Page 1

www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

18. Các dạng bài tập về phản ứng của axit (Đề 1)

Câu 1. Hòa tan hoàn toàn hỗn hợp X gồm Fe và Mg bằng một lượng vừa đủ dung dịch HCl 20%, thu được dung dịch Y. Nồng độ của FeCl2 trong dung dịch Y là 15,76%. Nồng độ phần trăm của MgCl2 trong dung dịch Y là A. 15,76% B. 24,24% C. 11,79% D. 28,21% Câu 2. Hỗn hợp X gồm Mg và kim loại M. Hòa tan hoàn toàn 8 gam hỗn hợp X cần vừa đủ 200 gam dung dịch HCl 7,3 %. Mặt khác cho 8 gam hỗn hợp X tác dụng hoàn toàn với khí Cl2 cần dùng 5,6 lít Cl2 (ở đktc) tạo ra hai muối clorua. Kim loại M và phần trăm về khối lượng của nó trong hỗn hợp X là: A. Al và 75 % B. Fe và 25 % C. Al và 30 % D. Fe và 70 % Câu 3. Hòa tan hoàn toàn hỗn hợp X gồm Fe, Mg bằng một lượng vừa đủ H2SO4 10% được dung dịch Y . Nồng độ FeSO4 trong dung dịch Y là 5%. Hỏi nồng độ MgSO4 trong dung dịch Y là bao nhiêu? A. 8,2% B. 4,2% C. 5,7% D. 7,9% Câu 4. Hoà tan hết 7,74 gam hỗn hợp bột Mg, Al bằng 500 ml dung dịch hỗn hợp HCl 1M và H2SO4 0,28M thu được dung dịch X và 8,736 lít H2 (ở đktc). Cô cạn dung dịch X thu được lượng muối khan là A. 38,93 gam B. 25,95 gam C. 103,85 gam D. 77,86 gam Câu 5. X là kim loại thuộc phân nhóm chính nhóm II (hay nhóm IIA). Cho 1,7 gam hỗn hợp gồm kim loại X và Zn tác dụng với lượng dư dung dịch HCl, sinh ra 0,672 lít khí H2 (ở đktc). Mặt khác, khi cho 1,9 gam X tác dụng với lượng dư dung dịch H2SO4 loãng, thì thể tích khí hiđro sinh ra chưa đến 1,12 lít (ở đktc). Kim loại X là A. Mg B. Ca C. Ba D. Sr Câu 6. Cho 3,68 gam hỗn hợp gồm Al và Zn tác dụng với một lượng vừa đủ dung dịch H2SO4 10 %, thu được 2,24 lít khí H2 (ở đktc). Khối lượng dung dịch thu được sau phản ứng là: A. 101,68 gam B. 88,20 gam C. 101,48 gam D. 97,80 gam

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Cho m gam hỗn hợp Mg, Al vào 250 ml dung dịch X chứa hỗn hợp axit HCl 1M và axit H2SO4 0,5M, thu được 5,32 lít H2 (ở đktc) và dung dịch Y (coi thể tích dung dịch không đổi). Dung dịch Y có pH là A. 1 B. 6 C. 7 D. 2 Câu 8. Hoà tan hoàn toàn 16 gam hỗn hợp Mg và Fe bằng dung dịch H2SO4 loãng vừa đủ. Sau phản ứng thấy khối lượng dung dịch tăng thêm 15,2 gam so với ban đầu. Khối lượng muối khan thu được khi cô cạn dung dịch sau phản ứng là (cho H = 1; O = 16; Mg = 24; S = 32; Fe = 56) A. 53,6 gam. B. 54,4 gam. C. 92 gam D. 92,8 gam. Câu 9. Hòa tan m gam hỗn hợp X (gồm Al, Fe, Zn và Mg) bằng dung dịch HCl dư. Sau phản ứng, khối lượng dung dịch axit tăng thêm (m – 2) gam. Khối lượng (gam) của muối tạo thành trong dung dịch sau phản ứng là A. m + 34,5. B. m + 35,5. C. m + 69 D. m + 71 Câu 10. Cho 1,67 gam hỗn hợp gồm hai kim loại ở 2 chu kỳ liên tiếp thuộc nhóm IIA tác dụng hết với dung dịch HCl (dư), thoát ra 0,672 lít khí H2 (ở đktc). Hai kim loại đó là A. Be và Mg. B. Ca và Sr. C. Sr và Ba D. Mg và Ca. Câu 11. Hoà tan hoàn toàn 2,45 gam hỗn hợp X gồm hai kim loại kiềm thổ vào 200 ml dung dịch HCl 1,25M, thu được dung dịch Y chứa các chất tan có nồng độ mol bằng nhau. Hai kim loại trong X là A. Mg và Ca. B. Be và Mg. C. Mg và Sr. D. Be và Ca. Câu 12. Hòa tan hết 10,4 gam hỗn hợp Fe, Mg vào 500ml dung dịch hỗn hợp H2SO4 0,4 M và HCl 0,8 M thu được dung dịch Y và 6,72 lít H2 (đktc). Cô cạn dung dịch Y thu được m gam muối khan. Giá trị của m là A. 36,7. B. 39,2. C. 34,2 ≤ m ≤ 36,7. D. 34,2. Câu 13. Cho m gam một kim loại tác dụng vừa đủ với 12,5m gam dung dịch H2SO4 14% (loãng), sau khi phản ứng xẩy ra hoàn toàn thu được dung dịch X. Dung dịch X có khối lượng thế nào so với dung dịch H2SO4 ban đầu? (biết trong quá trình phản ứng nước bay hơi không đáng kể) A. Tăng 2,86%. B. Tăng 8,97%. C. Tăng 7,71%. D. Tăng 8,00%.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 14. Cho m gam Na tan hết vào 100 ml dung dịch gồm (H2SO4 0,5M và HCl 1M) thu được 4,48 lít khí H2 (ở đktc). Cô cạn dung dịch sau phản ứng khối lượng chất rắn thu được là A. 18,55 gam. B. 17,55 gam. C. 20,95 gam. D. 12,95 gam. Câu 15. Để hoà tan hoàn toàn 6,4 gam hỗn hợp gồm kim loại R (chỉ có hoá trị II) và oxit của nó cần vừa đủ 400 ml dung dịch HCl 1M. Kim loại R là: A. Ba B. Ca C. Be D. Mg Câu 16. Hoà tan hoàn toàn 15,4 gam hỗn hợp Mg và Zn trong dung dịch HCl dư thấy có 6,72 lít khí thoát ra (ở đktc) và dung dịch X. Cô cạn dung dịch X được bao nhiêu gam muối khan ? A. 26,05 gam. B. 26,35 gam. C. 36,7 gam. D. 37,3 gam. Câu 17. Cho 13,5 gam hỗn hợp các kim loại Al, Cr, Fe tác dụng với lượng dư dung dịch H2SO4 loãng nóng (trong điều kiện không có không khí), thu được dung dịch X và 7,84 lít khí H2 (đktc). Cô cạn dung dịch X (trong điều kiện không có không khí) được m gam muối khan. Giá trị của m là A. 42,6. B. 45,5. C. 48,8. D. 47,1. Câu 18. Cho 33,4 gam hỗn hợp bột mịn X (gồm Al, Cr, Fe, Cu và Ag) vào dung dịch H2SO4 loãng, nóng. Sau khi các phản ứng xảy ra hoàn toàn, có 17,2 gam chất rắn tách ra, đồng thời thu được 11,2 lít khí (đktc). Độ tăng khối lượng của dung dịch sau phản ứng so với khối lượng dung dịch H2SO4 ban đầu là A. 15,2 gam. B. 15,7 gam. C. 32,4 gam. D. 32,9 gam. Câu 19. Cho 7,1 gam hỗn hợp gồm một kim loại kiềm X và một loại kim loại kiềm thổ Y tác dụng hết với lượng dư dung dịch HCl loãng, thu được 5,6 lít khí (đktc). Kim loại X, Y là A. liti và beri. B. kali và bari. C. kali và canxi. D. natri và magie. Câu 20. Hòa tan hoàn toàn 1,1 gam hỗn hợp gồm một kim loại kiềm X và một kim loại kiềm thổ Y (MX < MY) trong dung dịch HCl dư, thu được 1,12 lít khí H2 (đktc). Kim loại X là A. K. B. Na. C. Rb. D. Li. ĐÁP ÁN & LỜI GIẢI CHI TIẾT

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

2

Câu 1: C Giả sử số mol HCl = 1 mol → khối lượng dung dịch HCl = 182,5 gam.

UY

X phản ứng vừa đủ với 1 mol HCl sinh ra 0,5 mol H2.

.Q P T

N Ơ H

N

Đặt số mol Fe = x và số mol Mg = y mol → ∑ khối lượng kim loại = 56x + 24y. Phản ứng với HCl có 2x + 2y = 1 mol.

O Ạ Đ

Khối lượng dung dịch sau phản úng = 182,5 + 56x + 24y - 0,5 x 2 = 181,5 + 56x + 24y.

H

Nồng độ phần trăm FeCl2 =

N Ầ TR

G N Ư

Giải hệ ta được x = y = 0,25 mol. Từ đó tính được nồng độ % MgCl2 = 11,79.

0 00

B

Câu 2: D

1 3 +

Do Nên kim loại M là kim loại có thể thay đổi hóa trị. Như vậy, M là Fe.

Ta có hệ:

Câu 3: D Giả sử ban đầu có x mol Fe và 1 mol Mg. Số mol H2SO4 phản ứng là x +1 Số mol H2 thoát ra là x+1 Khối lượng dung dịch H2SO4 là 980(x+1) Sau phản ứng, khối lượng dung dịch là: 980(x+1)-2(x+1) + 56x +24=1034x +1002 Suy ra, nồng độ của MgSO4 là:

Câu 4: A

Axit đã phản ứng hết.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

TH3: HCl hết, có 1 kim loại tác dụng với nước, 1 kim loại không tác dụng với nước Câu 5: B Số mol hỗn hợp là: Đặt số mol X là x, số mol Zn là y.

.Q P T (loại)

Câu 6: C

Sau phản ứng:

0 00

Câu 8: B Câu 9: D Câu 10: B nH2 = 0,03 mol. Giả sử hai kim loại có CTC là M M + 2H2O → M(OH)2 + H2 nM = 0,03 mol → MM = 1,67 : 0,03 ≈ 55,67 Vậy hai kim loại đó là Ca (M = 40) và Sr (M = 88) Câu 11: D TH1: HCl tác dụng vừa đủ với X

I Ồ B

N Ầ TR

H

G N Ư

N

(loại)

Câu 12: A Khi phản ứng H2SO4 sẽ phản ứng tạo muối trước HCl

Câu 7: A

TH2: HCl còn dư

O Ạ Đ

TH4: HCl hết, cả 2 kim loại đều tác dụng với nước

Ta có hệ: Thử các giá trị của M, ta thấy có đáp án B thỏa mãn.

UY

Ỡ Ư D

NG

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

Câu 13: C

Câu 14: C Câu 15: D Coi hỗn hợp R và RO có khối lượng trung bình là M Khi cho hỗn hợp kim loại R và oxit vào HCl tạo muối RCl2 Bảo toàn nguyên tố Cl → nRCl2 = nHCl : 2 = 0,2 mol

(loại)

→ nR + nRO = 0,2 mol → 24< Mtb = 6,4 : 0,2 = 32 < 40 . Vậy kim loại cần tìm là Mg

Câu 16: C Câu 17: D Câu 18: A Câu 19: D

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ta có:

UY

Thử các cặp ở các đáp án vào thì chỉ có D thỏa mãn Câu 20: D + giả sử hỗn hợp chỉ gồm kim loại kiềm

+ giả sử hỗn hợp chỉ gồm kim loại kiềm thổ

0 00

giới hạn ở 22, nên bắt buộc hỗn hợp ban đầu phải có 1 kim loại có phân tử khối nhỏ hơn 22, đó là Li hoặc Be Nếu là Be thì kim loại kiềm sẽ là Li do

, trường hợp này loại vì

sẽ nhỏ hơn 11

Do đó kim loại kiềm X là Li, kim loại kiềm thổ Y thì chưa biết

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

19. Phương pháp giải các dạng toán về hợp chất lưỡng tính (Đề 2)

Câu 1. Hoà tan 0,54 gam Al trong 0,5 lít dung dịch H2SO4 0,1M thu được dung dịch A. Thêm V lít dung dịch NaOH 0,1 M cho đến khi kết tủa tan trở lại một phần. Nung kết tủa thu được đến khối lượng không đổi ta được chất rắn nặng 0,51 gam. ( Al = 27, Na = 23, O = 16, S = 32, H = 1) V có giá trị là: A. 1,1 lít B. 0,8 lít C. 1,2 lít D. 1,5 lít Câu 2. Cho 9,36 gam hỗn hợp X gồm Mg và Zn vào dung dịch chứa 430 ml H2SO4 1M, sau khi phản ứng hoàn toàn thu được dung dịch Y. Cho dung dịch Y vào 1,2 lít dung dịch Z chứa Ba(OH)2 0,05M và NaOH 0,7M. Lọc kết tủa, đem nung đến khối lượng không đổi thu được 26,08 gam chất rắn. Phần trăm theo khối lượng của Zn trong X là A. 22,4%. B. 7,5%. C. 29,6%. D. 33,3%. Câu 3. Cho 200 ml dung dịch AlCl3 1,5M tác dụng với V lít dung dịch NaOH 0,5M, lượng kết tủa thu được là 15,6 gam. Giá trị lớn nhất của V là A. 1,2. B. 1,8. C. 2,4. D. 2. Câu 4. Hoà tan hoàn toàn 8,2 gam hỗn hợp Na2O, Al2O3 vào nước thu được dung dịch X chỉ chứa một chất tan duy nhất. Tính thể tích CO2 (đktc) cần để phản ứng hết với dung dịch X. A. 1,12 lít B. 2,24 lít C. 4,48 lít D. 3,36 lít Câu 5. Cho từ từ đến hết 150ml dung dịch NaOH 2M vào một cốc đựng 100ml dung dịch AlCl3 nồng độ x mol/l, sau khi phản ứng hoàn toàn thấy trong cốc có 0,1 mol chất kết tủa. Thêm tiếp 100ml dung dịch NaOH 2M vào cốc, sau khi phản ứng hoàn toàn thấy trong cốc có 0,14 mol chất kết tủa. Giá trị của x là: A. 1,6. B. 1,0. C. 0,8. D. 2,0. Câu 6. Cho dung dịch chứa 0,015 mol FeCl2 và 0,02 mol ZnCl2 tác dụng với V ml dung dịch NaOH 1M, sau khi phản ứng xảy ra hoàn toàn tách lấy kết tủa nung trong không khí đến khối lượng không đổi được 1,605 gam chất rắn. Giá trị lớn nhất của V để thu được lượng chất rắn trên là: A. 70ml B. 100ml C. l40ml

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 115ml Câu 7. Trong một cốc thuỷ tinh đựng dung dịch ZnSO4. Thêm vào cốc 200ml dung dịch KOH nồng độ x mol/l thì thu được 4,95 gam kết tủa. Tách kết tủa, nhỏ dung dịch HCl vào nước lọc thì thấy xuất hiện kết tủa trở lại, tiếp tục cho HCl vào đến khi kết tủa tan hết rồi cho dung dịch BaCl2 dư vào thì thu được 46,6 gam kết tủa. Nồng độ x là: A. 2M B. 0,5M C. 4M D. 3,5M Câu 8. Cho 3,42 gam Al2(SO4)3 tác dụng với 200 ml dung dịch NaOH, sau phản ứng thu được 0,78 gam kết tủa. Nồng độ mol nhỏ nhất của dung dịch NaOH đã dùng là A. 0,15M B. 0,12M C. 0,28M D. 0,19M Câu 9. Cho V lít dung dịch NaOH 1M vào dung dịch chứa 0,1 mol Al2(SO4)3 và 0,1 mol H2SO4 đến phản ứng xảy ra hoàn toàn thu được 7,8 gam kết tủa. Giá trị lớn nhất của V để thu được lượng kết tủa trên là: A. 0,9 B. 0,45 C. 0,25 D. 0,6 Câu 10. Một cốc thuỷ tinh chứa 200ml dung dịch AlCl3 0,2M. Cho từ từ vào cốc V ml dung dịch NaOH 0,5M. Tính khối lượng kết tủa lớn nhất khi V biến thiên trong đoạn 250ml ≤ V ≤ 320ml. A. 3,12. B. 3,72. C. 2,73. D. 8,51. Câu 11. Hỗn hợp X gồm Al và Al2O3 có tỉ lệ khối lượng tương ứng là 1,8 : 10,2. Cho X tan hết trong dung dịch NaOH vừa đủ thu được dung dịch Y và 0,672 lít khí (đktc). Cho Y tác dụng với 200ml dung dịch HCl thu được kết tủa Z, nung Z ở nhiệt độ cao đến khối lượng không đổi thu được 3,57 gam chất rắn. Nồng độ mol lớn nhất của dung dịch HCl đã dùng là A. 0,75M. B. 0,35M. C. 0,55M. D. 0,25M. Câu 12. Hoà tan hoàn toàn m gam hỗn hợp K2O, Al2O3 vào nước được dung dịch X chỉ chứa một chất tan duy nhất. Cho từ từ 275ml dung dịch HCl 2M vào dung dịch X thấy tạo ra 11,7 gam kết tủa. Giá trị của m là A. 29,4 gam B. 49 gam C. 14,7 gam D. 24,5 gam Câu 13. Dung dịch X là dung dịch NaOH C%. Lấy 36 gam dung dịch X trộn với 400 ml dung dịch AlCl3 0,1M thì lượng kết tủa bằng khi lấy 148 gam dung dịch X trộn với 400 ml dung dịch AlCl3 0,1M. Giá trị của C là A. 3,6%.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 4,4%. C. 4,2%. D. 4,0%. Câu 14. Chia m gam hỗn hợp X gồm Al, Ba thành 2 phần bằng nhau - Phần 1: tác dụng với nước (dư) được 0,04 mol H2. - Phần 2: tác dụng với 50ml dung dịch NaOH 1M (dư) được 0,07 mol H2 và dung dịch Y. Cho V ml dung dịch HCl 1M vào Y được 1,56 gam kết tủa. Giá trị của V lớn nhất để thu được lượng kết tủa trên là A. 20 B. 50 C. 100 D. 130 Câu 15. Hòa tan 47,4 gam phèn chua KAl(SO4)2.12H2O vào nước được dung dịch X. Thêm dần đến hết 300ml dung dịch Ba(OH)2 1M vào X thì được a gam kết tủa và dung dịch Y. Lọc bỏ kết tủa rồi sục khí CO2 dư vào dung dịch nước lọc thấy tạo ra b gam kết tủa. Giá trị của a và b lần lượt là A. 46,6 và 27,5. B. 54,4 và 7,8. C. 46,6 và 7,8. D. 52,5 và 27,5. Câu 16. Điện phân 500ml dung dịch hỗn hợp gồm NaCl 0,1M và AlCl3 0,3M trong điều kiện có màng ngăn, điện cực trơ tới khi ở anot xuất hiện 2 khí thì ngừng điện phân. Sau điện phân, lọc lấy kết tủa rồi nung ở nhiệt độ cao đến khối lượng không đổi được m gam chất rắn. Giá trị của m là A. 7,65. B. 5,10. C. 15,30. D. 10,20. Câu 17. Khi cho V ml hay 3V ml dung dịch NaOH 2M tác dụng với 400ml dung dịch AlCl3 nồng độ x mol/l đều thu được 7,8 gam kết tủa. Giá trị của x là: A. 0,75M B. 0,625M C. 0,25M D. 0,75M hoặc 0,25M Câu 18. X là dung dịch AlCl3, Y là dung dịch NaOH 1M. Cho 240ml dung dịch Y vào cốc chứa 100ml dung dịch X, khuấy đều tới phản ứng hoàn toàn thấy trong cốc có 6,24 gam kết tủa. Thêm tiếp vào cốc 100ml dung dịch Y, khuấy đều đến khi kết thúc phản ứng thấy trong cốc có 4,68 gam kết tủa. Nồng độ mol của dung dịch X là A. 1,0M. B. 1,2M. C. 1,5M. D. 1,6M. Câu 19. X là dung dịch AlCl3, Y là dung dịch NaOH 2M. Cho 150ml dung dịch Y vào cốc chứa 100ml dung dịch X, khuấy đều tới phản ứng hoàn toàn thấy trong cốc có 7,8 gam kết tủa. Thêm tiếp vào cốc 100ml dung dịch Y, khuấy đều đến khi kết thúc phản ứng thấy trong cốc có 10,92 gam kết tủa. Nồng độ mol của dung dịch X là A. 3,2M.

Ư D I Ồ B

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 2,0M. C. 1,6M. D. 1,0M. Câu 20. Cho dung dịch X chứa NaCl và AlCl3. Điện phân 500 ml dung dịch X bằng dòng điện có cường độ không đổi I = 5A (có màng ngăn, hiệu suất 100%). Khi vừa hết khí Y thoát ra trên anot thì dừng điện phân, thu được 19,04 lít khí Y (đktc), trong dung dịch có 23,4 gam kết tủa keo. Nồng độ mol dung dịch sau điện phân là (coi thể tích dung dịch không đổi khi điện phân) A. 0,6M. B. 0,4M. C. 0,75M D. 0,8M. Câu 21. Hoà tan hoàn toàn m gam AlCl3 vào nước được dung dịch X. Nếu cho 480 ml dung dịch NaOH 1M vào X thì thu được 4a gam kết tủa. Mặt khác, nếu cho 170 ml dung dịch NaOH 3M vào X thì thu được 3a gam kết tủa. Giá trị của m gần nhất với A. 20,024. B. 20,026. C. 20,025. D. 20,027. Câu 22. Hoà tan hoàn toàn a gam Al2O3 trong 400 ml dung dịch HNO3 2M thu được dung dịch X. Thêm 600 ml dung dịch NaOH 1M vào dung dịch X thì thu được 7,8 gam kết tủa . Vậy giá trị của a tương ứng là A. 8,5 gam B. 15,3 gam C. 5,1 gam D. 10,2 gam Câu 23. Hòa tan hoàn toàn m gam hỗn hợp X gồm Na và K vào dung dịch HCl dư thu được dung dịch Y. Cô cạn dung dịch Y thu được (m + 31,95) gam hỗn hợp chất rắn khan. Hòa tan hoàn toàn 2m gam hỗn hợp X vào nước thu được dung dịch Z. Cho từ từ hết dung dịch Z vào 0,5 lít dung dịch CrCl3 1M đến phản ứng hoàn toàn thu được kết tủa có khối lượng là A. 51,5 gam. B. 30,9 gam. C. 20,6 gam. D. 54,0 gam. Câu 24. Dung dịch X gồm 0,1 mol H+, z mol Al3+, t mol NO3− và 0,02 mol SO 4 2 − . Cho 120 ml dung dịch Y

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

gồm KOH 1,2M và Ba(OH)2 0,1M vào X, sau khi các phản ứng kết thúc, thu được 3,732 gam kết tủa. Giá trị của z, t lần lượt là: A. 0,020 và 0,012 B. 0,020 và 0,120 C. 0,012 và 0,096 D. 0,120 và 0,020 Câu 25. Cho 150 ml dung dịch NaOH 7M tác dụng với 100 ml dung dịch Al2(SO4)3 1M. Nồng độ mol của dung dịch NaOH sau phản ứng là A. 1M B. 2M C. 3M D. 4M

