Page 1

TÀI LIỆU, CHUYÊN ĐỀ LỚP 12 MÔN HÓA HỌC

vectorstock.com/7471064

Ths Nguyễn Thanh Tú eBook Collection DẠY KÈM QUY NHƠN TEST PREP PHÁT TRIỂN NỘI DUNG

1200 Bài tập trắc nghiệm Este - Lipit HÓA HỌC 12 (cơ bản - nâng cao) có giải chi tiết WORD VERSION | 2020 EDITION ORDER NOW / CHUYỂN GIAO QUA EMAIL TAILIEUCHUANTHAMKHAO@GMAIL.COM

Tài liệu chuẩn tham khảo Phát triển kênh bởi Ths Nguyễn Thanh Tú Đơn vị tài trợ / phát hành / chia sẻ học thuật : Nguyen Thanh Tu Group Hỗ trợ trực tuyến Fb www.facebook.com/DayKemQuyNhon Mobi/Zalo 0905779594


Bài tập trắc nghiệmbài tập chương Este - Lipit 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 1) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 2) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 3) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 4) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 1) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 2) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 3) 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 4)

Bài tập trắc nghiệmbài tập chương Este - Lipit 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 1)

Câu 1: Hợp chất este là A. CH3CH2Cl. C. CH3CH2NO3.

B. HCOOC6H5. D. C2H5COOH.

Hiển thị đáp án Nhóm chức của este là – COOR (R là gốc hiđrocacbon ) → HCOOC6H5 là este → Đáp án B Câu 2: Chất không phải là este là A. HCOOCH=CH2. C. CH3COOH. Hiển thị đáp án

B. HCOOCH3. D. CH3COOCH3.


Nhóm chức của este là –COOR (R là ggốc hiđrocacbon) → HCOOCH = CH2, HCOOCH3, CH3COOCH3 đều là este → Loại đáp án A, B, D → CH3COOH không là este → Đáp án C Câu 3: Chất không phải là este là B. C2H5CHO.

A. HCOOC2H5.

C. CH3COOCH = CH2.

D.

Hiển thị đáp án HCOOC2H5 và CH3COOCH = CH2 là este đơn chức → Loại đáp án A, C

là este 2 chức → Loại đáp án D C2H5CHO là anđêhit → C2H5CHO không phải là este → Đáp án B

ng quát củ của este no, đơn chức, mạch hở là Câu 4: Công thức tổng A. CnH2nO (n ≥ 1). C. CnH2nO2 (n ≥ 2).

B. CnH2nO2 (n ≥ 1). D. CnH2nO3 (n ≥ 2).

Hiển thị đáp án Công thức tổng quát củaa este no, đơn chức, mạch hở là CnH2nO2 (n ≥ 2) → Đáp án C Câu 5: Trong công thứcc phân ttử este no, đơn chức, mạch hở có số liên kết π là A. 1.

B. 2.

C. 3.

D. 0.

Hiển thị đáp án


Este no, đơn chức, mạch hở (CnH2nO2) có k = 1 → có 1 liên kết π (trong nhóm – COO –) → Đáp án A

ng phân este có công th thức phân tử C3H6O2 là Câu 6: Số đồng A. 1.

B. 2.

C. 3.

D. 4.

Hiển thị đáp án C3H6O2 có k = 1 → este no, đơn chức, mạch hở

ng phân este có công th thức phân tử C3H6O2 là → Các đồng 1. HCOOCH2CH3

2. CH3COOCH3

→ Có 2 đồng phân este → Đáp án B Câu 7: Ứng với công thứcc phân ttử C4H6O2 có số este mạch hở là A. 4.

B. 3.

C. 5.

D. 6.

Hiển thị đáp án C4H6O2 có k = 2 → este không no, có chứa liên kết đôi C = C, đơn chức, mạch ạch hở

ở ccủa C4H6O2 là → Các đồng phân este mạch hở

→ Có 5 đồng phân este → Đáp án C


m 36,36% khối kh lượng. Câu 8: Trong phân tử este X no, đơn chức, mạch hở, oxi chiếm a mãn công thức phân tử của X là Số công thức cấu tạo thỏa A. 2.

B. 3.

C. 4.

D. 5.

Hiển thị đáp án Este no, đơn chức, mạch hở (CnH2nO2) có

→ Công thức phân tử củaa este X là C4H8O2 → Các công thức cấu tạo củaa este X là

→ Có 4 công thức cấu tạo → Đáp án C

c phân tử là C8H8O2 là Câu 9: Số đồng phân là este, có chứa vòng benzen, có công thức A. 9.

B. 8.

C. 7.

D. 6.

Hiển thị đáp án C8H8O2 có k = 5

ứa vòng benzen (gồm 1 vòng và 3 liên kết π), có công thức phân → Các đồng phân là este, có chứ tử là C8H8O2 là


→ Có 6 đồng phân → Đáp án D Câu 10: Este của glixerol với ới axit cacboxylic (RCOOH) được một số ố học ọc sinh viết vi như sau:

(2) (RCOO)2C3H5(OH)

(1) (RCOO)3C3H5

(4) (ROOC)2C3H5(OH)

(3) RCOOC3H5(OH)2 (5) C3H5(COOR)3. Công thức đã viết đúng là A. (1), (4). C. (1), (5), (4).

B. (5).

D. (1), (2), (3).

Hiển thị đáp án Este của glixerol vớii axit cacboxylic (RCOOH) có ddạng (RCOO)nC3H5(OH)3-n → Vậy các este đó có thể là RCOOC3H5(OH)2; (RCOO)2C3H5(OH); (RCOO)3C3H5 → Các công thức viết đúng là (1), (2), (3) → Đáp án D Câu 11: Công thức phân tử ử nào sau đây không thể của este. A. C4H8O2.

B. C4H10O2.

C. C2H4O2.

D. C4H6O2.

Hiển thị đáp án


este có dạng: CnH2n+2-2kO2 (k ≥ 1) → Đáp án B Câu 12: Chất béo động vật hầu hết ở thể rắn là do chứa A. chủ yếu gốc axit béo không no B. glixerol trong phân tử C. chủ yếu gốc axit béo no. D. gốc axit béo. Hiển thị đáp án → Đáp án C Câu 13: Từ dầu thực vật làm thế nào để có được bơ? A. Hidro hóa a xit béo. B. Đehidro hóa chất béo lỏng. C. Hidro hóa chất béo lỏng. D. Xà phòng hóa chất béo lỏng. Hiển thị đáp án → Đáp án C Câu 14: Chọn phát biểu đúng?Chọn phát biểu đúng? A. Chất béo là trieste của glixerol với axit. B. Chất béo là triete của glixerol với axit vô cơ. C. Chất béo là trieste của glixe rol với axit béo D. Chất béo là trieste của ancol với a xit béo. Hiển thị đáp án → Đáp án C


n hóa ch chất béo lỏng sang chất béo rắn nhờ phản ản ứng? ứ Câu 15: Có thể chuyển A. Tách nước

B. Hidro hóa.

C. Đề hiđro hóa

D. Xà phòng hóa.

Hiển thị đáp án → Đáp án B Câu 16: Phản ứng nào sau đây dùng để điều chế xà phòng?

dịch kiềm. A. Đun nóng axit béo vớii dung d B. Đun nóng glixerol vớii các axit béo.

dịch kiề m. C. Đun nóng chất béo vớii dung d D. Cả A, C đều đúng. Hiển thị đáp án → Đáp án C Câu 17: Phản ứng tương ng tác của ancol và axit tạo thành este có tên gọi là gì? A. Phản ứng trung hòa

B. Phản ứng ngưng tụ.

C. Phản ứng este hóa.

D. Phản ứng kết hợp.

Hiển thị đáp án

thức phân tử là C4H6O2 khi thủy y phân trong môi trường axit Câu 18: Mộtt este có công thứ imetyl xeton. Công th thức cấu tạo thu gọn của C4H6O2 là công thức nào? thu được đimetyl A. HCOOCH=CHCH3

B. CH3COOCH=CH2.

C. HCOOC(CH3)=CH2

D. CH2=CHCOOCH3.

Hiển thị đáp án

→ Đáp án C Câu 19: Este etyl fomat có công thức là


A. CH3COOCH3. C. HCOOCH=CH2.

B. HCOOC2H5. D. HCOOCH3.

Hiển thị đáp án Etyl: CH3CH2 – Fomat: HCOO – → Este etyl fomat có công thức là HCOOC2H5 → Đáp án B Câu 20: Este vinyl axetat có công thức là A. CH3COOCH = CH2.

B. CH3COOCH3.

C. CH2 = CHCOOCH3.

D. HCOOCH3.

Hiển thị đáp án axetat : CH3COO vinyl: CH2 = CH → Este vinyl axetat có công thức là CH3COOCH=CH2 → Đáp án A Câu 21: Công thức hóa học của metyl axetat là A. C2H5COOCH3.

B. CH3COOC2H5.

C. CH3COOCH3.

D. HCOOCH3.

Hiển thị đáp án → Đáp án C Câu 22: Cho este có công thức cấu tạo: CH2 = C(CH3)COOCH3. Tên gọi của este đó là A. Metyl acrylat. C. Metyl metacrylic.

B. Metyl metacrylat. D. Metyl acrylic.


Hiển thị đáp án Câu 23: Etse X có công thức cấu tạo CH3COOCH2-C6H5 (C6H5- : phenyl). Tên gọi của X là: A. metyl benzoat. C. benzyl axetat

B. phenyl axetat. D. phenyl axetic.

Hiển thị đáp án → Đáp án C Câu 24: Công thức cấu tạo thu gọn nào sau đây biểu thị một chất béo? A. (C17H35COO)3C3H5. C. C3H5COOC2H5.

B. CH3COOC2H5. D. (CH3COO)3C3H5.

Hiển thị đáp án → Đáp án A Câu 25: Công thức của triolein là: A. (CH3[CH2]16COO)3C3H5. B. (CH3[CH2]7CH=CH[CH2]5COO)3C3H5. C. (CH3[CH2]7CH=CH[CH2]7COO)3C3H5. D. (CH3[CH2]14COO)3C3H5. Hiển thị đáp án → Đáp án C Câu 26: Chất X có công thức phân tử là C4H8O2 là este có phản ứng tráng gương. Gọi tên các công thức cấu tạo của X. A. Propyl fomat, metyl acrylat. B. Metyl metacrylat, isopropyl fomat . C. Metyl metacrylic, isopropyl fomat.


D. Isopropyl fomat, propyl fomat. Hiển thị đáp án mạch hở. C4H8O2 có → este no đơn chức, m

Những chất chứa nhóm chức

thì có phản ứng tráng gương

ng HCOOR (R là gốc X có phản ứng tráng gương → X là este của axit fomic → X có dạng hiđrocacbon) → Các công thức cấu tạo củaa X là 1. HCOOCH2CH2CH3: propyl fomat 2. HCOOCH(CH3)2: isopropyl fomat → Đáp án D Câu 27: Mộtt este có công thứ thức phân tử là C3H6O2 có phản ứng ng tráng gương với dung dịch AgNO3 trong NH3. Công thức cấu tạo của este đó là công thức nào? A. HCOOC2H5.

B. CH3COOCH3.

C. HCOOC3H7.

D. C2H5COOCH3

Hiển thị đáp án → Đáp án A

nh chất gì? Câu 28: khi thủyy phân este vinyl axetat trong môi trường axit thu được những A. Axit a xetic và ancol vinylic. B. Axit axet ic và anđehit ehit axetic C. A xit axet ic và ancol etylic. D. Axit axetic và ancol vinylic. Hiển thị đáp án vinyl axetat: CH3COOCH=CH2


CH3COOCH=CH2 + H2O ⇆ CH3COOH + CH3CHO → Đáp án B Câu 29: Đặc điểm nào sau đây không đúng khi nói về metyl fomat là. A. Có CTPT C2H4O2. B. Là đồng đẳng của axit axetic. C. Là đồng phân của axit axetic. D. Là hợp chất este. Hiển thị đáp án → Đáp án B Câu 30: Một este có công thức phân tử là C4H8O2, khi thủy phân trong môi trường axit thu được ancol etylic . Công thức cấu tạo của C4H8O2 là A. C3H7COOH.

B. CH3COOC2H5.

C. HCOOC3H7.

D. C2H5COOCH3

Hiển thị đáp án Este C4H8O2 khi thủy phân trong môi trường axit thu được ancol etylic → Este C4H8O2 có CTCT: CH3COOC2H5 PT thủy phân: CH3COOC2H5 + H2O ⇆ CH3COOH + C2H5OH. → Đáp án B Câu 31: Glixerin đun với hỗn hợp CH3COOH và HCOOH ( xúc tác H2SO4 đặc) có thể được tối đa bao nhiêu trieste (este 3 lần este)? A. 3.

B. 4.

C. 5.

D. 6.

Hiển thị đáp án Kí hiệu CH3COOH là 1, HCOOH là 2


→ Đáp án D Câu 32: Để phân biệtt các este riêng biệt: vinyl axetat, etyl fomiat, metyl acrylat ta có thể tiến hành theo trình tự nào sau đây?

ch NaOH loãng , đun nhẹ, dùng dung dịch Br2, dùng dung dịch A. Dùng dung dịch H2SO4 loãng B. Dùng dung dịch Br2, dung dịch NaOH, dùng Ag2O/NH3 C. Dùng Ag2O/NH3, dùng dung dịch Br2, dùng dung dịch H2SO4 loãng D. Tất cả đều đúng. Hiển thị đáp án ng giữ giữa rượu etylic và axit axetic thì cân bằng ng sẽ chuyển dịch Câu 33: Trong phản ứng theo chiều thuận tạo este khi A. cho dư rượu etylic hoặc dư axit axet ic. B. dùng H2SO4 đặc để hút nước C. chưng cất ngay để lấy este ra. D. cả 3 biện pháp A,B,C. Hiển thị đáp án → Đáp án D Câu 34: Thuỷ phân este C4H6O2 trong môi trường axít ta được một hỗn ỗn hợp hợ 2 chất hữu

ương, công thức cấu tạo của este đó là cơ đều có phản ứng tráng gươ A. CH3COO-CH=CH2.

B. HCOO-CH2-CH=CH2.


C. CH3-CH=CH-OCOH.

D. CH2= CH-COOCH3.

Hiển thị đáp án C4H6O2 có k = 2 → C4H6O2 là este có chứa 1 liên kết π trong gốc hidrocacbon → Este đó: CH3CH=CH-OCOH CH3-CH=CH-OCOH + H2O ⇆ HCOOH + CH3CH2CHO HCOOH và CH3CH2CHO đều có PƯ tráng gương. → Đáp án C Câu 35: Thực hiện phản ứng este hoá giữa axit ađipic {HOOC-(CH2)4-COOH} với ancol đơn chức X thu được este Y1 và Y2 trong đó Y1 có công thức phân tử là C8H14O4. Hãy lựa chọn công thức đúng của X. A. CH3OH.

A. CH3OH.

B. C2H5OH. C. C3H5OH.

D. Cả A, B.

B. C2H5OH.

C. C3H5OH.

D. Cả A, B.

Hiển thị đáp án X: CH3OH hoặc C2H5OH HOOC-(CH2)4-COOH + 2CH3OH ⇆ CH3OCO-(CH2)4-COOCH3 (Y1) + 2H2O HOOC-(CH2)4-COOH + C2H5OH ⇆ HOOC-(CH2)4-COOC2H5 (Y1) + 2H2O → Đáp án D Câu 36: Đun nóng glixerin với axit hữu cơ đơn chức X thu được hỗn hợp các este trong đó có một este có công thức phân tử là C6H8O6. Lựa chọn công thức đúng của X. A. HCOOH. C. CH2=CH-COOH.

B. CH3COOH. D. CH3CH2COOH.

Hiển thị đáp án C6H8O6 có k = 2 → C6H8O6 là este 3 chức, no, không có liên kết π trong gốc hidrocacbon → X là HCOOH C3H5(OH)2 + HCOOH ⇆ C3H5(OCOH)3 + H2O.


→ Đáp án A Câu 37: Đun nóng este đơn chức X với NaOH thu được một muối và một anđehit. Hãy cho biết công thức chung nào thoả mãn? A. HCOOR B. R-COO-CH=CH-R’ C. R-COO-C(R)=CH2 D. Đáp án khác. Hiển thị đáp án Đun nóng este đơn chức X với NaOH thu được một muối và một anđehit → X có dạng RCOOCH=CH–R’ (R, R’ có thể là H hoặc gốc hiđrocacbon) PT tổng quát: RCOOCH=CH–R’ + NaOH -t → RCOONa + R’CH2CHO. o

→ Đáp án B Câu 38: Khi đun nóng chất hữu cơ X với NaOH thu được etilenglicol (HO-CH2-CH2OH) và muối natri axetat. Hãy lựa chọn công thức cấu tạo đúng của X. A. CH3COOCH2-CH2OH B. (CH3COO)2CH-CH3 C. CH3COOCH2-CH2-OOC-CH3 D. Cả A và C. Hiển thị đáp án CH3COOCH2-CH2OH + NaOH -t → CH3COONa(natri axetat) + HO-CH2-CH2-OH(etilenglicol) o

→ Đáp án A Câu 39: Cho a xit X có công thức là HOOC-CH2-CH(CH3)-COOH tác dụng với rượu etylic (xúc tác H2SO4 đặc) thì thu được bao nhiêu este ? A. 1.

B. 2.


C. 3.

D. 4.

Hiển thị đáp án Có 3 este có thể tạo thành là C2H5OOC-CH2-CH(CH3)-COOC2H5; HOOC-CH2-CH(CH3)COOC2H5; C2H5OOC-CH2-CH(CH3)-COOH. → Đáp án C Câu 40: So với các axit, ancol phân tử có cùng số nguyên tử cacbon thì este có nhiệt độ sôi và độ tan trong nước A. thấp hơn do khối lượng phân tử của este nhỏ hơn nhiều. B. thấp hơn do giữa các phân tử este không tồn tại liên kết hiđro. C. cao hơn do giữa các phân tử este có liên kết hiđro bền vững. D. cao hơn do khối lượng phân tử của este lớn hơn nhiều. Hiển thị đáp án So với các axit, ancol phân tử có cùng số nguyên tử cacbon thì este có nhiệt độ sôi và độ tan trong nước thấp hơn hẳn là do este không tạo được liên kết hiđro giữa các phân tử este với nhau và khả năng tạo liên kết hiđro giữa các phân tử este với các phân tử nước rất kém (SGK lớp 12 cơ bản – trang 4, 5) → Đáp án B 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 2)

Câu 41: Dãy các chất được sắp xếp theo chiều nhiệt độ sôi tăng dần là A. CH3COOC2H5, CH3[CH2]2CH2OH, CH3[CH2]2COOH. B. CH3[CH2]2COOH, CH3[CH2]2CH2OH , CH3COOC2H5. C. CH3[CH2]2COOH, CH3COOC2H5, CH3[CH2]2CH2OH. D. CH3[CH2]2CH2OH, CH3[CH2]2COOH , CH3COOC2H5. Hiển thị đáp án Nhiệt độ sôi theo thứ tự: este < ancol < axit (có cùng số nguyên tử C trong phân tử)


→ Nhiệt độ sôi: CH3COOC2H5 < CH3[CH2]2CH2OH < CH3[CH2]2COOH → Đáp án A Câu 42: Trong số các chất dưới đây chất có nhiệt độ sôi thấp nhất là A. CH3COOH

B. C6H5NH2

C. HCOOCH3

D. C2H5OH

Hiển thị đáp án Các chất có khối lượng phân tử tương đương, dựa vào khả năng liên kết H liên phân tử và với H2O: càng tạo liên kết H mạnh thì nhiệt độ sôi càng cao - Este không tạo được liên kết H như 3 chất còn lại → Đáp án C Câu 43: Một số este được dùng trong hương liệu trong công nghiệp thực phẩm, mĩ phẩm là nhờ các este A. là chất lỏng dễ bay hơi. B. có mùi thơm, không độc, an toàn với người. C. có thể bay hơi nhanh sau khi sử dụng. D. đều có nguồn gốc từ thiên nhiên. Hiển thị đáp án Một số este có mùi thơm, không độc được làm chất tạo hương trong công nghiệp thực phẩm ( benzyl fomat, etyl fomat, …), mĩ phẩm (linalyl axetat, geranyl axetat, …), … (SGK lớp 12 cơ bản – trang 7) → Đáp án B Câu 44: Cho hỗn hợp ancol CH3OH và C2H5OH phản ứng với hỗn hợp 2 axit CH3COOH, HCOOH. Số loại este được tạo ra tối đa là bao nhiêu? A. 1.

B. 2.

C. 3.

D. 4.


Hiển thị đáp án Phương trình hóa học:

→ có 4 loại este được tạoo ra : CH3COOCH3, CH3COOC2H5, HCOOCH3, HCOOC2H5 → Đáp án D Câu 45: Từ các ancol C3H8O và các axit C4H8O2 có thể tạo ra số este là đồng phân cấu tạo của nhau là A. 3.

B. 5.

C. 4.

D. 6.

Hiển thị đáp án C4H8O2 có k = 1 → axit no đơn chức, mạch hở. → Các axit là: CH3CH2CH2COOH, CH3CH(CH3)COOH C3H8O có k = 0 → ancol no đơn chức, mạch hở. → Các ancol là: CH3CH2CH2OH, CH3CH(OH)CH3 → Đồng phân este được tạoo ra từ các axit và các ancol trên là:

→ Có 4 đồng phân → Đáp án C


n thích hợp hợ ta thu được Câu 46: Khi cho axit axetic phản ứng với axetilen ở điều kiện este có công thức là A. CH2 = CHCOOCH3. C. CH3COOCH2CH3.

B. CH3COOCH = CH2.

D. HCOOCH2CH3.

Hiển thị đáp án Phương trình hóa học:

→ Đáp án B Câu 47: Metyl acrylat được điề điều chế từ axit và rượu lần lượt là A. CH2 = C(CH3)COOH và C2H5OH. B. CH2 = CHCOOH và C2H5OH. C. CH2 = C(CH3)COOH và CH3OH. D. CH2 = CHCOOH và CH3OH. Hiển thị đáp án ừ axit acrylic (CH2=CHCOOH) và rượu u metylic (CH3OH) Metyl acrylat được điều chế từ Phương trình hóa học:

→ Đáp án D

c), thu được 2,2 gam Câu 48: Đun 3 gam CH3COOH với C2H5OH dư (xúc tác H2SO4 đặc), ủa ph phản ứng este hóa tính theo axit là CH3COOC2H5. Hiệu suất của A. 20,75%.

B. 50,00%.

C. 36,67%.

D. 25,00%.

Hiển thị đáp án


→ Đáp án B

m HCOOH và CH3COOH (tỉ lệ mol 1:1). Lấy y 5,3 gam hỗn h hợp X Câu 49: Hỗn hợp X gồm c m gam hỗn h hợp este tác dụng với 5,75 gam C2H5OH (xúc tác H2SO4 đặc) thu được (hiệu suất của các phản ứng este hóa đều bằng 80%). Giá trị m là A. 10,12.

B. 6,48.

C. 8,10.

D. 16,20.

Hiển thị đáp án m HCOOH: CH3COOH (1:1) là RCOOH với R = 8 Coi hỗn hợp X gồm Phương trình hóa học :

→ axit hết → nRCOOC H = nX = 0,1 mol. 2

5

ng este hóa đều đạt 80% nên thực tế: Vì hiệu suất các phản ứng nRCOOC H = 0,1.80% = 0,08 mol → m = 0,08.(8+ 44 + 29) = 6,48 gam 2

5

→ Đáp án B Câu 50: Phát biểu đúng là A. Phản ứng giữa axit và ancol có mặt H2SO4 đặc là phản ứng một chiều. ều.

n phẩm cuối cu cùng là B. Tất cả các este phản ứng vvới dung dịch kiềm luôn thu được sản muối và ancol. C. Khi thuỷ phân chất béo luôn thu được C2H4(OH)2.


D. Phản ứng thuỷ phân este trong môi trường axit là phản ứng thuận nghịch. Hiển thị đáp án Câu 51: Công thức tổng quát của este được tạo thành từ axit không no có 1 nối đôi, đơn chức và ancol no, đơn chức là A. CnH2n-1COOCmH2m+1.

B. CnH2n-1COOCmH2m-1.

C. CnH2n+1COOCmH2m-1.

D. CnH2n+1COOCmH2m+1.

Hiển thị đáp án → Đáp án A Câu 52: Trong phân tử este no, đơn chức có số liên kết pi là : A. 0

B. 1 `

C. 2

D. 3

Hiển thị đáp án → Đáp án B Câu 53: CTPT của este X mạch hở là C4H6O2 . X thuộc loại este: A. No, đa chức B. Không no,đơn chức. C. No, đơn chức. D. Không no, có một nối đôi, đơn chức. Hiển thị đáp án C4H6O2 có k = 2 → C4H6O2 là este không no, có một nối đôi, đơn chức. → Đáp án D Câu 54: Phát biểu nào dưới đây đúng A. Este là sản phẩm của phản ứng giữa axit và ancol. B. Hợp chất CH3COOC2H5 thuộc loại este.


C. Phản ứng thủy phân este gọi là phản ứng xà phòng hóa. D. Phản ứng thủy phân este trong môi trường kiềm là phản ứng thuận nghịch. Hiển thị đáp án A. Sai vì một số este có phương pháp điều chế riêng. Ví dụ CH3COOCH=CH2 được điều chế bằng phản ứng cộng hợp giữa axit axetic và axetilen (SGK lớp 12 cơ bản – Trang 6): PTHH: CH3COOH + CH≡CH -t , xt→ CH3COOCH=CH2. o

C. Sai vì phản ứng thủy phân este trong môi trường kiềm gọi là phản ứng xà phòng hóa D. Sai vì phản ứng thủy phân este trong môi trường kiềm là phản ứng một chiều. → Đáp án B Câu 55: Este X có các đặc điểm sau : - Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau; - Thuỷ phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z (có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X). Phát biểu nào dưới đây không đúng ? A. Chất X thuộc loại este no, đơn chức. B. Chất Y tan vô hạn trong nước. C. Đun Z với dd H2SO4 đặc ở 170oC thu được anken. D. Đốt cháy hoàn toàn 1 mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O. Hiển thị đáp án +) Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau → X là este no đơn chức. +) Thuỷ phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z (có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X) → Y là HCOOH, Z là CH3OH, X là HCOOCH3. → Đáp án C


Câu 56: Thủy phân este X trong môi trường kiềm, thu được natri axetat và rượu etylic. Công thức cấu tạo của X là: A. CH3COOC2H5.

B. C2H5COOCH3.

C. C2H3COOC2H5

D. CH3COOCH3.

Hiển thị đáp án → Đáp án A Câu 57: Có bao nhiêu đồng phân cấu tạo este mạch hở có CTPT là C5H8O2 khi thủy phân tạo ra một axit và một anđehit là A. 2.

B. 3.

C. 4.

D. 5.

Hiển thị đáp án C5H8O2 có k = 2 → C5H8O2 là este đơn chức chứa 1 liên kết đôi. → Các đồng phân cấu tạo este mạch hở có CTPT là C5H8O2 khi thủy phân tạo ra một axit và một anđehit là: 1. HCOOCH=CHCH2CH3 2. HCOOCH=C(CH3)2 2. CH3COOCH=CHCH3 3. CH3CH2COOCH=CH2 → Đáp án C Câu 58: Cho các cặp chất: (1) CH3COOH và C2H5CHO; (2) C6H5OH và CH3COOH; (3) C6H5OH và (CH3CO)2O; (4) CH3COOH và C2H5OH; (5) CH3COOH và CH≡CH; (6) C6H5COOH và C2H5OH. Những cặp chất nào tham gia phản ứng este hoá ? A. (1), (2), (3), (4), (5). B. (2), (3), (4), (5), (6). C. (2), (4), (5), (6). D. (3), (4), (5), (6). Hiển thị đáp án


Những cặp chất nào tham gia phản ứng este hoá là: (3): C6H5OH + (CH3CO)2O → CH3COOC6H5 + CH3COOH Chú ý: Để điều chế este của phenol không dùng axit cacboxylic mà phải dùng anhidrit axit hoặc clorua axit. (4) CH3COOH + C2H5OH ⇆ CH3COOC2H5 + H2O. (5) CH3COOH + CH≡CH -t , xt→ CH3COOCH=CH2. o

(6) C6H5COOH + C2H5OH ⇆ C6H5COOC2H5 + H2O. → Đáp án D Câu 59: Biện pháp nào dưới đây được dùng để nâng cao hiệu suất phản ứng este hoá A. Thực hiện trong môi t rường kiềm. B. Chỉ dùng H2SO4 đặc làm xúc tác. C. Lấy dư 1 trong 2 chất đầu hoặc giảm nồng độ các sản phẩm đồng thời dùng H2SO4 đặc làm xúc tác và chất hút nước. D. Thực hiện trong môi trường axit đồng thời hạ thấp nhiệt độ. Hiển thị đáp án → Đáp án C Câu 60: Chất X có CTPT là C4H8O2. X tác dụng với dd NaOH sinh ra chất Y có công thức C2H3O2Na. CTCT thu gọn của X là A. HCOOC3H7. C. C2H5COOCH3

B. CH3COOC2H5 D. HCOOC3H5

Hiển thị đáp án → Đáp án B Câu 61: Cho các đồng phân mạch hở có CTPT là C2H4O2 tác dụng với: dd NaOH, Na, dd AgNO3/NH3 thì số phản ứng xảy ra là


A. 3.

B. 4.

C. 5.

D. 6.

Hiển thị đáp án Các đồng phân mạch hở của C2H4O2 là: CH3COOH, HCOOCH3, CH2OHCHO. +) CH3COOH phản ứng được với NaOH, Na CH3COOH + NaOH -t → CH3COONa + H2O o

CH3COOH + Na → CH3COONa + 1/2 H2 +) HCOOCH3 phản ứng được với NaOH, dd AgNO3/NH3 HCOOCH3 + NaOH -t → HCOONa + CH3OH o

HCOOCH3 + 2AgNO3 + 3NH3 + H2O → 2Ag↓ + 2NH4NO3 + NH4OCOOCH3 +) CH2OHCHO phản ứng được với Na và dd AgNO3/NH3. CH2OHCHO + Na → NaOCH2CHO + 1/2 H2 CH2OHCHO + 2AgNO3 + 3NH3 + H2O → 2Ag↓ + CH2OHCOONH4 + 2NH4NO3 → Đáp án D Câu 62: Sắp xếp theo chiều tăng nhiệt độ sôi của các chất sau đây: A. HCOOCH3 < CH3COOH < CH3CH2OH B. HCOOCH3 < CH3CH2OH < CH3COOH. C. CH3COOH < CH3CH2OH < HCOOCH3. D. CH3CH2OH < HCOOCH3 < CH3COOH. Hiển thị đáp án Thứ tự nhiệt độ sôi của các axit, ancol, este có cùng số C là: este < ancol < axit (Do giữa các nguyên tử este không có liên kết H, liên kết H trong axit bền hơn trong ancol) → Thứ tự sắp xếp đúng là: HCOOCH3 < CH3CH2OH < CH3COOH.


→ Đáp án B Câu 63: Axit nào sau đây là axit béo? A. Axit glutamic. C. Axit axetic.

B. Axit stearic. D. Axit ađipic.

Hiển thị đáp án → Đáp án B Câu 64: Công thức phân tử của tristearin là A. C54H104O6

B. C57H104O6

C. C54H98O6

D. C57H110O6

Hiển thị đáp án → Đáp án D Câu 65: Dãy các axít béo là A. axit axetic, axit acrylic, axit stearic. B. axit panmitic, axit oleic, axit propionic. C. axit axetic, axit stearic, axit fomic. D. axit panmitic, axit oleic, axit stearic. Hiển thị đáp án Axit axetic, axit acrylic, axit propionic, axit fomic đều không phải là axit béo → Loại đáp án A, B, C. → Dãy axit béo là: axit panmitic, axit oleic, axit stearic → Đáp án D Câu 66: Công thức phân tử của axit linoleic là? A. C8H36O2. C. C18H32O2.

B. C18H34O2. D. C16H32O2.


Hiển thị đáp án → Đáp án C Câu 67: Công thức phân tử của triolein là: A. C57H110O6.

B. C57H98O6.

C. C51H98O6.

D. C57H104O6.

Hiển thị đáp án → Đáp án D Câu 68: Đun nóng glixerol với axit cacboxylic RCOOH trong H2SO4 đặc làm xúc tác thu được este X. Công thức cấu tạo của X là: (a) (RCOO)3C3H5; (c) (HO)2C3H5OOCR;

(b) (RCOO)2C3H5(OH); (d) (ROOC)2C3H5(OH);

(e) C3H5(COOR)3. Số công thức đúng là: A. 1.

B. 2.

C. 3.

D. 4.

Hiển thị đáp án PTTQ: C3H5(OH)3 + nRCOOH ⇆ (RCOO)nC3H5(OH)3-n + nH2O Các công thức đúng là (a), (b), (c). → Đáp án C Câu 69: Sản phẩm của phản ứng este hóa giữa hai chất nào sau đây cho este có mùi hoa nhài? A. Ancol isoamylic và axit axetic. B. Ancol benzylic và axit fomic. C. Ancol isoamylic và axit fomic.


