2H5COO-CH3 Bài 9. Đốt cháy hoàn toàn một lượng hỗn hợp 2 este đồng đẳng, cho sản phẩm phản ứng cháy qua bình đựng P2O5 dư, khối lượng bình tăng thêm 6,21 gam, sau đó cho qua tiếp dung dịch Ca(OH)2 dư, thu được 34,5 gam kết tủa. Các este trên thuộc loại A. no, đa chức. B. không no, đơn chức. C. no, đơn chức. D. không no đa chức. Bài 10. Đốt cháy hoàn toàn 1,11 g hỗn hợp 2 este đồng phân của nhau, đều tạo bởi axit no đơn chức và ancol no đơn chức. Sản phẩm cháy cho qua dd Ca(OH)2 thấy sinh ra 4,5 g kết tủa. Hai este đó là A. HCOOC2H5, CH3COOCH3 B. CH3COOC2H5; C2H5COOCH3 C. HCOOC3H7, CH3COOC2H5 D. HOOCC3H7, C2H5COOCH3 Bài 11. Đốt cháy hoàn toàn hỗn hợp X gồm 2 chất hữu cơ no, đơn chức, mạch hở (chứa C, H, O). Dẫn sản phẩm cháy tạo thành vào dung dịch Ca(OH)2 dư, thu được a gam kết tủa và khối lượng dung dịch giảm 0,38a gam. Nếu cho X tác dụng với dung dịch NaOH dư, thu được một muối và một ancol. Hỗn hợp X gồm A. một axit và một ancol. B. một axit và một este. C. một ancol và một este. D. hai este. Bài 12. (NC) Trong 1 bình kín chứa hơi chất hữu cơ X (CnH2nO2) mạch hở và O2 (số mol O2 gấp đôi số mol cần cho phản ứng cháy) ở 139,9oC, áp suất trong bình là 0,8 atm. Đốt cháy hoàn toàn X sau đó đưa về nhiệt độ ban đầu, áp suất trong bình lúc này là 0,95 atm. X có CTPT là A. C2H4O2. B. C3H6O2. C. C4H8O2. D. C5H10O2 Bài 13. Các chất hữa cơ đơn chức Z1, Z2, Z3 có CTPT tương ứng là CH2O, CH2O2, C2H4O2. Chúng thuộc các dãy đồng đẳng khác nhau. Công thức cấu tạo của Z3 là A. HCOOCH3 B. CH3-O-CHO

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

H Ơ N

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

C. HO-CH2-CHO D. CH3COOCH3 Bài 14. Hợp chất hữu cơ X (chứa các nguyên tố C, H, O) và có khả năng tham gia phản ứng tráng gương. Số hợp chất thỏa mãn tính chất của X là? (Biết MX = 74 đvC) A. 6 chất. B. 3 chất. C. 4 chất. D. 5 chất. Bài 15. Đốt cháy hoàn toàn 10 gam este đơn chức X thu được 11,2 lít CO2 (đktc) và 7,2 gam H2O. CTPT của X là A. C4H8O2. B. C5H8O2. C. C4H6O2. D. C5H10O2. Bài 17. (NC) Đốt cháy hoàn toàn 2,01 gam hỗn hợp gồm axit acrylic, vinyl axetat, metyl metacrylat. Toàn bộ sản phẩm cháy cho qua dung dịch Ca(OH)2 dư, sau phản ứng thu được 9 gam kết tủa và dung dịch X. Vậy khối lượng dung dịch X đã thay đổi so với dung dịch Ca(OH)2 ban đầu là A. giảm 3,87 gam. B. tăng 5,13 gam. C. tăng 3,96 gam. D. giảm 9 gam. Bài 18. Hai chất hữu cơ X, Y (chứa C, H, O) đều chứa 53,33% oxi về khối lượng. Khối lượng phân tử của Y gấp 1,5 lần khối lượng phân tử X. Để đốt cháy 0,04 mol hỗn hợp cần 0,1 mol O2. Công thức phân tử của X, Y lần lượt là A. C2H4O2 và C3H6O3. B. C2H4O2 và C3H4O2. C. C3H6O3 và C4H8O4. D. C2H4O2 và C3H6O2. Bài 19. Đốt cháy hoàn toàn 6,8 gam một este X đơn chức chứa vòng benzen thu được CO2 và H2O. Hấp thụ toàn bộ sản phẩm này vào bình đựng dung dịch Ca(OH)2 lấy dư thấy khối lượng bình tăng 21,2 gam đồng thời có 40 gam kết tủa. Số CTCT có thể có của X là A. 4 B. 5 C. 6 D. 9 Bài 20. (CB) Đốt cháy hoàn toàn một lượng hỗn hợp 2 este, cho sản phẩm phản ứng cháy qua bình đựng P2O5 dư, khối lượng bình tăng thêm 6,21 gam, sau đó cho qua tiếp dung dịch Ca(OH)2 dư, thu được 34,5 gam kết tủa. Các este trên thuộc loại nào ? A. Este thuộc loại no. B. Este thuộc loại không no. C. Este thuộc loại no, đơn chức. D. Este thuộc loại không no đa chức.

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Bài 21. Hai chất hữu cơ X và Y đều đơn chức là đồng phân của nhau. Đốt cháy hoàn toàn 5,8 gam hỗn hợp X và Y cần 8,96 lít oxi (đktc) thu được khí CO2 và hơi nước theo tỉ lệ VCO2 : VH2O = 1 : 1 (đo ở cùng điều kiện). Công thức đơn giản của X và Y là A. C4H8O B. C2H4O C. C3H6O D. C5H10O Bài 22. Đốt cháy 1,6 gam một este E đơn chức được 3,52 gam CO2 và 1,152 gam nước. Công thức phân tử của E là A. C5H8O2. B. C4H8O2. C. C5H10O2. D. C4H6O2 Bài 23. Đốt cháy a gam một este sau phản ứng thu được 9,408 lít CO2 và 7,56 gam H2O, thể tích khí oxi cần dùng là 11,76 lít (các thể tích khí đều đo ở đktc). Biết este này do một axit đơn chức và một ancol đơn chức tạo nên. Công thức phân tử của este là A. C5H10O2 B. C4H8O2. C. C2H4O2. D. C3H6O2. Bài 24. (NC) X là este được tạo bởi axit 2 chức mạch hở và ancol no, 2 chức, mạch hở có công thức đơn giản nhất là C3H2O2. Để hiđro hóa hoàn toàn 1 mol X (xúc tác Ni, to) cần bao nhiêu mol H2: A. 4 mol B. 1 mol C. 3 mol D. 2 mol

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Ó

A

LỜI GIẢI CHI TIẾT

ÁN

-L

Í-

H

Câu 1: Đáp án: B Gọi công thức của axit no 2 chức , mạch hở là CaH2a-2O4 ( a≥ 2) và ancol no, 3 chức, mạch hở là CbH2b+2O3 ( b≥ 3).

G

TO

Este được tạo bởi axit no, 2 chức, mạch hở và ancol no, 3 chức, mạch hở có phương trình tổng hợp:

BỒ

ID Ư

Ỡ N

3CaH2a-2O4 + 2CbH2b+2O3 → C3a + 2bH6a+ 2b-14O12 + 6H2O Đặt 3a+ 2b = n → công thức tổng quát là CnH2n-14O12 và n ≥ 3.2 + 2.3 → n ≥ 12

Chú ý trong phương trình tổng hợp este để số chức axit kết hợp vừa đủ với chức ancol nên cần 3 axit và 2 ancol. Trong quá trình tổng hợp tách ra 6 phân tử H2O. Hệ số C, H của este dùng bảo toàn nguyên tố để tính.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

Câu 2: Đáp án: B Este X có mùi thơm của hoa nhài là CH3COOCH2C6H5 Câu 3: Đáp án: C 0, 3 Số C trong X: =3 0,1 Giá trị của a phụ thuộc vào số liên kết có trong X

Đ

ẠO

CTCT của este có 3C và ít nhất: HCOOC2 H 5

H

TR ẦN

www.daykemquynhon.ucoz.com

CTCT của este có 3C và nhiều nhất: HCOOC ≡ CH

Ư N

G

⇒ π = 1 ⇒ nH 2O = nCO2 = 0,3

⇒ π = 3 ⇒ nH 2O = nCO2 − (3 − 1) nX = 0,1

A

C

ẤP

2+

3

10

00

B

⇒ 0,1 ≤ a ≤ 0,3 Câu 4: Đáp án: A Ta thấy tỉ lệ nCO2/nH2O luôn bằng nhau ở mọi chất => đồng đẳng của este no đơn chức Câu 5: Đáp án: D 1.1, 68 3, 7 nX = = 0, 05 ⇒ M X = = 74 ⇒ C3 H 6O2 22, 4 0, 05 .(273 + 136,5) 273

H

Ó

Khi đốt P

-L

Í-

n p = 0, 0225 ⇒ nCO2 = nH 2O = 0, 0225.3 = 0, 0675

0, 0675.3 − 0, 0225.2 = 0, 07875 2

TO

ÁN

⇒ nO2 =

BỒ

ID Ư

Ỡ N

G

Thể tích khí còn lại sau phản ứng: V = nCO2 + nO2 du = 22, 4(0, 0675 + 0,1125 − 0, 07875) = 2, 268 Câu 6: Đáp án: B Đốt ancol: nCO = nH 2O = 0,5b

Bảo toàn C: Câu 7: Đáp án: B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

= 0,01 ; = 0,01 → nO trong X = 0,01 → X : (CH2O)n X bị khử bởi LiAlH4 cho 2 phân tử Y → X là ester của axit và ancol có số cacbon bằng nhau. → X : HCOOCH3 Câu 8: Đáp án: C M este = 88 ⇒ C4 H 8O2

Y

N

H Ơ

N

D escription: C :\U sers\duong\ D esktop\duongn gu\N âng C ao Lý thuy ết trọn

Khi đốt cháy cho cùng số CO2 thì 2 chất trên phải có số C bằng nhau trong CTPT

Đ

ẠO

Như vậy, axit và ancol tạo nên este có số C bằng nhau

G

⇒ CH 3COOC2CH 3

TR ẦN

H

Ư N

Câu 9: Đáp án: C nH 2O = 0,345; nCO2 = 0,345

www.daykemquynhon.ucoz.com

TP .Q

U

D escription: C :\U sers\duong \D esktop\duon gngu\N âng C ao - Lý thuy ết tr

C

ẤP

2+

3

10

1,11 − 0, 045.12 − 0, 045.2 = 0, 03 16 1,11.2 ⇒M = = 74 ⇒ C3 H 6O2 0, 03 ⇒ nO =

00

B

Như vậy, este là no, đơn chức Câu 10: Đáp án: A nCO2 = 0, 045 ⇒ nH 2O = 0, 045

A

Hai este đó là: HCOOC2 H 5 & CH 3COOCH 3

-L

Í-

H

Ó

Câu 11: Đáp án: B Sản phẩm cháy bao gồm CO2 , H 2O

ÁN

Gọi số mol chất là x, y aCaCO3 = 100 x

BỒ

ID Ư

Ỡ N

G

TO

Khối lượng dung dịch giảm

Mặt khác Nếu cho X tác dụng với dung dịch NaOH dư, thu được một muối và một ancol --> 1 este và 1 axit Câu 12: Đáp án: B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ẠO

TP .Q

U

Y

N

H Ơ

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

G

Đ

Câu 13: Đáp án: A Vì 3 hợp chất hữu cơ đều là đơn chức ⇒ Z1 Là anđehit fomic HCHO

Ư N

⇒ Z 2 là axit fomic HCOOH

www.daykemquynhon.ucoz.com

H

⇒ Z 3 không thuộc dãy đồng đẳng anđehit no đơn chức và axit no đơn chức

TR ẦN

⇒ Z 4 là este HCOOCH 3

2+

3

10

00

B

Câu 14: Đáp án: D

ẤP

Câu 15: Đáp án: B nCO2 = 0,5; nH 2O = 0, 4

C

10 − 0,5.12 − 0, 4.2 10 = 0,1 ⇒ M x = = 100 ⇒ C5 H 8O2 32 0,1 Câu 16: Đáp án: C 0,11 − 0, 005.12 − 0, 005.2 nX = = 0, 00125 32

ÁN

-L

Í-

H

Ó

A

⇒ nX

TO

Nhận xét: do nCO2=nH2O nên este là no, đơn chức

0, 005 = 4 ⇒ C4 H 8O2 0, 00125

Số đồng phân thỏa mãn

BỒ

ID Ư

Ỡ N

G

Số C trong X:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 17: Đáp án: A Cả 3 chất trên đều có

TP .Q

U

Y

N

H Ơ

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

ẠO

trong phân tử

= 0, 09 − nH 2O ⇒ nH 2O = 0, 065

TR ẦN

www.daykemquynhon.ucoz.com

H

32

G

2, 01 − 0, 09.12 − 2nH 2O

Ư N

Đ

⇒ nX = nCO2 − nH 2O

B

Khối lượng dung dịch X thay đổi: ∆m = mCO2 + mH 2O − mCaCO3 = 0, 09.44 + 0, 065.18 − 9 = −3,87

2+

3

10

00

Vậy, khối lượng giảm 3,87 gam Câu 18: Đáp án: A Từ giả thiết Khối lượng phân tử của Y gấp 1,5 lần khối lượng phân tử X và do X và Y có cùng %Oxi nên ta suy ra số nguyên tử O trong Y gấp 1,5 lần trong X

C

ẤP

Như vậy, số nguyên tử O trong X và Y theo tỉ lệ 2:3

Í-

H

Ó

A

Trong các đáp án thì chỉ có đáp án A thỏa mãn Câu 19: Đáp án: C nCO2 = 0.4

-L

mCO2 + mH 2O = 21, 2 ⇒ nH 2O = 0, 2 nO 6.8 − 0, 4.12 − 0, 2.2 = = 0, 05 2 32 6,8 = = 136 ⇒ C8 H 8O2 0, 05

TO

ÁN

⇒ neste =

Ỡ N

G

⇒ M este

BỒ

ID Ư

Các CTCT có thể có:

o, m, p − CH 3 − C6 H 4OOOCH CH 3COOC6 H 5 C6 H 5COOCH 3 HCOOCH 2 − C6 H 5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

Câu 20: Đáp án: C nCO2 = nH 2O = 0,345

0,3.3 − 0, 4.2 = 0,1 1 C : H : O = 0, 3 : 0, 6 : 0,1 = 3 : 6 :1 Câu 22: Đáp án: A Este đơn chức có 2 O trong phân tử

U

Ư N

G

Đ

ẠO

nO =

TR ẦN

10

00

B

Câu 23: Đáp án: B nCO2 = 0, 42; nH 2O = 0, 42

H

1, 6 − 0, 08.12 − 0, 064.2 nO 16 ⇒ neste = = = 0, 016 2 2 ⇒ M E = 100 ⇒ C5 H 8O2

www.daykemquynhon.ucoz.com

Y

5,8 + 0, 4.32 = 0, 3 62

TP .Q

Bảo toàn khối lượng: mCO2 + mH 2O = mX + mO2 ⇒ nCO2 = nH 2O =

N

H Ơ

Như vậy, este thuộc loại no, đơn chức, mạch hở Câu 21: Đáp án: C

2+

3

Như vậy, đây là este no đơn chức

0, 42.2 + 0, 42 − 0,525.2 = 0,105 2 0, 42 Số C trong este: = 4 ⇒ C4 H 8O2 0,105 Câu 24: Đáp án: D Theo đề bài, este X có 4 nguyên tử oxi và là este vòng. ⇒ CTPT của X là C6 H 4O4

-L

Í-

H

Ó

A

C

ẤP

⇒ neste =

6, 2 + 2 − 4 =5 2 Trong X có 1 vòng, 2 liên kết trong nhóm COO, và 2 liên kết π trong mạch Cacbon. Suy ra, để hiđro hóa hoàn toàn 1 mol X cần 5-1-2=2 mol H2

BỒ

ID Ư

Ỡ N

G

TO

ÁN

π +v =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ N Y

TO

Ỡ N

G

A.

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Bài 1. Chọn đáp án đúng: A. Chất béo là trieste của glixerol với axit. B. Chất béo là trieste của ancol với axit béo. C. Chất béo là trieste của glixerol với axit vô cơ. D. Chất béo là trieste của glixerol với axit béo. Bài 2. Chất béo (hay còn gọi là lipit) được định nghĩa là: A. Muối của các axit béo. B. Hỗn hợp của các glixerol và các axit béo. C. Hỗn hợp các axit béo. D. este của glixerol và các axit béo. Bài 3. Khi thủy phân chất nào sau đây sẽ thu được glixerol ? A. Muối B. Este đơn chức C. Chất béo D. Etyl axetat Bài 4. Câu nào dưới đây đúng ? A. Chất béo là chất rắn không tan trong nước. B. Chất béo không tan trong nước, nhẹ hơn nước nhưng tan nhiều trong dung môi hữu cơ. C. Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố. D. Chất béo là trieste của gilxerol với axit. Bài 5. Dãy các axit béo là A. axit axetic, axit acrylic, axit propionic. B. axit panmitic, axit oleic, axit axetic. C. axit fomic, axit axetic, axit stearic. D. axit panmitic, axit stearic, axit oleic. Bài 6. Có thể gọi tên este (C17H33COO)3C3H5 là A. triolein B. tristearin C. tripanmitin D. stearic Bài 7. Trong thành phần của một loại sơn có các triglixerit là trieste của glixerol với axit linoleic C17H31COOH và axit linolenic C17H29COOH. Vậy CTCT nào không đúng trong các công thức sau:

N

Cơ Bản - Lý thuyết và bài tập về Lipit – Chất béo (Đề 1)

BỒ

ID Ư

B.

C.

D.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

Bài 8. Xà phòng được điều chế bằng cách nào trong các cách sau: A. Phân hủy mỡ. B. Thủy phân mỡ trong kiềm. C. Phản ứng của axit với kim loại. D. Đehiđro hóa mỡ tự nhiên. Bài 9. Khi đun nóng chất béo với dung dịch H2SO4 loãng thu được A. glixerol và axit béo. B. glixerol và muối natri của axit béo. C. glixerol và axit cacboxylic. D. glixerol và muối natri của axit cacboxylic. Bài 10. Loại dầu nào sau đây không phải là este của axit béo và glixerol ? A. Dầu vừng. B. Dầu ôliu. C. Dầu gan cá. D. Dầu luyn. Bài 11. Để biến một dầu thành mỡ rắn, hoặc bơ nhân tạo người ta thực hiện quá trình A. hiđro hóa. B. cô cạn ở nhiệt độ cao. C. xà phòng hóa. D. làm lạnh.

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

Ni Bài 12. Axit X + 2H2  → axit Y. Tên gọi của axit X và Y lần lượt là: A. Axit panmitic; axit oleic. B. Axit linoleic và axit oleic. C. Axit oleic và axit steric. D. Axit linoleic và axit stearic. Bài 13. Chỉ ra điểm không đúng của các axit béo thường gặp: A. Đều là axit cacboxylic đơn chức. B. Có mạch dài không phân nhánh. C. Đều là các axit cacboxylic no. D. Có số chẵn nguyên tử Cacbon trong phân tử. Bài 14. Dầu mỡ để lâu bị ôi, thiu là do chất béo bị A. cộng hiđro thành chất béo no. B. khử chậm bởi oxi không khí. C. thủy phân với nước trong không khí. D. oxi hoá chậm thành các chất có mùi khó chịu. Bài 15. Triolein không tác dụng với chất (hoặc dung dịch) nào sau đây ? A. H2O (xúc tác H2SO4 loãng, đun nóng). B. Cu(OH)2 (ở nhiệt độ thường). C. Dung dịch NaOH (đun nóng). D. H2 (xúc tác Ni, đun nóng). Bài 16. Ở nhiệt độ thường, dầu thực vật ở trạng thái lỏng vì đây là loại chất béo A. chứa chủ yếu các gốc axit béo no. B. chứa hàm lượng khá lớn các gốc axit béo không no. C. chứa chủ yếu các gốc axit béo thơm. D. dễ nóng chảy, nhẹ hơn nước và không tan trong nước. Bài 17. Khi đun nóng glixerol với hỗn hợp ba axit béo C17H35COOH, C17H33COOH, C17H31COOH có thể thu được tối đa bao nhiêu chất béo khác nhau ? A. 21.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

B. 18. C. 16. D. 19. Bài 18. Ở ruột non cơ thể người, nhờ tác dụng xúc tác của các enzim như lipaza và dịch mật chất béo bị thuỷ phân thành A. axit béo và glixerol. B. axit cacboxylic và glixerol. C. CO2 và H2O. D. NH3, CO2, H2O. Bài 19. Cho glixerol phản ứng với hỗn hợp axit béo gồm C17H35COOH và C15H31COOH, số loại trieste được tạo ra tối đa là A. 6. B. 5. C. 3. D. 4. Bài 20. Để biến một số dầu thành mỡ rắn, mỡ nhân tạo người ta thực hiện quá trình nào sau đây ? A. Hiđro hóa (Ni, to). B. Cô cạn ở nhiệt độ cao. C. Làm lạnh. D. Xà phòng hóa. Bài 21. Hãy chọn công thức cấu tạo đúng để mô tả chất béo:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

2+

3

10

A.

Ó

A

C

ẤP

B.

TO

ÁN

-L

Í-

H

C.

BỒ

ID Ư

Ỡ N

G

D. Bài 22. Phát biểu nào sau đây là đúng nhất ? A. Lipit là trieste của glixerol với các axit béo. B. Axit béo là các axit monocacboxylic mạch cacbon không phân nhánh. C. Phản ứng thủy phân chất béo trong môi trường kiềm gọi là phản ứng xà phòng hóa và là phản ứng thuận nghịch. D. Phương pháp thông thường sản xuất xà phòng là đun dầu thực vật hoặc mỡ động vật với dung dịch NaOH hoặc KOH. Bài 23. Trong thành phần của một số dầu để pha sơn có este của glixerol với các axit không no C17H33COOH (axit oleic), C17H31COOH (axit linoleic). Có thể tạo ra tối đa bao nhiêu trieste khác nhau của glixerol với các gốc axit trên? A. 4

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

B. 5 C. 6 D. 2 Bài 24. Trong cơ thể người chất béo bị oxi hoá thành những chất nào sau đây ? A. NH3 và CO2. B. NH3, CO2, H2O. C. CO2, H2O. D. NH3, H2O. Bài 25. Trong các hợp chất sau, hợp chất nào thuộc loại lipit ?

Ư N

G

Đ

ẠO

A.

TR ẦN

www.daykemquynhon.ucoz.com

H

B.

10

00

B

C.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

D. Bài 26. Mỡ tự nhiên là A. Este của axit panmitic và đồng đẳng. B. Muối của axit béo. C. Hỗn hợp của các triglixerit khác nhau. D. Este của axit oleic và đồng đẳng, ... Bài 27. Este X không tác dụng với Na nhưng tác dụng với NaOH đun nóng thu được glixerol và natri axetat. CTPT của X là A. C6H8O6 B. C9H12O6 C. C9H14O6 D. C9H16O6 Bài 28. Để phân biệt hai chất béo: triolein và tripanmitin. Người ta sẽ dùng dung dịch A. NaOH. B. Brom. C. HCl. D. CuSO4. Bài 29. Có tất cả bao nhiêu triglixerit khi thuỷ phân hoàn toàn tạo glixerol và 2 axit là axit oleic và axit stearic ? A. 2 B. 4 C. 3 D. 6 Bài 30. Loại dầu nào sau đây không phải là este của axit béo và glixerol ?

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


Ư N

G

Đ

ẠO

TP .Q

U

Y

N

A. Dầu vừng. B. Dầu ôliu. C. Dầu gan cá. D. Dầu luyn. Bài 31. Phát biểu nào sau đây sai ? A. Nhiệt độ sôi của este thấp hơn hẳn so với ancol có cùng phân tử khối. B. Trong công nghiệp có thể chuyển hoá chất béo lỏng thành chất béo rắn. C. Số nguyên tử hiđro trong phân tử este đơn và đa chức luôn là một số chẵn. D. Sản phẩm của phản ứng xà phòng hoá chất béo là axit béo và glixerol. Bài 32. Có hai bình không nhãn đựng riêng biệt hai loại chất lỏng: dầu bôi trơn máy, dầu thực vật. Cách đơn giản nhất để phân biệt hai chất lỏng trên là phương án nào dưới đây ? A. Cho dung dịch KOH dư vào. B. Cho Cu(OH)2 vào. C. Đun nóng với dung dịch NaOH dư. D. Đun nóng với dung dịch KOH dư, đề nguội, rồi cho thêm từng giọt dung dịch CuSO4. Bài 33. Hãy biểu diễn công thức cấu tạo đơn giản nhất của axit linolenic (axit octađeka-9,12,15-trienoic). Chọn đáp án đúng

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

H TR ẦN

www.daykemquynhon.ucoz.com

A. B.

B

C.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

D. Bài 34. Các chất: (1) dầu bôi trơn động cơ, (2) mỡ lợn, (3) sáp ong, (4) xà phòng, (5) dầu thực vật. Những chất nào có chứa cùng một loại nhóm định chức (xét chất hóa học là thành phần hoá học chính của chất)? A. (2), (3) và (5). B. (1), (2) và (3). C. (1), (3) và (5). D. (2), (3) và (4). Bài 35. Cho các chất lỏng sau: axit axetic, glixerol, triolein. Để phân biệt các chất lỏng trên, có thể chỉ cần dùng A. nước và quỳ tím. B. nước và dd NaOH. C. dung dịch NaOH. D. nước brom. Bài 36. Cho vài giọt dung dịch CuSO4 vào ống nghiệm chứa 3 ml dầu ăn, nhỏ tiếp dung dịch NaOH vào và đun nóng nhẹ. Hiện tượng quan sát được là: A. Tạo kết tủa Cu(OH)2 và không tan trong dầu ăn. B. Tạo kết tủa Cu(OH)2 và Cu(OH)2 tan tạo dung dịch có màu xanh thẫm. C. Tạo kết tủa Cu(OH)2 sau đó kết tủa bị tan trong NaOH dư. D. Tạo kết tủa Cu(OH)-2, lắng xuống dầu ăn nổi lên trên. Bài 37. Cho triolein lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, CH3OH, dung dịch Br2, dung dịch NaOH, dung dịch KMnO4/H+. Trong điều kiện thích hợp, số trường hợp có phản ứng xảy ra là A. 2 B. 3 C. 5 D. 4 Bài 38. Cho chất béo X có công thức cấu tạo như sau:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Khi cho X tác dụng lần lượt với: dung dịch KOH, to; dung dịch Br2; H2 (xt: Ni, to); O2. Số trường hợp có phản ứng xảy ra là A. 1 B. 2 C. 3 D. 4 Bài 39. Tính chất của lipit được liệt kê như sau: (1) chất lỏng; (2) chất rắn; (3) nhẹ hơn nước; (4) tan trong nước; (5) tan trong xăng; (6) dễ bị thuỷ phân trong môi trường kiềm hoặc axit; (7) tác dụng với kim loại kiềm giải phóng H2; (8) dễ cộng H2 vào gốc axit. Số tính chất đúng với mọi loại lipit là A. 1 B. 2 C. 3 D. 4 Bài 40. Có các nhận định sau: (1) Chất béo là những este. (2) Các este không tan trong nước do chúng nhẹ hơn nước. (3) Các este không tan trong nước và nổi trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. (4) Khi đun chất béo lỏng với hiđro có xúc tác Ni trong nồi hấp thì chúng chuyển thành chất béo rắn. (5) Chất béo lỏng thường là những triglixerit chứa gốc axit không no trong phân tử. Số nhận định đúng là A. 5 B. 4 C. 3 D. 2 Bài 41. Cho các phát biểu sau: (a) Chất béo là trieste của glixerol với các axit béo. (b) Ở động vật, chất béo tập trung nhiều trong mô mỡ. Ở thực vật, chất béo tập trung nhiều trong hạt, quả... (c) Khi đun nóng glixerol với các axit béo, có H2SO4, đặc làm xúc tác, thu được chất béo. (d) Axit panmitic, axit stearic là các axit béo chủ yếu thường gặp trong thành phần của chất béo trong hạt, quả. Số phát biểu không đúng là A. 1 B. 2 C. 3 D. 4 Bài 42. Cho các nhận định sau: (a) Lipit là chất béo. (b) Lipit là tên gọi chung cho dầu mỡ động, thực vật. (c) Lipit là este của glixerol với các axit béo. (d) Lipit là những hợp chất hữu cơ có trong tế bào sống, không hoà tan trong nước, nhưng hoà tan trong các dung môi hữu cơ không phân cực. Lipit bao gồm chất béo, sáp, steroit, photpholipit.... Số phát biểu đúng là A. 1

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 2 C. 3 D. 4 Bài 43. Cho các nhận định sau: (a) Các este không tan trong nước do chúng nhẹ hơn nước. (b) Chất béo là trieste của glixerol với các axit monocacboxylic cacbon dài, phân nhánh. (c) Chất béo chứa các gốc axit no thường là chất lỏng ở nhiệt độ thường và được gọi là dầu. (d) Các este không tan trong nước và nổi lên trên mặt nước là do chúng không tạo được liên kết hiđro với nước và nhẹ hơn nước. (e) Phản ứng thuỷ phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. (g) Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. Số nhận định không đúng là A. 3 B. 4 C. 5 D. 6 Bài 44. Cho các phát biểu về chất béo: (a) Chất béo là este 3 lần este (trieste, triglixerit) của glixerol (glixerin) với các axit monocacboxylic mạch dài, có số cacbon chẵn và không phân nhánh; (b) chất béo rắn thường không tan trong nước, nặng hơn nước; (c) dầu (dầu thực vật) là một loại chất béo trong đó có chứa các gốc axit cacboxylic không no; (d) các loại dầu (dầu ăn, dầu nhờn v.v…) đều không tan trong nước cũng như trong các dung dịch HCl, NaOH; (e) chất béo (rắn cũng như lỏng) đều tan trong dung dịch KOH, NaOH; (g) có thể điều chế chất béo nhờ phản ứng este hoá giữa glixerol và axit monocaboxylic mạch dài; Số phát biểu đúng là A. 1 B. 2 C. 3 D. 4 Bài 45. Có các nhận định sau: (1) Chất béo là trieste của glixerol với các axit monocacboxylic có số chẵn nguyên tử cacbon (khoảng từ 1224C) và không phân nhánh. (2) Lipit gồm chất béo, sáp, steroit, photpholipit,… (3) Chất béo là các chất lỏng. (4) Chất béo chứa các gốc axit không no thường là chất lỏng ở nhiệt độ thường và được gọi là dầu. (5) Phản ứng thuỷ phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. (6) Chất béo là thành phần chính của dầu mỡ động, thực vật. Số nhận định đúng là A. 2 B. 3 C. 4 D. 5 Bài 46. Cho các phát biểu sau: (a) Số nguyên tử cacbon của chất béo là số lẻ; (b) Phản ứng xà phòng hóa chất béo là phản ứng một chiều; (c) Nguyên nhân của hiện tượng dầu mỡ động thực vật để lâu bị ôi thiu là do nối đôi C=O bị oxi hóa chậm bởi oxi không khí tạo thành sản phẩm có mùi khó chịu;

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

(d) Trong công nghiệp, một lượng lớn chất béo dùng điều chế xà phòng, glixerol và chế biến thực phẩm; (e) Lipit bao gồm chất béo, sáp, gluxit và photpholipit. Số phát biểu đúng là A. 3 B. 2 C. 4 D. 5 Bài 47. Cho các phát biểu sau: (a) Chất béo được gọi chung là triglixerit hay triaxylglixerol. (b) Đun chất béo với dung dịch NaOH thì thu được sản phẩm có khả năng hoà tan Cu(OH)2. (c) Phản ứng thủy phân chất béo trong môi trường axit là phản ứng thuận nghịch. (d) Chất béo và dầu mỡ bôi trơn có cùng thành phần nguyên tố . Số phát biểu đúng là A. 2. B. 4. C. 1. D. 3. Bài 48. Cho các phát biểu sau: (a) Chất béo được gọi chung là triglixerit hay triaxylglixerol. (b) Chất béo nhẹ hơn nước, không tan trong nước nhưng tan nhiều trong dung môi hữu cơ. (c) Phản ứng thủy phân chất béo trong môi trường axit là phản ứng thuận nghịch. (d) Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5. Số phát biểu đúng là A. 2. B. 4. C. 1. D. 3. Bài 49. Cho các phát biểu sau: 1. Trong một phân tử triolein có 3 liên kết π. 2. Muối natri hoặc kali của axit hữu cơ là xà phòng. 3. Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn. 4. Chất béo lỏng là các triglixerit chứa gốc axit béo không no trong phân tử. 5. Lipit là chất béo. Số phát biểu đúng là: A. 3 B. 1 C. 4 D. 2 Bài 50. Cho các phát biểu sau: (1) Thuỷ phân htoàn este no, đơn chức mạch hở trong dd kiềm thu được muối và ancol. (2) Phản ứng este hoá giữa axit cacboxylic với ancol (xt H2SO4 đặc) là p/ứ thuận nghịch. (3) Trong phản ứng este hoá giữa axit axetic và etanol (xt H2SO4 đặc), nguyên tử O của phân tử H2O có nguồn gốc từ axit. (4) Đốt cháy hoàn toàn este no mạch hở luôn thu được CO2 và H2O có số mol bằng nhau. (5) Các axit béo đều là các axit cacboxylic đơn chức và có số ngtử cacbon chẵn. Số phát biểu đúng là: A. 4. B. 5.

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 3. D. 2.

LỜI GIẢI CHI TIẾT

U

Y

N

H Ơ

N

Câu 1: Đáp án D Chất béo là trieste của glixerol với axit béo. Câu 2: Đáp án D Chất béo là este của glixerol và các axit béo. Câu 3: Đáp án C Thủy phân chất béo sẽ thu được glixerol

TP .Q

Câu 4: Đáp án B A sai do chất béo có thể là chất lỏng, ví dụ: dầu thực vật

Ư N

D sai, chất béo là trieste của glixerol với axit béo

TR ẦN

H

Câu 5: Đáp án D Các axit béo là axit panmitic, axit stearic, axit oleic. Câu 6: Đáp án A Đây là este của glixerol với axit oleic

www.daykemquynhon.ucoz.com

Đ G

C sai do trong mỡ bôi trơn còn có các tạp chất chứa các nguyên tố như S, P...

ẠO

B đúng

00

B

Như vậy, tên là triolein

2+

3

10

Câu 7: Đáp án A A sai do trong công thức có cả axit panmitic

Í-

H

Ó

A

C

ẤP

Câu 8: Đáp án B Xà phòng có thể được điều chế bằng cách thủy phân mỡ trong môi trường kiềm Câu 9: Đáp án A đun nóng chất béo với H2SO4 sẽ thu được axit béo và glixerol (phản ứng thủy phân trong axit) Câu 10: Đáp án D Dầu luyn được điều chế từ các parafin của dầu mỏ chứ không phải là este của axit béo và glixerol

TO

ÁN

-L

Câu 11: Đáp án A Để biến dầu thành mỡ ta thực hiện hidro hóa dầu Câu 12: Đáp án D Do cộng 2 H2 nên axit phải có 2 pi trong mạch C

Ỡ N

G

Như vậy, chất thỏa mãn là Axit linoleic và axit stearic.

BỒ

ID Ư

Câu 13: Đáp án C Axit béo thường gặp có thể là không no, ví dụ axit oleic

Câu 14: Đáp án D Dấu mỡ bị ôi là do nối đôi C=C trong gốc axit của chất béo bị oxi hóa chậm bởi oxi không khí tạo thành peoxit, chất này sẽ bị phân hủy thành các anđehit có mùi khó chịu Câu 15: Đáp án B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Triolein có thể phản ứng với H2O và NaOH (thủy phân) và H2 (cộng vào nối đôi trong gốc axit) NHư vậy, đáp án đúng là B

N

Câu 16: Đáp án B

Y

H

(C17 H 33COO ) 2 (C15 H 31COO)C3 H 5 (2 − cong − thuc )

TR ẦN

(C15 H 31COO ) 2 (C17 H 33COO)C3 H 5 (2 − cong − thuc )

www.daykemquynhon.ucoz.com

U

Ư N

G

Đ

ẠO

Câu 18: Đáp án A thuyphan Chất béo  → Axit béo + Glixerol Câu 19: Đáp án A Các este có thể tạo thành là: (C17 H 33COO )3 C3 H 5 ; (C15 H 31COO )3 C3 H 5

TP .Q

Câu 17: Đáp án B Đặt chất béo lần lượt là 1, 2, 3 Các chất béo có thể thu được: 111, 112, 113, 121, 122, 123, 131, 132, 133, 212, 213, 222, 223, 232, 233, 313, 323, 333

N

H Ơ

Do chứa các gốc axit béo không no nên dầu thực vật ở trạng thái lỏng

B

vậy có tất cả tối đa 6 trieste được tạo thành

ẤP

2+

3

10

00

Câu 20: Đáp án A Để biến dầu thành mỡ ta thực hiện quá trình hidro hóa dầu. Câu 21: Đáp án D Chất béo là trieste của glixerol với axit béo Câu 22: Đáp án D A: lipit còn gồm chất béo, sáp, steroit... trong đó chỉ có chất béo là treste của axit béo và grixerol

A

C

B: thiếu mạch cacbon dài

Í-

H

Ó

C: không thuận nghịch

TO

ÁN

-L

Câu 23: Đáp án C Câu 24: Đáp án C Trong cơ thể chất béo bị oxi hóa thành CO2 và H2O

Ỡ N

G

Câu 25: Đáp án A Câu 26: Đáp án C Mỡ tự nhiên là hỗn hợp của các triglixerit khác nhau.

BỒ

ID Ư

Câu 27: Đáp án C X không tác dụng với Na nên X không có nhóm OH cũng như COOH Tác dụng với NaOH thu được ancol và muối nên là este 3 chức của glixerol và axit axetic CTPT của X: C9 H14O6 Câu 28: Đáp án B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Nhận thấy 2 chất khác nhau ở chỗ 1 chất có nối đôi trong mạch C còn chất còn lại không có Như vậy, khi cho brom tác dụng với 2 chất thì chất nào làm mất màu brom là olein, chất còn lại là panmitin

H Ơ

TP .Q

U

Như vậy có 4 chất thỏa mãn. ( chú ý câu "thành phần có...." nên không có các TH R-111 hay R-222).

Y

N

ta có các triglixerit thỏa mãn là: R-112, R-121, R-221, R-212.

N

Câu 29: Đáp án B Triglixerit gồm gốc ancol glixerin R: -H2C-CH(-)-CH2- nối với các gốc axit oleic và stearic, gọi là 1, 2.