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 26. Cho 150 ml dung dịch NaOH 7M tác dụng với 250 ml dung dịch Al2(SO4)3 0,625M, thu được m gam kết tủa. Giá trị của m là A. 7,8 B. 15,6 C. 10,2 D. 3,9 Câu 27. Cho m gam Kali vào 250ml dung dịch X chứa AlCl3 aM, sau khi phản ứng kết thúc thu được 5,6 lít khí (ở đktc) và một lượng kết tủa. Tách kết tủa, nung đến khối lượng không đổi thu được 5,1 gam chất rắn. Giá trị của a là A. 0,15 B. 0,12 C. 0,55 D. 0,6 Câu 28. Cho hỗn hợp Na, K và Ba tác dụng hết với nước, thu được dung dịch X và 6,72 lít khí H2 (đktc). Nếu cho X tác dụng hết với dd Al(NO3)3 thì số gam kết tủa lớn nhất thu được là A. 7,8 gam. B. 15,6 gam. C. 46,8 gam. D. 3,9 gam Câu 29. Cho 250ml dung dịch NaOH 2M vào 250ml dung dịch AlCl3 xM, sau khi phản ứng hoàn toàn thu được 7,8 gam kết tủa. Giá trị của x là A. 1,2 B. 0,3 C. 0,6 D. 1,8 Câu 30. Cho 100ml dung dịch Al2(SO4)3 0,1M vào V ml dung dịch NaOH 0,1M. Thu được kết tủa nung tới khối lượng không đổi được 0,51 gam chất rắn. V là A. 300ml. B. 500ml. C. 700ml. D. 300 ml hoặc 700 ml Câu 31. Cho V lít dung dịch NaOH 1M vào 100ml dung dịch AlCl3 2M thu được 3,9 gam kết tủa. Giá trị của V là A. 150ml. B. 400ml. C. 150ml hoặc 400ml. D. 150ml hoặc 750ml Câu 32. Cho từ từ dung dịch NaOH 1M vào dung dịch có chứa 26,7 gam AlCl3 cho đến khi thu được 11,7 gam kết tủa thì dừng lại thì đã dùng hết V lít NaOH. Giá trị của V là A. 0,45 hoặc 0,6. B. 0,6 hoặc 0,65. C. 0,65 hoặc 0,75. D. 0,45 hoặc 0,65. Câu 33. Rót từ từ dung dịch Ba(OH)2 0,2M vào 150ml dung dịch AlCl3 0,04M đến khi thu được lượng kết tủa lớn nhất, nhỏ nhất. Thể tích dung dịch Ba(OH)2 đã dùng tương ứng là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 45ml và 60 ml. B. 45 ml và 90 ml. C. 90 ml và 120 ml. D. 60 ml và 90 ml. Câu 34. Cho m gam Na tan hết trong 100ml dung dịch Al2(SO4)3 0,2M. Sau phản ứng thu được 0,78 gam kết tủa. Giá trị của m là A. 0,69. B. 0,69 hoặc 3,45. C. 0,69 hoặc 3,68. D. 0,69 hoặc 2,76. Câu 35. Hòa tan 3,9 gam Al(OH)3 bằng 50 ml NaOH 3M được dung dịch X. Thêm V lít dung dịch HCl 2M vào dung dịch X thu được 1,56 gam kết tủa. Giá trị của V là A. 0,02 B. 0,24 C. 0,06 hoặc 0,12 D. 0,02 hoặc 0,24 Câu 36. Thêm dung dịch HCl vào dung dịch hỗn hợp gồm 0,1 mol NaOH và 0,1 mol Na[Al(OH)4] thu được 0,08 mol chất kết tủa. Số mol HCl đã thêm vào là A. 0,16 mol. B. 0,18 hoặc 0,26 mol C. 0,08 hoặc 0,16 mol. D. 0,26 mol Câu 37. Cho 400ml dung dịch Al(NO3)3 1,5M tác dụng với V lít dung dịch NaOH 0,5M, lượng kết tủa thu được là 15,6 gam. Giá trị lớn nhất của V là A. 4,4. B. 2,2. C. 4,2. D. 2,4. Câu 38. Cho 200 ml dung dịch NaOH aM tác dụng với 500 ml dung dịch AlCl3 0,2M được kết tủa, lọc lấy kết tủa nung đến khối lượng không đổi được 1,02 gam chất rắn. Giá trị lớn nhất của a là A. 1,9 B. 0,15 C. 0,3 D. 0,2 Câu 39. Cho 200 ml dung dịch AlCl3 1M tác dụng với dung dịch NaOH 0,5M thu được 7,8 gam kết tủa. Thể tích dung dịch NaOH 0,5M lớn nhất dùng là A. 0,6 lít B. 1,9 lít C. 1,4 lít D. 0,8 lít Câu 40. Cần ít nhất bao nhiêu ml dung dịch HCl 1M cần cho vào 500 ml dung dịch Na[Al(OH)4] 0,1M để thu được 0,78 gam kết tủa A. 10. B. 100. C. 15.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 170. Câu 41. Một cốc thuỷ tinh chứa 200ml dung dịch AlCl3 0,2M. Cho từ từ vào cốc V ml dung dịch NaOH 0,5M. Tính khối lượng kết tủa nhỏ nhất khi V biến thiên trong đoạn 200ml ≤ V ≤ 280ml. A. 1,56 gam. B. 3,12 gam. C. 2,6 gam. D. 0,0 gam. Câu 42. Thêm NaOH vào dung dịch chứa 0,01 mol HCl và 0,01 mol AlCl3. Lượng kết tủa thu được lớn nhất và nhỏ nhất ứng với số mol NaOH lần lượt là: A. 0,04 mol và ≥ 0,05 mol B. 0,03 mol và ≥ 0,04 mol C. 0,01 mol và ≥ 0,02 mol D. 0,02 mol và ≥ 0,03 mol Câu 43. Cho 200ml dung dịch H2SO4 0,5M vào dung dịch chứa a mol Na[Al(OH)4] được 7,8 gam kết tủa. Giá trị của a là A. 0,025 B. 0,05 C. 0,1 D. 0,125 Câu 44. Cho 200ml dung dịch Al2(SO4)3 1M vào 700ml dung dịch Ba(OH)2 1M. Phản ứng kết thúc thu được kết tủa nung kết tủa tới khối lượng không đổi thu được m gam chất rắn. Giá trị của m là A. 150 gam. B. 20,4 gam. C. 160,2 gam. D. 139,8 gam. Câu 45. Hòa tan hoàn toàn 9 gam hỗn hợp bột gồm Mg và Al bằng H2SO4 loãng thu được khí X và dung dịch Y. Thêm từ từ dung dịch NaOH vào Y sao cho kết tủa đạt giá trị lớn nhất thì dừng lại lọc kết tủa nung tới khối lượng không đổi thu được 16,2 gam chất rắn. Thể tích khí X thu được (đktc) là A. 10,08 lít. B. 7,84 lít. C. 6,72 lít. D. 8,96 lít. Câu 46. Hòa tan hoàn toàn 0,54 gam Al trong 0,5 lít dung dịch H2SO4 0,1M được dung dịch X. Thêm V lít dung dịch NaOH 0,1M cho đến khi kết tủa tan trở lại một phần. Nung kết tủa đến khối lượng không đổi ta được chất rắn nặng 0,51 gam. Giá trị của V là A. 0,8 lít. B. 1,1 lít. C. 1,2 lít. D. 1,5 lít. Câu 47. Cho 200 ml dung dịch hỗn hợp gồm MgCl2 0,3M, AlCl3 0,45 M và HCl 0,55M tác dụng hoàn toàn với V lít dung dịch hỗn hợp gồm NaOH 0,02M và Ba(OH)2 0,01M. Giá trị của V để được kết tủa lớn nhất và lượng kết tủa nhỏ nhất lần lượt là A. 1,25 lít và 1,475 lít. B. 1,25 lít và 14,75 lít. C. 12,5 lít và 14,75 lít.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 12,5 lít và 1,475 lít. Câu 48. Hoà tan hoàn toàn m gam hỗn hợp Na2O, Al2O3 vào nước được dung dịch trong suốt X. Thêm dần dần dung dịch HCl 1M vào dung dịch X nhận thấy khi bắt đầu thấy xuất hiện kết tủa thì thể tích dung dịch HCl 1M đã cho vào là 100 ml còn khi cho vào 200 ml hoặc 600 ml dung dịch HCl 1M thì đều thu được a gam kết tủa. Giá trị của a và m lần lượt là A. 7,8 và 19,5 B. 15,6 và 19,5 C. 7,8 và 39 D. 15,6 và 27,7 Câu 49. Thêm 240 ml dung dịch NaOH 1M vào một cốc thuỷ tinh đựng 100ml dung dịch AlCl3 nồng độ x mol/l, khuấy đều đến phản ứng hoàn toàn thấy trong cốc có 0,08 mol chất kết tủa. Thêm tiếp 100 ml dung dịch NaOH 1M vào cốc, khuấy đều đến phản ứng hoàn toàn thấy trong cốc có 0,06 mol chất kết tủa. Giá trị của x là A. 0,75 B. 1 C. 0,5 D. 0,8 Câu 50. Dung dịch X chứa m gam KOH và 40,2 gam K[Al(OH)4]. Cho 500 ml dung dịch HCl 2M vào dung dịch X thu được 15,6 gam kết tủa. Giá trị của m là A. 22,4 hoặc 44,8 B. 12,6 C. 8 hoặc 22,4 D. 44,8 Câu 51. Thêm dần dần Vml dung dịch Ba(OH)2 vào 150ml dung dịch gồm MgSO4 0,1M và Al2(SO4)3 0,15M thì thu được lượng kết tủa lớn nhất. Tách kết tủa, nung đến khối lượng không đổi thu được m gam chất rắn. Tính m. A. 22,12 B. 5,19 C. 2,89 D. 24,41 Câu 52. Thêm m gam Na vào 300ml dung dịch chứa Ba(OH)2 0,1M và NaOH 0,1M thu được dung dịch X. Thêm từ từ dung dịch X vào 200ml dung dịch Al2(SO4)3 0,1M thu được kết tủa Y. Để thu được lượng Y lớn nhất thì giá trị của m là A. 2,3 B. 0,46 C. 0,23 D. 0,69 Câu 53. Cho dung dịch X chứa 0,05 mol Na[Al(OH)4] và 0,1 mol NaOH tác dụng với dung dịch HCl 2M. Thể tích dung dịch HCl 2M lớn nhất cần cho vào dung dịch X để thu được 1,56 gam kết tủa là A. 0,06 lít B. 0,18 lít C. 0,12 lít D. 0,08 lít Câu 54. Cho từ từ V ml dung dịch NaOH 0,5M vào cốc thủy tinh chứa 200 ml dung dịch AlCl3 0,2M. Khối lượng kết tủa nhỏ nhất khi V biến thiên trong đoạn 200 ml tới 300 ml là A. 1,56 gam.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 0,78 gam. C. 0,0 gam. D. 3,12 gam. Câu 55. Khi cho 200 ml dung dịch NaOH aM vào 500 ml dung dịch AlCl3 bM thu được 15,6 gam kết tủa. Mặt khác, nếu cho 400 ml dung dịch NaOH aM vào 500 ml dung dịch AlCl3 bM thì thu được 23,4 gam kết tủa. Các phản ứng đều xảy ra hoàn toàn. Giá trị của a và b lần lượt là A. 3,00 và 0,75 B. 3,00 và 0,50 C. 3,00 và 2,50 D. 2,00 và 3,00 Câu 56. Cho 150 ml dung dịch KOH 1,2M tác dụng với 100 ml dung dịch AlCl3 nồng độ x mol/l, thu được dung dịch Y và 4,68 gam kết tủa. Loại bỏ kết tủa, thêm tiếp 175 ml dung dịch KOH 1,2M vào Y, thu được 2,34 gam kết tủa. Giá trị của x là A. 1,2 B. 0,8 C. 0,9 D. 1,0 Câu 57. Thêm từ từ 300 ml dung dịch gồm Ba(OH)2 0,5M và KOH x mol/lít vào 50 ml dung dịch Al2(SO4)3 1M. Sau khi kết thúc các phản ứng thu được 36,9 gam kết tủa. Giá trị của x là A. 0,75 B. 0,25 C. 0,50 D. 1,00 Câu 58. Trộn lẫn 100 ml dung dịch HCl 1M với 200 ml dung dịch Al2(SO4)3 0,1M thu được dung dịch X. Thêm từ từ 0,125 mol Ba(OH)2 vào dung dịch X thu được m gam kết tủa. Giá trị của m là A. 15,54 B. 17,10 C. 14,76 D. 13,98 Câu 59. Cho 200 ml dung dịch chứa KOH 0,9M và Ba(OH)2 0,2M vào 100 ml dung dịch H2SO4 0,3M và Al2(SO4)3 0,3M. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng kết tủa thu được là A. 9,32 B. 10,88 C. 14,00 D. 12,44 Câu 60. Hòa tan hoàn toàn m gam hỗn hợp Na2O, Al2O3 vào nước được dung dịch trong suốt X. Thêm từ từ dung dịch HCl 1M vào dung dịch X nhận thấy khi bắt đầu xuất hiện kết tủa thì thể tích dung dịch HCl 1M đã cho vào là 100 ml. Còn khi cho 250 ml hoặc 650 ml dung dịch HCl 1M vào dung dịch X thì sẽ thu được lượng kết tủa như nhau. Giá trị m là A. 20,5 B. 23,6 C. 19,5 D. 39,0

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

N Ơ H

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A 2Al + 3H2SO4 → Al2(SO4)3 + H2↑ nAl = 0,02 mol , nH2SO4 = 0,05 mol Vậy dung dịch A gồm : Al3+ 0,02mol và H+dư : 0,04 mol

O Ạ Đ

.Q P T

UY

N

Khi cho NaOH đến khi kết tủa tan trở lại một phần xảy ra các phương trình sau: H+ + OH- → H2O 0,04 --->0,04 Al3+ + 3OH- → Al(OH)3↓

N Ầ TR

H

G N Ư

0,01---->0,03----->0,01

B

Al3+ + 4OH- → Al(OH)4-

1 3 +

0 00

0,01----->0,04 Nung kết tủa Al(OH)3 tạo Al2O3 :0,005 mol → nAl(OH)3 = 0,01 mol

Vậy nOH- = 0,04 + 0,03 + 0,04 = 0,11 → V=1,1 lít. Câu 2: A kim loại bị hòa tan hết, và còn dư H+. Ta thấy, số mol OH- dùng để phản ứng với H+ và làm kết tủa Mg2+, Zn2+ bằng số mol H+ trong H2SO4. Như vậy, khi làm kết tủa hết các chất, vẫn còn dư 0,1 mol OH-. Tiếp đó, sẽ có phản ứng tạo phức của Zn(OH)2. *Nếu OH- tiếp tục dư (nZn<0,05 mol), thì hỗn hợp rắn thu được gồm BaSO4 0,06 mol và MgO Thỏa mãn

* NẾu OH- không dư (nZn >0,05). Giải hệ thỏa mãn

Không

Câu 3: D

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 4: B CHỉ thu được một chất tan nên số mol Na2O và Al2O3 bằng nhau

CHất tan trong X là 0,1 mol NaAl(OH)4

.Q P T

Câu 8: A Nồng độ NaOH nhỏ nhất là lượng NaOH đủ để kết tủa với 0,01 mol Al3+

Thể tích CO2 cần dùng là: Câu 5: A TA thấy tỉ lệ số mol NaOH và số mol kết tủa không bằng nhau Câu 9: A Câu 10: C

Như vậy, phản ứng đầu chưa có kết tủa bị tan, ở phản ứng sau có kết tủa bị hòa tan Phản ứng sau:

N Ầ TR

H

G N Ư

O Ạ Đ

UY

N

Lượng NaOH cho kết tủa lớn nhất là: Như vậy, Khoảng giá trị của NaOH là khoảng đã có kết tủa tan, nên lượng kết tủa lớn nhất đạt được tại số mol 0,125

0 00

=>x=1,6 Câu 6: B Ứng với giá trị V lớn nhất thì sẽ tạo ra kết tủa

tan một phần

Ta có:

Câu 7: D

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

2

1 3 +

B

Câu 11: C

Sơ đồ:

Câu 12: D Do chỉ thu được 1 chất tan duy nhất nên chất tan đó là KAl(OH)4

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Khi cho thêm CO2 dư thì CO2 phản ứng với OH- tạo HCO3- (không tạo kết tủa với Ba2+) và CO2 phản ứng với Al(OH)4- tạo Al(OH)3 kết tủa

UY

Câu 13: D Gọi lượng Al(OH)3 kết tủa là x mol Câu 16: B Ở catot:

Trong 36 gam:

Suy ra, số mol NaOH trong 148 gam:

N Ầ TR

H

G N Ư

O Ạ Đ

Câu 17: B Từ dữ kiện đề bài suy ra ở lần 1 kết tủa không tan, Câu 14: D Số mol H2 thu được ở phần 2 lớn hơn phần 1, nên trong phản ứng với H2O của hỗn hợp X thì vẫn còn Al chưa phản ứng

Trong Y có 0,04 mol Al(OH)4-, 0,03 mol OH-

Lượng HCl lớn nhất cần dùng: Câu 15: C

Ư D I Ồ B

G N Ỡ

TO

ÁN

-

A Ó H

Khi cho 0,6 mol OH- vào 0,1 mol Al3+ thì sẽ thu được 0,1 mol Al(OH)4- và 0,2 mol OH-

P Ấ C

0 00

2

1 3 +

B

.Q P T

N

dư, NaOH hết, còn ở lần 2 kết tủa tan 1 phần,

hết

3V ứng với

Câu 18: A Nhận thấy, ở lần 1 thì chưa có kết tủa tan còn lần 2 đã có kết tủa tan (nếu ở trường hợp cả 2 lần đều có kết tủa tan thì chênh lệch số mol kết tủa sẽ bằng chênh lệch số mol NaOH cho vào) Lần 2:

Câu 19: C Do khối lượng kết tủa và số mol NaOH không tỉ lệ nên ở phần 2 đã có 1 phần kết tủa tan lại Lần 2:

Như vậy, kết tủa chỉ có 0,2 mol BaSO4

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

+ TH1: OH- phản ứng với H+, lượng dư chỉ đủ để làm kết tủa 0,1 mol Al3+.

+ TH2: OH- phản ứng với H+, lượng dư làm kết tủa hết 2x mol Al3+ và hòa tan trở lại (2x-0,1) mol Al(OH)3.

UY

Vậy, a=8,5

Câu 20: B

Câu 23: C Câu 24: B Bảo toàn điện tích : 0,1 + 3z = t + 0,02.2 → t-3z = 0,06

O Ạ Đ

.Q P T

N

Nhận thấy kết tủa gồm BaSO4 : 0,012 mol, Al(OH)3: 0,012 mol

H+ + OH- → H2O

N Ầ TR

Nông độ dung dịch:

0,1 ------> 0,1

Câu 21: C TH1: Khi cho 0,48 mol NaOH thì chỉ tạo 1 phần kết tủa, khi cho 0,51 mol NaOH thì tạo kết tủa tối đa vào 1 phần bị tan

Al3+ + 3OH- → Al(OH)3

TH2: cả 2 lần đều tạo kết tủa tối đa và hòa tan 1 phần

N Á O

Trường hợp cho 0,48 mol NaOH

Ư D I Ồ B

G N Ỡ

Í -L

-

A Ó H

T

Câu 22: A Đặt nAl2O3=x. Sau phản ứng với HNO3, dung dịch có 2x mol Al3+ và có thể có 0,8-6x mol HNO3 dư. Cho NaOH vào thì có thể xảy ra 2 trường hợp:

Sưu tầm bởi GV. Nguyễn Thanh Tú

P Ấ C

0 00

B

H

0,012---0,036 ------> 0,012

31

Trường hợp cho 0,51 mol NaOH

Chênh lệch số mol kết tủa ở 2 trường hợp:

G N Ư

Ta có 3×nkết tủa + nH+ = 0,136 mol < nOH- = 0,168 mol → Xảy ra trường hợp hòa tan kết tủa

Dung dịch sau điện phân có 0,2 mol NaAl(OH)4

2+

Al3+ + 4OH- → Al(OH)4-

0,008----> 0,032 Vậy z= 0,012 + 0,008 =0,02 → t= 0,12. Câu 25: A Cho 1,05 mol NaOH + 0,1 mol Al2(SO4)3

. Sau phản ứng Vdung dịch = 150 + 100 = 250 ml = 0,25 lít

→ Câu 26: B Cho 1,05 mol NaOH + 0,15625 mol Al2(SO4)3

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

; nAl(OH)3 = 0,2 mol. Câu 30: D 0,01 mol Al2(SO4)3 + V ml NaOH → ↓

UY

→ mAl(OH)3 = 0,2 × 78 = 15,6 gam Nung ↓ → 0,005 mol Al2O3 Câu 27: D m gam K (x mol) + 0,25a mol AlCl3 → 0,25 mol H2↑ + ↓. Nung ↓ → 0,05 mol Al2O3.

→ nAl(OH)3 = 0,005 × 2 = 0,01 mol. • TH1: NaOH thiếu

↑ (*)

G N Ư

O Ạ Đ

.Q P T

↓ (**)

AlCl3 + 3NaOH → Al(OH)3↓ + 3NaCl

(***)

nNaOH = 3 × nAl(OH)3 = 3 × 0,01 = 0,03 mol → VNaOH = 0,03 : 0,1 = 0,3 lít = 300ml.

0 00

Theo (***) nAl(OH)3 dư = 0,05 × 2 = 0,1 mol → nAl(OH)3 phản ứng = 0,25a - 0,1 → nKOH = 0,25a - 0,1 → ∑nKOH = 0,75a + 0,25a - 0,1 = 0,5 → a = 0,6 Câu 28: B Na, K, Ba + H2O → 0,3 mol H2↑ Đặt công thức chung của ba kim loại là M ↑

N Á O

• X + Al(NO3)3 → ↓ lớn nhất

-L

Í-

B

Al(OH)3 + NaOH → NaAlO2 + 2H2O (**)

Theo (**) nKOH = 3 × nAlCl3 = 3 × 0,25a = 0,75a mol; nAl(OH)3 = 0,25a mol.

NG

H

Al2(SO4)3 + 6NaOH → 2Al(OH)3↓ + 3Na2SO4(*)

Theo (*) nH2 = 1/2x = 0,25 → nK = 0,5 mol.

N Ầ TR

• TH2: NaOH dư

(****)

N

A Ó H

P Ấ C

2

1 3 +

Theo (*) nNaOH = 0,01 × 6 = 0,06 mol; nAl(OH)3 = 0,02 mol.

Theo (**) nAl(OH)3 phản ứng = 0,02 - 0,01 = 0,01 mol → nNaOH = 0,01 mol → ∑nNaOH = 0,06 + 0,01 = 0,07 mol → VNaOH = 0,07 : 0,1 = 0,7 = 700 ml Câu 31: D

TH1:

còn dư:

TH2:

hết, NaOH tác dụng một phần với

T

→ mAl(OH)3 = 0,2 × 78 = 15,6 gam Câu 29: C

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 32: D

TH1:

còn dư:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn TH2:

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Theo (***) nAl(OH)3 phản ứng = 0,04 - 0,01 = 0,03 mol → nNaOH = 0,03 mol

hết, NaOH tác dụng một phần với

→ ∑nNaOH = 0,03 + 0,12 = 0,15 mol → nNa = 0,15 mol → mNa = 0,15 × 23 = 3,45 gam

UY

Câu 35: C Câu 33: A • Ba(OH)2 + 0,006 mol AlCl3 → ↓ lớn nhất

Dung dịch:

3Ba(OH)2 + 2AlCl3 → 3BaCl2 + 2Al(OH)3↓ nBa(OH)2 = 3/2 × nAlCl3 = 3/2 × 0,006 = 0,009 mol → CMBa(OH)2 = 0,009 : 0,2 = 0,045 lít = 45 ml. • Gọi V là thể tích Ba(OH)2 + 0,006 mol AlCl3 → ↓ nhỏ nhất 3Ba(OH)2 + 2AlCl3 → 3BaCl2 + 2Al(OH)3↓ (*)

TH1:

Ba(OH)2 dư + 2Al(OH)3 → Ba(AlO2)2 + 4H2O (**) Theo (*) nBa(OH)2 = 3/2 × 0,006 = 0,009 mol; nAl(OH)3 = 0,006 mol.

TH2:

0 1 3

Theo (**) nBa(OH)2 = 1/2 × 0,006 = 0,003 mol → ∑nBa(OH)2 = 0,009 + 0,003 = 0,012 mol → VBa(OH)2 = 0,012 : 2 = 60 ml Câu 34: B m gam Na + 0,02 mol Al2(SO4)3 → 0,01 mol ↓ • TH1: NaOH hết 2Na + 2H2O → 2NaOH + H2↑ 6NaOH + Al2(SO4)3 → 2Al(OH)3↓ + 3Na2SO4

N Á O

Í -L

B 00

-

A Ó H

P Ấ C

2+

N Ầ TR còn dư

H

G N Ư

O Ạ Đ

.Q P T

N

hết, HCl tác dụng với một phần

Câu 36: B

nNa = nNaOH = 0,01 × 3 = 0,03 mol → mNa = 0,03 × 23 = 0,69 gam. • TH2: NaOH dư

NG

2Na + 2H2O → 2NaOH + H2↑ (*)

ƯỠ

T

6NaOH + Al2(SO4)3 → 2Al(OH)3↓ + 3Na2SO4 (**)

D I BỒ

TH1:

còn dư

TH2:

hết, HCl tác dụng với một phần

NaOH + Al(OH)3 → NaAlO2 + 2H2O (***) Theo (**) nNaOH = 0,02 × 6 = 0,12 mol; nAl(OH)3 = 0,02 × 2 = 0,04 mol.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 37: A

N Ơ H

Câu 41: A

UY

=>V=4,4(l) Câu 38: A 0,2a mol NaOH + 0,1 mol AlCl3 → ↓ Al(OH)3 Nung ↓ → 0,01 mol Al2O3 → nAl(OH)3 = 0,02 mol. • a lớn nhất khi NaOH dư Vậy kết tủa nhỏ nhất là 1,56g 3NaOH + AlCl3 → Al(OH)3↓ + 3NaCl (*)

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 42: A NaOH + 0,01 mol HCl; 0,01 mol AlCl3

NaOH + Al(OH)3 → NaAlO2 + 2H2O (**) Theo (*) nNaOH = 0,1 × 3 = 0,3 mol; nAl(OH)3 = 0,1 mol.

0 00

B

• Thu được lượng ↓ lớn nhất thì NaOH thiếu

Theo (**) nAl(OH)3 phản ứng = 0,1 - 0,02 = 0,08 mol → nNaOH = 0,08 mol. → ∑nNaOH = 0,3 + 0,08 = 0,38 mol → CMNaOH = 0,38 : 0,2 = 1,9 M Câu 39: A 0,5V mol NaOH + 0,2 mol AlCl3 → 0,1 mol ↓ Al(OH)3 • V lớn nhất khi NaOH dư 3NaOH + AlCl3 → Al(OH)3↓ + 3NaCl (*) NaOH + Al(OH)3 → NaAlO2 + 2H2O (**) Theo (*) nNaOH = 0,2 × 3 = 0,6 mol; nAl(OH)3 = 0,2 mol.

ÁN

Í -L

Theo (**) nAl(OH)3 phản ứng = 0,2 - 0,1 = 0,1 mol → nNaOH = 0,1 mol.

TO

-

A Ó H

P Ấ C

2

1 3 +

NaOH + HCl → NaCl + H2O (*) 3NaOH + AlCl3 → Al(OH)3↓ + 3NaCl (**) Theo (*) nNaOH = nHCl = 0,01 mol Theo (**) nNaOH = 0,01 × 3 = 0,03 mol; nAl(OH)3 = 0,01 mol → ∑nNaOH = 0,01 + 0,03 = 0,04 mol. • Thu được ↓ nhỏ nhất khi NaOH dư NaOH + Al(OH)3 → NaAlO2 + 2H2O (***) Theo (***) nNaOH phản ứng = 0,01 mol → ∑nNaOH ≥ 0,04 + 0,01 = 0,05 Câu 43: D • 0,1 mol H2SO4 + a mol Na[Al(OH)4] → 0,1 mol Al(OH)3↓

→ ∑nNaOH = 0,6 + 0,1 = 0,7 mol → CMNaOH = 0,7 : 0,5 = 1,4 M Câu 40: A V lít HCl 1M + 0,05 mol Na[Al(OH)4] → 0,01 mol ↓Al(OH)3

• H2SO4 + 2Na[Al(OH)4] → Na2SO4 + 2Al(OH)3↓ + 2H2O (*)

Cần ít nhất HCl → HCl thiếu

3H2SO4 + 2Al(OH)3 → Al2(SO4)3 + 6H2O (**)

I Ồ B

Ỡ Ư D

NG

HCl + Na[Al(OH)4] → NaCl + Al(OH)3↓ + H2O

Theo (*) nH2SO4 = a/2 mol; nAl(OH)3 = a mol.

nHCl = 0,01 mol → VHCl = 0,01 : 1 = 0,01 lít = 10 ml

Theo (**) nAl(OH)3 phản ứng = a - 0,1 mol → nH2SO4 = 3/2 (a - 0,1) mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

0,04 --->0,04 → ∑nH2SO4 = a/2 + 3/2 (a - 0,1) = 0,1 → a = 0,125 mol Câu 44: A Nhận thấy 3 < nOH- : nAl3+ = 1,4 : 0,4 < 4 → xảy ra quá trình hòa tan kết tủa

Al3+ + 3OH- → Al(OH)3↓

UY

0,01---->0,03----->0,01 Al3+ + 3OH- → Al(OH)3↓ Al3+ + 4OH- → Al(OH)4x------3x 0,01----->0,04 Al3+ + 4OH- → Al(OH)4-

O Ạ Đ

.Q P T

N

Nung kết tủa Al(OH)3 tạo Al2O3 :0,005 mol → nAl(OH)3 = 0,01 mol y-------4y 2+

G N Ư

Vậy nOH- = 0,04 + 0,03 + 0,04 = 0,11 → V=1,1 lít. Câu 47: C Nhận thấy kết tủa lớn nhất khi có Mg(OH)2 : 0,06 mol và Al(OH)3 : 0,09 mol

2-

Ba + SO4 → BaSO4↓ 0,7-----0,6------->0,6

N Ầ TR

H

nOH- = nH+ + 2×nMg2+ + 3×nAl3+ = 0,11 + 2×0,06 + 3×0,09 = 0,5 mol Ta có hệ

→ 0,02V + 0,02V= 0,5 → V= 12,5 lít

Nung kết tủa đến khối lượng không đổi: Al2O3: 0,1 mol và nBaSO4 = 0,6 mol → mchất rắn = 150 gam. Câu 45: A 9 gam

dung dịch Y

kết tủa

16,2 gam

Gọi số mol của Al và Mg lần lượt là x, y

Ta có hệ :

N Á O

-L

Í-

A Ó H

Bảo toàn electron → nH2 = (0,2×3 + 0,15×2):2= 0,45 mol → V= 10,08 lit. Câu 46: B 2Al + 3H2SO4 → Al2(SO4)3 + H2↑

G N Ỡ

nAl = 0,02 mol , nH2SO4 = 0,05 mol

T

Vậy dung dịch A gồm : Al3+ 0,02mol và H+dư : 0,04 mol

I Ồ B

Khi cho NaOH đến khi kết tủa tan trở lại một phần xảy ra các phương trình sau: H+ + OH- → H2O

0 00

B

Kết tủa nhỏ nhất khi chỉ có Mg(OH)2 : 0,06 mol

Vậy kết tủa gồm nAl(OH)3 = 0,2 mol, nBaSO4 = 0,6 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