D. Ancol benzylic và axit axetic. Hiển thị đáp án CH3COOH + C6H5CH2OH → CH3COOCH2C6H5 (benzyl axetat – có mùi hoa nhài) → Đáp án D 1 số mùi este thông dụng: Amyl axetat có mùi dầu chuối. Amyl fomat có mùi mận. Etyl fomat có mùi đào chín. Metyl salicylat có mùi dầu gió. Isoamyl axetat có mùi chuối chín. Etyl Isovalerat có mùi táo. Etyl butirat và Etyl propionat có mùi dứa. Geranyl axetat có mùi hoa hồng. Metyl 2-aminobenzoat có mùi hoa cam. Benzyl axetat có mùi thơm hoa nhài → Đáp án D Câu 70: Este nào sau đây có mùi chuối chín? A. Etyl format C. Isoamyl exetat Hiển thị đáp án → Đáp án C

B. Benzyl exetat D. Etyl butirat


Câu 71: Khi thủy phân hoàn toàn một triglixerit X trong môi trường axit thu được hỗn hợp sản phẩm gồm glixerol, axit panmitic và axit oleic. Số công thức cấu tạo của X thỏa mãn tính chất trên là A. 8.

B. 4.

C. 6.

D. 2.

Hiển thị đáp án Thủy phân thu được hỗn hợp sản phẩm → X phải chứa cả 2 loại gốc axit béo. → CTCT của X thỏa mãn là: (C15H31COO)2(C17H33COO)C3H5 (2 đồng phân) và (C15H31COO)(C17H33COO)2C3H5 (2 đồng phân) → Có 4 CTCT của X thỏa mãn điều kiện bài toán. → Đáp án B Câu 72: Trong công nghiệp, một lượng lớn chất béo dùng để sản xuất A. ancol metylic và fructozơ. B. xà phòng và glucozơ. C. glixerol và xà phòng. D. ancol metylic và xà phòng. Hiển thị đáp án Trong công nghiệp, một lượng lớn chất béo dùng để sản xuất glixerol và xà phòng thông qua phản ứng xà phòng hóa. (RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3 → Đáp án C Câu 73: Số este có công thức phân tử C5H10O2 có khá năng tham gia phản ứng tráng bạc là? A. 6

B. 4


C. 3

D. 5

Hiển thị đáp án C5H10O2 có k = 1 → C5H10O2 là este no đơn chức mạch hở Este có phản ứng tráng bạc thì có gốc HCOO-

kiện là: HCOOHCH2CH2CH2CH3; HCOOCH(CH3)CH2CH3; → Có 4 chất thỏa mãn điều ki HCOOCH2CH(CH3)2; HCOOC(CH3)4. → Đáp án B

m axit HCOOH và axit CH3COOH (tỉ lệ mol 1:1). Lấy L 5,3 gam Câu 74: Hỗn hợp X gồm hỗn hợp X tác dụng vớii 5,75 gam C2H5OH (có xúc tác H2SO4 đặc) thu được m gam hỗn a các ph phản ứng este hoá đều bằng 80%). Giá trịị của củ m là hợp este (hiệu suất của A. 10,12.

B. 6,48.

C. 8,10.

D. 16,20.

Hiển thị đáp án Ta có nHCOOH = nCH COOH = 0,05(mol) 3

Và nC H = 0,125(mol) 2

5

Do hiệu suất của mỗi phản ứng este hóa đều bằng 80% nên ta có: mHCOOC H + mCH COOC H = 6,48(kg) 2

5

3

2

5

→ Đáp án B Câu 75: Cho sơ đồ sau:

Vậy chất Z là: A. CH3COOC2H5

B. CH3COOCH3

C. C2H5COOCH3

D. HCOOC2H5

Hiển thị đáp án CH2=CH2 + H2O -H SO 2

4

loãng→

CH3CH2OH (X)


CH3CH2OH + O2 -lên men giấm→ CH3COOH (Y) + H2O CH3COOH + CH3CH2OH -H SO 2

4

đặc→

CH3COOC2H5 (Z) + H2O

→ Đáp án A Câu 76: Cho phản ứng:

Sản phẩm thu được từ phản ản ứ ứng trên gồm: A. CH3CH2COOCH + CH2=CHOH. B. CH2=CHCOOH + CH3CH2OH. C. CH3CH2COOCH + CH3CHO. D. CH3CH2OH + CH3CHO. Hiển thị đáp án CH3CH2COOCH=CH2 + H2O -H → CH3CH2COOH + CH2=CH-OH +

Vì CH2=CH-OH kém bền nên sẽ biến thành CH3CHO → Đáp án C Câu 77: Mỡ tự nhiên là: A. Este của axit stearic (C17H35COOH). B. Muối của axit béo. C. Este của axit panmitic (C15H31COOH).

a các axit béo khác nhau. D. Hỗn hợp các trieste của Hiển thị đáp án → Đáp án D

ầu mỡ m và có mùi Câu 78: Khi dầu mỡ thực động vvật để lâu ngày sẽ có hiện tượng ôi dầu ợp ch chất nào sau đây. đặc trưng. Đó là mùi của hợp


A. Ancol. C. Este.

B. Hiđrocacbon thơm. D. Andehit.

Hiển thị đáp án Dầu mỡ lâu ngày có hiện tượng ôi, có mùi khó chịu là do liên kết C=C ở gốc axit không no của chất béo bọ oxi hóa chậm bởi oxi không khí tạo thành peoxit, chất này bị phân hủy thành các anđehit có mùi khó chịu gây hại cho người ăn ( SGK 12 cơ bản – trang 10). → Đáp án D Câu 79: Để làm sạch vết dầu ăn dính trên quần áo ta nên dùng phương pháp nào sau đây? A. Nhỏ vài giọt cồn vào vết dầu ăn B. Giặt bằng nước C. Giặt bằng xăng D. Giặt bằng xà phòng. Hiển thị đáp án Xà phòng thường dùng là hỗn hợp muối natri hoặc kali của axit béo, có thêm một số chất phụ gia. Phân tử muối natri của axit béo gồm 1 đầu ưa nước là nhóm COO-Na+ nối với 1 đuôi kị nước, ưa dầu mỡ là nhóm –CxHy (thường x ≥ 15). Đầu ưa dầu mỡ thâm nhập vào vết bẩn, còn nhóm COO-Na+ ưa nước có xu hướng kéo ra các phía phân tử nước → làm giảm sức căng bề mặt các chất bẩn bám trên vải, da → vết bẩn phân tán nhiều phần nhỏ rồi phân tán vào nước và bị rửa trôi (Xem hình 1.8: Sơ đồ quá trình làm sạch vết bẩn của xà phòng – SGK lớp 12 cơ bản – trang 15). → Đáp án D Câu 80: Khi thủy phân bất kì một chất béo nào thì cũng luôn thu được: A. Axit oleic C. Axit stearic Hiển thị đáp án

B. Glixerol D. Axit panmitic.


Chất béo tổng quát: (R1COO)(R2COO)(R3COO)C3H5 (Với R1COOH, R2COOH, R3COOH là axit béo, có thể giống nhau hoặc khác nhau). - Thủy phân chất béo trong môi trường axit (R1COO)(R2COO)(R3COO)C3H5 + 3H2O ⇆ R1COOH + R2COOH + R3COOH + C3H5(OH)3 - Thủy phân chất béo trong môi trường kiềm (R1COO)(R2COO)(R3COO)C3H5 + 3NaOH -t → R1COONa + R2COONa + R3COONa + C3H5(OH)3 o

→ Khi thủy phân bất kì một chất béo nào thì cũng luôn thu được glixerol (C3H5(OH)3) → Đáp án B 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 3)

Câu 81: Phát biểu nào sau đây không đúng? A. Chất béo không tan trong nước, nhưng tan nhiều trong các dung môi hữu cơ như benzen, hexan … B. Chất béo nhẹ hơn nước. C. Dầu ăn và dầu mỡ bôi trơn có cùng thành phần nguyên tố. D. Chất béo còn được gọi là triglixerit hay là triaxylglixerol. Hiển thị đáp án Phát biểu không đúng: Dầu ăn và dầu mỡ bôi trơn có cùng thành phần nguyên tố. Dầu ăn bản chất là các chất béo, dầu mỡ bôi trơn bản chất là các hiđrocacbon. → Đáp án C Câu 82: Cho sơ đồ chuyển hóa: X -+NaOH→ Y ←t - (CH3COO)2Ca o

X, Y đều là những chất hữu cơ đơn chức hơn kém nhau 1 nguyên tử C.


Tìm đáp án đúng. A. X là CH3 – COO – CH = CH2 B. Y là CH3 – CH2 – CH = O C. X là H – COO – C = CH2 – CH3 D. X là CH3 – CO – CH2 – CH3 Hiển thị đáp án + X là H – COO – C(CH3) = CH2 + Y là CH3 – CO - CH3 HCOO – C(CH3) = CH2 + NaOH HCOONa + CH3 – CO – CH3 (CH3CHOO)2Ca -t → CH3 – CO – CH3 + CaCO3 o

→ Đáp án C Câu 83: Etyl fomiat có thể phản ứng được với chất nào sau đây ? A. Dung dịch NaOH.

B. Natri kim loại.

C. Dung dịch AgNO3/NH3.

D. Cả (A) và (C) đều đúng.

Hiển thị đáp án HCOOC2H5 + NaOH -t → HCOONa + C2H5OH. o

HCOOC2H5 + 2AgNO3 + 3NH3 + H2O → 2Ag↓ + NH4OCOOC2H5 + 2NH4NO3 → Đáp án D Câu 84: Đốt cháy este no, đơn chức, mạch hở thu được A. nCO < nH O

B. nCO > nH O

C. nCO = nH O

D. Không xác định.

2

2

2

2

2

2

Hiển thị đáp án CTPT tổng quát của este no, đơn chức, mạch hở: CnH2nO2 (n ≥ 2).


PT đốt cháy:

→ nCO = nH O 2

2

→ Đáp án C Câu 85: Phản ứng thủyy phân este trong môi trường kiềm, đun nóng được gọi là phản ứng? A. Xà phòng hóa.

B. Tráng g gương. D. Hidro hóa.

C. Este hóa. Hiển thị đáp án → Đáp án A

Câu 86: Đặc điểm của phản ản ứ ứng thuỷ phân este trong môi trường kiềm ềm là A. xảy ra một chiều. B. luôn sinh ra axit và ancol. C. thuận nghịch. D. xảy ra nhanh ở nhiệt độ thường. Hiển thị đáp án → Đáp án A

un nóng este HCOOCH3 với một lượng vừa đủ dung dịch ch NaOH, sản s phẩm Câu 87: Đun thu được là A. CH3COONa và C2H5OH. C. HCOONa và C2H5OH.

B. HCOONa và CH3OH. D. CH3COONa và CH3OH.

Hiển thị đáp án HCOOCH3 + NaOH -t → HCOONa + CH3OH o

→ Sản phẩm thu được là HCOONa và CH3OH


→ Đáp án B Câu 88: Đun nóng este CH2 = CHCOOCH3 với một lượng vừa đủ dung dịch NaOH, sản phẩm thu được là A. CH2 = CHCOONa và CH3OH.

B. CH3COONa và CH3CHO.

C. CH3COONa và CH2 = CHOH.

D. C2H5COONa và CH3OH.

Hiển thị đáp án Câu 89: Khi thuỷ phân chất béo trong môi trường kiềm thì thu được muối của axit béo và A. phenol.

B. glixerol.

C. ancol đơn chức.

D. este đơn chức.

Hiển thị đáp án Chất béo tổng quát: (R1COO)(R2COO)(R3COO)C3H5 (Với R1COOH, R2COOH, R3COOH là axit béo, có thể giống nhau hoặc khác nhau). Thủy phân chất béo trong môi trường kiềm thu được muối của axit béo và glixerol (R1COO)(R2COO)(R3COO)C3H5 + 3NaOH -t → R1COONa + R2COONa + R3COONa + C3H5(OH)3 o

→ Đáp án B Câu 90: Khi xà phòng hóa tristearin ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H35COOH và glixerol. C. C15H31COOH và glixerol. D. C17H35COONa và glixerol. Hiển thị đáp án (C17H35COO)3C3H5 (Tristearin) + 3NaOH -t → 3C17H35COONa + C3H5(OH)3 (glixerol). o

→ Đáp án D


Câu 91: Khi xà phòng hóa tripanmitin ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H35COOH và glixerol. C. C15H31COONa và glixe rol. D. C17H35COONa và glixerol. Hiển thị đáp án (C15H31COO)3C3H5 (Tripanmitin) + 3NaOH -t → 3C15H31COONa + C3H5(OH)3 (glixerol). o

→ Đáp án C Câu 92: Khi xà phòng hóa triolein ta thu được sản phẩm là A. C15H31COONa và etanol. B. C17H35COOH và glixerol. C. C15H31COONa và glixe rol. D. C17H33COONa và glixerol. Hiển thị đáp án (C17H33COO)3C3H5 (Triolein) + 3NaOH -t → 3C17H33COONa + C3H5(OH)3 (glixerol). o

→ Đáp án D Câu 93: Triolein không tác dụng với chất (hoặc dung dịch) nào sau đây? A. H2O (xúc tác H2SO4 loãng, đun nóng). B. Cu(OH)2 (ở điều kiện thường). C. Dung dịch NaOH (đun nóng). D. H2 (xúc tác Ni, đung nóng). Hiển thị đáp án A. (C17H33COO)3C3H5 + 3H2O ⇆ 3C17H33COOH + C3H5(OH)3.


B. Triolein không tác dụng với Cu(OH)2 (ở điều kiện thường). C. (C17H33COO)3C3H5 + 3NaOH -t → 3C17H33COONa + C3H5(OH)3. o

D. (C17H33COO)3C3H5 + 3H2 -t , Ni→ (C17H35COO)3C3H5. o

→ Đáp án B Câu 94: Cho dãy các chất: phenyl axetat, anlyl axetat, metyl axetat, etyl fomat, tripanmitin. Số chất trong dãy khi thủy phân trong dung dịch NaOH (dư), đun nóng sinh ra ancol là A. 2.

B. 3.

C. 4.

D. 5.

Hiển thị đáp án Các chất trong dãy khi thủy phân trong dung dịch NaOH (dư), đun nóng sinh ra ancol là: 1. anlyl axetat (CH3COOCH2CH=CH2 + NaOH → CH3COONa + CH2=CHCH2OH) 2. metyl axetat (CH3COOCH3 + NaOH → CH3COONa + CH3OH) 3. etyl fomat (HCOOC2H5 + NaOH → HCOONa + C2H5OH) 4. tripanmitin (C15H31COO)3C3H5 + 3NaOH → 3C15H31COONa + C3H5(OH)3. → Đáp án C Câu 95: Este nào sau đây khi phản ứng với dung dịch NaOH dư, đun nóng không tạo ra hai muối? A. C6H5COOC6H5.

B. CH3COO-[CH2]2-OOCH2CH3.

C. CH3OOC-COOCH3.

D. CH3COOC6H5.

Hiển thị đáp án CH3OOC-COOCH3 + 2NaOH -t → (COONa)2 + 2CH3OH (chỉ tạo ra một muối) o

→ Đáp án C


Câu 96: Chất nào sau đây khi đun nóng với dung dịch NaOH thu được sản phẩm có anđehit? A. CH3–COO–CH2–CH=CH2.

B. CH3–COO–C(CH3)=CH2.

C. CH2=CH–COO–CH2–CH3.

D. CH3–COO–CH=CH–CH3.

Hiển thị đáp án CH3–COO–CH=CH–CH3 + NaOH → CH3COONa + CH3CH2CHO. → Đáp án D Câu 97: Một este có công thức phân tử là C4H6O2, khi thủy phân trong môi trường axit thu được axetanđehit. Công thức cấu tạo thu gọn của este đó là A. HCOO-CH=CH-CH3.

B. CH3COO-CH=CH2.

C. CH2=CH-COO-CH2.

D. HCOO-C(CH3)=CH2.

Hiển thị đáp án C4H6O2 có k = 2 → este đơn chức có chứa 1 liên kết đôi Khi thủy phân trong môi trường axit thu được axetanđehit → este đó là CH3COO-CH=CH2. CH3COO-CH=CH2 + H2O ⇆ CH3COOH + CH3CHO. → Đáp án B Câu 98: Cho triolein lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, CH3OH, dung dịch Br2, dung dịch NaOH. Trong điều kiện thích hợp, số phản ứng xảy ra là A. 2.

B. 3.

C. 5.

D. 4.

Hiển thị đáp án Triolein trong điều kiện thích hợp có phản ứng với: dung dịch Br2, dung dịch NaOH. (C17H33COO)3C3H5 + 3Br2 → (C17H33Br2COO)3C3H5


(C17H33COO)3C3H5 + 3NaOH → 3C17H33COONa + C3H5(OH)3 → Đáp án A Câu 99: Mệnh đề không đúng là A. CH3CH2COOCH=CH2 cùng dãy đồng đẳng với CH2=CHCOOCH3. B. CH3CH2COOCH=CH2 có thể trùng hợp tạo polime. C. CH3CH2COOCH=CH2 tác dụng được với dung dịch Br2.

ehit và muối. D. CH3CH2COOCH=CH2 tác dụng với dung dịch NaOH thu được anđehit Hiển thị đáp án A. Sai vì CH3CH2COOCH=CH2 là este của axit no và ancol không no còn CH2=CHCOOCH3 là este của axit không no và ancol no. B. Đúng

C. Đúng CH3CH2COOCH=CH2 + Br2 → CH3CH2COOCHBrCH2Br D. Đúng CH3CH2COOCH=CH2 + NaOH -t → CH3CH2COONa + CH3CHO. o

→ Đáp án A

thức phân tử C4H8O2 (vớii xúc tác axit) thu được 2 Câu 100: Thủyy phân este E có công th ột phản ph ứng duy sản phẩm hữu cơ X và Y. Từ X có thể điều chế trực tiếp ra Y bằng một nhất. Chất X là A. metanol. C. axit fomic. Hiển thị đáp án

B. etyl axetat. D. etanol.


E: CH3COOC2H5 X: C2H5OH Y: CH3COOH. CH3COOC2H5 + H2O ⇆ C2H5OH + CH3COOH 2C2H5OH + O2 -t , xt→ 2CH3COOH + H2O o

→ Đáp án D Câu 101: Hợp chất Y có công thức phân tử C4H8O2. Khi cho Y tác dụng với dung dịch NaOH sinh ra chất Z có công thức C3H5O2Na. Công thức cấu tạo của Y là A. C2H5COOC2H5.

B. CH3COOC2H5.

C. C2H5COOCH3.

D. HCOOC3H7.

Hiển thị đáp án Y (C4H8O2) có k = 1 và Y tác dụng được với dung dịch NaOH → Y là axit cacboxylic no, đơn chức, mạch hở hoặc este no, đơn chức, mạch hở Mà Y + NaOH sinh ra Z có công thức C3H5O2Na → Y là este Z là C2H5COONa → Y là C2H5COOCH3 → Đáp án C Câu 102: Thuỷ phân este X có công thức phân tử C4H8O2 trong dung dịch NaOH thu được hỗn hợp hai chất hữu cơ Y và Z trong đó Y có tỉ khối hơi so với H2 là 16. X có công thức là A. HCOOC3H7.

B. CH3COOC2H5.

C. HCOOC3H5.

D. C2H5COOCH3.

Hiển thị đáp án X (C4H8O2) có k = 1 → X là este no, đơn chức, mạch hở dY/H → MY = 16.2 = 32 → Y là CH3OH 2


→ X có công thức là C2H5COOCH3 → Đáp án D Câu 103: Một chất hữu cơ A có công thức phân tử là C3H6O2 thỏa mãn: A tác dụng được dung dịch NaOH đun nóng và dung dịch AgNO3/NH3, đun nóng. Vậy A có công thức cấu tạo là A. C2H5COOH.

B. CH3COOCH3.

C. HCOOC2H5.

D. OHCCH2CH2OH.

Hiển thị đáp án A (C3H6O2) có k = 1 A tác dụng được dung dịch NaOH đun nóng và dung dịch AgNO3/NH3, đun nóng → A là este của axit fomic (HCOOH) → A có công thức cấu tạo là HCOOC2H5 → Đáp án C Câu 104: Khi thủy phân HCOOC6H5 trong môi trường kiềm dư thì thu được A. 1 muối và 1 ancol. C. 2 muối.

B. 2 muối và nước.

D. 2 rượu và nước.

Hiển thị đáp án Phương trình hóa học khi thủy phân HCOOC6H5 trong môi trường kiềm dư: HCOOC6H5 + 2NaOH -t → HCOONa + C6H5ONa + H2O o

→ Sản phẩm sinh ra gồm 2 muối (HCOONa, C6H5ONa) và nước → Đáp án B Câu 105: Chất nào sau đây tác dụng với NaOH đun nóng tạo ra glixerol? A. Glyxin.

B. Tristearin.


C. Metyl axetat.

D. Glucozơ.

Hiển thị đáp án Phương trình hóa học: NH2 – CH2 – COOH (Glyxin) + NaOH → NH2 – CH2 – COONa + H2O (CH3[CH2]16COO)3C3H5 (tristearin) + 3NaOH 3CH3[CH2]16COONa + C3H5(OH)3 (glixerol) CH3COOCH3 (Metyl axetat) + NaOH → CH3COONa + CH3OH Glucozơ không có phản ứng với NaOH → Chất tác dụng với NaOH đun nóng tạo ra glixerol là tristearin → Đáp án B Câu 106: Sản phẩm của phản ứng xà phòng hóa vinyl axetat gồm natri axetat và chất nào sau đây? A. CH3OH.

B. C2H5OH.

C. CH2=CHOH.

D. CH3CHO.

Hiển thị đáp án CH3COOCH=CH + NaOH → CH3COONa + CH3CHO. → Đáp án D Câu 107: Este nào sau đây khi tác dụng với dung dịch NaOH đun nóng, thu được hỗn hợp sản phẩm gồm CH3COONa và CH3CHO ? A. CH2=CHCOOCH3. B. CH3COOCH=CHCH3. C. HCOOCH=CH2. D. CH3COOCH=CH2. Hiển thị đáp án A. CH2=CHCOOCH3 + NaOH → CH2=CHCOONa + CH3OH.


B. CH3COOCH=CHCH3 + NaOH → CH3COONa + CH3CH2CHO. C. HCOOCH=CH2 + NaOH → HCOONa + CH3CHO. D. CH3COOCH=CH2 + NaOH → CH3COONa + CH3CHO. → Đáp án D Câu 108: Chất X có công thức cấu tạo CH3CH2COOCH3. Tên gọi của X là A. etyl axetat. C. metyl propionat.

B. propyl axetat. D. metyl axetat.

Hiển thị đáp án → Đáp án C Câu 109: Este X có CTPT CH3COOC6H5. Phát biểu nào sau đây về X là đúng A. Tên gọi của X là benzyl axetat. B. X có phản ứng tráng gương. C. Khi cho X tác dụng với NaOH (vừa đủ) thì thu được 2 muối. D. X được điều chế bằng phản ứng của axit axetic với phenol. Hiển thị đáp án A Sai. Tên gọi của X là phenyl axetat. B. Sai, X không có phản ứng tráng gương C. Đúng, Phương trình: D. Sai, X được điều chế bằng phản ứng của anhidrit axetic với phenol: C6H10OH + (CH3CO)2O → CH3COOC6H5 + CH3COOH → Đáp án C


Câu 110: Thủy phân este X có CTPT C4H6O2. Khi X tác dụng với dung dịch NaOH thu được hỗn hợp 2 chất hữu cơ Y và Z trong đó Z có tỉ khối hơi so với H2 là 16. Tên của X là: A. Etyl axetat.

B. Metyl propionat.

C. Metyl axetat.

D. Metyl acrylat.

Hiển thị đáp án dZ/H → MZ = 32 → Z: CH3OH 2

CTCT X: CH2=CHCOOCH3: Metyl acrylat → Đáp án D Câu 111: Xà phòng 17,8 gam chất béo X cần vừa đủ dung dịch chứa 0,06 mol NaOH. Cô cạn dung dịch thu được a gam muối khan. Giá trị của a là A.19,12.

B.18,36.

C.19,04.

D.14,68.

Hiển thị đáp án BTKL: a = mX + mNaOH - mnước = 17.8 + 0.06. 40 – 0.02.92 =18,36(g) → Đáp án B Câu 112: Để tác dụng hết với a mol triolein cần tối đa 0,6 mol Br2 trong dung dịch. Giá trị của a là A. 0,12

B. 0,15.

C. 0,3.

D. 0,2.

Hiển thị đáp án Ta có: mỗi gốc oleat có 1 nối đôi C=C trong gốc hidrocacbon nên triolein có 3 nối đôi C=C → 1 mol (C17H33COO)3C3H5 phản ứng vừa đủ với 3 mol Br2 nên ntriolein= 0,2 → Đáp án D


Câu 113: Để tác dụng hết 3,0 gam hỗn hợp gồm axit axetic và metyl fomat cần V ml dung dịch NaOH 1M (đun nóng). Giá trị của V là A. 100.

B. 50.

C. 500.

D. 150.

Hiển thị đáp án Axit axetic và metyl fomat đều có công thức phân tử là C2H4O2 và tác dụng với NaOH theo tỉ lệ mol 1:1. nC H O = 0,05 mol → nNaOH = 0,05 mol → V = 0,05 lít = 50 ml 2

4

2

→ Đáp án B Câu 114: Este X có công thức phân tử C8H8O2. Cho X tác dụng với dung dịch NaOH, thu được sản phẩm có hai muối. Số công thức của X thỏa mãn chất trên là A. 6.

B. 3.

C. 4.

D. 5.

Hiển thị đáp án CH3COO-C6H5 HCOO-C6H4-CH3 (o-p-m) → Đáp án C Câu 115: Este X có công thức phân tử C8H8O2. Cho X tác dụng với dung dịch NaOH, thu được sản phẩm có 2 muối. Số công thức cấu tạo của X thỏa mãn tính chất trên là A. 6.

B. 3.

C. 4.

D. 5.

Hiển thị đáp án → Este X có: k = 5 Mà X + NaOH → 2 muối → X là este của phenol → Các công thức cấu tạo phù hợp của X là :


→ Có 4 công thức cấu tạo phù hợp → Đáp án C Câu 116: Este X là hợp chất ất thơm có công thức phân tử C9H10O2. Cho X tác dụng với o ra hai mu muối đều có phân tử khối lớn hơn n 80. CTCT thu gọn của X dung dịch NaOH tạo là

B.HCOOC6H4C2H5.

A.CH3COOCH2C6H5.

D. C2H5COOC6H5.

C. C6H5COOC2H5.

Hiển thị đáp án u có phân tử t khối lớn X(C9H10O2) có k = 5, X tác dụng vvới dung dịch NaOH tạo ra hai muối đều hơn 80→ X: C2H5COOC6H5 → Đáp án D

(v Câu 117: Xà phòng hóa hoàn toàn 3,7 gam HCOOC2H5 trong dung dịch NaOH (vừa ứa m gam mu muối. Giá trị của m là đủ), thu được dung dịch chứa A. 3,4.

B. 4,8.

C. 3,2.

D. 5,2

Hiển thị đáp án HCOOC2H5 + NaOH -t → HCOONa + C2H5OH o

→ nHCOONa = 0,05 mol → nHCOONa = 0,05 mol → mmuối = 0,05.68 = 3,4 g. → Đáp án A

chất béo cần vừa đủ 0,06 mol NaOH. Cô Câu 118: Xà phòng hóa hoàn toàn 17,24g ch cạn dung dịch sau phản ứng thu được khối lượng xà phòng là


A. 17,80g.

B. 18,24g.

C. 16,68g.

D. 18,38g.

Hiển thị đáp án Chất béo có dạng: C3H5(OCOR)3 (RCOOH là axit béo) C3H5(OCOR)3 + 3NaOH -t → 3RCOONa + C3H5(OH)3 o

→ nC H (OH) = nNaOH/3 = 0,02 mol 3

5

3

Bảo toàn khối lượng: mxà phòng = mchất béo + mNaOH – mglixerol = 17,24 + 0,06.40 – 0,02.92 =17,8g. → Đáp án A Câu 119: Xà phòng hóa hoàn toàn 178 gam tristearin trong dung dịch KOH, thu được m gam kali stearat. Giá trị của m là A. 200,8.

B. 183,6.

C. 211,6.

D. 193,2.

Hiển thị đáp án n(C H COO) C H = 0,02 mol; 17

35

3

3

5

(C17H35COO)3C3H5 + 3KOH → 3C17H35COOK + C3H5(OH)3 nC

17

H35COOK

→ mC

17

= 3.n(C

H35COOK

17

H35COO)3C3H5

= 0,06 mol

= 0,6. 322 = 193,2 g

→ Đáp án D Câu 120: Thủy phân hoàn toàn 0,1 mol este X bằng NaOH thu được một muối của axit cacboxylic Y và 7,6g ancol Z. Chất Y có phản ứng tráng bạc, Z hòa tan được Cu(OH)2 cho dung dịch màu xanh lam. Công thức cấu tạo của X là A. HCOOCH2CH2OOCCH3. B. HCOOCH2CH(CH3)OOCH.


C. HCOOCH2CH2CH2OOCH. D. CH3COOCH2CH2OOCCH3. Hiển thị đáp án Y có phản ứng tráng bạc → Y: HCOOH → Loại đáp án A, D nZ = nX = 0,1 mol → MZ = 76 → CTPT của Z là C3H8O2 Z hòa tan được Cu(OH)2 cho dung dịch màu xanh lam → Z: CH2OHCH(OH)CH3 → Loại đáp án C → X: HCOOCH2CH(CH3)OOCH → Đáp án B 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (cơ bản – phần 4)

Câu 121: Cho 20 gam một este X (có phân tử khối là 100đvc) tác dụng với 300 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 23,2g chất rắn khan. Công thức cấu tạo thu gọn của X là A. CH2=CHCH2COOCH3. C. C2H5COOCH=CH2.

B. CH3COOCH=CHCH3. D. CH2=CHCOOC2H5.

Hiển thị đáp án nX = 0,2 mol; nNaOH = 1.0,3 = 0,3 mol → nNaOH dư = 0,3 – 0,2 = 0,1 mol. → mchất rắn sau phản ứng = mmuối + mNaOH dư → mmuối = 23,2 – 0,1.40 = 19,2 gam → Mmuối = 96 → Muối là C2H5COONa → X: C2H5COOCH=CH2 → Đáp án C Câu 122: Thuỷ phân hoàn toàn 444 gam một lipit X thu được 46 gam glixerol và hai loại axit béo. Hai loại axit béo đó là A. C17H31COOH và C17H33COOH. B. C15H31COOH và C17H35COOH.


C. C17H33COOH và C17H35COOH. D. C17H33COOH và C15H31COOH. Hiển thị đáp án nglixerol = 0,5 mol → nX = 0,5 mol → MX = 888 X: C3H5(OCOR)3 → MR = 238,33 → Hai loại axit béo đó là: C17H33COOH và C17H35COOH → Đáp án C Câu 123: Hóa hơi 27,2 gam một este X thu được 4,48 lít khí (quy về đktc). Xà phòng hóa X bằng dung dịch NaOH (vừa đủ) thu được hỗn hợp hai muối của natri. Công thức cấu tạo thu gọn của este X là A. CH3COOC6H5.

B. C6H5COOCH3.

C. CH3COOC6H4CH3.

D. HCOOC6H5.

Hiển thị đáp án nkhí = 0,2 mol → MX = 136 Xà phòng hóa X bằng dung dịch NaOH (vừa đủ) thu được hỗn hợp hai muối của natri → X có dạng RCOOC6H5 Mà MX = 136 → MR + 121 = 136 → MR = 15 → R là CH3 → Công thức cấu tạo thu gọn của este X là CH3COOC6H5 → Đáp án A Câu 124: Xà phòng hoá hoàn toàn 17,6 gam hỗn hợp 2 este là etyl axetat và metyl propionat bằng một lượng vừa đủ V ml dung dịch NaOH 0,5M. Giá trị V đã dùng là A. 400 ml.

B. 500 ml.

C. 200 ml.

D. 600 ml.

Hiển thị đáp án


Etyl axetat: CH3COOC2H5 , metyl propionat: CH3CH2COOCH3 → Etyl axetat và metyl propionat có cùng công thức phân tử là C4H8O2 → neste = 0,2 mol

hợp este là RCOOR’ Gọi công thức chung của hỗnn hợ RCOOR’ + NaOH -t → RCOONa + R’OH o

→ nNaOH = neste = 0,2 mol → 0,5.V.10-3 = 0,2 → V = 400ml. → Đáp án A

bằng 200 ml dung dịch ch NaOH 0,2M. Sau Câu 125: Xà phòng hoá 8,8 gam etyl axetat b ắn khan có khối kh khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn lượng là A. 3,28 gam.

B. 8,56 gam. D. 10,4 gam.

C. 8,2 gam.

Hiển thị đáp án nCH COOCH CH = 0,1 mol; 3

2

3

nNaOH = 0,2. 0,2 = 0,04 mol

→ Chất rắn thu đượcc sau khi cô ccạn là CH3COONa → mCH COONa = 0,04.82 = 3,28 gam 3

→ Đáp án A

hợp gồm metyl fomat và à metyl axetat tác dụng với NaOH Câu 126: Cho 20,8 gam hỗn h ch NaOH 2M. Kh Khối lượng metyl fomat trong hỗn n hợp hợ là thì hết 150 ml dung dịch A. 3,7 gam.