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Câu 32: Đáp án C Dùng NaOH dư: * Dầu bôi trơn là hh các hidrocacbon nên không td vs NaOH  dd phân lớp. * Dầu thực vật là este td vs NaOH tạo muối  tạo dd đồng nhất.

G

Đ

ẠO

Vậy đáp án đúng là B. Câu 30: Đáp án D Dầu luyn đc điều chế từ các parafin của dầu mỏ chứ không phải là este của axit béo và glixerol Câu 31: Đáp án D D sai vì sản phẩm thu được là muối của axit báo và glixerol

C

ẤP

2+

3

10

C-C-C=C-C-C=C-C-C=C-C-C-C-C-C-C-C-COOH Câu 34: Đáp án A (1) Là hh các hidrocacbon. (2) Nhóm chức là este (3) Nhóm chức là este (4) Là hh muối của các axit béo. (5) Nhóm chức là este

00

B

Câu 33: Đáp án B Axit linoleic có CTCT là:

Í-

H

Ó

A

Câu 35: Đáp án A Cho 3 chất vào H2O thì chất không tan là triolein

-L

Cho quỳ tím vào 2 chất còn lại, chất nào làm quỳ hóa đỏ là axit axetic

ÁN

Chất còn lại là glixerol

CuSO4 + NaOH → Cu (OH ) 2 + Na2 SO4

G

TO

Câu 36: Đáp án B Ban đầu thì sẽ có phản ứng

ID Ư

Ỡ N

Dầu ăn cũng sẽ tác dụng với NaOH tạo glixerol và muối của axit béo.

BỒ

Cu(OH)2 sỉnh ra tạo phức tan màu xanh thẫm với glixerol

Câu 37: Đáp án B Triolein có CT là: (C17 H 33COO)3 C3 H 5 Triolein có phản ứng với: Br2 , NaOH , KMnO4 Câu 38: Đáp án D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

X là chết béo, các axit béo gồm axit stearic, oleic và linoleic. Như vậy, phản ứng thủy phân chính là cái đầu tiên -COO- (triglixerin), tức là phản ứng với KOH, to.

N

Thêm nữa, chú ý vào 2 axit không no, nối đôi C=C chính là nơi mấu chốt

H Ơ

để xảy ra các phản ứng hóa học ở gốc hđc

Y

N

Theo đó, nó có thể làm mất màu dung dịch Br2; làm no C=C bằng H2 (xt Ni, to).

TP .Q

U

► Note: ta biết dầu mỡ để trong không khí sẽ bị chuyển hóa: do O2 tấn công vào nối đôi C=C tạo thành các peroxit có mùi khó chịu.

ẠO Đ G Ư N H TR ẦN

www.daykemquynhon.ucoz.com

Vậy cả 4 TH đều có phản ứng xảy ra. Ta chọn D Câu 39: Đáp án C Các tính chất đúng là (3); (5); (6) (1) sai với chất béo no (2) sai với chất béo không no (4) sai với chất béo (7) sai với chất béo (8) sai với chất béo no.

2+

3

10

00

B

Câu 40: Đáp án B (1) đúng vì chất béo là trieste của glixerol với axit béo (2) Sai vì este không tan trong nước là do không tạo liên kết hidro với nước. (3) đúng. (4) đúng (5) đúng

-L

Í-

H

Ó

A

C

ẤP

Câu 41: Đáp án A Ý D sai vì axit panmitic và axit stearic là các axit no, thường có trong thành phần mỡ động vật. Câu 42: Đáp án A (a) Sai. Có nhiều chất là lipit chứ không riêng chất béo. (b) Sai. (c) Sai. Chất béo mới là este của glixerol với các axit béo. (d) Đúng.

G

TO

ÁN

Câu 43: Đáp án B (a) sai vì este không tan trong nước là do không tạo liên kết hidro với nước. (b) sai vì axit phải không phân nhánh (c) sai vì chất béo chứa gốc axit no ở dạng rắn. (e) sai vì phản ứng xà phòng hóa là phản ứng 1 chiều.

BỒ

ID Ư

Ỡ N

Câu 44: Đáp án D a) đúng. (b) sai vì chất béo nhẹ hơn nước. (c) đúng (d) đúng (e) sai, vì chất béo không tạo liên kết hidro với các chất trên. (g) đúng Câu 45: Đáp án C (1),(2),(4) và (6) đúng

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

(3) sai vì chất béo có thể là chất rắn

N

(5) sai, đó là phản ứng không thuận nghịch Câu 46: Đáp án A Phát biểu đúng là

H Ơ

a) Số nguyên tử cacbon của chất béo là số lẻ;

Y

N

(b) Phản ứng xà phòng hóa chất béo là phản ứng một chiều;

TP .Q

U

(d) Trong công nghiệp, một lượng lớn chất béo dùng điều chế xà phòng, glixerol và chế biến thực phẩm; [c sai là nối đôi C=C; e sai thừa gluxit)

Đ

ẠO

Câu 47: Đáp án D (a) Đúng

Ư N

G

(b) Đúng vì đun chất béo với NaOH sẽ tạo ra glixerol => phản ứng được với Cu(OH)2

www.daykemquynhon.ucoz.com

H

(c) Đúng vì thủy phân chất béo trong MT axit là pu thuận nghịch, trong MT kiềm là pu 1 chiều

B 00

Câu 48: Đáp án B Dễ dàng nhận thấy tất cả các phát biểu trên đều đúng

TR ẦN

(d) Sai vì khác thành phần nguyên tố. Dầu mỡ bôi trơn tạo thành từ các hidrocacbon

3

10

Câu 49: Đáp án D Số phát biểu đúng là: 3;4

C

ẤP

2+

Câu 50: Đáp án A (5) sai vì các axit béo đều là các axit cacboxylic đơn chức và có số nguyên tử cacbon chẵn (khoảng từ 12C đến 24C)

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

Có 4 phát biểu đúng là (1), (2), (3), (4)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 1. Đốt cháy hoàn toàn 1 mol một loại chất béo X thu được CO2 và H2O hơn kém nhau 6 mol. Mặt khác a mol chất béo trên tác dụng tối đa với 3,36 lít dung dịch Br2 0,5M. Giá trị của a gần nhất với A. 0,245 B. 0,285 C. 0,335 D. 0,425 Bài 2. Cho glixerol phản ứng với hỗn hợp gồm C17H35COOH, C17H33COOH, C17H31COOH và C15H31COOH; số loại chất béo (chứa đồng thời 3 gốc axit béo khác nhau) tối đa có thể tạo thành là A. 10 B. 12 C. 24 D. 40 Bài 3. Đun nóng hỗn hợp axit oxalic với hỗn hợp ancol metylic, ancol etylic (có mặt H2SO4 đặc xúc tác) có thể thu được tối đa bao nhiêu hợp chất hữu cơ có chứa chức este ? A. 3 B. 4 C. 5 D. 6 Bài 4. Khi đun nóng hỗn hợp gồm axit stearic, axit oleic và axit linoleic với glixerol thì thu được tối đa bao nhiêu trieste có khối lượng phân tử bằng 884u: A. 1 B. 2 C. 3 D. 4 Bài 5. Khi cho chất béo X phản ứng với dung dịch brom thì 1 mol X phản ứng tối đa với 4 mol Br2. Đốt cháy hoàn toàn a mol X thu được b mol H2O và V lít CO2 (đktc). Biểu thức liên hệ giữa V với a, b là A. V = 22,4(b + 3a). B. V = 22,4 (4a – b). C. V = 22,4(b + 6a). D. V = 22,4(b + 7a) Bài 6. X là 1 loại triglixerit hỗn tạp có chứa các gốc axít của 2 axit béo Y và Z. Đốt cháy hoàn toàn a mol X thu được b mol H2O và V lít khí CO2 (đktc) với V = 22,4.(b + 6a). Hai axít béo Y, Z không thể là A. axit panmitic ; axit stearic B. axit oleic ; axit linoleic C. axit stearic ; axit linoleic D. axit panmitic; axit linoleic Bài 7. (Đề NC)Thủy phân hoàn toàn triglixerit X trong NaOH dư người ta thu được hỗn hợp hai muối natri oleat và natri stearat theo tỉ lệ mol 1:2. Khi đốt cháy a mol X thu được b mol CO2 và c mol H2O. Liên hệ giữa a, b, c là: A. b – c = 2a B. b = c + a C. b – c = 4a D. b – c = 3a Bài 8. Cho m gam chất béo tạo bởi axit stearic và axit oleic tác dụng hết với dung dịch NaOH vừa đủ thu được dung dịch X chứa 109,68 gam hỗn hợp 2 muối. Biết 1/2 dung dịch X làm mất màu vừa đủ 0,12 mol Br2 trong CCl4. Giá trị của m là A. 132,90.

N

Nâng Cao - Lý thuyết và bài tập về Lipit – Chất béo (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 106,32. C. 128,70. D. 106,80. Bài 9. Khi thủy phân một triglixerit X ta thu được các axit béo là axit oleic, axit panmitic, axit stearic. Để đốt cháy hoàn toàn 8,6 gam X cần thể tích O2 (ở điều kiện tiêu chuẩn) là A. 20,16 lít. B. 16,128 lít. C. 15,68 lít. D. 17,472 lít. Bài 10. (Đề NC) Thủy phân 17,8 gam tristearin (C17H35COO)3C3H5 bằng 350 ml dung dịch KOH 0,2M thu được glixerol và dung dịch Y. Cô cạn Y thu được m gam chất rắn. Giá trị của m là A. 19,32. B. 19,88. C. 18,76. D. 7,00. Bài 11. Thuỷ phân hoàn toàn 10 gam một loại chất béo cần 1,2 gam NaOH. Từ 1 tấn chất béo trên đem nấu với NaOH thì lượng xà phòng nguyên chất có thể thu được là A. 1028 kg. B. 1038 kg. C. 1048 kg. D. 1058 kg. Bài 12. Xà phòng hóa hoàn toàn a gam một trieste X thu được 0,92 gam glixerol, 3,02 gam natri linoleat (C17H31COONa) và m gam natri oleat. Giá trị của a và m lần lượt là: A. 8,82; 6,08. B. 10,02; 6,08. C. 5,78; 3,04. D. 9,98; 3,04. Bài 13. Đốt cháy hoàn toàn m gam chất béo X chứa tristearin, tripanmitin, axit stearic và axit panmitic. Sau phản ứng thu được 13,44 lít CO2 (đktc) và 10,44 gam nước. Xà phòng hoá m gam X (hiệu suất 80%) thu được m gam glixerol. Giá trị của m là A. 2,484. B. 0,828. C. 1,656. D. 0,92. Bài 14. Cho a mol chất béo X cộng hợp tối đa với 5a mol Br2 . Đốt a mol X được b mol H2O và V lít CO2 .Biểu thức liên hệ giữa V, a và b là: A. V = 22,4.(4a - b) B. V = 22,4.(b + 5a) C. V = 22,4.(b + 6a) D. V = 22,4.(b + 7a) Bài 15. Đốt cháy hoàn toàn m gam chất béo X (chứa axit stearic, axit panmitic và các triglixerit của các axit này). Sau phản ứng thu được 20,16 lít CO2 (điều kiện tiêu chuẩn) và 15,66 gam nước. Xà phòng hóa m gam X (hiệu suất phản ứng bằng 90%) thì thu được khối lượng glixerol là A. 2,484 gam. B. 1,242 gam. C. 1,380 gam. D. 2,760 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 16. Đốt cháy hoàn toàn m gam chất béo X (chứa triglixerit của axit stearic, axit panmitic và các axit béo tự do đó). Sau phản ứng thu được 6,72 lít CO2 (đktc) và 5,22 gam nước. Xà phòng hoá m gam X (H = 90%) thì thu được khối lượng glixerol là A. 0,414 gam B. 1,242 gam C. 0,828 gam D. 0,46 gam Bài 17. Cho 0,25 mol tripanmitin tác dụng hoàn toàn với dung dịch NaOH dư, đun nóng, thu được m gam glixerol. Giá trị của m là A. 9,2. B. 4,6. C. 14,4. D. 23. Bài 18. Thủy phân triglixerit X trong NaOH người ta thu được hỗn hợp 3 muối natri oleat; natri sterat và natri linoleat. Khi đốt cháy a mol X thu được b mol CO2 và c mol H2O. Liên hệ giữa a, b, c là A. b – c = 5a. B. b – c = 7a. C. b – c = 4a. D. b – c = 6a. Bài 19. Hiđro hoá hoàn toàn m (gam) trioleoylglixerol thì thu được 89 gam tristearoylglixerol. Giá trị m là A. 88,4 gam B. 87,2 gam C. 88,8 gam D. 78,8 gam Bài 20. Thủy phân hoàn toàn chất béo X trong môi trường axit, thu được glixerol và hỗn hợp hai axit béo. Nếu đốt cháy hoàn toàn a mol X thì thu được 12,32 lít CO2 (đktc) và 8,82 gam H2O. Mặt khác, a mol X tác dụng tối đa với 40 ml dung dịch Br2 1M. Hai axit béo là A. axit panmitic và axit oleic. B. axit panmitic và axit linoleic. C. axit stearic và axit linoleic D. axit stearic và axit oleic. Bài 21. Xà phòng hóa hoàn toàn 70 gam hỗn hợp gồm triglixerit và axit béo cần dùng V lít dd NaOH 2M, đun nóng. Sau phản ứng thu được 7,36 gam glixerol và 72,46 gam xà phòng. Giá trị của V là: A. 0,130. B. 0,135. C. 0,120. D. 0,125. Bài 22. Một chất béo chứa este của axit panmitic và axit stearic và các axit béo tự do đó. Đốt cháy hoàn toàn chất béo đó thu được 0,5 mol CO2 và 0,3 mol H2O. Thủy phân chất béo trên thu được khối lượng glixerol là A. 9,2 gam. B. 9 gam. C. 18,4 gam D. 4,6 gam. Bài 23. Đốt cháy hoàn toàn m gam một chất béo (triglixerit) cần 1,61 mol O2, sinh ra 1,14 mol CO2 và 1,06 mol H2O. Cũng m gam chất béo này tác dụng vừa đủ với dung dịch NaOH thì khối lượng muối tạo thành là : A. 23,00 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

www.daykemquynhon.ucoz.com

H

LỜI GIẢI CHI TIẾT

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 20,28 gam. C. 18,28 gam. D. 16,68 gam. Bài 24. Một loại chất béo được tạo thành bởi glixerol và 3 axit béo là axit panmitic, axit oleic và axit linoleic. Đun 0,1 mol chất béo này với 500 ml dung dịch NaOH 1M sau phản ứng hoàn toàn thu được dung dịch X. Cô cạn cẩn thận dung dịch X (trong quá trình cô cạn không xảy ra phản ứng hóa học) còn lại m gam chất rắn khan. Giá trị của m là A. 91,6. B. 96,4. C. 99,2. D. 97. Bài 25. Đốt cháy hoàn toàn 0,1 mol triglixerit X thu được 250,8 gam CO2 và 90 gam nước. Mặt khác, 0,1 mol X phản ứng vừa đủ với V lít dung dịch Br2 2,5 M. Giá trị của V là A. 0,1. B. 0,2. C. 0,3. D. 0,4.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

 số liên kết pi trong chất béo:

B

TR ẦN

Câu 1: Đáp án D nBr2 = 3,36 x 0,5 = 1,68 mol. nCO2 − nH 2O = 0, 6 = nchatbeo

00

D escription: C :\U sers\plantronics\D esktop\M oon\H óa\2. este\N âng C ao - Lý thuy ết v à bài tập v ề Lipit – C hất béo (Đề 1)_files\latex(2).php

2+

⇒ ncb = 1, 68 : 4 = 0, 42mol → Chọn D.

3

10

Số liên kết pi trong mạch cacbon( trừ đi lk pi trong 3 nhóm R-COO): 7 – 3 = 4

H Í-

-L

Câu 3: Đáp án C Các chất thu được HOOC − COOCH 3

Ó

A

C

ẤP

Câu 2: Đáp án B Có 4 axit mà cần 3 gốc axit khác nhau để tạo este, ta có CT: ⇒ C43 = 12

ÁN

HOOC − COOC2 H 5

CH 3OOC − COOCH 3

TO

C2 H 5OOC − COOC2 H 5

BỒ

ID Ư

Ỡ N

G

CH 3OOC − COOC2 H 5

Câu 4: Đáp án D HD: Có thể giải quyết theo hướng sau, trước hết ta biết: gốc stearic C17H35COO-: M = 283, gốc oleic C17H33COO-: M = 281, gốc linoleic C17H31COO-: M = 279. trieste = gốc C3H5 liên kết với các gốc trên → tổng M các gốc = 884- 41 = 843 = 281 × 3 = 283 + 281 + 279.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ N Y U

ẠO

TP .Q

Do đó, tối đa sẽ có 4 trieste thỏa mãn ycbt.→ chọn D Câu 5: Đáp án C V −b nCO2 − nH 2O 22, 4 = = a ⇒ V = 22, 4(b + 6a) k = 4 + 3 = 7 ⇒ nX = 7 −1 6 Câu 6: Đáp án A Từ biểu thức: nCO2 = nH 2O + 6nX ⇔ nCO2 − nH 2O = (7 − 1) nX Như vậy, trong X có tổng cộng 7 liên kết π Trừ đi 3 liên kết trong COO thì trong các gốc axit có 4 liên kết π Ta thấy, đáp án A, 2 axit đề không có liên kết trong gốc hidrocacbon nên không thỏa mãn. Câu 7: Đáp án D X : (C17 H 33COO (C17 H 35COO ) 2 )C3 H 5

N

Thật chú ý TH trieste tạo bởi cả 3 gốc axit thì có 3 đồng phân ( R-1,2,3; R-1,3,2 và R-2,1,3 ).

G

Đ

Số liên kết pi trong X là: 1 + 3 = 4

Ư N

⇒ nCO2 − nH 2O = 3nX ⇒ b − c = 3a

H TR ẦN

www.daykemquynhon.ucoz.com

Câu 8: Đáp án B nC17H33COONa = 2 x nBr2 = 2 x 0,12 = 0,24 mol

→ mC17H35COONa = 109,68 - 0,24 x 304 = 36,72 gam → nC17H35COONa = 36,72 : 306 = 0,12 mol.

00

B

Vì nC17H33COONa = 2 x nC17H35COONa → X là (C17H33COO)2(C17H35COO)C3H5

H

Ó

= 0, 78 2 ⇒ VO2 = 0, 78.22, 4 = 17, 472 nO2 =

3 2+

C

ẤP

8, 6 = 0, 01 860 2nCO2 + nH 2O − 6n X

A

nX =

10

→ m = 0,12 x 886 = 106,32 gam Câu 9: Đáp án D X có công thức phân tử là C55 H104 O6

ÁN

-L

Í-

Câu 10: Đáp án B Thủy phân: (C17H35COO)3C3H5 + 3KOH → glixerol + 3C17H35COOK + KOH dư.

TO

ntristearin = 0,02 mol → nKOH cần = 0,06 mol → còn dư 0,01 mol.

G

Do đó chất rắn thu được sẽ gồm: 0,06 mol C17H35COOK và 0,01 mol KOH

Ỡ N

→ m = 19,88 gam. → Chọn B.

BỒ

ID Ư

p/s: bài này cần chú ý tỉ lệ, chất rắn chú ý có KOH còn dư và cũng đừng quên K = 39 khác Na = 23. Câu 11: Đáp án A 10 gam chất béo + 1,2 gam NaOH nNaOH = 0,03 mol.

Giả sử chất béo là (RCOO)3C3H5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3 -----------------------0,03-------------------------0,01

H Ơ

N

Theo BTKL: mRCOONa = 10 + 0,03 x 40 - 0,01 x 92 = 10,28 gam.

U

Y

10, 28.1000 = 1028kg → Chọn A. 10

TP .Q

1000 kg chất béo tác dụng với NaOH thu được

N

• 10 gam chất béo tác dụng với NaOH thu được 10,28 gam xà phòng.

ẠO

Câu 12: Đáp án A nC3H5(OH)3 = 0,92 : 92 = 0,01 mol; nC17H31COONa = 3,02 : 302 = 0,01 mol.

Đ

→ nC17H33COONa = 3 x nC3H5(OH)3 - nC17H31COONa = 3 x 0,01 - 0,01 = 0,02 mol

Ư N

G

→ mC17H33COONa = 0,02 x 304 = 6,08 gam.

H

X là (C17H31COO)(C17H33COO)2C3H5

TR ẦN

www.daykemquynhon.ucoz.com

→ a = 0,01 x 882 = 8,82 gam Câu 13: Đáp án B nCO2 = 0,6 mol; nH2O = 0,58 mol

10

00

B

Gọi công thức trung bình của triglixerit và axit tự do là:(CnH2n + 1COO)3C3H5 và CnH2n + 1COOH với số mol lần lượt là: x, y mol.

2+

3

 x(3n + 6) + x( n + 1) = 0, 6 Ta có hpt:  → x = 0,01 mol  x(3n + 4) + y ( n + 1) = 0,58

C

ẤP

Mà n(CnH2n + 1COO)3C3H5 = nC3H5(OH)3 = 0,01 mol

ÁN

-L

Í-

H

Ó

A

Do H = 90% → mC3 H 5 ( OH )3 = 0, 01.92.90% = 0,828 gam Câu 14: Đáp án D X có 5 liên kết pi ở gốc và 3 lk pi ở chức -> 8 lk pi Như vậy: V (8 − 1)nX = nCO2 − nH 2O ⇔ 7 a = − b ⇔ V = 22, 4.(b + 7 a ) 22, 4

ID Ư

Ỡ N

G

TO

Câu 15: Đáp án B nCO2 − nH 2O ntriglixerit = = 0, 015 2 ⇒ mglixerol = 0, 015.0, 9.92 = 1, 242

BỒ

Câu 16: Đáp án A nCO2 = 0,3 mol; nH2O = 0,29 mol

Gọi công thức trung bình của triglixerit và axit tự do là (CnH2n + 1COO)3C3H5 và CnH2n + 1 với số mol lần lượt là x, y mol.

 x(3n + 6) + x(n + 1) = 0,3 Ta có hpt:  → x = 0,005 mol  x(3n + 4) + y (n + 1) = 0, 29

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

n(CnH2n + 1COO)3C3H5 = nC3H5(OH)3 = 0,005 mol

N Y U

→ mC3H5(OH)3 = 0,25 x 92 = 23 gam Câu 18: Đáp án A Thủy phân X trong NaOH thu được hh 3 muối C17H33COONa, C177H35COONa và C17H31COONa

H Ơ

N

Do H = 90% → mC3H5(OH)3 = 0,005 x 92 x 90% = 0,414 gam Câu 17: Đáp án D nC3H5(OH)3 = n(C15H31COO)3C3H5 = 0,25 mol

TP .Q

→ X là (C17H33COO)(C17H35COO)(C17H33COO)C3H5

ẠO

→ Số liên kết π trong X là 1 + 2 + 3 = 6.

Ư N

G

Đ

→ nCO2 - nH2O = 5nX → b - c = 5a Câu 19: Đáp án A n(C17H35COO)3C3H5 = 89 : 890 = 0,1 mol. o

www.daykemquynhon.ucoz.com

H

Ni ,t → (C17H35COO)3C3H5 (C17H33COO)3C3H5 + 3H2 

TR ẦN

0,1 mol-------------------------------------0,1 mol

10

00

B

→ m = 0,1 x 884 = 88,4 gam Câu 20: Đáp án B Ta có nCO2 = 0,55, nH2O = 0,49 mol

3

Gọi số liên kết đôi C=C trong gốc axit là k → ak = nBr2 = 0,04 mol

ẤP

2+

Tổng số liên kết π trong X là π C=C + π C=O = k + 3

C

Luôn có nCO2 - nH2O = (k + 3-1)a → 0,06 = 0,04+ 2a → a = 0,01 , k= 4

H

Ó

A

Vì cứ 1 mol X phản ứng với 4 mol Br2 → trong có 2 gốc axit chứa 2 nối đôi ( axit linoleic) và 1 axit no ( Axxit pamitic hoặc axit steatic) → loại A, D

-L

Í-

Nhẩm số C = 0,55: 0,01 = 55 = 3 (C3H5) + 16 (C15H31COO)+ 2. 18 (C17H31COO)

Ỡ N

G

TO

ÁN

Vậy 2 axit béo thu được là axit pamitic và axit linoleic. Câu 21: Đáp án D 7,36 nC3 H 5 ( OH )3 = = 0, 08 92 nNaOH = 3nC3 H 5 ( OH )3 + nH 2O = 3.0, 08 + a = a + 0, 24

BỒ

ID Ư

Bảo toàn khối lượng: 70 + 40.(a + 0, 24) = 72, 46 + 7,36 + 18a ⇒ 22a = 0, 22 ⇒ a = 0, 01 ⇒ nNaOH = 0, 25 ⇒ V = 0,125(l ) Câu 22: Đáp án A Các axit panmitic và stearic đều có 1 π trong phân tử nên khi đốt sẽ thu được nCO2 = nH 2O este có 3 nhóm COO nên có 3 π trong phân tử ⇒ 2 nglixerol = nCO2 − nH 2O ⇒ nglixerol = 0,1 ⇒ m = 9, 2 Câu 23: Đáp án C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Bảo toàn khối lượng: mcb = 1.14.44 + 1, 06.18 − 1, 61.32 = 17, 72( g ) Bảo toàn oxi: 6ncb + 2 nO2 = 2nCO2 + nH 2O

⇒ 6ncb = 1,14.2 + 1, 06 − 1, 61.2 = 0,12 ⇒ ncb = 0, 02

H Ơ

N

nNaOH = 3ncb = 0, 06; nC3 H5 (OH )3 = ncb = 0, 02

Y

N

Bảo toàn khối lượng: mcb + mNaOH = mmuoi + mC3 H5 (OH )3

TP .Q

U

⇒ mmuoi = 17, 72 + 0, 06.40 − 0, 02.92 = 18, 28( g )

Đ

ẠO

Câu 24: Đáp án B Chất béo + NaOH  Chất rắn + Glixerol =>m = 856.0,1 + 0,5.40 – 92.0,1 = 96,4

Ư N

G

Câu 25: Đáp án B Ta có nCO2 = 5,7 mol,nH2O = 5

TR ẦN

www.daykemquynhon.ucoz.com

H

Nhận thấy nCO2- nH2O = 0,7 = 7 nX → Trong X có 8 liên kết π gồm 3 liên kết π CO và 5 liên kết π C=C

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

Nếu 0,1 mol X phản ứng với Br2 → nBr2= 5nX = 5. 0,1 = 0,5 mol → V= 0,2 lít

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

H Ơ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

Bài 1. Phản ứng este hóa giữa ancol etylic và axit axetic tạo thành sản phẩm có tên gọi là A. Axyl etylat. B. Axetyl etylat. C. Etyl axetat. D. Metyl axetat. Bài 2. Este được tạo thành từ axit no, đơn chức và ancol no, đơn chức có công thức cấu tạo là A. CnH2n+1COOCmH2m-1 B. CnH2n+1COOCmH2m+1. C. CnH2n-1COOCmH2m-1. D. CnH2n-1COOCmH2m+1. Bài 3. Trong số các Este mạch hở C4H6O2: HCOO-CH=CH-CH3 (1) HCOO-CH2-CH=CH2 (2) HCOO-C(CH3)=CH2 (3) CH3COO-CH=CH2 (4) CH2=CH-COO-CH3 (5) Các este có thể điều chế trực tiếp từ axit và ancol là: A. (2) và (4). B. (2) và (5). C. (1) và (3). D. (3) và (4). Bài 4. Các este có công thức C4H6O2 được tạo ra từ axit và ancol tương ứng có thể có công thức cấu tạo như thế nào ? A. CH2=CH-COO-CH3; CH3COO-CH=CH2; H-COO-CH2-CH=CH2. B. CH2=CH-COO-CH3; CH3COO-CH=CH2; H-COO-CH2-CH=CH2; H-COO-CH=CH-CH3. C. CH2=CH-COO-CH3; CH3COO-CH=CH2; H-COO-CH2-CH=CH2; H-COO-CH=CH-CH3; H-COOC(CH3)=CH2. D. CH2=CH-COO-CH3; H-COO-CH2-CH=CH2. Bài 5. Este được tạo ra từ axit axetic và ancol nào sau đây có mùi chuối chín ? A. 2-metylpropanol. B. 2-metylbutanol. C. 3-metylbutanol. D. 2,3-đimetylbutanol. Bài 6. Phenyl axetat được điều chế bằng phản ứng giữa A. phenol với axit axetic. B. phenol với axetan anđehit. C. phenol với axeton. D. phenol với anhiđrit axetic. Bài 7. Dãy hoá chất nào sau đây cần sử dụng để điều chế được benzyl axetat ? A. axit benzoic và ancol metylic. B. phenol, axit axetic và axit sunfuric đặc. C. phenol và anhiđrit axetic. D. ancol benzylic và axit axetic. Bài 8. Khi đun nóng hỗn hợp gồm rượu etylic, axit axetic và một ít H2SO4 đặc làm xúc tác để thực hiện phản ứng este hoá. Sau phản ứng, làm nguội hỗn hợp, thêm nước vào, hãy cho biết hiện tượng nào xảy ra A. hỗn hợp thu được tách thành 3 lớp. B. hỗn hợp thu được tách làm 4 lớp.

N

Cơ bản - Phản ứng este hóa – Điều chế este (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. hỗn hợp thu được là đồng nhất. D. hỗn hợp thu được tách làm 2 lớp. Bài 9. Khi đun nóng hỗn hợp các đồng phân của axit C3H7-COOH với hỗn hợp các đồng phân của ancol C4H9-OH (có mặt H2SO4 đặc) thì số este tối đa thu được là: A. 4. B. 6. C. 8. D. 10. Bài 10. Chất thơm P thuộc loại este có công thức phân tử C8H8O2. Chất P không được điều chế từ phản ứng của axit và ancol tương ứng, đồng thời không có khả năng phản ứng trang gương. Công thức cấu tạo thu gọn của P là công thức nào ? A. C6H5-COO-CH3. B. CH3COO-C6H5. C. H-COO-CH2-C6H5. D. H-COO-C6H4-CH3. Bài 11. Hỗn hợp gồm ancol đơn chức và axit đơn chức bị este hóa hoàn toàn thu đựơc một este. Đốt cháy hoàn toàn 0,11 gam este này thì thu được 0,22 gam CO2 và 0,09 gam H2O. Vậy công thức phân tử của ancol và axit có thể là công thức nào cho dưới đây ? A. CH4O và C2H4O2. B. C2H6O và C2H4O2. C. C2H6O và CH2O2. D. C2H6O và C3H6O2. Bài 12. Đun nóng 6,0 gam CH3COOH với 6,0 gam C2H5OH (có H2SO4 xúc tác, hiệu suất phản ứng este hóa bằng 50%). Khối lượng este tạo ra là A. 4,2 gam. B. 4,4 gam. C. 7,8 gam. D. 5,3 gam. Bài 13. Cho 23 gam C2H5OH tác dụng với 24 gam CH3COOH (xúc tác H2SO4 đặc) với hiệu suất phản ứng 60%. Khối lượng este thu được là: A. 21,12 gam. B. 26,4 gam. C. 22 gam. D. 23,76 gam. Bài 14. Đun nóng axit axetic với isoamylic (CH3)2CH-CH2CH2OH có H2SO4 đặc xúc tác thu được isoamyl axetat (dầu chuối). Tính lượng dầu chuối thu được từ 132,35 gam axit axetic đung nóng với 200 gam ancol isoamylic (Biết hiệu suất phản ứng đạt 68%) A. 97,5 gam. B. 195,0 gam. C. 292,5 gam. D. 159,0 gam. Bài 15. Tính khối lượng este metyl metacrylat thu được khi đun nóng 215 gam axit metacrylic với 100 gam ancol metylic. Giả thiết phản ứng hóa este đạt hiệu suất 60%. A. 125 gam. B. 150 gam. C. 175 gam. D. 200 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 16. Đốt cháy hoàn toàn 7,3 gam một axit no, đa chức mạch hở thu được 0,3 mol CO2 và 0,25 mol H2O. Cho 0,2 mol axit trên tác dụng với ancol etylic dư có xúc tác H2SO4 đặc. Khối lượng este thu được là (giả sử hiệu suất phản ứng đạt 100%) A. 37,5 gam. B. 28,6 gam. C. 34,7 gam. D. 40,4 gam. Bài 17. Cho 0,1 mol glixerol phản ứng với 0,15 axit axetic có xúc tác H2SO4 đặc, thu được m gam este X (không chứa chức khác) với hiệu suất phản ứng là 80%. Giá trị m là: A. 8,72. B. 14,02. C. 13,10. D. 10,9. Bài 18. Cho 0,1 mol glixerol phản ứng với 0,15 mol axit acrylic có H2SO4 đặc với hiệu suất là 60% thu được m gam este X. Giá trị của m là A. 9,72. B. 8,16. C. 7,62. D. 6,56. Bài 19. Khi cho 45,6 gam anhiđric axetic tác dụng với 64,8 gam p-crezol thu được bao nhiêu gam este nếu hiệu suất của phản ứng đạt 80% ? A. 82,23 gam. B. 83,32 gam. C. 60 gam. D. 53,64 gam. Bài 20. Đun nóng 6,0 gam CH3COOH với 9,2 gam C2H5OH (có H2SO4 làm xúc tác, hiệu suất phản ứng este hoá bằng 50%). Khối lượng este tạo thành là A. 8,8 gam. B. 6,0 gam. C. 5,2 gam. D. 4,4 gam. Bài 21. Đun sôi hỗn hợp X gồm 12 gam CH3COOH và 11,5 gam ancol etylic với H2SO4 làm xúc tác đến khi phản ứng kết thúc thu được 11,44 gam este. Tính hiệu suất phản ứng este hóa. A. 50% B. 52% C. 65% D. 66,67% Bài 22. Cho phản ứng este hóa giữa 3 gam axit axetic và 3,22 gam ancol etylic thu được 3,52 gam este. Hiệu suất của phản ứng este hóa trên là: A. 65% B. 72% C. 80% D. 75% Bài 23. Đun 12 gam axit axetic với một lượng dư ancol etylic (có H2SO4 đặc xúc tác). Đến khi phản ứng kết thúc thu được 11 gam este. Hiệu suất phản ứng este hóa là A. 70% B. 75% C. 62,5%

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 50% Bài 24. Đun một lượng dư axit axetic với 13,80 gam ancol etylic (có axit H2SO4 đặc làm xúc tác). Đến khi phản ứng dừng lại thu được 11,0 gam este. Hiệu suất của phản ứng este hóa là bao nhiêu ? A. 75,0% B. 62,5% C. 60,0% D. 41,67% Bài 25. Đun 12,00 gam axit axetic với 13,80 gam ancol etylic (có axit H2SO4 đặc làm xúc tác). Đến khi phản ứng dừng lại thu được 11,00 gam este. Hiệu suất của phản ứng este hoá là A. 75,0%. B. 62,5%. C. 60,0% D. 41,67%. Bài 26. Cho 6 gam axit axetic tác dụng với 9,2 gam ancol etylic (xúc tác H2SO4 đặc, đun nóng). Sau phản ứng thu được 4,4 gam este. Hiệu suất của phản ứng este hóa là A. 75% B. 25% C. 50% D. 55% Bài 27. Cho 12 gam axit axetic tác dụng với 4,6 gam ancol etylic (xúc tác H2SO4 đặc, đun nóng). Sau phản ứng thu được 6,6 gam este. Hiệu suất của phản ứng este hóa là A. 75% B. 25% C. 50% D. 55% Bài 28. Hỗn hợp X gồm axit fomic và axit axetic (tỉ lệ mol 1 : 1). Lấy 6,36 gam X tác dụng với 6,9 gam ancol etylic (xúc tác H2SO4) thu được 7,776 gam hỗn hợp este, hiệu suất của các phản ứng este hoá bằng nhau. Hiệu suất của phản ứng este hoá là A. 64%. B. 80% C. 75% D. 70% Bài 29. Cho 45 gam axit axetic phản ứng với 69 gam ancol etylic (xúc tác H2SO4 đặc), đun nóng, thu được 41,25 gam etyl axetat. Hiệu suất của phản ứng este hoá là A. 62,50% B. 50,00% C. 40,00% D. 31,25% Bài 30. Thực hiện phản ứng este hóa giữa m gam etanol với m gam axit acrylic (xt H2SO4 đặc), người ta thu được m gam este. Vậy hiệu suất phản ứng este hóa là: A. 81,3%. B. 72,0%. C. 46,0%. D. 66,7%. Bài 31. Este đơn chức mạch hở X thu được từ phản ứng este hóa giữa ancol Y và axit hữu cơ Z (xúc tác H2SO4 đặc, to). Đốt cháy hoàn toàn 4,3 gam X thu được 0,2 mol CO2 và 0,15 mol H2O. Số CTCT có thể có của X là A. 2

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 3 C. 4 D. 5 Bài 32. Đốt cháy a gam C2H5OH thì thu được 0,2 mol CO2. Đốt b gam CH3COOH thu được 0,2 mol CO2. Cho a gam C2H5OH tác dụng với b gam CH3COOH có xúc tác H2SO4 đặc (H = 100%). Khối lượng este thu được là A. 4,4 gam. B. 8,8 gam. C. 10,6 gam. D. 12,2 gam. Bài 33. Đốt hoàn toàn m gam ancol etylic được 0,2 mol CO2. Đốt cháy hoàn toàn p gam axit axetic được 0,2 mol CO2. Khi thực hiện phản ứng este hoá giữa m gam ancol etylic với p gam axit axetic (có H2SO4 đặc làm xúc tác, hiệu suất 80%) thu được bao nhiêu gam este? A. 7,04. B. 8,8. C. 14,08. D. 17,6. Bài 34. Chia hỗn hợp M gồm x mol ancol etylic và y mol axit axetic (x > y) thành hai phần bằng nhau. - Phần 1: Cho tác dụng với Na dư thu được 5,6 lít H2 (ở đktc). - Phần 2: Đun nóng với H2SO4 đặc tới phản ứng hoàn toàn được 8,8 gam este. Giả sử các phản ứng xảy ra hoàn toàn. Giá trị của x và y là A. x = 0,4 ; y = 0,1. B. x = 0,8 ; y = 0,2. C. x = 0,3 ; y = 0,2. D. x = 0,6 ; y = 0,4. Bài 35. Đun sôi hỗn hợp X gồm 9,0 gam axit axetic và 6,21 gam ancol etylic với H2SO4 đặc làm xúc tác đến khi kết thúc phản ứng thu được 7,92 gam etyl axetat. Hiệu suất của phản ứng este hóa là A. 60,0%. B. 61,97%. C. 63,31%. D. 66,67%. Bài 36. Đun nóng 24 gam axit axetic với lượng dư ancol etylic (xúc tác H2SO4 đặc), thu được 26,4 gam este. Hiệu suất của phản ứng este hóa là A. 75% B. 44% C. 55% D. 60% Bài 37. Cho 0,1 mol axit đơn chức X phản ứng với 0,15 mol ancol đơn chức Y thu được 4,5 gam este với hiệu suất 75%. Tên gọi của este là A. Metyl fomat B. Metyl axetat C. Etyl axetat D. Metyl propionat Bài 38. Cho 0,1 mol C3H5(OH)3 phản ứng với axit đơn chức có H2SO4 (H% = 60%) thu được 15,24 gam este X. CTCT của axit đó là A. HCOOH B. CH3COOH C. C2H5COOH