P Ấ C

2+

31

nOH- = nH+ + 2×nMg2+ + 4×nAl3+ = 0,11 + 2×0,06 + 4×0,09 = 0,59 mol → 0,02 V + 0,02V = 0,59 → V= 14,75 lit

Câu 48: A Hoà tan hoàn toàn hỗn hợp Na2O, Al2O3 vào nước được dung dịch trong suốt X (NaOH dư,NaAlO2) Chú ý thứ tự các phản ứng khi thêm dung dịch HCl vào dung dịch X HCl + NaOH → NaCl + H2O (1) NaAlO2+ HCl+ H2O → NaCl + Al(OH)3 (2) Al(OH)3 + 3HCl → AlCl3 + 3H2O (3) Khi thêm 0,1 mol HCl thì bắt đầu xuất hiện kết tủa → nNaOH dư = 0,1 mol (xảy ra (1)) Khi thêm 0,2 mol HCl thì xảy ra (1), (2) ( lượng AlO2- trong pt (2)dư ) → nkết tủa = nH+ phản ứng (2) = 0,2 - 0,1 = 0,1 mol → a = 7,8 gam. Loại B,D Khi thêm 0,6 mol HCl xảy ra hiện tượng hòa tan kết tủa (xảy ra cả 3 phương trình)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Chú ý nOH- = 2× nMg(OH)2 + 3× nAl(OH)3 = 0,165 mol → nBa2+ = nSO42- = 0,0825 mol -

→ 4×nAlO2 = 3nkết tủa +

(nH+

-

-0,1) → nAlO2 = 0,2 mol Nung kết tủa tạo ra : Al2O3 : 0,025 mol, BaSO4 : 0,0825 mol, MgO: 0,015 mol

Vậy NaAlO2 0,2 mol, NaOH dư 0,1 mol → m= mAl2O3 + mNa2O = 0,1×102 + 0,15×62 = 19,5 gam Câu 49: A Nhận thấy khi thêm dung dịch NaOH thì khối lượng kết tủa giảm đi → xảy ra sự hòa tan kết tủa

→ m= 22,1175 gam 22,12 gam. Câu 52: D Nhận thấy kết lớn nhất khi BaSO4: 0,03 mol, Al(OH)3: 0,04 mol

→ 4×nAlCl3 = nNaOH + nkết tủa = 0,34 + 0,06 = 0,4 mol → nAlCl3 = 0,1 mol

Vậy nOH-= 3×nAl3+ = 0, 12 mol

→ x = 1 M. Câu 50: A Nhận thấy nkết tủa = 0,2 mol < nK[Al(OH)4] =0,3 mol → Xảy ra 2 trường hợp

nNa = 0,12 - 2×nBa(OH)2- nNaOH = 0,03 mol → mNa = 0,69. Câu 53: C Nhận thấy nkết tủa = 0,02 mol < nNa[Al(OH)4] → Xảy ra 2 trường hợp,

- TH1: không xảy ra sư hòa tan kết tủa :

Để thể tích dung dịch HCl là lớn nhất thì xảy ra quá trình hòa tan kết tủa

KOH+ HCl → KCl + H2O

NaOH + HCl → NaCl + H2O

x----> x

0,1 ----> 0,1

0 00

K[Al(OH)4] + HCl → Al(OH)3 + KCl + H2O

Ta có x+ 0,2 = 1 → x= 0,8 mol → m= 44,8 gam - TH2: xảy ra sự hòa tan kết tủa KOH+ HCl → KCl + H2O

H Í

x----> x K[Al(OH)4] + HCl → Al(OH)3 + KCl + H2O

N Á O

0,2---------> 0,2---------> 0,2

0,1---------->0,4

G N Ỡ

H

.Q P T

-L

ÓA

T

P Ấ C

2+

31

0,02-----------> 0,02-------> 0,02

Na[Al(OH)4] + 4HCl → AlCl3 + 2H2O 0,03-------- ->0,12 Vậy nHCl = 0,1 + 0,02 + 0,12 = 0,24 mol → V= 0,12 lít. Câu 54: B 0,5V mol NaOH + 0,04 mol AlCl3 → Khối lượng ↓ nhỏ nhất khí V biến thiên 200 - 300ml. • 3NaOH + AlCl3 → 3NaCl + Al(OH)3↓ (*) Al(OH)3 + NaOH → NaAlO2 + 2H2O (**) Theo (*) nNaOH = 3 × 0,04 = 0,12 mol; nAl(OH)3 = 0,04 mol. Theo (**) nAl(OH)3 phản ứng = 0,5V - 0,12 mol → nAl(OH)3 dư = 0,04 - (0,5V - 0,12) = 0,16 - 0,5V mol.

Ta có x+ 0,2 + 0,4 = 1 → x= 0,4 → m = 22,4 gam.

Mà V biến thiên từ 0,2 lít - 0,3 lít → nAl(OH)3 dư biến thiên từ 0,01 mol đến 0,06 mol

Câu 51: A Lượng kết tủa lớn nhất khi Mg(OH)2 : 0,015 mol, Al(OH)3 : 0,045 mol, BaSO4: 0,0825 mol

→ mAl(OH)3 nhỏ nhất = 0,01 × 78 = 0,78 gam Câu 55: A

I Ồ B

N

Na[Al(OH)4] + HCl → Al(OH)3 + H2O

0,3---------> 0,2---------> 0,2

K[Al(OH)4] + 4HCl → AlCl3+ KCl + H2O

B

N Ầ TR

G N Ư

O Ạ Đ

UY

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Nhận thấy khi lượng NaOH tăng lên, lượng AlCl3 không đổi thì lượng kết tủa tăng lên → thí nghiệm 1 thì NaOH hết, AlCl3 còn dư ; thí nghiệm 2 cả NaOH và AlCl3 đều hết (xảy ra hiện tượng hòa tan kết tủa)

N Ơ H

Theo (***) nBa(OH)2 = 0,125 - 0,05 - 0,06 = 0,015 mol → nAl(OH)3 = 0,04 - 0,015 × 2 = 0,01 mol.

Thí nghiệm 1: Ta có 3× nkết tủa = nOH- = 0,6 mol → 0,2a= 0,6 → a= 3

→ m↓ = mBaSO4 + mAl(OH)3 = 0,06 × 233 + 0,01 × 78 = 14,76 gam Câu 59: D

Thí nghiệm 2:Ta có 4×nAl3+ = nOH- + nkết tủa → 4×0,5b= 0,4×3 + 0,3 → b= 0,75 +

Câu 56: A AlCl3 + KOH : 0,18 mol→ 0,06 mol Al(OH)3 + dd Y

(*)

DD Y + KOH : 0,21 mol → 0,03 mol Al(OH)3

(**)

Nhận thấy khi thêm KOH vào dung dịch Y lại tạo kết tủa

G N Ư

↓ (***)

→ trong dung dịch Y còn AlCl3 còn dư : (0,1x- 0,06) mol Vì 3×nKOH = 0,09 <nKOH = 0,21 mol → xảy ra hiện tượng hòa tan kết tủa

N Ầ TR

H

O Ạ Đ

UY

.Q P T

N

(****)

Theo (*)

4nAlCl3 dư = nkết tủa + nKOH → nAlCl3 = (0,03 +0,21):4= 0,06 → 0,1x-0,06 = 0,06 → x= 1,2

B

Theo (**)

0 00

Câu 57: B Nhận thấy 36,9 gam kết tủa gồm BaSO4 : 0,15 mol và Al(OH)3 : 0,025 mol Vì nAl(OH)3 = 0,025 mol < <nOH- = 0,3 + 0,3x mol → xảy ra hiện tượng hòa tan kết tủa 3+ Al + 3OH → Al(OH)3 3+ Al + 4OH → Al(OH)4 3+ Luôn có 4nAl = nOH + nAl(OH)3 → nOH = 0,3 + 0,3x = 4×0,1 -0,025= 0,375 mol → x= 0,25 mol

Câu 58: C 0,1 mol HCl + 0,02 mol Al2(SO4)3 → ddX

N Á O

ddX + 0,125 mol Ba(OH)2 → ↓ • 2HCl + Ba(OH)2 → BaCl2 + 2H2O (*)

NG

Í -L

-

A Ó H

T

P Ấ C

2

1 3 +

Theo (***) nAl(OH)3 dư = 0,06 - 0,02 =0,04 mol.

Theo (****)

→ m↓ = mAl(OH)3 + mBaSO4 = 0,04 × 78 + 0,04 × 233 = 12,44 gam Câu 60: B Gọi số mol của Na2O là x, Al2O3 là y mol Nhận thấy khi thêm 0,1 mol HCl mới bắt đầu tạo kết tủa → Trong dung dịch X chứa NaAlO2 và NaOH dư → nNaOH dư = 0,1 mol Khi thêm 0,25 mol hoặc 0,65 mol HCl thì lượng kết tủa như nhau → khi thêm 0,25 mol HCl thì lượng HCl hết lượng NaAlO2 còn dư → nHCl = nNaOH dư + nAl(OH)3 → 0,25 = 0,1 + nAl(OH)3 → nAl(OH)3 = 0,15 mol Khi thêm 0,65 mol thì HCl và NaAlO2 đều hết

Al2(SO4)3 + 3Ba(OH)2 → 2Al(OH)3↓ + 3BaSO4↓ (**)

D I BỒ

ƯỠ

→ 4nNaAlO2 = (nHCl -nNaOH dư)+ 3nAl(OH)3 → 8y = (0,65-0,1) + 3.0,15 → y = 0,125 mol

2Al(OH)3 + Ba(OH)2 → Ba(AlO2)2 + 4H2O (***) Bảo toàn nguyên tố Na → nNa2O = (nNaOH dư + nNaAlO2) :2 = (0,1 + 0,25 ):2 = 0,175mol

Theo (*) nBa(OH)2 = 0,1 : 2 = 0,05 mol. → m= 0,125.102 +0,175.62 = 23,6 gam.

Theo (**) nBa(OH)2 = 0,02 × 3 = 0,06 mol; nAl(OH)3 = 0,04 mol; nBaSO4 = 0,06 mol.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

UY

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

20. Các dạng bài tập về phản ứng của axit (Đề 2)

Câu 1. Cho 3 kim loại Al, Fe, Cu vào 2 lít dung dịch HNO3 phản ứng vừa đủ thu được 1,792 lít khí X (đktc) gồm N2 và NO2 có tỉ khối hơi so với He bằng 9,25. Nồng độ mol HNO3 trong dung dịch đầu là (phản ứng không tạo NH4+) A. 0,28M. B. 0,44M. C. 0,22M. D. 0,56M. Câu 2. Hoà tan a gam Cu và Fe (Fe chiếm 30% về khối luợng) bằng 50 ml dd HNO3 63% (D= 1,38g/ml). Sau khi phản ứng xảy ra hoàn toàn thu đựơc chất rắn X cân nặng 0,75a gam, dd Y và 6,104 lít hỗn hợp khí NO và NO2 (đkc). Cô cạn Y thì số gam muối thu được là A. 75,150g B. 62,100g C. 37,575g D. 49,745g Câu 3. Hòa tan hoàn toàn 100 gam hỗn hợp X gồm Fe, Cu, Ag trong dung dịch HNO3 (dư). Kết thúc phản ứng thu được 13,44 lít (đktc) hỗn hợp khí Y gồm NO2, NO, N2O theo tỉ lệ số mol tương ứng là 3 : 2 : 1 và dung dịch Z (không chứa muối NH4NO3). Cô cạn dung dịch Z thu được m gam muối khan. Giá trị của m và số mol HNO3 đã phản ứng lần lượt là A. 205,4 gam và 2,5 mol B. 199,2 gam và 2,4 mol C. 205,4 gam và 2,4 mol D. 199,2 gam và 2,5 mol Câu 4. Nung m gam bột Cu trong oxi thu được 37,6 gam hỗn hợp rắn X gồm Cu, CuO và Cu2O. Hòa tan hoàn toàn X trong dung dịch H2SO4 đặc, nóng (dư) thấy thoát ra 3,36 lít khí (ở đktc). Giá trị của m là A. 25,6 gam B. 32 gam C. 19,2 gam D. 22,4 gam Câu 5. Hòa tan hoàn toàn 12 gam hỗn hợp Fe, Cu (tỉ lệ mol 1:1) bằng axit HNO3, thu được V lít (ở đktc) hỗn hợp khí X (gồm NO và NO2) và dung dịch Y (chỉ chứa hai muối và axit dư). Tỉ khối của X đối với H2 bằng 19. Giá trị của V là (cho H = 1, N = 14, O = 16, Fe = 56, Cu = 64) A. 2,24. B. 4,48. C. 5,60. D. 3,36. Câu 6. Hoà tan 20,8 gam hỗn hợp bột gồm FeS, FeS2, S bằng dung dịch HNO3 đặc nóng dư thu được 53,76 lít NO2 (sản phẩm khử duy nhất, ở đktc và dung dịch X. Cho dung dịch X tác dụng với dung dịch NaOH dư, lọc lấy toàn bộ kết tủa nung trong không khí đến khối lượng không đổi thì khối lượng chất rắn thu được là: A. 16 gam B. 9 gam C. 8,2 gam

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 10,7 gam Câu 7. Cho 11,36 gam hỗn hợp gồm Fe, FeO, Fe2O3 và Fe3O4 phản ứng hết với dung dịch HNO3 loãng (dư), thu được 1,344 lít khí NO (sản phẩm khử duy nhất, ở đktc) và dung dịch X. Cô cạn dung dịch X thu được m gam muối khan. Giá trị của m là: A. 35,50 B. 34,36 C. 49,09 D. 38,72 Câu 8. Hòa tan hoàn toàn 30,4 gam chất rắn X gồm Cu, CuS, Cu2S và S bằng dung dịch HNO3 dư, thoát ra 20,16 lít khí NO duy nhất (đktc) và dung dịch Y. Thêm Ba(OH)2 dư vào dung dịch Y thu được m gam kết tủa. Giá trị của m là : A. 110,95 B. 115,85 C. 104,20 D. 81,55 Câu 9. Cho m gam hỗn hợp X gồm Al, Cu vào dung dịch HCl (dư), sau khi kết thúc phản ứng sinh ra 3,36 lít khí (ở đktc). Nếu cho m gam hỗn hợp X trên vào một lượng dư axit nitric (đặc, nguội), sau khi kết thúc phản ứng sinh ra 6,72 lít khí NO2 (sản phẩm khử duy nhất, ở đktc). Giá trị của m là A. 12,3. B. 15,6. C. 10,5. D. 11,5. Câu 10. Hoà tan hoàn toàn 8,862 gam hỗn hợp gồm Al và Mg vào dung dịch HNO3 loãng, thu được dung dịch X và 3,136 lít (ở đktc) hỗn hợp Y gồm hai khí không màu, trong đó có một khí hóa nâu trong không khí. Khối lượng của Y là 5,18 gam. Cho dung dịch NaOH (dư) vào X và đun nóng, không có khí mùi khai thoát ra. Phần trăm khối lượng của Al trong hỗn hợp ban đầu là A. 19,53%. B. 12,80%. C. 10,52%. D. 15,25%. Câu 11. Hòa tan hoàn toàn 20,88 gam một oxit sắt bằng dung dịch H2SO4 đặc, nóng thu được dung dịch X và 3,248 lít khí SO2 (sản phẩm khử duy nhất, ở đktc). Cô cạn dung dịch X, thu được m gam muối sunfat khan. Giá trị của m là A. 52,2. B. 54,0. C. 58,0. D. 48,4. Câu 12. Cho 18,5 gam hỗn hợp X gồm Fe và Fe3O4 tác dụng với 200 ml dung dịch HNO3 loãng đun nóng và khuấy đều. Sau khi phản ứng xảy ra hoàn toàn thu đươc 2,24 lít khí NO duy nhất (đktc), dung dịch Y và còn lại 1,46 gam kim loại. Nồng độ mol của dung dịch HNO3 và khối lượng muối có trong dung dịch Y lần lượt là A. 1,6M và 24,3 gam B. 3,2M và 48,6 gam. C. 3,2M và 54 gam D. 1,8M và 36,45 gam.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13. Cho 18,4 gam hỗn hợp X gồm Cu2S, CuS, FeS2 và FeS tác dụng hết với HNO3 (đặc nóng dư) thu được V lít khí chỉ có NO2 (ở đktc, sản phẩm khử duy nhất) và dung dịch Y. Cho toàn bộ Y vào một lượng dư dung dịch BaCl2, thu được 46,6 gam kết tủa, còn khi cho toàn bộ Y tác dụng với dung dịch NH3 dư thu được 10,7 gam kết tủa. Giá trị của V là A. 38,08 B. 11,2 C. 24,64 D. 16,8 Câu 14. Hòa tan hoàn toàn 25,6 gam chất rắn X gồm Fe, FeS, FeS2 và S bằng dung dịch HNO3 dư, thoát ra V lít khí NO duy nhất (đktc) và dung dịch Y. Thêm Ba(OH)2 dư vào Y thu được 126,25 gam kết tủa. Giá trị của V là A. 17,92. B. 19,04. C. 24,64. D. 27,58. Câu 15. Cho 17,6 gam hỗn hợp X gồm S, FeS, FeS2 tan hoàn toàn trong dung dịch HNO3 đặc nóng dư thu được V lit NO2 duy nhất và dung dịch Y. Cho Y tác dụng với dung dịch Ba(OH)2 dư, lọc và nung kết tủa trong không khí đến khối lượng không đổi thu được 62,6 gam chất rắn. V có giá trị A. 44,8 B. 47,1 C. 40,32 D. 22,4 Câu 16. Đun nóng m gam hỗn hợp Cu và Fe có tỉ lệ khối lượng tương ứng 7 : 3 với một lượng dung dịch HNO3. Khi các phản ứng kết thúc, thu dược 0,75m gam chất rắn, dung dịch X và 5,6 lít hỗn hợp khí (đktc) gồm NO và NO2 (không có sản phẩm khử khác của N+5). Biết lượng HNO3 đã phản ứng là 44,1 gam. Giá trị của m là A. 44,8. B. 33,6. C. 40,5. D. 50,4. Câu 17. (Đề NC) Đem nung hỗn hợp X (gồm x mol Fe và 0,15 mol Cu) trong không khí một thời gian, thu được 63,2 gam hỗn hợp Y gồm hai kim loại trên và hỗn hợp các oxit của chúng. Hòa tan hết hỗn hợp Y bằng dung dịch H2SO4 đặc, nóng, dư thì thu được 0,3 mol SO2 (sản phẩm khử duy nhất, đo ở đktc). Trị số của x là A. 0,60. B. 0,64. C. 0,67. D. 0,70. Câu 18. Thể tích dung dịch HNO3 1M loãng ít nhất cần dùng để hoà tan hoàn toàn một hỗn hợp gồm 0,15 mol Fe và 0,15 mol Cu (biết rằng phản ứng tạo ra chất khử duy nhất là NO) A. 1 lít. B. 0,6 lít. C. 0,8 lít. D. 1,2 lít. Câu 19. Cho 2,8 gam hỗn hợp X gồm Cu và Ag phản ứng hoàn toàn với dung dịch HNO3 dư, thu được 0,04 mol NO2 (Sản phẩm khử duy nhất của N+5) và dung dịch chứa m gam muối. Giá trị của m là:

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 5,28. B. 3,42. C. 4,08. D. 2,62. Câu 20. Cho 10 gam hỗn hợp Fe, Cu (trong đó Fe chiếm 40% khối lượng) vào một lượng axit H2SO4 đặc, đun nóng. Sau khi phản ứng xảy ra hoàn toàn, thu được dung dịch X, V lít khí SO2 (ở đktc) và còn lại 6,64 gam kim loại không tan. Giá trị của V là A. 1,176. B. 1,344. C. 1,596 D. 2,016. Câu 21. Hòa tan hết hỗn hợp X gồm 16,8 gam Fe ; 2,7 gam Al và 5,4 gam Ag tác dụng với H2SO4 đặc nóng dư chỉ thoát ra khí SO2 (sản phẩm khử duy nhất của S). Số mol H2SO4 đã tham gia phản ứng là A. 1,20 B. 1,25 C. 1,45 D. 1,85 Câu 22. Hòa tan hoàn toàn 11,90 gam hỗn hợp 3 kim loại X, Y, Z bằng dung dịch H2SO4 đặc, nóng thu được 7,616 lít khí SO2 (đktc), 0,640 gam S và dung dịch T. Cô cạn dung dịch T thu được m gam muối khan. Giá trị của m là: A. 50,30. B. 30,50. C. 35,00. D. 30,05. Câu 23. Cho 7,40 gam hỗn hợp kim loại Ag, Al, Mg tan hết trong dung dịch H2SO4 đặc nóng dư thu được hỗn hợp sản phẩm khử X (gồm 0,015 mol S và 0,0125 mol H2S) và dung dịch Y. Cô cạn dung dịch Y thu được bao nhiêu gam muối khan ? A. 12,65 gam. B. 15,62 gam. C. 16,52 gam. D. 15,26 gam. Câu 24. Hòa tan 13,6 gam hỗn hợp X gồm Fe, Cu bằng dung dịch HNO3 dư thu được 6,72 lít (đktc) hỗn hợp khí Y gồm NO và NO2 có khối lượng 12,2 gam. Khối lượng muối nitrat sinh ra là A. 45,9 gam. B. 44,6 gam. C. 59,4 gam. D. 46,4 gam. Câu 25. Hòa tan hết 4,43 gam hỗn hợp Al và Mg trong HNO3 loãng thu được dung dịch X và 1,568 lít (đktc) hỗn hợp hai khí (đều không màu) có khối lượng 2,59 gam trong đó có một khí bị hóa thành màu nâu trong không khí. Số mol HNO3 đã phản ứng là (phản ứng không tạo NH4+) A. 0,51 mol B. 0,45 mol C. 0,55 mol D. 0,49 mol

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 26. Nung m gam bột sắt trong oxi, thu được 3 gam hỗn hợp chất rắn X. Hòa tan hết hỗn hợp X trong dung dịch HNO3 (dư), thoát ra 0,56 lít (đktc) NO (là sản phẩm khử duy nhất). Giá trị của m là A. 2,52. B. 2,22. C. 2,32. D. 2,62. Câu 27. Hòa tan hoàn toàn 6,1 gam hỗn hợp bột X gồm FexOy và Cu bằng dd H2SO4 đặc nóng (dư). Sau phản ứng thu được 1,26 lít khí SO2 (sản phẩm khử duy nhất, ở đktc) và dd chứa 16,5 gam hỗn hợp muối sunfat. Phần trăm khối lượng của Cu trong X là A. 13,11%. B. 26,23%. C. 39,34%. D. 65,57%. Câu 28. Để a gam bột sắt trong không khí một thời gian được 7,52 gam hỗn hợp rắn X gồm Fe, FeO, Fe3O4 và Fe2O3. Hòa tan hết X trong dung dịch H2SO4 đặc, nóng (dư) được 0,672 lít khí SO2 (sản phẩm khử duy nhất, đo ở đktc) và dung dịch Y. Cô cạn cẩn thận dung dịch Y được b gam muối khan. Giá trị của a và b lần lượt là A. 7,0 và 25,0. B. 4,2 và 15,0. C. 4,48 và 16,0. D. 5,6 và 20,0. Câu 29. Cho 2,19 gam hỗn hợp gồm Cu, Al tác dụng hoàn toàn với dung dịch HNO3 dư, thu được dung dịch Y và 0,672 lít khí NO (ở đktc, là sản phẩm khử duy nhất). Khối lượng muối trong Y là A. 6,39 gam. B. 8,27 gam. C. 4,05 gam. D. 7,77 gam. Câu 30. Cho 8,37 gam hỗn hợp (Fe, Cu, Al) tác dụng hoàn toàn với lượng dư axit H2SO4 đặc nóng được 0,2 mol SO2 là sản phẩm khử duy nhất. Khối lượng (gam) muối tạo thành là : A. 27,57. B. 21,17. C. 46,77. D. 11,57. Câu 31. Cho 6,72 gam Fe vào dung dịch chứa 0,3 mol H2SO4 đặc, nóng (giả thiết SO2 là sản phẩm khử duy nhất). Sau khi phản ứng xảy ra hoàn toàn, thu được A. 0,12 mol FeSO4. B. 0,02 mol Fe2(SO4)3 và 0,08 mol FeSO4. C. 0,05 mol Fe2(SO4)3 và 0,02 mol Fe dư. D. 0,03 mol Fe2(SO4)3 và 0,06 mol FeSO4. Câu 32. Cho 6,72 gam Fe phản ứng với 125 ml dung dịch HNO3 3,2M thu được dung dịch X và khí NO (sản phẩm khử duy nhất của N+5). Biết các phản ứng xảy ra hoàn toàn, khối lượng muối trong dung dịch X là A. 21,60 gam. B. 25,32 gam. C. 29,04 gam. D. 24,20 gam.

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

N Ơ H

Câu 33. Cho 7,08 gam hỗn hợp kim loại Ag, Cu, Fe tan hết trong dung dịch H2SO4 đặc nóng dư thu được hỗn hợp sản phẩm khử X (gồm 0,01 mol H2S; 0,02 mol S và 0,03 mol SO2) và dung dịch Y. Khối lượng muối khan thu được khi cô cạn dung dịch Y là A. 19,56 gam. B. 19,82 gam. C. 32,04 gam. D. 32,56 gam.

UY

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A Gọi số mol của N2 và NO2 lần lượt là a, b

N Ầ TR

Ta có hệ

H

G N Ư

O Ạ Đ

.Q P T

N

nHNO3 phản ứng = 12nN2 + 2nNO2 = 0,56 mol → CM = 0,28M. Câu 2: C

1 3 +

0 00

B

nên Fe phản ứng chưa hết, Cu chưa phản ứng. dung dịch chỉ chứa

Ta có: mà

Bảo toàn e:

Câu 3: C Gọi số mol của NO2, NO, N2O lần lượt là 3x, 2x, và x mol → 3x + 2x + x = 0,6 → x = 0,1

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Luôn có nNO3 - ( muối) = nNO2 + 3nNO + 8nN2O = 1,7 mol

=>hỗn hợp ban đầu tạo ra được:

mmuối = mkl + mNO3- = 100 + 62. 1,7 = 205,4 gam

=>khối lượng muối là: Cách 2: x mol và Quy hỗn hợp về

nHNO3 phản ứng = 2nNO2 + 4nNO + 10nN2O = 2,4 mol

y mol.

Câu 4: B Quy hỗn hợp X gồm Cu : x mol và O : y mol

=>y=0,05 Ta có:

Ta có hệ

=>Khối lượng muối là:

→ m = 0,5. 64 = 32 gam. Câu 5: C

Câu 8: A xem hh ban đầu gồm Cu, S ta có 64x+32y=30.4 2x+6y=0,9.3 ==> x=0,3 ; y=0,35 m= 0,3.98+0,35.233

Mặt khác,

Câu 6: A 20,8 g gồm FeS, FeS2, S + HNO3 đ, to → 2,4 mol NO2 + ddX ddX + NaOH dư → ↓Fe(OH)3.