B. 3 gam.


D. 3,4 gam.

C. 6 gam.

Hiển thị đáp án nNaOH = 2.0,15 = 0,3 mol → neste = 0,3 mol

ng metyl fomat trong hhỗn hợp là: mHCOOCH = 0,1.60 = 6 g. → Khối lượng 3

→ Đáp án C

hỗn hợp etyl axetat và à etyl fomiat cần 25,93 ml Câu 127: Muốn thuỷ phân 5,6 gam h NaOH 10%, (D = 1,08 g/ml). Thành phần % khối lượng của a etyl axetat trong hỗn h hợp là A. 47,14%.

B. 52,16%.

C. 36,18%.

D. 50,20%.

Hiển thị đáp án mdung dịch NaOH = D.V = 1,08. 25,93 = 28 gam → nNaOH = 28. 10% = 2,8 gam → nNaOH = 0,07 → neste = nNaOH = 0,07 mol

ng của etyl axetat trong hhỗn hợp là: → Thành phần % khối lượng %mCH COOC H = 47,14% 3

2

5

→ Đáp án A

dụng với 200 ml dung dịch ch NaOH 1,5M đun Câu 128: Cho 13,6 gam phenyl axetat tác d ảy ra hoàn toàn thu được dung dịch X. Cô cạn ạn X thu được a nóng. Sau khi phản ứng xảy ủa a là gam chất rắn khan. Giá trịị của A. 12,2 gam.

B. 16,2 gam.

C. 19,8 gam.

D. 23,8 gam.

Hiển thị đáp án


nCH COOC H = 13,6/136 = 0,1 mol 3

6

5

nNaOH = 1,5. 0,2 = 0,3 mol

→ Chất rắnn khan sau khi cô cạn dung ddịch X là: NaOH dư (0,1 mol); CH3COONa (0,1 mol); C6H5ONa (0,1 mol) → a = mNaOH(dư) + mCH COONa + mC H ONa = 0,1.40 + 0,1.82 + 0,1.116 = 23,8 gam 3

6

5

→ Đáp án D

ạch hở h và ancol Câu 129: Cho 6 gam mộtt este X ccủa axit cacboxylic no, đơn chức, mạch ản ứng vừa hết với 100 ml dung dịch ch NaOH 1M. Tên gọi no, đơn chức, mạch hở phản của este đó là A. etyl axetat. C. metyl axetat.

B. propyl fomat. D. metyl fomat.

Hiển thị đáp án ạch hở h X là este củaa axit cacboxylic no, đơn chức, mạch hở và ancol no, đơn chức, mạch

ạch hhở có công thức phân tử là CnH2nO2 → X là este, no đơn chức, mạch → neste = nNaOH = 1.0,1 = 0,1 mol → Meste = 6/0,1 = 60 → 14n + 32 = 60 → n = 2 → Công thức phân tử của X là C2H4O2 → este X là HCOOCH3: metyl fomat → Đáp án D Câu 130: Cho 4,2 g este no, đơ đơn chức, mạch hở E tác dụng hết vớii dung dịch d NaOH

Vậy công thức cấu tạo của E có thể là ta thu được 4,76 g muốii natri. V A. CH3COOCH3. C. CH3COOC2H5.

B. HCOOCH3. D. HCOOC2H5.


Hiển thị đáp án Gọi công thức chung của este là RCOOR’ (R’ là gốc hiđrocacbon) Ta có: RCOOR’ + NaOH → RCOONa + R’OH Khi thủy phân este mà mmuối > meste, vậy gốc R’ là CH3 → loại đáp án C và D Theo phương pháp tăng giảm khối lượng: 1 mol este phản ứng → khối lượng muối tăng so với khối lượng este: 23 - 15 = 8 gam Khối lượng tăng thực tế là: 4,76 – 4,2 = 0,56 gam → nRCOOCH = nRCOONa = 0,07 mol → MRCOONa = 68 gam 3

→ RCOONa là HCOONa → Công thức cấu tạo của E là HCOOCH3 → Đáp án B Câu 131: X là một este no đơn chức có tỉ khối hơi đối với CH4 là 5,5. Nếu đem đun 2,2 gam este X với dung dịch NaOH (dư), thu được 2,05 gam muối. Công thức cấu tạo thu gọn của X là A. C2H5COOCH3.

B. HCOOCH2CH2CH3.

C. CH3COOC2H5.

D. HCOOCH(CH3)2.

Hiển thị đáp án Ta có: RCOOR’ + NaOH → RCOONa + R’OH Meste = 5,5.16 = 88 → neste = 2,2/88 = 0,025 mol → neste = nmuối = 0,025 mol → Mmuối = 82 gam → R là CH3 → X là CH3COOR’ → → MR’ = 29 → R’ là C2H5 → Công thức cấu tạo thu gọn của X là CH3COOC2H5 → Đáp án C


Câu 132: Trong cơ thể chất béo bị oxi hóa thành các chất nào sau đây ? A. NH3 và CO2.

B. H2O và CO2.

C. CO và H2O.

D. NH3, CO2 và H2O.

Hiển thị đáp án Ta có: RCOOR’ + NaOH → RCOONa + R’OH Meste = 5,5.16 = 88 → neste = 0,025 mol → neste = nmuối = 0,025 mol → Mmuối = MRCOONa = 82 gam → R là CH3 → X là CH3COOR’ → MCH COOR'→ MR’ = 29 → R’ là C2H5 3

→ Công thức cấu tạo thu gọn của X là CH3COOC2H5 → Đáp án B Câu 133: Đốt cháy hoàn toàn 0,1 mol X chỉ chứa nhóm chức este ta thu được 4.48 lít CO2 (đktc) và 3,6 gam H2O. CTPT của este X có thể là: A. C6H8O2

B. C4H8O4

C. C3H6O2

D. C2H4O2

Hiển thị đáp án Ta có: nCO = 0, 2 (mol); nH O = 0,2 (mol) 2

2

0,1 mol este khi cháy tạo ra 0,2 mol CO2 và 0,2mol H2O nên este là C2H4O2. → Đáp án D Câu 134: X là một este no đơn chức, có tỉ khối so với CH4 là 5,5. Nếu đem đun 2,2 gam este X với dung dịch NaOH dư, thu được 2,05 gam muối. Công thức cấu tạo thu gọn của X là: A. C2H5COOCH3

B. CH3HCOOCH2CH2CH3

C. CH3COOC2H5

D. HCOOCH(CH3)2.

Hiển thị đáp án


Gọi công thức tổng quát củaa este no đơn chức có dạng CnH2nO2. Mà dX/CH = 5,5 → MX = 5,5.16 = 88 4

→ 14n + 32 = 88 → n = 4 → Công thức phân tử của X là C4H8O2. nX = 2,2/88 = 0,025 mol

ng: RCOOR’ (0,025 mol) + NaOH → RCOONa (0,025 mol) + R’OH Phản ứng: Theo đề bài, ta có: 0,025(R + 67) = 2,05 → R = 15 : CH3– Vậy công thức cấu tạo là CH3COOCH2CH3 → Đáp án C

c, mạch mạ hở thì sản Câu 135: Khi đốt cháy hoàn toàn hỗn hợp các este no, đơn chức, phẩm thu được có A. số mol CO2 = số mol H2O. B. số mol CO2 > số mol H2O. C. số mol CO2 < số mol H2O. D. không xác định được. Hiển thị đáp án Gọi công thức phân tử củaa este no, đơn chức, mạch hở CnH2nO2 (n ≥ 2) Phản ứng đốt cháy:

→ Sản phẩm cháy thu đượcc có: nH O = nCO 2

2

→ Đáp án A

ột triglixerit X, thu được các axit béo gồm ồm axit oleic, axit Câu 136: Khi thủy phân một panmitic, axit stearic. Thể tích khí O2 (đktc) cần để đốt cháy hoàn toàn 8,6 gam X là A. 15,680 lít.

B. 20,160 lít.


C. 17,472 lít.

D. 16,128 lít.

Hiển thị đáp án X là este của glixerol với các axit béo: axit oleic (C17H33COOH), axit panmitic (C15H31COOH) và axit stearic (C17H35COOH) → Công thức phân tử của X là: C55H104O6 PTHH: C55H104O6 + 78O2 → 55CO2 + 52H2O nO = 0,01. 78 = 0,78 2

→ VO = 0,78.22,4 = 17,4721 2

→ Đáp án C Câu 137: Đốt cháy hết a mol este A được 2a mol CO2. A là A. metyl fomat. C. este vòng.

B. este 2 lần este. D. este không no.

Hiển thị đáp án Số mol C có trong 1 mol este A: nC(1 mol A) = nCO /nA = 2 mol 2

→ este A là HCOOCH3 (metyl fomat) là este no, đơn chức, mạch hở → Loại đáp án B, C, D → Đáp án A Câu 138: Đốt cháy một lượng este no, đơn chức, mạch hở E cần 0,35 mol oxi thu được 0,3 mol CO2. Công thức phân tử của este này là A. C2H4O2.

B. C4H8O2.

C. C3H6O2.

D. C5H10O2.

Hiển thị đáp án E là este no, đơn chức, mạch hở khi đốt cháy cho: nH O = nCO = 0,3 mol 2

Bảo toàn nguyên tố oxi ta có: nO(E) = 2nO = 2nCO + nH O 2

→ nO(E) + 2. 0,35 = 2.0,3 + 0,3 → nO(E) = 0,2

2

2

2


→ nC : nH : nO = 0,3 : (2.0,3) : 0,2 = 3:6:2 → E có dạng (C3H6O2)n Vì E là este đơn chức → n = 1 → Công thức phân tử của este E là C3H6O2 → Đáp án C Câu 139: Đốt cháy 2,58 gam một este đơn chức thu được 2,688 lít CO2 (đktc) và 1,62 gam H2O. Công thức phân tử của este đó là A.C4H8O2.

B. C4H6O2.

C. C3H6O2.

D. C5H8O2.

Hiển thị đáp án nCO = 0,12 mol; nH O = 0,09 mol 2

2

Theo định luật bảo toàn khối lượng ta có: mO(este) = 2,58 – mC – mH = 2,58 – 0,12.12 – 0,09.2 = 0,96 g → nO(este) = 0,96/16 = 0,06 mol → nC : nH : nO = 0,12 : (0,09.2) : 0,06 = 2:3:1 → este có dạng (C2H3O)n Vì este đơn chức → n = 2 → Công thức phân tử của este đó là C4H6O2 → Đáp án B Câu 140: Đốt cháy 6 gam este Y ta thu được 4,48 lít CO2 (đktc) và 3,6 gam H2O. Công thức cấu tạo của Y là A. CH3COOCH3. C. CH3COOC2H5.

B. HCOOCH3. D. HCOOC2H5.

Hiển thị đáp án Y no, đơn chức, mạch hở nên ta có sơ đồ phản ứng: CnH2nO2

nH O 2


14n+32

18n

6

3,6

→ Công thức phân tử của Y là C2H4O2 → Công thức cấu tạo của Y là HCOOCH3 → Đáp án B

ở thì thể tích khí Câu 141: Đốt cháy hoàn toàn một lượng este X no, đơn chức, mạch hở ề kiện nhiệt độ CO2 sinh ra luôn bằng thể tích khí O2 cần dùng cho phản ứng ở cùng điều u tạo ccủa este X đem đốt là và áp suất. Công thức cấu A. HCOOCH3. C. CH3COOC2H5.

B. CH3COOCH3. D. HCOOC3H7.

Hiển thị đáp án ện nhi nhiệt độ, áp suất) chính là tỉ lệ về số mol Tỉ lệ về thể tích (cùng điều kiện → Đốt cháy este X thu được sốố mol khí CO2 bằng số mol khí O2 cần dùng cho phản ứng

ở (CnH2nO2) có phản ứng đốt cháy: Este X no, đơn chức mạch hở

→ nCO = nO → n = (3n-2)/2 → n = 2 → Công thức phân tử của X là C2H4O2 2

2

→ Công thức cấu tạo củaa este X là HCOOCH3 → Đáp án A Câu 142: Đốt cháy hoàn toàn m gam hỗn hợp các este no, đơn chức, mạch m hở. Sản kh lượng bình phẩm cháy được dẫn vào bình đựng dung dịch nước vôi trong dư thấy khối tăng 6,2 gam. Số mol H2O sinh ra và khối lượng kết tủa tạo ra là A. 0,1 mol; 12 gam.

B. 0,1 mol; 10 gam.


C. 0,01 mol; 10 gam.

D. 0,01 mol; 1,2 gam.

Hiển thị đáp án thức phân tử là CnH2nO2 khi đốt cháy hoàn toàn cho: Este no, đơn chức, mạch hở có công th

ng khố khối lượng của H2O và CO2 Khối lượng bình tăng là tổng → mCO + mH O = 6,2 → 44x + 18x = 6,2 → x = 0,1 mol 2

2

CO2 + Ca(OH)2 → CaCO3↓ + H2O → nCaCO = nCO = 0,1 mol → mCaCO = 0,1.100 = 10 gam 3

2

3

→ Có 0,1 mol H2O sinh ra và 10 gam kết tủa tạo thành → Đáp án B

ktc) và 5,4 gam H2O. Biết E Câu 143: Đốtt cháy 7,4 gam este E thu được 6,72 lít CO2 (đktc) dịch AgNO3/NH3. Vậy công thức cấu ấu tạo tạ của E là có phản ứng tráng gương với dung d A. CH3COOCH2CH2CH3.

B. HCOOCH2CH2CH3.

D. HCOOCH3.

C. HCOOC2H5.

Hiển thị đáp án E no, đơn chức, mạch hở nên ta có ssơ đồ phản ứng: CnH2nO2

14n+32 7,4

nH O 2

18n 5,4

→ Công thức phân tử của E là C3H6O2 E có phản ứng tráng gương với dung ddịch AgNO3/NH3 → E là este củaa axit fomic → Công thức cấu tạo của E là HCOOC2H5 → Đáp án C


Câu 144: Đốt cháy hoàn toàn 0,11 gam một este X (tạo nên từ mộtt axit cacboxylic đơn chức và một ancol đơn chức) thu được 0,22 gam CO2 và 0,09 gam H2O. Số este đồng phân của X là A. 2.

B. 5.

C. 6.

D. 4.

Hiển thị đáp án nCO = 0,22/44 = 0,005 mol; 2

nH O = 0,09/18 = 0,005 mol; 2

→ nCO = nH O → este X no, đơn chức, mạch hở 2

2

Gọi công thức phân tử X là CnH2nO2 ta có sơ đồ: CnH2nO2 → 14n+32 0,11

nH O 2

18n 0,09

→ Công thức phân tử của E là C4H8O2 → Các đồng phân este của X là

→ Có 4 đồng phân → Đáp án D Câu 145: Đốtt cháy 3 gam chấ chất hữu cơ A được 4,4 gam CO2 và 1,8 gam nư n ớc. Công thức đơn giản nhất của A là A. CH2O.

B. C3H6O.


C. C2H6O.

D. C2H4O.

Hiển thị đáp án nH O = 1,8/18 = 0,1 mol; 2

nCO = 4,4/44 = 0,1 mol; 2

Bảo toàn khối lượng ta có: 3 = mC + mH + mO → 3 = 0,1.12 + 0,1.2 + mO → mO = 1,6g → nO = 1,6/16 = 0,1 mol → nC : nH : nO = 0,1: (0,1.2) : 0,1 = 1: 2: 1 → Công thức đơn giản nhất của A là CH2O → Đáp án A Câu 146: Nếu A là một este đơn chức thì số đồng phân của A là A. 1.

B. 2.

C. 3.

D. 4.

Hiển thị đáp án Nếu A là este đơn chức → Công thức phân tử của A là C2H4O2 → Đồng phân este duy nhất của A là HCOOCH3 → Đáp án A Câu 147: Este X tạo bởi ancol no, đơn chức,mạch hở và axit cacboxylic không no (có 1 liên kết đôi) đơn chức, mạch hở. Đốt cháy a mol X thu được 22,4 lít CO2 (đktc) và 9 gam H2O. Giá trị của a là A. 1.

B. 2.

C. 3.

D. 0,5.

Hiển thị đáp án nCO = 22,4/22,4 = 1 mol; 2


nH O = 9/18 = 0,5 mol; 2

Este X tạo bởi ancol no, đơnn chức, mạch hở và axit cacboxylic không no (có 1 liên kết đôi C =

ọi công th thức tổng quát của X là CnH2n-2O2 C) đơn chức, mạch hở → Gọi

Ta có: → nC H n

2n-2

O2

= nCO - nH O = 1 - 0,5 = 0,5 mol 2

2

→ Đáp án D Câu 148: Đốt cháy hoàn toàn m gam este đơn chức, no, mạch hở X thu được (m+7) gam CO2 và (m-6) gam H2O. Công thức cấu tạo của X có thể là: A. HCOOCH3 C. CH3COOCH3

B. HCOOC2H5. D. HCOOC2H3.

Hiển thị đáp án Đốt hoàn toàn m gam este đơn chức, no, mạch hở X → nH O = nCO 2

2

→ nCO = nH O = 0,5 mol 2

2

BTKL: mO(X) = mX – mC - mH = 15 – 0,5.12 – 0,5.2 = 8 → nO(X) = 0,5 mol → nC : nH : nO = 0,5 : 1 : 0,5 = 1: 2:1 X là este đơn chức → X có CTPT là C2H4O2 → Đáp án A

ch hở Y thì số mol Câu 149: Khi đốt cháy hoàn toàn một este no, đơn chức, mạch CO2 sinh ra bằng số mol O2 đã phản ứng. Tên gọi của este Y là A. propyl axetat. C. etyl axetat.

B. metyl axetat. D. metyl fomat.

Hiển thị đáp án Gọi CTPT của este là Y CnH2nO2


Ta có: nO = nCO → n = 3 2

2

→ Y là metyl axetat → Đáp án B

ải dùng 2 thể tích Câu 150: Đốt cháy hoàn toàn 1 thể tích hơi este đơn chức E phải O2 (đo ở cùng điều kiện). E là A. este 2 lần este. C. metyl fomat.

B. este không no. D. etyl axetat.

Hiển thị đáp án kiện) cũng chính là tỉ lệ về số mol Tỉ lệ về thể tích (đo ở cùng điều ki → Vậy đốt cháy hoàn toàn 1 mol este đơn chức E phải dùng 2 mol O2 Gọi công thức phân tử của E là CxHyO2 (x ≥ 2) (1)

Ta có: → Bảo toàn nguyên tố O: 2nC H O + 2nO = 2nCO + nH O x

y

2

2

2

2

→ 2.1 + 2.2 = 2x + y/2 → 4x + y = 12 → 4x ≤ 12 → x ≤ 3 (2)

Từ (1) và (2) → Công thức phân tử của E là C2H4O2

áp án A, B, D → E là HCOOCH3 (metyl fomat) là este no, đơn chức, mạch hở → Loại đáp → Đáp án C


150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 1)

Câu 1: Đun nóng axit axetic với isoamylic (CH3)2CH-CH2-CH2-OH có H2SO4 đặc, xúc tác thu được isoamyl axetat (dầu chuối). Khối lượng dầu chuối thu được từ 132,35 gam axit axetic đun nóng với 200 gam rượu isoamylic có giá trị gần nhất là ( biết hiệu suất phản ứng đạt 68%) A. 192,0 gam.

B. 97,5 gam.

C. 292,5 gam.

D. 195,0 gam.

Hiển thị đáp án (CH3)2CH – [CH2]2OH

(Isoamylic) [CH2]2OCOCH3 (isoamyl axetat) + H2O

+

CH3COOH

(axit

axetic)

(CH3)2CH

naxit axetic = 132,25/60 < nisoamylic = 200/88 → nisoamylic = naxit axetic. H = 1,5 mol → misoamyl axetat = 1,5.130 = 195g. → Đáp án D Câu 2: Cho hỗn hợp X gồm ancol metylic và hai axit cacboxylic (no, đơn chức, kế tiếp nhau trong dãy đồng đẳng) tác dụng hết với Na, giải phóng ra 6,72 lít khí H2 (đktc). Nếu đun nóng hỗn hợp X (có H2SO4 đặc làm xúc tác) thì các chất trong hỗn hợp phản ứng vừa đủ với nhau tạo thành 25 gam hỗn hợp este (giả thiết phản ứng este hoá đạt hiệu suất 100%). Hai axit trong hỗn hợp X là A. CH3COOH và C2H5COOH. B. HCOOH và CH3COOH. C. C2H5COOH và C3H7COOH. D. C3H7COOH và C4H9COOH. Hiển thị đáp án Gọi 2 axit có công thức chung là RCOOH. Khi tham gia phản ứng với Na → nancol + naxit = 2nH = 0,6 mol 2

Vì các chất trong hỗn hợp phản ứng este hóa vừa đủ với nhau → naxit = nancol = 0,3 mol


→ nRCOOCH = naxit = 0,3 mol → (R + 44 + 15). 0,3 = 25 3

→15 (CH3) < R = 24,333 < 29 (C2H5) Vậy axit kế tiếp nhau là CH3COOH. → Đáp án A Câu 3: Chia 7,8 gam hỗn hợp ancol etylic và ancol đồng đẳng R-OH thành 2 phần bằng nhau. Phần 1 tác dụng với Na (dư) thu được 1,12 lít H2 (đktc). Phần 2 cho tác dụng với 30 gam CH3COOH (có mặt H2SO4 đặc). Tính tổng khối lượng este thu được, biết hiệu suất phản ứng este hoá đều bằng 80%. A. 6,48 gam.

B. 8,1 gam.

C. 8,8 gam.

D. 6,24 gam.

Hiển thị đáp án Gọi CTPT chung của hỗn hợp 2 ancol là ROH Phần 1: nH = 1,12/22,4 = 0,05 mol → nROH = 2nH = 2. 0,05 = 0,1 mol 2

2

MROH = 3,9/0,1 = 39 → R = 39 - 17 = 22 nCH COOH = 0,5 ⇒ nCH COOR = nROH = 0,1 mol 3

3

→ meste = 0,1.(15 + 44 + 22).0,8 = 6,48 g. → Đáp án A Câu 4: Khi đun nóng 25,8 gam hỗn hợp ancol etylic và axit axetic có H2SO4 đặc làm xúc tác thu được 14,08 gam este. Nếu đốt cháy hoàn toàn lượng hỗn hợp đó thu được 23,4 ml nước. Thành phần % hỗn hợp ban đầu và hiệu suất của phản ứng este hóa lần lượt là A. 53,5% C2H5OH; 46,5% CH3COOH và hiệu suất 80%. B. 55,3% C2H5OH; 44,7% CH3COOH và hiệu suất 80%. C. 60,0% C2H5OH; 40,0% CH3COOH và hiệu suất 75%.


D. 45,0% C2H5OH; 55,0% CH3COOH và hiệu suất 60%. Hiển thị đáp án

neste = 0,16 ⇒ H = 0,16/0,2 = 80%

→ Đáp án A

m HCOOH và CH3COOH (tỉ lệ mol 1:1); hỗn hợp ợp Y gồm g CH3OH Câu 5: Hỗn hợp X gồm Lấy 11,13 gam hỗn hợp X tác dụng vớii 7,52 gam hỗn h hợp và C2H5OH (tỉ lệ mol 3 : 2). Lấ Khối lượng của este thu được là (biết ế hiệu suất các Y có xúc tác H2SO4 đặc, đun nóng. Kh phản ứng este đều 75%) A. 10,89 gam.

B. 11,4345 gam.

C. 14,52 gam.

D. 11,616 gam.

Hiển thị đáp án MX = (46 + 60)/2 = 53 → R1 + 45 = 53 → R1 = 8 MY = (32.3 + 46.2)/(3 + 2) = 37,6 → R2 + 17 = 37,6 → R2 = 20,6 nX = 11,13/53 = 0,21 nY = 7,52/37,6 = 0,2 Meste = 0,2. (R1 + 44 + R2).0,75 = 0,2. 72,6. 0,75 = 10,89g. → Đáp án A

m HCOOH, CH3COOH (tỉ lệ mol 1:1), hỗn hợp ợp Y gồm g CH3OH, Câu 6: Hỗn hợp X gồm hỗn hợp X tác dụng vớii 8,08 gam hỗn h hợp Y (có C2H5OH (tỉ lệ mol 2:3). Lấyy 16,96 gam h (hiệu suất các phản ứng ng este hóa đều bằng xúc tác H2SO4 đặc) thu được m gam este (hi 80%). Giá trị của m là


A. 12,064.

B. 22,736.

C. 17,728.

D. 20,4352.

Hiển thị đáp án hh X có khối lượng mol trung bình là: (46 + 60)/2 = 53 hh Y có khối lượng mol trung bình là: (32.2 + 46.3)/5 = 40,4 nX = 16,96/53 mol; nY = 0,2 mol. → meste = 0,2.(53 + 40.4 - 18).0,8 = 12,064g → Đáp án A Câu 7: Hỗn hợp X gồm 1 axit no đơn chức., mạch hở và một axit không no đơn chức, mạch hở có một liên kết đôi ở gốc hiđrocacbon. Khi cho a gam X tác dụng hết với CaCO3 thoát ra 1,12 lít CO2 (đktc). Hỗn hợp Y gồm CH3OH và C2H5OH; khi cho 7,8 gam Y tác dụng hết Na thoát ra 2,24 lít H2 (đktc). Nếu trộn a gam X với 3,9 gam Y rồi đun nóng có H2SO4 đặc xúc tác thì thu được m gam este (hiệu suất h%). Giá trị m theo a, h là A. (a + 2,1)h %.

B. (a + 7,8)h %.

C. (a + 3,9)h %.

D. (a + 6)h %.

Hiển thị đáp án nX = 2nCO = 0,1 mol 2

7,8g Y thì → nY = 2nH = 0,2 mol → 3,9g Y thì nY = 0,1 mol 2

→ khi thực hiện phản ứng este hóa thì nX = nY ⇒ meste = mX + mY - mH O = a + 3,9 - 0,1.18 = a + 2,1 2

Nếu tính theo hiệu suất h% thì meste = (a + 2,1)h%. → Đáp án A Câu 8: Thực hiện phản ứng este hoá giữa axit axetic và hỗn hợp gồm 8,4 gam 3 ancol là đồng đẳng của ancol etylic. Sau phản ứng thu được 16,8 gam hỗn hợp ba este. Lấy


ng este hoá trên thực hiện phản ứng xà phòng hoá hoàn toàn sản phẩm của phản ứng ất phản ph ứng este với dung dịch NaOH 4M thì thu được m gam muối (Giả sử hiệu suất hoá là 100%). Giá trị của m là A. 10,0.

B. 16,4.

C. 20,0.

D. 8,0.

Hiển thị đáp án CH3COOH + CnH2n+1OH → CH3COOCnH2n+1 + H2O. Tăng giảm khối lượng:

Sản phẩm của phản ứng xà phòng hóa là CH3COONa → m = 0,2.82 = 16,4g. → Đáp án B Câu 9: Hỗn hợp M gồm m ancol no, đơn chức và axit cacboxylic đơn chức, đều mạch hở

tổng số mol của hai chất là 0,5 mol (số mol của c axit lớn và có cùng số nguyên tử C, tổ ếu đố đốt cháy hoàn toàn M thì thu được c 66 gam khí CO2 và hơn số mol của ancol). Nếu ếu đun nóng M với H2SO4 đặc để thực hiện ện phản ph ứng este 25,2 gam H2O. Mặt khác, nếu hoá (hiệu suất là 80 %) thì số gam este thu được là A. 17,10.

B. 18,24.

C. 25,65.

D. 30,40.

Hiển thị đáp án

Ta có: ⇒ Số C trong phân tử X và Y: 1,5/0,5 = 3 nCO > nH O ⇒ axit Y là axit không no ⇒ Có hai trường hợp xảy ra 2

2


TH1:

⇒ a > b ⇒ TH1 loại TH2:

C3H7OH + CH2=CH-COOH -t , xt→ CH2=CH-COOC3H7 + H2O o

⇒ nCH =CH-COOC H = nC H OH. 80% = 0,2. 80% = 0,16 mol 2

3

7

3

7

⇒ mCH =CH-COOC H = 0,16. 114 = 18,24 gam) 2

3

7

→ Đáp án B Câu 10: Thực hiện phản ứng este hoá gi giữa axit ađipic (HOOC-(CH2)4-COOH) với hợp chất có chứa chức este Y1 và à Y2 trong đó Y1 có ancol đơn chức X thu được hai h công thức phân tử là C8H14O4. Công th thức của X là A. C3H5OH.

B. CH3OH.

C. CH3OH hoặc C2H5OH.

D. C2H5OH.

Hiển thị đáp án Như vậy Y1 và Y2 có thể là este 2 chức hoặc là tạp chức của etse và axit. ∗ Nếu Y1 là este 2 chức thì có CT là: CH3OOC – (CH2)4 – COOCH3 → ancol là CH3OH ∗ Nếu Y1 là tạp chức của este và axit thì có CT là: HOOC – (CH2)4 – COOC2H5 → ancol là C2H5OH → Đáp án C Câu 11: Cho 4,6 gam ancol X tác dụng với Na dư thu được 1,12 lít H2. Cho 9,0 gam ới Na dư thu được 1,68 lít H2. Đun nóng hỗn hợp h gồm 4,6 axit hữu cơ Y tác dụng với


gam ancol X và 9,0 gam axit hữu cơ Y (xúc tác H2SO4 đặc, to) thu được 6,6 gam este ều ki kiện tiêu chuẩn, hiệu suất phản ứng tạo thành este là E. Các thể tích khí đo ở điều A. 50%

B. 60%

C. 75%

D. 80%.

Hiển thị đáp án Giả sử ancol có n chức

Giả sử axit có m chức

→ Đáp án C Câu 12: Một hỗn hợp đẳng ng mol g gồm một axit cacboxylic no đơn chức và một ancol no phần bằng nhau. Phần 1 đem đốtt cháy thu được 0,2 đơn chức. Chia hỗn hợp làm hai ph

Phần 2 đem thực hiện phản ứng ng este hóa, phản ph ứng xong mol CO2 và 0,25 mol H2O. Ph su của phản đem loại nước rồi đốtt cháy thu được 0,2 mol CO2 và 0,22 mol H2O. Hiệu suất ứng este hóa là A. 40%.

B. 45%.

C. 50%.

D. 60%.

Hiển thị đáp án Phần 1: nancol = nH O - nCO = 0,05 mol 2

2

Phần 2: Ta thấy, lượng H2O loại đii chính là số mol este tạo thành → neste = 0,25 - 0,22 = 0,03 mol → H = 0,3/0,6 = 60%


→ Đáp án D Câu 13: Hỗn hợp X gồm m 1 ancol no, đơn chức và 1 axit no, đơn chức mạch m hở. Chia X thành 2 phần bằng nhau:

n 1 ssản phẩm thu được cho qua bình nước c vôi trong dư thấy - Đốt cháy hoàn toàn phần có 30 gam kết tủa. - Phần 2 được este hoá hoàn toàn vừa đủ thu được 1 este, đốtt cháy este này thu được khối lượng H2O là A. 1,8 gam.

B. 3,6 gam.

C. 5,4 gam.

D. 7,2 gam.

Hiển thị đáp án Este thu được sẽ là este no, đơn chức mạch hở Khi đốt este này thì thu được nH O = nCO 2

2

phần nên nH O = 0,3 → mH O = 5,4 Do số C không đổi trong cả 2 phầ 2

2

→ Đáp án C

m HCOOH, CH3COOH và C2H5COOH (tỉ lệ 5:1:1). Lấy L 5,2 gam Câu 14: Hỗn hợp X gồm hỗn hợp X tác dụng vớii 5,75 gam C2H5OH (có H2SO4 đặc làm xúc tác) thu được m gam ản ứ ứng este hóa đều bằng 80%). Giá trị m là hỗn hợp este (hiệu suât phản A. 6,4. C. 6,8.

B. 8,0. D. 8,1.

Hiển thị đáp án m HCOOH, CH3COOH và C2H5COOH (tỉ lệ 5:1:1) thành RCOOH Coi hỗn hợp X gồm


PTPƯ: RCOOH + C2H5OH ⇆ RCOOC2H5 + H2O. Do nX = 0,1 mol < nC H OH = 0,125 mol. 2

5

→ neste = 0,1. 0,8 = 0,08 (mol) → meste = 0,08. ( 7 + 44 + 29) = 6,4 gam. → Đáp án A Câu 15: Thực hiện phản ứng este hoá giữa axit axetic với 2 ancol no đơn chức là đồng đẳng kế tiếp nhau thu được hỗn hợp 2 este. Đốt cháy hoàn toàn 0,1 mol hỗn hợp 2 este đó thu được 10,08 lít CO2. Công thức cấu tạo của 2 ancol là A. CH3OH và C2H5OH. B. C2H5OH và CH3CH(OH)CH3. C. C2H5OH và CH3CH2CH2OH. D. n-C3H7OH và n-C4H9OH. Hiển thị đáp án nCO = 10,08/22,4 = 0,45 mol 2

Số C trung bình trong este: nCO /neste = 4,5 2

Như vậy, số C trung bình của 2 ancol là 4,5 - 2 = 2,5. → 2 ancol là C2H5OH và C3H7OH → Đáp án C Câu 16: Để đốt cháy hoàn toàn 1 mol axit cacboxylic đơn chức X cần đủ 3,5 mol O2. Trộn 7,4 gam X với lượng đủ ancol no Y (biết tỉ khối hơi của Y so với O2 nhỏ hơn 2). Đun nóng hỗn hợp với H2SO4 làm xúc tác. Sau khi phản ứng hoàn toàn thu được 8,7 gam este Z (trong Z không còn nhóm chức nào khác). Công thức cấu tạo của Z là A. C2H5COOCH2CH2OCOC2H5. B. C2H3COOCH2CH2OCOC2H3.