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. CH2=CH-COOH Bài 39. Đun 9,2 gam glixerin và 9 gam CH3COOH có xúc tác thu được m gam sản phẩm hữu cơ E chứa một loại nhóm chức. Biết hiệu suất phản ứng bằng 60%. Giá trị của m là A. 8,76 B. 9,64 C. 7,54 D. 6,54 Bài 40. Trộn 18 gam axit axetic với 23 gam ancol etylic rồi đun nóng một thời gian. Sau khi để nguội hỗn hợp và tách este thì được hỗn hợp chất lỏng X. Cho toàn bộ X tác dụng với Na dư thu đc 6,72 lit H2 (dktc). Số gam este tạo ra là A. 8.8g B. 17.6g C. 26.4g D. 44g Bài 41. Cho 9 gam axit axetic phản ứng với 13,8 gam ancol etylic (xúc tác H2SO4 đặc), đun nóng, thu được 8,25 gam etyl axetat. Hiệu suất của phản ứng este hoá là A. 50,00%. B. 62,50%. C. 40,00%. D. 31,25%. Bài 42. Cho 0,3 mol axit CH3COOH phản ứng với 0,2 mol ancol đơn chức X thu được 15 gam este với hiệu suất phản ứng 75%. Vậy công thức của este là: A. CH3COOCH3 B. CH3COOCH=CH-CH3 C. CH3COOCH2CH=CH2 D. CH3COOC2H5 Bài 43. Chia 11,52 gam hỗn hợp X gồm axit axetic và ancol etylic thành hai phần bằng nhau. Cho phần một tác dụng với Na dư thu được 1,232 lít H2 (đktc). Đun phần hai với H2SO4 đặc thu được m gam este với hiệu suất 80%. Giá trị của m là A. 3,520. B. 4,400. C. 4,224. D. 5,280. Bài 44. Cho hợp chất p-HO-C6H4-CH2OH tác dụng với lượng dư axit axetic có H2SO4 đặc làm xúc tác, đun nóng. Giả thiết phản ứng xảy ra hoàn toàn. Vậy sản phẩm tạo ra là: A. CH3-COO-C6H4-CH2OH B. HO-C6H4-CH2OOC-CH3 C. CH3-COO-C6H4-CH2OOC-CH3 D. Hỗn hợp gồm tất cả các chất trên Bài 45. Đun nóng hỗn hợp axit oxalic với hỗn hợp metanol, etanol (có mặt H2SO4 đặc làm xúc tác) có thể thu được tối đa bao nhiêu hợp chất chứa chức este là: A. 3 B. 4 C. 5 D. 6 Bài 46. Cho axit salixylic (X) (axit o-hiđroxibenzoic) phản ứng với metanol có H2SO4 đặc xúc tác thu được metyl salixylat (Y) dùng làm thuốc giảm đau. Cho 0,1 mol Y phản ứng với dung dịch NaOH dư. Số mol NaOH đã tham gia phản ứng là

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. 0,1. B. 0,2. C. 0,3. D. 0,05. Bài 47. Dãy hoá chất nào sau đây cần sử dụng để điều chế được benzyl axetat? A. axit benzoic và ancol metylic B. phenol, axit axetic và axit sunfuric đặc. C. phenol và anhiđrit axetic. D. ancol benzylic và axit axetic. Bài 48. Cho etanđiol tác dụng với axit fomic và axit axetic thu được tối đa bao nhiêu hợp chất có chứa nhóm chức este? A. 2 B. 4 C. 5 D. 6 Bài 49. Cho 10 gam hỗn hợp 2 axit HCOOH và CH3COOH trung hoà vừa đủ 190 ml dung dịch NaOH 1M. Nếu cho 10 gam hỗn hợp trên tác dụng với 9,2 gam rượu etylic có xúc tác H2SO4. Hiệu suất phản ứng là 90%. Lượng este thu được là A. 14,632 gam. B. 17 gam. C. 13,788 gam. D. 15 gam. Bài 50. Hỗn hợp X gồm CH3OH và C2H5OH có cùng số mol. Lấy 4,29 gam X tác dụng với 7,2 gam CH3COOH (có H2SO4 đặc xúc tác) thu được m gam hỗn hợp este (hiệu suất phản ứng este hóa đều bằng 50%). Giá trị m là A. 9,720 B. 4,455 C. 8,910 D. 4,860

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Ó

A

LỜI GIẢI CHI TIẾT

ÁN

-L

Í-

H

Câu 1: Đáp án C CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O Như vậy, este có tên là etyl axetat Câu 2: Đáp án B Gọi axit no đơn chức là CnH2n+1COOH, ancol no, đơn chức là CmH2m+1OH

G

TO

Như vậy công thức este là Cn H 2 n +1COOCm H 2 m +1

ID Ư

Ỡ N

Câu 3: Đáp án B Các este có thể điều chế trực tiếp từ axit và ancol các este có gốc RCOO liên kết với nguyên tử Cacbon no

BỒ

Như vậy, có 2 chất là (2) và (5) thỏa mãn Câu 4: Đáp án D Các đồng phân thỏa mãn HCOOCH 2CH = CH 2

CH 2 = CHCOOCH 3 Câu 5: Đáp án C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Este có mùi chuối chín là isoamyl axetat ⇒ CH 3 − CH (CH 3 ) − CH 2 − CH 2 − OOCCH 3

H Ơ

N

Như vậy, tên ancol là 3-metylbutanol

U

Y

N

Câu 6: Đáp án D Phản ứng: (CH 3CO )2 O + C6 H 5OH → CH 3COOC6 H 5 + CH 3COOH

TP .Q

Câu 7: Đáp án D Để điều chế benzyl axetat cần phản ứng este hóa của ancol benzylic và axit axetic

Đ

ẠO

Câu 8: Đáp án D Hỗn hợp sẽ tác làm 2 lớp, lớp ở trên không tan trong nước là este, lớp thứ 2 gồm rượu dư, axit dư và nước

Ư N

G

Câu 9: Đáp án C C3 H 7 COOH có 2 đồng phân; C4 H 9OH có 4 đồng phân

H TR ẦN

www.daykemquynhon.ucoz.com

=> số este tối đa thu được: 2.4 = 8 Câu 10: Đáp án B Loại A do có thể điều chế từ C6H5COOH và CH3OH

B

Loại C và D do chất này có khả năng tráng gương

10

00

B đúng do chỉ có thể điều chế được chất này bằng phản ứng (CH3CO)2O với C6H5OH

2+

ẤP

0,11 − 0, 005.12 − 0, 005.2 0,11 = 0, 00125 ⇒ M este = = 88 ⇒ C4 H 8O2 32 0, 00125

C

⇒ neste =

3

Câu 11: Đáp án B nCO2 = nH 2O = 0,005

Í-

H

Ó

A

Như vậy, công thức axit và ancol có thể là CH3COOH và C2H5OH Câu 12: Đáp án B naxit = 0,1; nancol = 0,13

ÁN

-L

⇒ meste = 0,1.0,5.88 = 4, 4 Câu 13: Đáp án A nCH3COOH = 0, 4; nC2 H5OH = 0,5

G

TO

⇒ meste = 0, 4.0,6.(59 + 29) = 21,12

ID Ư

Ỡ N

=> Đáp án A Câu 14: Đáp án B Phương trình phản ứng:

BỒ

(CH3)2CH-CH2CH2OH + CH3COOH ↔CH3COOCH2CH2CH(CH3)2 + H2O. Do nancol isoamylic =

200 132,35 > nCH3COOH = . 88 60

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

132,35 × 0,68 × 130 = 195 gam. Đáp án B 60 Câu 15: Đáp án B 215 100 Có: naxit = < nancol = 86 32

H Ơ Y

N

215 .100.0, 6 = 150( g ) 86

U

⇒ meste =

N

→ meste =

ẠO

TP .Q

Câu 16: Đáp án D 7,3 − 0, 25.2 − 0,3.12 nO = = 0, 2 16

G H

7,3 = 146 ⇒ HOOC − [CH 2 ]4 − COOH 0, 2 : (2n)

TR ẦN

www.daykemquynhon.ucoz.com

⇒ MX =

0, 2(n − 1) = 0, 05 ⇒ n = 2 2.n

Ư N

⇒ (n − 1)naxit = nCO2 − nH 2O ⇒

Đ

Giả sử có n nhóm COOH

10

00

=> Đáp án D Câu 17: Đáp án A C3 H 5 (OH )3 + 3CH 3COOH = (CH 3COO )3 C3 H 5 + 3H 2O

B

Khối lượng este thu được: m = 0,2.(29 + 44 + 14.4 + 44 + 29) = 40,4

2+

3

0,15 = 0, 05 ⇒ meste = 0, 05.218.0,8 = 8, 72( g ) 3

ẤP

⇒ neste =

H

Ó

A

C

Chọn A Câu 18: Đáp án C Do thu được este nên phản ứng theo tỉ lệ 1:3

-L

Í-

Glixerol + 3 axit acrylic ⇌ Este + H2O

ÁN

Như vậy, hiệu suất tính theo axit acrylic

0,15 .0, 6 = 7, 62 3

TO

⇒ mX = 254.

Ỡ N

G

Câu 19: Đáp án D (CH 3CO) 2 O + CH 3C6 H 4OH ⇌ CH 3COOC6 H 4CH 3 + CH 3COOH

BỒ

ID Ư

38  n( CH3CO )2 O = 85  ncrezol = 0, 6

⇒ meste =

38 .(59 + 76 + 15).0,8 = 53, 64 85

=> Đáp án D Câu 20: Đáp án D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O

H Ơ N Y U TP .Q ẠO Đ

3,52 = 0, 44 88 nCH3COOH = 0, 05  nC2 H5OH = 0, 07 0, 04 ⇒H = = 80% 0, 05

N

nCH3COOH = 0,1  nC2 H5OH = 0, 2 ⇒ m = 0,1.0,5.88 = 4, 4 => Đáp án D Câu 21: Đáp án C 12 nCH3COOH = = 0, 2; nC2 H5OH = 0, 25 ⇒ neste = naxit 60 11, 44 .100 = 65% mCH3COOC2 H5 ( lt ) = 0, 2.88 = 17, 6( g ) ⇒ H = 17.6 Chọn C Câu 22: Đáp án C CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O

G Ư N B

TR ẦN

H

11 = 0,125 88 nCH3COOH = 0, 2

ẤP

2+

3

nmuoi =

00

=> Đáp án C Câu 23: Đáp án C CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O

10

www.daykemquynhon.ucoz.com

nmuoi =

0,125 = 62,5% 0, 2 => Đáp án C Câu 24: Đáp án D CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O

ÁN

-L

11 = 0,125 88 nC2 H5OH = 0,3 nmuoi =

Í-

H

Ó

A

C

⇒H =

BỒ

ID Ư

Ỡ N

G

TO

0,125 = 41, 67% 0, 3 => Đáp án D Câu 25: Đáp án B 12 nCH3COOH = = 0, 2; nC2 H 5OH = 0,3 ⇒ neste = naxit 60 11 .100 = 62,5% mCH3COOC2 H5 ( lt ) = 0, 2.88 = 17, 6( g ) ⇒ H = 17, 6 Chọn B Câu 26: Đáp án C ⇒H =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O 4, 4 = 0, 05 88 nCH3COOH = 0,1  nC2 H5OH = 0, 2 0, 05 ⇒H = = 50% 0,1 => Đáp án C Câu 27: Đáp án A CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O

TP .Q

U

Y

N

H Ơ

N

nmuoi =

41, 25 = 0, 075 88 nCH3COOH = 0, 2  nC2 H5OH = 0,1 0, 075 ⇒H = = 75% 0,1

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

nmuoi =

10

7, 776 .100 = 80% 9, 72

2+

mRCOOC2 H 5 ( lt ) = 0,12.(8 + 4 + 29) = 9, 72 ⇒ H =

00

6, 36 = 0,12; nC2 H 5OH = 0,15 ⇒ neste = naxit 53

3

nX =

46 + 60 = 53 ⇒ R = 8 2

B

nHCOOH = nCH 3COOH ⇒ RCOOH =

TR ẦN

=> Đáp án A Câu 28: Đáp án B

A

41, 25 = 0, 46875 88 nCH 3COOH = 0, 75  nC2 H 5OH = 1,5 0, 46875 ⇒H = = 62, 6% 0, 75

C

ẤP

Chọn B Câu 29: Đáp án A CH 3COOH + C2 H 5OH ⇌ CH 3COOC2 H 5 + H 2O

TO

ÁN

-L

Í-

H

Ó

nmuoi =

BỒ

ID Ư

Ỡ N

G

=> Đáp án A Câu 30: Đáp án B m m > nCH 3COOH = ⇒ hiệu suất tính theo axit nC2 H 5OH = 46 72

nC2 H 3COOC2 H 5

m m = ⇒ H = 100 .100 = 72 % m 100 72

Chọn B Câu 31: Đáp án A

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Dễ dàng tìm được X : C4 H 6O2 mặt khác X được tạo ra từ phản ứng este hóa giữa ancol Y và axit hữu cơ Z=> X có 2 CTCT: 1.HCOOCH 2 − CH = CH 2

N

2.CH 2 = CH − COOCH 3

TP .Q

U

Y

N

H Ơ

=> A Câu 32: Đáp án B nC2H5OH = 0,1 mol; nCH3COOH = 0,1 mol CH3COOH + C2H5OH → CH3COOC2H5 + H2O nCH3COOC2H5 = 0,1 × 88 = 8,8 gam.

ẠO

Câu 33: Đáp án A nC2H5OH = 0,1 mol; nCH3COOH = 0,1 mol.

G Ư N

80 = 7,04 gam → Đáp án A. 100

H

mCH3COOC2H5 = 0,1 × 88 ×

Đ

CH3COOH + C2H5OH <=> CH3COOC2H5 + H2O

TR ẦN 00

y ( x > y) 2

2+

* Phần 2 ta được: neste = 0,1 = nancol =

B

x y 5, 6.2 + = = 0,5( mol ) 2 2 22, 4

10

* Phần 1 ta được:

3

www.daykemquynhon.ucoz.com

Câu 34: Đáp án B Chia hh M thành 2 phần bằng nhau nên:

C

ẤP

 x = 0,8 ⇒  y = 0, 2

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

Câu 35: Đáp án D Có: naxit = 0,15 > nancol = 0,135 Mà: neste = 0, 09( mol ) 0, 09 .100 = 66, 67 % ⇒H = 0,135 =>đáp án D Câu 36: Đáp án A CH3COOH + C2H5OH ⇔ CH3COOC2H5 + H2O.

BỒ

ID Ư

nCH3COOH =

24 = 0,4 mol. 60

nCH3COOC2H5 =

26, 4 = 0,3 mol. 88

0,3 = 0,75 0, 4 Đáp án A.

H=

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 37: Đáp án A neste = 0,1.0, 75 = 0, 075 ⇒ M este =

4, 5 = 60 ⇒ HCOOCH 3 ⇒ metyl axetat 0, 075

H Ơ

N

=> Đáp án A Câu 38: Đáp án D C3 H 5 (OH )3 + RCOOH → C3 H 5 (OOCR)3 + H 2O

N

15, 24 ⇒ R = 27 ⇒ CH 2 = CH − COOH 0,1.0, 6

⇒ M este = 41 + 3( R + 44) =

ẠO

TP .Q

U

Y

=> Đáp án D Câu 39: Đáp án D nGlyxerin = 0,1 ; naxetic = 0,15 E chỉ chứa 1 loại nhóm chức → E là este → axit axetic hết , glycerin dư → m = 0,15 : 3 × 0,6 × 218 = 6,54

Ư N

G

Đ

Câu 40: Đáp án B • nCH3COOH = 0,3 mol; nC2H5OH = 0,5 mol

H

Gọi số mol axit phản ứng là x

TR ẦN

www.daykemquynhon.ucoz.com

Sau phản ứng, X gồm H2O, axit dư, ancol dư

B

nH2 = 0,3 mol

2+

3

10

00

x + (0,3 - x) + (0,5 - x) = 0,3 x 2 => x = 0,2 mol => meste = 0,2 x 88 = 17,6 gam → Chọn B. Câu 41: Đáp án B nCH3COOH = 0,15 mol; nC2H5OH = 0,3 mol; nCH3COOC2H5 = 0,09375 mol.

ẤP

CH3COOH + C2H5OH <=> CH3COOC2H5 + H2O

0, 09375 = 62,5% → Chọn B. 0,15

A

C

Hiệu suất của phản ứng este hóa là H =

ÁN

15 = 100 0,15

TO

⇒ M este =

-L

neste = 0, 2.0, 75 = 0,15

Í-

H

Ó

Câu 42: Đáp án C Hiệu suất phản ứng sẽ tính theo ancol (do số mol ancol nhỏ hơn).

Ỡ N

G

Este được tạo thành từ ancol và axit nên phải có công thức là: CH 3COOCH 2CH = CH 2

BỒ

ID Ư

♦ Chú ý: tránh nhầm lẫn với công thức: CH 3COOCH = CH − CH 3 , chất này không được tạo thành từ axit và ancol.

Câu 43: Đáp án A nH2 = 0,055 mol Giả sử số mol của CH3COOH và C2H5OH trong 11,52 gam lần lượt là x, y

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

60 x + 46 y = 11, 52  x = 0,1 Ta có hpt:  →  x + y = 0, 055.4  y = 0,12

N

• 0,05 mol CH3COOH và 0,06 mol C2H5OH đun với H2SO4 đặc. H = 80%.

N

ẠO

TP .Q

U

Y

→ m = 0,05 x 88 x 80% = 3,52 gam → Chọn A. Câu 44: Đáp án B Chỉ xảy ra phản ứng p − HO − C6 H 4 − CH 2OH + CH 3COOH ⇒ p − HO − C6 H 4 − CH 2OOC − CH 3 + H 2O Vì không thể điều chế este của phenol bằng cách cho tác dụng với axit mà phải cho tác dụng với anhidrit axit

H Ơ

CH3COOH + C2H5OH <=> CH3COOC2H5 + H2O

H

Ư N

G

Đ

Câu 45: Đáp án C Các hợp chất chứa chức este gồm : HOOC-COOCH3, HOOC-COOC2H5, CH2OOC-COOCH3, C2H5OOCCOOC2H5, CH3OOC-COOC2H5.

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

Câu 46: Đáp án B Bài này ta chỉ cần đọc vào dữ liệu không cần ghi phương trình ra làm gì. Từ tên gọi ta thấy đây là một chất có nhóm chức OH đính vào nhân benzen và nhóm COOH.Khi phản ứng với metanol sẽ xảy ra phản ứng este hóa được chất Y.Khi ta cho Y ta dụng với NaOH thì sẽ có hai NaOH phản ứng một là phản ứng với nhóm OH hai là phản ứng xà phòng hóa este.Tỉ lệ 1:2 nên suy ra có 0,2(mol) NaOH tham gia phản ứng! Câu 47: Đáp án D Benzyl axetat có công thức phân tử là CH 3COO − CH 2C6 H 5 .Nó được điều chế từ axit axetic và ancol benzylic Câu 48: Đáp án C Các chất thỏa mãn CH 3COO − CH 2 − CH 2 − OH

Ó

CH 3COO − CH 2 − CH 2 − OOCCH 3

Í-

H

CH 3COO − CH 2 − CH 2 − OOCH

-L

HCOO − CH 2 − CH 2 − OH

ÁN

HCOO − CH 2 − CH 2 − OOCH

TO

Câu 49: Đáp án C

G

naxit = 0,19 ⇒ M axit =

10 1000 = 0,19 19

Ỡ N

145 19 RCOOH + C2 H 5OH ⇌ RCOOC2 H 5 + H 2O

ID Ư

Đặt công thức là RCOOH ⇒ R =

BỒ

Hiệu suất phản ứng tính theo axit:

145 Khối lượng este thu được là: mRCOOC2 H 5 = 0,19.0, 9( + 44 + 29) = 13, 788 19 => Đáp án C Câu 50: Đáp án B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn M ROH =

32 + 46 = 39 ⇒ R = 22 2

4, 29 = 0,11; nCH 3COOH = 0,12 ⇒ hiệu suất tính theo ancol 39

H Ơ

N

nROH =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

neste = 0,5nROH = 0,5.0,11 = 0, 055

U

Y

N

mCH 3COOR = 0, 055.(15 + 44 + 22) = 4,555( g )

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

Chọn B

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 1. Hỗn hợp X gồm axit HCOOH và axit CH3COOH (tỉ lệ mol 1:1). Lấy 5,3 gam hỗn hợp X tác dụng với 5,75 gam C2H5OH (có xúc tác H2SO4 đặc) thu được m gam hỗn hợp este (hiệu suất của các phản ứng este hoá đều bằng 80%). Giá trị của m là A. 10,12. B. 6,48. C. 8,10. D. 16,20. Bài 2. Cho hỗn hợp X gồm ancol metylic và hai axit cacboxylic (no, đơn chức, kế tiếp nhau trong dãy đồng đẳng) tác dụng hết với Na, giải phóng ra 6,72 lít khí H2 (đktc). Nếu đun nóng hỗn hợp X (có H2SO4 đặc làm xúc tác) thì các chất trong hỗn hợp phản ứng vừa đủ với nhau tạo thành 25 gam hỗn hợp este (giả thiết phản ứng este hoá đạt hiệu suất 100%). Hai axit trong hỗn hợp X là A. CH3COOH và C2H5COOH B. HCOOH và CH3COOH C. C2H5COOH và C3H7COOH D. C3H7COOH và C4H9COOH Bài 3. Chia 7,8 gam hỗn hợp ancol etylic và ancol đồng đẳng R-OH thành 2 phần bằng nhau. Phần 1 tác dụng với Na (dư) thu được 1,12 lít H2 (đktc). Phần 2 cho tác dụng với 30 gam CH3COOH (có mặt H2SO4 đặc). Tính tổng khối lượng este thu được, biết hiệu suất phản ứng este hoá đều bằng 80%. A. 6,48 gam. B. 8,1 gam. C. 8,8 gam. D. 6,24 gam. Bài 4. Khi đun nóng 25,8 gam hỗn hợp ancol etylic và axit axetic có H2SO4 đặc làm xúc tác thu được 14,08 gam este. Nếu đốt cháy hoàn toàn lượng hỗn hợp đó thu được 23,4 ml nước. Thành phần % hỗn hợp ban đầu và hiệu suất của phản ứng este hóa lần lượt là A. 53,5% C2H5OH; 46,5% CH3COOH và hiệu suất 80%. B. 55,3% C2H5OH; 44,7% CH3COOH và hiệu suất 80%. C. 60,0% C2H5OH; 40,0% CH3COOH và hiệu suất 75%. D. 45,0% C2H5OH; 55,0% CH3COOH và hiệu suất 60%. Bài 5. Hỗn hợp X gồm HCOOH và CH3COOH (tỉ lệ mol 1:1); hỗn hợp Y gồm CH3OH và C2H5OH (tỉ lệ mol 3 : 2). Lấy 11,13 gam hỗn hợp X tác dụng với 7,52 gam hỗn hợp Y có xúc tác H2SO4 đặc, đun nóng. Khối lượng của este thu được là (biết hiệu suất các phản ứng este đều 75%) A. 10,89 gam. B. 11,4345 gam. C. 14,52 gam. D. 11,616 gam. Bài 6. Hỗn hợp X gồm HCOOH, CH3COOH (tỉ lệ mol 1:1), hỗn hợp Y gồm CH3OH, C2H5OH (tỉ lệ mol 2:3). Lấy 16,96 gam hỗn hợp X tác dụng với 8,08 gam hỗn hợp Y (có xúc tác H2SO4 đặc) thu được m gam este (hiệu suất các phản ứng este hóa đều bằng 80%). Giá trị của m là A. 12,064. B. 22,736. C. 17,728. D. 20,4352. Bài 7. Hỗn hợp X gồm 1 axit no đơn chức., mạch hở và một axit không no đơn chức, mạch hở có một liên kết đôi ở gốc hiđrocacbon. Khi cho a gam X tác dụng hết với CaCO3 thoát ra 1,12 lít CO2 (đktc). Hỗn hợp Y gồm CH3OH và C2H5OH; khi cho 7,8 gam Y tác dụng hết Na thoát ra 2,24 lít H2 (đktc). Nếu trộn a gam

N

Nâng Cao - Phản ứng este hóa – Điều chế este (Đề 1)

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Đ

ẠO

TP .Q

U

Y

N

H Ơ

X với 3,9 gam Y rồi đun nóng có H2SO4 đặc xúc tác thì thu được m gam este (hiệu suất h%). Giá trị m theo a, h là A. (a + 2,1)h %. B. (a + 7,8)h %. C. (a + 3,9)h %. D. (a + 6)h %. Bài 8. Thực hiện phản ứng este hoá giữa axit axetic và hỗn hợp gồm 8,4 gam 3 ancol là đồng đẳng của ancol etylic. Sau phản ứng thu được 16,8 gam hỗn hợp ba este. Lấy sản phẩm của phản ứng este hoá trên thực hiện phản ứng xà phòng hoá hoàn toàn với dung dịch NaOH 4M thì thu được m gam muối (Giả sử hiệu suất phản ứng este hoá là 100%). Giá trị của m là A. 10,0. B. 16,4. C. 20,0. D. 8,0. Bài 9. Cho sơ đồ phản ứng:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

o

o

o

o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

+ CH 3OH / H 2 SO4 dac − t + Cl2 ,500 C + O2 , xt + NaOH ,t + CuO ,t X → Y  → Z  → T  → Q  → metyl − acrylat. Y, Z, T, Q là các sản phẩm chính của các phản ứng. Tên gọi của X và Z lần lượt là A. propen và ancol anlylic. B. propen và anđehit acrylic. C. propin và propan-1-ol. D. xiclopropan và ancol anlylic. Bài 10. Thực hiện phản ứng este hoá giữa axit ađipic (HOOC-(CH2)4-COOH) với ancol đơn chức X thu được hai hợp chất có chứa chức este Y1 và Y2 trong đó Y1 có công thức phân tử là C8H14O4. Công thức của X là A. C3H5OH. B. CH3OH. C. CH3OH hoặc C2H5OH. D. C2H5OH. Bài 11. Cho 4,6 gam ancol X tác dụng với Na dư thu được 1,12 lít H2. Cho 9,0 gam axit hữu cơ Y tác dụng với Na dư thu được 1,68 lít H2. Đun nóng hỗn hợp gồm 4,6 gam ancol X và 9,0 gam axit hữu cơ Y (xúc tác H2SO4 đặc, to) thu được 6,6 gam este E. Các thể tích khí đo ở điều kiện tiêu chuẩn, hiệu suất phản ứng tạo thành este là A. 50% B. 60% C. 75% D. 80% Bài 12. Một hỗn hợp đẳng mol gồm một axit cacboxylic no đơn chức và một ancol no đơn chức. Chia hỗn hợp làm hai phần bằng nhau. Phần 1 đem đốt cháy thu được 0,2 mol CO2 và 0,25 mol H2O. Phần 2 đem thực hiện phản ứng este hóa, phản ứng xong đem loại nước rồi đốt cháy thu được 0,2 mol CO2 và 0,22 mol H2O. Hiệu suất của phản ứng este hóa là A. 40% B. 45% C. 50% D. 60% Bài 13. Hỗn hợp X gồm 1 ancol no, đơn chức và 1 axit no, đơn chức mạch hở. Chia X thành 2 phần bằng nhau: - Đốt cháy hoàn toàn phần 1 sản phẩm thu được cho qua bình nước vôi trong dư thấy có 30 gam kết tủa. - Phần 2 được este hoá hoàn toàn vừa đủ thu được 1 este, đốt cháy este này thu được khối lượng H2O là

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. 1,8 gam B. 3,6 gam C. 5,4 gam D. 7,2 gam Bài 14. Hỗn hợp X gồm HCOOH, CH3COOH và C-2H5COOH (tỉ lệ 5:1:1). Lấy 5,2 gam hỗn hợp X tác dụng với 5,75 gam C2H5OH (có H2SO4 đặc làm xúc tác) thu được m gam hỗn hợp este (hiệu suât phản ứng este hóa đều bằng 80%). Giá trị m là A. 6,4 B. 8,0 C. 6,48 D. 8,1 Bài 15. Thực hiện phản ứng este hoá giữa axit axetic với 2 ancol no đơn chức là đồng đẳng kế tiếp nhau thu được hỗn hợp 2 este. Đốt cháy hoàn toàn 0,1 mol hỗn hợp 2 este đó thu được 10,08 lít CO2. Công thức cấu tạo của 2 ancol là A. CH3OH và C2H5OH B. C2H5OH và CH3CH(OH)CH3 C. C2H5OH và CH3CH-2CH2OH D. n-C3H7OH và n-C4H-9OH Bài 16. Để đốt cháy hoàn toàn 1 mol axit cacboxylic đơn chức X cần đủ 3,5 mol O2. Trộn 7,4 gam X với lượng đủ ancol no Y (biết tỉ khối hơi của Y so với O2 nhỏ hơn 2). Đun nóng hỗn hợp với H2SO4 làm xúc tác. Sau khi phản ứng hoàn toàn thu được 8,7 gam este Z (trong Z không còn nhóm chức nào khác). Công thức cấu tạo của Z là A. C2H5COOCH2CH2OCOC2H5 B. C2H3COOCH2CH2OCOC2H3 C. CH3COOCH2CH2OCOCH3 D. HCOOCH2CH2OCOH Bài 17. Chia 0,6 mol hỗn hợp gồm một axit đơn chức và một ancol đơn chức thành 2 phần bằng nhau. Phần 1: đốt cháy hoàn toàn, thu được 39,6 gam CO2. Phần 2: đun nóng với H2SO4 đặc, thu được 10,2 gam este E (hiệu suất 100%). Đốt cháy hết lượng E, thu được 22,0 gam CO2 và 9,0 gam H2O. Nếu biết số mol axit nhỏ hơn số mol ancol thì công thức của axit là A. C3H7COOH B. CH3COOH C. C2H5COOH D. HCOOH Bài 18. Đun nóng một axit đa chức X có chứa vòng benzen và có công thức là (C4H3O2)n (n < 4) với một lượng dư ancol Y đơn chức thu được este Z thuần chức có công thức (C6H7O2)m. Công thức ancol Y là A. CH3OH B. C2H5OH C. CH2=CH-CH2OH D. C3H7OH Bài 19. Este X được tạo ra từ ancol X1 đơn chức và axit X2 đa chức có công thức đơn giản là C2H3O2. Hãy cho biết có bao nhiêu chất thoả mãn ? A. 1 B. 2 C. 3 D. 4

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Bài 20. X là este tạo từ 1 axit đơn chức và ancol 2 chức. X không tác dụng với Na. Thuỷ phân hoàn toàn 0,1 mol X bằng NaOH (vừa đủ) thu được hỗn hợp sản phẩm có tổng khối lượng là 21,2 gam. Có nhiêu este thoả mãn điều kiện đó ? A. 1 B. 2 C. 3 D. 4 Bài 21. Cho 28,8 gam hỗn hợp X gồm ancol etylic và axit axetic tác dụng với Na dư thu được 6,16 lít H2 (đktc). Khi đun nóng 28,8 gam hỗn hợp X có H2SO4 đặc (xúc tác) thu được 17,6 gam este. Tính % về khối lượng mỗi chất trong X và hiệu suất của phản ứng este hóa? A. 47,92% C2H5OH; 52,08% CH3COOH và hiệu suất 75% B. 47,92% C2H5OH; 52,08% CH3COOH và hiệu suất 80% C. 45,0% C2H5OH; 55,0% CH3COOH và hiệu suất 60% D. 52,08% C2H5OH; 47,92% CH3COOH và hiệu suất 70% Bài 22. Cho 13,8 gam glixerol phản ứng hoàn toàn với axit hữu cơ đơn chức B, chỉ thu được chất hữu cơ E có khối lượng bằng 1,18 lần khối lượng của glixerol ban đầu ; hiệu suất phản ứng là 73,35%. Có bao nhiêu công thức cấu tạo phù hợp với E ? A. 3 B. 4 C. 2 D. 5 Bài 23. Đun nóng hỗn hợp axit axetic và etylen glicol (số mol bằng nhau, có H2SO4 đặc xúc tác) thì thu được hỗn hợp X gồm 5 chất (trong đó có 2 chất chứa chức este E1 và E2, ME1 < ME2 ). Lượng axit và ancol đã phản ứng lần lượt là 70% và 50% so với ban đầu. Thành phần % về khối lượng của E1 trong hỗn hợp X là A. 51,656%. B. 23,934%. C. 28,519%. D. 25,574%. Bài 24. Cho hỗn hợp X gồm 2 axit (no, đơn chức, đồng đẳng kế tiếp) và ancol etylic phản ứng hết với Na giải phóng ra 4,48 lít H2 (đktc). Mặt khác nếu đun nóng hỗn hợp X (có H2SO4 đậm đặc làm xúc tác) thì các chất trong hỗn hợp X phản ứng với nhau vừa đủ và tạo thành 16,2 gam hỗn hợp este (giả sử các phản ứng đều đạt hiệu suất 100%). Công thức của 2 axit lần lượt là A. C6H13COOH và C7H15COOH. B. CH3COOH và C2H5COOH. C. C3H7COOH và C4H9COOH. D. HCOOH và CH3COOH. Bài 25. Hỗn hợp X gồm axit axetic và etanol. Chia X thành ba phần bằng nhau: ♦ Phần 1 tác dụng với Kali dư thấy có 3,36 lít khí thoát ra. ♦ Phần 2 tác dụng với Na2CO3 dư thấy có 1,12 lít khí CO2 thoát ra. Các thể tích khí đo ở đktc. ♦ Phần 3 được thêm vào vài giọt dung dịch H2SO4, sau đó đun sôi hỗn hợp một thời gian. Biết hiệu suất của phản ứng este hoá bằng 60%. Khối lượng este tạo thành là A. 8,80 gam B. 5,20 gam C. 10,56 gam D. 5,28 gam Bài 26. Cho hỗn hợp X gồm 1 ancol đơn chức no và 1 ancol đơn chức phân tử có 1 liên kết đôi, có khối lượng m gam. Khi nạp m gam hỗn hợp vào 1 bình kín Y dung tích 6 lít và cho X bay hơi ở 136,5oC. Khi X

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

bay hơi hoàn toàn thì áp suất trong bình là 0,28 atm. Nếu cho m gam X este hóa với 45 gam axit axetic thì hiệu suất phản ứng đạt H%. Tổng khối lượng este thu được theo m và H là: A. [(2m + 4,2)H]/100 B. [(1,5m + 3,15)H]/100 C. [(m + 2,1)H]/100 D. [(m + 3)H]/100 Bài 27. (Đề NC) Đun 0,08 mol hỗn hợp H gồm hai axit hữu cơ chức X, Y là đồng đẳng kế tiếp (MX < MY) với một lượng dư ancol metylic thu được 2,888 gam hỗn hợp este với hiệu suất 50% tính từ X và 40% tính từ Y. Công thức cấu tạo của X và Y lần lượt là A. HCOOH và CH3COOH. B. CH3COOH và CH3CH2COOH. C. CH2=CHCOOH và CH2=C(CH3)COOH. D. CH3CH2COOH và CH3CH2CH2COOH. Bài 28. Oxi hóa hoàn toàn anđehit C2H4(CHO)2 trong điều kiện thích hợp thu được hợp chất hữu cơ X. Đung nóng hỗn hợp gồm 1 mol X và 1 mol ancol metylic (xúc tác H2SO4 đặc) thu được 2 este với tỉ lệ khối lượng là 1,81. Biết chỉ có 72 % lượng ancol chuyển hóa thành este. Vậy số mol của hai este có thể là A. 0,30 và 0,20. B. 0,36 và 0,18. C. 0,24 và 0,48. D. 0,12 và 0,24. Bài 29. Cho 4 mol axit axetic tác dụng với hỗn hợp chứa 0,5 mol glixerol và 1 mol etylen glicol (xúc tác H2SO4). Tính khối lượng sản phẩm thu được ngoài nước biết rằng có 50% axit và 80% mỗi ancol phản ứng. A. 170,4 g B. 176,5 g C. 156,7 g D. 312 g Bài 30. Thực hiện phản ứng este hoá giữa etilen glicol với một axit cacboxylic X thu được este có công thức phân tử là C8H10O4 . Nếu cho 0,05 mol axit X phản ứng với 250 ml dung dịch KOH 0,16M. Cô cạn dung dịch sau phản ứng thu được chất rắn có giá trị m gam, m nhận giá trị nào sau đây: A. 3,76 gam. B. 3,80 gam. C. 4,40 gam. D. 5,12 gam.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

ÁN

Câu 1: Đáp án B

TO

Ta có nHCOOH = nCH3COOH =

5,3 = 0, 05(mol ) 46 + 60

Ỡ N

G

Và nC2 H5OH = 0,125(mol )

BỒ

ID Ư

Do hiệu suất của mỗi phản ứng este hóa đều bằng 80% nên ta có: 80 mHCOOC2 H5 + mCH3COOC2 H5 = (74 + 88) .0,05 = 6, 48( g ) 100 Câu 2: Đáp án A Gọi 2 axit có công thức chung là RCOOH. Khi tham gia phản ứng với Na → nancol + naxit = 2nH2 = 0,6 mol Vì các chất trong hỗn hợp phản ứng este hóa vừa đủ với nhau → naxit = nancol = 0,3 mol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ nRCOOCH3 = naxit = 0,3 mol → (R + 44 + 15). 0,3 = 25 →15 (CH3) < R = 24,333 < 29 (C2H5)

N

H Ơ

N

Vậy axit kế tiếp nhau là CH3COOH. Đáp án A. Câu 3: Đáp án A 3,9 M ROH = = 39 ⇒ R = 39 − 17 = 22 0, 05.2 nCH3COOH = 0, 5 ⇒ mCH3COOR = mROH = 0,1

TP .Q

U

Y

⇒ meste = 0,1.(15 + 44 + 22).0,8 = 6, 48( g )

Đ G H

Ư N

0,16 = 80% 0, 2

TR ẦN

www.daykemquynhon.ucoz.com

neste = 0,16 ⇒ H =

ẠO

Chọn A Câu 4: Đáp án A 46nancol + 60naxit = 25,8 nancol = 0,3 ⇒  3nancol + 2naxit = 1,3 naxit = 0, 2

00

B

0,3.46  = 53,5% %mancol = 25,8 ⇒ %m = 46,5% axit 

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

Câu 5: Đáp án A 46 + 60 = 53 ⇒ R1 + 45 = 53 ⇒ R1 = 8 MX = 2 32.3 + 46.2 = 37, 6 ⇒ R2 + 17 = 37, 6 ⇒ R2 = 20, 6 MY = 3+ 2 11,13 nX = = 0, 21 53 7, 52 = 0, 2 nY = 37, 6 meste = 0, 2.( R1 + 44 + R2 ).0, 75 = 0, 2.72, 6.0, 75 = 10,89 g Câu 6: Đáp án A 46 + 60 hh X có khối lượng mol trung bình là: = 53 2 32.2 + 46.3 hh Y có khối lượng mol trung bình là: = 40, 4 5 16,96 nX = 53 8, 08 nY = = 0, 2 40, 4 ⇒ meste = 0, 2.(53 + 40, 4 − 18).0,8 = 12, 064

Câu 7: Đáp án A n X = 2nCO2 = 0,1mol 7,8g Y thì => nY=2nH2=0,2 mol => 3,9g Y thì nY=0,1 mol =>khi thực hiện phản ứng este hóa thì nX=nY

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

⇒ meste = mX + mY − mH 2O = a + 3,9 − 0,1.18 = a + 2,1

H Ơ

16,8 − 8, 4 = 0, 2 (59 + 14n + 1) − (14n + 18)

N

Tăng giảm khối lượng: nCH3COOH =

N

nếu tính theo hiệu suất h% thì meste= (a+2,1)h% Câu 8: Đáp án B CH 3COOH + Cn H 2 n +1OH → CH 3COOCn H 2 n +1 + H 2O

U

Y

Sản phẩm của phản ứng xà phòng hóa là CH3COONa

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

=>m = 0,2.82 = 16,4 Câu 9: Đáp án A

10

00

B

Câu 10: Đáp án C Như vậy Y1 và Y2 có thể là este 2 chức hoặc là tạp chức của etse và axit. * Nếu Y1 là este 2 chức thì có CT là: CH 3OOC − (CH 2 ) 4 − COOCH 3 ⇒ ancol là CH 3OH * Nếu Y1 là tạp chức của este và axit thì có CT là: HOOC − (CH 2 ) 4 − COOC2 H 5 ⇒ ancol là C2 H 5OH

n

2+ ẤP

=

0,1 ⇒ M ancol = 46n ⇒ n = 1 ⇒ C2 H 5OH n

C

2 nH 2

Ó

A

⇒ nancol =

3

Câu 11: Đáp án C Giả sử ancol có n chức

m

0,15 ⇒ M ancol = 60m ⇒ m = 1 ⇒ CH 3COOH m

-L

=

TO

6, 6 0, 075 = 0, 075 ⇒ H = = 75% 88 0,1

G

neste =

2 nH 2

ÁN

⇒ naxit =

Í-

H

Giả sử axit có m chức

ID Ư

Ỡ N

Câu 12: Đáp án D Phần 1: nancol = nH 2O − nCO2 = 0, 05

BỒ

Phần 2:

Ta thấy, lượng H2O loại đi chính là số mol este tạo thành ⇒ neste = 0, 25 − 0, 22 = 0, 03 ⇒H =

0,3 = 60% 0, 5

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13: Đáp án C Este thu được sẽ là este no, đơn chức mạch hở

H Ơ

N

Khi đốt este này thì thu được nH 2O = nCO2

ẠO

TP .Q

U

Câu 14: Đáp án A Coi hỗn hợp X gồm HCOOH, CH3COOH và C2H5COOH (tỉ lệ 5:1:1)thành RCOOH với MRCOOH = 46.5 + 60.1 + 74.1 5, 2 =52 → MR = 7. nX = = 0,1 mol. 7 52

Y

N

Do số C không đổi trong cả 2 phần nên nH 2O = 0,3 ⇒ mH 2O = 5, 4

Đ

PTPU RCOOH + C2H5OH ↔ RCOOC2H5 + H2O.