• Coi hh ban đầu gồm Fe và S Đặt nFe = x mol; nS = y mol → 56x + 32y = 20,8 (*)

TO

UY

Ta có

ÁN

H Í

-L

ÓA

P Ấ C

2+

31

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

Câu 9: A Khi cho hỗn hợp vào kim loại vào HCL chỉ có Al tham gia phản ứng sinh khí→ nAl = 2nH2 : 3 = 0,1 mol

Khi cho hỗn hợp vào kim loại vào HNO3 đặc nguội thì chỉ có Cu tham gia dphản ứng → nCu = nNO2 :2 = 0,15 mol → m = 0,1. 27 + 0,15. 64 = 12,3 gam. Câu 10: B mà Y có 2 khí không màu,1 khí hóa nâu trong không khí là NO, nên khí còn lại là Giải hệ ta được

Theo bảo toàn e: 3 × nFe + 6 × nS = 1 × nNO2 → 3x + 6y = 2,4 (**)

G N Ỡ

Từ (*), (**) → x = 0,2 mol; y = 0,3 mol.

nFe2O3 = 1/2 × nFe = 1/2 × 0,2 = 0,1 mol → mFe2O3 = 0,1 × 160 = 16 gam Câu 7: D Cách 1: . Ta có:

Ư D I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

%

Câu 11: C

%

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

20,88 g oxit sắt + H2SO4 đặc, nóng → ddX + 0,145 mol SO2↑. Cô cạn ddX thu được m gam muối. Ta có hpt: • Oxit sắt là FeO hoặc Fe3O4 → nFe2(SO4)3 = nSO2 = 0,145 mol. Theo bảo toàn e: nNO = (0,2 x 3 + 0,45 x 6) : 3 = 1,1 mol → VNO = 24,64 lít Câu 15: C Quy đổi hỗn hợp về Fe (x mol) và S (y mol).

→ ∑nH2SO4 = 0,145 x 3 + 0,145 = 0,58 mol → nH2O = 0,58 mol. Theo BTKL m = 20,88 + 0,58 x 98 - 0,145 x 64 - 0,58 x 18 = 58,0 gam Câu 12: B Dung dịch sau phản ứng còn kim loại Fe dư → dung dịch Y chỉ chừa Fe(NO3)2

Sơ đồ phản ứng:

Gọi số mol của Fe và Fe3O4 phản ứng lần lượt là a, b

Ta có hệ

Ta có hệ:

N Ầ TR

Có mmuối = ( 0,18 + 0,03.3). 180 = 48,6 gam

Bảo toàn electron:

Bảo toàn nguyên tố N → nHNO3phản ứng = nNO + 2nFe(NO3)2 = 0,1 + 2. (0,18 +0,03.3) = 0,64 mol → CM = 3,2 M Câu 13: A Quy đổi hỗn hợp về x mol Fe, y mol Cu và z mol S.

Câu 16: D

Sơ đồ phản ứng như sau:

Bảo toàn lưu huỳnh: Bảo toàn sắt:

Bảo toàn electron:

G N Ỡ

TO

ÁN

Í -L

-

Câu 14: C 25,6 gam chất rắn X gồm Fe, FeS, FeS2 và S + HNO3 dư → V lít NO + ddY.

I Ồ B

A Ó H

P Ấ C

2

1 3 +

0 00

B

H

G N Ư

O Ạ Đ

.Q P T

UY

N

Cu chưa phản ứng, Fe phản ứng còn dư, sản phẩm sắt thu được là sắt(II)

Đặt

BT e:

Câu 17: D Sơ đồ phản ứng:

Giải nhanh bằng pp cân bằng e: Xét toàn bộ quá trình ta thấy: Cho e gồm: sắt cho 3e lên sắt dương 3 và Cu cho 2e lên Cu+2.

ddY + BaCl2 → 126,25 gam BaSO4↓ và Fe(OH)3. Nhận e gồm: O2 nhận 4 xuống 2O-2 và S+6 nhận 2e xuống S+4.

• Coi hh X ban đầu gồm Fe và S

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Do đó, ta có phương trình: →

Ta có hệ Câu 18: C Để HNO3 là ít nhất thì

UY

Câu 25: D Có MX =

= 37

O Ạ Đ

.Q P T

Khí không màu hóa nâu trong không khí là NO : x mol có 30 < MX = 37 < 44 → khí không màu còn lại là N2O : y mol

Câu 19: A

Ta có

Vậy sắt bị oxi hóa thành Fe2+. Khối lượng sắt phản ứng là 10 - 6,64 = 3,36 gam → nFe = 0,06 mol Bảo toàn electron → 2nSO2 = 2nFe → nSO2 = 0,06 mol → V = 1,344 lit Câu 21: B = 0,625 mol

Số mol H2SO4 tham gia phản ứng là nH2SO4 pư = 2nSO2 = 1,25 mol

N Á O

Câu 22: A Luôn có nSO42- = 0,5ne nhận = 0,5.( 6nS + 2nSO2 ) = 0,4 mol

T

H

Câu 26: A Quy đổi chất rắn X về Fe : xmol và O : y mol

Khi tham gia phản ứng với H2SO4 đặc nóng thì sắt phản ứng trước, hết Fe mới đến Cu. Sau phản ứng còn 6,64 gam kim loại > 6 gam→ chứng tỏ Fe mới phản ứng một phẩn, Cu chưa tham gia phản ứng

Bảo toàn electron → nSO2 =

N Ầ TR

G N Ư

Có nHNO3 pứ = 4nNO + 10nN2O = 4. 0,035 + 10. 0,035 = 0,49 mol

Câu 20: B Trong 10 gam hỗn hợp thì Fe : 4 gam còn Cu : 6 gam

-L

Í-

A Ó H

P Ấ C

2+

31

0 00

B

Ta có hệ → m = 0,045. 56 = 2,52 gam. Câu 27: B Coi hỗn hợp gồm Fe,Cu và O:

bảo toàn e:

Có mmuối = mkl + mSO42- = 11,9 + 96.0,4 = 50,3 gam

%

Câu 23: C Luôn có nSO42- = 0,5ne nhận = 0,5.( 6nS + 8nH2S ) = 0,095 mol

Câu 28: D m gam Fe trong không khí → 7,52 gam hhX gồm 4 chất.

Có mmuối = mkl + mSO42- = 7,4 + 96.0,095 = 16,52 gam Câu 24: B Gọi số mol của NO và NO2 là lần lượt là x, y mol

hhX + H2SO4 đặc, nóng → 0,03 mol SO2 + ddY. Cô cạn Y được m1 gam muối khan.

Ư D I Ồ B

N

Luôn có mmuối = mkl +mNO3-= 13,6 + 62.∑ ne trao đổi = 13,6 + 62. ( 0,1. 3 + 0,2) = 44,6 gam

G N Ỡ

Sưu tầm bởi GV. Nguyễn Thanh Tú

%

• Ta có các quá trình nhường, nhận e:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Fe0 → Fe+3 + 3e O20 + 4e → 2O-2

UY

S+6 + 2e → S+4

.Q P T

Câu 33: A Luôn có nSO42- = 0,5ne nhận = 0,5.( 6nS + 2nSO2 +8nH2S ) = 0,13 mol

Theo bảo toàn e: 3 x nFe = 4 x nO2 + 2 x nSO2 → → m = 5,6 gam → nO2 = (7,52 - 5,6) : 32 = 0,06 mol → nO2- = 0,12 mol.

O Ạ Đ

N

Có mmuối = mkl + mSO42- = 7,08 + 96.0,13 = 19,56 gam 2-

• 1O thay thế bằng 1SO4

2-

4H+ + SO42- + 2e → SO2 + 2H2O nSO42-tạo muối = nO2- + ne nhận : 2 = 0,12 + 0,03 = 0,15 mol. mmuối = mFe + mSO42- = 5,6 + 0,15 x 96 = 20 gam Câu 29: D

Câu 30: A Khi cho kim loại tác dụng với H2SO4 đặc nóng thì mmuối =mkl + mSO42- = 8,37 + 96. 0,2 = 27,57 gam

Câu 31: D 0,12 mol Fe + 0,3 mol H2SO4 •

nSO42-tạo muối

= 0,15 mol

Đặt nFeSO4 = a mol; nFe2(SO4)3 = b mol.

N Á O

Theo bảo toàn Fe: a + 2b = 0,12 (*). Theo BTĐT: 2a + 6b = 0,15 x 2 (**)

Ỡ Ư D

Từ (*), (**) → a = 0,06; b = 0,03 Câu 32: B

I Ồ B

NG

Í -L

-

A Ó H

P Ấ C

0 00

2

1 3 +

B

N Ầ TR

H

G N Ư

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

21. Các dạng bài tập về phản ứng của axit (Đề 3)

Câu 1. Hoà tan hoàn toàn 12,42 gam Al bằng dung dịch HNO3 loãng (dư), thu được dung dịch X và 1,344 lít (ở đktc) hỗn hợp khí Y gồm hai khí là N2O và N2. Tỉ khối của hỗn hợp khí Y so với khí H2 là 18. Cô cạn dung dịch X, thu được m gam chất rắn khan. Giá trị của m là A. 38,34. B. 34,08. C. 106,38. D. 97,98. Câu 2. Hỗn hợp M gồm 0,04 mol Al và 0,06 mol Mg. Nếu đem hỗn hợp này hòa tan hoàn toàn trong HNO3 dư được 0,03 mol sản phẩm khử duy nhất X. Nếu đem hòa tan hỗn hợp đó trong H2SO4 đặc, nóng dư cũng thu được 0,03 mol sản phẩm khử duy nhất Y. X và Y lần lượt là A. NO2 và H2S B. NO2 và SO2 C. NH4NO3 và SO2 D. NH4NO3 và H2S. Câu 3. Cho hỗn hợp gồm 6,72 gam Mg và 0,8 gam MgO tác dụng hết với lượng dư dung dịch HNO3. Sau khi các phản ứng xảy ra hoàn toàn, thu được 0,896 lít một khí X (đktc) và dung dịch Y. Làm bay hơi dung dịch Y thu được 46 gam muối khan. Khí X là A. NO2 B. NO C. N2O D. N2 Câu 4. Cho 29 gam hỗn hợp gồm Al, Cu và Ag tác dụng vừa đủ với 950 ml dung dịch HNO3 1,5M, thu được dung dịch chứa m gam muối và 5,6 lít hỗn hợp khí X (đktc) gồm NO và N2O. Tỉ khối của X so với H2 là 16,4. Giá trị của m là A. 98,20 B. 97,20 C. 98,75 D. 91,00 Câu 5. Cho 2,16 gam Mg tác dụng với dung dịch HNO3 (dư). Sau khi phản ứng xảy ra hoàn toàn thu được 0,896 lít khí NO (ở đktc) và dung dịch X. Khối lượng muối khan thu được khi làm bay hơi dung dịch X là A. 13,32 gam. B. 6,52 gam. C. 8,88 gam. D. 13,92 gam. Câu 6. Hòa tan hoàn toàn m gam Al bằng dung dịch HNO3 loãng, thu được 5,376 lít (đktc) hỗn hợp khí X gồm N2, N2O và dung dịch chứa 8m gam muối. Tỉ khối của X so với H2 bằng 18. Giá trị của m là A. 21,60 B. 17,28 C. 19,44 D. 18,90

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Hòa tan hoàn toàn 10,8 gam Al trong dung dịch HNO3 dư, không thấy khí thoát ra, thu được dung dịch X. Cô cạn cẩn thận dung dịch X thu được khối lượng muối khan là A. 85,2 gam. B. 97,2 gam. C. 87,9 gam. D. 117,2 gam. Câu 8. Khi cho 9,6 gam Mg tác dụng hết với dung dịch H2SO4 thấy có 0,5 mol H2SO4 tham gia phản ứng thu được dung dịch X và sản phẩm khử Y. Chất Y là A. SO2 B. S C. H2S D. H2. Câu 9. Cho 1,26 gam hỗn hợp Mg và Al (trộn theo tỉ lệ mol 3 : 2) tác dụng với H2SO4 đặc, nóng vừa đủ, thu được 0,02 mol sản phẩm X (sản phẩm khử duy nhất). X là chất nào dưới đây ? A. SO2 B. S C. H2S D. H2 Câu 10. Hoà tan 5,95 gam hỗn hợp Al, Zn có tỉ lệ mol 2:1 bằng HNO3 loãng dư thu được 0,896 lít khí X là sản phẩm khử duy nhất. Xác định X. A. N2. B. N2O. C. NO. D. NO2. Câu 11. Hòa tan hoàn toàn 13,00 gam Zn trong dung dịch HNO3 loãng, dư thu được dung dịch X và 0,448 lít khí N2 (đktc). Khối lượng muối trong dung dịch X là A. 18,90 gam B. 37,80 gam C. 39,80 gam D. 28,35 gam. Câu 12. Cho hỗn hợp X gồm 5,4 gam Al, 4,8 gam Mg và 13 gam Zn tác dụng với dung dịch H2SO4 đặc, nóng dư thu được 0,175 mol một sản phẩm khử duy nhất là X. X là A. SO2. B. S. C. H2S. D. H2. Câu 13. Hòa tan 2,4 gam hỗn hợp Cu và Fe có tỷ lệ số mol 1:1 vào dung dịch H2SO4 đặc, nóng. Kết thúc phản ứng thu được 0,05 mol một sản phẩm khử duy nhất có chứa lưu huỳnh. Xác định sản phẩm đó: A. SO2. B. H2S. C. S. D. H2. Câu 14. Cho 24 gam kim loại kiềm thổ M vào dung dịch HNO3 loãng, nóng thì thu được 2,688 lít khí N2 (đktc). N2 là sản phẩm khử duy nhất của HNO3. Vậy kim loại M là: A. Sr

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. Ca C. Mg D. Ba Câu 15. Cho 0,28 mol Al vào dung dịch HNO3 dư thu được khí NO và dung dịch chứa 62,04 gam muối. Số mol khí NO thu được là A. 0,2. B. 0,28. C. 0,1. D. 0,14. Câu 16. Hoà tan 74,75 gam kim loại M trong dung dịch HNO3 dư thu được 5,6 lít hỗn hợp khí X (đktc) gồm 2 khí không màu không hoá nâu trong không khí có tỉ khối so với H2 bằng 17,2. Biết dung dịch không chứa muối amoni. Kim loại M là A. Zn B. Mg C. Fe D. Cu Câu 17. Hoà tan hoàn toàn 8,4 gam Mg vào 1 lit dung dịch HNO3 vừa đủ. Sau phản ứng thu được khí N2 (đktc) và dung dịch Y. Cô cạn dung dịch Y thu được 55,8 gam muối khan. Nồng độ mol của dung dịch HNO3 đã dùng là A. 0,76M B. 0,86M C. 0,96M D. 1,06M Câu 18. Hỗn hợp X gồm Mg (0,1 mol), Al (0,04 mol), Zn (0,15 mol). Cho X tác dụng với dung dịch HNO3, sau phản ứng thấy khối lượng dung dịch tăng 13,23 gam. Số mol HNO3 đã tham gia phản ứng là A. 0,62 mol. B. 1,24 mol. C. 0,6975 mol. D. 0,775 mol. Câu 19. Cho 0,1 mol Fe tan hết trong dung dịch HNO3 dư thấy thoát ra 0,3 mol khí X là sản phẩm khử duy nhất. Xác định X. A. NO2. B. N2 C. NO D. N2O Câu 20. Cho 9,6 gam Cu tan hết trong dung dịch HNO3 dư thấy thoát ra 2,24 lít khí X là sản phẩm khử duy nhất (đktc). Xác định X. A. NO2. B. N2 C. NO D. N2O Câu 21. Cho 2,6 gam Zn tan hết trong dung dịch HNO3 thấy thoát ra 0,224 lít khí X là sản phẩm khử duy nhất (đktc). Xác định X. A. NO2. B. N2

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. NO D. N2O Câu 22. Khi cho 5,4 gam Al tác dụng hết với dung dịch HNO3 dư thấy thoát ra 6,72 lít hỗn hợp X gồm hai khí, trong đó có một khí hoá nâu ngoài không khí (phản ứng không tạo muối amoni, khí đo ở đktc). Xác định các khí có trong X. A. NO và NO2. B. NO và N2O. C. NO và N2. D. NO2 và N2O. Câu 23. Khi cho 26,4 gam Mg tác dụng hết với dung dịch HNO3 dư thấy thoát ra 8,96 lít hỗn hợp X gồm hai khí có tỉ lệ mol 1:1, trong đó có một khí màu nâu (phản ứng không tạo muối amoni, khí đo ở đktc). Xác định các khí có trong X. A. NO và NO2. B. N2 và N2O. C. NO2 và N2. D. NO2 và N2O. Câu 24. Khi cho 6,4 gam Cu tác dụng hết với dung dịch HNO3 thấy tạo thành sản phẩm khử X duy nhất (khối lượng N trong X là 2,8 gam). Xác định X. A. N2 B. N2O C. NO D. NO2 Câu 25. Khi cho 13,0 gam Zn tác dụng hết với dung dịch HNO3 thấy có 0,5 mol HNO3 tham gia phản ứng thu được dung dịch Y và sản phẩm khử X duy nhất. Xác định X. A. N2. B. N2O. C. NO. D. NO2. Câu 26. Hoà tan hoàn toàn 3,24 gam hỗn hợp Mg và Al bằng dung dịch HNO3 vừa đủ, thu được 0,04 mol sản phẩm X (sản phẩm khử duy nhất). X là chất nào dưới đây ? A. NO2 B. NO C. N2O D. N2 Câu 27. Hoà tan hoàn toàn 45,9 gam kim loại M bằng dung dịch HNO3 loãng thu được hỗn hợp khí gồm 0,3 mol N2O và 0,9 mol NO và dung dịch không chứa . Kim loại M là A. Cu B. Mg C. Fe D. Al

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 2: D Câu 3: Câu 4: A

UY

BT e:

Câu 5: D Câu 6: A

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 18: D

0 00

Đặt

Câu 7: B Câu 8: C Câu 9: B Câu 10: A Ta có nAl= 0,1 và nZn = 0,05 mol

Ỡ Ư D

Gọi số e khí X nhận là a

I Ồ B

N Ơ H

Câu 13: A Câu 14: B Câu 15: A Câu 16: A Từ giả thiết có hỗn hợp X gồm 2 khí N2 và N2O với : nN2 = 0,15 mol,nN2O = 0,1 mol → ∑ne nhận = 2,3 mol. Giả sử kim loại có số oxi hóa + n khi pứ với HNO3,bảo toàn e ta có nM = 2,3 : x → M = 32,5n . Để ý rằng n = 1;2 hoặc 3,chọn được n = 2 ứng với M = 65 (Zn). Câu 17: B

NG

N Á O

Í -L

T

-

A Ó H

P Ấ C

2

1 3 +

B

Do đó phản ứng không tạo khí, chỉ tạo muối Bảo toàn e:

Câu 19: A Câu 20: C Câu 21: D Câu 22: A Câu 23: C - Khí màu nâu là NO2, giả sử khí còn lại là Z → nA = nNO2 = 0,2 mol. - Bảo toàn electron có: ne nhận của A = 2 mol = 10nA → A là N2. Câu 24: D Câu 25: B Câu 26: C Câu 27: A

bảo toàn electron có 0,1. 3 + 0,05.2 = a.0,04 → a = 10 → khí X là N2 Câu 11: C Câu 12: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

22. Các dạng bài tập về phản ứng của axit (Đề 4)

Câu 1. Cho m gam bột Fe vào 800 ml dung dịch hỗn hợp gồm Cu(NO3)2 0,2M và H2SO4 0,25M. Sau khi các phản ứng xảy ra hoàn toàn, thu được 0,6m gam hỗn hợp bột kim loại và V lít khí NO (sản phẩm khử duy nhất, ở đktc). Giá trị của m và V lần lượt là A. 17,8 và 4,48. B. 17,8 và 2,24. C. 10,8 và 2,24 D. 10,8 và 4,48 Câu 2. Cho hỗn hợp gồm 1,12 gam Fe và 1,92 gam Cu vào 400 ml dung dịch chứa hỗn hợp gồm H2SO4 0,5M và NaNO3 0,2M. Sau khi các phản ứng xảy ra hoàn toàn, thu được dung dịch X và khí NO (sản phẩm khử duy nhất). Cho V ml dung dịch NaOH 1M vào dung dịch X thì lượng kết tủa thu được là lớn nhất. Giá trị tối thiểu của V là A. 360. B. 240. C. 400. D. 120. Câu 3. Thực hiện hai thí nghiệm: 1) Cho 3,84 gam Cu phản ứng với 80 ml dung dịch HNO3 1M thoát ra V1 lít NO. 2) Cho 3,84 gam Cu phản ứng với 80 ml dung dịch chứa HNO3 1M và H2SO4 0,5 M thoát ra V2 lít NO. Biết NO là sản phẩm khử duy nhất, các thể tích khí đo ở cùng điều kiện. Quan hệ giữa V1 và V2 là (cho Cu = 64) A. V2 = V1 B. V2 = 2V1. C. V2 = 2,5V1 D. V2 = 1,5V1. Câu 4. Cho a gam Fe vào 100 ml dung dịch hỗn hợp gồm HNO3 0,8M và Cu(NO3)2 1M. Sau khi các phản ứng xảy ra hoàn toàn, thu được 0,92a gam hỗn hợp kim loại và khí NO (sản phẩm khử duy nhất của N+5 ). Giá trị của a là A. 11,0 B. 11,2 C. 8,4 D. 5,6 Câu 5. Cho 7,68 gam Cu vào 200 ml dung dịch gồm HNO3 0,6M và H2SO4 0,5M. Sau khi các phản ứng xảy ra hoàn toàn (sản phẩm khử duy nhất là NO), cô cạn cẩn thận toàn bộ dung dịch sau phản ứng thì khối lượng muối khan thu được là: A. 19,76 gam. B. 20,16 gam. C. 19,20 gam. D. 22,56 gam. Câu 6. Cho bột Cu dư vào 2 cốc đựng V1 (lít) dung dịch HNO3 4M và V2 (lít) dung dịch hỗn hợp HNO3 3M và H2SO4 1M đều thu được V lít (đktc) khí NO duy nhất thoát ra. Mối quan hệ giữa V1 và V2 là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. V1 = 1,40V2 B. V1 = 0,8V2 C. V1 = 0,75V2 D. V1 = 1,25V2 Câu 7. Cho 29 gam hỗn hợp gồm Al, Cu và Ag tác dụng vừa đủ với 950 ml dung dịch HNO3 1,5M, thu được dung dịch chứa m gam muối và 5,6 lít hỗn hợp khí X (đktc) gồm NO và N2O. Tỉ khối của X so với H2 là 16,4. Giá trị của m là A. 98,20 B. 97,20 C. 98,75 D. 91,00 Câu 8. Cho 0,87 gam hỗn hợp gồm Fe, Cu và Al vào bình đựng 300 ml dung dịch H2SO4 0,1M. Sau khi các phản ứng xảy ra hoàn toàn, thu được 0,32 gam chất rắn và 448 ml khí (đktc) thoát ra. Thêm tiếp vào bình 0,425 gam NaNO3, khi các phản ứng kết thúc thì thể tích khí NO (đktc, sản phẩm khử duy nhất) tạo thành và khối lượng muối trong dung dịch là A. 0,224 lít và 3,750 gam. B. 0,112 lít và 3,750 gam. C. 0,112 lít và 3,865 gam. D. 0,224 lít và 3,865 gam. Câu 9. Cho m gam Fe vào bình chứa dung dịch gồm H2SO4 và HNO3, thu được dung dịch X và 1,12 lít khí NO. Thêm tiếp vào dung dịch H2SO4 dư vào bình thu được 0,448 lít khí NO và dung dịch Y. Biết trong cả hai trường hợp NO là sản phẩm khử duy nhất, đo ở điều kiện tiêu chuẩn. Dung dịch Y hòa tan vừa hết 2,08 gam Cu (không tạo thành sản phẩm khử của N+5). Biết các phản ứng đều xảy ra hoàn toàn. Giá trị của m là A. 4,2. B. 2,4. C. 3,92. D. 4,06. Câu 10. Cho 1,92 gam bột Cu vào 100 ml dung dịch hỗn hợp (gồm KNO3 0,16M và H2SO4 0,5M) thu được dung dịch X và khí NO (sản phẩm khử duy nhất). Để kết tủa toàn bộ Cu2+ trong X cần tối thiểu V lít dung dịch NaOH 0,5M. Giá trị của V là: A. 0,184 B. 0,168 C. 0,048 D. 0,256 Câu 11. Hòa tan 9,6 gam bột Cu bằng 200ml dung dịch hỗn hợp gồm HNO3 0,5M và H2SO4 1M. Sau khi phản ứng xảy ra hoàn toàn được khí NO (sản phẩm khử duy nhất) và dung dịch X. Cô cạn cẩn thận X được khối lượng muối khan là: A. 35 gam B. 28,2 gam C. 24 gam D. 25,4 gam Câu 12. Cho 0,3 mol bột Cu và 0,6 mol Fe(NO3)2 vào dung dịch chứa 0,9 mol H2SO4 (loãng). Sau khi các phản ứng xảy ra hoàn toàn, thu được V lít khí NO (sản phẩm khử duy nhất, ở đktc). Giá trị của V là A. 6,72. B. 8,96.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 4,48. D. 10,08. Câu 13. Có ba dung dịch riêng biệt: H2SO4 1M; KNO3 1M; HNO3 1M được đánh số ngẫu nhiên là (1), (2), (3). - Trộn 5 ml dung dịch (1) với 5 ml dung dịch (2), thêm bột Cu dư, thu được V1 lít khí NO. - Trộn 5 ml dung dịch (1) với 5 ml dung dịch (3), thêm bột Cu dư, thu được 2V1 lít khí NO. - Trộn 5 ml dung dịch (2) với 5 ml dung dịch (3), thêm bột Cu dư, thu được V2 lít khí NO. Biết các phản ứng xảy ra hoàn toàn, NO là sản phẩm khử duy nhất, các thể tích khí đo ở cùng điều kiện. So sánh nào sau đây đúng? A. V2 = V1. B. V2 = 3V1. C. V2 = 2V1. D. 2V2 = V1. Câu 14. Cho 1,82 gam hỗn hợp bột X gồm Cu và Ag (tỉ lệ số mol tương ứng 4 : 1) vào 30 ml dung dịch gồm H2SO4 0,5M và HNO3 2M, sau khi các phản ứng xảy ra hoàn toàn, thu được a mol khí NO (sản phẩm khử duy nhất của N+5). Trộn a mol NO trên với 0,1 mol O2 thu được hỗn hợp khí Y. Cho toàn bộ Y tác dụng với H2O, thu được 150 ml dung dịch có pH = z. Giá trị của z là: A. 1 B. 3 C. 2 D. 4 Câu 15. Ba dung dịch loãng gồm HNO3; HCl; KNO3 chứa số mol chất tan như nhau, được ký hiệu ngẫu nhiên là X, Y, Z. Trộn X và Y rồi cho Cu dư vào thu được V1 lít khí NO. Trộn (X và Z) hoặc trộn (Y và Z) rồi cho Cu dư đều được V2 lít khí NO. (NO là sản phẩm khử duy nhất, đo ở cùng điều kiện). Dung dịch Z là A. HNO3 B. HCl C. KNO3 D. HCl hoặc HNO3 Câu 16. Hoà tan 19,2 gam Cu vào 400 ml dung dịch X gồm HNO3 1M và H2SO4 0,75M. Sau khi phản ứng kết thúc thu được V lit khí NO duy nhất (đktc). Tính V. A. 2,24 lit B. 4,48 lit C. 5,60 lit D. 8,96 lit Câu 17. Hoà tan 9,6 gam Cu vào 100 ml dung dịch X gồm HNO3 0,5M và H2SO4 1M. Sau khi phản ứng kết thúc thu được V lit khí NO duy nhất (đktc). Tính V. A. 0,28 lit B. 1,12 lit C. 1,40 lit D. 2,24 lit Câu 18. Hoà tan 7,68 gam Cu vào 400 ml dung dịch X gồm HNO3 0,25M và H2SO4 0,225M. Sau khi phản ứng kết thúc thu được V lit khí NO duy nhất (đktc). Tính V. A. 0,56 lit B. 1,568 lit C. 1,792 lit

D I BỒ

ƯỠ

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

N Ơ H

D. 2,24 lit

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

UY

Câu 1: B

.Q P T

N

Do thu được hỗn hợp bột kim loại nên Fe còn dư, sản phẩm phản ứng của Fe là

1 3 +

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

Câu 2: A Câu 3: B Câu 4: A Câu 5: A

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

đều hết Dung dịch thu được có:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 6: D

Dung dịch có:

UY

Câu 7: A

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

N

Câu 9: D Câu 10: B Câu 11: C Câu 12: B Câu 13: B PTHH: 3Cu + 8H+ + 2NO3- → 3Cu2+ + 2NO + 4H2O. * Vì khi trộn (1) với (2) hoặc (1) với (3) thì thu được thể tích khí lần lượt là V1 và 2V1 → lượng NO3- hoặc H+ ở hai thí nghiệm là gấp đôi nhau. Để ý rằng lượng NO3- bằng nhau → lượng H+ gấp đôi nhau → (1) là KNO3, (2) là HNO3 và (3) là H2SO4. * Khi đó dễ dàng xác định được V1 = 0,028 lít, V2 = 0,084 lít→ V2 = 3V1 Câu 14: A Tính được nCu = 0,02 mol và nAg = 0,005 mol; nH+= 0,09 mol và nNO3- = 0,06 mol. ♦ Số mol e kim loại nhường tối đa là : ne nhường = 0,045 mol. ♦ Khí NO được sỉnh ra từ bán phương trình:4H+ + NO3- + 3e →NO + 2H2O Để ý rằng NO3- dư và nếu H+ hết → ne nhận = 3nH+ : 4 = 0,0675 mol > ne nhường. ||→ Số mol khí NO = ne nhận : 3 = 0,015 mol. ♦ Xét quá trình phản ứng của NO và O2 có: Khi NÓ lên NÓ2 thì ne nhường = 0,015 x 2 = 0,03 mol. Khi O2 xuống O-2 thì ne nhận = 0,1 x 4 = 0,4 mol. ||→ ne nhận > ne nhường → O2 dư →nHNO3 = nNO = 0,015 mol → CM (HNO3) = 0,1 mol → pH = - log(H+) = 1.