C. CH3COOCH2CH2OCOCH3. D. HCOOCH2CH2OCOH. Hiển thị đáp án

nX = 0,1 mol. Giả sử ancol a (a < 3) chức. → Meste = 87a → a = 2 → Meste = 174 → C2H5COO – CH2 – CH2 – OOCC2H5. → Đáp ánA

n hợ hợp gồm một axit đơn chức và một ancol đơn chức thành 2 Câu 17: Chia 0,6 mol hỗn phần bằng nhau. Phần 1: đốt cháy hoàn toàn, thu được 39,6 gam CO2.

u suất suấ 100%). Đốt Phần 2: đun nóng với H2SO4 đặc, thu được 10,2 gam este E (hiệu cháy hết lượng E, thu được 22,0 gam CO2 và 9,0 gam H2O. Nếu biết số mol axit nhỏ hơn số mol ancol thì công thức của axit là A. C3H7COOH.

B. CH3COOH.

C. C2H5COOH.

D. HCOOH.

Hiển thị đáp án Phần 2:


Gọi số C trong axit là a, trong ancol là b Do số mol của axit nhỏ hơnn ancol nên → nancol – naxit = 0,1 mol

Mặt khác, Như vậy, sau phản ứng ancol dư 0,1

ần chính là CO2 do ancol dư tạo ra Số CO2 chênh lệch giữa 2 phần Số C trong ancol: 0,4/0,1 = 4 → C4H9OH Như vậy, số C trong axit: (0,9 - 0,2.4)/0,1 = 1 → HCOOH → Đáp án D

đa chức X có chứa vòng benzen và có công thức là Câu 18: Đun nóng mộtt axit đ c este Z thuần thu chức có (C4H3O2)n (n < 4) với một lượng dư ancol Y đơn chức thu được công thức (C6H7O2)m. Công thức ancol Y là A. CH3OH.

B. C2H5OH.

C. CH2=CH-CH2OH.

D. C3H7OH.

Hiển thị đáp án Dễ thấy, do este Z thuần chức nên số O trong este bằng số O trong axit, như vậy n = m

Số C của ancol:

Số H của ancol: Do ancol đơn chức nên ancol là C2H5OH → Đáp án B


Câu 19: Este X được tạo ra từ ancol X1 đơn chức và axit X2 đa chức có công thức đơn giản là C2H3O2. Hãy cho biết có bao nhiêu chất thoả mãn ? A. 1

B. 2

C. 3

D. 4

Hiển thị đáp án Gọi công thức là: C2nH3nO2n Dễ thấy, n phải là số chẵn (n lẻ thì số H sẽ lẻ) n = 2 → C4H6O4 → CH3OOC – COOCH3. n = 4 → C8H12O8. Chất này là este 4 chức: k = 3 < 4 → Loại → Đáp án A Câu 20: X là este tạo từ 1 axit đơn chức và ancol 2 chức. X không tác dụng với Na. Thuỷ phân hoàn toàn 0,1 mol X bằng NaOH (vừa đủ) thu được hỗn hợp sản phẩm có tổng khối lượng là 21,2 gam. Có nhiêu este thoả mãn điều kiện đó ? A. 1.

B. 2.

C. 3.

D. 4.

Hiển thị đáp án nNaOH = 2nX = 0,2 mol Bảo toàn khối lượng: mX = 21,2 – mNaOH = 13,2 → MX = 13,2/0,1 = 132 → C5H8O4 Các este thỏa mãn là: CH2(OOCH) – CH(OOCH) – CH3 CH2(OOCH) – CH2 – CH2(OOCH) → Đáp án B


hợp X gồm ancol etylic và à axit axetic tác dụng với Na dư Câu 21: Cho 28,8 gam hỗn hợ ktc). Khi đun nóng 28,8 gam hỗn hợp X có H2SO4 đặc (xúc tác) thu được 6,16 lít H2 (đktc). su của phản thu đượcc 17,6 gam este. Tính % vvề khối lượng mỗi chất trong X và hiệu suất ứng este hóa? A. 47,92% C2H5OH; 52,08% CH3COOH và hiệu suất 75% B. 47,92% C2H5OH; 52,08% CH3COOH và hiệu suất 80% C. 45,0% C2H5OH; 55,0% CH3COOH và hiệu suất 60% D. 52,08% C2H5OH; 47,92% CH3COOH và hiệu suất 70%. Hiển thị đáp án Gọi số mol của C2H5OH và CH3COOH lần lượt là x, y

Ta có hệ CH3COOH + C2H5OH ⇆ CH3COOC2H5 + H2O

suất được tính theo axit Vì nCH COOH < nC H OH nên hiệu su 3

2

5

Có neste = 0,2 mol → H = (0,2/0,25). 100% = 80% %mC H OH = (0,3.46/28,8). 100% = 47,92%; %mCH COOH = 52,08% 2

5

3

→ Đáp án B

đơ chức B, chỉ Câu 22: Cho 13,8 gam glixerol phản ứng hoàn toàn với axit hữu cơ đơn a glixerol ban đầu; thu được chất hữu cơ E có khối lượng bằng 1,18 lần khối lượng của v E? hiệu suất phản ứng là 73,35%. Có bao nhiêu công thức cấu tạo phù hợp với A. 3.

B. 4.

C. 2.

D. 5.

Hiển thị đáp án Trước hết phải tìm nhanh ra CTPT của E. Ta có: mE = 1,18. 13,8 = 16,284 gam.


phản ứng là: Có hiệu suất nên số mol glixerol ph

phản ứng ). (số mol E luôn bằng số mol glixerol ph

Vậy CTPT của E là: C5H8O5. - TH1: E là este 2 lần axit HCOOH của glixerol ( còn 1 nhóm -OH ancol). Gọi gốc HCOO- là 1; HO- là 0 và C3H5- là gốc R thì ta có 2 CTCT thỏa mãn là: R-101 và R110. - TH2: E là este 1 lần axit C3H6O2 và còn 2 nhóm HOTương tự, gọi gốc axit là 1, HO- là 0 và C3H5 là R ta có các CTCT là: R-100 và R-010.

thỏa mãn phù hợp với E. Như vậy, tổng tất cả có 4 CTCT th → Đáp án B

ợp axit axetic và etylen glicol (số mol bằng bằ nhau, có Câu 23: Đun nóng hỗn hợp được hỗn hợp X gồm 5 chất (trong đó ó có 2 chất ch chứa chức H2SO4 đặc xúc tác) thì thu đư ợng axit và ancol đã phản ứng lần lượt là 70% và 50% so este E1 và E2, ME < ME ). Lượ n % về khối lượng của E1 trong hỗn hợp X là với ban đầu. Thành phần 1

2

A. 51,656%.

B. 23,934%.

C. 28,519%.

D. 25,574%.

Hiển thị đáp án X gồm 5 chất: H2O, (CH3COO)(OH)C2H4 (E1), (CH3COO)2C2H4(E2), CH3COOH dư, d C2H4(OH)2 Coi hỗn hợp ban đầu có: nCH COOH = nC H (OH) số mol axit phản ứng là 0,7mol và số mol acol phản ứng là 0,5mol 3

Gọi nE = a, nE = b 1

2

2

4

2


→ Ta có Hệ PT: mX = maxit + mancol = 60 + 62 = 122 gam

→ Đáp án D Câu 24: Cho hỗn hợp X gồm ồm 2 axit (no, đơn chức, đồng đẳng kế tiếp) ếp) và ancol etylic un nóng hỗn h hợp X phản ứng hết với Na giảii phóng ra 4,48 lít H2 (đktc). Mặt khác nếu đun chất trong hỗn hợp X phản ứng với v nhau vừa (có H2SO4 đậm đặc làm xúc tác) thì các ch

hỗn hợp este (giả sử các phản ứng đều đạt đạ hiệu suất đủ và tạo thành 16,2 gam h a 2 axit lầ lần lượt là 100%). Công thức của A. C6H13COOH và C7H15COOH. B. CH3COOH và C2H5COOH. C. C3H7COOH và C4H9COOH. D. HCOOH và CH3COOH. Hiển thị đáp án X: nH = 0,2 mol 2

Vì 2 chất phản ứng vừa đủ tạo ạo este nên naxit = nancol = neste = 0,2 mol → MRCOOC H = 16,2/02 = 81 → R = 8 2

5

→ HCOOH, CH3COOH → Đáp án D Câu 25: Hỗn hợp X gồm m axit axetic và etanol. Chia X thành ba phần bằng ằng nhau: • Phần 1 tác dụng với Kali dư thấy có 3,36 lít khí thoát ra. • Phần 2 tác dụng với Na2CO3 dư thấy có 1,12 lít khí CO2 thoát ra. Các thể tích khí đo ở đktc.


• Phần 3 được thêm vào vài giọt dung dịch H2SO4, sau đó đun sôi hỗn hợp một thời gian. Biết hiệu suất của phản ứng este hoá bằng 60%. Khối lượng este tạo thành là A. 8,80 gam.

B. 5,20 gam.

C. 10,56 gam.

D. 5,28 gam.

Hiển thị đáp án nCH COOH = 3a mol; nC H OH = 3b mol. 3

2

5

- Phần 1: nH = 3,36/22,4 = 0,15 mol. 2

nCH COOH + nC H OH = a + b = 0,15 × 2 = 0,3 mol. 3

2

5

- Phần 2: nCO = 1,12/2,24 = 0,05 mol. 2

nCH COOH = a = 0,05.2 = 0,1 mol → b = 0,2 mol. 3

- Phần 3: CH3COOH + C2H5OH ⇆ CH3COOC2H5 + H2O. → mCH COOC H = 0,1.88.(60/100) = 5,28g 3

2

5

→ Đáp án D Câu 26: Cho hỗn hợp X gồm 1 ancol đơn chức no và 1 ancol đơn chức phân tử có 1 liên kết đôi, có khối lượng m gam. Khi nạp m gam hỗn hợp vào 1 bình kín Y dung tích 6 lít và cho X bay hơi ở 136,5oC. Khi X bay hơi hoàn toàn thì áp suất trong bình là 0,28 atm. Nếu cho m gam X este hóa với 45 gam axit axetic thì hiệu suất phản ứng đạt H%. Tổng khối lượng este thu được theo m và H là: A. [(2m + 4,2)H]/100 B. [(1,5m + 3,15)H]/100 C. [(m + 2,1)H]/100 D. [(m + 3)H]/100. Hiển thị đáp án


Vậy, hiệu suất tính theo ancol. Số mol ancol và axit phản ứng là 0,05.0,01H → Số mol H2O tạo thành cũng là 0,05.0,01H mol Khối lượng este thu được là: meste = m.0,01H + 0,05.0,01.H.60 – 0,01.0,05.H.18 = [(m + 2,1).H]/100 → Đáp án C

n hợ hợp H gồm hai axit hữu cơ chức X, Y là đồng đẳng kế tiếp Câu 27: Đun 0,08 mol hỗn ợp este với hiệu (MX < MY) với một lượng dư ancol metylic thu được 2,888 gam hỗn hợp suất 50% tính từ X và 40% tính từ Y. Công thức cấu tạo của X và Y lần lượt là A. HCOOH và CH3COOH. B. CH3COOH và CH3CH2COOH. C. CH2=CHCOOH và CH2=C(CH3)COOH. D. CH3CH2COOH và CH3CH2CH2COOH. Hiển thị đáp án Gọi phân tử khối của X là M thì của Y là M + 14 (M ≥ 46). ta có hệ phương trình:

Chặn khoảng giá trị củaa M ta có:

4(x + y)M + 112(x + y) < 28,88 (do Mx ≥ 46x) → M < 62,25 5(x + y)M + 66(x + y) > 28,88 (do - My ≤ - 46y) → M > 59.


Như vậy, chỉ duy nhấtt M = 60 ứng với axit axetic CH3COOH thỏa mãn → còn lại là C2H5COOH. → Đáp án B

anđehit C2H4(CHO)2 trong điều kiện n thích hợp h thu được Câu 28: Oxi hóa hoàn toàn an ung nóng hỗn hợp gồm 1 mol X và 1 mol ancol metylic (xúc tác hợp chất hữu cơ X. Đung với tỉ lệ khối lượng là 1,81. Biết chỉ có 72 % lượng ancol H2SO4 đặc) thu đượcc 2 este vớ chuyển hóa thành este. Vậy số mol của hai este có thể là A. 0,30 và 0,20.

B. 0,36 và 0,18.

C. 0,24 và 0,48.

D. 0,12 và 0,24.

Hiển thị đáp án nancol phản ứng = 0,72 mol

→ a + 2b = 0,72

→ a = 0,1685, b = 0,2757 → Đáp án B Câu 29: Cho 4 mol axit axetic tác d dụng với hỗn hợp chứa a 0,5 mol glixerol và 1 mol n ớc biết rằng etylen glicol (xúc tác H2SO4). Tính khối lượng sản phẩm thu được ngoài nư

phản ứng. có 50% axit và 80% mỗii ancol ph A. 170,4 g.

B. 176,5 g.

C. 156,7 g.

D. 312 g.

Hiển thị đáp án


Ta có cho axit axetic tác dụng với glixerol và etilenglicol tạo sản phẩm. 2CH3COOH + HO-CH2-CH2-OH → CH3COOCH2CH2OOCCH3 + 2H2O 3CH3COOH + HO-CH2-CH2-OH → HO-CH2CH2OOCCH3 + H2O → C3H5(OOCCH3)3 + 3H2O 2CH3COOH + HO-CH2-CH2-OH → C3H5(OH)(OOCCH3)2+ 2H2O CH3COOH + C3H5(OH)3 → C3H5(OH)2(OOCCH3) + H2O Nhận thấy nH O = nCH COOH phản ứng = 0,5. 4 = 2 mol 2

3

Bảo toàn khối lượng → msản phẩm = 2. 60 + 0,5. 0,8. 92 + 0,8.1. 62 - 2. 18 = 170,4 gam → Đáp án A Câu 30: Thực hiện phản ứng este hoá giữa etilen glicol với một axit cacboxylic X thu được este có công thức phân tử là C8H10O4 . Nếu cho 0,05 mol axit X phản ứng với 250 ml dung dịch KOH 0,16M. Cô cạn dung dịch sau phản ứng thu được chất rắn có giá trị m gam, m nhận giá trị nào sau đây: A. 3,76 gam.

B. 3,80 gam.

C. 4,40 gam.

D. 5,12 gam.

Hiển thị đáp án Xét este: π + v = (8.2 + 2 - 10)/2 = 4 Như vậy, axit là đơn chức và có 1 liên kết π trong mạch C. Công thức X là: C2H3COOH nKOH = 0,4 mol Như vậy, dung dịch sau phản ứng với KOH chứa 0,04 mol muối và 0,01 mol axit dư. Khi cô cạn: m = 0,04.110 = 4,4 gam. → Đáp án C Câu 31: Hỗn hợp M gồm ancol no, đơn chức X và axit cacboxylic Y, đều mạch hở và có cùng số nguyên tử cacbon. Tổng số mol của hỗn hợp M là 0,5mol (số mol X nhỏ


ktc) và 25,2 gam H2O. hơn số mol Y). Nếu đốtt cháy hoàn toàn M thu được khí CO2 (đktc) un nóng M vớ với H2SO4 đặc để thực hiện phản ứng ng este hóa với v hiệu Mặt khác, nếu đun ng este thu được là suất là 75%. Khối lượng B. 25,65 gam

A. 22,80 gam.

D. 18,24 gam.

C. 17,1 gam. Hiển thị đáp án

Ta có: ⇒ Số C trong phân tử X và Y: 1,5/0,5 = 3 nCO > nH O ⇒ axit Y là axit không no ⇒ Có hai trường hợp xảy ra 2

2

TH1:

⇒ a > b ⇒ TH1 loại TH2:

C3H7OH + CH2=CH-COOH → CH2 = CH – COOC3H7 + H2O → nCH -CH-COOC H = nC H OH.75% = 0,2.75% = 0,15 mol 2

3

7

3

7

→ mCH -CH-COOC H = 0,15. 144 = 17,1 g 2

3

7

→ Đáp án C

đơ chức. Trong Câu 32: Este X được tạo thành từ etylen glicol và hai axit cacboxylic đơn nhiều hơn số nguyên tử oxi là 1. Khi cho m gam X phân tử este, số nguyên tử cacbon nhi


tác dụng với dung dịch NaOH (dư) thì lượng NaOH đã phản ứng là 10 gam. Giá trị của m là A. 17,5.

B. 14,5.

C. 15,5.

D. 16,5.

Hiển thị đáp án Gọi CTPT của X là R1COO-CH2CH2-OOCR2 Trong X thì số C nhiều hơn số O là 1 → Số C trong X là 5 nNaOH = 10/40 = 0,25 mol → X: HCOO-CH2CH2-OOCCH3 HCOO-CH2CH2-OOCCH3 (0,125) + 2NaOH (0,25) → HCOONa + CH3COONa + HOCH2CH2OH → mX = 0,125.132 = 16,5 gam. → Đáp án D Câu 33: E là este của một axit đơn chức và ancol đơn chức. Để thủy phân hoàn toàn 6,6 gam chất E phải dùng 34,1 ml dung dịch NaOH 10% (d = 1,1 g/ml). Lượng NaOH này dùng dư 25% so với lượng NaOH phản ứng. Công thức cấu tạo đúng của E là: A. CH3COOCH3 C. CH3COOC2H5

B. HCOOC3H7 D. Cả B và C đều đúng

Hiển thị đáp án Ta có: mNaOH đem dùng = (34,1. 1,1. 10)/100 = 3,751 (gam) mNaOH phản ứng = (3,751. 100)/(100 + 25) = 3 (gam) → ME = 88 gam → R + 44 + R’ = 88 → R + R’ = 44 - Khi R = 1 → R’ = 43 (C3H7) → CTCT (E): HCOOC3H7 (propyl fomiat) - Khi R = 15 → R’ = 29 → CTCT (E): CH3COOC2H5 (etyl axetat)


→ Đáp án D Câu 34: Có 2 este có đồng phân của nhau và đều do các axit no, đơn chức và rượu no, đơn chức tạo thành. Để xà phòng hóa 22,2 gam hỗn hợp 2 este nói trên phải dùng vừa hết 12gam NaOH nguyên chất. Công thức phân tử của 2 este là: A. HCOOC2H5 và CH3COOCH3 B. C2H5COOCH3 và CH3COOCH3 C. CH3COOCH5 và HCOOC3H7 D. Không xác định được Hiển thị đáp án Các phương trình phản ứng xà phòng hóa 2 este có dạng: RCOOR’ + NaOH → RCOONa + R’OH R’’COOR’’’ + NaOH → R’’COONa + R’’’OH Hai este là đồng phân của nhau nên có cùng phân tử khối và có chung công thức tổng quát của este no đơn chức là CnH2nO2 Đặt x và y là mỗi số mol este trong 22,2 gam hỗn hợp Tỉ lệ mol trong phương trình là 1 : 1 nên: nNaOH = neste = x + y = 0, 3 mol Mx + My = 22,2 hay M(x + y) = 22,2. Vậy M = 22,2/0,3 = 74 CnH2nO2 = 72 → n = 3. Công thức đơn giản của 2 este là C3H6O2 Có 2 đồng phân là: HCOOC2H5 và CH3COOCH3 → Đáp án A Câu 35: Este đơn chức X có tỉ khối hơi so với CH4 là 6,25. Cho 20 gam X tác dụng với 300 ml dung dịch KOH 1M (đun nóng). Cô cạn dung dịch sau phản ứng thu được 28 gam chất rắn khan. Công thức cấu tạo của X là


A. CH3-CH2-COO-CH=CH2. B. CH2=CH-COO-CH2-CH3. C. CH2=CH-CH2- COO -CH3. D. CH3-COO-CH=CH-CH3. Hiển thị đáp án - Từ tỉ khối ta suy ra MX =100 → CTPT của este X đơn chức là C5H8O2 - Ta có: nX = 0,2 mol ; nKOH = 0,3 mol. - Đặt CTTQ của X là: RCOOR’ - Tìm gốc R + Ta có: nKOH phản ứng = nRCOOH = nX = 0,2mol → nKOH dư = 0,1 mol mà

ấu ttạo của X là CH3-CH2-COO-CH=CH2. → R là C2H5. Vậy công thức cấu → Đáp án A

ữu cơ A chỉ chứa 1 loại nhóm chức tác dụng ụng với v 1 lit dung Câu 36: Cho 21,8g chất hữu muối của axit hữu cơ X và 0,1 mol ancol Y. Lư L ợng dịch NaOH 0,5M thu được 24,6g mu NaOH dư có thể trung hòa hết 0,5 lit dung dịch HCl 0,4M. Tổng khối lượng mol của X và Y là : A. 132

B. 152

C. 272

D. 174

Hiển thị đáp án nNaOH phản ứng = 0,5 - 0,5. 0,4 = 0,3 mol → nNaOH : nancol = 3 : 1 → Y là ancol ba chức. Giả sử A là (RCOO)3R1 MRCOONa = MR + 67 = 82 → MR = 15 → R là CH3 → X là (CH3COO)3R1


MX = 59.3 + MR = 218 → MR = 41 → R1 là C3H5 1

1

Vậy X là CH3COONa, Y là C3H5(OH)3 → MX + MY = 82 + 92 = 174. → Đáp án D Câu 37: Hỗn hợp X gồm axit stearic, axit panmitic và triglixerit của axit stearic, axit panmitic. Đốt cháy hoàn toàn m gam X, thu được 6,72 lít CO2 (đktc) và 5,22 gam H2O. Xà phòng hóa m gam X (hiệu suất = 90%), thu được a gam glixerol. Giá trị của a là A. 0,414.

B. 1,242.

C. 0,828.

D. 0,460.

Hiển thị đáp án nCO = 0,3 mol; nH O = 0,29 mol. 2

2

Vì một phân tử chất béo đề bài cho có 3 liên kết đôi → 2nchất béo = nCO - nH O = 0,01 mol → nglixerol = 0,005 mol 2

2

Với hiệu suất 90% có m = 0,005. 92. 90% = 0,414 gam → Đáp án A Câu 38: Cho vào ống nghiệm 2 ml etyl axetat, sau đó thêm tiếp 1 ml dung dịch NaOH 30% quan sát hiện tượng (1); lắp ống sinh hàn đồng thời đun sôi nhẹ trong khoảng 5 phút, quan sát hiện tượng (2). Kết quả hai lần quan sát (1) và (2) lần lượt là A. Sủi bọt khí, chất lỏng tách thành hai lớp. B. Chất lỏng đồng nhất, chất lỏng tách thành hai lớp. C. Chất lỏng tách thành hai lớp, chất lỏng đồng nhất. D. Chất lỏng tách thành hai lớp, chất lỏng tách thành hai lớp. Hiển thị đáp án Câu 39: Cho các phản ứng: (1) X + NaOH -t → Y + Z o


(2) Y + NaOH (rắn) -CaO, t → CH4 + Y1 o

(3) CH4 -1500 C.11n→ Q + H2 o

(4) Q + H2O -t , xt→ Z o

Dùng hóa chất gì để phân biệt X và metyl fomiat? A. Quỳ tím. B. Dung dịch Br2. C. Dung dịch AgNO3/NH3. D. Dung dịch AgNO3/NH3 hoặc dung dịch Br2 Hiển thị đáp án CH3COOCH=CH2 (X) + NaOH → CH3COONa (Y) + CH3CHO(Z) CH3COONa + NaOH → CH4 + Na2CO3 (Y1) CH4 -1500 C→ CH≡CH (Q)+ H2 o

CH≡CH + H2O → CH3CHO metyl fomiat: HCOOCH3 tham gia phản ứng tráng bạc còn X thì không tham gia → Đáp án C Câu 40: Cho sơ đồ chuyển hóa sau : (1) C4H6O2 (M) + NaOH -t → (A) + (B) o

(2) (B) + AgNO3 + NH3 + H2O -t → (F)↓ + Ag + NH4NO3 o

(3) (F) + NaOH -t → (A)↑ + NH3 + H2O o

Chất M là: A. HCOO(CH2)=CH2. C. HCOOCH=CHCH3.

B. CH3COOCH=CH2. D. CH2=CHCOOCH3.


Hiển thị đáp án - Các phản ứng xảy ra: (1) CH3COOCH=CH2 (M) + NaOH -t → CH3COONa (A) + CH3CHO (B) o

(2) CH3CHO (B) + AgNO3 + NH3 -t → CH3COONH4 (F) + Ag↓ + NH4NO3 o

(3) CH3COONH4 (F) + NaOH -t → CH3COONa (A) + NH3 + H2O o

→ Đáp án B 150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 2)

Câu 41: Este X có công thức phân tử C4H8O2 thỏa mãn các điều kiện sau: X + H2O -t , H SO4 đặc→ Y1 + Y2 o

2

Y1 + O2 -t , xt→ Y2 + H2O o

Tên gọi của X là A. metyl propionat. C. etyl axetat.

B. isopropyl fomat. D. n-propyl fomat.

Hiển thị đáp án Từ 2 phương trình → Y1 và Y2 đều có số nguyên tử C bằng nhau. Mà este ban đầu là C4H8O2 → X là CH3COOC2H5 hay etyl axetat → Đáp án C Câu 42: Este X được tạo thành từ axit oxalic và hai ancol đơn chức. Trong phân tử X, số nguyên tử cacbon nhiều hơn số nguyên tử oxi là 1. Khi cho m gam X tác dụng với dung dịch NaOH dư, sau khi phản ứng hoàn toàn có 9,6 gam NaOH đã phản ứng. Giá trị của m là A. 17,5.

B. 31,68.

C. 14,5.

D. 15,84.

Hiển thị đáp án


Este X được tạo thành từ axit oxalic và hai ancol đơn chức có dạng ROOC-COOR' Trong phân tử este, số nguyên tử cacbon nhiều hơn số nguyên tử oxi là 1 → số nguyên tử C trong este là 5 Vậy X có công thức C2H5OOC-COOCH3 C2H5OOC-COOCH3 + 2NaOH → C2H5OH + NaOOC-COONa + CH3OH neste = 0,5nNaOH = 0,12 mol → m = 15,84 gam → Đáp án D Câu 43: Cho sơ đồ phản ứng: (1) X (C5H8O2) + NaOH → X1 (muối) + X2 (2) Y (C5H8O2) + NaOH → Y1 (muối) + Y2 Biết X1 và Y1 có cùng số nguyên tử cacbon; X1 có phản ứng với nước brom, còn Y1 thì không. Tính chất hóa học nào giống nhau giữa X2 và Y2? A. Bị khử bởi H2 (to, Ni). B. Tác dụng được với dung dịch AgNO3/NH3 (to). C. Bị oxi hóa bởi O2 (xúc tác) thành axit cacboxylic. D. Tác dụng được với Na. Hiển thị đáp án X có CTPT C5H8O2 → k = π + v = 2 = πCO + πC=C X1 và Y1 có cùng số nguyên tử cacbon; X1 có phản ứng với nước brom, còn Y1 thì không → X1 chứa liên kết đôi C=C. → X có cấu tạo CH2=CHCOOC2H5 CH2=CHCOOC2H5 + NaOH → CH2=CHCOONa (X1) + C2H5OH (X2) Y có cấu tạo C2H5COOCH=CH2


C2H5COOCH=CH2 + NaOH → C2H5COONa (Y1) + CH3CHO (Y2) Chỉ có Y2 tham gia phản ứng với H2 và AgNO3/NH3 → loại A, B Chỉ có X2 tác dụng với Na → loại D C2H5OH + O2 -men giấm→ CH3COOH + H2O 2CH3CHO + O2 -Mn , t → 2CH3COOH +

o

→ Đáp án C Câu 44: Cho các nhận định sau: (1) Axit béo là các axit monocacboxylic có mạch cacbon dài không phân nhánh và có chẵn nguyên tử cacbon (12C-24C). (2) Chất béo là trieste của glixerol với các axit béo. (3) Lipit gồm nhiều loại: chất béo, sáp, steroit, photpholipit, …. (4) Chất béo chứa các gốc axit béo không no thường là các chất rắn ở nhiệt độ thường. (5) Phản ứng thủy phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. (6) Khi đun chất béo lỏng với hiđro có xúc tác Ni trong nồi hấp thì chúng chuyển thành chất béo rắn. Số nhận định đúng là A. 4.

B. 3.

C. 5.

D. 2.

Hiển thị đáp án Nhận định đúng là: (1); (2); (3); (6). (4) Chất béo chứa các gốc axit béo không no thường là các chất lỏng ở nhiệt độ thường. Chất béo chứa các gốc axit béo no thường là các chất rắn ở nhiệt độ thường.


ất béo trong môi trường kiềm (hay phản ứng xà phòng hóa) là phản (5) Phản ứng thủy phân chất ứng một chiều. → Đáp án A Câu 45: Thủy phân hoàn toàn chất béo X sau phản ứng thu được axit oleic (C17H33COOH) và axit linoleic (C17H31COOH). Nếu đốt cháy hoàn toàn m gam X cần ng vừa vừ đủ với V ml 76,32 gam oxi thu đượcc 75,24 gam CO2. Mặt khác m gam X tác dụng Br2 1M. Giá trị của V là A. 120.

B. 150.

C. 360.

D. 240.

Hiển thị đáp án nO = 2,385 mol; nCO = 1,71 mol 2

2

CTPT của X là C57H2yO6 Bảo toàn electron và bảo toàn nguyên tố cacbon:

rocacbon) 4.2,385 = (216 + 2y).(1,71/57) → X là C57H102O6 (7 – 3 = 4π trong gốc hiđrocacbon) → nBr = 0,12 mol → V = 0,12 lít = 120 ml 2

→ Đáp án A Câu 46: Hợp chất hữu cơ A có chứa C, H, O, N với mC : mH : mO : mN = 9:2,25:8:3,5. MA = 91. Cho A tác dụng với NaOH thu được muối B và khí C bay ra. B ng 4. Xác định khối tác dụng được vớii vôi tôi xút thu được khí có tỉ khối so với He bằng lượng mol phân tử chất C. A. 42

B. 60

C. 45

D. 31

Hiển thị đáp án mC : mH : mO : mN = 9 : 2,5 : 8 : 3,5


Mà MA = 91 → A có công thức C3H9O2N B tham gia phản ứng vôi tôi xút tạo chất khí có M = 16 (CH4) → B có cấu tạo CH3COONa → A có cấu tạo CH3COONH3CH3 + NaOH → CH3COONa (B) + CH3NH2 (C) + H2O → Khối lượng mol phân tử chất C là 31. → Đáp án D Câu 47: Cho các phàn ứng sau: (1) X + 2NaOH -t → 2Y + H2O o

(2) Y + HCl loãng → Z + NaCl Biết X là hợp chất hữu cơ mạch hở, có công thức C4H6O5. Cho 11,4 gam Z tác dụng với Na dư thì khối lượng muối rắn thu được là? A. 18 gam.

B. 16,58 gam.

C. 15,58 gam.

D. 20 gam.

Hiển thị đáp án X + 2NaOH → 2Y + H2O → X vừa có nhóm este vừa có nhóm axit X là HO-CH2-COO-CH2-COOH Y là HO-CH2-COONa Z là HO-CH2-COOH có nZ = 0,15 mol HO-CH2-COOH + 2Na → NaO-CH2-COONa + H2 → mmuối = 18g → Đáp án A


Câu 48: Thủy phân hoàn toàn 89 gam chất béo bằng dung dich NaOH để điều chế xà phòng thu được 9,2 gam glixerol. Biết muối của axit béo chiếm 60% khối lượng xà phòng thu được là? A. 153 gam

B. 58,92 gam

C. 55,08gam.

D. 91,8 gam

Hiển thị đáp án nNaOH = 2nGlixerol = 0,3 mol Bảo toàn khối lượng: mchất béo + mNaOH - mGlixerol = mmuối = 91,8 g ⇒ mxà phòng = 153 g → Đáp án A Câu 49: Một este đơn chức X tác dụng vừa đủ với dung dịch KOH có C% = 11,666%. Sau phản ứng thu được dung dịch Y, cô cạn Y thì phần hơi chỉ có H2O với khối lượng là 86,6 gam. Còn lại chất rắn Z với khối lượng là 23 gam. Số công thức cấu tạo của este là: A. 2.

B. 5.

C. 3.

D. 4.

Hiển thị đáp án Cô cạn Y chỉ thu được H2O ⇒ X là este của phenol. Đặt nX = x. → nKOH = 2x mol; nnước sản phẩm = x mol → mnước/dung dịch KOH = 848x. ⇒ ∑mnước = 848x + 18x = 86,6(g) → x = 0,1 mol. Bảo toàn khối lượng ta có: mX = 23 + 0,1.18 – 0,2.56 = 13,6(g) → MX = 136 → X là C8H8O2. Các CTCT thỏa mãn là CH3COOC6H5 và o, m, p – CH3C6H4OOCH → Đáp án D


ạch hở h E bằng 26 Câu 50: Xà phòng hoá hoàn toàn m gam một este no, đơn chức, mạch ch MOH 28% (M là kim loại kiềm). Cô cạn hỗn hợp p sau phản ph ứng thu gam dung dịch ng X và 10,08 gam chất rắn khan Y. Đốtt cháy hoàn toàn Y, thu được 24,72 gam chất lỏng ặt khác, cho X tác được sản phẩm gồm CO2, H2O và 8,97 gam muối cacbonat khan. Mặt mu trong Y dụng với Na dư, thu đượcc 12,768 lít khí H2 (đktc). Phần trăm khối lượng muối có giá trị gần nhất với A. 67,5.