Ư N

G

Do nX = 0,1 mol < nC2H5OH = 0,125 mol.

H

→ neste = 0,1× 0,8 = 0,08 (mol)

TR ẦN B 10

Như vậy, số C trung bình của 2 ancol là 4,5-2=2,5.

00

www.daykemquynhon.ucoz.com

→ meste = 0,08 × ( 7 + 44 + 29)= 6,4 gam. Câu 15: Đáp án C nCO2 Số C trung bình trong este: = 4,5 neste

2+

3

Tóm lại, 2 ancol là C2H5OH và C3H7OH

H

Ó

A

C

ẤP

Câu 16: Đáp án A y y C x H y O2 + ( x + − 1)O2 → xCO2 + H 2O 4 2 x = 3 y ⇒ x + − 1 = 3, 5 ⇒ 4 x + y = 18 ⇒  ⇒ C2 H 5COOH 4 y = 6

-L

Í-

n X = 0,1

Ỡ N

G

TO

ÁN

Giả sử ancol a (a <3) chức. 0,1 ⇒ neste = ⇒ M este = 87 a ⇒ a = 2 ⇒ M este = 174 ⇒ C2 H 5COO − CH 2 − CH 2 − OOCC2 H 5 a Câu 17: Đáp án D Phần 2:

ID Ư

neste =

10, 2 − 12nCO2 − 2nH 2O = 0,1 ⇒ M este = 102 ⇒ C5 H10O2 32

BỒ

Gọi số C trong axit là a, trong ancol là b

Do số mol của axit nhỏ hơn ancol nên ⇒ nancol − naxit = 0,1

nancol = 0, 2 Mặt khác, nancol + naxit = 0,3 ⇒  naxit = 0,1

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Như vậy, sau phản ứng ancol dư 0,1 Số CO2 chênh lệch giữa 2 phần chính là CO2 do ancol dư tạo ra

H Ơ N

0,9 − 0, 2.4 = 1 ⇒ HCOOH 0,1

ẠO

6n − 4n =2 n

Số H của ancol:

7 n − 3n − 2n =6 n

H

Ư N

G

Đ

Số C của ancol:

TR ẦN

www.daykemquynhon.ucoz.com

Câu 18: Đáp án B Dễ thấy, do este Z thuần chức nên số O trong este bằng số O trong axit, như vậy n=m

TP .Q

U

Như vậy, số C trong axit:

N

0, 4 = 4 ⇒ C4 H 9OH 0,1

Y

Số C trong ancol:

Do ancol đơn chức nên ancol là C2H5OH

10

00

B

Câu 19: Đáp án A Gọi công thức là: C2 n H 3n O2 n

C

8.2 + 2 − 12 = 3 < 4 ⇒ loai 2

H Í-

-L

Câu 20: Đáp án B nNaOH = 2nX = 0, 2

Ó

A

Chất này là este 4 chức: π + v =

ẤP

n = 4 ⇒ C8 H12O8

2+

n = 2 ⇒ C4 H 6O4 ⇒ CH 3OOC − COOCH 3

3

Dễ thấy, n phải là số chẵn (n lẻ thì số H sẽ lẻ)

ÁN

Bảo toàn khối lượng: mX = 21, 2 − mNaOH = 13, 2 ⇒ M X =

13, 2 = 132 ⇒ C5 H 8O4 0,1

TO

Các este thỏa mãn là:

Ỡ N

G

CH 2 (OOCH ) − CH (OOCH ) − CH 3

BỒ

ID Ư

CH 2 (OOCH ) − CH 2 − CH 2 (OOCH ) Câu 21: Đáp án B Gọi số mol của C2H5OH và CH3COOH lần lượt là x, y

 x + y = 0, 275.2  x = 0,3 → Ta có hệ  46 x + 60 y = 28,8  y = 0, 25 CH3COOH + C2H5OH ⇌ CH3COOC2H5 + H2O

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vì nCH3COOH < nC2H5OH nên hiệu suất được tính theo axit Có neste = 0,2 mol → H =

H Ơ

N

0, 3.46 ×100% = 47,92%, %mCH3COOH = 52,08%. 28,8

N

%mC2H5OH =

0, 2 ×100% = 80% 0, 25

TP .Q

U

Y

Câu 22: Đáp án B trước hết phải tìm nhanh ra CTPT của E. Ta có: mE = 1,18.13,8 = 16,284 gam,

ẠO

Có hiệu suất nên số mol glixerol phản ứng là:

G

Đ

13,8 x 0,7335 : 92 = 0,110025  ME = 16,284 : Ans = 148

Ư N

( số mol E luôn bằng số mol glixerol phản ứng ).

H TR ẦN

www.daykemquynhon.ucoz.com

Vậy CTPT của E là: C5 H 8O5

Bài này phải cẩn thận, không thì thiếu TH. ( hay + khó chỗ này ).

00

B

► TH1: E là este 2 lần axit HCOOH của glixerol ( còn 1 nhóm -OH ancol).

10

gọi gốc HCOO- là 1; HO- là 0 và C3H5- là gốc R thì ta có 2 CTCT thỏa mãn là: R-101 và R-110.

2+

3

► TH2: E là este 1 lần axit C3 H 6O2 và còn 2 nhóm HO-

ẤP

tương tự, gọi gốc axit là 1, HO- là 0 và C3H5 là R ta có các CTCT là: R-100 và R-010.

Ó

A

C

Như vậy, tổng tất cả có 4 CTCT thỏa mãn phù hợp với E. Chọn B.♦♦♦ Câu 23: Đáp án D X gồm 5 chất: H 2O, (CH 3COO )(OH )C2 H 4 ( E1 ), (CH 3COO ) 2 C2 H 4 ( E2 ), CH 3COOHdu , C2 H 4 (OH ) 2 du

Í-

H

coi hỗn hợp ban đầu có => nCH 3COOH = nC2 H 4 (OH ) 2 = 1mol ⇒ số mol axit phản ứng là 0,7mol và số mol

ÁN

-L

acol phản ứng là 0,5mol gọi nE1 = a, nE2 = b

G

TO

a + 2b = 0, 7 a = 0,3 => ta có Hệ PT:  ⇒ a + b = 0,5 b = 0, 2 mX = maxit + mancol = 60 + 62 = 122 g

Ỡ N

0,3.104 = 25,574 122 Câu 24: Đáp án D XnH 2 = 0, 2

BỒ

ID Ư

=>% E1 =

Vì 2 chất phản ứng vừa đủ tạo este nên naxit = nancol = neste = 0, 2 16, 2 → M RCOOC2 H 5 = = 81 → R = 8 0, 2 → HCOOH , CH 3COOH

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 25: Đáp án D nCH3COOH = 3a mol; nC2H5OH = 3b mol. 3, 36 = 0,15 mol. 22, 4 nCH3COOH + nC2H5OH = a + b = 0,15 × 2 = 0,3 mol.

H Ơ

N

- Phần 1: nH2 =

1,12 = 0,05 mol. 2, 24 nCH3COOH = a = 0,05 × 2 = 0,1 mol. =>b = 0,2 mol.

TP .Q

U

Y

N

- Phần 2: nCO2 =

Đ G Ư N H TR ẦN

www.daykemquynhon.ucoz.com

Câu 26: Đáp án C 0, 28.6 nancol = = 0, 05 22, 4 .(273 + 136,5) 273 45 nCH 3COOH = = 0, 75 75

ẠO

- Phần 3: CH3COOH + C2H5OH ⇔ CH3COOC2H5 + H2O. 60 mCH3COOC2H5 = 0,1 × 88 × = 5,28 gam. 100

ẤP

2+

3

10

00

B

Vậy, hiệu suất tính theo ancol. Số mol ancol và axit phản ứng là 0,05.0,01H, nên số mol H2O tạo thành cũng là 0,05.0,01H mol H Khối lượng este thu được là meste = m.0, 01H + 0, 05.0, 01.H .60 − 0, 01.0, 05H .18 = (m + 2,1). 100 Câu 27: Đáp án B ► Cách 1: gọi phân tử khối của X là M thì của Y là M + 14 (M ≥ 46). ta có hệ phương trình:

Ó

A

C

 x + y = 0, 08  x + y = 0,08 ⇔ . 0,5 x( M + 14) + 0, 4 y ( M + 28) = 2,888 (5 x + 4 y ) M + 70 x + 112 y = 28,88

Í-

H

Chặn khoảng giá trị của M: 4(x + y)M + 112(x + y) < 28,88 (do Mx ≥ 46x)→ M < 62,25

-L

5(x + y)M + 66(x + y) > 28,88 (do - My < - 46y) → M > 59.

ÁN

Như vậy, chỉ duy nhất M = 60 ứng với axit axetic CH3COOH thỏa mãn → còn lại là C2H5COOH.

TO

Do đó đáp án đúng cần chọn là B. ♦

Ỡ N

G

► Cách 2: Cách nhanh nhất và không phải nghĩ nhiều nhất là thay 4 đáp án và thử.

BỒ

ID Ư

gọi số mol X là x mol và Y là y mol. lập hệ số mol và khối lượng este ta có:

 x + y = 0, 08 . 0, 5 x ( M X − 1 + 15) + 0, 4 y ( M Y − 1 + 15) = 2,888

Thay 4 đáp án + bấm máy thấy chỉ TH đáp án B cho nghiệm dương tròn đẹp, x = y = 0,04 mol. Câu 28: Đáp án B nancol phản ứng = 0,72

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

 HOOCC2 H 4COOCH 3 : a + CH 3OH X : C2 H 4 (COOH )2  → C2 H 4 (COOCH 3 )2 : b → a + 2b = 0, 72 132a = 1,81 146b → a = 0,36, b = 0,18

H Ơ

N

+TH 1:

146b = 1,81 132a → a = 0,1685, b = 0, 2757 →B

TP .Q

U

Y

N

+TH 2 :

Đ

ẠO

Câu 29: Đáp án A Ta có cho axit axetic tác dụng với glixerol và etilenglicol tạo sản phẩm.

Ư N

G

2CH3COOH + HO-CH2-CH2-OH → CH3COOCH2CH2OOCCH3 + 2H2O

00

Nhận thấy nH2O = nCH3COOH phản ứng = 0,5. 4= 2 mol

B

CH3COOH + C3H5(OH)3 → C3H5(OH)2(OOCCH3) + H2O

TR ẦN

www.daykemquynhon.ucoz.com

2CH3COOH + HO-CH2-CH2-OH → C3H5(OH)(OOCCH3)2+ 2H2O

H

3CH3COOH + HO-CH2-CH2-OH → HO-CH2CH2OOCCH3 + H2O → C3H5(OOCCH3)3 + 3H2O

ẤP

2+

3

10

Bảo toàn khối lượng → msản phẩm = 2. 60 + 0,5. 0,8. 92 + 0,8.1. 62 - 2. 18 = 170,4 gam Câu 30: Đáp án C 8.2 + 2 − 10 Xét este: π + v = =4 2

Í-

H

Ó

Công thức X là: C2 H 3COOH

A

C

Như vậy, axit là đơn chức và có 1 liên kết trong mạch C.

-L

nKOH = 0, 04

TO

ÁN

Như vậy, dung dịch sau phản ứng với KOH chứa 0,04 mol muối và 0,01 mol axit dư.

BỒ

ID Ư

Ỡ N

G

Khi cô cạn: m = 0,04.110 = 4,4

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Cách nào sau đây dùng để điều chế etyl axetat ? A. Đun hồi lưu hỗn hợp etanol, giấm và axit sunfuric đặc. B. Đun hồi lưu hỗn hợp axit axetic, rượu trắng và axit sunfuric. C. Đun hỗn hợp etanol, axit axetic và axit sunfuric đặc trong cốc thuỷ tinh chịu nhiệt. D. Đun hồi lưu hỗn hợp etanol, axit axetic và axit sunfuric đặc. Câu 2: Khi cho axit axetic phản ứng với axetilen ở điều kiện thích hợp ta thu được este có công thức là A. CH2=CH-COOCH3. B. CH3COOCH=CH2. C. CH3COOCH2CH3. D. HCOOCH2CH3. Câu 3: Este phenyl axetat CH3COOC6H5 được điều chế bằng phản ứng nào ? A. CH3COOH + C6H5OH (xt, to). B. CH3OH + C6H5COOH (xt, to). C. (CH3CO)2O + C6H5OH (xt, to). D. CH3OH + (C6H5CO)2O (xt, to). Câu 4: Cho phản ứng este hóa : RCOOH + R’OH ↔ R-COO-R’ + H2O Để phản ứng chuyển dịch ưu tiên theo chiều thuận người ta thường : A. Dùng H2SO4 đặc để hút nước và làm xúc tác. B. Chưng cất để tách este ra khỏi hỗn hợp phản ứng. C. Tăng nồng độ của axit hoặc ancol. D. Tất cả đều đúng. Câu 5: Phát biểu nào sau đây không đúng ? A. Sản phẩm của phản ứng giữa axit và ancol luôn là este B. Vinyl axetat không phải là sản phẩm của phản ứng este hóa C. Phản ứng cộng axit axetic với axetilen thu được este D. Phản ứng este hóa là phản ứng thuận nghịch Câu 6: Đun nóng hỗn hợp gồm glixerol cùng axit axetic và axit propionic, (xúc tác H2SO4 đặc) thì sốTrieste tối đa thu được là: A. 5 B. 4 C. 6 D. 7 Câu 7: Dầu chuối là este có tên isoamyl axetat, được điều chế từ A. CH3OH, CH3COOH. B. (CH3)2CH-CH2OH, CH3COOH. C. C2H5COOH, C2H5OH. D. CH3COOH, (CH3)2CH-CH2-CH2OH. Câu 8: Một số este được dùng trong hương liệu, mĩ phẩm, bột giặt là nhờ các este A. là chất lỏng dễ bay hơi. B. có mùi thơm, an toàn với người. C. có thể bay hơi nhanh sau khi sử dụng. D. đều có nguồn gốc từ thiên nhiên. Câu 9: Cho các este: vinyl axetat, vinyl benzoat, etyl axetat, isoamyl axetat, phenyl axetat, anlyl axetat . Số este có thể điều chế trực tiếp bằng phản ứng của axit và ancol tương ứng (có H2SO4 đặc làm xúc tác) là: A. 5 B. 3 C. 2

N

Phản ứng este hóa và điều chế este

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 4 Câu 10: Hỗn hợp X gồm 1 ancol no, đơn chức và 1 axit no, đơn chức mạch hở.Chia X thành 2 phần bằng nhau. - Đốt cháy hoàn toàn phần 1 sản phẩm thu được cho qua bình nước vôi trong dư thấy có 30g kết tủa. - Phần 2 được este hoá hoàn toàn vừa đủ thu được 1 este, đốt cháy este này thu được khối lượng H2O là: A. 1,8g B. 3,6g C. 5,4g D. 7,2g Câu 11: Cho 30 gam axit axetic tác dụng với 92 gam ancol etylic có mặt H2SO4 đặc. Khối lượng este thu được khi hiệu suất phản ứng 60% là A. 26,4 gam. B. 27,4 gam. C. 28,4 gam. D. 30,4 gam. Câu 12: X là hỗn hợp gồm HCOOH và CH3COOH (tỉ lệ mol 1:1). Lấy 21,2 gam X tác dụng với 23 gam C2H5OH (xúc tác H2SO4 đặc, đun nóng) thu được m gam hỗn hợp este (hiệu suất este hóa đều đạt 80%). Giá trị m là A. 40,48 gam. B. 23,4 gam. C. 48,8 gam D. 25,92 gam. Câu 13: Đun nóng 6 gam CH3COOH với 9,2 gam C2H5OH (có H2SO4 đặc làm xúc tác) đến khi phản ứng đạt tới trạng thái cân cân bằng thì được 5,5 gam este. Hiệu suất phản ứng este hóa là A. 55%. B. 62,5%. C. 75%. D. 80%. Câu 14: Hỗn hợp X gồm HCOOH và CH3COOH (tỉ lệ mol 1:1). Lấy 5,3 gam X tác dụng với 5,75 gam C2H5OH (xúc tác H2SO4 đặc) thu được m gam hỗn hợp este (hiệu suất các phản ứng este hóa đều bằng 80%). Giá trị của m là A. 10,12 gam. B. 6,48 gam. C. 8,1 gam. D. 16,2 gam. Câu 15: Khi thực hiện phản ứng este hoá 1 mol CH3COOH và 1 mol C2H5OH, lượng este lớn nhất thu được là 2/3 mol. Để đạt hiệu suất cực đại là 90% (tính theo axit) khi tiến hành este hoá 1 mol CH3COOH cần số mol C2H5OH là (biết các phản ứng este hoá thực hiện ở cùng nhiệt độ) A. 0,342. B. 2,925 C. 2,412. D. 0,456. Câu 16: Cho 0,3 mol axit X đơn chức trộn với 0,25 mol ancol etylic đem thực hiện phản ứng este hóa thu được thu được 18 gam este. Tách lấy lượng ancol và axit dư cho tác dụng với Na thấy thoát ra 2,128 lít H2. Vậy công thức của axit và hiệu suất phản ứng este hóa là A. CH3COOH, H% = 68%. B. CH2=CH-COOH, H%= 78% C. CH2=CH-COOH, H% = 72%.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. CH3COOH, H% = 72%. Câu 17: Oxi hoá anđehit OHCCH2CH2CHO trong điều kiện thích hợp thu được hợp chất hữu cơ X. Đun nóng hỗn hợp gồm 1 mol X và 1 mol ancol metylic với xúc tác H2SO4 đặc thu được 2 este Z và Q (MZ < MQ) với tỷ lệ khối lượng mZ : mQ = 1,808. Biết chỉ có 72% ancol chuyển thành este. Số mol Z và Q lần lượt là A. 0,36 và 0,18. B. 0,48 và 0,12. C. 0,24 và 0,24. D. 0,12 và 0,24. Câu 18: Khối lượng axit metacrylic và ancol metylic lần lượt cần lấy để điều chế được 100 kg poli(metylmetacrylat) là bao nhiêu ? (Cho biết hiệu suất toàn bộ quá trình điều chế đạt 80%) A. 86 kg và 32 kg. B. 107,5 kg và 40 kg. C. 68,8 kg và 25,6 kg. D. 75 kg và 30 kg Câu 19: Hỗn hợp A gồm axit axetic và etanol. Chia A thành ba phần bằng nhau. + Phần 1 tác dụng với Kali dư thấy có 3,36 lít khí thoát ra. + Phần 2 tác dụng với Na2CO3 dư thấy có 1,12 lít khí CO2 thoát ra. Các thể tích khí đo ở đktc. + Phần 3 được thêm vào vài giọt dung dịch H2SO4, sau đó đun sôi hỗn hợp một thời gian. Biết hiệu suất của phản ứng este hoá bằng 60%. Khối lượng este tạo thành là bao nhiêu? A. 8,80 gam B. 5,20 gam C. 10,56 gam D. 5,28 gam Câu 20: Để đốt cháy hoàn toàn 1 mol axit cacboxylic đơn chức X cần đủ 3,5 mol O2. Trộn 7,4 gam X với lượng đủ ancol no Y (biết tỉ khối hơi của Y so với O2 nhỏ hơn 2). Đun nóng hỗn hợp với H2SO4 làm xúc tác. Sau khi phản ứng hoàn toàn thu được 8,7 gam este Z (trong Z không còn nhóm chức nào khác). Công thức cấu tạo của Z là: A. C2H5COOCH2CH2OCOC2H5 B. C2H3COOCH2CH2OCOC2H3 C. CH3COOCH2CH2OCOCH3 D. HCOOCH2CH2OCOH Câu 21: Giả sử trong điều kiện thích hợp, người ta thực hiện được phản ứng este hóa vừa đủ giữa 12,4 gam etylenglicol với m gam hỗn hợp hai axit hữu cơ đơn chức no mạch hở đồng đẳng kế tiếp, thu được 32 gam hỗn hợp ba este đa chức. Công thức hai axit hữu cơ đem dùng là: A. HCOOH, CH3COOH B. CH3COOH, CH3CH2COOH C. CH3CH2COOH, CH3CH2CH2COOH D. C3H7COOH, C4H9COOH Câu 22: Hỗn hợp E gồm 3 este có số mol bằng nhau, đa chức của axit oxalic và hai rượu đơn chức, no, mạch hở, đồng đẳng kế tiếp. Thực hiện phản ứng xà phòng hóa hoàn toàn 4,8 gam hỗn hợp E bằng dung dịch xút vừa đủ thì thấy đã dùng hết 19,48 ml dung dịch NaOH 11% (có khối lượng riêng 1,12 g/ml). Công thức của hai rượu tạo nên hỗn hợp E là: A. CH3OH, C2H5OH B. C4H9OH, C5H11OH C. C2H5OH, C3H7OH D. C5H11OH, C6H13OH

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 23: Hỗn hợp M gồm ancol no, đơn chức X và axit cacboxylic đơn chức Y, đều mạch hở và có cùng số nguyên tử C, tổng số mol của hai chất là 0,5 mol (số mol của Y lớn hơn số mol của X). Nếu đốt cháy hoàn toàn M thì thu được 33,6 lít khí CO2 (đktc) và 25,2 gam H2O. Mặt khác, nếu đun nóng M với H2SO4 đặc để thực hiện phản ứng este hoá (hiệu suất là 80%) thì số gam este thu được là A. 22,80 B. 34,20 C. 27,36 D. 18,24 Câu 24: Đốt cháy hoàn toàn 7,6 gam hỗn hợp gồm một axit cacboxylic no, đơn chức, mạch hở và một ancol đơn chức (có số nguyên tử cacbon trong phân tử khác nhau) thu được 0,3 mol CO2 và 0,4 mol H2O. Thực hiện phản ứng este hóa 7,6 gam hỗn hợp trên với hiệu suất 80% thu được m gam este. Giá trị của m là A. 4,08. B. 6,12. C. 8,16. D. 2,04. Câu 25: Hỗn hợp A gồm 1 axit no đơn chức và một axit không no đơn chức có một liên kết đôi ở gốc hiđrocacbon. Khi cho a gam A tác dụng hết với CaCO3 thoát ra 1,12 lít CO2 (đktc). Hỗn hợp B gồm CH3OH và C2H5OH khi cho 7,8 gam B tác dụng hết Na thoát ra 2,24 lít H2 (đktc). Nếu trộn a gam A với 3,9 gam B rồi đun nóng có H2SO4 đặc xúc tác thì thu được m gam este (hiệu suất h%). Giá trị m theo a, h là A. (a +2,1)h%. B. (a + 7,8) h%. C. (a + 3,9) h%. D. (a + 6)h%. Câu 26: Cho 4 mol axit axetic tác dụng với hỗn hợp chứa 0,5 mol glixerol và 1 mol etilenglicol (xúc tác H2SO4). Tính khối lượng sản phẩm thu được ngoài nước biết rằng có 50% axit và 80% mỗi ancol phản ứng. A. 312 g B. 156,7 g C. 170,4 g D. 176,5 g Câu 27: Cho biết hằng số cân bằng của phản ứng este hoá: CH3COOH + C2H5OH CH3COOC2H5 + H2O có K = 4 Nếu cho hỗn hợp cùng số mol axit và ancol tác dụng với nhau thì khi phản ứng đạt đến trạng thái cân bằng thì % ancol và axit đã bị este hoá là A. 50%. B. 66,7%. C. 33,3%. D. 65%. Câu 28: Biết rằng phản ứng este hoá CH3COOH + C2H5OH ---> CH3COOC2-H5 + H2O có hằng số cân bằng K = 4, Tính % ancol etylic bị este hoá nếu bắt đầu với CC2H5OH = 1 M, CCH3COOH = 2 M. A. 80% B. 68% C. 75% D. 84,5% Câu 29: Khi đun nóng 25,8 gam hỗn hợp ancol etylic và axit axetic có H2SO4 đặc làm xúc tác thu được 14,08 gam este. Nếu đốt cháy hoàn toàn lượng hỗn hợp đó thu được 23,4 ml H2O (lỏng). Tìm thành phần trăm khối lượng mỗi chất trong hỗn hợp đầu và hiệu suất của phản ứng este hoá. A. 55,3% C2H5OH; 44,7% CH3COOH và hiệu suất 80

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 60,0% C2H5OH; 40,0% CH3COOH và hiệu suất 75% C. 45,0% C2H5OH; 55,0% CH3COOH và hiệu suất 60% D. 53,5% C2H5OH; 46,5% CH3COOH và hiệu suất 80%

BỒ

H Ơ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

Câu 1: Đáp án: D Cách tốt nhất để điều chế etylaxetat là đun hồi lưu hỗn hợp gồm cồn tuyệt đối, axit axetic "băng" và H2SO4 đặc → CH3COOC2H5 + H2O (xúc tác: H2SO4 đặc) C2H5OH + CH3COOH  Câu 2: Đáp án: B Phản ứng xảy ra như sau: → H3COOCH=CH2 CH3COOH + CH≡CH  Câu 3: Đáp án: C Phenyl axetat được điều chế từ phenol và anhidrit axetic: C6H5OH + (CH3CO)2O  → C6H5OOCCH3 + CH3COOH Câu 4: Đáp án: D Theo nguyên lí chuyển dịch cân bằng, để phản ứng chuyển dịch theo chiều thuận: + Tăng cường các chất tham gia + Liên tục lấy đi sản phẩm tạo thành Câu 5: Đáp án: A Este là sản phẩm của phản ứng giữa axit hữu cơ và ancol. Nếu cho axit vô cơ tác dụng với ancol sẽ không tạo este. → C2H5Cl + H2O VD: C2H5OH + HCl  Câu 6: Đáp án: C Có 4 trường hợp: + Trieste chỉ tạo bởi 3 gốc axit axetic => Có 1 đồng phân + Trieste chỉ tạo bởi 2 gốc axit axetic + 1 gốc axit propionic => Có 2 đồng phân + Trieste chỉ tạo bởi 1 gốc axit axetic + 2 gốc axit propionic => có 2 đồng phân + Trieste chỉ tạo bởi 3 gốc axit propionic => có 1 đồng phân. => Vậy có tất cả 6 đồng phân Câu 7: Đáp án: D Este isoamylaxetat tạo bởi ancol isoamylic (CH3)2CH-CH2-CH2-OH và axit axetic CH3COOH Câu 8: Đáp án: B Tiêu chí hàng đầu để sử dụng các chất phụ gia, các chất màu hay hương liệu là phải an toàn cho người sử dụng. Câu 9: Đáp án: B Các este thỏa mãn là: etyl axetat (C2H5OH + CH3COOH); isoamylaxetat ( (CH3)2CH-CH2-CH2-OH + CH3COOH) ; anlyl axetat (CH2=CH-CH2OH + CH3COOH) Câu 10: Đáp án: C Vì ancol và axit được este hóa vừa đủ => nancol = naxit = x mol Vì ancol no, đơn chức => khi đốt tạo ra nH2O - nCO2 = x Vì axit no đơn chức => khi đốt tạo nH2O = nCO2 => Nếu đốt trực tiếp X => nH2O = nCO2 + x = 0,3 + x mol Sau phản ứng este hóa, có x mol H2O bị loại ra từ X => Lượng nước khi đốt este là : (0,3 + x) - x = 0,3 mol => mH2O = 0,3.18 = 5,4g Câu 11: Đáp án: A nCH3COOH = 0,5 mol ; nC2H5OH = 2 mol → CH3COOC2H5 + H2O CH3COOH + C2H5OH  => Ancol dư , axit hết => neste = nCH3COOH H% = 0,5.60% = 0,3 mol => mCH3COOC2H5 = 26,4g

N

LỜI GIẢI CHI TIẾT

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 12: Đáp án: D

BỒ

H Ơ N Y U TP .Q ẠO Đ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

→ RCOOC2H5 + H2O RCOOH + C2H5OH  nRCOOC2H5 = 0,4.0,8 = 0,32 mol => m = 0,32.(8 + 44 + 29) = 25,92 g Câu 13: Đáp án: B → CH3COOC2H5 + H2O CH3COOH + C2H5OH  ban đầu: 0,1 mol 0,2 mol sau: 0,0625 mol Do axit hết ( theo lí thuyết) => H = = 62,5 % Câu 14: Đáp án: B 1 + 15 =8 Coi hỗn hợp HCOOH : CH3COOH (1: 1) là RCOOH, với R = 2 RCOOH + C2H5OH  → RCOOC2H5 + H2O 5, 3 = 0,1 mol ; nC2H5OH = 0,125 mol nRCOOH = 8 + 45 => Axit hết => nRCOOC2H5 = 0,1.0,8 = 0,08 mol => m = 0,08.(8 + 44 + 29) = 6,48g Câu 15: Đáp án: B → CH3COOC2H5 + H2O CH3COOH + C2H5OH  Ban đầu: 1 mol 1 mol 0 mol Sau: 1/3 mol 1/3 mol 2/3 mol 2/3 mol 2 2 . [CH 3COOC2 H 5 ].[ H 2O ] 3 3 => Hệ số cân bằng k = =4 = [CH 3COOH ].[C2 H 5OH ] 1 . 1 3 3 Để hiệu suất là 90%, giả sử cần x mol C2H5OH Vì nCH3COOH = 1 mol => nCH3COOC2H5 = 0,9 mol Do đó: nH2O = 0,9 mol nC2H5OH dư = x - 0,9 ; nCH3COOH dư = 1 - 0,9 = 0,1 mol 0,9.0,9 Mà k = 4 => = 4 => x = 2,925 mol 0,1.( x − 0,9) Câu 16: Đáp án: C → RCOOC2H5 + H2O Gọi X là RCOOH => RCOOH + C2H5OH  Gọi số mol este là x => naxit dư = 0,3 - x mol nancol dư = 0,25 - x mol 1 Cứ 1 mol RCOOH hoặc C2H5OH đều tạo H2 khi phản ứng với Na. 2 2,128 => 0,5.(0,3 - x) + 0,5.(0,25 - x) = 22, 4 18 => x = 0,18 mol => Meste = = 100 => RCOOC2H5 = 100 0,18 => R = 27 (CH2=CH-). Axit là CH2=CH-COOH n 0,18 Hiệu suất = este = = 72% (vì ancol hết - theo lí thuyết) nancol 0, 25 Câu 17: Đáp án: A Oxi hóa OHCCH2CH2CHO tạo axit HOOC-CH2-CH2-COOH => Este Z là HOOCCH2CH2COOCH3 ; este Q là CH3OOCCH2CH2COOCH3 nancol phản ứng = 0,72 mol .