0 00

Câu 8: C Chất rắn không tan chính là phần Cu không tác dụng:

.Q P T

N Ơ H

B

N Ầ TR

H

G N Ư

O Ạ Đ

Câu 15: C Câu 16: B Câu 17: B Câu 18: B

T

đều hết

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

23. Ancol – Phenol (Đề 1)

Câu 1. Đun nóng 1 hỗn hợp gồm 2 ancol no đơn chức với H2SO4 đặc ở 140oC thu được 21,6 gam nước và 72 gam hỗn hợp 3 ete. Biết 3 ete có số mol bằng nhau (phản ứng hoàn toàn). Xác định CTPT của 2 ancol. A. CH3OH và C2H5OH B. CH3OH và C3H7OH C. CH3OH và C4H9OH D. Cả 3 trường hợp trên đều có thể xảy ra Câu 2. Đun 132,8 gam hỗn hợp 3 ancol no, đơn chức với H2SO4 đặc ở 140oC cho đến khi phản ứng hoàn toàn thu được 111,2 gam hỗn hợp các ete có số mol bằng nhau. Số mol mỗi ete là: A. 0,10 mol B. 0,15 mol C. 0,20 mol D. 0,25 mol Câu 3. Pha a gam rượu etylic (D = 0,8g/ml) vào nước được 80ml rượu 250. Giá trị của a là A. 16. B. 25,6. C. 32. D. 40. Câu 4. Để xác định độ rượu của một loại etylic (kí hiệu rượu X) người ta lấy 10 ml rượu X cho tác dụng hết với Na thu được 2,564 lít H2 (đktc). Độ rượu của X gần nhất với giá trị nào (biết drượu = 0,8 g/ml) A. 87,50. B. 85,70. C. 91,00. D. 92,50. Câu 5. Cho Na tác dụng hoàn toàn với 18,8 gam hỗn hợp hai ancol no, đơn chức kế tiếp nhau trong dãy đồng đẳng sinh ra 5,6 lít khí H2 (đktc). CTPT của hai ancol là: A. C3H7OH và C4H9OH B. CH3OH và C2H5OH C. C2H5OH và C3H7OH D. C4H9OH và C5H11OH Câu 6. Oxi hoá ancol đơn chức X bằng CuO (đun nóng), sinh ra một sản phẩm hữu cơ duy nhất là xeton Y (tỉ khối hơi của Y so với khí hiđro bằng 29). Công thức cấu tạo của X là: A. CH3-CHOH-CH3 B. CH3-CH2-CHOH-CH3 C. CH3-CO-CH3 D. CH3-CH2-CH2-OH Câu 7. Cho hỗn hợp X gồm ancol metylic, etylen glicol và glixerol. Đốt cháy hoàn toàn m gam X thu được 6,72 lít khí CO2 (đktc). Cũng m gam X trên cho tác dụng với Na dư thu được tối đa V lít khí H2 (đktc). Giá trị của V là A. 3,36 B. 11,20 C. 5,60

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 6,72 Câu 8. Hỗn hợp X gồm metanol, etanol, propan-1-ol và H2O. Cho m gam X tác dụng Na dư thu được 15,68 lit H2 (đktc). Mặt khác đốt cháy hoàn toàn m gam X thu được V lit CO2 (đktc) và 46,8 gam H2O. Giá trị m và V lần lượt là: A. 19,6 và 26,88. B. 42 và 26,88. C. 42 và 42,56. D. 61,2 và 26,88. Câu 9. Cho 1,24 gam hỗn hợp hai ancol đơn chức tác dụng vừa đủ với Na thấy thoát ra 336 ml khí H2 (đktc). Hỗn hợp các chất rắn chứa Na được tạo ra có khối lượng bao nhiêu ? A. 1,90 gam. B. 1,585 gam. C. 1,93 gam. D. 1,57 gam. Câu 10. Oxi hóa 13,2 gam ancol đơn chức X thu được 15,6 gam sản phẩm (gồm anđehit Y và H2O). Số ancol thỏa mãn X là A. 2 B. 4 C. 6 D. 8 Câu 11. Pha 160 gam C2H5OH (D = 0,8 g/ml) vào nước được 0,5 lít rượu có độ rượu là A. 40o. B. 66,6o. C. 25,6o. D. 9,6o. Câu 12. Cho 10 ml dung dịch ancol etylic 46o phản ứng hết với kim lại Na (dư), thu được V lít khí H2 (đktc). Biết khối lượng riêng của ancol etylic nguyên chất bằng 0,8 g/ml. Giá trị của V là A. 4,256. B. 0,896. C. 3,360. D. 2,128. Câu 13. Cho 12,8 gam dung dịch ancol X (trong nước) có nồng độ 71,875% tác dụng với lượng Na dư thu được 5,6 lít khí (đktc). Công thức của ancol X là A. CH3OH. B. C2H4(OH)2. C. C3H5(OH)3. D. C4H7OH. Câu 14. Cho m gam một ancol no, đơn chức X qua bình đựng CuO (dư), nung nóng. Sau khi phản ứng hoàn toàn, khối lượng chất rắn trong bình giảm 0,32 gam. Hỗn hợp hơi thu được có tỉ khối đối với hiđro là 15,5. Giá trị của m là A. 0,64. B. 0,46. C. 0,32. D. 0,92.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 15. Cho 1 lít cồn 92o tác dụng với Na dư. Cho khối lượng riêng của ancol etylic nguyên chất là 0,8 g/ml. Thể tích khí H2 được ở đktc là A. 224,24 lít. B. 224 lít. C. 280 lít. D. 228,98 lít. Câu 16. Đốt cháy hoàn toàn 0,2 mol một ancol X no, mạch hở cần vừa đủ 17,92 lít khí O2 (ở đktc). Mặt khác, nếu cho 0,1 mol X tác dụng vừa đủ với m gam Cu(OH)2 thì tạo thành dung dịch có màu xanh lam. Giá trị của m và tên gọi của X tương ứng là A. 9,8 và propan-1,2-điol. B. 4,9 và propan-1,2-điol. C. 4,9 và propan-1,3-điol. D. Design Câu 17. Cho 15,6 gam hỗn hợp hai ancol đơn chức, kế tiếp nhau trong dãy đồng đẳng tác dụng hết với 9,2 gam Na, thu được 24,5 gam chất rắn. Hai ancol đó là A. C3H5OH và C4H7OH. B. C2H5OH và C3H7OH. C. C3H7OH và C4H9OH. D. CH3OH và C2H5OH. Câu 18. Hòa tan 92 gam C2H5OH vào nước thu được 250 ml dung dịch X. Biết khối lượng riêng của rượu nguyên chất là D = 0,8 g/ml. Độ rượu của dung dịch X là A. 29,44o. B. 36,8o. C. 46o. D. 46o. Câu 19. Khối lượng etanol có trong 1 lít rượu 90o là (khối lượng riêng của etanol là 0,8 g/ml) A. 980 gam. B. 900 gam. C. 800 gam. D. 720 gam. Câu 20. Oxi hóa 4,0 gam ancol đơn chức Z bằng O2 (có mặt xúc tác) thu được 5,6 gam hỗn hợp X gồm anđehit, ancol dư và nước. Tên của Z và hiệu suất phản ứng là A. metanol; 80%. B. etanol; 80%. C. metanol; 75%. D. etanol; 75%. Câu 21. Trong ancol X, oxi chiếm 26,667% về khối lượng. Đun nóng X với H2SO4 đặc thu được anken Y. Phân tử khối của Y là A. 56. B. 70. C. 28. D. 42. Câu 22. Tách nước hỗn hợp gồm ancol etylic và ancol Y chỉ tạo ra 2 anken. Đốt cháy cùng số mol mỗi ancol thì lượng nước sinh ra từ ancol này bằng 5/3 lần lượng nước sinh ra từ ancol kia. Ancol Y là A. CH3-CH2-CH(OH)-CH3.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. CH3-CH2-CH2-OH. C. CH3-CH2-CH2-CH2-OH. D. CH3-CH(OH)-CH3. Câu 23. Đun nóng hỗn hợp X gồm 6,4 gam CH3OH và 13,8 gam C2H5OH với H2SO4 đặc ở 140oC, thu được m gam hỗn hợp 3 ete. Biết hiệu suất phản ứng của CH3OH và C2H5OH tương ứng là 50% và 60%. Giá trị của m là A. 9,44. B. 15,7. C. 8,96. D. 11,48. Câu 24. Đun nóng hỗn hợp gồm hai ancol đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng với H2SO4 đặc ở 140oC. Sau khi các phản ứng kết thúc, thu được 6 gam hỗn hợp gồm ba ete và 1,8 gam nước. Công thức phân tử của hai ancol trên là A. C3H5OH và C4H7OH. B. CH3OH và C2H5OH. C. C2H5OH và C3H7OH. D. C3H7OH và C4H9OH. Câu 25. Đốt cháy hoàn toàn một lượng hỗn hợp X gồm 3 ancol thuộc cùng dãy đồng đẳng thu được 6,72 lít khí CO2 (đktc) và 9,90 gam H2O. Nếu đun nóng cũng lượng hỗn hợp X như trên với H2SO4 đặc ở nhiệt độ thích hợp để chuyển hết thành ete thì tổng khối lượng ete thu được là: A. 6,45 gam B. 5,46 gam C. 7,40 gam D. 4,20 gam Câu 26. Đun nóng 2 ancol đơn chức X, Y với H2SO4 đặc được hỗn hợp gồm 3 ete. Lấy ngẫu nhiên 1 ete trong số 3 ete đó đem đốt cháy hoàn toàn thu được 6,6 gam CO2 và 3,6 gam H2O. Nhận định nào sau đây đúng ? A. Ete đem đốt cháy là ete đối xứng B. X, Y có số nguyên tử cacbon bằng nhau C. Tổng số đồng phân ancol của X, Y là 2 D. X, Y có số mol bằng nhau Câu 27. Đun nóng hỗn hợp hai ancol đơn chức, mạch hở với H2SO4 đặc, thu được hỗn hợp gồm các ete. Lấy 7,2 gam một trong các ete đó đem đốt cháy hoàn toàn, thu được 8,96 lít khí CO2 (ở đktc) và 7,2 gam H2O. Hai ancol đó là A. C2H5OH và CH2=CH-CH2-OH. B. C2H5OH và CH3OH. C. CH3OH và C3H7OH. D. CH3OH và CH2=CH-CH2-OH. Câu 28. Đun nóng một ancol đơn chức X với dung dịch H2SO4 đặc trong điều kiện nhiệt độ thích hợp sinh ra chất hữu cơ Y, tỉ khối hơi của Y so với X là 1,4375. Công thức phân tử của X là A. C4H8O. B. C3H8O. C. CH4O. D. C2H6O. Câu 29. Đun nóng một ancol đơn chức X với dung dịch H2SO4 đặc trong điều kiện nhiệt độ thích hợp sinh ra chất hữu cơ Y, tỉ khối hơi của Y so với X là 0,7568. Công thức phân tử của X là

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. C4H10O. B. C3H8O. C. CH4O. D. C2H6O. Câu 30. Đun nóng một ancol đơn chức X với dung dịch H2SO4 đặc trong điều kiện nhiệt độ thích hợp sinh ra chất hữu cơ Y, tỉ khối hơi của X so với Y là 0,5918. Công thức phân tử của X là A. C4H8O. B. C3H6O. C. C3H6O. D. C2H6O. Câu 31. Đun nóng một ancol đơn chức X với dung dịch H2SO4 đặc trong điều kiện nhiệt độ thích hợp sinh ra chất hữu cơ Y, tỉ khối hơi của X so với Y là 1,6428. Công thức phân tử của X là A. C4H8O. B. C3H8O. C. CH4O. D. C2H6O. Câu 32. Chia hỗn hợp gồm hai ancol đơn chức X và Y (phân tử khối của X nhỏ hơn của Y) là đồng đẳng kế tiếp thành hai phần bằng nhau: - Đốt cháy hoàn toàn phần 1 thu được 5,6 lít CO2 (đktc) và 6,3 gam H2O. - Đun nóng phần 2 với H2SO4 đặc ở 140oC tạo thành 1,25 gam hỗn hợp ba ete. Hóa hơi hoàn toàn hỗn hợp ba ete trên, thu được thể tích của 0,42 gam N2 (trong cùng điều kiện nhiệt độ, áp suất). Hiệu suất của phản ứng tạo ete của X, Y lần lượt là: A. 30% và 30%. B. 25% và 35%. C. 40% và 20%. D. 20% và 40%. Câu 33. Đun nóng 16,6 gam hỗn hợp X gồm 3 ancol no đơn chức với H2SO4 đặc ở 140oC thu được 13,9 gam hỗn hợp 6 ete có số mol bằng nhau. Mặt khác, đun nóng X với H2SO4 đặc ở 180oC thu được sản phẩm chỉ gồm 2 olefin và nước. Các phản ứng xảy ra hoàn toàn. Tên gọi của 3 ancol trong X là A. metanol, etanol và propan-1-ol. B. etanol, propan-2-ol và propan-1-ol. C. propan-2-ol, butan-1-ol và propan-1-ol. D. etanol, butan-1-ol và butan-2-ol.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

NG

N Á O

-L

Í-

A Ó H

T

Câu 1: A Câu 2: C Bảo toàn khối lượng mancol = mete + mH2O → mH2O = 21,6 gam → nH2O = 1,2 mol

I Ồ B

Ỡ Ư D

Luôn có nete = nH2O = 1,2 mol

Khi cho 3 ancol tham gia tách nước tạo 6 ete → số mol một ete là 1,2:6 = 0,2 mol. Câu 3: A

Sưu tầm bởi GV. Nguyễn Thanh Tú

P Ấ C

N Ơ H

VC2H5OH nguyên chất sau khi pha = 80 x 25% = 20 ml. Mà d = 0,8 g/ml → a = 20 x 0,8 = 16 gam Câu 4: B Gọi thể tích rượu và nước trong 10 ml rượu X là x và y

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

UY

N

Câu 5: B

0 00

2+

31

=>2 ancol là CH3OH và C2H5OH Câu 6: A Câu 7: A Nhận thấy, các hợp chất trên đều có số C bằng số nhóm OH.

Câu 8: B Câu 9: A nH2 = 0,336 : 22,4 = 0,015 mol → nNa = 0,015 x 2 = 0,03 mol. Theo BTKL: mhh chất rắn = 1,24 + 0,03 x 23 - 0,015 x 2 = 1,9 gam Câu 10: B Câu 11: A Câu 12: A Câu 13: C Câu 14: D R-CH2OH + CuO RCHO + Cu + H2O Giả sử có x mol ancol tham gia phản ứng.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta có mCuO - mCu = 80x - 64x = 0,32 → 0,02 mol. hh hơi gồm RCHO và H2O với số mol mỗi chất là 0,02 mol.

UY

→ MR = 15 → R là CH3

Ta có: Vậy m = 46 x 0,02 = 0,92 gam Câu 15: D

Câu 16: B Câu 17: B Câu 18: C Câu 19: D Câu 20: A Câu 21: D Câu 22: C Câu 23: C Câu 24: B Câu 25: A Câu 26: C Câu 27: D Câu 28: C Câu 29: A Câu 30: B Câu 31: D Câu 32: C Câu 33: B

I Ồ B

0 00

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

24. Các dạng bài tập về phản ứng của axit (Đề 5)

Câu 1. Cho hỗn hợp có khối lượng 4,88 gam gồm Cu và oxit Fe. Hoà tan hoàn toàn hỗn hợp trên vào dd HNO3 dư được dd A và 1,12 lít (đktc) hỗn hợp khí B gồm NO và NO2 có tỉ khối so với H2 bằng 19,8. Cô cạn dd A thu được 14,78 gam hỗn hợp muối khan. CTPT của oxit Fe là A. FeO. B. FeO hoặc Fe2O3. C. Fe3O4. D. Fe2O3. Câu 2. Nung m gam bột Cu trong oxi thu được 37,6 gam hỗn hợp rắn X gồm Cu, CuO và Cu2O. Hòa tan hoàn toàn X trong dung dịch H2SO4 đặc, nóng (dư) thấy thoát ra 3,36 lít khí (ở đktc). Giá trị của m là A. 25,6 gam B. 32 gam C. 19,2 gam D. 22,4 gam Câu 3. Cho m gam bột Fe vào 800 ml dung dịch hỗn hợp gồm Cu(NO3)2 0,2M và H2SO4 0,25M. Sau khi các phản ứng xảy ra hoàn toàn, thu được 0,6m gam hỗn hợp bột kim loại và V lít khí NO (sản phẩm khử duy nhất, ở đktc). Giá trị của m và V lần lượt là A. 17,8 và 4,48. B. 17,8 và 2,24. C. 10,8 và 2,24 D. 10,8 và 4,48 Câu 4. Cho 5,6 gam Fe vào 200 ml dung dịch X (chứa Cu(NO3)2 0,5M và HCl 1M) đến phản ứng hoàn toàn thu được khí NO và m gam kêt tủa. Giá trị m là (biết rằng NO là sản phẩm khử duy nhất của NO3- và không có khí H2 bay ra) A. 1,6 B. 3,2 C. 6,4 D. 4,0 Câu 5. Hòa tan hết m gam Al cần 940ml dd HNO3 1M, thu được 1,68 lit (đktc) hỗn hợp G gồm 2 khí không màu và không hóa nâu trong không khí, tỷ khối hơi hỗn hợp G so với hiđro bằng 17,2. Giá trị m gần nhất với A. 6,7 B. 6,9 C. 6,6 D. 6,8 Câu 6. Cho hỗn hợp X gồm Fe và Cu vào 400 ml dung dịch chứa hỗn hợp gồm H2SO4 0,5M và NaNO3 0,2M. Sau khi các phản ứng xảy ra hoàn toàn, thu được dung dịch Y và khí NO (sản phẩm khử duy nhất) đồng thời còn một phần 1 kim loại chưa tan hết. Cho V ml dung dịch NaOH 1M vào dung dịch Y thì lượng kết tủa thu được là lớn nhất. Giá trị tối thiểu của V là A. 280. B. 240. C. 320.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 360. Câu 7. Cho 3,76 gam hỗn hợp X gồm Mg và MgO có tỉ lệ mol tương ứng là 14:1 tác dụng hết với dung dịch HNO3 thì thu được 0,448 lít một khí duy nhất (đo ở đktc) và dung dịch Y. Cô cạn cẩn thận dung dịch Y thu được 23 gam chất rắn khan T. Xác định số mol HNO3 đã phản ứng. A. 0,28 B. 0,36 C. 0,32 D. 0,34 Câu 8. Hòa tan m gam Al vào V lit dung dịch X gồm HCl 1M và H2SO4 0,5 M (vừa đủ) sau phản ứng dung dịch X tăng (m- 1,08) gam. Giá trị V là A. 0,54 B. 0,72 C. 1,28 D. 0,0675 Câu 9. Chia 156,8 gam hỗn hợp L gồm FeO, Fe3O4, Fe2O3 thành hai phần bằng nhau. Cho phần thứ nhất tác dụng hết với dung dịch HCl dư được 155,4 gam muối khan. Phần thứ hai tác dụng vừa đủ với dung dịch M là hỗn hợp HCl, H2SO4 loãng thu được 167,9 gam muối khan. Số mol của HCl trong dung dịch M là A. 1,75 mol B. 1,80 mol C. 1,50 mol D. 1,00 mol Câu 10. Hoà tan 7,68 g hỗn hợp Fe2O3 và Cu trong dung dịch HCl khi axit hết người ta thấy còn lại 3,2 gam Cu dư. Khối lượng của Fe2O3 ban đầu là A. 4,48 gam. B. 4,84 gam. C. 3,2 gam. D. 2,3 gam Câu 11. Hòa tan hết 26,43 gam hỗn hợp bột gồm Mg, Al, Al2O3 và MgO bằng 795 ml dung dịch hỗn hợp gồm HCl 0,5M và H2SO4 0,75M (vừa đủ). Sau phản ứng thu được dung dịch X và 4,368 lít khí H2 (ở đktc). Cô cạn dung dịch X thu được khối lượng muối khan là: A. 98,98 gam B. 88,18 gam C. 100,52 gam D. 86,58 gam Câu 12. Hòa tan hết hỗn hợp X gồm 0,12 mol Fe và 0,24 mol kim loại M trong dung dịch H2SO4 loãng dư thu được dung dịch X và 10,752 lít khí (đktc). Cô cạn dung dịch X thu được 59,28 gam muối khan. Kim loại M là : A. Na. B. Mg. C. Ca. D. Al. Câu 13. Cho 20 gam hỗn hợp kim loại M và Al vào dung dịch hỗn hợp H2SO4 và HCl (số mol HCl gấp 3 lần số mol H2SO4) thì thu được 11,2 lít H2 (đktc) và 3,4 gam kim loại dư. Lọc lấy phần dung dịch rồi đem cô cạn thu được m gam muối khan. Giá trị của m là A. 75,1 gam

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 71,5 gam C. 57,1 gam D. 51,7 gam Câu 14. Hoà tan hoàn toàn 8,862 gam hỗn hợp gồm Al và Mg vào dung dịch HNO3 loãng, thu được dung dịch X và 3,136 lít (ở đktc) hỗn hợp Y gồm hai khí không màu, trong đó có một khí hóa nâu trong không khí. Khối lượng của Y là 5,18 gam. Cho dung dịch NaOH (dư) vào X và đun nóng, không có khí mùi khai thoát ra. Phần trăm khối lượng của Al trong hỗn hợp ban đầu là A. 19,53%. B. 12,80%. C. 10,52%. D. 15,25%. Câu 15. Cho x mol Fe tan hoàn toàn trong dung dịch chứa y mol H2SO4 (tỉ lệ x : y = 2:5), thu được một sản phẩm khử duy nhất và dung dịch chỉ chứa muối sunfat. Số mol electron do lượng Fe trên nhường khi bị hoà tan là A. 2x B. 3x C. 2y D. y Câu 16. Cho m gam Fe tan hết trong 300 ml dung dịch FeCl3 1,5M thu được dung dịch Y. Cô cạn dung dịch Y thu được 81,525 gam chất rắn khan. Để hòa tan m gam Fe cần tối thiểu bao nhiêu ml dung dịch HNO3 1M (biết sản phẩm khử duy nhất là NO) ? A. 450 ml. B. 400 ml. C. 350 ml. D. 600 ml. Câu 17. Cho 8,4 gam sắt tan hết vào dung dịch HNO3 loãng. Sau khi phản ứng xảy ra hoàn toàn thu được 2,688 lít khí NO (sản phẩm khử duy nhất, ở đktc) và dung dịch X. Cô cạn dung dịch X thu được m gam muối khan. Giá trị của m là: A. 29,04. B. 32,40. C. 36,30. D. 30,72. Câu 18. Hỗn hợp X chứa Fe2O3 (0,1 mol), Fe3O4 (0,1 mol), FeO (0,2 mol) và Fe (0,1 mol). Cho X tác dụng với HNO3 loãng dư tạo ra khí NO (sản phẩm khử duy nhất), số mol HNO3 tham gia phản ứng là A. 3,0 mol B. 2,4 mol. C. 2,2 mol D. 2,6 mol. Câu 19. Hòa tan hết 2,32 gam hỗn hợp X gồm FeO, Fe2O3, Fe3O4 (trong đó tỉ lệ khối lượng FeO và Fe2O3 là 9/20 ) trong 200 ml dung dịch HNO3 1M thu được dung dịch Y. Dung dịch Y có thể hòa tan tối đa bao nhiêu gam Fe (biết rằng NO là sản phẩm khử duy nhất của N+5) ? A. 3,08 gam B. 4,48 gam C. 3,5 gam. D. 5,04 gam.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

N Ơ H

Câu 20. Để a gam Fe ở lâu ngoài không khí, sau một thời gian thu được hỗn hợp M chứa Fe, FeO, Fe2O3, Fe3O4 có khối lượng là b gam. Cho M tác dụng với HNO3, sau phản ứng thu được V lít hỗn hợp khí NO, N2, NO2 có tỉ lệ thể tích lần lượt là 3 : 2 : 1. Biểu thức quan hệ của a với các đại lượng còn lại là: 7b 28V + A. a = 10 22, 4

UY

8b 28V + B. a = 10 22, 4 C. a =

7b 26V + 10 22, 4

8b 26V + 10 22, 4 Câu 21. Hòa tan hết 15,2 gam hỗn hợp gồm Fe và Cu bằng dung dịch HNO3 thu được dung dịch X và 4,48 lit khí NO (đktc). Thêm từ từ 3,96 gam kim loại Mg vào hỗn hợp X đến khi phản ứng xảy ra hoàn toàn thu được 224 ml khí NO (đktc), dung dịch Y và m gam chất rắn không tan. Biết NO là sản phẩm khử duy nhất của N+5. Giá trị của m là A. 6,4. B. 9,6. C. 12,4. D. 15,2. Câu 22. Hòa tan hoàn toàn 20,88 gam một oxit sắt bằng dung dịch H2SO4 đặc, nóng thu được dung dịch X và 3,248 lít khí SO2 (sản phẩm khử duy nhất, ở đktc). Cô cạn dung dịch X, thu được m gam muối sunfat khan. Giá trị của m là A. 52,2. B. 54,0. C. 58,0. D. 48,4. Câu 23. Hoà tan hoàn toàn 12,15 gam Al bằng dung dịch HNO3 loãng (dư), thu được dung dịch X và 1,344 lít (ở đktc) hỗn hợp khí Y gồm hai khí là N2O và N2. Tỉ khối của hỗn hợp khí Y so với khí H2 là 18. Cô cạn dung dịch X, thu được m gam chất rắn khan. Giá trị của m là A. 106,65 B. 45,63 C. 95,85 D. 103,95 Câu 24. Cho m gam hỗn hợp X gồm Mg, Al, Zn và Cu tác dụng hết với dung dịch HNO3 thu được dung dịch Y (không có muối amoni) và 11,2 lít (đktc) hỗn hợp khí Z gồm N2, NO, N2O và NO2 (trong đó N2 và NO2 có phần trăm thể tích bằng nhau) có tỉ khối đối với heli bằng 8,9. Số mol HNO3 phản ứng là A. 3,4 mol. B. 3,0 mol. C. 2,8 mol. D. 3,2 mol. Câu 25. Cho 9,55 gam hỗn hợp gồm Mg, Al và Zn tác dụng vừa đủ với 870 ml dung dịch HNO3 1M, thu được dung dịch chứa m gam muối và 0,06 mol hỗn hợp khí N2 và N2O. Tỉ khối của hỗn hợp khí so với H2 là 20,667. Giá trị của m là A. 54,95 D. a =