B. 85,0.

C. 80,0.

D. 97,5.

Hiển thị đáp án

→ CTPT E: C4H8O2 → CTCT E: HCOOC3H7 M trong MOH chuyển hết vào muối cacbonat (M2CO3)

→ Đáp án B Câu 51: Cho 1 gam este X có công thức HCOOCH2CH3 tác dụng với ới nước (xúc tác axit H2SO4 loãng). Sau một thời gian, để trung hòa axit hữu cơ sinh ra cần đúng 45 ml ệ ph phần trăm este chưa bị thủy phân là dung dịch NaOH 0,1M. Tỉỉ lệ A. 33,3%. C. 60%.

B. 50%. D. 66,7%.


Hiển thị đáp án nHCOOCH CH = 1/74 mol; nNaOH để trung hòa axit = 0,1.0,045 = 0,0045 mol 2

3

HCOOH (x) + NaOH (0,0045) → HCOONa + H2O Vì NaOH phản ứng vừa đủ → x = 0,0045 mol Số mol este chưa bị thủy phân là: 1/74 - x = 1/74 - 0,0045 mol

thủy phân: → Tỉ lệ phần trăm este chưa bị th

→ Đáp án D

ết 6,24 gam h hỗn hợp X gồm hai este đơn chức mạch m hở (tạo Câu 52: Để thủy phân hết ra từ một axit cacboxylic và hai ancol) và một este ba chức mạch hở thì cần dùng vừa ch NaOH aM. Sau ph phản ứng, thu được hỗn hợp Y gồm ồm các muối mu của hết 64 ml dung dịch các axit cacboxylic và các ancol. Đốt cháy hoàn toàn hỗn hợp Y thì thu được muối ktc) và 4,68 gam H2O. a gần với giá trị nào sau đây đ nhất? cacbonat, 5,152 lít CO2 (đktc) A. 1,26

B. 1,3

C. 1,1

D. 1,21

Hiển thị đáp án Có nCO = 5,152/22,4 = 0,23 mol, nH O = 4,68/18 = 0,26 mol, nNaOH = 0,064a mol 2

2

→ nNa CO = 0,032a mol 2

3

Có nCOO = nNaOH = 0,064 a mol → nO(X) = 2.0,064a = 0,128a Bảo toàn nguyên tố C → nC(X) = 0,23 + 0,032a mol


Bảo toàn nguyên tố H → nH(X) = 0,26.2 - 0,064a = 0,52- 0,064a Có 6,24 = mC + mH + mO → 6,24 = 12.( 0,23 + 0,032a) + 0,52 - 0,064a + 0,128a → a = 1,25 → Đáp án A

m phenyl axetat, metyl benzyloat, benzyl fomat và etyl phenyl Câu 53: Hỗn hợp X gồm oxalat. Thủy phân hoàn toàn 36,9 gam X trong dung dịch NaOH (dư, đun nóng), có 0,4 ợc m gam hỗn hợp muối và 10,9 gam hỗn hợp hợ Y gồm các mol NaOH phản ứng, thu đượ ụng vvới Na dư, thu được 2,24 lít khí H2 (đktc). đktc). Giá trị của m ancol. Cho toàn bộ Y tác dụng là A. 40,2. C. 42.

B. 49,3. D. 38,4.

Hiển thị đáp án CH3COOC6H5 (M = 136): a mol C6H5COOCH3 (M = 136): b mol HCOOCH2C6H5 (M = 136): c mol

(M = 194): d mol Khi phản ứng vớii NaOH ta thu được m gam muối và 10,9 gam ancol

Từ đề bài ta có hệ phương trình sau:


→ mmuối = mCH COONa + mC H COONa + m(COONa) + mHCOONa + mC H ONa 3

6

5

2

6

5

→ mmuối = 0,05.82 + 0,1.144 + 0,05.134 + 0,05.68 + (0,05 + 0,05).116 = 40,2 gam → Đáp án A

ồm 2 axit (no, đơn chức, đồng đẳng kế tiếp) ếp) và ancol etylic Câu 54: Cho hỗn hợp X gồm un nóng hỗn h hợp X phản ứng hết với Na giảii phóng ra 4,48 lít H2 (đktc). Mặt khác nếu đun ới nhau vừa v đủ và (có H2SO4 đặc làm xúc tác) thì các chất trong hỗn hợp X phản ứng với ợp este (gi (giả sử các phản ứng đều đạtt hiệu hiệ suất 100%). tạo thành 16,2 gam hỗn hợp Công thức của 2 axit lần lượt là: A. CH3COOH và C2H5COOH. B. C3H7COOH và C4H9COOH. C. HCOOH và CH3COOH. D. C6H13COOH và C7H15COOH. Hiển thị đáp án ng este hóa axit và ancol phản ứng vừa đủ với nhau Khi thực hiện phản ứng → naxit = nancol nH = 4,48/22,4 = 0,2 mol → nX = 2.nH = 2. 0,2 = 0,4 mol 2

→ 2 axit là: HCOOH và CH3COOH → Đáp án C

2


Câu 55: Cho 14,8 gam một hỗn hợp gồm 2 este đồng phân của nhau bay hơi ở điều kiện thích hợp. Kết quả thu được một thể tích hơi đúng bằng thể tích của 6,4 gam oxi trong cùng điều kiện như trên. Khi đốt cháy hoàn toàn hỗn hợp hai este trên, thu được sản phẩm phản ứng là CO2 và H2O, tỉ lệ thể tích khí CO2 và hơi H2O là 1:1. Xác định công thức cấu tạo của 2 este. A. CH3COOCH3 và HCOOC2H5. B. HCOOC3H7 và CH3COOC2H5. C. HCOOC3H7 và C2H5COOCH3. D. HCOOC3H7 và CH3COOCH3. Hiển thị đáp án Theo bài ra: Khi đốt cháy hoàn toàn hỗn hợp hai este trên thu được sản phẩm phản ứng là CO2 và H2O có: VCO = VH O → nCO = nH O → 2 este là no, đơn chức, mạch hở 2

2

2

2

Gọi công thức tổng quát của 2 este đồng phân là CnH2nO2 (n ≥ 2) Thể tích hơi của 14,8 gam este bằng thể tích hơi của 6,4 gam O2 → neste = nO = 6,4/32 = 0,2 mol 2

→ Meste = 14,8/0,2 = 74 → 14n + 32 = 74 → n = 3 → Công thức phân tử của 2 este là C3H6O2 → Công thức cấu tạo của 2 este là CH3COOCH3 và HCOOC2H5 → Đáp án A Câu 56: Hỗn hợp X gồm vinyl axetat, metyl axetat và etyl fomat. Đốt cháy hoàn toàn 3,08 gam X, thu được 2,16 gam H2O. Phần trăm số mol của vinyl axetat trong X là (đổi đề bài) A. 25%. C. 72,08%. Hiển thị đáp án

B. 27,92%. D. 75%.


nH O = 2,16/18 = 0,12 mol 2

→ 86x + 74y = 3,08 (1) Đặt công thức chung củaa ba chất là CxH6O2.

Sơ đồ phản ứng: → x + y = 0,04 (2) Từ (1) và (2) ta có hệ phương trình:

→ Phần trăm về số mol củaa vinyl axetat là:

%nCH COOCH=CH 3

2

→ Đáp án A Câu 57: Hỗn hợp A gồm m 2 este đơn chức, no, mạch hở đồng ng phân. Khi trộn tr 0,1 mol m gồm gồ CO2 và hơi hỗn hợp A với O2 vừa đủ rồi đốt cháy thu được 0,6 mol sản phẩm nước. Công thức phân tử 2 este là A. C4H8O2.

B. C5H10O2.

C. C3H6O2.

D. C3H8O2.

Hiển thị đáp án m 2 este đơn chức, no, mạch hở cho: Khi đốt cháy hỗn hợp A gồm nCO = nH O = 0,6/2 = 0,3 mol 2

2

→ Trong 0,1 mol A có 0,3 mol C và 0,6 mol H


→ Trong 1 mol A có 3 mol C và 6 mol H → Công thức phân tử của 2 este có dạng C3H6Ox Vì 2 este đơn chức → x = 2 → Công thức phân tử của 2 este là C3H6O2 → Đáp án C Câu 58: Đốt cháy hoàn toàn 0,1 mol este X thu được 0,3 mol CO2 và 0,3 mol H2O. Nếu cho 0,1 mol X tác dụng hết với NaOH thì thu được 8,2 gam muối. Công thức cấu tạo của X là A. CH3COOCH3. C. CH3COOC2H5.

B. HCOOCH3. D. HCOOC2H5.

Hiển thị đáp án Ta có: nCO = nH O = 0,6/2 = 0,3 mol 2

2

→ Este no, đơn chức, mạch hở → Trong 0,1 mol X có 0,3 mol C và 0,6 mol H → Trong 1 mol X có 3 mol C và 6 mol H → Công thức phân tử của este X đơn chức là C3H6O2 Khi X tác dụng với NaOH thu được muối có dạng RCOONa → nRCOONa = nX = 0,1 mol → MRCOONa = 8,2/0,1 = 82 → MR = 15 → R là CH3 → Muối là CH3COONa → Công thức cấu tạo của X là CH3COỌCH3 → Đáp án A Câu 59: Đốt cháy hoàn toàn một lượng hỗn hợp hai este X cho sản phẩm cháy qua bình đựng P2O5 dư thấy khối lượng bình tăng thêm 6,21 gam, sau đó cho qua dung dịch Ca(OH)2 dư thu được 34,5 gam kết tủa. Các este nói trên thuộc loại A. no, đơn chức, mạch hở.


ạch h hở. B. không no, đơn chức, mạch C. no, đơn chức, mạch vòng.

ạch vòng. D. không no, đa chức, mạch Hiển thị đáp án nCaCO = 3,45/100 = 0,345 mol 3

→ Khối lượng bình đựng P2O5 dư tăng chính là khối lượng nước → mH O = 6,21 gam → nH O = 6,21/18 = 0,345 mol 2

2

ch hở → nCO = nCaCO = 0,345 mol → nCO = nH O → Hai este đều no, đơn chức, mạch 2

3

2

2

→ Đáp án A Câu 60: Đốt cháy hoàn toàn 1,46 gam chất hữu cơ A gồm C, H, O thì thu được 1,344 lít CO2 (đktc) và 0,9 gam H2O. Công thức nào dưới đây có thể là công thức đúng. A. (COOC2H5)2.

B. CH3COOH.

C. CH3COOCH3.

D. HOOCC6H4COOH.

Hiển thị đáp án nCO = 1,344/22,4 = 0,06 mol; nH O = 0,9/18 = 0,05 mol → nH O < nCO 2

2

2

2

→ Loại đáp án B, C Bảo toàn khối lượng ta có: 1,46 = mC + mH + mO → 1,46 = 0,06.12 + 0,05.2 + mO → mO = 0,64 gam → nO = 0,64/16 = 0,04 mol → nC : nH : nO = 0,06 : (0,05.2) : 0,04 = 3:5:2

dạng là (C3H5O2)n → Công thức phân tử củaa A có dạ


(COOC2H5)2 có công thức phân tử (C3H5O2)2 HOOCC6H4COOH có công thức phân tử (C4H3O2)2 → Loại đáp án D → Đáp án A Câu 61: Đốt cháy hoàn toàn 0,2 mol este X, đơn chức có 1 liên kết đôi C = C trong phân tử rồi dẫn sản phẩm cháy vào dung dịch Ca(OH)2 dư thu được 60 gam kết tủa. X có công thức cấu tạo là A. HCOOCH = CH2.

B. CH3COOCH = CH2.

C. HCOOCH = CHCH3.

D. CH3COOC(CH3) = CH2.

Hiển thị đáp án Đốt cháy este X cho sản phẩm cháy CO2 Ta có: CO2 + Ca(OH)2 → CaCO3↓ + H2O → nCO = nCaCO3 = 60/100 = 0,6 mol 2

→ Đốt cháy hoàn toàn 0,2 mol este X thu được 0,6 mol CO2 → 1 mol este X có 3 mol C → Công thức phân tử của este X đơn chức là C3HxO2 Vì X có chứa 1 liên kết đôi C = C trong phân tử → Công thức cấu tạo của X là HCOOCH = CH2 → Đáp án A Câu 62: Cho sơ đồ chuyển hóa sau: (a) C3H4O2 + NaOH → X + Y (b) X + H2SO4 (loãng) → Z + T (c) Z + dung dịch AgNO3/NH3 (dư) → E + Ag + NH4NO3 (d) Y + dung dịch AgNO3/NH3 (dư) → F + Ag + NH4NO3


Chất E và chất F theo thứ tự là A. (NH4)2CO3 và CH3COOH. B. (NH4)2CO3 và CH3COONH4. C. HCOONH4 và CH3CHO. D. HCOONH4 và CH3COONH4 Hiển thị đáp án Vì C3H4O2 thủy phân trong NaOH tạo ra 1 muối phản ứng vơí AgNO3/NH3 tạo ra Ag và 1 chất cũng tác dụng với AgNO3/NH3 tạo ra Ag → HCOOCH=CH2 → Đáp án B Câu 63: Thủy phân hoàn toàn este A của axit hữu cơ đơn chức X và ancol đơn chức Y bằng dung dịch NaOH vừa đủ. Làm bay hơi hoàn toàn dung dịch sau thủy phân. Phần hơi được dẫn qua bình đựng CaCl2 khan dư. Sau khi làm khô, phần hơi còn lại cho qua bình đựng K dư thấy có khí Z bay ra và khối lượng bình đựng K tăng 6,2 gam. Dẫn khí Z qua CuO nung nóng dư sinh ra 6,4 gam Cu. Lượng este ban đầu tác dụng vừa đủ với 32 gam brom thu được sản phẩm chứa 65,04% brom về khối lượng. Tên gọi của A là A. vinyl fomat.

B. metyl metacrylat.

C. vinyl axetat

D. metyl acrylat .

Hiển thị đáp án Các phương trình xảy ra: RCOOR1 + NaOH → RCOONa + R1OH Làm bay hơi dung dịch sau thủy phân,sau đó cho qua CaCl2 để hút hết nước,sau đó cho qua K thì có khí nên có phản ứng: R1OH + K → ROK + 1/2 H2 Cho H2 qua CuO


CuO + H2 -t → Cu + H2O o

nCu = 0,1 mol → nH = 0,1 mol → nR OK = 0,2 mol 2

1

→ R1OH là CH3OH Ta có neste = 0,2(mol), nBr = 0,2(mol) 2

→ Este có 1 liên kết đôi ở ngoài mạch C → Este có M là 86 → Đáp án D Câu 64: Este X có công thức phân ttử dạng CnH2n–2O2. Đốt cháy 0,42 mol X rồi cho sản ứa 68,376 gam phẩm cháy hấp thụ hoàn toàn vào dung dịch nước vôi trong có chứ

ịch nước vôi trong vẩn đục. Thuỷ phân X bằng bằ dung dịch Ca(OH)2 thì thấy dung dịch ữu cơ không tham gia phản ứng tráng gương. Phát biểu nào NaOH thu được 2 chất hữu sau đây về X là đúng? A. Không thể điều chế được từ ancol và axit hữu cơ tương ứng. B. Tên của este X là vinyl axetat.

a etyl acrylat. C. X là đồng đẳng của D. Thành phần % khối lượng O trong X là 36,36%. Hiển thị đáp án ẩn đụ đục → có kết tủa → nCO ≤ nOH = 1,848 mol. Dung dịch nước vôi trong bịị vẩn 2

→ n ≤ 1,848/0,42 = 4,4 → n = 3 hoặc n = 4. s phẩm đều Với n = 3 → X là HCOOCH=CH2 → loại vì thủy phân trong NaOH thu được 2 sản tham gia phản ứng tráng gương. ạo duy nh nhất thỏa mãn của X là CH2=CHCOOCH3. → n = 4 → công thức cấu tạo A. Sai vì có thể điều chế từ ancol và axit tương ứng là CH2=CHCOOH và CH3OH.


B. Sai vì tên của este X là metyl acrylat. C. Đúng ⇒ chọn C. D. Sai vì %mO(X) = (32/86).100% = 37,21% → Đáp án C Câu 65: Đốt cháy hoàn toàn hỗn hợp X gồm 2 este no, đơn chức, mạch hở ta thu ỗn hợp hợ Y gồm một được 1,8 gam H2O. Thủyy phân hoàn toàn hỗn hợp X ta thu được hỗn

hỗn hợp Y thì thể tích CO2 thu được ở đktc là ancol và axit. Nếu đốtt cháy 1/2 h A. 2,24 lít.

B. 3,36 lít.

C. 1,12lít.

D. 4,48 lít.

Hiển thị đáp án nH O = 1,8/18 = 0,1 mol 2

Gọi công thức phân tử chung của 2 este là RCOOR’

ạch hhở → Khi đốt cháy X cho sản phẩm cháy có: Vì 2 este đều no, đơn chức, mạch nCO = nH O = 0,1 mol → x = 0,1 2

2

→ Nếu đốt cháy 1/2 hỗn hợpp Y thì thể tích CO2 thu được ở đktc là: VCO = 22,4x/2 = (0,1. 22,4)/2 = 1,12 lít 2

→ Đáp án C

đktc) và 0,9 gam Câu 66: Đốt cháy hoàn toàn 0,01 mol este X thu được 1,344 lít CO2 (đktc) bằng dung dịch KOH thì thu được c 0,2 mol ancol etylic và H2O. Khi thủyy phân 0,1 mol X b ấu tạ tạo của X là 0,1 mol muối. Công thức cấu A. CH3COOC2H5.

B. HCOOC2H5.


D. CH2(COOC2H5)2.

C. (COOC2H5)2.

Hiển thị đáp án ằng dung ddịch KOH thì thu đượcc 0,2 mol ancol etylic và 0,1 mol Khi thủy phân 0,1 mol X bằng muối → neste = nmuối = nC H OH/2 → X có thể là (COOC2H5)2 hoặc R(COOC2H5)2 (với R là gốc áp án A, B hiđrocacbon) → Loại đáp 2

5

nCO = 1,344/22,4 = 0,06 mol; nH O = 0,9/18 = 0,05 mol. 2

2

→ 0,01 mol X có 0,06 mol C và 0,1 mol H → 1 mol X có 6 mol C và 10 mol H → Công thức phân tử của X là C6H10O4 → Công thức cấu tạo của X là (COOC2H5)2 → Đáp án C

c 0,22 gam CO2 và 0,09 gam Câu 67: Đốt cháy hoàn toàn 0,11 gam một este thu được ủa ancol và axit tạo thành este là H2O. Công thức phân tử của A. CH4O và C2H4O2.

B. C2H6O và C2H4O2.

C. C2H6O và CH2O2.

D. C2H6O và C3H6O2.

Hiển thị đáp án

ch hở và O2 (số mol Câu 68: Trong một bình kín chứa hơi este X (có dạng CnH2nO2) mạch n cho phả phản ứng cháy) ở 139,9oC; áp suấtt trong bình là 0,8 atm. O2 gấp đôi số mol cần Đốt cháy hoàn toàn X sau đó đưa về nhiệt độ ban đầu, áp suất trong bình lúc này là 0,95 atm. X có công thứcc phân ttử là A. C4H8O2.

B. C3H6O2.

C. CH2O2.

D. C2H4O2.

Hiển thị đáp án


c: n = PV/RT (V, R, T trước và sau phản ứng đều giống nhau) Từ công thức:

→ Công thức phân tử của X là C3H6O2 → Đáp án B

ơ chức, mạch Câu 69: Đốt cháy hoàn toàn 12,88 gam hỗn hợp X gồm một axit no, đơn ức, mạch hở được 0,54 mol CO2 và 0,64 mol H2O. Thực hở và một ancol no, đơn chứ c m gam este. Giá hiện phản ứng este hóa hoàn toàn llượng hỗn hợp trên thì thu được trị của m là A. 10,20 gam.

B. 8,82 gam.

C. 12,30 gam.

D. 11,08 gam.

Hiển thị đáp án nancol = nH O + nCO = 0,64 - 0,54 = 0,1 mol 2

2

Bảo toàn khối lượng: mX = mC + mH + mO → 12,88 = 0,54.12 + 0,64.2.1 + mO(X) → mO(X) = 5,12 g → nO(X) = 5,12/16 = 0,32 mol nO(X) = nancol + 2naxit → 0,32 = 0,1 + 2naxit → naxit = 0,11 mol Gọi x, y lần lượt là số nguyên tử C trong axit và ancol 0,11x + 0,1y = 0,54 → 11x + 10y = 54 → x = 4, y = 1 → Công thức phân tử của axit và ancol lần lượt là: C3H7COOH và CH3OH C3H7COOH (0,11) + CH3OH (0,1) ⇆ C3H7COOCH3 (0,1)


→ m = 0,1.102 = 10,2 gam → Đáp án A Câu 70: Đốt cháy hoàn toàn 2,34g h hỗn hợp gồm m metyl axetat , etyl fomat và vinyl sản phẩm cháy vào dung dịch Ca(OH)2 dư. ư. Sau phản ứng axetat rồi hấp thụ toàn bộ sả ợ dung dịch thu được 10g kết tủa và dung dịch X. Khối lượng X so với khối lượng Ca(OH)2 ban đầu đã thay đổi như thế nào A. tăng 3,98g.

B. giảm 3,38g.

C. tăng 2,92g.

D. giảm 3,98g

Hiển thị đáp án 2 chất metyl axetat và etyl fomat cùng CTPT C3H6O2; vinyl axetat (C4H6O2) Gọi số mol của 2 CTPT trên lần lượt là x mol và y mol. ta có hệ:

ng: 74x + 86y = 2,34 gam. (1) khối lượng: dư: 3x + 4y = 0,1 mol. (2) bảo toàn C. chú ý Ca(OH)2 dư

Vậy giải hệ: → ∑nH O = 0,09 mol 2

ịch ( không ph phải khối lượng bình) nên lượng tăng: Chú ý là khối lượng dung dịch ∆m = mCO + mH O - mket tua = 0,09.18 + 0,1.44 = -3,98 gam 2

2

ịch gi giảm 3,98 gam Vậy tức là khối lượng dung dịch → Đáp án D

hỗn hợp gồm m axit acrylic, vinyl axetat và metyl Câu 71: Đốt cháy hoàn toàn 4,02 gam h ản ph phẩm cháy vào bình 1 đựng dung dịch H2SO4 đặc, bình metacrylat rồi cho toàn bộ sản 2 đựng dung dịch Ba(OH)2 dư thấy khối lượng bình 1 tăng m gam, bình 2 xuất hiện ủa m là 35,46 gam kết tủa. Giá trịị của


A. 2,70.

B. 2,34.

C. 3,24.

D. 3,65.

Hiển thị đáp án Gọi công thức phân tử chung của hhỗn hợp axit là CnH2n-2O2 Ta có:

BTKL: mC H n

2n-2

O2

+ mO = mH O + mCO 2

2

2

→ 4,02 + (3y/2).32 = 18y + 0,18.44 → y = 0,13 → m = mH O = 0,13.18 = 2,34 gam 2

→ Đáp án B Câu 72: Đốt cháy hoàn toàn một lượng este X (no, đơn chức, mạch hở) ở) cần c vừa đủ a Mặt khác, cho 0,1 mol X tác dụng vừa đủ với dung dịch mol O2 thu được a mol H2O. M

ch chứ chứa m gam muối. Giá trị của m là KOH thu được dung dịch A. 9,8.

B. 6,8.

D. 8,4.

D. 8,2.

Hiển thị đáp án Gọi công thức phân tử của X là CnH2nO2

Ta có:


→ Công thức phân tử của X là C2H4O2 → Công thức cấu tạo của X là HCOOCH3 HCOOCH3 + KOH → HCOOK + CH3OH nHCOOK = nHCOOCH = 0,1 mol 3

→ mHCOOK = 0,1.84 = 8,4 gam → Đáp án C Câu 73: Đốt cháy hoàn toàn a gam este X đơn chức, mạch hở (phân tử có số liên kết ể tích khí CO2 bằng 6/7 thể tích khí O2 đã phản ứng (các thể π nhỏ hơn 3), thu được thể ện). Cho m gam X tác d dụng hoàn toàn vớii 200 ml dung dịch d tích khí đo ở cùng điều kiện).

dịch Y. Cô cạn Y, thu được 12,88 gam chất rắn khan. Giá KOH 0,7M, thu đượcc dung dị trị của m là A. 7,20

B. 6,66

C. 8,88

D. 10,56

Hiển thị đáp án - Este X đơn chức, mạch hở,, phân ttử chứa (k+1) liên kết π → dạng CnH2n-2kO2 (k ≤ 1) (k là số πC=C còn tổng số liên kết π trong X là (k+1) do có πC=O nữa) Đốt

- Giả thiết

giải nghiệm nguyên k, n vớii 0 ≤ k ≤ 1 → ứng với k = 0, n =3 cho biết este là C3H6O2 - Nếu este X là HCOOC2H5: x mol x mol HCOOC2H5 + 0,14 mol KOH → 12,88 g chất rắn + x mol C2H5OH


- BTKL có 74x + 0,14.56 = 12,88 + 46x → x = 0,18 mol > 0,14 mol → Loại

dư (chú ý ở đây phản ứng thủyy phân hoàn toàn nên KOH phải vừa đủ hoặc dùng dư) - Nếu este X là CH3COOCH3 x mol CH3COOCH3 + 0,14 mol KOH → 12,88 g chất rắn + x mol CH3OH

BTKL có74x + 0,14.56 = 12,88 + 32x → x = 0,12 mol → m = 74x = 8,88 g → Đáp án C Câu 74: Đốt cháy hoàn toàn một este no 2 chức mạch hở X. Sục toàn bộ sản phẩm ch Ca(OH)2 dư, sau phản ứng thu được c 5,0 gam kết kế tủa và khối cháy vào dung dịch m 2,08 gam. Bi Biết khi xà phòng hóa X chỉ thu được muối mu của axit lượng dung dịch giảm cacboxylic và ancol. Số đồng phân ccủa X là: A. 3 C. 6.

B. 4. D. 5.

Hiển thị đáp án - Khi đốt cháy este X thì:

- Áp dụng độ bất bão hòa, ta đượ ợc: nX = nCO - nH 0 → nO(X) = 4nX = 0,04 2

2

→ nC : nH : nO = 0,05 : 0,08 : 0,04 = 5:8:4 → Vậy este X có CTPT là C5H8O4 + TH1: X được tạo thành từ axit đơn chức và ancol hai chức: HCOOCH2 – CH2OOC2H5 và HOOC – CH(CH)3 – CH2 – OOCH + TH2: X được tạo thành từ axit đơn chức và ancol hai chức : C2H5OOC – COOCH3 và CH3OOC – CH2 – COO – CH3


→ Đáp án B Câu 75: Hỗn hợp E gồm m hai este đơn chức, là đồng phân cấu tạo và đều chứa vòng (đ thu được benzen. Đốt cháy hoàn toàn m gam E cần vừa đủ 8,064 lít khí O2 (đktc),

ch NaOH (dư) thì có 14,08 gam CO2 và 2,88 gam H2O. Đun nóng m gam E với dung dịch ản ứ ứng, thu được dung dịch T chứa a 6,62 gam hỗn h hợp ba tối đa 2,80 gam NaOH phản ủa axit cacboxylic trong T là muối. Khối lượng muối của A. 3,84 gam.

B. 2,72 gam.

C. 3,14 gam.

D. 3,90 gam.

Hiển thị đáp án Ta có:

- Bảo toàn khối lượng: ng: m = 0,32.12 + 0,16.2+ 0,08.16 = 5,44g - Ta có: nC : nH : nO = 0,32 : 0,32: 0,08 = 4:4:1 - E đơn chức → CTPT của E là C8H8O2 - Sau phản ứng thủy phân thu được 3 muối → có 1 este của phenol Gọi este của phenol là A có x mol, este của ancol là B có y mol Ta có hệ phương trình:

este của phenol: ví dụ HCOOC6H4CH3 hoặc CH3COOC6H5 tác dụng với sẽẽ thu được muối của axit cacboxylic, muối củaa phenol và H2O

s thu được este của ancol: có thể là C6H5COOCH3 hoặc HCOOCH2C6H5, tác dụng vớii NaOH sẽ muối của axit cacboxylic và ancol


Bảo toàn khối lượng có mROH = 1,08 g → MROH = 108 → ROH là C6H5CH2OH

→ ∑mmuoi axit cacboxylic trong T = mHCOONa + mCH COONa = 3,14 gam 3

→ Đáp án C

ới dung d dịch NaOH vừa đủ, thu được 2 chất ất Y và Z. Cho Z Câu 76: Chất X tác dụng với ch AgNO3 trong NH3 dư thu được chất hữu cơ T. Cho T tác dụng tác dụng với dung dịch với dung dịch NaOH lại thu được Y. Chất Y là A. CH3COOCH=CH2.

B. HCOOCH3.

C. CH3COOCH=CH-CH3.

D. HCOOCH=CH2.

Hiển thị đáp án có cùng số cacbon → loại C và D - Xét B: trong 2 sản phẩm chỉỉ có tráng gương → sinh ra CO2 → loại → Đáp án A

un nóng 0,2 mol hỗn hợp X chứa etyl fomat và etyl axetat với dung dịch Câu 77: Đun AgNO3/NH3 (dùng dư) thu được 17,28 gam Ag. Nếu thủy phân hoàn toàn 28,84 gam X với dung dịch KOH vừa đủ, thu được m gam muối. Giá trị của m là A. 37,24 gam.

B. 31,64 gam.

C. 32,34 gam.

D. 26,74 gam.

Hiển thị đáp án

- Cho 0,2 mol X

chỉ có HCOOC2H5 phản ứng


nHCOOC H = nAg/2 = 0,08 mol ⇒ nCH COOC H = 0,12 mol 2

5

3

2

5

- Cho 28,84 gam

→ mmuối = 0,14.84 + 0,21.98 = 32,34 (g) → Đáp án C Câu 78: Este X, mạch hở,, có công th thức phân tử C4H6O2. Đun un nóng a mol X trong dung

dịch Y. Cho toàn bộ Y tác dụng với ới lượng dư dung dịch NaOH vừa đủ, thu được dung d được 4a mol Ag. Biết các phản ứng xảy y ra hoàn toàn. Công dịch AgNO3 trong NH3, thu đư thức cấu tạo của X là A. HCOOCH=CH-CH2.

B. CH2=CH-COO-CH3.

C. CH3COO-CH=CH2.

D. HCOO-CH2-CH=CH2.

Hiển thị đáp án C4H6O2 có k = 2 → Trong phân tử X có chứaa 2 liên kết π (gồm 1 liên kết π của nhóm –COO– và 1 liên kết π của gốc hiđrocacbon). Vì → Các sản phẩm của phản ứng th thủy phân X trong NaOH đều phản ứng vớii AgNO3 trong NH3. → X có dạng HCOO-CH=CH-R Vì công thức phân tử của X là C4H6O2 → Công thức cấu tạo của X là HCOO-CH=CH-CH3. → Đáp án A

m axit cacbonxylic X và este Y (đều đơn chức ứ và cùng số Câu 79: Hỗn hợp M gồm phản ứng vừa đủ với dung dịch ịch chứa ch 0,25 mol nguyên tử cacbon). Cho m gam M ph hợp hai muối. Mặt khác, cũng ng cho m gam M trên tác NaOH, sinh ra 18,4 gam hỗn h


ứ thu được dụng với lượng dư dung dịch AgNO3 trong NH3 đung nóng kết thúc phản ứng ủa X và giá trị của m lần lượt là 32,4 gam Ag. Công thức của A. C2H5COOH và 18,5.

B. CH3COOH và 15,0.

C. C2H3COOH và 18,0.

D. HCOOH và 11,5.

Hiển thị đáp án nAg = 32,4/108 = 0,3 mol nM = nNaOH = 0,25 mol → nAg : nNaOH < 2 → chỉ X hoặc Y tráng bạc. Do X và Y cùng số C → Y tráng bbạc → nY = nAg/2 = 0,15 mol → nX = 0,1 mol.

→ X là và Y là HCOOCH3 → m = 15g. → Đáp án B

m các ch chất hữu cơ mạch hở, đơn chức có cùng công thức phân Câu 80: Hỗn hợp X gồm un nóng 14,4 gam X với dung dịch KOH dư đến hoàn toàn thu được tử là C3H4O2. Đun ịch sau phản ph ứng). dung dịch Y (giả sử không có ssản phẩm nào thoát ra khỏi dung dịch c dung dịch d Z. Cho Z Trung hòa bazơ còn dư trong dung dịch Y bằng HNO3, thu được ch AgNO3 dư trong NH3 thu được 43,2 gam kết tủa. ủa. Nếu N cho 14,4 tác dụng với dung dịch gam X tác dụng Na dư thì thu được tối đa bao nhiêu lit H2 ở đktc? A. 2,24 lit

B. 1,12 lit

C. 3,36 lit

D. 4,48 lit

Hiển thị đáp án

→ nH = 0,05 → V = 1,12 2

→ Đáp án B


150 câu trắc nghiệm Este Lipit có lời giải chi tiết (nâng cao – phần 3)

Câu 81: X là este mạch hở, đơn chức. Thủy phân hoàn toàn m gam X bằng dung dịch chứa NaOH (vừa đủ) thu được muối Y và ancol Z (có cùng số nguyên tử C). Đốt cháy hết lượng muối Y trên cần vừa đủ 0,3 mol O2, sản phẩm cháy thu được chứa 0,25 mol CO2. Nếu đốt cháy hết lượng ancol Z cần 0,4 mol O2 và thu được tổng số mol CO2 và H2O là 0,6 mol. Giá trị của m gần nhất với giá trị nào sau đây? A. 9.