N

1 + 15 =8 2

G

Coi hỗn hợp HCOOH : CH3COOH (1:1) là RCOOH , với R =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO Đ G

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Đặt nZ = x ; nQ = y => x + 2y = nancol = 0,72 mol 132 x Mà mZ : mQ = 1,808 => = 1,808 146 y Tìm được x = 0,36 ; y = 0,18 Câu 18: Đáp án: B CH2=C(CH3)COOH + CH3OH  → CH2=C(CH3)COOCH3 + H2O Vì hiệu suất đạt 80 % 1 1 100 100 = . 86 . = 107,5 kg .Maxit. => naxit = 0,8 100 0,8 M este 1 1 100 100 nancol = .Mancol . = . 32 . = 40 kg 0,8 100 0,8 M este Câu 19: Đáp án: D Gọi số mol axit và ancol trong mỗi phần lần lượt là x và y. 1 CH3COOH + K  → H2 2 1 → H2 C2H5OH + K  2 1 1 => x+ y = 0,15 2 2 1 1 1 → CH3COONa + CO2 + H2O Na2CO3  CH3COOH + 2 2 2 1 => y = nCO2 = 0,05 2  x = 0, 2 => Khi este hóa, ancol phản ứng hết (theo lí thuyết) =>   y = 0,1 Vì hiệu suất là 60% => n este = 0,6.0,1 = 0,06 mol => meste = 0,06.88 = 5,28g Câu 20: Đáp án: A Gọi CT của axit : CxHyO2 y CxHyO2 + (x + → CO2 + H2O - 1)O2  4 y nO2 phản ứng = x + - 1 = 3,5 => 4x + y = 18 4 => x = 3, y = 6 , axit là C3H6O2 Ancol Y có dY/O2 < 2 => MY < 2.32 = 64 7, 4 nX = = 0,1 mol => nH2O (trong phản ứng este hóa) = 0,1 mol 74 Bảo toàn khối lượng : mX + mY = mZ + mH2O => mY = 8,7 + 0,1.18 - 7,4 = 3,1 3,1 Nếu Y đơn chức => nY = 0,1 => MY = = 31 => loại 0,1 3,1 Nếu Y 2 chức => nY = 0,05 => MY = = 62 (CH2OH-CH2OH) 0, 05 Nếu Y có nhiều hơn 2 chức thì MY > 64 => loại Vậy Z là CH3CH2COOCH2CH2OOCCH2CH3 Câu 21: Đáp án: B 12, 4 nancol = = 0,2 mol 62

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ư N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

→ Este + H2O Ta có: Ancol + Axit  Vì ancol 2 chức => nH2O = naxit = 2nancol = 0,4 mol Bảo toàn khối lượng: mancol + maxit = meste + mH2O => maxit = 32 + 0,4.18 - 12,4 = 26,8g 26,9 => M axit = = 67 => Axit là CH3COOH (60) và C2H5COOH (74) 0, 4 Câu 22: Đáp án: C 19, 48.1.12.0,11 nNaOH = = 0,06 mol 40 Gọi 2 rượu là R1OH và R2OH => 3 este là R1OOCOOR1 ; R2OOCCCOOR1; R2OOCCOOR2. Vì số mol este là như nhau => Gọi E là R1OOCCOOR2 R1OOCCOOR2 + 2NaOH NaOOCCOONa + R1OH + R2OH 4,8 1 => neste = nNaOH =0,03 => R1 + 44 + 44 + R2 = 2 0, 03 => R1 + R2 = 72 Mà 2 rượu kế tiếp => R2 - R1 = 14 (Giả sử R2 > R1) => R1 = 29 ; R2 = 43 (C2H5- và C3H7-) Câu 23: Đáp án: D Vì axit và ancol có cùng số nguyên tử C nCO2 1,5 = => Số nguyên tử C = =3 0,5 nM => Ancol là C3H7OH nCO2 = 1,5 mol ; nH2O = 1,4 mol => Axit cacboxylic không no. Mà có 3 nguyên tử C => Axit là C3H4O2 hoặc C3H2O2; gọi chung là C3HmO2  x + y = 0,5(1) Đặt nC3H7OH = x, nC3HmO2 = y, ta có:  8 x + my = 1, 4.2 = 2,8(2) Mà y > x => y 0,25 Nhân pt(1) với 8 rồi trừ đi cho phương trình (2) 1, 2 1, 2 < = 4,8 => (8 - m)y = 1,2 => 8 - m = y 0, 25 => m > 3,2 => m = 4. Khi đó x = 0,2; y = 0,3 C3H7OH + CH2=CH-COOH  → CH2=CH-COOC3H7 + H2O => neste = 0,2.0,8 = 0,16 mol (vì hiệu suất đạt 80%) => meste = 0,16.114 = 18,24g Câu 24: Đáp án: A Vì nH2O > nCO2 => Ancol no, đơn chức Khi đốt axit sẽ tạo nH2O = nCO2 , do đó nancol = 0,4 - 0,3 = 0,1 mol Gọi ancol là CnH2n+2O ; axit là CmH2mO2, số mol axit là x 0,1n + xm = 0,3(1) =>  (14 x + 18).0,1 + (14m + 32) x = 7, 6(2) (2) <=. 14.(0,1n + xm) = 32x = 5,8 => x = 0,05 => 0,1n + 0,05m = 0,3 <=> 2n + m = 6. Mà m ≠ n => n = 1; m = 4 => Ancol là CH3OH ; axit là C3H7COOH → C3H7COOCH3 + H2O C3H7COOH + CH3OH  Vì H = 80% => neste = 0,05.0,8 = 0,04 mol (do axit hết) => meste = 0,04.102 = 4,08 g Câu 25: Đáp án: A Gọi CT chung của A là RCOOH 2RCOOH + CaCO3  → (RCOO)2Ca + CO2 + H2O

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

=> Trong a gam A có số mol axit là 2nCO2 = 0,1 mol Trong 7,8 gam B có n ancol = 2 nH2 = 0,2 mol => Trong 3,9 gam B có n ancol = 0,1 mol Khi trộn a gam A với 3,9 gam B : Ancol + axit este + H2O Vì n ancol = n axit = 0,1 mol => nH2O = 0,1 mol => m este (lí thuyết) = a + 3,9 - 0,1.18 = a + 2,1 (g) Vì hiệu suất là h% => m este = (a + 2,1).h% Câu 26: Đáp án: C Mỗi phân tử glyxerol phản ứng tối đa với 3 phân tử axit axetic , mỗi phân tử etylen glycol phản ứng tối đa với 2 phân tử axit axetic nCH3COOH phản ứng = 0,5.4 = 2 mol nC3H5(OH)3 pứ tối đa = 0,4.3 + 0,8.2 = 2,8 mol Suy ra, CH3COOH phản ứng hết . Sản phẩm tạo thành vẫn chứa nhóm -OH ancol Cứ 1 nhóm COOH phản ứng tạo 1 H2O => nH2O = nCH3COOH = 2 mol Bảo toàn khối lượng => m sp = m axit + m ancol - mH2O = 2.60 + 0,4.92 + 0,8.62 - 2.18 = 170,4 (g) Câu 27: Đáp án: B Giả sử có 1 mol ancol , 1 mol axit , sau phản ứng tạo x mol este => n ancol dư = n axit dư = 1 - x → CH3COOC2H5 + H2O CH3COOH + C2H5OH  1-x 1-x x x [CH 3COOC2 H 5 ].[ H 2O ] x 2 => k = ) =( [CH 3COOH ].[C2 H 5OH ] 1 − x Mà k = 4 x 2 x 2 => ( = 2 (vì x < 1) => x = ) = 4 <=> 1− x 1− x 3 2 2 => Hiệu suất là 3 = = 66,67% 1 3 Câu 28: Đáp án: D Giả sử có x mol este được tạo thành => n ancol dư = 1- x ; n axit dư = 2 - x CH3COOH + C2H5OH  → CH3COOC2H5 + H2O 2-x 1-x x x => k = x2 mà k = 4 => = 4 <=> 3x2 - 12x + 8 = 0 (2 − x)(1 − x) <=> x = 3,16 (loại) hoặc x = 0,845 0,845 => Hiệu suất là = 84,5% 1 Vậy có 84,5% ancol bị este hóa Câu 29: Đáp án: D Gọi nCH3COOH = x ; nC2H5OH = y 60 x + 46 y = 25,8  x = 0, 2  =>  23, 4 ⇔   y = 0, 3 2 x + 3 y = 18 0, 2.60 => % CH3COOH = = 46,5% ; % C2H5OH = 53,5% 25,8 Gọi hiệu suất phản ứng este hóa là H. => n este = 0,2.H (vì axit hết - theo lí thuyết)

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

=> meste = 0,2H.88 = 17,6H Mà meste = 14,08 => H = 80%

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

A.

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Trong số các este mạch hở có công thức phân tử C4H6O2 thì có mấy este khi đun nóng với dung dịch AgNO3/ NH3 cho Ag kết tủa? A. 2 B. 3 C. 4 D. 5 Câu 2: Khi cho một este X thủy phân trong môi trường kiềm thu được một chất rắn Y và hơi rượu Z. Đem chất rắn Y tác dụng với dung dịch H2SO4 đun nóng thu được axit axetic. Còn đem oxi hóa rượu Z thu được anđehit T (T có khả năng tráng bạc theo tỷ lệ 1: 4). Vậy công thức cấu tạo của X là A. CH3COOC2H5 B. HCOOC3H7 C. C2H5COOCH3. D. CH3COOCH3. Câu 3: Este X không no, mạch hở, có tỉ khối hơi so với oxi bằng 3,125 và khi tham gia phản ứng xà phòng hoá tạo ra một anđehit và một muối của axit hữu cơ. Có bao nhiêu công thức cấu tạo phù hợp với X? A. 2 B. 3 C. 4 D. 5 Câu 4: Thủy phân 4,3 gam este X đơn chức mạch hở (có xúc tác axit) đến khi phản ứng hoàn toàn thu được hỗn hợp hai chất hữu cơ Y và Z. Cho Y, Z phản ứng với dung dịch dư AgNO3/NH3 thu được 21,6 gam bạc. Công thức cấu tạo của X là: A. CH3COOCH=CH2 B. HCOOCH=CH-CH3 C. HCOOCH2CH=CH2 D. HCOOC(CH3)=CH2 Câu 5: Cho 20 gam một este X (có phân tử khối là 100 đvC) tác dụng với 300 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 23,2 gam chất rắn khan. Công thức cấu tạo của X là A. CH2=CHCH2COOCH3. B. CH3COOCH=CHCH3. C. C2H5COOCH=CH2. D. CH2=CHCOOC2H5. Câu 6: Xà phòng hóa este X đơn chức no chức thu được một chất hữu cơ Y chứa Na. Cô cạn, sau đó thêm vôi tôi xút vào rồi nung ở nhiệt độ cao được một rượu C và một muối vô cơ. Đốt cháy hoàn toàn rượu này được CO2 và hơi nước theo tỉ lệ về thể tích là 2/3. Công thức cấu tạo este đó là:

N

Thủy phân este đặc biệt

B. C. CH3CH2CH2COOCH3 D. Cả A và B đều đúng Câu 7: X có công thức phân tử C3H4O2. Khi cho X phản ứng với dung dịch NaOH thu được 1 sản phẩm duy nhất. Xác định công thức cấu tạo của X ? A. CH2=CH-COOH B. HCOOCH=CH2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


Y

N

C. D. Cả A, B và C Câu 8: Đốt cháy 0,8 gam một este X đơn chức được 1,76 gam CO2 và 0,576 gam H2O. Cho 5 gam X tác dụng với lượng NaOH vừa đủ, cô cạn dung dịch sau phản ứng được 7 gam muối khan Y. Cho Y tác dụng với dung dịch axit loãng thu được Z không phân nhánh. Công thức cấu tạo của X là:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

TP .Q

U

A.

G

Đ

ẠO

B.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

C. D. CH2=CH-COOC2H5 Câu 9: Cho axit Salixylic (X) (axit o-hiđroxibenzoic) phản ứng với metanol có H2SO4 đặc xúc tác thu được metyl Salixylat (Y) dùng làm thuốc giảm đau. Cho Y phản ứng với dung dịch NaOH dư thu được hỗn hợp sản phẩm trong đó có muối Z. Công thức cấu tạo của Z là A. o – NaOC6H4COOCH3. B. o – HOC6H4COONa C. o – NaOOCC6H4COONa D. o – NaOC6H4COONa Câu 10: Hai este A, B là dẫn xuất của benzen có công thức phân tử là C9H8O2; A và B đều cộng hợp với brom theo tỉ lệ mol là 1 : 1. A tác dụng với xút cho một muối và một anđehit. B tác đụng với xút dư cho 2 muối và nước, các muối có khối lượng phân tử lớn hơn khối lượng phân tử của natri axetat. Công thức cấu tạo của A và B có thể là: A. HOOC-C6H4-CH=CH2 và CH2=CH-COOC6H5 B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH C. HCOOC6H4CH=CH2 và HCOOCH=CH-C6H5 D. C6H5COOCH=CH2 và CH2=CH-COOC6H5 Câu 11: Hóa hơi 27,2 gam một este X thu được 4,48 lít khí ( đo ở đktc). Xà phòng hóa X bằng dung dịch NaOH ( vừa đủ) thu được hỗn hợp hai muối của natri.Công thức của este X là A. CH3 –COO- C6H5. B. C6H5 – COO – CH3. C. C3H3 – COO – C4H5. D. C4H5 – COO – C3H3. Câu 12: Một hỗn hợp gồm hai este đều đơn chức, có 3 nguyên tố C, H, O. Lấy 0,25 mol hai este này phản ứng với 175ml dung dịch NaOH 2M đun nóng thì thu được một anđehit no mạch hở và 28,6 gam hai muối hữu cơ. Cho biết khối lượng muối này bằng 1,4655 lần khối lượng muối kia. Phần trăm khối lượng của oxi trong anđehit là 27,58%. Xác định công thức cấu tạo của hai este. A. CH3COOCH=CH2 và HCOOC6H5 B. HCOOCH=CH2 và CH3COOC6H5 C. HCOOCH=CH-CH3 và HCOOC6H5 D. Kết quả khác

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 13: Một este đơn chức, mạch hở có khối lượng là 12,9 gam tác dụng đủ với 150ml dung dịch KOH 1 M. Sau phản ứng thu một muối và anđehit. Công thức cấu tạo của este là: A. HCOOCH=CH-CH3 B. CH3COOCH=CH2 C. C2H5COOCH=CH2 D. HCOOCH=CH-CH3 hoặc CH3COOCH=CH2 Câu 14: Cho các chất HCOOCH3; CH3COOH; CH3COOCH=CH2; HCOONH4; CH3COOC(CH3)=CH2; CH3COOC2H5; HCOOCH2-CH=CH2. Khi cho các chất trên tác dụng với dd NaOH thu được sản phẩm có khả năng tác dụng với dd AgNO3/NH3. Số chất thoả mãn điều kiện trên là: A. 3 B. 4 C. 5 D. 6 Câu 15: Hợp chất hữu cơ X có thành phần C, H, O và chỉ chứa 1 nhóm chức trong phân tử. Đun nóng X với NaOH thì được X1 có thành phần C, H, O, Na và X2 có thành phần C, H, O. MX1 = 82%MX; X2 không tác dụng Na, không cho phản ứng tráng gương. Đốt 1 thể tích X2 thu được 3 thể tích CO2 cùng điều kiện. CTCT X là A. HCOOCH=CH-CH3 B. CH3COOCH=CH-CH3 C. C2H5COOCH=CH2 D. CH3-COO-C(CH3)=CH2 Câu 16: Xà phòng hóa một este (X) đơn chức no bằng một lượng vừa đủ dd NaOH, chỉ thu được một sản phẩm duy nhất (Y) không có sản phẩm thứ hai dù là lượng nhỏ. Cô cạn dung dịch sau phản ứng, nung chất (Y) với vôi tôi xút thu được rượu (Z) và một muối vô cơ. Đốt cháy hoàn toàn rượu (Z) thu được CO2 và hơi nước có tỉ lệ về thể tích lần lượt là 3 : 4. CTCT thu gọn của X có thể là:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

A

C

ẤP

A.

Í-

H

Ó

B.

ÁN

-L

C.

BỒ

ID Ư

Ỡ N

G

TO

D. Câu 17: Một este đơn chức X (chứa C, H, O và không có nhóm chức khác). Tỉ khối hơi của X đối với oxi bằng 3,125. Cho 20 gam X tác dụng với 300ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được 23,2 gam bã rắn. CTCT thu gọn của X có thể là A. CH3COOCH3 B. CH3COOCH=CH2 C. C2H5COOCH=CH2 D. HCOOCH=CH2 Câu 18: Cho 4,48 gam hổn hợp gồm CH3COOC2H5 và CH3COOC6H5 (có tỷ lệ mol là 1:1) tác dụng với 800 ml dung dịch NaOH 0,1 M thu được dung dịch X. Cô cạn dung dịch X thì khối lượng chất rắn thu được là A. 5,6 gam B. 3,28 gam

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. 6,4 gam D. 4,88 gam Câu 19: Cho este X (C8H8O2) tác dụng với dung dịch NaOH thu được hỗn hợp muối đều có khối lượng phân tử lớn hơn 70 đvc. Công thức cấu tạo của X là A. HCOO – C6H4 – CH3. B. CH3COOC6H5. C. C6H5COOCH3. D. HCOOCH2C6H5. Câu 20: Hợp chất thơm X thuộc loại este có công thức phân tử C8H8O2. X không thể điều chế từ phản ứng của axit và ancol tương ứng và không tham gia phản ứng tráng gương. Công thức cấu tạo của X là A. C6H5COOCH3. B. CH3COOC6H5 C. HCOOCH2C6H5. D. HCOOC6H4CH3. Câu 21: Hai este A, B là dẫn xuất của benzen có CTPT là C9H8O2. A và B đều cộng hợp Br2 theo tỉ lệ 1:1. A tác dụng với NaOH tạo 1 muối và 1 anđehit. B tác dụng với NaOH cho 2 muối và H2O. A, B có CTCT lần lượt là: A. C6H5COOCH=CH2, CH2=CH-COOC6H5 B. CH2=CH-COOC6H5, C6H5COOCH=CH2 C. HCOOCH=CH-C6H5, C6H5COOCH=CH2 D. C6H5COOCH=CH2, HCOOCH=CH-C6H5 Câu 22: Este X là dẫn xuất của benzen có công thức C9H8O2. X tác dụng được với dung dịch Br2 theo tỉ lệ 1:1. Khi cho X tác dụng với dung dịch NaOH đun nóng thu được 1 muối và một anđehit. Muối thu được có khối lượng phân tử lớn hơn 82. Công thức cấu tạo thu gọn của X là A. C6H5COOCH=CH2. B. HCOOC6H4CH=CH2. C. HCOOCH=CH-C6H5. D. HCOOC(C6H5)=CH2. Câu 23: Este X là hợp chất thơm có công thức phân tử là C9H10O2. Cho X tác dụng với dung dịch NaOH, tạo ra hai muối đều có phân tử khối lớn hơn 80. Công thức cấu tạo thu gọn của X là A. CH3COOCH2C6H5 B. HCOOC6H4C2H5 C. C6H5COOC2H5 D. C2H5COOC6H5 Câu 24: Este X là dẫn xuất của benzen có công thức C9H8O2. X tác dụng được với dung dịch Br2 theo tỉ lệ 1:1. Khi cho X tác dụng với dung dịch NaOH đun nóng thu được 1 muối và 1 xeton. Công thức cấu tạo thu gọn của X là A. C6H5COOCH=CH2. B. HCOOC6H4CH=CH2. C. C6H5COOCH=CHCH3. D. HCOOC(C6H5)=CH2. Câu 25: Este X là dẫn xuất của benzen có công thức C9H8O2. X tác dụng được với dung dịch Br2 theo tỉ lệ 1:1. Khi cho X tác dụng với dung dịch NaOH đun nóng, dư thu được 2 muối và nước . Các muối đều có khối lượng phân tử lớn hơn 82. Công thức cấu tạo thu gọn của X là A. HCOOC6H4CH=CH2. B. CH2=CHCOOC6H5. C. CH2=CHCOOC6H4CH3. D. C2H5COOC6H5.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 26: Este X có công thức C9H8O2 tác dụng với dung dịch NaOH tạo thành 2 muối và nước . Nung nóng 1 trong 2 muối với vôi tôi xút thu được etilen. X là A. phenyl axetat B. phenyl propionat. C. phenyl acrylat. D. benzyl axetat. Câu 27: Một hỗn hợp A gồm 2 este X, Y có cùng công thức phân tử C8H8O2 và đều chứa vòng benzen. Xà phòng hoá hết 0,2 mol X, ta cần 0,3 lít dung dịch NaOH 1M thu được 3 muối (Có Mmuối >70).Tính khối lượng mỗi muối. A. 8,2 gam CH3COONa; 14,4 gam C6H5COONa; 11,6 gam C6H5ONa B. 4,1 gam CH3COONa; 14,4 gam C6H5COONa; 11,6 gam C6H5ONa C. 8,2 gam CH3COONa; 7,2 gam C6H5COONa; 5,8 gam C6H5ONa D. 4,1 gam CH3COONa; 14,4 gam C6H5COONa; 17,4 gam C6H5ONa Câu 28: Đốt cháy 1,7 gam este X cần 2,52 lít oxi (đktc), chỉ sinh ra CO2 và H2O với tỉ lệ số mol = 2. Đun nóng 0,01 mol X với dd NaOH thấy 0,02 mol NaOH tham gia phản ứng. X không có chức ete, không phản ứng với Na trong điều kiện bình thường và không khử được AgNO3/NH3 ngay cả khi đun nóng. Biết Mx < 140 đvC. Công thức cấu tạo của X là A. HCOOC6H5 B. CH3COOC6H5 C. C2H5COOC6H5 D. C2H3COOC6H5 Câu 29: Một chất hữu cơ X có công thức đơn giản là C4H4O tác dụng vừa dung dịch KOH nồng độ 11,666%. Sau phản ứng thu được dung dịch Y. Cô cạn dung dịch Y thì phần hơi chỉ có H2O với khối lượng 86,6 gam, còn lại là chất rắn Z có khối lượng là 23 gam. Công thức cấu tạo của X có thể là: A. CH3COOC6H5 B. HCOOC6H4CH3 C. HCOOC6H4-C2H5 D. Cả A và B đều đúng Câu 30: Cho 2,76 gam chất hữu cơ A chứa C, H, O tác dụng với dung dịch NaOH vừa đủ, sau đó chưng khô thì phần bay hơi chỉ có nước, phần chất rắn khan còn lại chứa hai muối của natri chiếm khối lượng 4,44 gam. Nung nóng hai muối này trong oxi dư, sau khi phản ứng hoàn toàn, ta thu được 3,18 gam Na2CO3 2,464 lít khí CO2 (đktc) và 0,9 gam nước. Biết công thức đơn giản cũng là công thức phân tử. Công thức cấu tạo thu gọn của A là: A. C6H5COOH B. HCOOC6H5 C. HCOOC6H4OH D. Tất cả đều sai

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

LỜI GIẢI CHI TIẾT

BỒ

ID Ư

Ỡ N

Câu 1: Đáp án: C Các este thỏa mãn là: HCOOC=C-C (cis - trans) ; HCOOCH2CH=CH2; HCOOC(CH3)=CH2 => Có 4 đồng phân Câu 2: Đáp án: D → Y + H2SO4 CH3COOH X + kiềm  [O ] → Z  → Andehit  → 4Ag => Z là CH3OH X + kiềm  => X là CH3COOCH3 Câu 3: Đáp án: C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U TP .Q ẠO Đ

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

d Este/O2 = 3,125 => M este = 3,125. 32 = 100 (C5H8O2) Xà phòng hóa X thu được andehit => X có thể là HCOOCH=CH-CH2-CH3 ; HCOOCH=C(CH3)-CH3; CH3COOCH=CH-CH3 ; C2H5COOCH=CH2 Có 4 CTCT thỏa mãn Câu 4: Đáp án: B Có 3 tình huống : chỉ Y tráng bạc; chỉ Z tráng bạc; cả Y và Z đều tráng bạc 1 Với 2 TH đầu: => nX = nAg = 0,1 => MX = 43 (loại) 2 1 Với TH 3: => nX = nAg = 0,05 => MX = 86 (C4H6O2) 4 Vì cả Y và Z đều tráng bạc => X là HCOOCH=CH-CH3 Câu 5: Đáp án: C 20 nX = = 0,2 mol ; nNaOH = 0,3 mol 100 => NaOH dư 0,1 mol Chất rắn = muối + NaOH dư => muối = 23,2 - 0,1.40 = 19,2 g 19, 2 => M muối = = 96 (C2H5COONa) 0, 2 Mà X có PTK = 100 (C5H8O2) => X là C2H5COOCH=CH2 Câu 6: Đáp án: B nCO2 2 = => Rượu là C2H5OH Đốt rượu => nH 2O 3

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

ẤP

2+

3

10

00

Khi nung Y với vôi tôi xút , nhóm -COONa bị thay bởi -H => Y là : +) HO-CH2-CH2-COONa => X là

H

Ó

A

C

+) CH3-CH(OH)-COONa => X là

TO

ÁN

-L

Í-

Câu 7: Đáp án: C → 1 sản phẩm duy nhất => X là este nội phân tử X + NaOH 

→ CH3-CH(OH)-COONa + NaOH 

BỒ

ID Ư

Ỡ N

G

Câu 8: Đáp án: C nCO2 = 0,04 ; nH2O = 0,032 Bảo toàn khối lượng => mO = 0,8 - 0,04.12 - 0,032.2 = 0,256 g => nO = 0,016 => C : H : O = 5 : 8 : 2 mà X đơn chức => X là C5H8O2 Với 5g X => nX = 0,05 mol => nNaOH = 0,05 => mNaOH = 2g Mà m muối = mX + mNaOH (7 = 5 + 2) => X là este nội phân tử. Vì Z không phân nhánh

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

=> X là: hay Câu 9: Đáp án: D HOOC - C6H4 - OH + CH3OH  → H3COOC - C6H4 - OH + H2O Axit salyxylic metyl salixylat → NaOOC - C6H4 - ONa + CH3OH + H2O H3COOC - C6H4 - OH + 2NaOH  Z: oct - NaO - C6H4 - COONa Câu 10: Đáp án: D 9.2 + 2 − 8 =6 Độ bất bão hòa của A và B : k = 2 A, B đều cộng Br2 theo tỉ lệ 1: 1 => Chứa 1 liên kết pi C=C A + NaOH  → 1 muối + 1 andehit => A là C6H5 - COOCH=CH2 → 2 muối => B là este của phenol B + NaOH  Mà muối tạo thành lớn hơn CH3COONa => B là C6H5 - OOCCH=CH2 Câu 11: Đáp án: A 27, 2 neste = 0,2 mol => Meste = = 136 0, 2 → 2 muối => X là este của phenol X + NaOH  Do đó, X có dạng C6H5OOCR => 121 + R = 136 => R = 15 Vậy X là C6H5OOCCH3 Câu 12: Đáp án: C Andehit no, mạch hở có CT: CnH2nO Mà %O = 27,58% 16 = 0,2758 => n = 3 => andehit là CH3CH2CHO => 14n + 16 neste = 0,25 mol mà nNaOH = 0,35 mol phản ứng vừa đủ => Hỗn hợp chứa 1 este của phenol với số mol là 0,35 - 0,25 = 0,1 mol => Este còn lại có số mol là 0,15 mol 28, 6 Trong 28,6 g muối chứa = 11,6 g muối này, và 28,6 - 11,6 = 17 g muối kia. 1 + 1, 4655 +) TH1: muối của gốc axit là 11,6g , muối của phenol là 17 g 11, 6 => M muối gốc axit = = 46,4 , loại 0, 25 +) TH2: Muối của gốc axit là 17 g , muối của phenol là 11,6 g 17 => M muối của gốc axit = = 68 (HCOONa) 0, 25 11, 6 M muối phenol = = 116 (C6H5ONa) 0,1 => Hai este là HCOOC6H5 và HCOOCH=CH-CH3 Câu 13: Đáp án: D Este + KOH  → Muối + Andehit => Este có dạng RCOOCH=CH-R' 12,9 M este = 86 => R + R' = 16 0,15 <=> +) R = 1; R' = 15 <=> HCOOCH=CH-CH3 +) R= 15; R' = 1 <=> CH3COOCH=CH2 Câu 14: Đáp án: B Các chất thỏa mãn là: HCOOCH3 ; CH3COOCH=CH2 ; HCOONH4 ; HCOOCH2-CH=CH2

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

U

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U TP .Q ẠO Đ

;

C

ẤP

2+

;

3

=> X có thể là:

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Câu 15: Đáp án: D X1 chứa C, H, O, Na => X1 là muối của axit cacboxylic X2 chứa C, H, O không tráng gương và không phản ứng với Na => X2 là xeton Mà X2 chứa 3 C => X2 là CH3 - CO - CH3 Gọi X : RCOOC(CH3)=CH2 => X1 là RCOONa RCOONa Mà = 82% RCOOC (CH 3 ) = CH 2 R + 67 <=> = 0,82 R + 85 => R = 15 Suy ra X là CH3COOC(CH3)=CH2 Câu 16: Đáp án: B Xà phòng hóa este chỉ tạo một sản phẩm => X là este nội phân tử Nung muối Y => Thực hiện phản ứng vôi tôi xút, tạo ancol Z và Na2CO3 Đốt Z => 3CO2 + 4H2O 3 => Rượu no, có số C là =3 4−3 => Z là CH3-CH2-CH2-OH

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

Xét 4 đáp án => B thỏa mãn Câu 17: Đáp án: C d X/O2 = 3,125 => MX = 100 => X làC5H8O2 20 nC5H8O2 = = 0,2 mol => NaOH dư 0,3 - 0,2 = 0,1 mol 100 Bã rắn gồm 0,1 mol NaOH và 0,2mol muối => 0,1. 40 + 0,2.Muối = 23,2 => M muối = 96 (C2H5COONa) => X là C2H5COOCH=CH2 Câu 18: Đáp án: C → CH3COONa + C2H5OH CH3COOC2H5 + NaOH  → CH3COONa + C6H5ONa + H2O CH3COOC6H5 + NaOH  4, 48 Ta có nCH3COOC2H5 = nCH3COOC6H5 = = 0,02 mol 88 + 136 Khi cô cạn X sẽ có 0,02 mol C2H5OH và 0,02 mol H2O bay ra BTKL => m chất rắn = 4,48 + 0,08.40 - 0,02.(46 + 18) = 6,4 (g) Câu 19: Đáp án: B → thu được hỗn hợp muối Este + NaOH  => X là este của phenol => X có thể là C6H5OOCCH3 hoặc HCOO-C6H4-CH3 Mà các muối tạo ra có PTK > 70 => X là C6H5OOCCH3

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


Ó

H Ơ N Y U TP .Q

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

Câu 20: Đáp án: B X (C8H8O2) : - không điều chế từ axit và ancol tương ứng => Este của phenol - Không tham gia tráng gương => không là este của HCOOH => X là CH3COOC6H5 → CH3COOC6H5 + CH3COOH * Điều chế X : (CH3-CO)2O + C6H5OH  Câu 21: Đáp án: A A, B lần lượt là: C6H5COOCH=CH2 ; CH2 = CH - COOC6H5 → C6H5COONa + CH3CHO C6H5COOCH=CH2 + NaOH  (A) Muối Andehit → CH2=CH-COONa + C6H5ONa + H2O CH2=CH-COOC6H5 + 2NaOH  (B) 2 muối nước Câu 22: Đáp án: A → Muối + Andehit X + NaOH  => X có dạng RCOOCH = CHR' => R + R' = 78 Muối tạo thành RCOONa > 82 => R > 15 => R' < 78 - 15 = 63 Mà X là dẫn xuất của benzen => R, R' phải chứa C6H5 Do đó, R = 77 (C6H5- ) và R' = 1 => X là C6H5COOCH=CH2 Câu 23: Đáp án: D Theo đề bài => X là este của phenol Vì cả 2 muối có PTK > 80 => Gốc axit nhỏ nhất là CH3COOSuy ra, có 4 chất thỏa mãn: CH3COOC6H4CH3 (o-; m- ; p-) hoặc C2H5COOC6H5 Câu 24: Đáp án: D X là HCOOC(C6H5)=CH2 X + Br2 : HCOOC(C6H5)=CH2 + Br2  → HCOOC(Br)(C6H5)-CH2Br → HCOONa + C6H5-C(CH3)=O X + NaOH : HCOOC(C6H5) = CH2 + NaOH  Câu 25: Đáp án: B Các muối đều có PTK > 82 => Gốc axit nhỏ nhất thỏa mãn chứa 3 C => Gốc rượu (phenol) còn lại chứa 6C => Không thể nhận nối đôi C=C => Gốc axit là CH2=CH-COOH Este là CH2=CH-COOC6H5 Câu 26: Đáp án: C Một trong 2 muối phải là natri acrylat CH2 = CH - COONa

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ẠO

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

CaO ,t → CH2 = CH2 + Na2CO3 CH2 = CH - COONa + NaOH  => Este là C6H5OOCCH=CH2 (phenol acrylat) Câu 27: Đáp án: A Các muối đều có M > 70 => X, Y là CH3COOC6H5 và C6H5COOCH3 → CH3COONa + C6H5ONa + C6H5COONa + H2O CH3COOC6H5 + 2NaOH  → CH3COONa + C6H5ONa + C6H5COONa + H2O C6H5COOCH3 + NaOH  nA = 0,2 mol , nNaOH = 0,3 mol => nCH3COOC6H5 = 0,1mol => nC6H5COOCH3 = 0,1 Do đó : CH3COONa = 0,1 mol <=> 8,2 g C6H5ONa = 0,1 mol <=> 11,6 g C6H5COONa = 0,1 mol <=> 14,4 g Câu 28: Đáp án: B Các muối đều có M > 70 => X, Y là CH3COOC6H5 và C6H5COOCH3 → CH3COONa + C6H5ONa + C6H5COONa + H2O CH3COOC6H5 + 2NaOH  → CH3COONa + C6H5ONa + C6H5COONa + H2O C6H5COOCH3 + NaOH  nA = 0,2 mol , nNaOH = 0,3 mol => nCH3COOC6H5 = 0,1mol => nC6H5COOCH3 = 0,1 Do đó : CH3COONa = 0,1 mol <=> 8,2 g C6H5ONa = 0,1 mol <=> 11,6 g

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

C6H5COONa = 0,1 mol <=> 14,4 g Câu 29: Đáp án: D Dựa vào đáp án => X chứa 2 oxi , tức C8H8O2 mặt khác, ở cả 3 đáp án A, B, C tỉ lệ phản ứng với KOH là 1:2 Do đó, X phản ứng với KOH tỉ lệ 1:2 => X là este của phenol 56.2 x Gọi số mol X là x => nKOH = 2x => mKOH = 0,11666 BTKL => mX + m dd KOH = m hơi + m rắn 56.2 x <=> 136x + = 86,6 + 23 => x = 0,1 mol 0,11666 Giả sử X là RCOOR' (R' chứa C6H5-) => Chất rắn là RCOOK và R'OK => 0,1.(R + 44 + 39 + R' + 16 + 39) = 23 <=> R + R' = 92 <=> R = 15 (CH3-) ; R' = 77(C6H5-) hoặc R = 1 (H-) ; R' = 91 (CH3C6H4-) Vậy X là CH3COOC6H5 hoặc HCOOC6H4CH3 Câu 30: Đáp án: C nNa2CO3 = 0,03 mol ; nCO2= 0,11 mol ; nH2O = 0,05 mol → H2O (1) A + NaOH  0,04 mol → hai muối natri + O2  → Na2CO3 + CO2 + H2O (2) A + NaOH  4,44 g Bảo toàn nguyên tố => nNaOH = 0,06 mol BTKL: mA + mNaOH = mH2O + m muối => mH2O = 0,72 g <=> nH2O = 0,04 BTKL với phản ứng đốt muối natri: mmuối + mO2 = mNa2CO3 + mCO2 + mH2O => mO2 = 4,48 g => nO2 = 0,14 mol Giả sử trong 2,76 g A có chứa x mol C , y mol H, z mol O Bảo toàn nguyên tố C => x = nNa2CO3 + nCO2 = 0,14 Bảo toàn nguyên tố H: y + nNaOH = 2nH2O (1) + 2nH2O (2) => y = 2(0,04 + 0,05) - 0,06 = 0,12 BTKL : 2,76 = mC + mH + mO => z = 0,06 => C : H : O = 7 : 6 : 3 => A là C7H6O3 => nA = 0,02 mol → 2H2O , tức A có este của phenol, và có thêm 1 nhóm -OH phenol => Cứ 1 A + 3 NaOH  => A là HCOOC6H4OH (o- , m- , p-)

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

U

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Khẳng định nào sau đây là đúng A. Este no, hai chức phản ứng với NaOH theo tỉ lệ mol 1:1 B. Este no, ba chức phản ứng với NaOH theo tỉ lệ mol 1:2 C. Thủy phân este luôn thu được ancol và axit D. Este no, ba chức mạch hở phản ứng với NaOH theo tỉ lệ 1:3 Câu 2: Thủy phân hoàn toàn 0,1 mol este X cần vừa đủ 0,2 mol NaOH thu được 15 gam muối natri của 2 axit cacboxylic và etylen glicol. Phát biểu nào dưới đây không đúng khi nói về X: A. X tham gia phản ứng tráng bạc B. X có CTPT là C5H8O4 C. X là este no, hai chức D. X là este no, không có phản ứng tráng bạc Câu 3: Hợp chất hữu cơ mạch hở X có công thức phân tử C6H10O4. Thủy phân X tạo ra hai ancol đơn chức có số nguyên tử cacbon trong phân tử gấp đôi nhau. Công thức của X là A. CH3OCO-CH2-COOC2H5. B. C2H5OCO-COOCH3. C. CH3OCO-COOC3H7. D. CH3OCO-CH2-CH2-COOC2H5. Câu 4: Hợp chất hữu cơ X chỉ chứa một nhóm chức, có CTPT C6H10O4. khi X tác dụng với NaOH được một muối và một ancol. Lấy muối thu được đem đốt cháy thì sản phẩm không có nước. CTCT của X là A. CH3COOCH2CH2COOCH3. B. C2H5OOC-COOC2H5. C. HOOC(C2H4)4COOH. D. CH3OOCCOOC3H7. Câu 5: E là hợp chất hữu cơ chỉ chứa một loại nhóm chức, công thức phân tử C6H10O4. E tác dụng với dung dịch NaOH đun nóng cho ra hỗn hợp chỉ gồm ancol X và hợp chất Y có công thức C2H3O2Na. X là A. ancol metylic. B. ancol etylic. C. ancol anlylic D. etylen glicol Câu 6: E là hợp chất hữu cơ chỉ chứa một loại nhóm chức, công thức phân tử C10H18O4. E tác dụng với dung dịch NaOH đun nóng cho ra hỗn hợp chỉ gồm muối natri của axit ađipic và ancol Y. Y có công thức phân tử là A. CH4O. B. C2H6O. C. C3H6O. D. C3H8O. Câu 7: E là hợp chất hữu cơ chỉ chứa một loại nhóm chức, công thức phân tử là C6H8O4. Thủy phân E (xúc tác axit) thu được ancol X và 2 axit cacboxylic Y, Z có công thức phân tử là CH2O2 và C3H4O2. Ancol X là A. ancol metylic. B. ancol etylic. C. ancol anlylic D. etylen glicol. Câu 8: E là hợp chất hữu cơ, công thức phân tử C9H16O4. Thủy phân E (xúc tác axit) được axit cacboxylic X và 2 ancol Y và Z. Biết Y và Z đều có khả năng tách nước tạo anken. Số cacbon Y gấp 2 lần số cacbon của Z. X là A. axit axetic. B. axit malonic

N

Thủy phân este đa chức

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. axit oxalic. D. axit acrylic. Câu 9: Cho 0,1 mol este E phản ứng vừa đủ với dung dịch chức 0,2 mol NaOH, cho ra hỗn hợp 2 muối natri có công thức C2H3O2Na và C3H3O2Na và 6,2 gam ancol X. E có công thức là A. C6H10O4. B. C6H8O4. C. C7H10O4. D. C7H12O4. Câu 10: Cho 0,1 mol este E phản ứng vừa đủ với dung dịch chứa 0,3 mol NaOH, cho ra hỗn hợp gồm 3 muối natri có công thức CHO2Na ; C2H3O2Na ; C3H3O2Na và 9,2 gam ancol X. E có công thức phân tử phân tử là A. C8H10O4. B. C10H12O6. C. C9H12O6. D. C9H14O6. Câu 11: Xà phòng hóa một hợp chất có công thức phân tử C10H14O6 trong dung dịch NaOH (dư), thu được glixerol và hỗn hợp gồm ba muối (không có đồng phân hình học). Công thức của ba muối đó là: A. CH2=CH-COONa, HCOONa và CHºC-COONa. B. CH3-COONa, HCOONa và CH3-CH=CH-COONa. C. HCOONa, CHºC-COONa và CH3-CH2-COONa. D. CH2=CH-COONa, CH3-CH2-COONa và HCOONa. Câu 12: X là este tạo từ ancol no đơn chức và axit no đều mạch hở. Trong phân tử X có chứa 2 liên kết p. Hãy cho biết công thức chung nào đúng nhất với X ? A. CnH2n-2O2 B. CnH2n-2O4 C. R(COOR’)2 D. CnH2n(COOCmH2m+1)2 Câu 13: Cho 21,8 gam chất hữu cơ A chỉ chứa một loại nhóm chức tác dụng với 1 lít dung dịch NaOH 0,5M thu được 24,6 gam một muối và 0,1 mol rượu B. Lượng NaOH dư có thể trung hòa hết 0,5 lít dung dịch HCl 0,4. Cho biết công thức cấu tạo thu gọn của A? A. (CH3COO)3C3H5 B. (HCOO)3C3H5 C. (C2H5COO)3C3H5 D. Kết quả khác Câu 14: Este X có công thức phân tử C7H10O4 mạch thẳng. Khi cho 15,8 gam X tác dụng vừa đủ với 200 gam dd NaOH 4% thì thu được một ancol Y và 17,6 gam hỗn hợp 2 muối. Công thức cấu tạo của 2 muối nào sau đây có thể thỏa mãn : A. C2H3COONa và C2H5COONa B. CH3COONa và C2H3COONa C. CH3COONa và C3H5COONa D. HCOONa và C2H3COONa Câu 15: Đốt cháy hoàn toàn 1,46 gam chất X gồm có C, H, O thu được 1,344 lít khí CO2 (ở đktc) và 0,90 gam H2O. Tỉ khối hơi của X so với hiđro bằng 73. Biết khi thủy phân 0,1 mol X bằng dung dịch KOH, thu được 0,2 mol rượu etylic và 0,1 mol muối Y. Chất X có công thức cấu tạo là: A. CH3COOC2H5 B. HCOOC2H5 C. CH2 – COOC2H5 |

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

COOC2H5 D. COOC2H5 | COOC2H5 Câu 16: Một hợp chất hữu cơ X có công thức phân tử C7H12O4. Biết X chỉ có 1 loại nhóm chức, khi cho 16 gam X tác dụng vừa đủ 200 gam dung dịch NaOH 4% thì thu được một rượu Y và 17,80 gam hỗn hợp 2 muối. Xác định công thức cấu tạo thu gọn của X. A. CH3OOC-COOC2H5 B. CH3COO-(CH2)2-OOC2H5 C. CH3COO-(CH2)2-OOCC2H5 D. Tất cả đều sai . Câu 17: Thủy phân hoàn toàn 0,1 mol este E (mạch hở và chỉ chứa một loại nhóm chức) cần dùng vừa đủ 100 ml dung dịch NaOH 3M, thu được 24,6 gam muối của một axit hữu cơ và 9,2 gam một ancol. Công thức của E là : A. C3H5(COOC2H5)3 B. (HCOO)3C3H5 C. (CH3COO)3C3H5 D. (CH2=CH-COO)3C3H5 Câu 18: Thủy phân hoàn toàn 0,1 mol este X cần 200 ml dd NaOH 1,5M. Cô cạn dung dịch sau phản ứng thu được glixerol và 24,6 gam muối khan của axit hữu cơ đơn chức, mạch thẳng. Hãy cho biết X có bao nhiêu CTCT A. 1 B. 4 C. 7 D. 10 Câu 19: Cho 0,01 mol một este của axit hữu cơ phản ứng vừa đủ với 100ml dung dịch NaOH 0,2M, sản phẩm tạo thành chỉ gồm một rượu và một muối với số mol bằng nhau. Mặt khác, khi xà phòng hóa hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ là 60ml dung dịch KOH 0,25M, sau khi phản ứng kết thúc đem cô cạn dung dịch được 1,665gam muối khan.Cho biết công thức cấu tạo của este?