0 00

1 3 +

O Ạ Đ

.Q P T

N

B

N Ầ TR

H

G N Ư

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 42,55 C. 40,55 D. 42,95 Câu 26. Cho 14,3 gam hỗn hợp X gồm Mg, Zn và Al hòa tan hết trong V lít dd HNO3 1M vừa đủ thu được 9,856 lít NO2 (đktc) và dd Z chứa 81,9 gam muối. Thể tích HNO3 cần dùng là A. 1,58 lít. B. 1,00 lít. C. 0,88 lít. D. 0,58 lít. Câu 27. Hòa tan hết 17,44 gam hỗn hợp gồm Fe, Fe3O4, Fe2O3, CuO, Cu, Mg, MgO (trong đó oxi chiếm 18,35% về khối lượng) trong dung dịch HNO3 loãng dư, kết thúc các phản ứng thu được dung dịch Y và 0,56 lít (đktc) hỗn hợp khí Z gồm N2 và N2O. Tỉ khối của Z so với H2 là 18,8. Cho dung dịch NaOH tới dư vào Y rồi đun nóng, không có khí thoát ra. Số mol HNO3 đã phản ứng với X là A. 0,67. B. 0,47. C. 0,57. D. 0,37. Câu 28. Hoà tan hết 12,8 gam hỗn hợp X gồm Cu2S và FeS2 trong dung dịch có chứa a mol HNO3 thu được 31,36 lít khí NO2 (ở đktc và là sản phẩm duy nhất của sự khử N+5) và dung dịch Y.Biết Y phản ứng tối đa với 4,48 gam Cu giải phóng khí NO.Tính a? A. 1,8 mol B. 1,44 mol C. 1,92 mol D. 1,42 mol Câu 29. Nung 20,8 gam hỗn hợp gồm Cu, Mg và Al trong oxi một thời gian thu được 21,52 gam chất rắn X. Hòa tan X trong V ml dung dịch HCl 0,5M vừa đủ thu được 0,672 lít khí H2 (ở đktc). Giá trị của V là A. 150. B. 400. C. 200. D. 300. Câu 30. Cho 45 gam hỗn hợp bột Fe và Fe3O4 vào V lít dung dịch HCl 1M, khuấy đều để các phản ứng xảy ra hoàn toàn, thấy thoát ra 4,48 lít khí (đktc) và 5 gam kim loại không tan. Giá trị của V là A. 1,2. B. 1,392. C. 0,4. D. 0,6. Câu 31. Hòa tan hoàn toàn 58 gam hỗn hợp X gồm Fe, Cu, Ag trong dung dịch HNO3 thu được 0,15 mol khí NO, 0,05 mol khí N2O và dung dịch Y (không tạo NH4+). Cô cạn dung dịch Y lượng muối khan thu được là A. 120,4 gam. B. 89,8 gam. C. 110,7 gam. D. 90,3 gam. Câu 32. Hòa tan hết 4,43 gam hỗn hợp Al và Mg trong HNO3 loãng thu được dung dịch X và 1,568 lít (đktc) hỗn hợp hai khí (đều không màu) có khối lượng 2,59 gam trong đó có một khí bị hóa thành màu nâu trong không khí. Số mol HNO3 đã phản ứng là (phản ứng không tạo NH4+)

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 0,51 mol B. 0,45 mol C. 0,55 mol D. 0,49 mol Câu 33. Cho 6,14 gam hỗn hợp X gồm Zn và Fe vào dung dịch HNO3 đặc nguội (dư) một thời gian, thấy thoát ra 1,344 lít khí NO2 (đktc, sản phẩm khử duy nhất của N+5), phần chất rắn còn lại cho tiếp vào dung dịch HCl dư thấy thoát ra 0,672 lít H2 (đktc). Vậy % khối lượng của Fe trong hỗn hợp X là A. 27,36. B. 72,64. C. 36,48. D. 37,67. Câu 34. Nung đến hoàn toàn 0,05 mol FeCO3 trong bình kín chứa 0,01 mol O2 thu được chất rắn X. Để hòa tan X bằng dung dịch HNO3 (đặc, nóng) thì số mol HNO3 tối thiểu là A. 0,14 B. 0,153 C. 0,16 D. 0,18 Câu 35. Cho x mol Fe tan hoàn toàn trong dung dịch chứa y mol H2SO4 (tỉ lệ mol x : y = 2 : 5), thu được một sản phẩm khử duy nhất. Khối lượng muối sắt sunfat tạo thành trong dung dịch là A. 70,4y gam. B. 152,0x gam. C. 40,0y gam. D. 200,0x gam. Câu 36. Hỗn hợp X gồm 7,2 gam Mg, 5,4 gam Al và 6,5 gam Zn. Hoà tan hoàn toàn X trong dung dịch HNO3 dư, thu được 1,344 lít khí N2 duy nhất (đo ở đktc). Số mol HNO3 đã tham gia phản ứng là A. 0,72 mol. B. 1,52 mol. C. 1,62 mol. D. 1,72 mol. Câu 37. Cho 9,55 gam hỗn hợp gồm Mg, Al và Zn tác dụng vừa đủ với 870 ml dung dịch HNO3 1M, thu được dung dịch chứa m gam muối và 0,06 mol hỗn hợp khí X gồm N2 và N2O, tỉ khối của X so với H2 bằng 20,667. Giá trị của m gần nhất với A. 55,0 B. 54,5 C. 55,5 D. 54,0 Câu 38. Cho 7,1 gam hỗn hợp gồm một kim loại kiềm X và một loại kim loại kiềm thổ Y tác dụng hết với lượng dư dung dịch HCl loãng, thu được 5,6 lít khí (đktc). Kim loại X, Y là A. liti và beri. B. kali và bari. C. kali và canxi. D. natri và magie. Câu 39. Hòa tan hết 2,72 gam hỗn hợp X gồm FeS2, FeS, Fe, CuS và Cu trong 440 ml dung dịch HNO3 1M, sau khi kết thúc các phản ứng thu được dung dịch Y và 0,07 mol một chất khí thoát ra. Cho Y tác dụng với

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

lượng dư dung dịch BaCl2 thu được 4,66 gam kết tủa. Mặt khác, dung dịch Y có thể hòa tan tối đa m gam Cu. Biết trong các quá trình trên, sản phẩm khử duy nhất của N+5 là NO. Giá trị m là A. 6,52 B. 8,32 C. 7,68 D. 2,64 Câu 40. Hòa tan hết m gam hỗn hợp X gồm Zn, Fe và FeCO3 trong dung dịch HCl loãng dư thu được 2,912 lít hỗn hợp khí Y (đktc). Mặt khác cho cùng lượng X trên phản ứng với dung dịch HNO3 đặc đun nóng, kết thúc phản ứng thu được dung dịch Z, hỗn hợp khí T có thể tích 3,808 lít (đktc) và còn lại 1,4 gam một kim loại không tan. Biết rằng NO2 là sản phẩm khử duy nhất của N+5 và khi cô cạn Z thu được 19,08 gam muối khan. Giá trị của m gần nhất với A. 8,5. B. 9,0. C. 9,5. D. 10,0.

UY

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: C Đặt

Bảo toàn e:

Câu 2: B Quy hỗn hợp X gồm Cu : x mol và O : y mol

D I BỒ

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 4: A

mặt khác:

Ta có hệ

N Ơ H

Do thu được hỗn hợp bột kim loại nên Fe còn dư, sản phẩm phản ứng của Fe là

ƯỠ →

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2+

31

0,2 ------------------------> 0,15 Ta thấy, trong phản ứng với H+ và NO3- thì Fe dư, nên chỉ lên số oxi hóa +2. Sau phản ứng này, Fe còn dư 0,025 mol sẽ phản ứng với Cu.

Câu 5: B 2 khí không màu và không hóa nâu trong không khí là

Từ (1), (2)

T

→ m = 0,5. 64 = 32 gam. Câu 3: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

(Có thể dùng công thức nhanh đối với bài kim loại tác dụng với

)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Quy đổi thành FeO, Fe2O3 Cho phần thứ nhất tác dụng hết với dung dịch HCl dư được 155,4 gam muối khan Câu 6: C

UY

.Q P T

N

Phần thứ hai tác dụng vừa đủ với dung dịch M là hỗn hợp HCl, H2SO4 loãng thu được 167,9 gam muối khan Ta có

(1)

Mặt khác bảo toàn điện tích ta có

Sau phản ứng còn kim loại nên trong dung dịch có muối

ta giải ra

=>quá trình (1) xảy ra hoàn toàn. Số mol e nhận

, trong dd sau phản ứng có H+ dư 0,08 mol.

Cho NaOH vào để đạt kết tủa lớn nhất, thì NaOH vừa đủ để phản ứng với H+ và kết tủa hết các ion Fe2+ và Cu2+.

Câu 7: B

vậy dung dịch Y còn có muối vậy chất khí là

N Á O

H Í

-L

Câu 8: A m gam Al + V lít ddX gồm HCl 1M và H2SO4 → ddX tăng (m - 1,08) gam. ↑

Ỡ Ư D

NG

T

ddX tăng (m - 1,08) gam → mH2 = 1,08 gam → nH2 = 1,08 : 2 = 0,54 mol.

I Ồ B

→ V = 0,54 lít Câu 9: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 10: C Cu dư nên trong dung dịch có CuCl2 và FeCl2 x mol Fe2O3 --> 2x mol FeCl3 Cu + 2FeCl3 --> CuCl2 + 2FeCl2 x______2x => 160x+64x=7,68-3,2=4,48 =>x=0,02 mol mFe2O3=0,02.160=3,2 gam

0 00

Nhận thấy số mol e nhận luôn bằng số mol OH- cần dùng để kết tủa các ion

ÓA

P Ấ C

2

1 3 +

G N Ư

O Ạ Đ

B

N Ầ TR

H

Câu 11: B Ta thấy rõ

Mà ta có vậy

bảo toàn khối lượng ta có

Câu 12: D Câu 13: C Câu 14: B mà Y có 2 khí không màu,1 khí hóa nâu trong không khí là NO, nên khí còn lại là Giải hệ ta được

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Bảo toàn electron cho toàn bộ quá trình → 3nFe = 2nO + 3nNO + 10nN2 + nNO2

→ 3.

= 2.

→a=

+

+ 3.

+ 10.

+

UY

%

%

Câu 15: D Ta thấy, số mol chất khử nhường = số mol chất oxi hóa nhận:

Câu 21: A

Như vậy số mol e do Fe nhường là y mol Câu 16: B Câu 17: D Có mmuối = mkl+ mNO3- = 8,4 + 62. 3. 0,12 = 30,72 gam.

G N Ư

O Ạ Đ

.Q P T

0,2 mol NO + dd X

15,2 gam chất rắn

H

N

Mg(NO3)2 + 0,01 mol NO +

Khi cho Mg vào dung dịch X sinh ra khí → chứng tỏ dd X chứa HNO3 dư Câu 18: D Bảo toàn electron → 3nNO = nFe3O4 + nFeO + 3nFe → nNO = 0,2 mol

N Ầ TR

Ta có hệ Vì HNO3 dư nên hình thành Fe(NO3)3

0 00

B

Thứ tự Mg phản ứng trong dung dịch X là HNO3, Fe3+, Cu2+, Fe2+

Bảo toàn nguyên tố sắt → n Fe(NO3)3 = 0,1. 2+ 0,1. 3 + 0,2+ 0,1= 0,8 mol Bảo toàn nguyên tố N → nHNO3 = 3n Fe(NO3)3+ nNO = 2,6 mol

Câu 19: A Có

=

=

:

= 1:1

→ Có thể coi hỗn hợp X chỉ chứa Fe3O4 : 0,01 mol 0,01 mol Fe3O4 + 0,2 mol HNO3 → NO + dd Y

Í-

-L

A Ó H

P Ấ C

N Á O

Có nO =

mol

I Ồ B

Ỡ Ư D

NG

Sưu tầm bởi GV. Nguyễn Thanh Tú

→ mCu = 6,4 gam. Câu 22: C 20,88 g oxit sắt + H2SO4 đặc, nóng → ddX + 0,145 mol SO2↑. Cô cạn ddX thu được m gam muối.

Theo BTKL m = 20,88 + 0,58 x 98 - 0,145 x 64 - 0,58 x 18 = 58,0 gam Câu 23: D

T

V lít hỗn hợp khí NO, N2, NO2 có tỉ lệ thể tích lần lượt là 3 : 2 : 1 → NO :

= 0,1 mol

→ ∑nH2SO4 = 0,145 x 3 + 0,145 = 0,58 mol → nH2O = 0,58 mol.

Bảo toàn electron có 3nNO + 2nFe3O4 = 2nFe → nFe = 0,055 mol → m = 3,08 gam Câu 20: A

→ Vậy chất rắn sinh ra chỉ chứa Cu là :

• Oxit sắt là FeO hoặc Fe3O4 → nFe2(SO4)3 = nSO2 = 0,145 mol.

dung dịch Z : Fe(NO3)2 : 0,03 + x mol

Luôn có nHNO3 = 4nNO + 8nFe3O4 → nNO = 0,03 mol

2

1 3 +

Thấy 2nMg= 0,33 < 3nNO+ nFe3+ + 2nCu2+

Ta có hệ: Kiểm tra xem sản phẩm khử có NH4NO3 hay không?

lít, N2 :

lít, NO2

lít

Nếu có tạo thành NH4NO3 thì:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Khi cô cạn thì chất rắn thu được là 0,45 mol Al(NO3)3 và 0,10125 mol NH4NO3.

Câu 24: D vì

UY

Mặt khác: nên coi như hỗn hợp Z chỉ gồm

bảo toàn e: Bảo toàn N:

Ta có: Giải hệ:

Nhận xét, số mol e chất khử nhường sẽ bằng với số mol NO3- tạo muối.

0 00

Đặt số mol NH4NO3 tạo thành là x. Số mol e nhường nhận là: Bảo toàn N: số mol NO3- tạo muối với kim loại là: Bảo toàn e: Khối lượng muối: Câu 26: A Giả sử số mol muối NH4NO3 tạo thành là x.

Khối lượng muối thu được:

G N Ỡ

TO

ÁN

Câu 27: A

Sưu tầm bởi GV. Nguyễn Thanh Tú

B

N Ầ TR

H

Quy đổi hỗn hợp về Cu, Fe và S.

Lưu ý là trong đề bài có Mg và Al thường sẽ có NH4NO3.

I Ồ B

G N Ư

Câu 28: B Ta có, Cu2S nhường 10 e, FeS2 nhường 15 e.

Câu 25: A

O Ạ Đ

.Q P T

N

-

A Ó H

P Ấ C

2

1 3 +

Xét trong toàn bộ quá trình thì (0,04+0,07 mol)Cu, 0,08 mol Fe (chỉ tạo Fe 2+) và 0,18 mol S nhận e, còn 1,4 mol NO2 và NO là nhận e

Số mol NO3- tạo muối là:

Câu 29: D

20,8 gam

+ O2 → 21,52 gam X

muối + H2O + H2

Bảo toàn khối lượng có mO2 = 21,52 - 20,8 = 0,72 gam → nO2 = 0,0225 mol Bảo toàn nguyên tố O → nH2O = 2nO2 = 0,045 mol Bỏ toàn nguyên tố H → nHCl = 2nH2 + 2nH2O = 0,15 mol → V= 0,3 lít Câu 30: A Câu 31: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Luôn có mmuối = mkl + mNO3- = mkl + 62.∑ne trao đổi

Câu 35: A Chọn

UY

Câu 32: D Có MX =

= 37 Câu 36: D

Khí không màu hóa nâu trong không khí là NO : x mol có 30 < MX = 37 < 44 → khí không màu còn lại là N2O : y mol

Bảo toàn e có →

Ta có

Có nHNO3 pứ = 4nNO + 10nN2O = 4. 0,035 + 10. 0,035 = 0,49 mol Câu 33: C Fe bị thụ động khi tác dụng với phản ứng

đặc nguội và sau đó lấy ra cũng không tác dụng với HCl nên chỉ có Zn

0 00

%

Câu 34: C Nung 0,05 mol FeCO3 và 0,01 O2 → chất rắn X. X + HNO3.

Í -L

• Bản chất của phản ứng là các quá trình nhường, nhận electron:

N Á O

Fe2+ → Fe3+ + 1e O02 + 4e → 2O-2 N+5 + 1e → N+4

ƯỠ

→ Giả sử số mol của NO2 là x

D I BỒ

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 37: A

bảo toàn e, ta có:

%

B

N Ơ H

tạo ra 2 muối

→ mmuối = 58 + 62.( 0,15.3 + 8. 0,05) = 110,7 gam

NG

T

→ Theo bảo toàn electron: 1 × 0,05 = 0,01 × 4 + 1 × x → x = 0,01 mol.

-

A Ó H

P Ấ C

2

1 3 +

Câu 38: D

Ta có:

Thử các cặp ở các đáp án vào thì chỉ có D thỏa mãn

Câu 39: B Coi hỗn hợp ban đầu gồm Fe :x mol, S, Cu: y mol

∑nHNO3 = 3 × nFe(NO3)3 + 1 × nNO2 = 3 × 0,05 + 0,01 = 0,16 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta có nNO = 0,07 mol, nS = nBaSO4 = 0,02 mol NO3- + 3e + 4H+ → NO + 2H2O

UY

S + 4H2O → SO42- + 6e + 8H+ Vì 4nNO -8nS < mHNO3 = 0,44 mol → Dung dịch Y chứa HNO3dư : 0,44- 0,12= 0,32 mol, Fe3+, Cu2+ Bảo toàn electron: 3x + 2y = 0,07.3- 0,02.6 =0,09 Lại có : mCu + mFe = 2,72-0,02.32 → 56x+ 64y = 2,08 Giải hệ 2pt: → x= 0,02, y = 0,015 Vậy dung dịch Y chứa: HNO3 dư: 0,32 mol, Fe3+: 0,02 mol, Cu2+ : 0,015 mol, SO42-, NO3-

Khối lượng Cu tối đa có thể bị hòa tan là : mCu = 64. ( ×nHNO3dư + ×nFe3+) = 64. 0,13= 8,32 gam. Câu 40: D Gọi số mol Zn, Fe, FeCO3 lần lượt là x, y, z mol

0 00

Cho X phản ứng với HCl dư → khí sinh ra gồm H2 và CO2 → x+y + z= 0,13 Cho X phản ứng HNO3 sinh ra 0,17 mol (NO2 và z mol CO2) và còn dư 1,4 gam kim loại Fe ( 0,025 mol) muối sinh ra gồm Fe(NO3)2 : y+ z- 0,025 mol và Zn(NO3)2 : x mol Bảo toàn electron → nNO2 = 2x + 2. ( y- 0,025)

Ta có hệ → m= 0,02. 65 + 0,07. 56 + 0,04. 116 = 9,86 gam.

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 1. Trộn 5,6 gam bột sắt với 2,4 gam bột lưu huỳnh rồi nung nóng (trong điều kiện không có không khí), thu được hỗn hợp rắn M. Cho M tác dụng với lượng dư dung dịch HCl, giải phóng hỗn hợp khí X và còn lại một phần không tan G. Để đốt cháy hoàn toàn X và G cần vừa đủ V lít khí O2 (ở đktc). Giá trị của V là A. 4.48 B. 3,36 C. 2.8 D. 3.08 Câu 2. Cho 15 gam hỗn hợp X gồm Cu và Al tác dụng vừa đủ với hỗn hợp Y gồm O2 và Cl2 (có số mol bằng nhau) được 30,45 gam hỗn hợp Z gồm oxit và muối. Nếu cho X tác dụng với dung dịch HCl dư thì thu được V lít khí H2 (đktc). Giá trị của V là A. 10,08 lít B. 7,84 lít C. 4,48 lít D. 6,72 lít Câu 3. Cho 2,13 gam hỗn hợp X gồm ba kim loại Mg, Cu và Al ở dạng bột tác dụng hoàn toàn với oxi thu được hỗn hợp Y gồm các oxit có khối lượng 3,33 gam. Thể tích dung dịch HCl 2M vừa đủ để phản ứng hết với Y là A. 57 ml. B. 50 ml. C. 75 ml. D. 90 ml. Câu 4. Cho 40 gam hỗn hợp X gồm Au, Ag, Fe, Zn tác dụng với oxi dư nung nóng thu được 46,4 gam chất rắn Y. Thể tích dung dịch H2SO4 20% (d = 1,14 g/ml) có khả năng phản ứng với chất rắn Y là A. 257,95 ml B. 85,96 ml C. 334,86 ml D. 171,93 ml Câu 5. Cho 2,13 gam hỗn hợp X gồm Mg, Al, Cu, Fe ở dạng bột tác dụng hoàn toàn với oxi thu được hỗn hợp Y gồm các oxit có khối lượng 3,33 gam. Thể tích dung dịch hỗn hợp HCl 1M và H2SO4 2M vừa đủ để phản ứng hết với Y là A. 15 ml B. 30 ml C. 45 ml D. 50 ml Câu 6. Hỗn hợp khí X gồm clo và oxi. X phản ứng vừa hết với một hỗn hợp gồm 4,8 gam Mg và 8,1 gam Al tạo ra 37,05 gam hỗn hợp các muối và oxit của hai kim loại. Tỉ lệ về thể tích giữa khí clo và oxi trong X tương ứng là A. 1:1 B. 4:5 C. 3:5 D. 5:4

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

N Ơ H

Câu 7. Oxi hóa hoàn toàn m gam kim loại X cần vừa đủ 0,25m gam khí O2. X là kim loại nào sau đây? A. Al B. Fe C. Cu D. Ca Câu 8. Hòa tan hoàn toàn 0,1 mol FeS2 trong 200 ml dung dịch HNO3 4M, sản phẩm thu được gồm dung dịch X và một chất khí thoát ra. Dung dịch X có thể hòa tan tối đa m gam Cu. Biết trong các quá trình trên, sản phẩm khử duy nhất của N+5 đều là NO. Giá trị của m là A. 12,8. B. 6,4. C. 9,6. D. 3,2. Câu 9. Cho 0,15 mol FeS2 vào 3 lít dung dịch HNO3 0,6M, đun nóng và khuấy đều để các phản ứng hoàn toàn thu được dung dịch X. Khối lượng Cu tối đa có thể tan trong X là (biết trong các phản ứng trên, NO là sản phẩm khử duy nhất của NO3− )

25. Các dạng bài tập về phản ứng của kim loại với phi kim (Đề 1)

UY

H

A. 33,60 gam. B. 28,80 gam. C. 4,80 gam. D. 2,88 gam. Câu 10. Cho 0,3 mol FeS2 vào 2 lít dung dịch HNO3 1,0M, đun nóng và khuấy đều để các phản ứng hoàn toàn thu được dung dịch X. Khối lượng Cu tối đa có thể tan trong X là (biết trong các phản ứng trên, NO là sản phẩm khử duy nhất của NO3− )

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N

B

A. 9,6 gam. B. 19,2 gam. C. 28,8 gam. D. 38,4 gam. Câu 11. Cho m gam hỗn hợp X gồm Mg, Fe, Zn ở dạng bột tác dụng hoàn toàn với oxi thu được 2,81 gam hỗn hợp Y gồm các oxit. Hòa tan hoàn toàn lượng Y ở trên vào axit H2SO4 loãng (vừa đủ). Sau phản ứng, cô cạn dd thu được 6,81 gam hỗn hợp muối sunfat khan. Giá trị của m là A. 1,21. B. 1,81. C. 2,01. D. 6,03. Câu 12. Nung m gam hỗn hợp bột Fe và S trong bình kín không có không khí. Sau phản ứng đem phần rắn thu được hòa tan vào lượng dư dung dịch HCl được 3,8 gam chất rắn X không tan, dung dịch Y và 0,2 mol khí Z. Dẫn Z qua dung dịch Cu(NO3)2 dư, thu được 9,6 gam kết tủa đen. Giá trị của m là A. 11,2 B. 15,6 C. 18,2 D. 18,4 Câu 13. Nung nóng hỗn hợp 5,6 gam bột Fe với 4 gam bột S trong bình kín (không có không khí) một thời gian thu được hỗn hợp X gồm FeS, FeS2, Fe và S dư. Cho X tan hết trong axit H2SO4 đặc nóng dư được V lít khí SO2. Giá trị của V là A. 3,36.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 8,96. C. 11,65. D. 11,76. Câu 14. Oxi hóa hoàn toàn 14,30 gam hỗn hợp bột các kim loại Mg, Al, Zn bằng oxi dư thu được 22,3 gam hỗn hợp oxit. Cho lượng oxit này tác dụng hết với dung dịch HCl thì lượng muối tạo ra là: A. 48,90 gam. B. 36,60 gam. C. 32,050 gam. D. 49,80 gam. Câu 15. Cho dung dịch HCl đặc, dư tác dụng với 6,96 gam MnO2. Lượng khí clo sinh ra oxi hóa hoàn toàn kim loại M, tạo ra 7,6 gam muối. Kim loại M là A. Mg B. Fe C. Al D. Cu Câu 16. Đốt cháy hoàn toàn 7,2 gam kim loại M (có hoá trị hai không đổi trong hợp chất) trong hỗn hợp khí Cl2 và O2. Sau phản ứng thu được 23,0 gam chất rắn và thể tích hỗn hợp khí đã phản ứng là 5,6 lít (ở đktc). Kim loại M là A. Mg. B. Ca. C. Be. D. Cu. Câu 17. Trộn bột lưu huỳnh với bột một kim loại M (hóa trị 2) được 25,9 gam hỗn hợp X. Cho X vào bình kín không chứa không khí, đốt nóng để phản ứng xảy hoàn toàn được chất rắn Y. Biết Y tan hoàn toàn trong dung dịch HCl dư cho 0,3 mol khí Z có d Z/ H2 = 11,67 . Kim loại M là

P Ấ C

2

A. Fe B. Zn C. Pb D. Mg Câu 18. Cho 7,84 lít hỗn hợp khí X (đktc) gồm Cl2 và O2 phản ứng vừa đủ với 11,1 gam hỗn hợp Y gồm Mg và Al, thu được 30,1 gam hỗn hợp Z. Phần trăm khối lượng của Al trong Y là A. 75,68% B. 24,32% C. 51,35% D. 48,65% Câu 19. Đốt cháy 11,9 gam hỗn hợp gồm Zn, Al trong khí Cl2 dư. Sau khi các phản ứng xảy ra hoàn toàn, thu được 40,3 gam hỗn hợp muối. Thể tích khí Cl2 (đktc) đã phản ứng là A. 8,96 lít. B. 6,72 lít. C. 17,92 lít. D. 11,2 lít. Câu 20. Đốt cháy hoàn toàn 17,4 gam hỗn hợp Mg và Al trong khí oxi (dư) thu được 30,2 gam hỗn hợp oxit. Thể tích khí oxi (đktc) đã tham gia phản ứng là: A. 17,92 lít B. 4,48 lít

Ư D I Ồ B

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

N Ơ H

C. 11,20 lít D. 8,96 lít

UY

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: C Câu 2: D Ta có: Trong Y có Đặt →

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Mặt khác khi cho tác dụng với HCl chỉ có Al phản ứng

1 3 +

0 00

Câu 3: C Câu 4: D Câu 5: B Câu 6: D Câu 7: C

Câu 8: A 0,1 mol FeS2 + 0,8 mol HNO3 → dd X + ↑NO x mol. ddX + tối đa m gam Cu y mol. • Bản chất của phản ứng là quá trình nhường, nhận electron: FeS2 → Fe+2 + 2S+6 + 14e Cu → Cu+2 + 2e

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N+5O3- + 4H+ + 3e → N+2O + 2H2O

Câu 11: C Câu 12: C Câu 13: D Câu 14: D Câu 15: A Câu 16: A Gọi số mol của Cl2 và O2 lần lượt là x, y mol.