B. 11.

C. 12.

D. 10.

Hiển thị đáp án Đặt nY = nZ = x → nNaOH = x → nNa CO = 0,5x 2

3

Do Y và Z có cùng C → nC(Z) = nC(Y) Đốt muối Y thu được: 0,25 mol CO2; 0,5x mol Na2CO3 Đốt cháy ancol Z thu được: nCO (Z) = nCO (Y) + nNa CO = 0,25 + 0,5x → nH O(Z) = (0,35 - 0,5x) mol 2

2

2

3

2

Bảo toàn nguyên tố Oxi: Đốt Z: nZ = nOH = (0,5x + 0,05) mol = x → x = 0,1 mol Đốt Y: nH O(Y) = 0,15 mol là → HY = 3, CY = 3 → Y là CH2 = CHCOONa 2

→ Z là C3H6O Bảo toàn khối lượng: m = 0,1.94 + 0,1.58 – 0,1.40 = 11,2 g → Đáp án B Câu 82: Đốt cháy hoàn toàn 0,2 mol este đơn chức X rồi cho sản phẩm cháy lần lượt qua bình 1 đựng 100 gam dung dịch H2SO4 96,48%; bình 2 đựng dung dịch KOH dư. Sau thí nghiệm thấy nồng độ H2SO4 ở bình 1 giảm còn 87,08%; bình 2 có 82,8 gam muối. Công thức phân tử của X là


A. C3H4O2.

B. C2H4O2.

C. C3H6O2.

D. C4H8O2.

Hiển thị đáp án 0,2 mol CxHyO2 + O2 → CO2 + H2O Hấp thụ sản phẩm cháy qua bình 1 đựng 100 g dung dịch H2SO4 96,48%; bình 2 đựng KOH dư. Bình 1 thu được H2SO4 87,08 %

→ nH O = 0,6 mol. 2

nCO = nK CO = 82,8/138 = 0,6 mol 2

2

3

Ta có x = 0,6 : 0,2 = 3; y = 0,6 . 2 : 0,2 = 6 → X có CTPT là C3H6O2 → Đáp án C Câu 83: Đốt cháy hoàn toàn a mol X (là trieste ccủa glixerol vớii các axit đơn chức, ro hóa m1 gam X cần mạch hở), thu đượcc b mol CO2 và c mol H2O (b – c = 4a). Hiđro ới dung dịch d chứa 6,72 lít H2 (đktc), thu đượcc 39 gam Y (este no). Đun nóng m1 gam với n dung dị dịch sau phản ứng, thu được m2 chất rắn. ắn. Giá trị tr của m2 0,7 mol NaOH, cô cạn là A. 57,2.

B. 42,6.

C. 53,2

D. 52,6

Hiển thị đáp án nH = 6,67/22,4 = 0,3 mol 2

Đốt với hợp chất hữu cơ chứa C, H và O ( nếu có) thì khi đốt cháy ta có: nCO - nH O = (k-1).nHCHC → k = 5 = 3πC=O + 2πC=C 2

2

Mặt khác: 1πC=C + 1H2 → nX = 1/2 nH = 0,15 mol 2

Bảo toàn khối lượng: m1 = 39 – mH = 39 - 0,3.2 = 38,4 g 2


Dễ thấy NaOH dư → nglixerol = nX = 0,15 mol → m2 = m1 + mNaOH – mglixerol = 38,4 + 0,7.40 – 0,15.92 = 52,6 g → Đáp án D Câu 84: Hợp chất X là một este no, mạch hở, hai chức (phân tử không chứa thêm nhóm chức nào khác). Đốt cháy hoàn toàn X cần thể tích khí oxi bằng thể tích CO2 sinh ra ở cùng điều kiện. Lấy 13,2 gam X phản ứng hết với 200 ml dung dịch KOH 1,25M. Sau phản ứng thu được hỗn hợp hai ancol và dung dịch Y. Cô cạn dung dịch Y thu được chất rắn khan có khối lượng xấp xỉ bằng A. 16,5 gam

B. 13,5 gam

C. 15,5 gam

D. 19,5 gam

Hiển thị đáp án Hợp chất X là một este no, mạch hở, hai chức có công thức tổng quát CnH2n-2O4 CnH2n-2O4 + (1,5n-2,5)O2 -t → nCO2 + (n-1)H2O o

Có 1,5n - 2,5 = n → n = 5 → X có công thức C5H8O4 Để thuỷ phân X thu được hỗn hợp ancol → X phải có cấu tạo CH3OOC-COOC2H5 Có 2nX < nKOH = 0,25 mol → chứng tỏ chất rắn khan có KOOC-COOK : 0,1 mol và KOH dư : 0,05 mol → m = mKOOC-COOK + mKOH = 0,1.166 + 0,05.56 = 19,4 gam → Đáp án D Câu 85: Cho hỗn hợp E gồm hai este X và Y phản ứng hoàn toàn với dung dịch NaOH, thu được sản phẩm gồm muối của axit cacboxylic đơn chức và hỗn hợp hai ancol no, đơn chức, kế tiếp trong dãy đồng đẳng. Mặt khác, đốt cháy hoàn toàn 27,2 gam E cần vừa đủ 1,5 mol O2 thu được 29,12 lít khí CO2 (đktc). Tên gọi của X và Y lần lượt là A. metyl acrylat và etyl acrylat. B. metyl propionat và etyl propionat.


C. metyl axetat và etyl axetat. D. etyl acrylat và propyl acrylat. Hiển thị đáp án nCO = 29,12/22,4 = 1,3 mol 2

E + NaOH → muối của axit cacboxylic đơn chức + hai ancol no, đơn chức, kế tiếp nhau trong dãy đồng đẳng → E là este đơn chức, kế tiếp nhau trong dãy đồng đẳng. Bảo toàn khối lượng ta có: mH O = mE + mO - mCO = 27,2 + 1,5.32 - 1,3.44 = 18 gam 2

2

2

→ nH O = 18/18 = 1 mol 2

Bảo toàn nguyên tố oxi ta có: nO(E) = 2nCO + nH O - 2nO = 2.1,3 + 1 - 2.1,5 = 0,6 mol 2

2

2

→ nE = nO(E)/2 = 0,6/2 = 0,3 mol Nhận thấy: nCO - nH O = nE → X và Y là 2 este không no, đơn chức có 1 liên kết π trong gốc hiđrocacbon. 2

2

Gọi công thức chung của X là CnH2n-2O2 → Số nguyên tử cacbon trung bình của E là n = nCO /nE = 1,3/0,3 = 4,33 2

→ Công thức phân tử của X và Y là C4H6O2 và C5H8O2 → Công thức cấu tạo của X: CH2=CHCOOCH3 và Y: CH2=CHCOOCH2CH3 Tên gọi của X và Y lần lượt là metyl acrylat và etyl acrylat. → Đáp án A Câu 86: Thủy phân hoàn toàn m1 gam este X mạch hở bằng dd NaOH dư, thu được m2 gam ancol Y (không có khả năng phản ứng với Cu(OH)2 ) và 15g hỗn hợp muối của hai axit cacboxylic đơn chức. Đốt cháy hoàn toàn m2 gam Y bằng oxi dư, thu được 0,3 mol CO2 và 0,4 mol H2O. Giá trị của m1 là


A. 16,2.

B. 10,6.

C. 14,6.

D. 11,6.

Hiển thị đáp án Đốt cháy m gam Y: nCO = 0,3 mol; mH O = 0,4 mol → nC(Y) : nH(Y) = 3 : 8 2

2

(mà Số H ≤ 2. Số C + 2) → Y có dạng C3H8Ox Vì X + NaOH → hỗn hợp 2 muối axit hữu cơ đơn chức → ancol 2 chức Y không phản ứng với Cu(OH)2 → ancol Y không có 2 nhóm OH kề nhau → Y là HOCH2CH2CH2OH có nancol = nCO /3 = 0,1 mol → nNaOH = 2nancol = 0,2 mol. 2

Bảo toàn khối lượng: m1 = mancol + mmuối – mNaOH = 0,1.76 + 15 – 0,2.40 = 14,6g → Đáp án C Câu 87: Este X đơn chức mạch hở có tỉ khối hơi so với oxi bằng 3,125. Đốt cháy hoàn toàn 0,2 mol hỗn hợp E gồm X và 2 este Y, Z (đều no, mạch hở, MY < Mz) thu được 0,7 mol CO2. Biết E phản ứng với dung dịch KOH vừa đủ, chỉ thu được hỗn hợp hai ancol (có cùng số nguyên tử cacbon) và hỗn hợp hai muối. Phân tử khối của Z là A. 132.

B. 118.

C. 146.

D. 136.

Hiển thị đáp án dX/O = 3,125 → MX = 3,125.32 = 100 2

Gọi công thức phân tử của X là CxHyO2 Ta có: MX = 12.x + y + 16.2 = 100 → 12x + y = 68 → x = 5 và y = 8 Vậy công thức phân tử của X là C5H8O2 Số nguyên tử cacbon trung bình của E là nCO /nE = 0,7/0,2 = 3,5 < 5 2

→ Trong hỗn hợp E có chứa este có 2 hoặc 3 nguyên tử cacbon. Vì E + KOH → 2 ancol (có cùng số nguyên tử cacbon) + 2 muối


→ Hai ancol đó là C2H5OH và C2H4(OH)2.

ứa 3 nguyên tử cacbon → Trong hỗn hợp E có este chứa Công thức cấu tạo của X là CH2=CHCOOCH2CH3 → Công thức cấu tạo của Y và Z lần lượt là:

TH1: HCOOC2H5 và → MZ = 118

TH2: HCOOC2H5 và → MZ = 170 → Đáp án B Câu 88: Cho 0,1 mol este X (no, đơn chức, mạch hở) phản ứng hoàn toàn với dung a 0,18 mol MOH (M là kim loại kiềm). Cô cạn dung dịch ch sau phản ph ứng, thu dịch chứa được chất rắn Y và 4,6 gam ancol Z. Đốt cháy hoàn toàn Y, thu được M2CO3, H¬2O của X là và 4,84 gam CO¬2. Tên gọi củ A. metyl axetat. C. etyl fomat.

B. etyl axetat. D. metyl fomat.

Hiển thị đáp án ch hở → nancol Z = nX = 0,1 mol X là este no, đơn chức, mạch → MZ = 4,6/0,1 = 46 → ancol Z là C2H5OH nM CO = nMOH/2 = 0,18/2 = 0,9 mol; nCO = 4,48/44 = 0,11 mol. 2

3

→ Số C có trong phân tử X là:

2


ử C4H8O2 → Este X có công thức phân tử → Y là CH3COOH → X là CH3COOC2H5 (etyl axetat) → Đáp án B Câu 89: Thủyy phân 37 gam hai este cùng công thức phân tử C3H6O2 bằng dung dịch

dịch sau phản ứng thu được hỗn hợp p ancol Y và chất rắn NaOH dư. Chưng cấtt dung dị o n hợp hợ các ete. Biết khan Z. Đun nóng Y với H2SO4 đặc ở 140 C , thu được 14,3 gam hỗn các phản ứng xảy ra hoàn toàn. Khối lượng muối trong Z là A. 34,2 gam.

B. 38,2 gam.

C. 40,0 gam.

D. 42,2 gam.

Hiển thị đáp án R1COOR2 + NaOH → R1COONa + R2OH (1) 2R2OH -H SO , 140 C→ R2OR2 + H2O (2) 2

4

o

neste = 0,5 mol → nancol = nNaOH = neste = 0,5 mol → nH O = nancol/2 = 0,25 mol → mH O = 0,25.18 = 4,5 g 2

2

BTKL cho PT (2): mancol = meste + mH O = 14,3 + 4,5 = 18,8g. 2

BTKL cho PT (1): mmuối (Z) = meste + mNaOH – mancol = 37 + 0,5.40 – 18,8 = 38,2g. → Đáp án B

ợp G g gồm 3 este đơn chức mạch hở thu được hỗn hợp X Câu 90: Thủy phân hỗn hợp m 3 axit cacboxylic (1 axit no và 2 axit không no đều có 2 liên kếtt pi trong phân tử). t gồm ừa đủ với 150 ml dung dịch NaOH 2M,thu đư ược 25,56 gam Lấy m gam X tác dụng vừa dư và hấp thụ từ ừ từ hỗn hợp sau hỗn hợp muối. Đốt cháy hoàn toàn m gam X trong oxi d ch NaOH dư thấy khối lượng dung dịch tăng lên 40,08 gam so phản ứng vào dung dịch Tổng khối lượng của a hai axit cacboxylic không no trong với dung dịch NaOH ban đầu. T m gam X là


A. 18,96 gam.

B. 12,06 gam.

C. 15,36 gam.

D. 9,96 gam.

Hiển thị đáp án Ta có nNaOH = 0,3 = naxit = neste suy ra nO trong axit = 0,3.2 = 0.6 mol Và ta có maxit = mmuối – 22.0,3 = 18.96g

ẩm cho vào bình NaOH : Đốt cháy X thu được sản phẩm Thu được mkhối lượng bình tăng = mH O + mCO = 40.08g 2

2

(bảo toàn khối lượng)

Suy ra số mol O2 phản ứng là : Bảo toàn O: ta suy ra được nCO = 0.69 mol và nH O = 0.54 mol 2

2

Ta có naxit không no = mCO - mH O = 0,15 mol 2

2

ợp axit = nh là 4 nên axit Số H trung bình trong hỗn hợp (mà axit k no có số H ít nhất no là HCOOH) → maxit không no = 18,96- 0,15.46 = 12,06g → Đáp án là B Câu 91: Khi phân tích este E đơn chức mạch hở thấy cứ 1 phần khối ối lượng H thì có ng dung dịch d NaOH 7,2 phần khối lượng C và 3,2 phần khối lượng O. Thủy phân E bằng

u R bậ bậc 3. Công thức cấu tạo của E là thu được muối A và rượu A. HCOOC(CH3)2CH=CH2. B. CH3COOC(CH3)2CH3. C. CH2 = CHCOOCH(CH3)2. D. CH2 = CHCOOC(CH3)2CH=CH2. Hiển thị đáp án Gọi công thức phân tử củaa este E là CxHyOz


→ E có dạng (C3H5O)n Vì este E đơn chức → Trong phân ttử E có 2 nguyên tử O → n = 2

ủa E là C6H10O2 → Vậy công thức phân tử của C6H10O2 có k = 2 → este E đơn chức, mạch hở có chứa 1 liên kết π trong phân tử → Loại đáp án B, D

ch NaOH thu được rượu R bậc 3 Thủy phân E bằng dung dịch

HCOOC(CH3)2CH=CH2 + NaOH -t → HCOONa + CH2 = o

CH2=CHCOOCH(CH3)2 + NaOH -t → CH2=CHCOONa + o

bậ 2 → Loại đáp → CH2 = CHCOOCH(CH3)2 thủy phân trong dung dịch NaOH thu được rượu bậc án C → Đáp án A Câu 92: Thuỷ phân este đơn ch chức, no, mạch hở E bằng dung dịch ch NaOH thu được

ng phân ttử bằng 24/29 khối lượng phân tử este E. Biết Bi d(E/kk). muối khan có khối lượng Công thức cấu tạo của E là A. C2H5COOCH3. C. C3H7COOC2H5.

B. C2H5COOC3H7. D. C4H9COOCH3.

Hiển thị đáp án E no, đơn chức mạch hở nên có dạng CnH2nO2 d(E/kk) = 4 → ME = 4.29 = 116 → 14n + 32 = 116 → n = 6 → Công thức phân tử của E là C6H12O2 → Loại đáp án A (C2H5COOCH3 có công thức phân tử là C4H8O2)


muối thu được sau phản ứng thủy phân bằng ng dung dịch d NaOH là Gọi công thức phân tử củaa muố RCOONa Ta có:

→ Công thức cấu tạo của E là C2H5COOC3H7 → Đáp án B Câu 93: Hai este X và Y có cùng CTPT C8H8O2 và chứa vòng benzen trong phân tử. m X và Y tác dụng với dung dịch NaOH dư, đun nóng, lư l ợng Cho 6,8 gam hỗn hợp gồm a 4,7 gam ba muối. mu Khối NaOH phản ứng tối đa là 0,06 mol, thu được dung dịch Z chứa a axit cacboxylic có phân ttử khối lớn hơn trong Z là lượng muối của A. 0,82 gam.

B. 0,68 gam.

C. 2,72 gam.

D. 3,40 gam.

Hiển thị đáp án k = π + v = (8.2 + 2 - 8)/2 = 5

ủa phenol và 1 este nhỗn hợp = 0,05 mol → 1 < nNaOH/nhh < 2 mà Z chứa 3 muối → Z chứa 1 este của của ancol Giả sử X: este củaa phenol, Y: este của ancol

muối phenolat + H2O X + 2NaOH → muối củaa axit cacboxylic + mu Y + NaOH → muối củaa axit cacboxylic + ancol

Bảo toàn khối lượng: mnước + mancol = 6,8 + 0,06.40 – 4,7 = 4,5 gam


Khối lượng muối củaa axit cacboxylic có phân ttử khối lớn hơn trong Z là mCH COONa = nCH COONa.82 = 0,01. 82 = 0,82 gam. 3

3

→ Đáp án A Câu 94: Hóa hơii 5 gam este đơ đơn chức E được thể tích hơi bằng thể ể tích của c 1,6 gam ệt độ và áp suất. Xà phòng hóa hoàn toàn 1 gam este E bằng oxi đo cùng điều kiện nhiệt ợc ancol X và 0,94 gam muối natri của a axit cacboxylic Y. dung dịch NaOH vừa đủ đượ Vậy X là A. ancol metylic.

B. ancol etylic.

C. ancol anlylic.

D. ancol isopropylic.

Hiển thị đáp án neste = nO = 1,6/32 = 0,05 mol → Meste = 5/0,05 = 100 2

Số mol este E xà phòng hóa là: 1/100 = 0,01 mol Gọi công thức chung củaa este E là RCOOR’ (R’ là gốc hiđrocacbon) Ta có: RCOOR’ + NaOH → RCOONa + R’OH → nRCOONa = neste = 0,01 mol → MRCOONa = 0,94/0,01 = 94 → MR = 27 → R là C2H3 (CH2=CH– ) → E: CH2=CHCOOR’ → 71 + MR’ = 100 → MR’ = 100 – 71 = 29 → R’ là C2H5


→ Vậy ancol X là C2H5OH → Đáp án B Câu 95: Cho 0,01 mol một este tác dụng vừa đủ với 100ml dung dịch NaOH 0,2M, đun nóng. Sản phẩm tạo thành gồm một ancol và một muối có số mol bằng nhau và bằng số mol este. Mặt khác, xà phòng hóa hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ 60ml dung dịch KOH 0,25M, cô cạn dung dịch sau phản ứng thu được 1,665 gam muối khan. Công thức của este đó là: A. C2H4(COO)2C4H8.

B. C4H8(COO)2C2H4.

C. CH2(COO)2C4H8.

D. C4H8(COO)C3H6.

Hiển thị đáp án nNaOH : neste = 0,02 : 0,01 = 2 ⇒ este 2 chức Phương trình phản ứng 1 Este + 2NaOH → 1 ancol + 1 muối Xà phòng hóa: neste = nmuối = nKOH/2 = (0,25.0,06)/2 = 0,0075mol → Meste = 1,29/0,0075 = 172 (C8H12O4) → Mmuối = 1,665/0,0075 = 222 (C4H8(COOK)2 → este: C4H8(COO)2C2H4 → Đáp án B Câu 96: Cho các phát biểu sau: (a) Chất béo nhẹ hơn nước, không tan trong nước nhưng tan trong các dung môi hữu cơ không phân cực. (b) Chất béo là trieste của glixerol với axit béo. (c) Phản ứng thủy phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. (d) Tristearin có nhiệt độ nóng chảy cao hơn nhiệt độ nóng chảy của triolein. Số phát biểu đúng là


A. 2.

B. 1.

C. 4.

D. 3.

Hiển thị đáp án Các phát biểu đúng: (a), (b), (d). → Đáp án D Câu 97: Cho các phản ứng sau: X + 3NaOH -t → C6H5ONa + Y + CH3CHO + H2O o

Y + 2NaOH -t , CaO→ T + 2Na2CO3 o

CH3CHO + 2Cu(OH)2 + NaOH -t → Z + … o

Z + NaOH -t , CaO→ T + Na2CO3 o

Công thức phân tử của X là A. C11H12O4.

B. C12H14O4.

C. C12H20O6.

D. C11H10O4.

Hiển thị đáp án Z: CH3COONa → T: CH4 → Y: CH2(COONa)2 → X: C6H5OOC-CH2-COOCH=CH2 (C11H10O4) → Đáp án D Câu 98: Chất X có công thức phân tử C5H8O4 là este 2 chức, chất Y có CTPT C4H6O2 là este đơn chức, Cho X và Y lần lượt tác dụng với NaOH dư, sau đó cô cạn các dung dịch rồi lấy chất rắn thu được tương ứng nung với NaOH khan (có mặt CaO) thì trong mỗi trường hợp chỉ thu được CH4 là chất hữu cơ duy nhất. Công thức cấu tạo của X, Y là: A. CH3OOC-CH2-COOCH3, CH3COOC2H3. B. CH3COO-CH2-COOCH3, CH3COOC2H3.


C. CH3-CH2-OOC-COOCH3, CH3COOC2H3. D. CH3COO-CH2-COOCH3, C2H3COOCH3. Hiển thị đáp án Muối của axit tạo X và Y tham gia phản ứng vôi tôi xút đều chỉ thu được CH4 là chất hữu cơ duy nhất → Axit tạo X là CH2(COOH)2, axit tạo Y là CH3COOH → CTCT của X là CH2(COOCH3)2, của Y là CH3COOCH=CH2. → Đáp án A Câu 99: Cho este X mạch hở có công thức phân tử C7H10O4. Thủy phân hoàn toàn X trong dung dịch NaOH đun nóng, thu được muối Y và hai chất hữu cơ Z và T (thuộc cùng dãy đồng đẳng). Axit hóa Y, thu được hợp chất hữu cơ E (chứa C, H, O). Phát biểu nào sau đây sai? A. Phân tử E có số nguyên tử hiđro bằng số nguyên tử oxi. B. E tác dụng với Br2 trong CCl4 theo tỉ lệ mol 1 : 2. C. Có 2 công thức cấu tạo phù hợp với X. D. Z và T là các ancol no, đơn chức. Hiển thị đáp án Câu 100: Hai chất hữu cơ X, Y có thành phần phân tử gồm C, H, O (MX < MY < 70). Cả X và Y đều có khả năng tham gia phản ứng tráng bạc và đều phản ứng được với dung dịch KOH sinh ra muối. Tỉ khối hơi của Y so với X có giá trị là: A. 1,403.

B. 1,333.

C. 1,304.

D. 1,3.

Hiển thị đáp án - Vì X, Y đều tham gia phản ứng tráng bạc và tác dụng với KOH sinh ra muối nên X, Y có dạng HCOOR mà MX < MY < 70 X là HCOOH ; Y là HCOOCH3. Vậy dY/X = MY : MX = 1,304


→ Đáp án C Câu 101: Cho glixerol tác dụ ụng với hỗn hợp p 3 axit C17H35COOH, C17H33COOH và thể được tạo thành chứa 2 gốc c axit trong số s 3 axit C15H31COOH. Số loạii trieste có th béo trên là A. 9. C. 12.

B. 6. D. 10.

Hiển thị đáp án Gọi gốc axit C17H35-, C17H33-, C15H31- lần lượt là 1, 2, 3

ạo thành chứa 2 gốc axit trong số 3 axit béo trên là Các loại trieste có thể được tạo

→ Có 12 loại este được tạo thành → Đáp án C Câu 102: Cho các tính chất sau: (1) chất lỏng hoặc chất rắn; (2) tác dụng với dung dịch Br2; (3) nhẹ hơn nước; (4) không tan trong nước;

u trong các dung môi h hữu cơ; (5) tan nhiều (6) phản ứng thủy phân;

ềm; (7) tác dụng với kim loại kiềm; (8) cộng H2 vào gốc rượu

úng cho lipit là Những tính chất không đúng


A. (2), (5), (7).

B. (7), (8).

C. (3), (6), (8).

D. (2), (7), (8).

Hiển thị đáp án Những tính chất không đúng cho lipit là: (2) tác dụng với dung dịch Br2; (7) tác dụng với kim loại kiềm; (8) cộng H2 vào gốc rượu → Đáp án D Câu 103: Cho 14,8 gam một hỗn hợp gồm 2 este đồng phân của nhau bay hơi ở điều kiện thích hợp. Kết quả thu được một thể tích hơi đúng bằng thể tích của 6,4 gam oxi trong cùng điều kiện như trên. Khi đốt cháy hoàn toàn hỗn hợp hai este trên, thu được sản phẩm phản ứng là CO2 và H2O, tỉ lệ thể tích khí CO2 và hơi H2O là 1:1. Xác định công thức cấu tạo của 2 este. A. CH3COOCH3 và HCOOC2H5. B. HCOOC3H7 và CH3COOC2H5. C. HCOOC3H7 và C2H5COOCH3. D. HCOOC3H7 và CH3COOCH3. Hiển thị đáp án Khi đốt cháy hoàn toàn hỗn hợp hai este trên thu được sản phẩm phản ứng là CO2 và H2O có: VCO = VH O → nCO = nH O → 2 este là no, đơn chức, mạch hở 2

2

2

2

Gọi công thức tổng quát của 2 este đồng phân là CnH2nO2 (n ≥ 2) Thể tích hơi của 14,8 gam este bằng thể tích hơi của 6,4 gam O2 → neste = nO = 6,4/32 = 0,2 mol → Meste = 14,8/0,2 = 74 → 14n + 32 = 74 → n = 3 2

→ Công thức phân tử của 2 este là C3H6O2


→ Công thức cấu tạo của 2 este là CH3COOCH3 và HCOOC2H5 → Đáp án A Câu 104: Có các nhận định sau: (1) Chất béo là trieste của glixerol với các axit monocacboxylic có mạch C dài không phân nhánh. (2) Lipit gồm các chất béo, sáp, steroid, photpholipit,... (3) Chất béo là chất lỏng (4) Chất béo chứa các gốc axit không no thường là chất lỏng ở nhiệt độ thường và được gọi là dầu. (5) Phản ứng thủy phân chất béo trong môi trường kiềm là phản ứng thuận nghịch. (6) Chất béo là thành phần chính của dầu mỡ động vật, thực vật. Số nhận định đúng A. 5.

B. 2.

C. 4.

D. 3.

Hiển thị đáp án Các nhận định đúng là: (2), (3), (6) (1) sai vì chất béo là trieste của glixerol với axit béo (2) sai vì chất béo ở trạng thái lỏng hoặc rắn (5) sai vì phản ứng thủy phân chất béo trong môi trường kiềm là phản ứng một chiều. → Đáp án D Câu 105: Hỗn hợp X gồm hai chất hữu cơ no, đơn chức, mạch hở. Đun 20,6 gam X với dung dịch NaOH đủ, thu được 20,5 gam một muối cacboxylat Y và 10,1 gam hỗn hợp Z gồm hai ancol là đồng đẳng kế tiếp. Đốt cháy hoàn toàn 10,1 gam Z, thu được


khố lượng phân 8,96 lít (đktc) CO2. Thành phần phần trăm về khối lượng của chấtt có khối tử nhỏ hơn trong X là A. 35,92%.

B. 53,88%.

C. 64,08%.

D. 46,12%.

Hiển thị đáp án Nhận thấy X thuỷ phân trong NaOH ttạo muối và ancol → X là este Bảo toàn khối lượng → mNaOH = 20,5 + 10,1 - 20,6 = 10 gam → nNaOH = 0,25 mol → nmuối = 0,25 mol → Mmuối = 82 ( CH3COONa) Có nancol = 0,25 mol → Mancol = 40,4 → hai ancol là CH3OH: x mol và C2H5OH: y mol

Ta có hệ X gồm CH3COOCH3: 0,1 mol và CH3COOC2H5: 0,15 % CH3COOCH3 = [(0,1.74)/20,6]. 100% = 35,92% → Đáp án A Câu 106: Cho este X đơn n chức tác dụng hoàn toàn với 1 lít dung dịch ịch KOH 2,4M, thu a 210 gam ch chất tan và à m gam ancol Z. Oxi hóa không hoàn toàn được dung dịch Y chứa

ng oxi có xúc tác thu được hỗn hợp T. Chia T thành 3 phần bằng m gam ancol Z bằng nhau: - Cho phần 1 tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 43,2 gam Ag. - Cho phần 2 tác dụng vớii NaHCO3 dư thu được 4,48 lít khí (ở đktc).

(vừa đủ) thu được 8,96 lít khí (ở đktc) và 51,6 gam chất - Cho phần 3 tác dụng vớii Na (v rắn khan. Tên gọi của X là A. etyl fomat.

B. propyl axetat.


D. etyl axetat

C. metyl axetat

Hiển thị đáp án – Phần 2: naxit = nkhí thoát ra = 0,2 mol → Giả sử Z là CH3OH → Axit là HCOOH → nAg tạo ra > 0,2.2 = 0,4 → Loại Z có dạng RCH2OH (R khác H) → nRCHO = nAg : 2 = 0,2 mol

Lại có: nRCH OH + nRCOOH + nH 0 = 2nH ⇒ nRCH OH 2

2

2

2

Rắn khan gồm: 0,2 mol RCH2ONa; 0,2 mol RCOONa; 0,4 mol NaOH. → 0,2.(MR + 53) + 0,2.(MR + 67) + 0,4. 40 = 51,6 g. → MR = 29 → Z là C3H7OH với số mol: 0,6.3 = 1,8 mol = nKOH đã phản ứng → KOH dư 0,6 mol → Mmuối = (210 - 0,6.56)/1,8 = 98 (CH3COOK) → Este X là CH3COOC3H7 → X là propyl axetat → Đáp án B

a các este đều mạch hở gồm hai este đơn chức ứ và một este Câu 107: Hỗn hợp X chứa ột liên kết đôi C=C. Đốt cháy hoàn toàn 0,24 mol X cần đa chức, không no chứa mộ ủy phân X trong dùng 1,04 mol O2, thu được 0,93 mol CO2 và 0,8 mol H2O. Nếu thủy p Y ch chứa 2 ancol có cùng số nguyên tử cacbon và hỗn hợp Z NaOH, thu được hỗn hợp m khố khối lượng của este đơn chức có khối lượng phân tử t lớn chứa 2 muối. Phần trăm trong X là A. 22,7%.

B. 15,5%.


C. 25,7%.

D. 13,6%.

Hiển thị đáp án - Ta có: khi thủyy phân X trong NaOH thu được 2 ancol có cùng cacbon và 2 muối

Mặt khác: → Trong X có 1 chất là HCOOC2H5 (A), este đơn chức còn lại là RCOOC2H5 (B), este 2 chức (C) được tạo từ etylenglicol C2H4(OH)2 và hai axit cacboxylic HCOOH; RCOOH (trong gốc –R có 1 liên kết đôi C=C) + Lúc này kA = 1; kB = 2; kC = 3. Áp dụng -CO

2

và H2O→

nB + 2nC = nCO - nH O = 0,13 (1) 2

2

-BT O→ 2nA + 2nB + 4nC = 2nCO + nH O - 2nO = 0,58 (2) và nA + nB + nC = 0,24 (3) 2

2

2

+ Từ (1), (2), (3) ta tính được: nA = 0,16 mol; nB = 0,03 mol; nC = 0,05 mol nCO = 0,93 = 0,16.3 + 0,03.CB + 0,05.CC với (CB > 4, CC > 5) (4) 2

+ Nếu CB = 5 thay vào (4) ta có: CC = 6 → Thỏa mãn (nếu CB càng tăng thì CC < 6 nên ta không xét nữa) Vậy (B) là CH2=CH–COOC2H5: 0,03 mol, (C) là C2H4(OCOCH=CH2)(OCOH) mX = mC(X) + mH(X) + mO(X) = 0,93.12 + 0,8.2 + (0,16 + 0,03 + 2.0,05).32 = 22,04g

→ Đáp án D Câu 108: Hỗn hợp E chứa a 3 este đều hai chức, mạch hở trong đó ó có một mộ este không

ợp E vớ v i dung dịch no chứa một liên kếtt C=C trong phân ttử. Đun nóng hoàn toàn hỗn hợp ới ph phản ứng). Cô cạn dung dịch sau phản ứng thu được hai NaOH (lấy dư 2,4 lần so với ồng đẳng kế tiếp và hỗn hợp F chứa a ba chất chấ rắn. Lấy hỗn ancol đơn chức, cùng dãy đồ ợp 3 ete (biết (bi rằng hợp 2 ancol đun với H2SO4 đặc ở 140oC thu được 6,39 gam hỗn hợp ỗi ancol đều bằng 75%). Đốt cháy toàn bộ F bằng bằ lượng oxi hệu suất ete hóa của mỗi


kh lớn nhất là vừa đủ thu đượcc 0,24 mol Na2CO3 và 0,16 mol H2O. Este có phân tử khối m khố khối lượng của nó trong hỗn hợp E. este nào? Tính phần trăm A. C2H2(COOC3H7)2; 24,63%. B. C2H2(COOC3H7)2; 23,64%. C. (COOC3H7)2; 21,43%. D. C2H2(COO)2C2H5C3H7; 22,91%. Hiển thị đáp án Đang biên soạn

m mộ một axit đơn chức, một ancol đơn chức và một este đơn Câu 109: Hỗn hợp A gồm nhiều hơn 1C trong phân tử. Đốt cháy hoàn toàn m gam chức (các chất trong A đều có nhi m cháy vào bình đựng dung dịch Ca(OH)2 dư thấy ấ có 135 gam A rồi hấp thụ sản phẩm ời kh khối lượng dung dịch giảm m 58,5 gam. Biết Biế số mol ancol kết tủa xuất hiện. Đồng thời trong m gam A là 0,15. Cho Na d dư vào m gam A thấy có 2,8 lít khí (đktc) đktc) thoát ra. Mặ M t ừa đủ với dung dịch chứa a 12 gam NaOH. Cho m gam A vào khác m gam A tác dụng vừa phản ứng tối đa là dung dịch nước brom dư. Số mol brom ph A. 0,4.