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

-L

Í-

A.

TO

ÁN

B.

BỒ

ID Ư

Ỡ N

G

C. D. Kết quả khác Câu 20: Hợp chất hữu cơ X chứa C, H, O, mạch thẳng, có khối lượng phản ứng 146. X không tác dụng với natri kim loại. Lấy 14,6 gam X tác dụng vừa đủ 100ml dung dịch NaOH 2M thu được hỗn hợp gồm một muối và một rượu. Công thức cấu tạo có thể có của X là: A. HCOO(CH2)4OCOH B. CH3COO(CH2)2OCOCH3 C. CH3OOC-(CH2)2-COOCH3 hoặc C2H5OOC-COOC2H5 D. Cả A, B, C đều đúng Câu 21: Este X tạo từ hỗn hợp 2 axit đơn chức X1, X2 và glixerol. Đun nóng X với dung dịch NaOH thu được 9,2 gam glixerol và 23 gam hỗn hợp 2 muối. Hãy cho biết công thức của 2 axit

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. HCOOH và CH3COOH B. HCOOH và C2H5COOH C. CH3COOH và C2H3COOH D. HCOOH và C2H3COOH Câu 22: Một hợp chất hữu cơ X có công thức phân tử C8H14O4 . Khi X tác dụng hoàn toàn với dd NaOH tạo ra hai ancol A và B có số nguyên tử cacbon gấp đôi nhau . Khi đun nóng lần l-ượt A , B với H2SO4 đặc ở 1700C thì A tạo ra một olefin duy nhất , B tạo ra 3 olefin đồng phân . X có công thức cấu tạo là. A. C2H5OOC-COOCH2-CH2-CH2-CH3 B. CH3OOC-(CH2)3-COO-CH2-CH3 C. C2H5OOC-COOCH(CH3)-CH2-CH3 D. C2H5OOC-COOCH2-CH(CH3)-CH3 Câu 23: Hợp chất hữu cơ no, đa chức X có công thức phân tử C7H12O4. Cho 0,1 mol X tác dụng vừa đủ với 100 gam dd NaOH 8% thu được chất hữu cơ Y và 17,8 gam hỗn hợp muối. Công thức cấu tạo thu gọn của X là: A. CH3COO-[CH2]-OOCC2H5 B. CH3 COO[CH2]2OOCC2H5 C. CH3OOCCH2-COOC3H7 D. CH3COO[CH2]2COOC2H5 Câu 24: Để thuỷ phân 0,01 mol este tạo bởi một ancol đa chức và một axit cacboxylic đơn chức cần dùng 1,2 gam NaOH. Mặt khác để thủy phân 6,35 gam este đó cần 3 gam NaOH, sau phản ứng thu được 7,05 gam muối. Công thức cấu tạo của este đó là A. (CH3COO)3C3H5. B. (CH2 = CHCOO)3C3H5. C. (CH2 = CHCOO)2C2H4. D. (C3H5COO)3C3H5. Câu 25: Đun nóng 0,1 mol X với lượng vừa đủ dd NaOH thu được 13,4g muối của axit hữu cơ đa chức B và 9,2g ancol đơn chức C. Cho ancol C bay hơi ở 1270C và 600 mmHg sẽ chiếm thể tích 8,32 lít.Công thức phân tử của chất X là: A. C2H5OOC-COOC2H5 B. CH3OOC-COOC2H5 C. CH3OOC-CH2-COOC2H5 D. C2H5OOC-CH2COOC2H5 Câu 26: X là trieste của glixerol và axit hữu cơ Y. Đốt cháy hoàn toàn 0,1 mol X rồi hấp thụ tất cả sản phẩm cháy vào dung dịch Ca(OH)2 dư thu được 60g kết tủa. X có công thức cấu tạo là: A. (HCOO)3C3H5 B. (CH3COO)3C3H5 C. (C17H35COO)3C3H5 D. (C17H33COO)3C3H5 Câu 27: X là este mạch hở do axit no A và ancol no B tạo ra. Khi cho 0,2 mol X phản ứng với NaOH thu được 32,8 gam muối. Để đốt cháy 1 mol B cần dùng 2,5 mol O2. Công thức cấu tạo của X là A. (CH3COO)2C2H4 B. (HCOO)2C2H4. C. (C2H5COO)2C2H4 D. (CH3COO)3C3H5. Câu 28: Đun nóng 0,1 mol chất X chỉ chứa một loại nhóm chức tác dụng vừa đủ với NaOH trong dd thu được 13,4 gam muối của axit hữu cơ Y mạch thẳng và 9,2 gam ancol đơn chức. Cho toàn bộ lượng ancol đó tác dụng với Na thu được 2,24 lít H2 (đktc). Xác định CTCT của X. A. Đietyl oxalat

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. Etyl propionat C. Đietyl ađipat D. Đimetyl oxalat Câu 29: Một este A (không chứa chức nào khác) mạch hở được tạo ra từ 1 axit đơn chức và rượu no. Lấy 2,54 gam A đốt cháy hoàn toàn thu được 2,688 lít CO2 (đktc) và 1,26 gam H2O. 0,1 mol A phản ứng vừa đủ với 12 gam NaOH tạo ra muối và rượu. Đốt cháy toàn bộ lượng rượu này được 6,72 lít CO2 (đktc). CTCT của A là A. (CH3COO)2C3H5 B. (HCOO)2C2H4. C. (C2H5COO)2C2H4 D. (C2H3COO)3C3H5. Câu 30: Đun nóng 7,2 gam este X với dung dịch NaOH dư. Phản ứng kết thúc thu được glixerol và 7,9 gam hỗn hợp muối. Cho toàn bộ hỗn hợp muối đó tác dụng với H2SO4 loãng thu được 3 axit hữu cơ no, đơn chức, mạch hở Y, Z, T. Trong đó Z, T là đồng phân của nhau, Z là đồng đẳng kế tiếp của Y. Công thức cấu tạo của X là:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

H TR ẦN

www.daykemquynhon.ucoz.com

A.

10

00

B

B.

2+

3

C. D. A hoặc B

ẤP

LỜI GIẢI CHI TIẾT

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

Câu 1: Đáp án : D Este no, 2 chức + NaOH theo tỉ lệ 1 : 2 => A sai Este no, 3 chức + NaOH theo tỉ lệ 1 : 3 => B sai Thủy phân este trong môi trường axit thì thường thu được ancol/anđehit và axit nhưng thủy phân trong kiềm thì thu được muối và ancol/ hoặc một số chất hữu cơ khác... Câu 2: Đáp án : D 0,1 mol X + 0,2 mol NaOH => 15 g muối + C2H4(OH) => X là este 2 chức => X có dạng RCOO-CH2-CH2-OOCR' X + 2NaOH RCOONa + R'COONa + C2H4(OH)2 0,1 0,2 0,1 0,1 15 => R + R' = - 67.2 = 16 0,1 => R và R' là H- và CH3 => A, B, C đúng , và D sai Câu 3: Đáp án : A Thủy phân X tạo ra 2 ancol có số mol gấp đôi nhau => Số C có thể là 1 - 2 hoặc 2 - 4 .... nhưng từ cặp 2- 4 trở đi sẽ thiếu C cho gốc axit => X tạo bởi CH3OH và C2H5OH => X là CH3OCOCH2COOC2H5 Câu 4: Đáp án : B Khi đốt muối mà không tạo nước => Muối là NaOOC-COONa

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn 1 t → Na2CO3 + CO2 NaOOC-COONa + O2  2

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N H Ơ N Y U TP .Q ẠO Đ G Ư N H

Hơn nữa vì chỉ tạo một ancol => X là C2H5OOC - COOC2H5 Câu 5: Đáp án : D Theo đề bài C6H10O4 + NaOH  CH3COONa + X E chứa 4 oxi mà lại chỉ có một nhóm chức => E là este 2 chức , cứ 1 E phản ứng với 2 NaOH . Như vậy: C6H10O4 + 2NaOH  2CH3COONa + X Bảo toàn nguyên tố tìm được X là C2H6O2 (Etylen glycol) Câu 6: Đáp án : B Axit Adipic HOOC-(CH2)4-COOH => Ancol đơn chức 10 − 6 => Số C của ancol là =2 2 => Ancol là C2H6O (Ancol etylic) Câu 7: Đáp án : D Dễ dàng thấy E tạo bởi 1 axit đơn chức và 1 ancol 2 chức => C6H8O4 + 2H2O  X + CH2O2 + C3H4O2 Bảo toàn nguyên tố => X là C2H6O2 (Etylen glycol) Câu 8: Đáp án : B 9.2 + 2 − 16 E có độ bất bão hòa k = =2 2 => E là este no 2 chức Y và Z đều tách nước tạo anken => số C tối thiểu là 2 Gọi số C của Z là x => số C của Y là 2x (x ≥ 2) => x + 2x < 9 => x < 3, do đó x = 2 Vậy axit có số C là 9 - 2 - 2.2 = 3 (HOOC - CH2 - COOH) => X là axit malonic Câu 9: Đáp án : C X là ancol 2 chức => nX = nE = 0,1 mol 6, 2 => MX = = 62 => X là etylen glycol CH2OH - CH2OH 0,1 E + 2NaOH C2H3O2Na + C3H3O2Na + C2H6O2 Bảo toàn nguyên tố => E có công thức: C7H10O4 Câu 10: Đáp án : C X là ancol 3 chức , nX = nE = 0,1 mol 9, 2 => MX = = 92 => X là C3H5(OH)3 (Glyxerol) 0,1 E + 3NaOH  CHO2Na + C2H3O2Na + C3H3O2Na + C3H8O3 Bảo toàn nguyên tố => E là : C9H12O6 Câu 11: Đáp án : D 10.2 + 2 − 14 Este có độ bất bão hòa k = =4 2 Mà este chứa 3 nhóm C=O => Gốc ancol chứa 1 nối đôi C = C Este có CT: R1OCOCH2 - CH(OCOR2) - CH2COOR3 => R1 + R2 + R3 chứa 10 - 6 = 4 nguyên tử C Mà R1 ≠ R2 ≠ R3 suy ra 3 gốc là +) H- ; CH3 - ; CH2=CH-CH2+) H- ; CH3-CH2- ; CH2=CHCOONa => 3 muối là : +) HCOONa ; CH3COONa; CH2=CH- CH2COONa +) HCOONa ; CH3CH2COONa ; CH2=CHCOONa Câu 12: Đáp án : D

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

o

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

Công thức chung CnH2n(COOCmH2m+1)2 đúng nhất , theo đó X tạo từ axit 2 chức CnH2n(COOH)2 và ancol đơn chức CmH2m+1OH Câu 13: Đáp án : A nHCl = 0,2 mol => nNaOH phản ứng = 0,5 - 0,2 = 0,3 mol Vì cứ 3 NaOH tạo ra 1 ancol B => A là este 3 chức tạo bởi ancol 3 chức và axit đơn chức 24, 6 => n muối = 0,3 mol => M muối = = 82 (CH3COONa) 0,3 21,8 A có PTK là = 218 0,1 => Rượu B có PTK = 218 + 3.18 - 3.60 = 92 (C3H5(OH)3) A là (CH3COO)3C3H5 Câu 14: Đáp án : B 4 mNaOH = 200. = 8 (g) 100 8 => nNaOH = = 0,2 mol 40 Gọi 2 muối là R1COONa và R2COONa => Số mol mỗi muối là 0,1 mol Suy ra: 0,1.(R1 + 67 + R2 + 67) = 17,6 <=> R1 + R2 = 42 => +) R1 = 1; R2 = 41 (H- và C3H5-) +) R1 = 15 ; R2 = 27 (CH3 - và C2H3-) Theo những phương án đã cho => B thỏa mãn Câu 15: Đáp án : D nCO2 = 0,06 mol ; nH2O = 0,05 mol Bảo toàn khối lượng => mO (trong X) = 1,46 - 0,06.12 - 0,05.2 = 0,64 g => C : H : O = 3 : 5 : 2 => X là (C3H5O2)n dX/H2 = 73 => (12.3 + 5 + 32)n = 73.2 => n = 2 => X có CTtPT là C6H10O4 Mà X tạo từ 2 phân tử C2H5OH => gốc axit là 2 chức => X là C2H5OOC - COOC2H5 Câu 16: Đáp án : C 16 200 nX = = 0,1 mol ; nNaOH = .4% = 0,2 mol 160 40 Vì nX = 2nNaOH => X là este 2 chức, tạo bởi ancol 2 chức và axit đơn chức Gọi 2 muối là R1COONa và R2COONa => Số mol mỗi muối là 0,1. Do đó: 0,1.(R1 + 67 + R2 + 67) = 17,8 => R1 + R2 = 44 => +) R1 = 1 (H-) ; R2 = 43 (C3H7-) +) R1 = 15 (CH3-) ; R2 = 29 (C2H5-) => X là : HCOO(CH2)2OOC3H7 hoặc CH3COO(CH2)2 OOCC2H5 Câu 17: Đáp án : C n este = 0,1 mà nNaOH = 0,3 mol => Este 3 chức 24, 6 +) Nếu axit đa chức => nmuối = 0,1 => M muối = = 246 0,1 Muối có dạng R(COONa)3 => R = 45 (loại) 9, 2 = 92 (C3H5(OH)3) +) Nếu ancol đa chức => n ancol = 0,1 => M ancol = 0,1

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

H Ơ N Y U TP .Q ẠO Đ G Ư N

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

Vậy este là (CH3COO)3C3H5 Câu 18: Đáp án : D nNaOH = 0,3 mol = 3 n este => Este 3 chức Do thủy phân este tạo glixerol + muối => Este có dạng R1OCOCH2 - CH(OCOR2) - CH2OCOR3 => Muối là R1COONa ; R2COONa và R3COONa Theo đề bài, suy ra 0,1.(R1 + 67 + R2 + 67+ R3 + 67) = 24,6 <=> R1 + R2 + R3 = 45 Ta có các trường hơp sau: +) R1 = 1 (H-) ; R2 = 1 (H-) ; R3 = 43 (C3H7-) => Có 3 đồng phần (là 3 hoán vị của R1;R2; R3) +) R1 = 1 (H-) ; R2 = 15 (CH3-) ; R3 = 29 (C2H5-) => Có 6 đồng phân +) R1 = R2 = R3 = 15 (CH3-) => Có 1 đồng phần Vậy có tất cả 3 + 6 + 1 = 10 CTCT phù hợp Câu 19: Đáp án : A 0,01 mol este + 0,02 mol NaOH => rượu và muối có cùng số mol => Este 2 chức, tạo bởi axit và ancol đều 2 chức 1 nKOH = 0,015 mol => n este = nKOH = 7,5.10-3 mol 2 1, 29 => Meste = = 172 7,5.10−3 1, 665 = 222 M muối = 7,5.10−3 =>M của KOOC - R - COOK = 222 => R = 56 (-C4H8-) => Axit là HOOCC - C4H8 - COOH => Ancol có PTK là 172 + 2.18 - 146 = 62 (là Etylen glycol)

N

24, 6 = 82 (CH3COONa) 0,3

H

n muối = 3 n este = 0,3 => M muối =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

=> Este là: Câu 20: Đáp án : D X có PTK = 146 => X có CTPT : C6H10O4 Cứ 0,1 mol X phản ứng đủ với 0,2 mol NaOH => X là este 2 chức Sản phẩm gồm 1 muối và 1 rượu => X có thể là : HCOO-(CH2)4 - OOCH ; H3C - OOC - (CH2)2 - COOCH3 CH3COO(CH2)2 - OOCCH3 ; C2H5OOC - COOC2H5 Câu 21: Đáp án : D nC3H8O3 = 0,1 mol => Tổng số mol muối là 0,3 mol Trong 2 muối, gọi muối có số mol nhiều hơn là R1COONa ; muối kia là R2COONa => nR1COONa = 0,2 ; nR2COONa = 0,1 => 0,2.(R1 + 67) + 0,1.(R2 + 67) = 23 <=> 2R1 + R2 = 29 => R1 = 1 ; R2 = 27 (H- và C2H3 - ) Hai muối là HCOONa và C2H3COONa => hai axit là: HCOOH và C2H3COOH Câu 22: Đáp án : C A có khả năng tạo olefin => Số C tối thiểu của A là 2 => Số C tối thiểu của B là 4; mà X chỉ có 8 C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U TP .Q ẠO Đ G Ư N H

=> A có 2 C ; B có 4 C và axit có 2 C (axit 2 chức ) B là C4H9OH mà tạo 3 olefin => B là ancol sec-butylic Vậy X là : C2H5OOC-COOCH(CH3)-CH2-CH3 Câu 23: Đáp án : B nX = 0,1 mol ; nNaOH = 0,2 mol => X là este 2 chức Mà sản phẩm chứa hỗn hợp muối => Axit đơn chức , ancol 2 chức Gọi 2 muối là R1COONa và R2COONa => 0,1.(R1 + 67 + R2 + 67) = 17,8 => R1 + R2 = 44 => +) R1 = 1 (H-) ; R2 = 43 (C3H7 - ) +) R1 = 15 (CH3-) ; R2 = 29 (C2H5-) Câu 24: Đáp án : B 1, 2 Thủy phân 0,01 mol este cần = 0,03 mol NaOH 40 => este 3 chức tạo bởi ancol 3 chức và axit đơn chức 3 nNaOH = = 0,075 mol 40 0, 075 => n este = = 0,025 ; n muối = 0,075 3 6,35 => M este = = 254 0, 025 7, 05 M muối = = 94 (C2H3COONa) => Axit là C2H3COOH 0, 075 => M ancol = 254 + 18.3 - 72.3 = 92 (C3H8O3) => Este là (C2H3COO)3C3H5 Câu 25: Đáp án : A 600 .8, 32 PV 760 Số mol ancol: nancol = = = 0,2 mol RT 0, 082.(127 + 273) 9, 2 => M ancol = = 46 (C2H5OH) 0, 2 13, 4 M muối = = 134. Dễ dàng thấy đây là muối của axit 2 chức 0,1 => muối có dạng NaOOC - R - COONa => R = 134 - 2.67 = 0 => Axit là HOOC - COOH Vậy X là : C2H5OOC - COOC2H5 Câu 26: Đáp án : A X có dạng C3H5(OCOR)3 => m kết tủa = 60 ; nO2 = 0,6 mol => Đốt 1 mol X tạo 6 mol CO2 => X có 6 C => Gốc R không chứa C nào Vậy X là C3H5(OCOH)3 Câu 27: Đáp án : A Gọi công thức B là: CnH2n+2Ox Khi đốt B: CnH2n+2Ox + O2  CO2 + H2O 2n + 2 x − = 2,5 Lượng O2 cần là: nO2 = n + 4 2 3n x − = 2 <=> 3n - x = 4 <=> 2 2 => x = 2; n = 2 (Etylen glycol) 32,8 Muối có PTK = = 82 (CH3COONa) 0, 2.2

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


M Cn H 2 n+1COONa

+ neste .

H Ơ

M Cm H 2 m+1COONa = 7,9

2+

Suy ra: 2neste.

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

(vì ancol 2 chức => n muối = 2nX = 0,4) Vậy X là (CH3COO)2C2H4 Câu 28: Đáp án : A nH2 = 0,1 mol => n ancol = 2nH2 = 0,2 mol (vì ancol đơn chức) 9, 2 => M ancol = = 46 (C2H5OH) 0, 2 Đun 0,1 mol X tạo ra 0,2 mol ancol => X là este 2 chức, muối của Y là muối 2 chức NaOOCRCOONa Theo đề bài: 0,1.(R + 67.2) = 13,4 => R = 0 => X là C2H5OOCCOOC2H5 (đietyl oxalat) Câu 29: Đáp án : D Đốt 2,54 g A tạo ra 0,12 mol CO2 và 0,07 mol H2O Bảo toàn khối lượng => mO (trong A) = 2,54 - 0,12.12 - 0,07.2 = 0,96 => nO = 0,06 => C : H : O = 12 : 14 : 6 Cứ 0,1 mol A phản ứng với 0,3 mol NaOH => A chứa 3 chức este => A có 6 oxi hay công thức của A là C12H14O6 Vì axit đơn chức => rượu 3 chức => nancol = 0,1 Đốt 0,1 mol ancol tạo 0,3 mol CO2 => Ancol là C3H5(OH)3 => Axit là C2H3COOH => A là (C2H3COO)3C3H5 Câu 30: Đáp án : D Gọi công thức Z, T là CnH2n+1COOH ; Y là CmH2m+1COOH => n = m + 1 hoặc m = n + 1 hay n = m - 1 Este là C3H5(CnH2n+1COO)2(CmH2m+1COO) Muối khi thủy phân: CmH2m+1COO - C3H5 - (OOCCnH2n+1)2 + NaOH C3H5(OH)3 + 2CnH2n+1COONa + CmH2m+1COONa 7, 2 7, 2 Số mol este = = M este 28n + 14m + 176

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

7, 2 .(2(14n + 68) + 14m + 68) = 7,9 28n + 14m + 176 +) Nếu n = m + 1 => n = 3; m = 2 +) Nếu n = m - 1 => n = 2,33 => loại Vậy các axit là C3H7COOH và C2H5COOH

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

<=>

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Câu nào sau đây sai? A. Chất béo ở điều kiện th-ường là chất rắn B. Chất béo nhẹ hơn nư-ớc. C. Chất béo không tan trong n-ước, tan trong các dung môi hữu cơ D. Chất béo có nhiều trong tự nhiên. Câu 2: Cho este X có CTCT CH3COOCH = CH2. Câu nào sau đây sai? A. X là este ch-ưa no B. X đ--ược điều chế từ phản ứng giữa r-ượu và axit t-ương ứng. C. X có thể làm mất màu nư-ớc brom D. Xà phòng hoá cho sản phẩm là muối và anđehit. Câu 3: Phản ứng este hoá giữa r-ượu và axit hữu cơ sẽ dịch chuyển theo chiều tạo este trong trư-ờng hợp nào dư-ới đây? A. Cho r-ượu hay axit d-ư B. Chư-ng cất ngay để tách este C. Dùng chất hút nư-ớc để tách nư-ớc. D. Cả A, B, C. Câu 4: Câu nào sau đây sai? A. Phản ứng este hoá là phản ứng giữa rư-ợu và và axit B. Phản ứng este hoá xảy ra không hoàn toàn C. Phản ứng este hoá có chiều thuận cho sản phẩm là este và nư-ớc D. Trong phản ứng este hoá, nguyên tử H của axit hữu cơ kết hợp với - OH của r-ượu tạo ra H2O. Câu 5: Câu nào sau đây đúng? Dầu mỡ động thực vật và dầu bôi trơn máy: A. Khác nhau hoàn toàn B. Giống nhau hoàn toàn C. Chỉ giống nhau về tính chất hoá học. D. Đều là lipit. Câu 6: Câu nào sau đây sai? A. Lipit là một loại chất béo. B. Lipit có trong tế bào sống C. Lipit không hoà tan trong nư-ớc D. Lipit là một loại este phức tạp. Câu 7: Thủy phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng, thu được hai sản phẩm hữu cơ X, Y (chỉ chứa các nguyên tử C, H, O). Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. Chất X là: A. Axit axetic B. Rượu etylic C. Etyl axetat D. Axit fomic Câu 8: Công thức của este đa chức được tạo bởi axit R(COOH)n và rượu R’(OH)n’ là: A. R(COO)nn’R’ B. Rn(COO)nn’R’n’ C. Rn’(COO)nn’R’n D. CxHy(COO)nn’ Câu 9: Đun nóng 66,3 gam etyl propionat với 400 ml dung dịch NaOH 2M, cô cạn dung dịch sau phản ứng khối lượng chất rắn thu được là: A. 62,4 gam.

N

Tổng hợp este-lipit

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. 59,3 gam C. 82,45 gam. D. 68,4 gam. Câu 10: Este nào sau đây là nguyên liệu để điều chế thủy tinh hữu cơ : A. CH2=CH – COOCH3. B. CH2 = C(CH3)COOCH=CH2 C. CH2=C(CH3)COOCH3 D. CH3COOCH=CH2. Câu 11: Xác định công thức cấu tạo các chất A2, A3, A4 theo sơ đồ biến hóa sau: C4H8O2 → A2 → A3 → A4 → C2H6 A. C2H5OH; CH3COOH và CH3COONa B. C3H7OH; C2H5COOH và C2H5COONa C. C4H9OH; C3H7COOH và C3H7COONa D. Câu A,B,C đúng Câu 12: A là chất hữu cơ có công thực nghiệm (C4H5ClO2)n. Tỉ khối hơi của A nhỏ hơn 5. Khi cho A tác dụng với dung dịch Xút, đun nóng, thì thu được một muối hữu cơ, muối NaCl và anđehit axetic. Công thức cấu tạo của A là: A. CH3COOCH(Cl)CH3 B. CH3COOCHCHCl C. ClCH2COOCHCH2 D. Một công thức khác Câu 13: Khi thuỷ phân hoàn toàn hợp chất X có CTPT C4H6O2 trong môi trư-ờng axit thu đ-ược hỗn hợp 2 chất đều tham gia phản ứng tráng gư-ơng. CTCT của X là gì? A. CH3COOCH = CH2 B. CH2 = CH - COOCH3 C. HCOOCH = CH - CH3 D. HCOOCH3 Câu 14: A là một este có công thức thực nghiệm (C3H5O2)n. Một mol A tác dụng vừa đủ hai mol KOH trong dung dịch, tạo một muối và hai rượu hơn kém nhau một nguyên tử cacbon trong phân tử. A là: A. Metyl etyl malonat B. Metyl Vinyl malonat C. Vinyl alyl oxalat D. Metyl etyl ađipat Câu 15: Cho sơ đồ chuyển hoá sau: 1) C3H4O2 + NaOH → (A) + (B) 2) (A) + H2SO4 loãng → (C) + (D) 3) (C) + AgNO3 + NH3 + H2O → (E) + Ag↓ + NH4NO3 4) (B) + AgNO3 + NH3 + H2O → (F) + Ag↓ + NH4NO3 Các chất B và A có thể là: A. CH3CHO và HCOONa B. HCOOH và CH3CHO C. HCHO và HCOOH D. HCHO và CH3CHO Câu 16: Để trung hoà 14 gam một chất béo cần 15 ml dung dịch KOH 0,1M. Chỉ số axit của chất béo đó bằng bao nhiêu? Giải thích? A. 5 B. 6 C. 7 D. 8 Câu 17: Khi xà phòng hoá 1,5 gam chất béo cần 100 ml dung dịch KOH 0,1M. Chỉ số xà phòng hoá của chất béo đó là bao nhiêu?

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


TP .Q

U

Y

N

A. 373,3 B. 337,3 C. 333,7 D. 377,3 Câu 18: Muốn trung hòa 5,6 gam một chất béo X đó cần 6ml dung dịch KOH 0,1M . Hãy tính chỉ số axit của chất béo X và tính lượng KOH cần trung hòa 4 gam chất béo có Y chỉ số axit bằng 7. A. 5 và 14mg KOH B. 4 và 26mg KOH C. 3 và 56mg KOH D. 6 và 28mg KOH Câu 19: Giả sử một chất béo có công thức:

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

Muốn điều chế 20 kg xà phòng từ chất béo này thì cần dùng bao nhiêu kg chất béo này để tác dụng với dung dịch xút? Coi phản ứng xảy ra hoàn toàn. A. 19,37 kg chất béo B. 21,5 kg C. 25,8 kg D. Một trị số khác Câu 20: Thuỷ phân hoàn toàn 10 gam một lipit trung tính cần 1,68 gam KOH. Từ 1 tấn lipit trên có thể điều chế được bao nhiêu tấn xà phòng natri loại 72%. A. 1,428 B. 1,028 C. 1,513 D. 1,628 Câu 21: Đốt cháy hoàn toàn một lượng hỗn hợp 2 este, cho sản phẩm phản ứng cháy qua bình đựng P2O5 dư, khối lượng bình tăng thêm 6,21 gam, sau đó cho qua tiếp dung dịch Ca(OH)2 dư, thu được 34,5 gam kết tủa. Các este trên thuộc loại gì? (đơn chức hay đa chức, no hay không no). A. Este thuộc loại no B. Este thuộc loại không no C. Este thuộc loại no, đơn chức D. Este thuộc loại không no đa chức . Câu 22: Đốt cháy 6 gam X chỉ chứa chức este thu đ--ược 8,8 gam CO2 và 3,6 gam H2O. CTPT của este là gì? A. C2H4O2 B. C3H6O2 C. C4H8O2 D. C4H8O4 Câu 23: Hai hợp chất A, B mạch hở (chỉ chứa C, H, O) đơn chức đều tác dụng với NaOH không tác dụng với natri. Để đốt cháy hoàn toàn m gam hỗn hợp X gồm A, B thu được 6,72 lit CO2 và 5,4 gam H2O. Cho biết A, B thuộc hợp chất gì? A. Axit đơn chức không no B. Este đơn chức không no C. Este đơn chức no D. Tất cả đều sai Câu 24: Có hai este là đồng phân của nhau và đều do các axit no một lần và rượu no một lần tạo thành. Để xà phòng hóa 22,2 gam hỗn hợp hai este nói trên phải dùng hết 12 gam NaOH nguyên chất. (giả thiết là hiệu suất phản ứng đạt 100%). Cho biết công thức cấu tạo của hai este? A. CH3COOC2H5 và C2H5COOCH3

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. HCOOC2H5 và CH3COO CH3 C. C3H7COO CH3 và CH3COOC3H7 D. Câu A,B,C đều đúng. Câu 25: Xà phòng hoá hoàn toàn 2,22 gam hỗn hợp este đồng phân X và Y cần dùng hết 30 ml dung dịch NaOH 1M. Khi đốt cháy hoàn toàn hỗn hợp este đó thu đư-ợc khí CO2 và H2O với thể tích bằng nhau.CTPT của 2 este và Tổng khối l-ượng H2O và CO2 thu được là bao nhiêu? A. CH3COOCH3 và HCOOC2H5; 5,58 g B. CH3COOC2H5 và C2H5OOCH3; 26 g C. C3H7COOCH3 và CH3COOC3H7 ; 18 g D. Tất cả đều sai. Câu 26: A là chất hữu cơ có thành phần nguyên tố là C, H, O và Cl. Khối lượng mol phân tử của A là 122,5 gam. Tỉ lệ số mol của C, H, O, Cl lần lượt là 4 : 7 : 2 : 1. Đem thủy phân A trong dung dịch xút thì thu được hai chất có thể cho được phản ứng tráng gương. A là: A. HCOOCH2CH(Cl)CHO B. HCOOCH=CH2CH2Cl C. HOC-CH2CH(Cl)OOCH D. HCOO-CH(Cl)CH2CH3 Câu 27: Người ta lấy 688 gam axit metacrilic tác dụng với 320 gam rượu metylic, thu được este với hiệu suất 60%. Nếu đem lượng este này trùng hợp để tạo thủy tinh hữu cơ (plexiglas), hiệu suất 80%, thì khối lượng polyme thu được sẽ là bao nhiêu? A. 480 gam B. 384 gam C. 640 gam D. Một trị số khác Câu 28: Trong một phản ứng este hóa, 20,8 gam axit malonic phản ứng được với m gam hỗn hợp hai rượu đơn chức no mạch hở đồng đẳng liên tiếp, thu được 34,8 gam hỗn hợp ba este đa chức. Hai rượu trong hỗn hợp là: A. Metanol; Etanol B. Etanol; Propanol-1 C. C3H7OH; C4H9OH D. C4H9OH; C5H11OH Câu 29: Cho este có CTPT C4H8O2. Sản phẩm thuỷ phân hoàn toàn X trong môi tr-ường kiềm dư- cho tác dụng với Na d-ư thu đ-ược 2,24 lít H2 (đktc). Đốt cháy hoàn toàn X thu đư-ợc bao nhiêu gam CO2 (đktc) ? A. 32,5 g B. 35,2 g C. 25,3 g D. 23,5 g Câu 30: Cho 7,4 gam este X no, đơn chức phản ứng với AgNO3/NH3 thu đư-ợc 21,6 gam kết tủa. CTPT của este là gì? A. HCOOCH3 B. CH3COOC2H5 C. HCOOC2H5 D. CH3COOCH3 Câu 31: Hỗn hợp X gồm 2 este C4H8O2 và C3H6O2 tác dụng với NaOH d-ư thu đư-ợc 6,14 gam 2 muối và 3,68 gam rượu duy nhất có tỉ khối hơi so với oxi là 1,4375. CTPT của 2 este là gì? A. CH3COOC2H5 và HCOOC2H5 B. C2H5COOCH3 và CH3COOCH3 C. C3H7COOCH3 và CH3COOCH3

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. CH3COOCH3 và HCOOCH3 Câu 32: Để nhận biết hai chất béo: olein và panmitin. Người ta sẽ dùng dung dịch: A. NaOH. B. Brôm C. HCl D. CuSO4. Câu 33: A là một este có công thức phân tử C16H14O4. Một mol A tác dụng được với bốn mol NaOH. Muối natri thu được sau phản ứng xà phòng hóa nếu đem đốt cháy chỉ thu được CO2 và xôđa. A có cấu tạo đối xứng. A là: A. Este của axit sucxinic (HOOCCH2CH2COOH) với phenol B. Este của axit malonic (HOOCCH2COOH) với một phenol thường và một Cresol (Metylphenol) C. Este của axit oxalic với hai cresol (CH3C6H4OOC-COOC6H4CH3) D. Cả (A), (B), (C) Câu 34: X là este của một axit hữu cơ đơn chức và rượu đơn chức. Để thủy phân hoàn toàn 6,6 gam chất X người ta dùng 34,10 ml dung dịch - NaOH 10% có d = 1,1 gam/ml (lượng NaOH này dư 25% so với lượng NaOH cần dùng cho phản ứng). Cho biết công thức cấu tạo của chất X? A. CH3COOCH3 B. HCOOC3H7 C. CH3COO C2H5 D. Cả hai câu B và C đều đúng. Câu 35: Hỗn hợp X gồm 1 rư-ợu no, đơn chức và 1 axit no, đơn chức, mạch hở. Chia X thành 2 phần bằng nhau: - Phần 1 đốt cháy hoàn toàn sản phẩm thu đư-ợc cho qua bình đựng nư-ớc vôi trong thấy có 30 gam kết tủa. - Phần 2 đ--ược este hóa hoàn toàn vừa đủ thu đư-ợc 1 este. Khi đốt cháy este này thì thu đ-ược khối l-ượng H2O là bao nhiêu? A. 1,8 g B. 3,6 g C. 5,4 g D. 7,2 g Câu 36: Một este hữu cơ đơn chức có thành phần khối lượng mC : mO = 9 : 8. Cho este trên tác dụng với một lượng dung dịch NaOH vừa đủ, thu một muối có khối lượng bằng 41/37 khối lượng este. Công thức cấu tạo đúng của este là: A. HCOOC2H5 B. HCOOC2H3 C. CH3COOCH3 D. CH3COOC2H3 Câu 37: Hỗn hợp E gồm hai chất hữu cơ A, B có cùng chức hóa học. Đun nóng 13,6 gam hỗn hợp E với dung dịch NaOH dư thu được sản phẩm gồm một muối duy nhất của một axit đơn chức, không no hỗn hợp hai rượu đơn chức, no kế tiếp nhau trong dãy đồng đẳng. Đốt cháy hoàn toàn 27,2 gam hỗn hợp E phải dùng hết 33,6 lít khí oxi thu được 29,12 lít khí CO2 và hơi nước (các khí đo ở cùng điều kiện tiêu chuẩn). Công thức phân tử của A, B có thể là: A. C3H4O2 và C4H6O2 B. C2H2O2 và C3H4O2 C. C4H6O2 và C5H8O2 D. C4H8O2 và C5H10O2 Câu 38: Đun nóng a gam một hợp chất hữu cơ X có chứa C, H, O mạch không phân nhánh với dung dịch chứa 11,20g KOH đến khi phản ứng xảy ra hoàn toàn, ta được dung dịch B. Để trung hòa vừa hết lượng KOH dư trong dung dịch B cần dùng 80ml dung dịch HCl0,50M. Làm bay hơi hỗn hợp sau khi trung hòa

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

một cách cẩn thận, người ta thu được 7,36 gam hỗn hợp hai rượu đơn chức và 18,34 gam hỗn hợp hai muối. Hãy xác định công thức cấu tạo của X? A. CH3OOC-CH2-COOC3H7 B. CH3OOC-COOC2H5 C. CH3OOC-(CH2)2-COOC3H7 D. CH3OOC-CH=CH-COOCH2CH2CH3 Câu 39: Một hợp chất hữu cơ X có công thức phân tử C7H12O4. Biết X chỉ có 1 loại nhóm chức, khi cho 16 gam X tác dụng vừa đủ 200 gam dung dịch NaOH 4% thì thu được một rượu Y và 17,80 gam hỗn bợp 2 muối. Xác định công thức cấu tạo thu gọn của X. A. CH3OOC-COOC2H5 B. CH3COO-( CH2)2-OOC2H5 C. CH3COO-(CH2)2-OOCC2H5 D. Tất cả đều sai . Câu 40: Một este đơn chức X (chứa C, H, O và không có nhóm chức khác). Tỉ khối hơi của X đối với oxi bằng 3,125. Cho biết công thức cấu tạo của X trong trường hợp sau đây: Cho 0,15mol X tác dụng vừa đủ với dung dịch NaOH. Cô cạn dung dịch sau phản ứng thu được 21 gam muối khan (X có mạch không phân nhánh)

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

00

B

A.