Theo bảo bảo electron: 14 × nFeS2 + 2 × nCu = 3 × nNO → 14 × 0,1 + 2y = 3x (*) • Sau phản ứng trong dung dịch có Fe+2; Cu+2; NO3-; SO4-2 Theo bảo toàn điện tích 2 × nFe+2 + 2 × nCu+2 = 1 × nNO3- + nSO4-2 → 2 × 0,1 + 2y = 3x + 0,1 × 2 (**) Từ (*) và (**) → x = 0,6; y = 0,2 → mCu = 0,2 × 64 = 12,8 gam Câu 9: A 0,15 mol FeS2 + 1,8 mol HNO3 → ddX

Ta có hệ

G N Ư

PTPU: 2M + O2 → 2MO , M + Cl2 → MCl2 Cu + ddX

3Cu + 8H+ + 2NO3- → 3Cu2+ + 2NO + 4H2O

0 00

0,45---1,2-----------0,3 Cu + 2Fe3+ → Cu2+ + 2Fe+2 0,075--0,15 → nCu = 0,45 + 0,075 = 0,525 mol → mCu = 0,525 x 64 = 33,6 gam Câu 10: C 0,3 mol FeS2 + 2,0 mol HNO3 → ddX

Í-

Cu + ddX • FeS2 + 4H+ + 5NO3- → Fe3+ + 2SO42- + 5NO + 2H2O

N Á O

0,3------1,2------1,5------0,3

Ỡ Ư D

Cu + 2Fe3+ → Cu2+ + 2Fe+2

I Ồ B

0,15--0,3

NG

N Ầ TR

H

→ M = 7,2 : 0, 3= 24 ( Mg). Câu 17: B Câu 18: B Gọi số mol của Cl2 và O2 lần lượt là x, y

0,15------0,6------0,75------0,15

0,3---0,8-----------0,2

O Ạ Đ

.Q P T

N

→ nM = nCl2 + 2. nO2 = 0,2 + 2. 0,05 = 0,3 mol

• FeS2 + 4H+ + 5NO3- → Fe3+ + 2SO42- + 5NO + 2H2O

T

3Cu + 8H+ + 2NO3- → 3Cu2+ + 2NO + 4H2O

UY

N Ơ H

-L

A Ó H

P Ấ C

2+

31

B

Ta có hệ

Gọi số mol của Mg và Al lần lượt là a, b

Ta có hệ

. 100% = 24,32%. %mAl = Câu 19: A Theo BTKL: mCl2 = 40,3 - 11,9 = 28,4 gam → nCl2 = 28,4 : 71 = 0,4 mol. → VCl2 = 0,4 x 22,4 = 8,96 lít Câu 20: D

→ nCu = 0,3 + 0,15 = 0,45 mol → mCu = 0,45 x 64 = 28,8 gam

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

1. Anđehit – Axit cacboxylic (Đề 1) Câu 1. Cho m gam hỗn hợp M gồm hai axit X, Y (Y nhiều hơn X một nhóm -COOH) phản ứng hết với dung dịch NaOH tạo ra (m + 8,8) gam muối. Nếu cho toàn bộ lượng M trên tác dụng với lượng dư dung dịch AgNO3 trong NH3, sau phản ứng kết thúc thu được 43,2 gam Ag và 13,8 gam muối amoni của axit hữu cơ. Công thức của Y và giá trị của m lần lượt là : A. HOCO-COOH và 18,1 B. HOCO-CH2-COOH và 30,0 C. HOCO-CH2-COOH và 19,6 D. HOCO-COOH và 27,2 Câu 2. Đốt cháy hoàn toàn một anđehit X, thu được số mol CO2 bằng số mol H2O. Nếu cho X tác dụng với lượng dư AgNO3 trong dung dịch NH3, sinh ra số mol Ag gấp bốn lần số mol X đã phản ứng. Công thức của X là A. HCHO B. CH3CHO C. (CHO)2 D. C2H5CHO Câu 3. Cho 0,1 mol hỗn hợp X gồm hai anđehit no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng tác dụng với lượng dư dung dịch AgNO3 trong NH3, đun nóng thu được 32,4 gam Ag. Hai anđehit trong X là A. HCHO và C2H5CHO B. HCHO và CH3CHO C. C2H3CHO và C3H5CHO D. CH3CHO và C2H5CHO Câu 4. Oxi hoá 1,2 gam CH3OH bằng CuO nung nóng, sau một thời gian thu được hỗn hợp sản phẩm X (gồm HCHO, H2O và CH3OH dư). Cho toàn bộ X tác dụng với lượng dư dung dịch AgNO3 trong NH3, được 12,96 gam Ag. Hiệu suất của phản ứng oxi hoá CH3OH là A. 65,5%. B. 80,0%. C. 76,6%. D. 70,4%. Câu 5. Cho m gam hỗn hợp etanal và propanal phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, thu được 43,2 gam kết tủa và dung dịch chứa 17,5 gam muối amoni của hai axit hữu cơ. Giá trị của m là A. 9,5 B. 10,9 C. 14,3 D. 10,2 Câu 6. X là hỗn hợp chỉ chứa axit cacboxylic no, mạch hở. Đốt cháy hoàn toàn 0,3 mol hỗn hợp X, thu được 11,2 lít khí CO2 (ở đktc). Nếu trung hòa 0,6 mol X thì cần dùng 400 ml dung dịch NaOH 2,5M. Số chất tối đa có trong X là A. 2 B. 3 C. 4 D. 5 Câu 7. Hỗn hợp X gồm axit Y đơn chức và axit Z hai chức (Y, Z có cùng số nguyên tử cacbon). Chia X thành hai phần bằng nhau. Cho phần một tác dụng hết với Na, sinh ra 4,48 lít khí H2 (ở đktc). Đốt cháy hoàn toàn phần hai, sinh ra 26,4 gam CO2. Công thức cấu tạo thu gọn và phần trăm về khối lượng của Z trong hỗn hợp X lần lượt là A. HOOC- CH2-COOH và 70,87%. B. HOOC-CH2-COOH và 54,88%. C. HOOC-COOH và 60,00%.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. HOOC-COOH và 42,86%. Câu 8. Cho 4,6 gam một ancol no, đơn chức phản ứng với CuO nung nóng, thu được 6,2 gam hỗn hợp X gồm anđehit, nước và ancol dư. Cho toàn bộ lượng hỗn hợp X phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, đun nóng, thu được m gam Ag. Giá trị của m là A. 16,2 B. 43,2 C. 10,8 D. 21,6 Câu 9. Cho 13,6 gam một chất hữu cơ X ( có thành phần nguyên tố C, H, O ) tác dụng vừa đủ với dung dịch chứa 0,6 mol AgNO3 trong NH3, đun nóng, thu được 43,2 gam Ag. Công thức cấu tạo của X là A. CH≡C-CH2-CHO B. CH2=C=CH-CHO C. CH3-C≡C-CHO D. CH≡C-[CH2]2-CHO. Câu 10. Oxi hóa m gam ancol đơn chức X, thu được hỗn hợp Y gồm axit cacboxylic, nước và ancol dư. Chia Y làm hai phần bằng nhau. Phần một phản ứng hoàn toàn với dung dịch KHCO3 dư, thu được 2,24 lít khí CO2 (đktc). Phần hai phản ứng với Na vừa đủ, thu được 3,36 lít khí H2 (đktc) và 19 gam chất rắn khan. Tên của X là A. Propan-1-ol. B. Propan-2-ol. C. Etanol. D. Metanol. Câu 11. Oxi hoá hết 2,2 gam hỗn hợp hai ancol đơn chức thành anđehit cần vừa đủ 4,8 gam CuO. Cho toàn bộ lượng anđehit trên tác dụng với lượng dư dung dịch AgNO3 trong NH3, thu được 23,76 gam Ag. Hai ancol là: A. CH3OH, C2H5CH2OH. B. CH3OH, C2H5OH. C. C2H5OH, C3H7OH. D. C2H5OH, C2H5CH2OH. Câu 12. Cho m gam hỗn hợp X gồm hai rượu (ancol) no, đơn chức, kế tiếp nhau trong dãy đồng đẳng tác dụng với CuO (dư) nung nóng, thu được một hỗn hợp rắn Z và một hỗn hợp hơi Y (có tỉ khối hơi so với H2 là 13,75). Cho toàn bộ Y phản ứng với một lượng dư dung dịch AgNO3 trong NH3 đun nóng, sinh ra 64,8 gam Ag. Giá trị của m là A. 9,2. B. 7,8. C. 7,4. D. 8,8. Câu 13. Cho 5,76 gam axit hữu cơ X đơn chức, mạch hở tác dụng hết với CaCO3 thu được 7,28 gam muối của axit hữu cơ. Công thức cấu tạo thu gọn của X là A. CH2=CH-COOH. B. HC≡C-COOH. C. CH3-CH2-COOH. D. CH3COOH. Câu 14. Hỗn hợp X gồm hai ancol no, đơn chức, mạch hở, kế tiếp nhau trong dãy đồng đẳng. Oxi hoá hoàn toàn 0,2 mol hỗn hợp X có khối lượng m gam bằng CuO ở nhiệt độ thích hợp, thu được hỗn hợp sản phẩm hữu cơ Y. Cho Y tác dụng với một lượng dư dung dịch AgNO3 trong NH3, thu được 54 gam Ag. Giá trị của m là A. 15,3. B. 13,5. C. 8,1.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 8,5. Câu 15. Cho hỗn hợp gồm 0,05 mol HCHO và 0,02 mol HCOOH vào lượng dư dung dịch AGNO3 trong NH3, đun nóng. Sau khi các phản ứng xảy ra hoàn toàn, thu được m gam Ag. Giá trị của m là A. 30,24 B. 21,60 C. 15,12 D. 25,92 Câu 16. Cho 0,1 mol anđehit X tác dụng với lượng dư AgNO3 trong dung dịch NH3, đun nóng thu được 43,2 gam Ag. Hiđro hoá X thu được Y, biết 0,1 mol Y phản ứng vừa đủ với 4,6 gam Na. Công thức cấu tạo thu gọn của X là A. HCHO. B. CH3CH(OH)CHO. C. OHC-CHO. D. CH3CHO. Câu 17. Trung hoà 5,48 gam hỗn hợp gồm axit axetic, phenol và axit benzoic, cần dùng 600 ml dung dịch NaOH 0,1M. Cô cạn dung dịch sau phản ứng, thu được hỗn hợp chất rắn khan có khối lượng là A. 4,90 gam. B. 6,84 gam. C. 8,64 gam. D. 6,80 gam. Câu 18. Cho 3,6 gam axit cacboxylic no, đơn chức X tác dụng hoàn toàn với 500 ml dung dịch gồm KOH 0,12M và NaOH 0,12M. Cô cạn dung dịch thu được 8,28 gam hỗn hợp chất rắn khan. Công thức phân tử của X là A. C2H5COOH. B. HCOOH. C. CH3COOH. D. C3H7COOH. Câu 19. Chia m gam ancol X thành hai phần bằng nhau: - Phần một phản ứng hết với 8,05 gam Na, thu được a gam chất rắn và 1,68 lít khí H2 (đktc). - Phần hai phản ứng với CuO dư, đun nóng, thu được chất hữu cơ Y. Cho Y phản ứng với lượng dư dung dịch AgNO3 trong NH3, thu được 64,8 gam Ag. Biết các phản ứng xảy ra hoàn toàn. Giá trị của a là A. 8,25. B. 18,90. C. 8,10. D. 12,70. Câu 20. Đốt cháy hoàn toàn a mol một anđehit X (mạch hở) tạo ra b mol CO2 và c mol H2O (biết b = a + c). Trong phản ứng tráng gương, một phân tử X chỉ cho 2 electron. X thuộc dãy đồng đẳng anđehit A. không no có một nối đôi C=C, đơn chức. B. no, đơn chức. C. không no có hai nối đôi C=C, đơn chức. D. no, hai chức.

Ư D I Ồ B

G N Ỡ

N Á O

T

-L

Í-

A Ó H

P Ấ C

M là hỗn hợp của 2 axit mà tác dụng với dd AgNO3/NH3 thu được Ag => M có axit HCOOH Mặt khác: Y nhiều hơn X một nhóm -COOH => X là HCOOH;Y:R(COOH)2 nHCOOH=1/2nAg=0,2mol Ta có:m gam M + NaOH -->(m+8,8) Muối Theo tăng giảm khối lượng thì:nX+2nY=8,8/22=0,4 =>nY=0,1mol PT: R(COOH)2 + 2NH3 --> R(COONH4)2 M của R(COONH4)2=13,8/0,1=138 ==>R=14 => Y: CH2(COOH)2 =>m=0,2.46+0,1.104=19,6gam

UY

Câu 2: A Câu 3: B Câu 4: B Câu 5: B Câu 6: A Câu 7: D

N Ầ TR

H

G N Ư

N

Gọi nY = a ; nZ = b ; số cacbon trong phân tử là n

Ta có hệ → a ( n - 1,5 ) = b ( 3 - n ) ; a và b đều > 0 → ( n - 1,5 ) và ( 3 - n ) cùng dấu → 1,5 < n < 3 ( dấu " = " loại do k thỏa mãn phương trình ) → n = 2

2+

31

0 00

B

Thay vào phương trình trên được → % HOOC-COOH là 42,86%

Câu 8: B Câu 9: A Nhận thấy dựa vào đáp án và nAg = 0,4 mol < nAgNO3 = 0,6 mol → X chứa liên kết 3 đầu mạch sinh ra sản phẩm kết tủa ( loại B, C) Có n↓ = nX = 0,6- 0,4 = 0,2 mol . Có nAg : nX = 0,4 : 0,2 = 2 → X chứa 1 nhóm CHO Vậy X có dạng CH≡C-R-CHO MX = 13,6 : 0,2 = 68 → 13 + 12 + R + 29 = 68 → R = 14 ( CH2) X có công thức CH≡CH-CH2-CHO.

Câu 10: C

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

RCH2OH + 1/2O2 →

Câu 1: C

- P1 + NaHCO3: nRCOOH = 1/2x = 0,1 → x = 0,2 mol.

Sưu tầm bởi GV. Nguyễn Thanh Tú

O Ạ Đ

.Q P T

N Ơ H

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

- P2 + Na nRCOOH + nH2O + nRCH2OH = x + x + y = 0,15 x 2 x 2 → y = 0,6 - 0,2 x 2 = 0,2 mol.

UY

mrắn = mRCOONa + mNaOH + mRCH2ONa = (MR + 67) x 0,2 + 0,2 x 40 + (MR + 53) x 0,2 = 19 x 2 → MR = 15 → R là CH3 → X là CH3CH2OH

Câu 11: A Câu 12: B Câu 13: A Câu 14: D Câu 15: D Câu 16: C Câu 17: D Câu 18: C Câu 19: D Ta có nNa= 0,35 mol, nH2 = 0,075 mol → nOH( X) = 0,15 mol Ta có nAg = 0,6 mol = 4n OH (X) → X là CH3OH

0 00

Bảo toàn khối lượng → mchất rắn = 0,15.32+ 8,05 - 0,075.2 = 12,7 gam

Câu 20: A

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

2. Các dạng bài tập về phản ứng của kim loại với dung dịch muối (Đề 1)

Câu 1. Cho hỗn hợp bột gồm 2,7 gam Al và 5,6 gam Fe vào 550 ml dung dịch AgNO3 1M. Sau khi các phản ứng xảy ra hoàn toàn, thu được m gam chất rắn. Giá trị của m là (biết thứ tự trong dãy thế điện hoá: Fe3+/Fe2+ đứng trước Ag+/Ag) A. 59,4. B. 64,8. C. 32,4. D. 54,0. Câu 2. Cho hỗn hợp gồm Fe và Zn vào dung dịch AgNO3 đến khi các phản ứng xảy ra hoàn toàn, thu được dung dịch X gồm hai muối và chất rắn Y gồm hai kim loại. Hai muối trong X là A. Fe(NO3)3 và Zn(NO3)2. B. Zn(NO3)2 và Fe(NO3)2. C. AgNO3 và Zn(NO3)2. D. Fe(NO3)2 và AgNO3. Câu 3. Cho hỗn hợp gồm 1,2 mol Mg và x mol Zn vào dung dịch chứa 2 mol Cu2+ và 1 mol Ag+ đến khi các phản ứng xảy ra hoàn toàn, thu được một dung dịch chứa ba ion kim loại. Trong các giá trị sau đây, giá trị nào của x thoả mãn trường hợp trên? A. 1,8. B. 1,5. C. 1,2. D. 2,0. Câu 4. Cho m gam hỗn hợp bột Zn và Fe vào lượng dư dung dịch CuSO4. Sau khi kết thúc các phản ứng, lọc bỏ phần dung dịch thu được m gam bột rắn. Thành phần phần trăm theo khối lượng của Zn trong hỗn hợp bột ban đầu là (cho Fe = 56, Cu = 64, Zn = 65) A. 90,27%. B. 85,30%. C. 82,20%. D. 12,67%. Câu 5. Cho x mol Mg vào dung dịch chứa y mol Cu(NO3)2 và z mol AgNO3, sau khi kết thúc các phản ứng thu được dung dịch gồm 2 muối. Mối quan hệ giữa x, y, z là A. 0,5z ≤ x < 0,5z + y. B. z ≤ x < y + z. C. 0,5z ≤ x ≤ 0,5z + y. D. x < 0,5z + y. Câu 6. Cho c mol Mg vào dung dịch chứa đồng thời a mol Zn(NO3)2 và b mol AgNO3. Điều kiện cần và đủ để dung dịch sau phản ứng chỉ chứa một muối là: A. 2c > 2 + 2a B. 2c ≥ a + 2b C. c ≥ b/2 + a D. C ≥ a + b Câu 7. Cho m gam bột Zn vào 500 ml dung dịch Fe2(SO4)3 0,24M. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng dung dịch tăng thêm 9,6 gam so với khối lượng dung dịch ban đầu. Giá trị của m là A. 32,50

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 20,80 C. 29,25 D. 48,75. Câu 8. Cho 1,93 gam hỗn hợp gồm Fe và Al tác dụng với dung dịch chứa Cu2+ và 0,03 mol Ag+. Sau phản ứng thu được 6,44 gam hỗn hợp có 2 kim loại. Phần trăm khối lượng Fe trong hỗn hợp đầu bằng A. 58,03% B. 44,04% C. 72,02% D. 29,01%. Câu 9. Cho 2,8 gam bột sắt vào 200 ml dung dịch gồm AgNO3 0,1M và Cu(NO3)2 0,5M; khi các phản ứng xảy ra hoàn toàn thu được m gam chất rắn X. Giá trị của m là A. 4,72 B. 4,08 C. 4,48 D. 3,20 Câu 10. Cho 0,42 gam hỗn hợp bột Fe và Al vào 250 ml dung dịch AgNO3 0,12M. Sau khi các phản ứng xảy ra hoàn toàn, thu được dung dịch X và 3,333 gam chất rắn. Khối lượng Fe trong hỗn hợp ban đầu là A. 0,168 gam B. 0,123 gam C. 0,177 gam D. 0,150 gam Câu 11. Cho bột Fe vào dung dịch gồm AgNO3 và Cu(NO3)2. Sau khi các phản ứng xảy ra hoàn toàn, thu được dung dịch X gồm hai muối và chất rắn Y gồm hai kim loại. Hai muối trong X và hai kim loại trong Y lần lượt là: A. Cu(NO3)2; AgNO3 và Cu; Ag. B. Cu(NO3)2; Fe(NO3)2 và Cu; Fe. C. Fe(NO3)2 ; Fe(NO3)3 và Cu; Ag. D. Cu(NO3)2; Fe(NO3)2 và Ag; Cu. Câu 12. Cho hỗn hợp X gồm Al và Mg tác dụng với 1 lít dung dịch gồm AgNO3 a mol/l và Cu(NO3)2 2a mol/l, thu được 45,2 gam chất rắn Y. Cho Y tác dụng với dung dịch H2SO4 đặc, nóng (dư), thu được 7,84 lít khí SO2 (ở đktc, là sản phẩm khử duy nhất). Biết các phản ứng xảy ra hoàn toàn. Giá trị của a là A. 0,30. B. 0,20. C. 0,15. D. 0,25. Câu 13. Nhúng một lá kim loại M (chỉ có hoá trị hai trong hợp chất) có khối lượng 50 gam vào 200 ml dung dịch AgNO3 1M cho đến khi phản ứng xảy ra hoàn toàn. Lọc dung dịch, đem cô cạn thu được 18,8 gam muối khan. Kim loại M là A. Fe. B. Cu. C. Mg. D. Zn. Câu 14. Cho 19,3 gam hỗn hợp bột gồm Zn và Cu có tỉ lệ mol tương ứng là 1 : 2 vào dung dịch chứa 0,2 mol Fe2(SO4)3. Sau khi các phản ứng xảy ra hoàn toàn, thu được m gam kim loại. Giá trị của m là A. 12,80.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 12,00. C. 6,40. D. 16,53. Câu 15. Nhúng một thanh sắt nặng 100 gam vào 100 ml dung dịch hỗn hợp gồm Cu(NO3)2 0,2M và AgNO3 0,2M. Sau một thời gian lấy thanh kim loại ra, rửa sạch làm khô cân được 101,72 gam (giả thiết các kim loại tạo thành đều bám hết vào thanh sắt). Khối lượng sắt đã phản ứng là A. 1,40 gam. B. 2,16 gam. C. 0,84 gam. D. 1,72 gam. Câu 16. Hòa tan hỗn hợp chứa 0,1 mol Mg và 0,1 mol Al vào dung dịch hỗn hợp chứa 0,1 mol Cu(NO3)2 và 0,35 mol AgNO3. Khối lượng chất rắn thu được khi phản ứng xảy ra hoàn toàn là A. 21,6 gam B. 37,8 gam C. 42,6 gam D. 44,2 gam. Câu 17. Tiến hành hai thí nghiệm sau: - Thí nghiệm 1: Cho m gam bột Fe (dư) vào V1 lít dung dịch Cu(NO3)2 1M; - Thí nghiệm 2: Cho m gam bột Fe (dư) vào V2 lít dung dịch AgNO3 0,1M. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng chất rắn thu được ở hai thí nghiệm đều bằng nhau. Giá trị của V1 so với V2 là A. V1 = 10V2. B. V1 = 5V2. C. V1 = 2V2. D. V1 = V2. Câu 18. Nhúng 1 thanh kim loại hoá trị II vào dung dịch CuSO4, sau 1 thời gian lấy thanh kim loại ra thấy thanh kim loại giảm 0,05% khối lượng. Mặt khác cũng nhúng thanh kim loại trên vào dung dịch Pb(NO3)2, sau phản ứng lấy ra cân lại thấy khối lượng tăng 7,1%. Biết số mol 2 muối tham gia phản ứng như nhau. Kim loại M là A. Fe. B. Cd. C. Zn. D. Mg. Câu 19. Lấy 2 thanh kim loại cùng khối lượng cùng một kim loại M hóa trị 2. Thanh 1 nhúng vào dung dịch CuCl2; thanh 2 vào dung dịch CdCl2, hai dung dịch này có cùng thể tích và cùng nồng độ mol. Sau một thời gian, thanh 1 có khối lượng tăng 1,2%; thanh 2 tăng 8,4%. Số mol muối trong 2 dung dịch giảm như nhau. Kim loại M là A. Zn. B. Fe. C. Mg. D. Ni. Câu 20. Hai thanh kim loại X cùng chất, đều có khối lượng là a gam. Thanh thứ nhất nhúng vào 100 ml dung dịch AgNO3; thanh thứ 2 nhúng vào 1,51 lít dung dịch Cu(NO3)2. Sau 1 thời gian lấy 2 thanh kim loại ta thấy thanh 1 tăng khối lượng, thanh 2 giảm khối lượng nhưng tổng khối lượng 2 thanh vẫn là 2a gam, đồng thời

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

trong dung dịch thấy nồng độ mol của muối kim loại X trong dung dịch Cu(NO3)2 gấp 10 lần trong dd AgNO3. Kim loại X là (biết X có hóa trị 2) A. Cd. B. Zn. C. Pb. D. Fe. Câu 21. Trộn hai dung dịch AgNO3 0,42M và Pb(NO3)2 0,36M với thể tích bằng nhau được dung dịch X. Cho 0,81 gam bột Al vào 100 ml dung dịch X tới phản ứng hoàn toàn được m gam chất rắn Y. Giá trị của m là A. 4,851. B. 4,554. C. 6,525. D. 6,291. Câu 22. Cho hỗn hợp bột kim loại: a mol Mg, b mol Al, phản ứng với dung dịch hỗn hợp chứa c mol Cu(NO3)2, d mol AgNO3 Sau phản ứng thu được chất rắn chứa 2 kim loại. Biểu thức liên hệ giữa a, b, c, d là: A. 2a + 3b = 2c +2 d. B. 2a + 3b ≤ 2c – d. C. 2a + 3b ≥ 2c – d. D. 2a + 3b ≤ 2c + d. Câu 23. Cho hỗn hợp chứa x mol Mg, y mol Fe vào dung dịch có chứa z mol CuSO4. Sau khi kết thúc các phản ứng người ta thấy trong dung dịch có mặt cả 3 ion kim loại. Muốn thỏa mãn điều kiện đó thì: A. x < y < z. B. z = x + y. C. z > x + y. D. y = x + z. Câu 24. Cho hỗn hợp chứa x mol Mg, y mol Fe vào dung dịch chứa z mol CuSO4. Sau khi kết thúc các phản ứng thu được chất rắn gồm 2 kim loại. Muốn thỏa mãn điều kiện đó thì: A. z ≥ x. B. x ≤ z < x + y. C. x < z < y. D. z = x + y. Câu 25. Nhúng một thanh Mg vào dung dịch chứa 0,8 mol Fe(NO3)3 và 0,05 mol Cu(NO3)2. Sau một thời gian, lấy thanh kim loại ra, rửa sạch, cân lại thấy khối lượng tăng 11,6 gam so với thanh kim loại ban đầu. Khối lượng Mg đã phản ứng là: A. 20,88 gam. B. 6,96 gam. C. 25,2 gam. D. 24 gam. Câu 26. Nhúng thanh Fe vào dung dịch CuSO4. Sau một thời gian, khối lượng dung dịch giảm 0,8 gam so với khối lượng dung dịch ban đầu. Khối lượng Fe đã phản ứng là A. 6,4 gam. B. 8,4 gam. C. 11,2 gam. D. 5,6 gam.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 27. Nhúng một thanh sắt vào dung dịch hỗn hợp chứa 0,02 mol AgNO3 và 0,05 mol Cu(NO3)2. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng thanh sắt tăng m gam (coi toàn bộ kim loại sinh ra bám vào thanh sắt). Giá trị của m là A. 1,44. B. 3,60. C. 5,36. D. 2,00. Câu 28. Cho hỗn hợp gồm Al và Zn vào dung dịch AgNO3. Sau khi phản ứng xảy ra hoàn toàn, thu được dung dịch X chỉ chứa một muối và phần không tan Y gồm hai kim loại. Hai kim loại trong Y và muối trong X là A. Al, Ag và Zn(NO3)2 B. Al, Ag và Al(NO3)3 C. Zn, Ag và Al(NO3)3 D. Zn, Ag và Zn(NO3)2 Câu 29. Cho một thanh hợp kim nặng 8,8 gam chứa các kim loại Ag, Fe, Mg hòa tan trong 750ml CuSO4 0,1M. Sau một thời gian, thu được thanh hợp kim X và dung dịch Y. Rửa sạch và sấy khô thanh hợp kim X và cân thấy khối lượng tăng thêm so với thanh hợp kim ban đầu là 1,16 gam. Nhúng thanh X vào dung dịch H2SO4 đặc nóng dư thì thu được 2,576 lít khí SO2 (đktc). Cho 800ml dung dịch NaOH 0,2M vào dung dịch Y, lọc lấy kết tủa rửa sạch, nung trong không khí đến khối lượng không đổi thu được 5 gam chất rắn. Phần trăm khối lượng của Ag trong hợp kim là A. 61,36% B. 36,82% C. 49,09% D. 44,18% Câu 30. Cho hỗn hợp bột Al, Fe vào dung dịch chứa Cu(NO3)2 và AgNO3. Sau khi các phản ứng xảy ra hoàn toàn, thu được hỗn hợp rắn gồm ba kim loại là A. Fe, Cu, Ag. B. Al, Cu, Ag. C. Al, Fe, Cu. D. Al, Fe, Ag.