B. 0,6.

C. 0,75.

D. 0,7.

Hiển thị đáp án

⇒ nCO = nCaCO = 0,135 mol ⇒ a = 1,35 2

3

mdd ↓ = mCaCO - mCO - mH O ⇒ 58,5 = 135 - 1,35.44 - b.18 ⇒ b = 0,95 3

2

2

R1CH2OH + Na → R1CH2ONa + 1/2 H2 ↑ R2COOH + Na → R2COONa + 1/2 H2 ↑


⇒ nR CH OH + nR COOH = 2nH = (2.2,8)/22,4 = 0,25 mol 1

2

2

2

⇒ nR COOH = 0,25 - nR1CH OH = 0,25 - 0,15 = 0,1 mol 2

2

R2COOH + NaOH → R2COONa + H2O R2COOR4 + NaOH -t → R3COONa + R4OH o

⇒ nR COOR + nR COOH = nNaOH = 12/40 = 0,3 mol 3

4

2

⇒ nR COOR = 0,3 - nR COOH = 0,3 - 0,1 = 0,2 mol 3

4

2

⇒ nA = nR CH OH + nR COOH + nR COOR = 0,15 + 0,1 + 0,2 = 0,45 mol 1

2

2

3

4

Gọi công thức phân tử chung của A là CnH2n+2-2kOx (k là số liên kết π trong A)

Số mol brom phản ứng tối đa là: nBr = nA.k - nR COOH = (0,45.17)/9 - 0,1 = 0,75 mol 2

2

ất khi có este ddạng HCOOR Chú ý: Số mol Brom lớn nhất → Đáp án C Câu 110: Đốt cháy hoàn toàn m gam h hỗn hợp X gồm 2 este đồng ng phân cần c dùng u cho m gam X tác dụng d 4,704 lít khí O2, thu đượcc 4,032 lít CO2 và 3,24 gam H2O. Nếu

ch KOH 1M. Cô ccạn dung dịch sau phản ứng thìì thu được 7,98 hết với 110 ml dung dịch muối Y và b mol muối Z (MY > MZ). Các thể tích gam chất rắn khan, trong đó có a mol mu ẩn. T Tỉ lệ a : b là khí đều đo ở điều kiện chuẩn. A. 2 : 3.

B. 3 : 2.

C. 2 : 1.

D. 1 : 5.

Hiển thị đáp án


ức mạch hở → nH O = nCO → este no, đơn chứ 2

2

BTNT Oxi: nO(X) = nH O + 2.nCO - 2.nO = 0,18 + 2.0,18 - 2.0,21 = 0,12 mol 2

2

2

→ neste = nO(este)/2 = 0,12/2 = 0,06 mol

Ta có: Công thức phân tử của este là C3H6O2

→ Đáp án D Câu 111: Hỗn hợp T là hai axit cacboxylic đều đơn chức, mạch hở (biết rằng r A có khả ịch brom ttối đa theo tỉ lệ 1: 2 ); Z là este được ợ tạo bởi T và năng tác dụng với dung dịch

hỗn hợp E chứa T, Z cần dùng ùng 11,2 lít khí O2 (ở etylenglicol. Đốtt cháy 13,12 gam h đktc). Mặt khác 0,36 mol E làm mất màu vừa đủ 16 gam dung dịch Br2. Nếu đun nóng dịch KOH 0,5M (vừa đủ), cô cạn n dung dịch d sau phản 13,12 gam E vớii 400 ml dung d ồm a mol mu muối A và b mol muối B (MA < MB). Tỉ lệ của a: b là ứng thu được hỗn hợp F gồm A. 2: 3.

B. 2: 1.

C. 1: 3.

D. 1: 2.

Hiển thị đáp án đơn chức → R1COOH, R2COOH Hỗn hợp T là hai axit cacboxylic đơ


Z là este được tạo bởi T và etylen glicol → este 2 chức → R1OOC−CH2−CH2−COOR2

- Quá trình 1: 13,12 (g) E + Gọi a, b, c lần lượt là mol của 2 axit trong T, Z. + Ta có:

- Quá trình 2: Khi cho E tác dụng vvới dung dịch Br2, nhận thấy

phản ứng cộng Br2 khi đó Z được tạo bởii A cũng cũ có phản ứng Trong A chỉ có 1 chấtt tham gia ph cộng Br2. t: a mol + Gọi X là axit có 2 liên kết: + Gọi Y là axit có chứa 1 liên kếết: b mol

chứa 3 liên kết: c mol → Z là este của axit X, Y → có ch + Ta có hệ sau:

Bảo toàn C: n.0,03 + m.0,13 + 0,02. (n + m + 2) = 0,49

ới n ≥ 3 và m ≥ 2). (với n, m là số C của X, Y với


+ Xét n = 3 suy ra n = 2.

Từ đó Z gồm + Nếu n > 3 thì m < 2: không thỏỏa mãn → Đáp án C Câu 112: Đốt cháy hoàn toàn 3,08 gam m một hỗn hợp gồm m vinyl axetat, metyl axetat và etyl fomat thu được CO2 và 16 gam H2O. Dẫn toàn bộ sản phẩm cháy vào dung dịch A d B. Khối chứa nước vôi trong dư.. Sau phản ứng lọc kết tủa thu được mộtt dung dịch dịch A lượng dung dịch B so vớii dung d A. tăng 8,72 gam.

B. giảm 8,72 gam.

C. tăng 8,27 gam.

D. giảm 8,27 gam.

Hiển thị đáp án nH O = 2,16/18 = 0,12 mol 2

→ 86x + 74y = 3,08 (1) Đặt công thức chung củaa ba chất là CnH6O2.

→ x + y = 0,04 (1)

→ nCO = 4x + 3y = 0,13 mol 2

CO2 + Ca(OH)2 → CaCO3 ↓ + H2O


→ nCaCO = nCO = 0,13 mol → mCaCO = 13 g 3

2

3

→ (mH O + mCO ) - mCaCO = (16 + 0,13.44) - 13 = 8,72 gam 2

2

3

ch B so vớ với dung dịch A tăng 8,72 gam. → Khối lượng dung dịch → Đáp án A

m 3 este đơn chức, tạo thành từ cùng mộtt ancol Y với v 3 axit Câu 113: Hỗn hợp X gồm ó, có hai axit no là đồng đẳng kế cacboxylic ( Phân tử chỉ có nhóm -COOH); Trong đó, ôi C=C trong phân tiếp và mộtt axit không no ( có đồng phân hình học, chứa một lk đôi ợp muối mu và m gam tử). Thủy phân hoàn toàn 5,88 gam X bằng NaOH, thu được hỗn hợp ancol Y. Cho m gam Y vào bình đựng Na dư, sau phản ứng thu được c 896 ml khí (đktc) ( ng 2,48 gam. Mặt khác, nếu đốt cháy hoàn toàn 5,88 gam X trên và khối lượng bình tăng ng este không no trong X là thì thu được CO2 và 3,96 gam H2O. Phần trăm khối lượng A. 40,82%.

B. 29,25%.

C. 34,01%.

D. 38,46%.

Hiển thị đáp án Đang biên soạn

đơn chức; Y là este của một ancol đơn n chức với một axit Câu 114: X là axit cacboxylic đơ c. Cho m gam h hỗn hợp M gồm X, Y tác dụng với lượng dư dung cacboxylic hai chức. ạn dung d dịch được ancol Z và rắn n khan T trong đó có chứa dịch NaOH, sau đó cô cạn 28,38 gam hỗn hợp muối.i. Cho hơi ancol Z qua ống đựng lượng dư CuO nung nóng, anđehit và hơi nước. Dẫn hơi W qua bình đựng lượng thu được hỗn hợp hơi W gồm an rắ khan T với dư dung dịch AgNO3/NH3, thu được 95,04 gam Ag. Mặtt khác, nung rắn ktc) mộ một ankan duy nhất. Biết các phản ứng xảy ảy ra hoàn toàn. CaO được 4,928 lít (đktc) Giá trị m là A. 29,38.

B. 26,92.

C. 24,20.

D. 20,2.

Hiển thị đáp án


→ Đáp án C

đều mạch hở, thuần chức trong đó X, Y đều đề đơn chức, Z Câu 115: X, Y, Z là ba este đ hỗn hợp E chứa X, Y, Z cần ần dùng 0,94 mol hai chức. Đốt cháy hoàn toàn 19,28 gam h


O2 thu được 11,52 gam nước. Mặt khác đun nóng 19,28 gam E với dung dịch NaOH vừa đủ, thu được hỗn hợp T chứa hai ancol đều no, không thuộc cùng dãy đồng đẳng và hỗn hợp gồm hai muối có tỉ lệ mol 1 : 1. Dẫn toàn bộ T qua bình đựng Na dư, thấy khối lượng bình tăng 9,2 gam. Phần trăm khối lượng của este có khối lượng phân tử nhỏ nhất trong hỗn hợp E có giá trị gần nhất với giá trị nào sau đây? A. 8,9.

B. 10,4.

C. 7,7.

D. 9,1.

Hiển thị đáp án +) E (19,28 g) + O2 (0,94 mol) → CO2 + H2O (0,64 mol) → Bảo toàn khối lượng: mCO = mE + mO - mH O = 37,48 (g) → nCO = 0,86 mol 2

2

2

2

→ Bảo toàn nguyên tố Oxi: nO(E) = 2nCO + nH O - 2nO = 0,48 mol 2

2

2

→ nOH(ancol) = nNaOH = nCOO = 0,24 mol ROH + Na → RONa + 1/2 H2 ↑ → nH = 0,12 mol 2

Bảo toàn khối lượng: mT = mbình tăng + mH = 9,2 + 0,12.2 = 9,44 g. 2

Từ giả thiết → T gồm ancol đơn chức và 2 chức Mặt khác, do X, Y, Z đều mạch hở → các muối đều đơn chức. → số mol mỗi muối là 0,12 mol → Bảo toàn khối lượng: mmuối = mE + mNaOH - mT = 19,28 + 0,24.40 – 9,44 = 19,44 g → Mmuối = 19,44/0,24 = 81 → Phải chứa HCOONa → Mmuối còn lại = (19,44 - 0,12.68)/0,12 = 94 (C2H3COONa) +) Quy E về HCOOH, C2H3COOH, CH3OH, C2H4(OH)2, CH2, H2O → nHCOOH - nC H COOH = 0,12 mol, nH O = -nCOO = -0,24 mol 2

3

2

Đặt nCH OH = x; nC H (OH) = y; nCH = z 3

2

4

2

2

→ mE = 0,12.46 + 0,12.72 + 32x + 62y + 14z – 0,24.18 = 19,28 g. (1)


nCO = nC(E) = 0,12 + 0,12.3 + x + 2y + z (2) 2

nOH = x + 2y = 0,24 mol (3) Từ (1), (2), (3) → x = 0,04 mol; y = 0,1 mol; z = 0,14 mol → Ancol là C2H5OH và C3H6(OH)2

m 0,02 mol HCOOC2H5; 0,02 mol C2H3COOC2H5 và 0,1mol → Hỗn hợp E gồm C2H3COOC3H6OOCH este có KLPT nhỏ nhất là HCOOC2H5

→ Đáp án C

m este X đơn chức và axit cacboxylic Y hai chức (đều mạch Câu 116: Hỗn hợp E gồm đôi C=C trong phân tử). Đốt cháy hoàn àn toàn một lượng E hở, không no có một liên kết đ hơi nước. Mặt khác, thủy y phân 46,6 gam E thu được 0,43 mol khí CO2 và 0,32 mol h ch NaOH 12% rrồi cô cạn dung dịch thu được phần ph hơi Z có bằng 200 gam dung dịch ng khối kh lương bình chứa chất hữu cơ T. Dẫn toàn bộ Z vào bình đựng Na, sau phản ứng ời thoát ra 6,16 lít khí H2 (đktc). Biết tỉ khối của ủa T so với v H2 là tăng 188,85 gam đồng thời ủa Y trong h hỗn hợp E là 16. Phần trăm khối lượng của A. 41,30%.

B. 43,35%.

C. 48,00%.

D. 46,35%.

Hiển thị đáp án Đang biên soạn

hỗn hợp X gồm este đơn chức c M (C5H8O2) và este hai Câu 117: Thủyy phân m gam h ừa đủ 150 ml dung dịch NaOH 1M rồi cô cạn ạn thu được hỗn chức N (C6H10O4) cần vừa hợp Z gồm hai ancol no đơn chức, đồng đẳng kế tiếp, hợp Y gồm hai muối và hỗn h n phẩ phẩm hữu cơ nào khác. Cho toàn bộ hỗn hợp ợp Z tác dụng d với ngoài ra không chứa sản ối hơi so với H2 là một lượng CuO (dư)) nung nóng thu được hỗn hợp hơi T (có tỉ khối ợp T tác d dụng với một lượng dư dung dịch AgNO3/NH3 thu 13,75). Cho toàn bộ hỗn hợp


ản ứng xảy ra hoàn toàn. Thành phần phần ần trăm tr của muối được 32,4 gam Ag. Các phản n trong Y là có phân tử khối nhỏ hơn A. 38,84%.

B. 48,61%.

C. 42,19%.

D. 41,23%.

Hiển thị đáp án Nhận thấyy khi oxi hóa ancol bằng CuO luôn thu được hợp chất hữu cơ C (andehit hoặc xeton) và nước có số mol bằng nhau Ta có MT = (MC + MH O)/2 = 27,5 → MC = 37 → C chứa 2 anđehit kế tiếp ếp nhau là HCHO, CH3CHO 2

ng chéo → HCHO và CH3CHO có số mol bằng nhau. Do MC = 37, sử dụng đường Gọi số mol của HCHO và CH3CHO là x mol

ạc → nAg = 4x + 2x = 0,3 → x = 0,05 mol Khi tham gia phản ứng tráng bạc Vậy 2 ancol thu được gồm CH3OH : 0,05 mol và C2H5OH : 0,05 mol

ần dùng 0,15 mol NaOH thu được 2 muối và 2 ancol CH3OH: 0,05 Khi thủy phân hỗn hợp X cần mol; C2H5OH: 0,05 mol ng este vòng C5H8O2 → B có cấu tạo CH3OOC-CH2COOC2H5: 0,05 mol và A phải có cấu tạo dạng Luôn có nNaOH = 2nB + nA → nA = 0,05 mol Vậy hỗn hợp Y gồm NaOOOC-CH2-COONa: 0,05 mol và C5H9O3Na: 0,05 mol

→ % NaOOC-CH2-COONa = → Đáp án B Câu 118: Hỗn hợp A gồm m ba ch chất hữu cơ X, Y, Z đơn chức, đồng ng phân của c nhau, đều

hỗn hợp A vớii dung dịch dị NaOH vừa tác dụng được với NaOH. Đun nóng 13,875 gam h ỗn h hợp muối và hỗn hợp ancol có tỉ khối hơi so với H2 bằng đủ thu được 15,375 gam hỗn ng 2,1 lít. Phần Ph trăm khối 20,67. Ở 136,50C, 1 atm thể tích hơi của 4,625 gam X bằng ứ tự khối lượng phân tử gốc axit tăng dần) lần ần lượt là lượng của X, Y, Z (theo thứ


A. 40%; 40%; 20%.

B. 40%; 20%; 40%.

C. 25%; 50%; 25%.

D. 20%; 40%; 40%.

Hiển thị đáp án Ta có:

c, tác ddụng được với NaOH ⇒ X, Y, Z là axit hoặc este Mặt khác: X, Y, Z đơn chức,

⇒ CTPT dạng: CxHyO2, dễ dàng ⇒


→ Đáp án B

chất hữu cơ A đơn chức vớii 300 ml dung dịch dị NaOH 1 M Câu 119: Đun 20,4 gam một ch p chất h hữu cơ C. Cho C phản ứng với Na dư thu được 2,24 lít thu được muối B và hợp ợp rrắn gồm NaOH và CaO thu được c khí D có tỉt khối đối với H2 (đktc). Nung B với hỗn hợp ng 0,5. Khi oxi hóa C b bằng CuO được chất hữu cơ E không phản ứng với O2 bằng nh CTCT củ của A? AgNO3/NH3. Xác định A. CH3COOCH2CH2CH3.

B. CH3COOCH(CH3)2

C. C2H5COOCH2CH2CH3.

D. C2H5COOCH(CH3)2.

Hiển thị đáp án Chất C tác dụng vớii Na sinh ra khí H2 ⇒ C là ancol. Oxi hóa C ra E không phản ứng vvới AgNO3 ⇒ C không là ancol bậc 1. Các đáp án cho A là este đơnn chức ⇒ B là muối của Na. Nung B với NaOH rắn tạoo ra D có MD = 32. 0,5 = 16 → D là CH4 → B là CH3COONa. Đặt công thức của A là CH3COOR’ CH3COOR’ + NaOH → CH3COONa + R’OH R’OH + Na → R’ONa + H2↑ CH3COONa + NaOH -CaO, t → CH4↑ + Na2CO3. o

Ta có: nH = 0,1 mol → nancol = 2nH = 2. 0,1 = 0,2 mol 2

2

nNaOH = 0,3 mol > nancol → NaOH dư, este phản ứng hết. → neste = nancol = 0,2 mol → Meste = 20,4/0,2 = 102 → R’ = 102 – 59 = 43. → gốc R’ là C3H7 và C là ancol bậc 2: CH3CH(OH)CH3 → Đáp án B


Câu 120: Cho X, Y (MX < MY) là hai este mạch hở, có mạch cacbon không phân nhánh. Đốt cháy hoàn toàn X hoặc Y luôn thu được CO2 có số mol bằng số mol O2 đã phản ứng. Đun nóng 30,24 gam hỗn hợp E chứa X, Y (số mol của X gấp 1,5 lần số mol Y) trong 400 ml dung dịch KOH 1M, sau phản ứng chỉ thu được hỗn hợp F chứa 2 ancol và hỗn hợp G chứa 2 muối. Cho F vào bình đựng Na dư, sau phản ứng có khí H2 thoát ra và khối lượng bình tăng 15,2 gam. Đốt cháy hoàn toàn G cần vừa đủ 0,42 mol O2. Tổng số nguyên tử trong phân tử Y là A. 19.

B. 20.

C. 22.

D. 21.

Hiển thị đáp án Bảo toàn gốc OH: nOH ancol = nKOH = 1.0,4 = 0,4 mol -OH + Na → -ONa + 1/2 H2 ↑ Bảo toàn khối lượng: mF = 15,2 + 0,2.2 = 15,6 g. Bảo toàn khối lượng: mmuối = 30,24 + 0,4.56 – 15,6 = 37,04 g. Bảo toàn nguyên tố kali: nCOOK = nKOH = 0,4 mol; nK CO = 0,2 mol 2

3

Đốt cháy G được: nCO = x; nH O = y; nK CO = 0,2 mol 2

2

2

3

Bảo toàn nguyên tố Oxi: 0,4.2 + 0,42.2 = 0,2.3 + 2x + y (1) Bảo toàn khối lượng: 37,04 + 0,42.32 = 0,2.138 + 44x + 18y (2) Từ (1) và (2) ta có: x = 0,52 mol; y = 0 mol → muối không chứa H. Vậy muối phải là của axit 2 chức → X, Y là hai este 2 chức → nX = 0,12 mol; nY = 0,08 mol Đặt số C trong gốc axit của X và Y là a và b nC(X) + nC(Y) = nC(F) + nC(G) → 0,12a + 0,08b = 0,2 + 0,52 Giải phương trình nghiệm nguyên: a = 2, b = 6 → 2 muối là (COOK)2 và KOOCC≡C–C≡CCOOK


Mặt khác, đốt X hay Y đềuu cho nCO = nO 2

2

→ Có dạng cacbohidrat Cn(H2O)m Lại có X và Y đều là este 2 chức → m = 4 → X, Y đều chứa 8H trong phân tử

đều đơn chức → nF = nOH = 0,4 mol → MF = 39 → F có chứa Do X và Y mạch hở → 2 ancol đề ancol CH3OH → X là CH3OOCCOOC2H5; Y là CH3OOCC≡C–C≡CCOOC2H5 chứa 21 nguyên tử → Đáp án D m Este Lipit có llời giải chi tiết (nâng cao – phần 4) 150 câu trắc nghiệm

un nóng 0,1 mol este no, đơn chức mạch hở X vớii 30 ml dung dịch d 20% (D Câu 121: Đun roxit kim lo loại kiềm A. Sau khi kết thúc phản ứng xà phòng hoá, = 1,2 g/ml) của một hiđroxit chất rắn Y và 4,6 gam ancol Z, biết rằng ng Z bị b oxi hoá bởi cô cạn dung dịch thì thu được ch m có khả năng phản ứng tráng bạc. Đốtt cháy chất chấ rắn Y thì thu CuO thành sản phẩm hỗn hợp CO2 và hơi nước. Công thức th cấu được 9,54 gam muốii cacbonat, 8,26 gam h tạo của X là A. CH3COOCH3. C. HCOOCH3.

B. CH3COOC2H5. D. C2H5COOCH3.

Hiển thị đáp án ch hở: CnH2n+1COOCmH2m+1 (0 ≤ n; 1 ≤ m) X là este no, đơn chức, mạch

Ta có: nX = nAOH (pư) = nZ = 0,1 mol ⇒ MZ = 14m + 18 = 4,6/0,1 ⇒ m = 2 ⇒ Z: C2H5OH Mặt khác:


→ nNaOH (ban đầu) = 7,2/40 = 0,18 mol

→ n = 1 → X: CH3COOC2H5 → Đáp án B

m ancol A, axit cacoxylic B ((đều no, đơn chức, mạch m hở) và Câu 122: Hỗn hợp X gồm este C tạo ra từ A và B. Đốt cháy hoàn toàn m gam X cần dùng vừa đủ 0,18 mol O2, dịch ch NaOH 0,1M đun nóng, sinh ra 0,14 mol CO2. Cho m gam X trên vào 500ml dung d ịch Y còn lại 3,68 sau khi kết thúc các phản ứng thu được dung dịch Y. Cô cạn dung dịch gam chất rắn khan. Ngườii ta cho thêm bột CaO và 0,48 gam NaOH vào 3,68 gam chất ng xảy xả ra hoàn toàn rắn khan trên rồii nung trong bình kín (chân không).Sau khi phản ứng của m gần nhất với thu được m gam khí. Giá trịị củ A. 0,85 gam.

B. 1,25 gam.

C. 1,45 gam.

D. 1,05 gam.

Hiển thị đáp án Đang biên soạn

hỗn hợp X gồm este đơn chức A (C5H8O2) và este nhị Câu 123: Thủyy phân m gam h chức B (C6H10O4) cần dùng vừa đủ 150 ml dung dịch NaOH 1M rồi cô cạn thu được hỗn hợp Y gồm 2 muối và hỗn hợp Z gồm 2 ancol no đơn chức đồng đẳng kế tiếp. p Z tác dụ dụng với một lượng CuO dư nung nóng thu được hỗn hợp Cho toàn bộ hỗn hợp ụng với v một lượng hơi T (có tỉ khối hơi so với H2 là 13,75). Cho toàn bộ hỗn hợp T tác dụng dư dung dịch AgNO3/NH3 thu được 32,4g Ag. Các phản ứng xảy ra hoàn toàn. Thành

ng mu muối có phân tử nhỏ hơn trong hỗn hợp Y là : phần phần trăm khối lượng A. 38,84%

B. 48,61%


C. 42,19%

D. 41,23%

Hiển thị đáp án Nếu trong T không chứaa HCHO → nandehit = 0,5nAg = 0,15 mol

ng CuO → nnước = nandehit = 0,15 mol Có khi oxi hoa ancol bằng

Vậy T chắc chắn chứaa HCHO: a mol và CH3CHO : b mol Ta có hệ

Vì nNaOH = 0,15 mol > ∑nancol = 0,1 mol → chứng tỏ A phải có cấu tạo vòng

( ví dụ

)

và B có cấu tạo CH3OOC-CH2-COOC2H5: 0,05 mol Muối thu được gồm HOCH2-CH2-CH2-CH2-COONa: 0,05 mol và NaOOCCH2COONa: 0,05 mol % HOCH2-CH2-CH2-CH2-COONa = 48,61%. → Đáp án B

m mộ một axit đa chức X và một hợp chất hữu cơ tạp chức Y đều Câu 124: Hỗn hợp A gồm a các nguyên tử C, H, O. Tiến hành ba thí nghiệm với vớ m gam hỗn có thành phần chứa hợp A TN1: phản ứng hoàn toàn với lượng dư AgNO3 trong NH3 thu được c 43,2 gam Ag.

ới 100 ml dung d dịch KHCO3 2M. TN2: phản ứng vừa đủ với ới 100 ml dung d dịch KOH 4M, thu được c 1 ancol duy nhất nh Z và TN3: phản ứng vừa đủ với Dẫn toàn bộ Z qua bình đựng Na dư thấy khối khố lượng bình hỗn hợp T gồm hai muối.i. Dẫ


tăng 9 gam, đồng thời thu được 2,24 lít khí H2. Đốt cháy hoàn toàn hỗn hợp T bằng lượng O2 vừa đủ thu được 8,96 lít CO2, nước và muối cacbonat. Biết các khí đo ở điều kiệu tiêu chuẩn, phần trăm khối lượng của Y trong hỗn hợp A có giá trị gần nhất với giá trị A. 69,5%.

B. 31,0%.

C. 69,0%.

D. 30,5%.

Hiển thị đáp án TN1 → nCHO = 0,5. nAg = 0,2 mol TN2 → nHCO = nCOOH = 0,2 mol 3

TN3 → nCOO = nKOH = 0,4 mol > nCOOH → chứng tỏ Y chứa nhóm COO: 0,2 mol, CHO: 0,2 mol. Bảo toàn nguyên tố K → nK CO = 0,5nKOH = 0,2 mol 2

3

Có ∑ nC (muối) = nCO + nK CO = 0,6 mol = nCOOH + nCHO + nCOO 2

2

3

Y tạp chức → chứng tỏ X là (COOH)2: 0,1 mol và Y là HOC-COOR': 0,2 mol Ancol Z + Na → muối + H2 → mancol = mbình tăng + mH = 9,2 gam và nOH- = 2nH = 0,2 mol 2

2

Z là ancol đơn chức → Mancol = 9,2/0,2 = 46 (C2H5OH ) → Y là HOC-COOC2H5 %Y = 69,38% → Đáp án A Câu 125: Cho hỗn hợp X gồm hai chất hữu cơ, no đơn chức, mạch hở (chứa C, H, O) tác dụng vừa đủ với 20ml dung dịch NaOH 2M thu được một muối và một ancol. Đun nóng lượng ancol thu được với axit H2SO4 đặc ở 170°C thu được 0,015 mol anken (là chất khí ở điều kiện thường). Nếu đốt cháy lượng X như trên rồi cho sản phẩm qua


x ra hoàn bình đựng CaO dư thì khối lượng bình tăng 7,75 gam. Biết các phản ứng xảy ây đ đúng ? toàn. Phát biểu nào sau đây A. Khối lượng của chấtt có phân ttử khối lớn hơn trong X là 2,55 gam.

a hai ch chất trong X là 164. B. Tổng phân tử khối của ối lượng các chất trong X là 49,5% và 50,5%. C. Thành phần phần trăm khố thức cấu tạo phù hợp với điều kiện bài toán. D. Một chấtt trong X có 3 công th Hiển thị đáp án - Khi đốt cháy X có nCO = nH O 2

2

→ 44nCO + 18nH O = mbình tăng → 44a + 18a = 7,75 → a = 0,125 mol 2

2

ới NaOH : - Xét quá trình X tác dụng với + Nhận thấy rằng, nNaOH > nanken → trong trong X chứa 1 este và 1 axit. Khi dehirat hóa ancol thì : neste A = nanken = 0,015 mol → naxit (B) = nX – neste = 0,025 mol - Gọi CA và CB lần lượt là số nguyên tử C của este A và axit B (với CA ≥ 3, CB ≥ 1) → nA. CA + nB.CB = nCO → 0,015CA + 0,025CB = 0,125 → CA = 5, CB = 2 (Thỏa mãn) → Vậy A 2

là C5H10O2 và B là C2H4O2

giữa A và B là: ∆m = 102nA – 60nB = 0,03 g. A. Sai, Độ chênh lệch khối lượng gi ng phân tử kh khối của A và B là 162. B. Sai, Tổng khối lượng C. Đúng,

D. Sai, Este A có 7 đồng ng phân tương ứng là: CH3COO-C3H7 (2 đồng ng phân) ; HCOO-C4H9 (4 đồng phân); C2H5COOC2H5 (1 đồồng phân) và axit B chỉ có 1 đồng phân là CH3COOH. → Đáp án C


ều đơn chức, mạch hở (trong đó Y và Z đều có hai liên kết Câu 126: X, Y, Z là 3 este đề ỗn hợp hợ E chứa X, pi trong phân tử và có đồng phân hình học). Đốt cháy 21,62 gam hỗn n phẩ phẩm cháy dẫn qua dung dịch Ca(OH)2 dư ư thấy khối lượng Y, Z với oxi vừa đủ, sản m 34,5 gam so vớ với trước phản ứng. Mặt khác, đun un nóng 21,62 gam E với dung dịch giảm ch NaOH 1M (v (vừa đủ), thu được hỗn hợp F chỉ chứa ứa 2 muối mu và hỗn 300 ml dung dịch p thuộ thuộc cùng dãy đồng đẳng. Khối lượng của ủa muối mu có khối hợp gồm 2 ancol kế tiếp n trong hỗn hợp F là lượng phân tử lớn hơn A. 4,68 gam.

B. 8,1 gam.

C. 9,72 gam.

D. 8,64 gam.

Hiển thị đáp án - Đặt nCO = X; nH O = y → n↓ = X → mdd giam = m↓ - (mCO + mH O) 2

2

2

2

→ 100x – (44x + 18y) = 34,5 (1) - nCOO = nNaOH = 0,3 mol, mE = mC + mH + mO

→ 21,62 = 12x + 2y + 0,3.2.16 = 21,62 (2) Từ (1), (2) ta có có: x = 0,87 mol; y = 0,79 mol - X, Y, Z đều đơn chức → nE = nCOO = 0,3 mol → C = 0,87/0,3 = 2,9 → X là HCOOCH3 2 ancol là CH3OH và C2H5OH. Lại có Y và Z có 2π → liên kết π trong gốc axit → Y và Z tạo bởi cùng 1 gốcc axit nY,Z = nCO - nH O = 0,08 mol → nX = nNaOH - 0,08 = 0,22 mol 2

2

Mà Y và Z có đồng phân hình họọc → chứa CH3CH=CHCOOCH3 → 2 muối là: 0,08 mol CH3CH=CHCOONa và 0,22 mol HCOONa Muối có PTK lớn hơn là CH3CH=CHCOONa → mmuối có PTK lớn = 0,08. 108 = 8,64g.


→ Đáp án D Câu 127: Hợp chất X chứa ứa (C,H,O) có 5 liên kết pi trong phân tử, ử, X tác dụng d với NaOH theo tỉ lệ 1 : 3. Đốt cháy hoàn toàn 13,8 gam X cần dùng vừa đủ 15,68 lít khí ng thu được 5,4 gam nước. Mặt khác, thủy y phân hoàn toàn 6,9 O2 (đktc), sau phản ứng ạ dung dịch A gam X trong 100 ml dung dịch NaOH 2M thu được dung dịch A. Cô cạn

ắn là thu được khối lượng chất rắn A. 11,1 gam.