3

10

B.

C

ẤP

2+

C.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

D. Câu 41: Một hỗn hợp X gồm hai chất hữu cơ. Cho hỗn hợp X phản ứng với KOH vừa đủ, cần dùng 100ml dung dịch KOH 5M. Sau phản ứng thu được hỗn hợp hai muối của hai axit no đơn chức và được một rượu no đơn chức Y. Cho toàn bộ Y tác động hết với Na được 3,36 lít H2. Cho biết hai hợp chất hữu cơ là hợp chất gì? A. 1 axit và 1 rượu B. 1 este và 1 rượu C. 2 este D. 1 este và 1 axit Câu 42: Cho hỗn hợp M gồm 2 hợp chất hữu cơ mạch thẳng X, Y (chỉ chứa C, H, O) tác dụng vừa đủ với 8 gam NaOH thu được một rượu đơn chức và hai muối của hai axit hữu cơ đơn chức kế tiếp nhau trong dãy đồng đẳng. Lượng rượu thu được cho tác dụng với Na dư tạo ra 2,24 lít khí (đktc). X, Y thuộc loại hợp chất gì? A. axit B. 1 axit và 1 este C. 2 este D. 1 rượu và 1 axit .

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 43: Đốt cháy hoàn toàn một lượng hỗn hợp hai chất hữu cơ đơn chức no, mạch hở cần 3,976 lít oxi (đo ở diều kiện tiêu chuẩn) thu được 6,38 g CO2. Cho lượng este này tác dụng vừa đủ với KOH thu được hỗn hợp hai rượu kế tiếp và 3,92 g muối của một axit hữu cơ. Công thức cấu tạo của hai chất hữu cơ trong hỗn hợp đầu là: A. HCOOCH3 và C2H5COOCH3 B. CH3COOC2H5 và C3H7OH C. CH3COOCH3 Và CH3COOC2H5 D. C2H5COOCH3Và CH3COOC2H5 Câu 44: Hợp chất X (C, H, O) chứa một nhóm chức trong phân tử, không tác dụng với Na, tác dụng với NaOH có thể theo tỉ lệ 1 :1 hay 1:2. Khi đốt cháy 1 mol X cho 7 mol CO2. Tìm công thức cấu tạo của X A. C2H5COOC4H9 B. C3H7COOC3H7 C. HCOOC6H5 D. Kết quả khác Câu 45: Giả sử trong điều kiện thích hợp, người ta thực hiện được phản ứng este hóa vừa đủ giữa 12,4 gam etylenglicol với m gam hỗn hợp hai axit hữu cơ đơn chức no mạch hở đồng đẳng kế tiếp, thu được 32 gam hỗn hợp ba este đa chức. Công thức hai axit hữu cơ đem dùng là: A. HCOOH, CH3COOH B. CH3COOH, CH3CH2COOH C. CH3CH2COOH, CH3CH2CH2COOH D. C3H7COOH, C4H9COOH Câu 46: Hỗn hợp E gồm 3 este đa chức của axit oxalic và hai rượu đơn chức, no, mạch hở, đồng đẳng kế tiếp. Thực hiện phản ứng xà phòng hóa hoàn toàn 4,8 gam hỗn hợp E bằng dung dịch xút vừa đủ thì thấy đã dùng hết 19,48 ml dung dịch NaOH 11% (có khối lượng riêng 1,12 g/ml). Công thức của hai rượu tạo nên hỗn hợp E là: A. CH3OH, C2H5OH B. C4H9OH, C5H11OH C. C2H5OH, C3H7OH D. C5H11OH, C6H13OH Câu 47: A là một este. 11,8 gam A tác dụng vừa đủ 200 ml dung dịch NaOH 1M. Đem chưng cất thu đươc rượu metylic và một muối. Đốt cháy hết lượng muối này, thu được CO2 và m gam xôđa. Trị số của m là: A. 10,6 gam B. 21,2 gam C. 5,3 gam D. Một trị số khác Câu 48: Cho 0,01 mol một este của axit hữu cơ phản ứng vừa đủ với 100ml dung dịch NaOH 0,2M, sản phẩm tạo thành chỉ gồm một rượu và một muối với số mol bằng nhau. Mặt khác, khi xà phòng hóa hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ là 60ml dung dịch KOH 0,25M, sau khi phản ứng kết thúc đem cô cạn dung dịch được 1,665gam muối khan. Cho biết công thức cấu tạo của este?

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

A.

B.

C.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. Đáp án khác Câu 49: Hai este A, B là dẫn xuất của benzen có công thức phân tử là C9H8O2; A và B đều cộng hợp với brom theo tỉ lệ mol là 1 : 1. A tác dụng với xút cho một muối và một anđehit. B tác đụng với xút dư cho 2 muối và nước, các muối có khối lượng phân tử lớn hơn khối lượng phân tử của natri axetat. Công thức cấu tạo của A và B có thể là: A. HOOC-C6H4-CH=CH2 và CH2=CH-COOC6H5 B. C6H5COOCH=CH2 và C6H5-CH=CH-COOH C. HCOOC6H4CH=CH2 và HCOOCH=CH-C6H5 D. C6H5COOCH=CH2 và CH2=CH-COOC6H5 Câu 50: Cho 0,01 mol một este X phản ứng vừa hết với 100ml dung dịch NaOH 0,2M, sản phẩm tạo ra chỉ gồm một muối và một rượu đều có số mol bằng số mol của este, đều có cấu tạo mạch thẳng. Mặt khác khi xà phòng hóa hoàn toàn 2,58 gam este đó bằng lượng KOH vừa đủ, phải dùng 20ml dung dịch KOH 1,5M thu được 3, 33 gam muối. Hãy xác định công thức cấu tạo của este

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

A.

B

B.

2+

3

10

00

C.

D.

ẤP

LỜI GIẢI CHI TIẾT

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

Câu 1: Đáp án: A Chất béo ở điều kiện thường , có thể là chất rắn (tristearin) hoặc chất lỏng (triolein) Câu 2: Đáp án: B Este CH3COOCH=CH2 được điều chế theo phản ứng : CH3COOH + C2H2  CH3COOCH=CH2 Câu 3: Đáp án: D Theo nguyên lí dịch chuyển cân bằng, phản ứng hữu cơ sẽ chuyển dịch theo chiều thuận, nếu: +) Dùng tăng chất tham gia +) Liên tục lấy đi sản phẩm Câu 4: Đáp án: D Trong phản ứng este hóa, nhóm -OH của axit kết hợp với -H của ancol, tạo thành H2O. Câu 5: Đáp án: A Dầu mỡ động thực vật là các trieste, còn dầu mỡ bôi trơn máy là các ankan cao phân tử. Chúng hoàn toàn khác nhau. Câu 6: Đáp án: A Lipit bao gồm các chất béo, sáp , steroid , phospholipid..... Câu 7: Đáp án: B −

H 2O , H → CH3COOH + C2H5OH Ta thấy: CH3COOC2H5 (C4H8O2)  mengiam → CH3COOH + H2O C2H5OH + O2  Vậy X là C2H5OH Câu 8: Đáp án: C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

N

Số chức este tạo ra phải là bội của n và n' , ta chọn n.n' Do đó: n' R(COOH)n + nR'(OH)n'  Rn'(COO)n.n' R' + n.n' H2O Câu 9: Đáp án: D C2H5COOC2H5 + NaOH  Chất rắn + C2H5OH 0,65 mol 0,8 mol 0,65 mol Bảo toàn khối lượng => chất rắn = 66,3 + 0,8.40 - 0,65.46 = 68,4 g Câu 10: Đáp án: C Thủy tinh hữu cơ được điều chế từ este metyl metacrylat: o

U

Y

N

t , xt , p → -(-CH2 - C(CH3)(COOCH3) -)n nCH2=C(CH3)COOCH3  Câu 11: Đáp án: B −

Ư N

G

Đ

ẠO

Câu 12: Đáp án: A Vì tỉ khối hơi của A < 5 => 120,5n < 29.5 => n < 1,2 => n = 1 => A có công thức C4H5ClO2 Ta thấy: CH3COOCH(Cl)CH3 + 2NaOH  CH3COONa + CH3CHO + NaCl Câu 13: Đáp án: C Cả hai sản phẩm đều có phản ứng tráng gương, khiến ta nghĩ đến este của axit formic

TP .Q

H 2O , H + O2 + NaOH CaO → C3H7O   → C2H5COOH → → C2H6 Ta có: C4H8O2  CH3COONa  NaOH .t o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

H HCOOCH=CH-CH3 + H2O → HCOOH + CH3CH2CHO Câu 14: Đáp án: A A tác dụng với 2 mol KOH => A là este hai chức => n = 2 => A có CTPT là: C6H10O4 Nhận thấy: CH3OOCCH2COOC2H5 + 2KOH  CH3OH + C2H5OH + KOOCCH2COOK (thỏa mãn) Vậy A là: etyl metyl malonat Câu 15: Đáp án: A (1) HCOOCH=CH2 + NaOH  HCOONa + CH3CHO (2) HCOONa + H2SO4  HCOOH + Na2SO4 (3) HCOOH + AgNO3 + NH3 + H2O  (NH4)2CO3 + Ag + NH4NO3 (4) CH3CHO + AgNO3 + NH3 + H2O  CH3COONH4 + Ag + NH4NO3 Câu 16: Đáp án: B m (mg ) 0,1.0,15.1000 Chỉ số axit = KOH =6 = mchatbeo ( g ) 14 Câu 17: Đáp án: A m ( mg ) 0,1.0,1.56.1000 chỉ số xà phòng hóa = KOH = 373,3 = mchatbeo ( g ) 1,5 Câu 18: Đáp án: D 0, 006.0,1.56.1000 Chỉ số axit = =6 5, 6 Trung hòa 4g chất béo cần mKOH = 4.7 = 28 (mg) Câu 19: Đáp án: A Giả sử ta cần x mol chất béo đó

+ 3NaOH  xà phòng + C3H5(OH)3 x mol 3x mol x mol Bảo toàn khối lượng => 860x + 3x.40 = m xà phòng + x.92 Mà m xà phòng = 20 000g => x = 22,522

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

=> m chất béo = 22,522.860 = 19,37.103 (g) = 19,37 kg Câu 20: Đáp án: A

1, 68 = 0,03 mol 56

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

=> Thủy phân 1 tấn lipid cần nNaOH = 3000 mol 1 => nC3H5(OH)3 = . nNaOH = 1000 mol 3 BTKL => m xà phòng = 106 + 3000.40 - 1000.92 = 1028000 = 1,028 tấn 1, 028 => m xà phòng 72% = = 1,428 tấn 0, 72 Câu 21: Đáp án: C 0, 21 P2O5 hấp thụ H2O => nH2O = = 0,345 mol 18 Ca(OH)2 hấp thụ CO2 => nCO2 = 0,345 mol Ta thấy nCO2 = nH2O => Este no, đơn chức, mạch hở Câu 22: Đáp án: A nCO2 = 0,2 mol , nH2O = 0,2 mol BTKL => mO = 6 - 0,2.12 - 0,2.2 = 3,2 => nO = 0,2 mol Vì X chỉ chứa chức este , mà X có C : H : O = 1:2:1 => X là C2H4O2 (HCOOCH3) Câu 23: Đáp án: C Vì nCO2 = nH2O = 0,3 mol => A,B có dạng CnH2nOx . Mà A, B đơn chức tác dụng với NaOH , không tác dụng với Na => A,B là este đơn chức, no , mạch hở Câu 24: Đáp án: B 22, 2 nNaOH = 0,3 mol => n este = 0,3 mol => M este = = 74 (C3H6O2) 0,3 Suy ra, hai este là HCOOC2H5 và CH3COOCH3 Câu 25: Đáp án: A Vì V CO2 = V H2O => Este no, mạch hở, đơn chức 22, 2 nNaOH = 0,03 mol => M este = = 74 (C3H6O2) 0,3 Do đó, hai este là CH3COOCH3 và HCOOC2H5 Khi đốt 0,03 mol C3H6O2, tạo nCO2 = nH2O = 0,09 mol => mCO2 + mH2O = 5,58 g Câu 26: Đáp án: D Công thức phân tử của A có dạng (C4H7O2Cl)n Mà MA = 122,5 => n = 1 => A là C4H7O2Cl Ta thấy : HCOOCHClCH2CH3 + 2NaOH  HCOONa + C2H5CHO + NaCl Cả HCOONa và C2H5CHO đều có phản ứng tráng gương Câu 27: Đáp án: B 688 nC4H6O2 = = 8 mol ; nCH3OH = 10 mol 86 Polyme tạo thành là (C3H5COOCH3)n => m polyme = 8.0,6.0,8.100 = 384 g Câu 28: Đáp án: B Gọi CT chung của 2 rượu là ROH HCOO-CH2-COOH + 2 ROH  ROOCCH 2COOR + 2H2O 34,8 n malonic = 0,2 mol => M este = = 174 0, 2 => R = 36 => Hai rượu là C2H5OH và C3H7OH

N

Theo đề bài => Thủy phân 10 g lipid cần nNaOH = nKOH =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO Đ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

Câu 29: Đáp án: B Cứ 1 mol este tạo ra 1 mol ancol mà n ancol = 2nH2 = 0,2 mol => n este = 0,2 mol => nCO2 = 0,2.4 = 0,8 mol => mCO2 = 35,2 g Câu 30: Đáp án: C Este X có phản ứng tráng gương => X có dạng HCOOR nAg = 0,2 mol => nX = 0,1 mol => MX = 74 => R = 29 (C2H5-) => X là HCOOC2H5 Câu 31: Đáp án: A M rượu = 1,4375.32 = 46 => Ancol là C2H5OH 3, 68 => nC2H5OH = = 0,08 mol => n muối = 0,08 mol 46 6,14 => M muối = = 76,75 => Muối là HCOONa và CH3COONa 0, 08 Vậy hai este là HCOOC2H5 và CH3COOC2H5 Câu 32: Đáp án: B Dùng dung dịch Br2. Chỉ olein có phản ứng : (C17H33COO)3C3H5 + 3Br2  (C17H33Br2COO)3C3H5 Câu 33: Đáp án: C Muối natri phải là NaOOC-COONa => A là CH3C6H4OOCC-COOC6H4CH3 A + 4NaOH  CH3C6H4ONa + NaOOC-COONa + 2H2O Câu 34: Đáp án: D 34,1.1,1 nNaOH = .10% = 0,093775 mol 40 0, 093775 => nNaOH pứ = = 0,075 mol 1, 25 6, 6 => M X = = 88 (C4H8O2) 0, 075 Câu 35: Đáp án: C Dễ dàng thấy, nCO2 (1) = nCO2(2) = 0,3 mol Mà ở phần 2, este tạo thành là no, hở đơn chức => nH2O = nCO2 = 0,3 mol => mH2O = 0,3.18 = 5,4 g Câu 36: Đáp án: C mC : mO = 9:8 => nC : nO = 3:2 mà este đơn chức => Este có chứa 3 cacbon => Este là C3HxO2 Muối tạo thành chỉ có thể là HCOONa hoặc CH3COONa 37 +) Nếu muối là HCOONa => C3HxO2 = 68. = 61,37 (loại) 41 37 +) Nếu muối là CH3COONa => C3HxO2 = 82. = 74 => x = 6 41 => Este là CH3COOCH3 Câu 37: Đáp án: C E + O2  CO2 + H2O BTKL => mE + mO2 = mCO2 + mH2O => mH2O = 18g Bảo toàn oxi => nO (trong E) = 2nCO2 + nH2O - 2nO2 = 0,6 mol 0,6 27, 2 => nE = = 0,3 mol => M E = 90,667 2 0,3 Vì E tạo bởi 1 axit không no, đơn chức => Axit nhỏ nhất là CH2=CHCOOH => M ancol < M E + 18 - M C3 H 4O2 = 36,67 => Ancol là CH3OH và C2H5OH, axit là C3H4O2

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vậy hai este là C4H6O2 và C5H8O2 Câu 38: Đáp án: C

11, 2 - 0,04 = 0,16 mol 56 Sản phẩm thu được 2 ancol và 2 muối (gồm cả KCl) => Este là 2 chức, tạo từ ancol đơn chức và axit 2 chức 1 n muối = nKOH = 0,08 mol ; m muối = 18,34 - 0,04.74,5 = 15,36 g 2 15,36 Muối có dạng R(COOK)2 => R(COOK)2 = = 192 => R = 26 (-C2H4-) 0, 08 7,36 n ancol = 0,16 mol => M ancol = = 46 => Ancol chứa CH3OH 0,16 Xét 4 đáp án, thấy CH3OOC(CH2)2COOC3H7 thỏa mãn Câu 39: Đáp án: C nX = 0,1 mol ; nNaOH = 0,2 mol => Este hai chức, tạo từ axit đơn chức và ancol hai chức 17,8 n muối = 0,2 mol => M muoi = = 89 0, 2 => RCOONa + R'COONa = 89.2 = 178 => R + R' = 44 => R = 1(H) ; R' = 43 (C3H7) <=> X: HCOOCH2CH2OOCC3H7 hoặc R = 15 (CH3) ; R' = 29 (C2H5) <=> X : CH3COOCH2CH2OOCC2H5 Câu 40: Đáp án: A M X = 3,125 . 32 = 100 => X là C5H8O2 nNaOH = 0,15 mol => mNaOH = 6 g Thấy rằng, m muối = mX + mNaOH => X là este nội phân tử

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

nKOH dư = 0,04 mol => nKOH pứ =

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

Mà X không phân nhánh => X là Câu 41: Đáp án: D nKOH = 0,5 mol ; nH2 = 0,15 mol => n ancol = 0,3 mol Do đó, X gồm 1 este (0,3 mol) và 1 axit cacboxylic (0,2 mol) Câu 42: Đáp án: C nNaOH = 0,2 mol ; n ancol = 2nH2 = 0,2 mol => M chứa 2 este (có thành phần gốc hidrocacbon của ancol giống nhau) Câu 43: Đáp án: C 6,38 nO2 = 0,1775 mol ; nCO2 = nH2O = = 0,145 mol 44 Bảo toàn oxi => nO (trong este) = 0,145.3 - 0,1775.2 = 0,08 => n este = 0,04 mol 0,145 => C = = 3,625 => Este là C3H6O2 và C4H8O2 0, 04 3,92 M muối = = 98 (CH3COOK) 0, 04 Hai chất ban đầu là CH3COOCH3 và CH3COOC2H5 Câu 44: Đáp án: C Ta thấy: 1:1 → HCOONa + C6H5OH HCOOC6H5 + NaOH  1:2 và HCOOC6H5 + NaOH → HCOONa + C6H5ONa Câu 45: Đáp án: B Gọi este là C2 H 4 (OOCR ) 2

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

nC2H4(OH)2 = 0,2 mol => M este =

32 = 160 0, 2

H Ơ N Y U TP .Q ẠO Đ G Ư N H

B

TR ẦN

www.daykemquynhon.ucoz.com

=> R = 22 => Hai axit là CH3COOH và C2H5COOH Câu 46: Đáp án: C Gọi CT của e là (OOCR ) 2 19, 48.1,12.0,11 4,8 nNaOH = = 0,06 => (OOCR ) 2 = = 160 40 0, 03 => R = 36 => Ancol là C2H5OH và C3H7OH Câu 47: Đáp án: A Nếu este đơn chức => M este = 59 (loại) 11,8 => Este hai chức, M este = = 118 . Mà este tạo bởi CH3OH 0,1 => Este là CH3OOCCOOCH3 => Muối là NaOOCCOONa 0,1 mol => nNa2CO3 = 0,1 mol => mNa2CO3 = 10,6 g Câu 48: Đáp án: C Từ đề bài => Este hai chức, tạo bởi axit và ancol đều 2 chức nKOH = 0,015 mol => n muối = 0,0075 mol => M muối = 222 (KOOC-R-COOK) => R = 56 (-C4H6-)

N

=> C2 H 4 (OOCR ) 2 = 160

00

Este có dạng

10

1, 29 = 172 0,0075 => R' = 28 (-C2H4-)

ẤP

2+

3

mà M este =

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

Vậy este là Câu 49: Đáp án: D A, B lần lượt là C6H5COOCH=CH2 và CH2=CH-COOC6H5 A + NaOH  C6H5COONa + CH3CHO B + NaOH  CH2=CH-COONa + C6H5ONa Câu 50: Đáp án: A 1 n este = nNaOH ; mà n muối = n rượu = n este 2 => Este hai chức, tạo từ axit hai chức và rượu 2 chức, mạch thẳng

+ 2 KOH  R(COOK)2 + R'(OH)2 0,03 mol 0,015 mol 3,33 => R(COOK)2 = = 222 => R = 56 (-C4H6-) 0, 015 0,015 mol

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

2,58 = 172 => R' = 28 (-C2H4-) 0, 015

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

=

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Một este đơn chức mạch hở có tỉ khối so với H2 bằng 50. Khi thủy phân trong môi trường kiềm không tạo ra sản phẩm có khả năng tham gia phản ứng tráng gương: Số đồng phân cấu tạo este thỏa mãn là: A. 2 B. 4 C. 5 D. 6 Câu 2: Số đồng phân của este có công thức phân tử C6H12O2 khi thủy phân tạo ra ancol không bị oxi hóa bởi CuO. A. 1 B. 2 C. 3 D. 4 Câu 3: Khi đốt cháy hoàn toàn một este no, đơn chức thì số mol CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este là A. metyl fomiat. B. etyl axetat. C. n-propyl axetat. D. metyl axetat. Câu 4: Đốt cháy hoàn toàn m gam hỗn hợp 2 este no, đơn chức, mạch hở cần dùng 30,24 lít O2 (đktc), sau phản ứng thu được 48,4 gam khí CO2. Giá trị của m là: A. 68,2 gam B. 25 gam C. 19,8 gam D. 43 gam Câu 5: Este có các tính chất sau: Thủy phân trong dung dịch NaOH đều cho hai sản phẩm (X, Y) và chỉ có một sản phẩm Y cho phản ứng tráng gương. Cho Y tráng gương tạo được Y1, đun nóng Y1 với NaOH tạo được X. CTCT của este là: A. CH3COOCH=CH-CH3 B. C2H5COOCH=CH2. C. HCOOCH=CH3. D. CH3CH(CH3)COOCH=C(CH3)2. Câu 6: Hỗn hợp gồm phenyl axetat và metyl axetat có khối lượng 7,04 gam thủy phân trong NaOH dư, sau phán ứng thu được 9,22 gam hỗn hợp muối. % theo khối lượng của hai este trong hỗn hợp ban đầu là: A. 64,53% và 35,47% B. 53,65% và 46,35% C. 54,44% và 45,56% D. 57,95% và 42,05% Câu 7: Đốt cháy hoàn toàn một este đơn chức thu được 8,8 gam CO2. Nếu xà phòng hóa hoàn toàn lượng este này thì cần vừa đúng: 20 gam NaOH 10%. Hiđrô hóa hoàn toàn lượng este này thì cần 2,24 lít khí H2 ( đktc). CTCT của este trên là: A. CH2 = CH-COOCH3. B. CH ≡ C-COOCH3 C. CH2=CH-COOCH=CH2. D. HCOOCH=CH2. Câu 8: Đốt cháy hoàn toàn m gam etyl axetat bằng lượng oxi vừa đủ, toàn bộ sản phẩm đem dẫn qua dung dịch Ca(OH)2 sau phản ứng thu đuợc 19,68 gam kết tủa và khối lượng của dung dịch tăng thêm 20 gam. Giá trị của m ban đầu là:

N

Tổng hợp este-lipit nâng cao

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. 7,04 gam. B. 14,08 gam. C. 56,32 gam. D. 28,16 gam. Câu 9: Cho các este có tên gọi sau đây: metyl acrylat; vinyl axetat; alyl fomiat; isopropenyl fomiat, metyl metacrylat. Trong các este trên, có bao nhiêu este có cùng chung một công thức phân tử. A. 2 B. 3 C. 4 D. 5 Câu 10: Hỗn hợp hai este đơn chức A và B là đồng phân của nhau có khối lượng 2.59 gam tác dụng vừa đủ với 40 ml dung dịch NaOH ,0,875M sau phản ứng thu được 2,66 gam muối. % theo số mol của hai ancol thu được sau phản ứng là: A. 48,12% và 51,88% B. 57,14% và 42,86% C. 50% và 50% D. 45,14% và 54,86%. Câu 11: Đốt cháy hoàn toàn hỗn hợp gồm: Axit propionic; metyl fomiat; metyl propionat; etyl axetat thì cần dùng vừa đủ 9,52 lít khí O2 ( đktc). Sau phản ứng thu được 15,4 gam CO2. Nếu cho hỗn hợp ban đầu đem phản ứng với NaOH 0,5M thì thể tích của NaOH ít nhất cần dùng để phản ứng hết với hỗn hợp là: A. 200 ml. B. 100 ml C. 400 ml D. 300 ml. Câu 12: Hỗn hợp X gồm axit HCOOH và axit CH3COOH (tỉ lệ mol 1:1). Lấy 5,3 gam hỗn hợp X tác dụng với 5,75 gam C2H5OH (có xúc tác H2SO4 đặc) thu được m gam hỗn hợp este (hiệu suất của các phản ứng este hoá đều bằng 80%). Giá trị của m là : A. 10,12. B. 6,48. C. 8,10. D. 16,20. Câu 13: Một este đơn chức có % O = 37,21%. Số đồng phân của este mà sau khi thủy phân chỉ cho một sản phẩm tham gia phản ứng tráng gương là : A. 1 B. 2 C. 3 D. 4 Câu 14: Xà phòng hóa hoàn toàn 17,4 gam một este đơn chức X cần dùng vừa đủ 300 ml dung dịch NaOH 0,5M thu được muối A và ancol B. Oxi hóa B thu được xeton. Công thức cấu tạo của X là: A. HCOOCH(CH3)2 B. CH3COOCH2CH(CH3)2. C. CH3CH2COOCH(CH3)2 D. HCOOCH(CH3)CH2CH3 Câu 15: Hỗn hợp gồm hai este A và B là đồng đắng của nhau và hơn kém nhau một cacbon trong phân tử. Khi đốt cháy hoàn toàn hỗn hợp này thu được 16,28 gam CO-2 và 5,22 gam nước. CTCT của hai este trên là : A. CH3COOCH=CH2 ; CH2=CH-COOC2H5. B. CH3COOCH3 và CH3COOC2H5.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

C. CH3COOC2H5 và C2H5COOC2H5 D. CH2=CH-COOCH3và CH2=C(CH3)COOCH3. Câu 16: Đốt cháy hoàn toàn 0,014 mol hỗn hợp hai este A và B là đồng đẳng cua nhau, hơn kém nhau một nhóm CH2, sản phẩm cháy cho qua bình đựng 500 ml dung dịch Ca(OH)2 0.08M thu được 3 gam kết tủa và khối lượng của dung dịch tăng thêm 0,1 gam. Nếu tiếp tục đun nóng dung dịch sau phản ứng thu tiếp kết tủa. Công thức của hai este là: A. CH3COOCH3; HCOOCH3. B. CH3COOCH3 và CH3COOCH2CH3. C. HCOOC2H5 và CH3COOCH3. D. HCOOCH=CH2và CH3COOCH=CH2. Câu 17: Đốt cháy m gam este no đơn chức thu được a gam H2O. Nếu lấy m/2 gam este này đem thủy phân hoàn toàn thu được hỗn hợp X gồm ancol và axit. Đốt cháy hỗn hợp X thu được b gam CO2. Biểu thức nào sau đây là đúng. a .44 A. b = 18 a B. b = .44 9 11a C. b = 9 a D. b = .22, 4 9 Ni Câu 18: Axit X + 2H2  → axit Y. Tên gọi của axit X và Y lần lượt là: A. Axit panmitic; axit oleic. B. Axit lioleic và axit oleic. C. Axit oleic và axit steric. D. Axit lioleic và axit stearic. Câu 19: Cho este sau đây: C6H5OOC-CH2-COOCH3. Để phản ứng hết với 19,4 gam este này thì một dung dịch chứa ít nhất bao nhiêu gam KOH. A. 16,8 B. 11,2 C. 12 D. 8 Câu 20: Đốt cháy hoàn toàn một este đơn chức, mạch hở có 2 liên kết pi trong phân tử. San phản ứng thu được a gam CO2 và b gam H2O. Nếu cho este này tác dụng với NaOH thì cần dùng vừa đủ dung dịch chứa x gam NaOH. Biểu thức nào sau đây là đúng. 3 1 A. x = 40.( a - b) 11 9 10 20 B. x = ab 11 9 a b − C. x = 44 18 D. x = 40.(a - b) Câu 21: Chọn câu sai: A. Đun nóng chất béo với NaOH dư, sản phẩm tạo ra có khả năng hòa tan được Cu(OH)2. B. Để chuyển dầu thực vật thành bơ người ta tiến hành hiđrô hóa dầu thực vật với xúc tác Ni. C. Khi cho Glixerol đun nóng với hỗn hợp hai axit béo: stearic và axit oleic trong sản phẩm sẽ thu được 6 chất béo ở trạng thái rắn.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. Khi đun nóng chất béo với dung dịch NaOH hoặc KOH nguời ta thu được xà phòng. Câu 22: Để trung hòa luợng axit tự do có trong 5,6 gam chất béo cần 0,02 gam NaOH. Chỉ số axit béo của xà phòng này là: A. 3,57 B. 5 C. 4,45 D. 6 Câu 23: Hỗn hợp gồm các este, đơn chức, no có công thức phân tử C4H8O2 và C5H10O2 khi thủy phân trong môi trường kiềm thì thu được tối đa 6 ancol khác nhau và một muối duy nhất. Vậy muối đó là: A. CH3COONa B. HCOONa. C. C3H7COONa. D. C2H5COONa Câu 24: Một loại chất béo chỉ gồm panmitin và stearin. Đun nóng 42,82 kg chất béo trên với NaOH, khối lượng glixerol thu được 4,6 kg. % theo khối lượng của hai trieste trong chất béo trên là: A. 40% và 60% B. 36,55% và 63.45% C. 42,15% và 57,85%. D. 37,65% và 62,35%. Câu 25: xà phòng hóa hoàn toàn một loại chất béo thì cần vừa đủ 2,44 kg NaOH, sau phản ứng thu được 1,84 kg Glixerol và 17,202 kg xà phòng. Khối lượng chất béo ban đầu đem thủy phân là: ( Biết phản ứng xà phòng hóa xảy ra hoàn toàn). A. 16,202kg. B. 16,620kg C. 16,602kg D. 16,642kg. Câu 26: Cho glixerol tác dụng với hỗn hợp 3 axit cacboxilic đơn chức, hỏi trong sản phẩm sẽ thu được tối đa bao nhiêu trieste có công thức cấu tạo khác nhau. A. 14 B. 18 C. 12 D. 15 Câu 27: Cho vài giọt dung dịch CuSO4 vào ống nghiệm chứa 3 ml dầu ăn, nhỏ tiếp dung dịch NaOH vào và đun nóng nhẹ. Hiện tuợng quan sát được. A. Tạo kết tủa Cu(OH)2 và không tan trong dầu ăn. B. Tạo kết tủa Cu(OH)2 và Cu(OH)2 tan tạo dung dịch có màu xanh thẩm. C. Tạo kết tủa Cu(OH)2 sau đó kết tủa bị tan trong NaOH dư, D. Tạo kết tủa Cu(OH)-2, lắng xuống dầu ăn nổi lên trên. Câu 28: Cho triolein và vinyl axetat lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, dung dịch brôm, dung dịch NaOH. Trong điều kiện thích hợp, số phản ứng hóa học xảy ra: A. 4 B. 5 C. 6 D. 7 Câu 29: Chỉ ra điểm không đúng của các axit béo thường gặp: A. Đều là axit cacboxilic đơn chức. B. Có mạch dài không phân nhánh. C. Đều là các axit cacboxylic no

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. Có số chẵn nguyên tử Cacbon trong phân tử. Câu 30: Khi thủy phân hoàn toàn 4 gam este CH3COOCH2CH2OOCCH3 trong NaOH, sản phẩm thu được có thể hòa tan tốt đa được m gam Cu(OH)2. m có giá trị. A. 1,34 B. 24,5 C. 49 D. 12,25 Câu 31: Khi cho các đồng phân bền có cùng công thức phân tử C2H4O2 lần lượt tác dụng với Na( tạo H2), NaOH ( tạo muối), Na2CO3 ( tạo CO2). AgNO3/NH3 (tạo ra Ag). Các điều kiện phản ứng hóa học đều có đủ: Số phản ứng hóa học xảy ra là: A. 4 B. 5 C. 6 D. 7 Câu 32: Hai este A và B có CTPT CH3COOR và CH3COOR/ và có khối lượng 5,56 gam tác dụng vừa đủ với NaOH thu được 4,92 gam muối và hai ancol , hai ancol thu được đem oxi hóa bởi CuO thu được hai anđêhit, lượng anđêhit này tác dụng với lượng dư dung dịch AgNO3/NH3 thu được tối đa 17,28 gam kết tủa. Nếu đốt cháy hoàn toàn hỗn hợp hai este trên thì tổng khối lượng của CO2 và H2O thu được là: A. 16,12 gam. B. 13,64 gam. C. 17,36 gam. D. 32,24 gam. Câu 33: Thủy phân hoàn toàn 0,1 mol este X cần vừa đúng 32 gam dung dịch NaOH 25% thu được hai ancol A và B có tỉ khối đối với H2 bằng 22,5. Nếu đốt cháy hoàn toàn 0,1 mol este X thu được 30,8 gam CO2. Công thức cấu tạo đúng của este X là: A. CH3OOCCH2-CH2COOC2H5 B. CH3OOC-CH2-COOCH2-CH=CH2 C. CH3OOC-CH(CH3)-COOC2H5 D. CH3OOC-CH2-CH2-CH2COOCH2-CH=CH2 Câu 34: Xà phòng hóa 36,4 kg một chất béo có chỉ số axit bằng 4 thì cần dùng vừa đúng 7,366 kg KOH. Nếu hiệu suất của các phản ứng đều đạt là 100% thì khối lượng của xà phòng thu được là: A. 39,765kg B. 39,719kg C. 31,877kg D. 43,689 kg. Câu 35: A, B, C là ba hợp chất hữu cơ đơn chức và đồng đẳng kế tiếp nhau MA < MB < MC và không tác dụng được với Na. Tỉ khối hơi của hỗn hợp gồm 1 mol A và 3 mol C đối với H2 bằng 47,5. Nếu đốt cháy hoàn toàn 0,2 mol B rồi dẫn toàn bộ sản phẩm cháy qua bình đựng nước vôi trong lấy dư thì khối lượng bình tăng lên: A. 35,2 gam. B. 24,8 gam. C. 37,2 gam D. 49,6 gam Câu 36: Khi cho 45,6 gam anhiđric axetic tác dụng với 64,8 gam p-crezol thu được bao nhiêu gam este nếu hiệu suất của phản ứng đạt 80%. A. 82,23gam B. 83,32gam C. 60 gam

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

D. 53,64 gam Câu 37: Cho 2 mol axit axetic tác dụng với 2 mol ancol metylic ( với xúc tác H2SO4 loãng) thấy hiệu suất cực đại của quá trình đạt 69,1%. Nếu tiến hành thí nghiệm ở cùng nhiệt độ và xúc tác như trên với 3 mol axit axetic và 4 mol ancol metylic thì hiệu suất cực đại của quá trình este hóa là bao nhiêu? A. 58,5% B. 68,5% C. 78% D. 80% Câu 38: Thủy phân hoàn toàn 0,2 mol một este thì cần vừa đúng 80 gam dung dịch NaOH 30% sau phản ứng thu được 54,8 gam muối của hai axit cacboxilic đơn chức. Hai axit đó là: A. C2H5COOH và C3H7COOH. B. HCOOH và C2H5COOH. C. CH3COOH và C2H5COOH. D. CH3COOH và C2H3COOH. Câu 39: Este nào sau đây khi bị thủy phân cho ra một muối duy nhất và một ancol. A. HO-CH2CH2COOCH2CH2COOCH3 B. CH3COOC6H5. C. CH3COOCH2COOCH3. D. CH3COOCH2OOCC2H5. Câu 40: Đun sôi 13,4 gam hỗn hợp gồm hai chất hữu cơ đơn chức, hơn kém nhau một nhóm CH2 với 200ml dung dịch NaOH 1M thì phản ứng vừa đủ thu được một ancol và 16,4 gam một muối. Toàn bộ lượng ancol phản ứng với Na dư thu được 1,12 lít khí H2 ( đktc). % theo khối lượng của mỗi chất trong hỗn hợp là: A. 55,22% và 44,78% B. 45,25% và 54,75% C. 53,22% và 46,78%. D. 50% và 50%.

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

ẤP

LỜI GIẢI CHI TIẾT

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

Câu 1: Đáp án : D M este = 50.2 = 100 => Este là C5H8O2 Các đồng phân thỏa mãn là: CH3COOCH2CH=CH2 ; CH3COOC(CH3)=CH2 ; CH2=CH-COOCH2CH3 ; CH2=CH-CH2COOCH3 ; CH3-CH=CHCOOCH3 ; CH2=C(CH3)-COOCH3 => Đáp án D Câu 2: Đáp án : B Ancol không bị oxi hóa bởi CuO => Ancol bậc 3 Các đồng phân thỏa mãn : CH3COOC(CH3)3 ; HCOOC(CH3)2 - C2H5 Câu 3: Đáp án : A Gọi este là CnH2nO2 , ta có: 3n − 2 to → nCO2 + H2O CnH2nO2 + O2  2 3n − 2 => = n <=> n = 2 => Este là HCOOCH3 (Metyl format) 2 Câu 4: Đáp án : B Ta có : Este + O2  CO2 + H2O 48, 4 Vì este no, đơn chức , mạch hở => nCO2 = nH2O = = 1,1 mol 44 Bảo toàn khối lượng => meste + mO2 = mCO2 + mH2O => m = 1,1.(44 + 18) - 1,35.32 = 25 g Câu 5: Đáp án : D Ta thấy:

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ

=> Este là CH ≡ C-COOCH3 Câu 8: Đáp án : B m dung dịch tăng = 20 g => mCO2 + mH2O - m kết tủa = 20 => mCO2 + mH2O = 20 + 19,68 = 39,68 g 39,68 mà nCO2 = nH2O => nCO2 = = 0,64 mol 44 + 18 0, 64 => nCH3COOC2H5 = = 0,16 mol => m = 0,16.88 = 14,08 g 4 Câu 9: Đáp án : C Ta thấy: +) Metyl acrylat : CH2=CH-COOCH3 +) Vinyl axetat : CH3COOCH=CH2 +) Alyl fomiat : HCOOCH2-CH=CH2 +) Isopropenyl fomiat : HCOOC(CH3)=CH2 +) Metyl metacrylat : CH2=C(CH3)COOCH3 => Có 4 chất có cùng công thức phân tử. Câu 10: Đáp án : B 2,59 nNaOH = 0,035 mol => neste = 0,035 mol => M = = 74 0, 035 =>Este là CH3COOCH3 và HCOOC2H5 Đặt nCH3COOCH3 = x , nHCOOC2H5 = y. Ta được:  x + y = 0, 035  82 x + 68 y = 2, 66 => x = 0,02 mol , y = 0,015 mol x => % CH3OH = = 57,14% x+ y % C2H5OH = 42,68 % Câu 11: Đáp án : A nO2 = 0,425 mol ; nCO2 = 0,35 mol Vì các este đều no, hở, đơn chức => nH2O = nCO2 = 0,35 mol Bảo toàn nguyên tố oxi => nO (trong este) = 2nCO2 + nH2O – 2nO2 = 0,2 mol 0, 2 0,1 => neste = = 0,1 mol => VNaOH = = 0,2 lít = 200 ml 2 0,5

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

CH3CH(CH3)COOCH=C(CH3)2 + NaOH  CH3CH(CH3)COONa + CH3CH(CH3)CHO (X) (Y) + AgNO3 / NH 3 + NaOH → CH3CH(CH3)COONH4 (Y1) → CH3CH(CH3)COONa (X) CH3CH(CH3)CHO  Câu 6: Đáp án : D CH 3COOC6 H 5 + NaOH  CH3COONa + C6H5ONa + CH3OH  CH 3COOCH 3 Đặt nCH3COOC6H5 = x ; nCH3COOCH3 = y. Ta Có: 136 x + 74 y = 7, 04  x = 0, 03 ⇔  82 x + 116 x + 82 y = 9, 22  y = 0,04 0, 03.136 => % CH3COOC6H5 = = 57,95 % 7, 04 => % CH3COOCH3 = 42,05 % Câu 7: Đáp án : B Vì este đơn chức => neste = nNaOH = 0,05mol 0, 2 nCO2 = 0,2 mol => Số C của este là: =4 0, 05 nH2 = 0,1 mol = 2neste => Este có 2 liên kết π ở gốc hidrocacbon

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 12: Đáp án : B

G

H Ơ N Y

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

nRCOOH = 0,1 mol ; nC2H5OH = 0,125 mol => neste = 0,1.80% = 0,08 mol => mRCOOC2H5 = 0,08.(8 + 44 + 29) = 6,48 g Câu 13: Đáp án : C Este đơn chức => Chứa 2 nguyên tử oxi 32 => Meste = = 86 0,3721 => Este là C4H6O2 => Các đồng phân thỏa mãn : HCOOCH2-CH=CH2 ; HCOOC(CH3)=CH2 ; CH3COOCH=CH2 Câu 14: Đáp án : C nNaOH = 0,15 mol => neste = 0,15 mol 17, 4 => Meste = = 116 => Este là C6H12O2 0,15 Oxi hóa B tạo xeton => B là ancol bậc 2 Xét 4 phương án đã cho => X là CH3CH2COOCH(CH3)2 Câu 15: Đáp án : D Giả sử mỗi este có độ bất bão hòa là k 0,37 − 0, 29 0, 08 = nCO2 = 0,37 mol , nH2O = 0,29 mol => neste = k −1 k −1 0,37 0,37(k − 1) => Số C trung bình = (k ≥ 2) = 0, 08 neste Dễ thấy, với k ≥ 3 => C trung bình ≥ 9,25 , không có đáp án => k = 2 , C trung bình = 4,625 => Este là C4H6O2 và C5H8O2 Câu 16: Đáp án : B Ta có: nCa(OH)2 = 0,04 mol ; nCaCO3 = 0,03 mol => Dung dịch tạo thành chứa 2 muối => nCO2 = nOH- - nCaCO3 = 0,08 – 0,03 = 0,05 mol m dung dịch tăng = 0,1 g => mCO2 + mH2O = 0,1 + 3 = 3,1 g => mH2O = 3,1 – 0,05.44 = 0,9 g => nH2O = 0,05 mol 0,05 => Hai este đều no, hở, đơn chức. Số C trung bình = = 3,54 0,014 => Este là C3H6O2 và C4H8O2. Câu 17: Đáp án : C Khi đốt m/2 (g) este cũng giống như đốt hỗn hợp X, đều tạo ra b (g) CO2 => Đốt m (g) este tạo ra 2b (g) CO2 2b a 11a Mà nCO2 = nH2O => = ⇔b= 44 18 9 Câu 18: Đáp án : D

N

1 + 15 =8 2

U

Coi HCOOH và CH3COOH là axit RCOOH, với R =

o

BỒ

ID Ư

Ỡ N

Ni ,t → C17H35COOH Ta thấy: C17H31COOH + 2H2  (axit linoleic) (axit stearic) Câu 19: Đáp án : A C6H5OOCCH2COOCH3 + 3KOH  C6H5OK + KOOCCH2COOK + CH3OH + H2O 19, 4 => mKOH = 56. = 16,8 (g) 194 Câu 20: Đáp án : B nCO2 − nH 2O a b = − Este có độ bất bão hòa k = 2 => neste = k −1 44 18 a b 10a 20b − => mNaOH = neste . 40 <=> x = 40.( − ) = 44 18 11 9

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U

Đ

ẠO

Câu 21: Đáp án : C Phát biểu C sai. Chất béo tạo thành có chứa axit béo chưa no => Tồn tại ở trạng thái lỏng. Câu 22: Đáp án : B 0, 02.56.1000 Chỉ số axit là: =5 40.5, 6 Câu 23: Đáp án : B Nhận thấy rằng: +) Thủy phân HCOOC3H7 , tạo C3H7OH (2 đồng phân) +) Thủy phân HCOOC4H9 , tạo C4H9OH (4 đồng phân) => Sản phẩm chứa 1 muối (HCOONa) và 6 ancol, thỏa mãn Câu 24: Đáp án : D Gọi số mol của panmitin và stearin là x và y. Coi các đơn vị đã cho là gam (thay vì kg). 806 x + 890 y = 42,82  x = 0, 02  Ta được :  ⇔ 4, 6  y = 0, 03  x + y = 92

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

G

0, 02.806 = 37,65 % 42,82 => % stearin = 62,35 % Câu 25: Đáp án : B Có 2 phản ứng xảy ra: 3NaOH + (RCOO)3C3H5  3RCOONa + C3H5(OH)3 (1) NaOH + R'COOH  R'COONa + H2O (2) Ta coi các đơn vị là gam (thay vì kg) nNaOH = 0,061 mol , nglyxerol = 0,02 mol => nNaOH (2) = 0,061 - 0,02.3 = 10-3 => mH2O = 10-3 . 18 = 0,018 g BTKL => 2,44 + m chất béo = 17,202 + 1,84 + 0,018 => m chất béo = 16,62 g <=> m chất béo = 16,62 kg (đổi lại đơn vị) Câu 26: Đáp án : B n2 (n + 1) 9.4 = = 18 Số trieste tối đa là: 2 2 Câu 27: Đáp án : B Khi cho NaOH vào dầu ăn: 3NaOH + (RCOO)3C3H5 --> 3RCOONa + C3H5(OH)3 Glyxerol tạo ra sẽ hòa tan Cu(OH)2 tạo phức màu xanh thẫm Câu 28: Đáp án : A Có 4 phản ứng xảy ra: 1. Triolein + Br2  (C17H33Br2COO)3C3H5 2. Vinylaxetat + Br2  CH3COOC2H3Br2 3. Triolein + NaOH  Xà phòng + glyxerol 4. Vinyaxetat + NaOH  CH3COONa + CH3CHO Câu 29: Đáp án : C Các axit béo thường gặp là những axit cacboxylic đơn chức, mạch dài không phân nhánh, có số chẵn nguyên tử cacbon => Axit béo có thể không no. Câu 30: Đáp án : A Thủy phân CH3COOCH2CH2OOCCH3 , tạo C2H4(OH)2 mà cứ 2 phân tử etylenglycol hòa tan được 1 phân tử Cu(OH)2 4 1 . .98 = 1,34 g => m = 146 2 Câu 31: Đáp án : D Các đồng phân bền có CTPT là C2H4O2 là: CH3COOH ; HCOOCH3 ; HO-CH2-CHO

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

=> % m panmitin =

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


BỒ

H Ơ N Y U TP .Q ẠO Đ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

CH3COOH có phản ứng với Na, NaOH, Na2CO3. HCOOCH3 có phản ứng với NaOH , AgNO3/NH3 HO-CH2-CHO có phản ứng với Na ; AgNO3/NH3 => Có 7 phản ứng xảy ra. Câu 32: Đáp án : A CH 3COOR  ROH + NaOH   + CH3COONa   R ' OH CH 3COOR ' nCH3COONa = 0,06 mol => n ancol = 0,06 mol => n andehit = 0,06 mol 17, 28 Mà nAg = = 0,16 mol => andehit phải chứa HCHO 108 1 nHCHO = nAg - n andehit = 0,08 - 0,06 = 0,02 mol 2 => nCH3OH = 0,02 mol ; n andehit còn lại = 0,04 mol Mà mA + mB = 5,56 => 0,02.(59 + 15) + 0,04.(59 + R') = 5,56 => R' = 43 (C3H7-) Do đó,khi đốt 0,02 mol CH3COOCH3 0,04 mol CH3COOC3H7 tạo nCO2 = nH2O = 0,26 mol => mCO2 + mH2O = 16,12 g => Đáp án A Câu 33: Đáp án : B 32.0, 25 nNaOH = = 0,2 mol = 2 n este => Este 2 chức 40 M ancol = 22,5 . 2 = 45 => Một trong 2 ancol là CH3OH (32) => Ancol còn lại là M = 45.2 - 32 = 58 (CH2=CH-CH2OH) Đốt 0,1 mol este tạo 0,7 mol CO2 => Este có 7 nguyên tử C => Este là CH3OOCCH2COOCH2CH=CH2 Câu 34: Đáp án : A 3KOH + (RCOO)3C3H5 3RCOOK + C3H5(OH)3 (1) KOH + R'COOH R'COOK + H2O (2) 4 .10−3.36, 4.10−3 = 2,6 mol nKOH (2) = 56 7,366.103 => nKOH (1) = − 2, 6 56 BTKL : mKOH + mCB = m xà phòng + mC3H5(OH)3 + mH2O 1 <=>7,366 + 36,4 = mxà phòng + (nKOH (1) . . 92 + nKOH (2).18).10-3 3 <=> mxà phòng = 39,765 kg Câu 35: Đáp án : D Theo đề bài A = B - 14 = C - 28 (hơn kém nhau -CH2-) M A + 3M C Ta có: dA,C/H2 = 47,5 => = 47,5 .2 4 <=> MA + 3MC = 380 , mà MA = MC - 28 => MA = 74 (C3H6O2) => B là C4H8O2 , đốt 0,2 mol B tạo thành nCO2 = nH2O = 0,8 mol => m bình tăng = 0,8.(18 +44) =49,6 g Câu 36: Đáp án : D (CH3CO)2O + CH3-C6H4-OH CH3COO-C6H4-CH3 + CH3COOH 0,447 mol 0,6 mol => neste = 0,447.0,8 = 0,3576 mol => meste = 0,3576.150 = 53,64 g Câu 37: Đáp án : C

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

G

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


H Ơ N Y U TP .Q

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

Theo đề bài: CH3COOH + CH3OH CH3COOCH3 + H2O ban đầu: 2 mol 2 mol sau phản ứng: 0,618 mol 0,618 mol 1,382 mol 1,382 mol [CH 3COOCH 3 ].[ H 2O] => Hằng số cân bằng k = =5 [CH 3COOH ].[CH 3OH ] Nếu cho 3 mol CH3COOH + 4 mol CH3OH, gọi hiệu suất là h , ta có: nCH3COOH phản ứng = nCH3OH pứ = 3.h => neste = nH2O = 3h => nCH3COOH dư = 3 - 3h ; nCH3OH dư = 4 - 3h 3h.3h [CH 3COOCH 3 ].[ H 2O] = => k = =5 [CH 3COOH ].[CH 3OH ] (3 − 3h)(4 − 3h) Giải ra tìm được h = 0,78 = 78% => Đáp án C Câu 38: Đáp án : C nNaOH = 0,6 mol = 3neste => Este 3 chức => Trong 2 muối tạo ra có 1 muối chiếm 0,2 mol ; 1 muối chiếm 0,4 mol Gọi 2 muối lần lượt là RCOONa ; R'COONa => 0,2.(R + 67) + 0,4.(R' + 67) = 54,8 <=> R + 2R' = 73 => R =15 (CH3) ; R' = 29 (C2H5) Câu 39: Đáp án : A HOCH2CH2COOCH2CH2COOCH3 + 2NaOH  2HOCH2CH2COONa + CH3OH Câu 40: Đáp án : A nH2 = 0,05 mol => nancol = 0,1 mol Mà nNaOH = 0,2 mol => Hỗn hợp chứa 1 axit và 1 este naxit = 0,1 mol ; neste = 0,1 mol 16, 4 n muối = 0,2 mol => M muối = = 82 (CH3COONa) 0, 2 Gọi este là CH3COOOR => -,1.60 + 0,1.(59 + R) = 13,4 => R = 15 (CH3) Vậy hỗn hợp chứa : 0,1 mol CH3COOH 0,1 mol CH3COOCH3 => % mCH3COOH = 44,78% % mCH3COOCH3 = 55,22 %

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ẠO

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

Câu 1: Nhận định nào sau đây không đúng? A. Tên este RCOOR’ gồm: tên gốc hiđrocacbon R’ + tên anion gốc axit (đuôi “at”). B. Khi thay nguyên tử H ở nhóm –COOH của axit cacboxylic bằng gốc hiđrocacbon thì được este. C. Phản ứng thuỷ phân este trong môi trường kiềm là phản ứng 1 chiều và gọi là phản ứng xà phòng hoá. D. Các este là chất lỏng hoặc chất rắn ở điều kiện thường và chúng rất ít tan trong nước. Câu 2: So với các axit, ancol có cùng số nguyên tử cacbon thì este có nhiệt độ sôi A. thấp hơn do khối lượng phân tử của este nhỏ hơn nhiều. B. thấp hơn do giữa các phân tử este không tồn tại liên kết hiđro. C. cao hơn do giữa các phân tử este có liên kết hiđro bền vững. D. cao hơn do khối lượng phân tử của este lớn hơn nhiều. Câu 3: Đốt cháy hoàn toàn 7.8 gam este X thu được 11.44 gam CO2 (đktc) và 4.68 gam H2O. CTPT của X là: A. C2H4O2 B. C3H6O2 C. C4H8O2 D. C5H10O2 Câu 4: Công thức tổng quát của este tạo bởi axit đơn chức, no, mạch hở và ancol đơn chức, no, mạch hở có dạng. A. CnH2n+2O2 ( n ≥ 2) B. CnH2nO2 (n ≥ 2) C. CnH2nO2 ( n ≥ 3) D. CnH2n-2O2 ( n ≥ 4) Câu 5: Cho các chất có công thức cấu tạo sau đây : (1) CH3CH2COOCH3 ; (2) CH3OOCCH3 ; (3) HCOOC2H5 ;(4) CH3COOH ; (5) CH3OCOC2H3 ; (6) HOOCCH2CH2OH ; (7) CH3OOC-COOC2H5. Những chất thuộc loại este là A. (1), (2), (3), (4), (5), (6). B. (1), (2), (3), (5), (7). C. (1), (2), (4), (6), (7). D. (1), (2), (3), (6), (7). Câu 6: Công thức phân tử tổng quát của este tạo bởi ancol no, đơn chức và axit cacboxylic không no, có một liên kết đôi C=C, đơn chức là: A. CnH2nO2 ( n ≥ 2) B. CnH2n+2O2 ( n ≥ 4) C. CnH2n-2O2 ( n ≥ 4) D. CnH2n+1O2 ( n ≥ 3) Câu 7: Tính số đồng phân của este X mạch hở có CTPT là C4H6O2 . A. 4 B. 7 C. 5 D. 6 Câu 8: Các hợp chất: isoamyl axetat; etyl axetat, benzyl fomat; vinyl axetat thuộc loại hợp chất: A. Este không no B. este C. Axit axetic D. anđehit Câu 9: Số đồng phân của hợp chất este đơn chức có CTPT C4H8O2 tác dụng với dung dịch AgNO3/NH3 sinh ra Ag là

N

Xác định CTPT, CTCT este

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

A. 4 B. 2 C. 1 D. 3 Câu 10: Một este tạo từ axit no đơn chức và ancol no, bậc III đơn chức mạch hở. Vậy công thức chung của este đó là : A. CnH-2nO2 ( n≥5) B. CnH-2nO2 ( n≥4) C. CnH-2nO2 ( n≥3) D. CnH-2nO2 (n≥2) Câu 11: Đốt cháy hoàn toàn một lượng hỗn hợp hai este cho sản phẩm cháy qua bình đựng P2O5 dư thấy khối lượng bình tăng thêm 6,21g, sau đó cho qua dd Ca(OH)2 dư thu được 34,5g kết tủa. Các este nói trên thuộc loại: A. No, đơn chức, mạch hở B. No, đa chức, mạch hở C. Không no, đơn chức, mạch hở D. Không no, đa chức, mạch hở Câu 12: Trong thành phần nước dứa có este tạo bởi ancol isoamylic và axit isovaleric. CTPT và CTCT của este là A. C10H20O2 và (CH3)2CHCH2CH2OOCCH2CH(CH3)2 B. C9H14O2 và CH3CH2COOCH(CH3)2 C. C10H20O2 và (CH3)2CHCH2CH2COOCH2CH(CH3)2 D. C10H16O2 và (CH3)2CHCH2CH2COOCH2CH(CH3)2 Câu 13: Cho dãy chuyển hoá:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

H 2O H2 O2 C2 H 2 1500 C → X  → Y  → Z  → T  → M CH4  Công thức cấu tạo của M là A. CH3COOCH3. B. CH2 = CHCOOCH3. C. CH3COOCH = CH2. D. CH3COOC2H5. Câu 14: Đặc điểm của phản ứng thuỷ phân este trong môi trường axit là phản ứng A. Không thuận nghịch. B. Luôn sinh ra axit và ancol. C. Thuận nghịch. D. Xảy ra nhanh ở nhiệt độ thường. Câu 15: Este X có công thức phân tử là C4H8O2. Đun nóng X trong dung dịch NaOH thu được muối X1 và ancol X2. Oxi hóa X2 thu được chất hữu cơ X3. X3 không có phản ứng tráng gương. Vậy tên gọi của X là : A. Metyl propionat B. Etyl axetat C. n-propyl fomiat D. Isopropyl fomiat.

LiAlH 4 Câu 16: Chọn sản phẩm chính cho phản ứng sau: C2H5COOCH3  → A + B. A, B là: A. C2H5OH, CH3COOH B. C3H7OH, CH3OH C. C3H7OH, HCOOH D. C2H5OH, CH3OH Câu 17: Khi trùng hợp CH2=CH-COOCH3 thu được A. Polistiren.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

B. Poli(vinyl axetat) C. Poli(metyl acrylat) D. Polietilen. Câu 18: Dãy các chất sau được sắp xếp theo chiều nhiệt độ sôi tăng dần A. CH3COOC2H5, CH3CH2CH2OH, CH3COOH B. CH3COOH, CH3CH2CH2OH, CH3COOC2H5 C. CH3COOH, CH3COOC2H5, CH3CH2CH2OH D. CH3CH2CH2OH, CH3COOH, CH3COOC2H5 Câu 19: Để phân biệt các este riêng biệt: metyl axetat, vinyl fomiat, metyl acrylat, ta có thể sử dụng các thuốc thử nào sau đây? A. Dùng dung dịch NaOH, đun nhẹ, dùng dung dịch brom, dùng dung dịch H2SO4 loãng. B. Dùng dung dịch NaOH, dùng dung dịch AgNO3 trong NH3. C. Dùng dung dịch AgNO3 trong NH3, dùng dung dịch brom. D. Dùng dung dịch brom, dùng dung dịch H2SO4 loãng. Câu 20: Cho dãy các chất: HCHO, CH3COOH, CH3COOC2H5, HCOOH, C2H5OH, HCOOCH3. Số chất trong dãy tham gia phản ứng tráng gương là A. 3 B. 6 C. 4 D. 5 Câu 21: Trong phản ứng este hoá giữa ancol và một axit hữu cơ thì cân bằng sẽ chuyển dịch theo chiều tạo ra este khi ta: A. Cho ancol dư hay axit hữu cơ dư. B. Giảm nồng độ ancol hay axit hữu cơ. C. Dùng chất hút nước, chưng cất ngay để tách este. D. Cả 2 biện pháp A, C. Câu 22: Cho sơ đồ sau: C2 H 2 → C2 H 4Cl2 → X → C2 H 4O2 → CH 2 = CHOOCCH 3

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

Công thức cấu tạo của X là A. C2H4(OH)2. B. C2H5OH. C. CH3CHO. D. HOCH2CHO. Câu 23: Đun este E ( C6H12O2) với dung dịch NaOH ta được 1 ancol A không bị oxi hoá bởi CuO. E có tên là: A. Isopropyl propionat B. Isopropyl axetat C. Butyl axetat D. Tert-butyl axetat. Câu 24: Đặc điểm của phản ứng thuỷ phân este trong môi trường kiềm là A. Không thuận nghịch. B. Luôn sinh ra axit và ancol. C. Thuận nghịch. D. Xảy ra nhanh ở nhiệt độ thường. Câu 25: Một este có công thức phân tử là C4H8O2, khi thủy phân trong môi trường axit thu được rượu Y. Oxi hóa rượu Y thành anđehit Y1 sau đó cho Y1 tham gia phản ứng tráng gương thu được số mol Ag gấp 4 lần số mol Y1. Vậy tên gọi của este là : A. Metyl propionat

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. Etyl axetat C. n-propyl fomiat D. Isoproyl fomiat. +

+ H 2O , H → Y1 + Y2 Câu 26: Este X ( C4H8O2) thoả mãn các điều kiện: X 

N

+ O2 , xt Y1  → Y2

TP .Q

U

Y

N

H Ơ

X có tên là: A. Isopropyl fomiat B. Propyl fomiat C. Metyl propionat D. Etyl axetat. Câu 27: Cho sơ đồ sau:

ẠO

O2 , xt NaOH + NaOH + NaOH X (C4 H 8O2 ) → Y  T  → Z → → C2 H 6 CaO ,t o

+

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

Công thức cấu tạo thu gọn của X là A. CH3COOC2H5. B. C2H5COOCH(CH3)2. C. CH3CH2CH2COOH D. HCOOCH2CH2CH3. Câu 28: Cho este X có công thức phân tử là C4H6O4 được điều chế từ axit đơn chức A và ancol B. Đun nóng 0,1 mol X trong 200ml dung dịch NaOH 1,5M sau đó đem cô cạn cẩn thận thì thu được bao nhiêu gam chất rắn khan? A. 13,6 gam B. 15,6 gam C. 17,6 gam D. 20,4 gam Câu 29: Cho sơ đồ sau: o

o

ẤP

H 3O , t H 2 SO4 dac ,t C2 H 5OH / H 2 SO4 dac + HCN CH 3CHO  → X   → Y  → Z (C3 H 4O2 )  →T

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

Công thức cấu tạo của T là A. CH3CH2COOC2H5. B. C2H5COOCH3. C. CH2 = CHCOOC2H5. D. C2H5COOCH = CH2. Câu 30: Tính chất hoá học quan trọng nhất của este là A. Phản ứng trùng hợp. B. Phản ứng cộng. C. Phản ứng thuỷ phân. D. Tất cả các phản ứng trên. Câu 31: Thuỷ phân hoàn toàn 8,88 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,2M (vừa đủ) thu được 8,16 gam một muối Y. Tên gọi của X là A. Etyl fomat B. Etyl axetat C. Metyl axetat D. Propyl axetat Câu 32: Cho sơ đồ sau: o

2+

+ H 2O / H 3 1500 C + NaOH CH 4  M → CH 4 → X  → Y → Z → T →

Công thức cấu tạo của Z là A. C2H5OH.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

ẠO

TP .Q

U

Y

N

H Ơ

B. CH3COOH. C. CH3COOC2H5. D. Cả A, B đều đúng. Câu 33: Este X có chứa vòng benzen và có công thức phân tử là C8H8O2. Hãy cho biết X có bao nhiêu công thức cấu tạo ? A. 7 B. 4 C. 6 D. 5 Câu 34: Cho sơ đồ sau:

N

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

Công thức cấu tạo của X là A. CH2 = C(CH3) – COOC2H5. B. CH2 = CHOCOC2H5. C. CH2 = C(CH3)COOCH3. D. CH2 = CHCOOC2H5 Câu 35: Đốt cháy hoàn toàn 6,8 gam một este A no đơn chức chứa vòng benzen thu được CO2 và H2O . Hấp thụ toàn bộ sản phẩm này vào bình đựng dung dịch Ca(OH)2 lấy dư thấy khối lượng bình tăng 21,2 gam đồng thời có 40 gam kết tủa. Xác định CTPT, CTCT có thể có của A A. 2 B. 3 C. 6 D. 5

LỜI GIẢI CHI TIẾT

o

ÁN

-L

Í-

H

Ó

A

C

ẤP

Câu 1: Đáp án : B Phát biểu B không đúng. Este được tạo thành do sự thay thế nhóm -OH ở -COOH của axit cacboxylic bởi gốc hidrocacbon: R-CO-OH + H-O-R' → RCOOR' + H2O. Câu 2: Đáp án : B Giữa các phân tử este không tồn tại liên kết hidro, do đó este có nhiệt độ sôi thấp hơn ancol tương ứng. * Điều kiện để có liên kết hidro: - Có nguyên tử có độ âm điện lớn (N, O,..); Nguyên tử có độ âm điện lớn còn cặp e chưa dùng, và liên kết trực tiếp với một nguyên tử H. Câu 3: Đáp án : A

BỒ

ID Ư

Ỡ N

G

TO

t → CO2 + H2O. X + O2  nCO2 = 0,26 mol => mC = 0,26.12 = 3,12 (g) nH2O = 0,26 mol => mH = 0,26.2 = 0,52 (g) vì nCO2 = nH2O => X là este no, đơn chức CnH2nO2 BTKL => mO = 7,8 – mC – mH = 4,16 => nO = 0,26 mol 1 => nX = nO = 0,13 => n = 2. 2 => X là C2H4O2. Câu 4: Đáp án : B Este tạo ra là este no, đơn chức, mạch hở => chứa 1 liên kết π và 2 oxi => CTTQ: CnH2nO2 (n ≥ 2) Câu 5: Đáp án : B Chất 4: CH3COOH là axit axetic Chất 6: HOOC-CH2CH2OH, là một peta hy vọng axit Câu 6: Đáp án : C

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

Este tạo thành có k = 2 (một liên kết π trong C=O và một liên kết π của C=C); va có 2 oxi => CTTQ: CnH2n + 2 – 2kO2 <=> CnH2n - 2O2 (do k = 2). Ancol no nhỏ nhất có 1C, axit nhỏ nhất có liên kết C=C có 3C => n ≥ 4. Vậy công thức của este cần tìm là CnH2n - 2O2 (n ≥ 4). Câu 7: Đáp án : D Số đồng phân của este X mạch hở, có CTPT: C4H6O2 là: +) HCOOC3H5 :Có các đồng phân: HCOOCH2-CH=CH2 HCOOCH=CH-CH3 (x 2 vì Trường hợp này có đồng phân cis và trans) HCOOC=CH2 | CH3 +) CH3COOC2H3: Có một đồng phân: CH3COOCH=CH2 +) C2H3COOCH3: Có một đồng phân CH2=CH-COOCH3 . => ∑= 6 đồng phân Câu 8: Đáp án : B Theo lý thuyết về este Câu 9: Đáp án : B Este tác dụng được với AgNO3/NH3 sinh ra Ag thì este đó phải có gốc của axit fomic => có 2 đồng phân là HCOOCH2CH2CH3 và HCOOCH(CH3)2 Câu 10: Đáp án : A Este tạo ra este no, đơn chức, mạch hở => CTTQ: CnH2nO2 Axit nhỏ nhất thỏa mãn có 1C. Ancol bậc 3 nhỏ nhất thỏa mãn là có 4C: C(OH)(CH3)3 Do đó n ≥ 5 => Este: CnH2nO2 (n ≥ 5) Câu 11: Đáp án : A Theo bài thì: P2O5 hấp thụ H2O=> khối lượng bình tăng chính là khối lượng của nước. => nH2O = 0,345 mol +) Ca(OH)2 hấp thụ CO2 => nCO2 = 0,345 mol Nhận thấy : nCO2 = nH2O => Este phải no, đơn chức, mạch hở. Câu 12: Đáp án : A Ancol isoamylic là :

N

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

H Ơ

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

-L

Í-

H

Ó

Axxit isovaleric là:

TO

ÁN

=> Este có CTPT: C10H20O2 CTPT:

G

Câu 13: Đáp án : C o

BỒ

ID Ư

Ỡ N

H 2O H2 O2 1500 C → C2H2  → CH3CHO  → C2H5OH  → CH4  C2 H 2 → CH3COOCH=CH2 CH3COOH  Vậy M là CH3COOCH=CH2 Câu 14: Đáp án : C Phản ứng thủy phân este trong Môi trường axit là phản ứng thuận nghịch, xảy ra chậm. Sản phẩm sinh ra không nhất thiết là axit và ancol. Chẳng hạn: +

H CH3COOCH=CH2 + H2O → CH3COOH + CH3CHO. Câu 15: Đáp án : D X3 không có phản ứng tráng gương => X3 là xeton => X2 là ancol bậc 2. => X2 là

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

TP .Q

U

Y

N

H Ơ

N

X1 là HCOONa. => Este là HCOOCH(CH3)2: Isopropyl fomiat. Câu 16: Đáp án : B LiAlH4 khử este thành ancol tương ứng: LiAlH 4 → RCH2OH + R’CH2OH. RCOOCH2R’  Suy ra, A và B là C3H7OH và CH3OH. Câu 17: Đáp án : C CH2=CH-COOCH3 là metyl ancrylat Trùng hợp thu được: nCH2=CHCOOCH3 →

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

Ư N

G

Đ

ẠO

Polime là Poli (metyl acrylat) Câu 18: Đáp án : A Vì este không có liên kết hiđro nên sẽ có nhiệt độ sôi thấp hơn ancol, axit Câu 19: Đáp án : C Ba este là: (1) CH3COOCH3; (2) HCOOCH=CH2; (3) CH2=CH–COOCH3 Dùng AgNO3/NH3 thì chỉ (2) phản ứng. Sau đó, cho Br2 vào thì (3) làm mất màu. Câu 20: Đáp án : A Những chất tham gia tráng gương gồm: Anđehit; axit fomic hoặc este tạo bởi axit fomic => trong bài này thì: HCHO; HCOOH; HCOOCH3 tham gia phản ứng tráng gương => có 3 chất. Câu 21: Đáp án : D t o , H 2 SO4 dac  → Este + H2O Axit + Ancol ←  Để cân bằng chuyển dịch theo chiều tạo este, người ta dùng: +) H2SO4 đặc hút H2O, Chưng cất ngay để tách este +) Cho ancol dư hay axit hữu cơ dư. +) Tăng cường axit và ancol Câu 22: Đáp án : C C2H2 + 2HCl → CH3–CHCl2 (C2H4Cl2) o

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

t → CH3CHO + 2NaCl + H2O CH3-CHCl2 + 2NaOH  (X) 1 Mn2+ CH3CHO + O2  → CH3COOH. 2 CH3COOH + C2H2 → CH3COOCH = CH2. Vậy, X là CH3CHO. Câu 23: Đáp án : D Ancol A không bị oxi hóa bởi CuO => A là ancol bậc 3. Xét 4 đáp án, có D: (CH3)3–C –OOCCH3 (tert butylaxetat) thỏa mãn. Ancol tert-butylic là:

Câu 24: Đáp án : A Thủy phân este trong môi trường kiềm là phản ứng xảy ra theo một chiều, tức là không thuận nghịch. Đây còn gọi là phản ứng xà phòng hóa. Câu 25: Đáp án : A Este có 2O => là Este đơn chức. Oxi hóa Y thành anđehit nên Y là ancol đơn chức => Y1 là anđehit đơn chức. Mà 1Y1 → 4Ag => Y1 là HCHO. => Este: CH3CH2COOCH3 (metyl propionat) Câu 26: Đáp án : D

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Từ sơ đồ => X là CH3COOCH2CH3:

+

Ư N

G

Đ

ẠO

TP .Q

U

Y

N

H Ơ

N

+

+ H 2O , H → CH3COOH + C2H5OH (Y1) CH3COOCH2CH3  C2H5OH + O2 → CH3COOH (Y2). Câu 27: Đáp án : D Ta đi ngược từ cuối: CaO (T): C2H5COONa + NaOH  → C2H6 + Na2CO3. to (Z): C2H5COOH + NaOH → C2H5COONa + H2O (Y): C2H5CH2OH + O2 → C2H5COOH + H2O (X): HCOOCH2CH2CH3 + NaOH → HCOONa + CH3CH2CH2OH. Câu 28: Đáp án : C Este C4H6O4 có k = 2, lại chứa 4 oxi nên là este 2 chức => Este là: HCOOCH2CH2OOCH. X + 2NaOH → 2HCOONa + HOCH2CH2OH. bđ 0,1 0,3 pư 0,1 0,2 0,2 0,1 mol dư 0,1 =>chất rắn gồm HCOONa và NaOH dư => Chất rắn = 0,2.68 + 0,1. 40 = 17,6 g (hay áp dụng bảo toàn khối lượng=> chất rắn = 0,1.118 + 0,3.40 – 0,1.62 = 17,6 (g)) Câu 29: Đáp án : C o

o

-L

Í-

H

Ó

A

C

ẤP

2+

3

10

00

B

TR ẦN

www.daykemquynhon.ucoz.com

H

+ HCN H 3O , t H 2 SO4 dac ,t CH3CHO  → CH3-CH(OH)-C ≡ N   → CH3-CH(OH)-COOH  → CH2 = CH – C2 H 5OH / H 2 SO4 dac COOH → CH2 = CHCOOC2H5. Câu 30: Đáp án : C Mọi este đều có phản ứng thủy phân. Phản ứng thủy phân trong kiềm còn gọi là phản ứng xà phòng hóa. Câu 31: Đáp án : A Ta có: nNaOH = 0,12 => neste = n muối = 0,12 mol 8,88 => Meste = = 74 (C3H6O2) 0,12 8,16 M muối = = 68 (HCOONa) 0,12 => Este: HCOOCH2CH3 (etyl fomat) Câu 32: Đáp án : D CH4 C2H2 CH3CHO (Y)

ÁN

(Y): CH3CHO + NaOH CH4 CH3COONa → CaO ,t o

BỒ

ID Ư

Ỡ N

G

TO

(M) Vậy Z có thể là C2H5OH hoặc CH3COOH. Câu 33: Đáp án : C Este X có chứa vòng benzen và có CTPT: C8H8O2 là:

HCOO – CH2 (hay HCOO – CH2 – C6H5) CH3-COO – C6H5 C6H5 – COO – CH3.

=> Tổng có 6 đồng phân. => Đáp án C.

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N

H Ơ

N

Dang bài này lúc đầu đọc thì thấy đơn giản nhưng khi viết cụ thể các đồng phân thì không ít bạn đã làm sai do viết thiếu công thức. Câu 34: Đáp án : A X là CH2 = C(CH3) – COOC2H5

Y U TP .Q ẠO Đ G Ư N H TR ẦN

10

00

B

www.daykemquynhon.ucoz.com

CH2 = C(CH3)COOC2H5 Câu 35: Đáp án : C Ta có: mCaCO3 = 40 => nCO2 = 0,4 mol. m bình tăng = mCO2 + mH2O => mH2O = 3,6 => nH2O = 0,2 mol. => mO (trong este) = 6,8 – 0,4.12 – 0,2.2 = 1,6 => nO = 0,1 Ta có: C: H: O = 0,4 : 0,4 : 0,1 = 4 : 4 : 1 = 8 : 8 : 2 => Este là C8H8O2. Các đồng phân: HCOO – CH2 – C6H5 CH3-COO – C6H5 C6H5 – COO – CH3.

BỒ

ID Ư

Ỡ N

G

TO

ÁN

-L

Í-

H

Ó

A

C

ẤP

2+

3

=>Có 6 đồng phân

Tổng hợp bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial

Profile for Dạy Kèm Quy Nhơn Official

TỔNG HỢP ĐỀ CHUYÊN ĐỀ LÝ THUYẾT VÀ BÀI TẬP ESTE - LIPIT - XÀ PHÒNG TỪ VẬN DỤNG THẤP ĐẾN CAO  

"TỔNG HỢP ĐỀ CHUYÊN ĐỀ LÝ THUYẾT VÀ BÀI TẬP ESTE - LIPIT - XÀ PHÒNG TỪ VẬN DỤNG THẤP ĐẾN CAO CHUẨN BỊ CHO KÌ THI THPT QG 2017" LINK DOCS.GOO...

TỔNG HỢP ĐỀ CHUYÊN ĐỀ LÝ THUYẾT VÀ BÀI TẬP ESTE - LIPIT - XÀ PHÒNG TỪ VẬN DỤNG THẤP ĐẾN CAO  

"TỔNG HỢP ĐỀ CHUYÊN ĐỀ LÝ THUYẾT VÀ BÀI TẬP ESTE - LIPIT - XÀ PHÒNG TỪ VẬN DỤNG THẤP ĐẾN CAO CHUẨN BỊ CHO KÌ THI THPT QG 2017" LINK DOCS.GOO...

Advertisement