B. 13,1 gam.

C. 9,4 gam.

D. 14,0 gam.

Hiển thị đáp án Ta có: nO = 15,68/22,4 = 0,7 mol; nH O = 5,4/18 = 0,3 mol; nNaOH = 0,1.2 = 0,2 mol 2

2

Thí nghiệm 1: Đốt cháy X

Bảo toàn khối lượng: mX + mO = mCO + mH O 2

2

2

→ 13,8 + 0,7.32 = mCO + 5,4 → = 30,8 g → nCO = 30,8/44 = 0,7 mol 2

2

Bảo toàn nguyên tố oxi: nO(X) + 2nO = 2nCO + nH O → nO(X) + 2.0,7 = 2.0,7 + 0,3 → nO(X) = 0,3 mol 2

2

2

Gọi công thức của X là Ta có: x : y : z = 0,7 : 0,6 : 0,3 = 7 : 6 : 3

ủa X là C7H6O3 → Công thức đơn giản nhất của → Công thức phân tử của X là (C7H6O3)n Vì X có 5 liên kết π trong phân tử nên k = 5 → 4n + 1 = 5 → n =1 → Công thức phân tử của X là C7H6O3 Vì X phản ứng vớii NaOH theo tỉ lệ 1:3


→ Công thức cấu tạo của X là HCOOC6H4OH Thí nghiệm 2: 6,9 gam X tác dụng với 0,2 mol NaOH: nX = 6,9/138 = 0,05 mol HCOOC6H4OH (0,05) + 3NaOH (0,2) → HCOONa (0,05) + ONaC6H4ONa (0,05) + 2H2O → Chất rắn gồm: HCOONa: 0,05 mol; NaOC6H4ONa: 0,05 mol và NaOH: 0,2 – 0,05.3 = 0,05 mol → mrắn = 0,05.68 + 154.0,05 + 40.0,05 = 13,1 g → Đáp án B Câu 128: Để thuỷ phân hết 7,612 gam hỗn hợp X gồm 2 este đơn chức và 2 este đa chức thì cần dùng vừa hết 80ml dung dịch KOH aM. Sau phản ứng, thu được hỗn hợp Y gồm các muối của các axit cacboxylic và các ancol. Đốt cháy hoàn toàn hỗn hợp Y thì thu được K2CO3; 4,4352 lít CO2 (đktc) và 3,168 gam H2O. Vậy a gần với giá trị nào sau đây nhất ? A. 1,63.

B. 1,42.

C. 1,25.

D. 1,56

Hiển thị đáp án Ta có: nCO = 4,4352/22,4 = 0,198 mol; nH O = 3,168/18 = 0,176 mol. 2

2

nKOH = 0,08a → nCOO = 0,08a; nK CO = 0,04a mol 2

3

Bảo toàn nguyên tố: nC(X) = 0,04 + 0,198 ; nH(X) = 2.0,176 - 0,08a ; nO(X) = 0,08a.2 → 12(0,04a + 0,198) + 2.0,176 - 0,08a + 0,16a.16 = 7,612 → a = 1,65 → Đáp án A Câu 129: Cho 1 mol chất X (C9H8O4, chứa vòng benzen) tác dụng hết với NaOH dư, thu được 2 mol chất Y, 1 mol chất Z và 1 mol H2O. Chất Z tác dụng với dung dịch H2SO4 loãng, thu được chất hữu cơ T. Phát biểu nào sau đây sai?


A. Chất Y có phản ứng tráng bạc. B. Chất X tác dụng với NaOH theo tỉ lệ mol 1:3. C. Chất T tác dụng với NaOH theo tỉ lệ mol 1:2. D. Phân tử chất Z có 2 nguyên tử oxi. Hiển thị đáp án k = 6 = 1 vòng benzen + 2πC=O → X không chứa πC=C ngoài vòng benzen. Dễ thấy X là HCOOC6H4CH2OOCH → Y là HCOONa, Z là NaOC6H4CH2OH. → T là HOC6H4CH2OH → C sai vì T tác dụng với NaOH theo tỉ lệ 1 : 1 → Đáp án C Câu 130: Đốt cháy hoàn toàn a mol X (là trieste của glixerol với các axit đơn chức, mạch hở), thu được b mol CO2 và c mol H2O (b - c = 5a). Hiđro hóa m1 gam X cần 6,72 lít H2 (đktc), thu được 89,00 gam Y (este no). Đun nóng m1 gam X với dung dịch chứa 0,45 mol NaOH, cô cạn dung dịch sau phản ứng, thu được m2 gam chất rắn. Giá trị của m2 là A. 91,20 C. 104,40

B. 97,80 D. 97,20

Hiển thị đáp án Vì b - c = 5a nên trong X có chứa 6 liên kết pi với 3 liên kết pi ở 3 nhóm –COO và 3 liên kết pi ở mạch C của axit. Ta có nH = 0,3 = 3nX nên nX = 0,1 mol 2

Bảo toàn khối lượng, ta có mX = meste – mH = 89 – 0,3.2 = 88,4g 2

Bảo toàn khối lượng, ta có mX + mNaOH = m2 + mC H (OH)3 (nglixerol = nX = 0,1 mol) 3

→ m2 = 88,4 + 0,45.40 – 0,1.92 = 97,2 g. → Đáp án D

5


hỗn hợp X gồm hai este đồng ng phân cần c dùng Câu 131: Đốt cháy hoàn toàn m gam h u cho m gam X tác 27,44 lít khí O2, thu đượcc 23,52 lít khí CO2 và 18,9 gam H2O. Nếu ịch NaOH 1M, cô ccạn dung dịch sau phản ứng thì thu được dụng hết với 400 ml dung dịch n khan, trong đó có a mol muối Y và b mol muối Z (MY < MZ). Các thể 27,9 gam chất rắn tích khí đều đo ở điều kiện tiêu chuẩn. Tỉ lệ a : b là A. 3 : 5.

B. 2 : 3.

C. 3 : 2.

D. 4 : 3.

Hiển thị đáp án

→ Đáp án D Câu 132: Este hai chứcc X tác d dụng với dung dịch NaOH tạo ra mộtt muối muố và một ancol đều có số mol bằng số mol este, đều có cấu tạo mạch thẳng. Mặtt khác 2,58 gam X tác dụng vừa đủ với 0,03 mol KOH thu được 3,33 gam muối. Este đó là A. (COO)2C2H4. C. C4H8(COO)2C2H4.

B. C2H4(COO)2C3H6. D. (CH3COO)2C2H4.

Hiển thị đáp án

→ Đáp án C Câu 133: Hỗn hợp E chứa ứa este X (CnH2n-6O4) và este Y (CmH2m-4O6) đều ề mạch hở và thuần chức. Hidro hóa hoàn toàn 41,7 gam E cần dùng 0,18 mol H2 (Ni/to). Đốt cháy un nóng 0,18 mol E với v dung hết 41,7 gam E thu đượcc 18,9 gam H2O. Mặt khác nếu đun


hỗn hợp chứa muối của axit đơn chức c có khối kh lượng m dịch KOH vừa đủ thu được hỗ đa chức. Giá trị của m là gam và hỗn hợp 2 ancol no, đ A. 16,835. C. 43,2.

B. 22,5. D. 57,6.

Hiển thị đáp án Từ công thức X, Y → chất đầu dãy là (C2H3COO)2C2H4 và (HCOO)3C3H5 Qui đổi hỗn hợp E thành: C8H10O4 (x mol); C6H8O6 (y mol) và CH2 (z mol) Lập hệ phương trình:

→ nE(41,7g) = 0,09 + 0,15 = 0,24 mol. +) mmuối = (0,18/0,24). (mE + mKOH – metilenglicol - mglixerol) mE = 41,7 g; mKOH = (2.0,09 + 3.0,15).56 = 35,28 g; metilenglycol = 0,09. 62 = 5,58 g; mglyxerol = 0,15.92 = 13,8 g → mmuối = 43,2 g. → Đáp án C Câu 134: Đốt cháy hoàn toàn 22,9 gam hỗn hợp X gồm hai este đơn chức, mạch hở ới hai axit cacboxylic kkế tiếp nhau trong dãy đồng đẳng, thu tạo bởi cùng một ancol với được 1,1 mol CO2 và 15,3 gam H2O. Mặt khác, toàn bộ lượng X trên phản ứng hết với ch NaOH 1M thu được dung dịch Y. Cô cạn dung dịch ịch Y thu được m 300 ml dung dịch n khan. Khi cho X tác d dụng với dung dịch AgNO3/NH3 dư ư thấy có kết tủa gam chất rắn

a m là trắng xuất hiện. Giá trị của A. 19,0.

B. 18,4.


C. 26,9.

D. 20,4.

Hiển thị đáp án nH O = 15,3/18 = 0,85 mol 2

Bảo toàn khối lượng: mO(X) = mX - mC - mH

nX = nO(X)/2 = 0,5/2 = 0,25 mol Gọi công thức chung củaa 2 este trong X là CnH2n+2-2kO2

Ta thấy nX = nCO - nH O = 1,1 - 0,85 = 0,25 → k = 2 2

2

→ este X trong mạch C có 1 liên kết C=C .

→ Công thức phân tử 2 este là: C4H6O2 và C5H8O2 Khi cho X tác dụng vớii dung dịch AgNO3/NH3 dư thấy có kết tủa trắng xuấtt hiện

BTKL: m = mX + mNaOH - mancol(CH =CH-CH -OH) = 22,9 + 0,3.40 - 0,25.58 = 20,4 gam 2

→ Đáp án D

2


Câu 135: Hỗn hợp E gồm este đơn chức X và este hai chức Y (X, Y đều no, mạch hở). Xà phòng hóa hoàn toàn 40,48 gam E cần vừa đủ 560 ml dung dịch NaOH 1M, thu được hai muối có tổng khối lượng a gam và hỗn hợp T gồm hai ancol có cùng số nguyên tử cacbon. Đốt cháy toàn bộ T, thu được 16,128 lít khí CO2 (đktc) và 19,44 gam H2O. Giá trị của a gần nhất với giá trị nào sau đây? A. 43,0.

B. 37,0.

C. 40,5.

D. 13,5.

Hiển thị đáp án Giải T + O2 -t → 0,72 mol CO2 + 1,08 mol H2O. o

Tương quan nT = ∑nH O - ∑nCO → số C = 0,72/0,36 = 2 2

2

→ 2 ancol no có cùng số C là 2 chỉ cố thể là C2H5OH và C2H4(OH)2 → nX + nY = ∑nhỗn hợp ancol = 0,36 mol; lại có → giải hệ só mol có nX = 0,16 mol; nY = 0,2 mol. Từ giả thiết đề cho có: 40,48 gam E + 0,56 mol NaOH → a gam muối + 0,15 mol C2H5OH + 0,2 mol C2H4(OH)2 → bảo toàn khối lượng có a = 43,12 gam → Chọn đáp án A Giải cụ thể và rõ hơn 2chất X và Y ta biện luận giải pt nghiệm nguyên như sau: 40,48 gam hỗn hợp E gồm 0,16 mol X dạng CnH2nO2 và 0,2 mol Y dạng CmH2m-2O4 → 0,16.(14n + 32) + 0,2.(14m + 62) = 40,48 → 4n + 5m = 41 Cặp nghiệm nguyên thỏa mãn là n = 4 và m = 5.ứng với X là CH3COOC2H5 và Y là HCOOCH2CH2OOCCH3. → Đáp án A Câu 136: Hỗn hợp E chứa hai chất hữu cơ đều mạch hở và không chứa nhóm chức khác gồm este X (CnH2n–2O2) và este Y (CmH2m–4O4), trong đó số mol của X lớn hơn số mol của Y. Đốt cháy hết 16,64 gam E với oxi vừa đủ, thu được x mol CO2 và y mol H2O


với x = y + 0,2. Mặt khác đun nóng 16,64 gam với dung dịch KOH vừa đủ, thu được hỗn hợp F chứa 2 ancol đồng đẳng kế tiếp và hỗn hợp hợp chứa 2 muối; trong đó có a gam muối A và b gam muối B. Dẫn toàn bộ F qua bình đựng Na dư, thấy khối lượng bình tăng 6,76 gam. Giá trị gần nhất của a: b là A. 1,7.

B. 1,8.

C. 1,6.

D. 1,5.

Hiển thị đáp án X có dạng CnH2n-2O2 và Y có dạng CmH2m-4O4, lại cho 2 ancol đồng đẳng kế tiếp → 2 ancol no, đơn chức, mạch hở. Ta có: x = y + 0,2 → x – y = 0,2 = nX + 2nY → n2 ancol = 0,2mol Gọi ancol là ROH (0,2 mol) → nH = 0,1 → mbình tăng = mancol – mH 2

2

→ 6,76 = 0,2. (R + 17) – 0,2 → R = 17,8 → 2 ancol CH3OH (z mol) và C2H5OH (t mol) → z + t = 0,2 và 32z + 46t – 0,2 = 6,76 → z = 0,16 và t = 0,04 Do nX > nY , ta xét 2 trường hợp sau: TH1: X tạo bởi CH3OH và Y tạo bởi C2H5OH Quy đổi hỗn hợp thành C4H6O2 (0,16 mol); C8H12O4(0,04 mol); CH2 (x mol) Có mhỗn hợp = 16,64 → x < 0 (loại) TH2: X tạo bởi CH3OH và Y tạo bởi cả 2 ancol. Quy đổi hỗn hợp thành C4H6O2 (0,12 mol); C7H10O4(0,04 mol); CH2 (x mol) (do chia mất CH3OH vào 2 ancol) Có mhỗn hợp = 16,64 → x = 0 → X là C2H3COOCH3 (0,12 mol) và Y là CH3OOC-C2H2-COOC2H5 (0,04 mol)


→ muối thu được là C2H3COONa (0,12 mol) và C2H2(COONa)2 (0,04 mol) → mC H COONa = 11,28 và mC H (COONa)2 = 6,4 2

3

2

2

(nhận thấy các đáp án. a:b đều > 1) → a = mC H COONa = 11,28 và b = mC H (COONa)2 = 6,4 2

3

2

2

→ a : b = 11,28/6,4 = 1,7625 → Đáp án A Câu 137: Tiến hành phản ứng thu thuỷ phân hỗn hợp X gồm m 2 este no, mạch mạ hở, thuần

ch NaOH vvừa đủ trong bình cầu 3 cổ. Chưng cất dung dịch d sau chức bằng dung dịch đều có khối kh lượng phản ứng, thu đượcc dung dịch Y và hỗn hợp hơi Z gồm 2 ancol (đều c 3,36 lít CO2 (đktc) phân tử < 100 đvC). Đốtt cháy hoàn toàn hỗn hợp ancol Z, thu được n dung d dịch Y, thu được 10,66 gam muốii B của một m axit hữu và 4,32 gam H2O. Cô cạn ối Na2CO3. Thành cơ, đốt cháy hoàn toàn B với dòng khí oxi dư, thu được 6,89 gam muối ủa este có phân ttử khối lớn hơn trong X là phần % khối lượng của của A. 60,78%.

B. 58,97% .

C. 47,25%.

D. 54,90%.

Hiển thị đáp án Bước 1. Tìm muối B: Đốt B: nNa CO = 6,89/106 = 0,065 mol 2

3

Đốt Z: nCO = 3,36/22,4 = 0,15 mol; nH O = 4,32/18 = 0,24 mol 2

2

Bảo toàn Na: nNa/B = nNaOH = 2nNa CO = 0,13 mol = nmuối 2

3

ở Z gồ gồm các ancol no, hở Vì X gồm 2 este no, mạch hở → Gọi CT chung của Z là CnH2n+2Om

nancol = 0,24 – 0,15 = 0,09 mol


Phản ứng thuỷ phân (RCOO)mR’ + mNaOH → mRCOONa + R’(OH)m

ức, 1 ancol đơn chức → Hỗn hợp este X có ít nhấtt 1 este đơn chức hỗn hợp Z gồm 1 ancol đa chức, c, gọi B là RCOONa Axit tạo muối B là đơn chức, → nRCOONa = nNa/B = 0,13 mol ⇒ MRCOONa = 10,66/0,13 = 82 R = 15, R là CH3, muối B là CH3COONa

ỗn hhợp Z Bước 2. Tìm các chất trong hỗn Vì n = 1,67 CT của 1 ancol là CH3OH: a mol và ancol còn lại là CnH2n+2Om ta có: a + nb = 0,15 và a + b = 0,09 → (n – 1).b = 0,06 a + mb = 0,13 → (m – 1).b = 0,04

n, làm cho Mancol > 100 Có thể thấy ngay là n = 4 và m = 3, những giá trị lớn hơn, Vậy 2 ancol là CH3OH và C4H7(OH)3, Gọi a và b là số mol của 2 ancol tương ứng

% khối lượng của: (CH3COO)3C4H7 → Đáp án C Câu 138: X, Y là hai axit no, đơn chức, đồng đẳng liên tiếp, Z là ancol 2 chức, T là este thuần chức tạo bởii X, Y, Z. Đốt cháy 0,1 mol hỗn hợp E chứa X, Y, Z, T cần dùng ợng CO2 nhiều hơn H2O là 10,84 gam. Mặt khác 0,1 mol E 0,47 mol khí O2 thu được lượ


tác dụng vừa đủ vớii 0,11 mol NaOH thu được dung dịch G và mộtt ancol có tỉt khối so

ồi nung nóng vvới xút có mặt CaO thu được c m gam hỗn hợp với H2 là 31. Cô cạn G rồi ất vớ với khí. Giá trị của m gần nhất A. 2,5.

B. 3,5.

C. 4,5.

D. 5,5.

Hiển thị đáp án dancol/H = Mancol = 62 → Ancol Z có CTCT HOCH2CH2OH(C2H6O2) 2

Ta có:

Khi đốt cháy E có:

Áp dụng ĐLBTNT.O: nO(E) + 2nO = 2nH O → 4a + 2b + 2c + 0,47.2 = 0,41.2 + 0,4 2

2

→ 4a + 2b + 2c + 0,47.2 = 0,41.2 + 0,4 → 4a + 2b + 2c = 0,28 mol

Giả hệ PT: Áp dụng ĐLBTKL cho phản ứng cháy: → mE = 0,41.44 + 0,4.18 – 0,47.32 = 10,2

0,1 mol E + 0,11 mol NaOH

thủy phân: mE + mNaOH = mRCOONa + mancol + mnước Áp dụng ĐLBTKL cho phản ứng th


→ mRCOONa = 10,2 + 0,11.40 – 0,07.62 – 0,03.18 = 9,72 gam. → mRH = 9,72 – 0,11.(69 – 1) = 2,46 g → Đáp án A Câu 139: Cho 1 mol triglixerit X tác dụng với dung dịch NaOH dư, thu được 1 mol glixerol, 1 mol natri panmitat, 1 mol natri oleat và 1 mol natri linoleat. Có các phát biểu sau: (a) Phân tử X có 6 liên kết π. (b) Có 6 đồng phân cấu tạo thỏa mãn tính chất X. (c) X có nhiệt độ nóng chảy và nhiệt độ sôi thấp hơn tristearin. (d) 1 mol X có thể cộng tối đa 3 mol H2 (Ni, to). Số phát biểu đúng là A. 4.

B. 1.

C. 2.

D. 3.

Hiển thị đáp án Natri panmitat: C15H31COONa; natri oleat: C17H33COONa; natri linoleat: C17H31COONa. → X được tạo bởi 3 axit C15H31COOH; C17H33COOH; C17H31COOH. → các mệnh đề đúng: a, c, d. (X có 4 đồng phân thỏa mãn). → Đáp án D Câu 140: Hỗn hợp X gồm một axit cacboxylic Y và một este Z (Y, Z đều mạch hở không phân nhánh). Đun nóng 0,275 mol X cần dùng 200 ml dung dịch NaOH 2M thu được hỗn hợp 2 muối và hỗn hợp 2 ancol. Đun nóng toàn bộ 2 ancol này với H2SO4 đặc ở 140oC thu được 7,5 gam hỗn hợp 3 ete. Lấy hỗn hợp 2 muối trên nung với vôi tôi xút chỉ thu được một khí duy nhất, khí này làm mất màu vừa đủ dung dịch 44 gam Br2 thu được sản phẩm chứa 85,106% brom về khối lượng. Khối lượng của Z trong X là:


A. 18,96 gam.

B. 23,70 gam.

C. 10,80 gam.

D. 19,75 gam.

Hiển thị đáp án ỗn hợ hợp X gồm axit Y và esteZ thu được hai ancol và hai muối nên Z - Nhận thấy rằng, khi cho hỗn

chức và hai ancol, ta có hệ sau: là este hai chức được tạo từ axit hai ch

ng ancol thu được với H2SO4 đặc ở 140oC thì - Khi đun nóng toàn bộ lượng nH O = nancol/2 = 2nZ/2 = 0,125 mol → BTKL: mancol = meste + 18nH O = 9,75(g) 2

2

→ Hỗn hợp ancol gồm CH3OH và C2H5OH.

ối tác ddụng với NaOH/ CaO (to), rồi cho hỗn n khí tác dụng d với Br2 ta - Xét quá trình hỗn hợp muối được:

→ mkhí = mdẫn xuất halogen - mBr = 7,7(g) 2

- Giả sử khí thu được là anken thì: Mhidrocacbon = mkhi/mBr = 28(C2H4) 2

→ muối C2H3COONa và NaOOC-CH=CH-COONa Vậy este Z là CH3OOC-CH=CH-COOC2H5 với mZ = 19,75g. → Đáp án D Câu 141: Este X có công thứ ức phân tử là C5H8O2. Đun un nóng 10,0 gam X trong 200 ml ch NaOH 0,3M. Sau khi ph phản ứng hoàn toàn, cô cạn dung dịch ịch sau phản ph ứng dung dịch

ắn khan. V Vậy tên gọi của X là: thu được 5,64 gam chất rắn A. vinyl propionat. C. etyl acrylat.

B. anlyl axetat. D. metyl metacrylat.


Hiển thị đáp án nX = 0,1 mol; nNaOH = 0,06 mol → X dư → nchất rắn = nNaOH ( chất rắn chính là muối RCOONa ) → MRCOONa = R + 67 = 94 → R = 27 (CH2=CH-) → X là CH2=CHCOOC2H5 ( etyl acrylat ) → Đáp án C Câu 142: Thủy phân hoàn toàn chất béo X trong môi trường axit, thu được glixerol và hỗn hợp hai axit béo. Nếu đốt cháy hoàn toàn a mol X thì thu được 12,32 lít CO2 (đktc) và 8,82 gam H2O. Mặt khác, a mol X tác dụng tối đa với 40 ml dung dịch Br2 1M. Hai axit béo là A. axit panmitic và axit linoleic. B. axit stearit và axit linoleic. C. axit stearit và axit oleic. D. axit panmitic và axit oleic. Hiển thị đáp án nCO = 0,55 mol; nH O = 0,49 mol → π + 3 = (0,55-0,49)/a + 1 (1) 2

2

C-C

nπ = a.πC-C = nBr = 0,04 mol (2) C-C

2

(1) và (2) → a = 0,01 → πC-C = 4 và C = 0,55/0,01 = 55 → Đáp án A Câu 143: Đun nóng m gam hỗn hợp X gồm ba este đều no, mạch hở với lượng dư dung dịch AgNO3 trong NH3, thu được 17,28 gam Ag. Mặt khác, đun nóng m gam X với dung dịch NaOH vừa đủ, thu được hỗn hợp Y gồm hai ancol hơn kém nhau một nguyên tử cacbon và 22,54 gam hỗn hợp Z gồm hai muối của hai axit có mạch không phân nhánh. Đốt cháy hoàn toàn Y, thu được 11,44 gam CO2 và 9,0 gam H2O. Phần trăm khối lượng của este có khối lượng phân tử lớn nhất trong hỗn hợp X là A. 76,7%.

B. 58,2%.


C. 51,7%.

D. 68,2%.

Hiển thị đáp án nAg = 0,16 mol → nHCOO = 0,08 mol → Vậy Y chứa CH3OH (a mol) và C2H6Ox (b mol với x = 1 hoặc x = 2).

Ta có: (1): a + b = 0,24; (2): a + 2b = 0,26 → a = 0,22; b = 0,02. +) TH1: X là este no, đơn chức, X ggồm este no tạo bởi HCOOH, RCOOH vàà hai ancol CH3OH và C2H6O

m 22,54 gam: HCOONa (0,08) và RCOONa (0,16) Muối gồm ởi HCOOH, RCOOH và hai ancol CH3OH và C2H6O2. +) TH2: X gồm este no tạo bởi Khi đó 22,54 gam: HCOONa (0,08) và RCOONa. nRCOONa = 0,22 + 0,02.2 – 0,08 = 0,18 mol → MRCOONa = 95.

ức th thỏa mãn). (loại - không tìm được công thức ởi HCOOH, R(COOH)22 và hai ancol CH3OH và C2H6O2 +) TH3: X gồm este no tạo bởi m: HCOONa (0,08) và R(COONa)2. 22,54 gam gồm: Vì X là các este no, hở nHCOONa = 0,08 > nC H O = 0,02 2

6

2

m HCOOCH3: 0,04 mol, HOOC-CH2-CH2-OOCH: 0,02 mol và → các este trong X gồm CH3OOC-R-COOCH3 nR(COONa) = (0,22 + 0,02.2 – 0,04) : 2 = 0,09 → MR(COONa) = 190 2

2

→ (CH2)4(COONa)2. → X gồm: HCOOCH3 (0,04); HCOO-CH2-CH2-OOCH (0,02) và CH3OOC-(CH2)4COOCH3 (0,09).

khối lượng phân tử lớn nhất là → Phần trăm khối lượng củaa este có kh


→ Đáp án A Câu 144: Đốt cháy hoàn toàn m gam m một chất béo X cần n 1,106 mol O2, thu được v a gam H2. 0,798 mol CO2 và 0,7 mol H2O. Cho m gam chất béo X tác dụng tối đa với Giá trị của a là A. 0,224.

B. 0,140.

C. 0,364.

D. 0,084.

Hiển thị đáp án Gọi CTPT của chất béo X là CxHyO6

Áp dụng ĐLBT nguyên tố oxi ta có: nO(X) + nO(O ) = nO(CO ) + nO(H O) → 6nX + 2nO = 2nCO + nH O 2

2

2

2

2

2

Ta có:

→ Trong X: 8 liên kết π gồm m 3 liên kết π ở nhóm chức COO + 5 liên kết π ở gốc ốc hidrocacbon → X tác dụng với H2 theo tỉ lệệ 1:5 → Đáp án B

phản ứng tráng bạc. c. Axit cacboxylic Y là đồng Câu 145: X là este đơn chức, không có ph ỗ hợp X, Y tác phân của X. Trong phân tử X và Y đều có vòng benzen. Cho 0,2 mol hỗn dịch NaOH 1M, thu được dung dịch Z chứa ứa ba muối. mu Đốt dụng vừa đủ vớii 350 ml dung d dẫn khí thoát ra vào dung dịch nước c vôi trong dư, thu cháy hoàn toàn muốii trong Z, d ch Z là: được 142,5 gam kết tủa. Khối lượng muối cacboxylat trong dung dịch A. 20,2 gam

B. 18,1 gam

C. 27,8 gam

D. 27,1 gam


Hiển thị đáp án X và Y là đồng phân nên đặt sốố nguyên tử C của X và Y là n. nNaOH = 0,35 mol → nNa CO = 0,175 mol 2

3

nCaCO = 1,425 mol 3

BTNT C: 0,2n = 0,175 + 1,425 → n = 8. Z chứa 3 muối nên X là este của phenol. Đặt số mol của X, Y lần lượt là x, y.

ng tráng gương nên X là CH3COOC6H5 X không tham gia phản ứng → Y là C7H7COOH. Muối cacboxylat gồm CH3COONa (0,15 mol) và C7H7COONa (0,05 mol). → mmuối → Đáp án A

chức mạch hở X (được tạo từ axit cacboxylic no, đa chức, Câu 146: Đốtt cháy este 2 chứ phân tử X không có quá 3 liên kết π) thu được tổng thể tích CO2 và H2O gấp 5/3 lần dụng hoàn toàn vớii 400 ml dung dịch NaOH thể tích O2 cần dùng. Lấyy 21,6 gam X tác d ch sau phả phản ứng thu được m gam chất rắn. Giá trịị lớn lớ nhất của m 1M, cô cạn dung dịch là A. 28,0.

B. 26,2.

C. 24,8.

D. 24,1.

Hiển thị đáp án CTPT của este là CnH2n-2-2kO4

Ta có vì tổng số mol của CO2 và H2O gấp 5/3 số mol O2


Nên Vì este có nhiều nhất là 3 liên kếết đôi → k = 1, k = 0 Với k = 0 ta có n = 6,333 loại k = 1 ta có n = 6(chọn) Mà este 2 chức gồm axit no nên X có CTPT là CH3OOCCH2COOCH=CH2 thì có khối lượng muối lớn nhất → mmax = 0,15.148 + 0,1.40 = 26,2 gam → Đáp án B

m sau: Câu 147: Este có đặc điểm - Đốt cháy hoàn toàn tạo thành CO2 và H2O có số mol bằng nhau;

ờng axit được Y (tham gia phản ứng ng tráng gương) và chất - Thủy phân X trong môi trườ bằng một nửa số nguyên tử cacbon trong X). Z (có số nguyên tử cacbon bằ Phát biểu không đúng là: A. Đun Z với dung dịch H2SO4 đặc ở 170oC thu được anken. B. Chất X thuộc loạii este no, đơn chức. C. Chất Y tan vô hạn trong nước. D. Đốt cháy hoàn toàn 1 mol X, X sinh ra sản phảm gồm 2 mol CO2 và 2 mol H2O Hiển thị đáp án - Đốt cháy hoàn toàn tạo thành CO2 và H2O có số mol bằng nhau → X là este no đơn đơ chức mạch hở

ờng axit được Y (tham gia phản ứng ng tráng gương) → Y là - Thủy phân X trong môi trườ HCOOH. Chất Z có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X → Z là CH3OH → X là HCOOCH3.


A. Sai vì từ C2H5OH mới tạoo ra anken B. Chất X thuộc loại este no, đơn chức → Đúng C. Chất Y tan vô hạn trong nước → Đúng: axit HCOOH tan vô hạn trong nước D. Đốt cháy hoàn toàn 1mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O → Đúng: C2H4O2 → 2CO2 + 2H2O. → Đáp án A Câu 148: Thủy phân hoàn toàn 7,612 gam hỗn hợp X gồm 2 este đơn chức và 2 este ẩn 80 ml dung d dịch NaOH a M. Sau phản ứng, thu được hỗn đa chức đều mạch hở cẩn

a các axit cacboxylic và các ancol. Đốtt cháy hoàn toàn Y thu hợp Y gồm các muối của ktc) và 3,168 gam H2O. Giá trị của a là: được 4,4352 lít CO2 (đktc) A. 1,56.

B. 1,65.

C. 1,42.

D. 1,95.

Hiển thị đáp án Đốt Y cũng tương đương với đốt X và NaOH. nNaOH = 0,08a mol → nNa CO = 0,04a mol, nO(X) = 0,16a mol 2

3

→ mX = 12.(0,198 + 0,04a) + (0,352 – 0,08a) + 16.0,16a = 7,612 → a = 1,65g → Đáp án B Câu 149: Đốt cháy hoàn toàn 8,6 gam 1 este G thu được hỗn hợp p X. Cho X lội l từ từ

ng dung dịch d giảm qua nước vôi trong dư thu được 40 gam kết tủa đồng thời khối lượng un nóng đến pư hoàn đi 17 gam. Mặt khác, lấyy 8,6 gam G cho vvào 250 ml KOH 1M đun ch Y. Cô ccạn Y thu được 19,4 gam chất rắn n khan. Tên của G là toàn thu được dung dịch A. metyl acrylat.

B. etyl axetat .


D. đimetyl oxalat.

C. metyl metacrylat. Hiển thị đáp án mdung dịch giảm = mkết tủa - m(CO

2

+ H2O)

→ 17 = 40 – m(CO

2

+ H2O)

→ m(CO

2

+ H2O)

= 23 g

nkết tủa = nCO = 0,4 mol → mCO = 5,4 → nH O = 0,3 mol 2

2

2

Gọi CTCT là RCOOR’ Ta có RCOOR’ + O2 → CO2 + H2O

Bảo toàn oxi: → Meste = 86 → CTPT: C4H6O2 Có nRCOOR’ = 0,1 mol → nRCOOK = 0,1 mol mrắn = mKOH dư + mmuối → mmuối = 19,4 – (0,25 – 0,1).56 = 11 → Mmuối = 110 → MRCOO = 110 - 39 = 71 R là CH2=CH→ X là CH2=CHCOOCH3 → X là Metyl acrylat → Đáp án A

ạo thành từ glixerol và các axit cacboxylic đơn đơ chức. Trong Câu 150: Trieste X được tạo nhiều hơn số nguyên tử oxi là 1. Cho m gam X tác phân tử X có số nguyên tử cacbon nhi ứ Đốt cháy dụng hết với lượng dư dung dịch NaOH thì có 12 gam NaOH phản ứng. n ít nhấ nhất bao nhiêu lít O2 (đktc)? hoàn toàn m gam X cần A. 17,92 lít. C. 8,96 lít. Hiển thị đáp án

B. 13,44 lít. D. 14,56 lít.


Số C (X) = Số O + 1 = 6 +1 = 7 → X có CT: (CH3COO)(HCOO)2C2H5 hay C7H10O6 nX = nNaOH/3 = 0,1 mol

→ V0 = 0,65. 22,4 = 14,56 lít → Đáp án D

Profile for Dạy Kèm Quy Nhơn Official

1200 Bài tập trắc nghiệm Este - Lipit HÓA HỌC 12 (cơ bản - nâng cao) có giải chi tiết  

https://app.box.com/s/vqzmtpykt2x82lsg2clo9v68cp5lpo8u

1200 Bài tập trắc nghiệm Este - Lipit HÓA HỌC 12 (cơ bản - nâng cao) có giải chi tiết  

https://app.box.com/s/vqzmtpykt2x82lsg2clo9v68cp5lpo8u