N Á O

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

-L

Í-

A Ó H

P Ấ C

2

T

Câu 1: A Câu 2: B Phần không tan Y gồm 2 kim loại, đó là Ag và Fe vì nếu có Zn dư thì Fe sẽ chưa phản ứng và Y sẽ gồm 3 kim loại

I Ồ B

Ỡ Ư D

NG

Do đó Zn đã tác dụng hết, X chỉ chứa 2 muối nên, Zn phản ứng hết, Fe phản ứng một phần, và còn Fe dư nên X

Sưu tầm bởi GV. Nguyễn Thanh Tú

N Ơ H

chứa muối sắt(II). X chứa Câu 3: C

UY

N Ầ TR

H

G N Ư

Để dung dịch có chứa 3 ion kim loại thì

1 3 +

0 00

B

O Ạ Đ

.Q P T

N

vẫn dư

Câu 4: A Câu 5: A Sau khi phản ứng kết thúc thu được 2 muối là

Tức là AgNO3 đã phản ứng hết Trong dung dịch vẫn còn Cu(NO3)2 nên

Câu 6: C Dung dịch chỉ thu được có 1 muối khi Mg phản ứng vừa đủ hoặc còn dư với Zn(NO3)2 và AgNO3 Bảo toàn electron 2nMg ≥ 2nZn(NO3)2 + nAgNO3 → 2c ≥ 2a + b → c ≥ a + 0,5b Câu 7: B Câu 8: A Câu 9: A Câu 10: C Câu 11: D Câu 12: A Câu 13: B Câu 14: C Câu 15: A Câu 16: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 17: D Câu 18: C Giả sử thanh kim loại nặng 100 gam.

N Ơ H

Gọi số mol tham gia của hai muối là x mol → số mol M tham gia là x mol

Câu 22: D Cho hỗn hợp bột kim loại: a mol Mg, b mol Al, phản ứng với dung dịch hỗn hợp chứa c mol Cu(NO3)2, d mol AgNO3 thì Mg tham gia phản ứng với AgNO3

Khi cho thanh M vào dung dịch CuSO4 thanh kim loại giảm 0,05% khối lượng → mM -mCu = 0,05 → x.M x64 = 0,05

Hai kim loại thu được sau phản ứng gồn Ag và Cu →Al, Mg, AgNO3 phản ứng hết, Cu(NO3)2 phản ứng vừa đủ hoặc còn dư

Khi cho thanh M vào dung dịch Pb(NO3)2 thấy thanh kim loại tăng 7,1% → mPb - mM = 7,1 → 207x -xM = 7,1

Theo định luật bảo toàn electron → 2nMg +3nAl ≤ 2nCu(NO3)2 + nAgNO3 → 2a + 3b ≤ 2c + d

UY

O Ạ Đ

.Q P T

N

Câu 23: C Câu 24: B Câu 25: C Thứ tự phản ứng của Mg với các ion là Fe3+, Cu2+, Fe2+

Giải hệ → xM = 3,25, x = 0,05 → M = 65( Zn) Câu 19: B Đặt:

N Ầ TR

H

G N Ư

Nhận thấy muốn cho khối lượng thanh Mg tăng thì Mg phản ứng hết Fe3+, Cu2+ và một phần Fe2+ Ta có:

Gọi số mol Mg phản ứng là x mol

0 00

B

→ Muối có trong dung dịch gồm Mg(NO3)2 : x mol, Fe(NO3)2 dư : ( 0,8. 3 + 0,05. 2 - 2x) : 2 = 1,25-x mol

Câu 20: B Giả sử số mol của kim loại X tham gia phản ứng với dung dịch AgNO3là x mol với dung dịch Cu(NO3)2 là y mol → số mol Ag sinh ra là 2x mol, số mol Cu sinh ra là y mol

P Ấ C

Theo đề bài khối lượng thanh 1 tăng bằng khối lượng thanh 2 tăng → 108.2x -xM = yM - 64y

A Ó H

Trong dung dịch thấy nồng độ mol của muối kim loại X trong dung dịch Cu(NO3)2 gấp 10 lần trong dd AgNO2 → y/ 1,51 = 10. x / 0,1 → y = 151x → 108.2x -x.M = 151xM - 64. 151x → M = 65 ( Zn) Câu 21: D

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

2+

31

Bảo toàn nguyên tố Fe → nFe = 0,8 - ( 1,25-x) = x- 0,45 mol mtăng = mkl bám vào - mMg pư → 11,6 = 0,05. 64 + 56. ( x- 0,45) - 24x → x = 1,05 mol

→ m = 1,05. 24= 25,2 gam Câu 26: D Câu 27: D Câu 28: C Phần không tan Y gồm 2 kim loại, đó là Ag và Zn vì nếu có Al dư thì Zn sẽ chưa phản ứng và Y sẽ gồm 3 kim loại Do đó Al đã tác dụng hết, X chỉ chứa 1 muối nên Zn chưa phản ứng, Al phản ứng vừa hết đủ với

,

X chỉ chứa Câu 29: A

8,8 g

Y

+ 0,075 mol CuSO4 → X

+ dd Y

5g

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Chú ý thí nghiệm (1) phản ứng xảy ra trong một thời gian → phản ứng không xảy ra hoàn toàn Nếu Mg còn dư trong phản ứng CuSO4 → m tăng = 0,075. ( 64-24) = 3 g > 1,16 → Mg phản ứng hết : x mol, Fe phản ứng một phần : y mol

UY

Luôn có nNa2SO4 = nSO42- = 0,075 mol → nNa+ = 0,15 < 0,16 → trong thí nghiệm dung dịch Y phản ứng với NaOH thì NaOH còn dư, toàn bộ lượng muối chuyển về hidroxit tương ứng → 5 gam chất rắn chứa MgO, Fe2O3, CuO → 40x + 80y + 80. ( 0,075-x-y) = 5 → x = 0,025 mol Khối lượng thanh kim loại tăng 1,16 gam → x.( 64-24) + y. ( 64-56) = 1,16 → y = 0,02 Tổng khối lượng hợp kim là 8,8 gam → 108a + 24. 0,025 + 56. ( b + 0,02) = 8,8 (1)

0,115 mol SO2

Thanh X chứa

0 00

Bảo toàn electron → a + 3b + 0,045. 2 = 0,115. 2 (2) Giải hệ (1), (2) → a = 0,05, b= 0,03

%Ag = Câu 30: A

I Ồ B

×100% = 61,36%.

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

3. PP Giải các dạng toán trọng tâm về Este – Chất béo (Đề 1)

Câu 1. Hỗn hợp X gồm axit HCOOH và axit CH3COOH (tỉ lệ mol 1:1). Lấy 5,3 gam hỗn hợp X tác dụng với 5,75 gam C2H5OH (có xúc tác H2SO4 đặc) thu được m gam hỗn hợp este (hiệu suất của các phản ứng este hoá đều bằng 80%). Giá trị của m là A. 10,12. B. 6,48. C. 8,10. D. 16,20. Câu 2. Xà phòng hoá hoàn toàn 1,99 gam hỗn hợp hai este bằng dung dịch NaOH thu được 2,05 gam muối của một axit cacboxylic và 0,94 gam hỗn hợp hai ancol là đồng đẳng kế tiếp nhau. Công thức của hai este đó là A. CH3COOCH3 và CH3COOC2H5. B. C2H5COOCH3 và C2H5COOC2H5. C. CH3COOC2H5 và CH3COOC3H7. D. HCOOCH3 và HCOOC2H5. Câu 3. Chất hữu cơ X có công thức phân tử C5H8O2. Cho 5 gam X tác dụng vừa hết với dung dịch NaOH, thu được một hợp chất hữu cơ không làm mất màu nước brom và 3,4 gam một muối. Công thức của X là A. HCOOC(CH3)=CHCH3. B. CH3COOC(CH3)=CH2. C. HCOOCH2CH=CHCH3. D. HCOOCH=CHCH2CH3. Câu 4. Thuỷ phân hoàn toàn 0,2 mol một este E cần dùng vừa đủ 100 gam dung dịch NaOH 24%, thu được một ancol và 43,6 gam hỗn hợp muối của hai axit cacboxylic đơn chức. Hai axit đó là: A. C2H5COOH và C3H7COOH B. HCOOH và C2H5COOH C. HCOOH và CH3COOH D. CH3COOH và C2H5COOH Câu 5. Hỗn hợp X gồm axit panmitic, axit stearic và axit oleic. Để trung hoà m gam X cần 40 ml dung dịch NaOH 1M. Mặt khác nếu đốt cháy hoàn toàn m gam X thì thu được 15,68 lit khí CO2 (đktc) và 12,42 gam H2O. Phần trăm số mol của axit oleic trong hỗn hợp X là: A. 12,5% B. 37,5% C. 25% D. 18,75% Câu 6. Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai este đồng phân cần dùng 27,44 lít khí O2, thu được 23,52 lít khí CO2 và 18,9 gam H2O. Nếu cho m gam X tác dụng hết với 400 ml dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng thì thu được 27,9 gam chất rắn khan, trong đó có a mol muối Y và b mol muối Z (MY < MZ). Các thể tích khí đều đo ở điều kiện tiêu chuẩn. Tỉ lệ a : b là A. 2 : 3. B. 4 : 3. C. 3 : 2. D. 3 : 5.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Khi cho 0,15 mol este đơn chức X tác dụng với dung dịch NaOH (dư), sau khi phản ứng kết thúc thì lượng NaOH phản ứng là 12 gam và tổng khối lượng sản phẩm hữu cơ thu được là 29,7 gam. Số đồng phân cấu tạo của X thỏa mãn các tính chất trên là: A. 4 B. 5 C. 6 D. 2 Câu 8. Este đơn chức mạch hở X thu được từ phản ứng este hóa giữa ancol Y và axit hữu cơ Z (xúc tác H2SO4 đặc, to). Đốt cháy hoàn toàn 4,3 gam X thu được 0,2 mol CO2 và 0,15 mol H2O. Số CTCT có thể có của X là A. 2 B. 3 C. 4 D. 5 Câu 9. Hỗn hợp X gồm axit panmitic, axit stearic và axit linoleic. Để trung hòa m gam X cần 50 ml dung dịch NaOH 1M. Mặt khác, nếu đốt cháy hoàn toàn m gam X thì thu được 19,04 lít khí CO2 (ở đktc) và 14,76 gam H2O. Phần trăm số mol của axit linoleic trong m gam hỗn hợp X là A. 62,5%. B. 30%. C. 31,25%. D. 60%. Câu 10. Một loại chất béo được tạo thành bởi glixerol và 3 axit béo là axit panmitic, axit oleic và axit linoleic. Đun 0,1 mol chất béo này với 500 ml dung dịch NaOH 1M sau phản ứng hoàn toàn thu được dung dịch X. Cô cạn cẩn thận dung dịch X (trong quá trình cô cạn không xảy ra phản ứng hóa học) còn lại m gam chất rắn khan. Giá trị của m là A. 91,6. B. 96,4. C. 99,2. D. 97. Câu 11. Thủy phân hoàn toàn m1 gam este X mạch hở bằng dung dịch NaOH dư, thu được m2 gam ancol Y (không có khả năng phản ứng với Cu(OH)2) và 15 gam hỗn hợp muối của hai axit cacboxylic đơn chức. Đốt cháy hoàn toàn m2 gam Y bằng oxi dư thu được 0,3 mol CO2 và 0,4 mol H2O. Giá trị của m1 là A. 16,2 B. 14,6 C. 10,6 D. 11,6 Câu 12. Hỗn hợp X gồm một axit cacboxylic no, đơn chức, mạch hở và một ancol đơn chức, mạch hở. Đốt cháy hoàn toàn 21,7 gam X, thu được 20,16 lít khí CO2 (đktc) và 18,9 gam H2O. Thực hiện phản ứng este hóa X với hiệu suất 60%, thu được m gam este. Giá trị của m là A. 12,24 B. 10,80 C. 15,53 D. 9,18 Câu 13. Cho 4,48 gam hỗn hợp gồm CH3COOC2H5 và CH3COOC6H5 (có tỉ lệ mol là 1:1) tác dụng với 800 ml dung dịch NaOH 0,1M thu được dung dịch X. Cô cạn dung dịch X thì khối lượng chất rắn thu được là A. 6,40 gam.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 4,88 gam. C. 5,60 gam. D. 3,28 gam. Câu 14. Thủy phân 37 gam hai este cùng công thức phân tử C3H6O2 bằng dung dịch NaOH dư. Chưng cất dung dịch sau phản ứng thu được hỗn hợp ancol Y và chất rắn khan Z. Đun nóng Y với H2SO4 đặc ở 140oC, thu được 14,3 gam hỗn hợp các ete. Biết các phản ứng xảy ra hoàn toàn. Khối lượng muối trong Z là A. 40,0 gam. B. 42,2 gam. C. 38,2 gam. D. 34,2 gam. Câu 15. Đốt cháy hoàn toàn 1 mol chất béo, thu được lượng CO2 và H2O hơn kém nhau 6 mol. Mặt khác a mol chất béo trên tác dụng tối đa với 600 ml dung dịch Br2 1M. Giá trị của a là A. 0,20. B. 0,15. C. 0,30. D. 0,18. Câu 16. Thuỷ phân hoàn toàn 0,1 mol este X bằng NaOH, thu được một muối của axit cacboxylic Y và 7,6 gam ancol Z. Chất Y có phản ứng tráng bạc, Z hoà tan được Cu(OH)2 cho dung dịch màu xanh lam. Công thức cấu tạo của X là A. HCOOCH2CH2CH2OOCH. B. HCOOCH2CH(CH3)OOCH. C. HCOOCH2CH2OOCCH3. D. CH3COOCH2CH2OOCCH3. Câu 17. Hai este X, Y có cùng công thức phân tử C8H8O2 và chứa vòng benzen trong phân tử. Cho 6,8 gam hỗn hợp gồm X và Y tác dụng với dung dịch NaOH dư, đun nóng, lượng NaOH phản ứng tối đa là 0,06 mol, thu được dung dịch Z chứa 4,7 gam ba muối. Khối lượng muối của axit cacboxylic có phân tử khối lớn hơn trong Z là A. 0,82 gam. B. 0,68 gam. C. 3,40 gam. D. 2,72 gam. Câu 18. Xà phòng hóa hoàn toàn 17,6 gam CH3COOC2H5 trong dung dịch NaOH (vừa đủ), thu được dung dịch chứa m gam muối. Giá trị của m là A. 16,4. B. 19,2. C. 9,6. D. 8,2. Câu 19. Este X có công thức phân tử C2H4O2. Đun nóng 9,0 gam X trong dung dịch NaOH vừa đủ đến khi phản ứng xảy ra hoàn toàn thu được m gam muối. Giá trị của m là A. 10,2. B. 15,0. C. 12,3. D. 8,2. Câu 20. Đun nóng 0,1 mol este đơn chức X với 135 ml dung dịch NaOH 1M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được ancol etylic và 9,6 gam chất rắn khan. Công thức cấu tạo của X là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. C2H5COOCH3. B. C2H3COOC2H5. C. C2H5COOC2H5. D. CH3COOC2H5. Câu 21. Hóa hơi hoàn toàn 4,4 gam một este X mạch hở, thu được thể tích hơi bằng thể tích của 1,6 gam khí oxi (đo ở cùng điều kiện). Mặt khác, thủy phân hoàn toàn 11 gam X bằng dung dịch NaOH dư, thu được 10,25 gam muối. Công thức của X là A. C2H5COOCH3. B. CH3COOC2H5. C. C2H5COOC2H5. D. HCOOC3H7. Câu 22. Cho 20 gam một este X (có phân tử khối là 100 đvC) tác dụng với 300 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 23,2 gam chất rắn khan. Công thức cấu tạo của X là A. CH2=CHCH2COOCH3. B. CH3COOCH=CHCH3. C. C2H5COOCH=CH2. D. CH2=CHCOOC2H5. Câu 23. Đốt cháy hoàn toàn một este đơn chức, mạch hở X (phân tử có số liên kết π nhỏ hơn 3), thu được thể tích khí CO2 bằng 6/7 thể tích khí O2 đã phản ứng (các thể tích khí đo ở cùng điều kiện). Cho m gam X tác dụng hoàn toàn với 200 ml dung dịch KOH 0,7M thu được dung dịch Y. Cô cạn Y thu được 12,88 gam chất rắn khan. Giá trị của m là A. 10,56. B. 7,20. C. 8,88. D. 6,66. Câu 24. Thủy phân 4,3 gam este X đơn chức, mạch hở có xúc tác axit đến khi phản ứng hoàn toàn thu được hỗn hợp 2 chất hữu cơ Y và Z. Cho Y và Z phản ứng với dung dịch AgNO3/NH3 thu được 21,6 gam Ag. CTCT của X là A. CH3COO-CH=CH2. B. HCOO-CH=CH-CH3. C. HCOO-CH2-CH=CH2. D. HCOOC(CH3)=CH2. Câu 25. Xà phòng hóa hoàn toàn 13,6 gam một este X cần vừa đủ 50ml dung dịch NaOH 4M, thu được 19,8 gam 2 muối có số mol bằng nhau (khối lượng mol mỗi muối đều lớn hơn 68). CTCT của X có thể là A. CH3COO-(CH2)3-OOCC2H5. B. HCOOC6H4CH3. C. CH3COOC6H4CH3. D. CH3COOC6H5. Câu 26. Thuỷ phân hoàn toàn 0,08 mol hỗn hợp hai este đơn chức X, Y (MX < MY) cần dùng hết 110 ml dung dịch NaOH 1M thu được 10,46 gam hỗn hợp hai muối, đồng thời thu được 2,9 gam ancol Z, ancol này không bền chuyển hóa ngay thành anđehit. Công thức cấu tạo của hai este lần lượt là A. CH3–COO–CH=CH–CH3 và CH3–COO–C6H4–CH3. B. CH3–COO–CH2–CH=CH3 và CH3–COO–C6H4–CH3. C. CH3–COO–CH=CH2 và CH3–COO–CH2–C6H5. D. CH3–COO–CH=CH2 và CH3–COO–C6H4–CH3.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 27. Đun sôi hỗn hợp X gồm 12 gam CH3COOH và 11,5 gam ancol etylic với H2SO4 làm xúc tác đến khi phản ứng kết thúc thu được 11,44 gam este. Tính hiệu suất phản ứng este hóa. A. 50% B. 52% C. 65% D. 66,67% Câu 28. Đun một lượng dư axit axetic với 13,80 gam ancol etylic (có axit H2SO4 đặc làm xúc tác). Đến khi phản ứng dừng lại thu được 11,0 gam este. Hiệu suất của phản ứng este hóa là bao nhiêu ? A. 75,0% B. 62,5% C. 60,0% D. 41,67% Câu 29. Hỗn hợp X gồm axit fomic và axit axetic (tỉ lệ mol 1 : 1). Lấy 6,36 gam X tác dụng với 6,9 gam ancol etylic (xúc tác H2SO4) thu được 7,776 gam hỗn hợp este, hiệu suất của các phản ứng este hoá bằng nhau. Hiệu suất của phản ứng este hoá là A. 64%. B. 80% C. 75% D. 70% Câu 30. Đun nóng axit axetic với isoamylic (CH3)2CH-CH2-CH2OH có H2SO4 đặc xúc tác thu được isoamyl axetat (dầu chuối). Lượng dầu chuối thu được khi đun nóng 132,35 gam axit axetic với 200 gam ancol isoamylic là (Biết hiệu suất phản ứng đạt 68%) A. 195,0 gam. B. 200,9 gam. C. 286,8 gam. D. 295,5 gam. Câu 31. Cho hỗn hợp X gồm ancol metylic và hai axit cacboxylic (no, đơn chức, kế tiếp nhau trong dãy đồng đẳng) tác dụng hết với Na, giải phóng ra 6,72 lít khí H2 (đktc). Nếu đun nóng hỗn hợp X (có H2SO4 đặc làm xúc tác) thì các chất trong hỗn hợp phản ứng vừa đủ với nhau tạo thành 25 gam hỗn hợp este (giả thiết phản ứng este hoá đạt hiệu suất 100%). Hai axit trong hỗn hợp X là A. CH3COOH và C2H5COOH B. HCOOH và CH3COOH C. C2H5COOH và C3H7COOH D. C3H7COOH và C4H9COOH Câu 32. Hợp chất hữu cơ no, đa chức X có công thức phân tử C7H12O4. Cho 0,1 mol X tác dụng vừa đủ với 100 gam dung dịch NaOH 8% thu được chất hữu cơ Y và 17,8 gam hỗn hợp muối. Công thức cấu tạo thu gọn của X là A. CH3OOC-(CH2)2-COOC2H5. B. CH3OOC-CH2-COO-C3H7. C. CH3COO-(CH2)2-OOCC2H5. D. CH3COO-(CH2)2-COOC2H5. Câu 33. Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai ancol đơn chức, cùng dãy đồng đẳng, thu được 15,68 lít khí CO2 (đktc) và 17,1 gam nước. Mặt khác, thực hiện phản ứng este hóa m gam X với 15,6 gam axit axetic, thu được a gam este. Biết hiệu suất phản ứng este hóa của hai ancol đều bằng 60%. Giá trị của a là A. 15,48.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 25,79. C. 24,80. D. 14,88. Câu 34. Cho axit salixylic (axit o-hiđroxibenzoic) phản ứng với anhiđrit axetic, thu được axit axetylsalixylic (o-CH3COO-C6H4-COOH) dùng làm thuốc cảm (aspirin). Để phản ứng hoàn toàn với 43,2 gam axit axetylsalixylic cần vừa đủ V lít dung dịch KOH 1M. Giá trị của V là A. 0,48. B. 0,72. C. 0,24. D. 0,96. Câu 35. Este X có công thức phân tử C4H8O2. Cho 2,2 gam X vào 20 gam dung dịch NaOH 8%, đun nóng, sau khi phản ứng xảy ra hoàn toàn, thu được dung dịch Y. Cô cạn Y thu được 3 gam chất rắn khan. Công thức cấu tạo của X là A. CH3CH2COOCH3. B. CH3COOCH2CH3. C. HCOOCH(CH3)2. D. HCOOCH2CH2CH3. Câu 36. Thủy phân hoàn toàn chất béo X trong môi trường axit, thu được glixerol và hỗn hợp hai axit béo. Nếu đốt cháy hoàn toàn a mol X thì thu được 12,32 lít CO2 (đktc) và 8,82 gam H2O. Mặt khác, a mol X tác dụng tối đa với 40 ml dung dịch Br2 1M. Hai axit béo là A. axit panmitic và axit oleic. B. axit panmitic và axit linoleic. C. axit stearic và axit linoleic D. axit stearic và axit oleic. Câu 37. Cho 26,4 gam hỗn hợp hai chất hữu cơ có cùng công thức phân tử C4H8O2 tác dụng với dung dịch NaOH vừa đủ, thu được dung dịch X chứa 28,8 gam hỗn hợp muối và m gam ancol Y. Đun Y với dung dịch H2SO4 đặc ở nhiệt độ thích hợp, thu được chất hữu cơ Z, có tỉ khối hơi so với Y bằng 0,7. Biết các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 6,0 B. 6,4 C. 4,6 D. 9,6 Câu 38. Hỗn hợp X gồm HCOOH và CH3COOH (tỉ lệ mol 1:1); hỗn hợp Y gồm CH3OH và C2H5OH (tỉ lệ mol 3 : 2). Lấy 11,13 gam hỗn hợp X tác dụng với 7,52 gam hỗn hợp Y có xúc tác H2SO4 đặc, đun nóng. Khối lượng của este thu được là (biết hiệu suất các phản ứng este đều 75%) A. 11,43 gam B. 10,89 gam C. 14,52 gam D. 15,25 gam Câu 39. (X), (Y) là các đồng phân của C6H9O4Cl thỏa mãn các điều kiện sau: +) 36,1 gam (X) + NaOH dư → 9,2 gam etanol + 0,4 mol muối (X1) + NaCl +) (Y) + NaOH dư → muối Y1 + hai ancol (có số nguyên tử C bằng nhau) + NaCl CTCT của (X), (Y) lần lượt là A. (X): C2H5OOC-COOCH2CH2Cl và (Y): ClCH2COOCH2COOC2H5 B. (X) : ClCH2COOCH2COOC2H5 và (Y): HOOCCH2COOC(CH3)(Cl)CH3

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. (X) : ClCH2COOCH2COOC2H5 và (Y): HOOCCH2COOC(CH3)(Cl)CH3 D. (X) : HOOCCH2COOC(CH3)(Cl)CH3 và (Y) : C2H5OOC-COOCH2CH2Cl Câu 40. Chất hữu cơ X có công thức phân tử C5H8O2. Cho 8,5 gam X tác dụng vừa hết với dung dịch NaOH, thu được một hợp chất hữu cơ có phản ứng tráng gương và 6,97 gam một muối. Công thức của X là A. HCOOC(CH3)=CHCH3. B. CH3COOC(CH3)=CH2. C. HCOOCH=CHCH2CH3. D. CH3COOCH=CHCH3. Câu 41. Cho 15 gam axit axetic tác dụng với 9,2 gam ancol etylic (xác tác H2SO4 đặc, đun nóng). Sau phản ứng thu được 8,8 gam este. Hiệu suất của phản ứng este hoá là A. 80% B. 40% C. 50% D. 60% Câu 42. Xà phòng hóa hoàn toàn Trieste X bằng dung dịch NaOH thu được 9,2 gam glixerol và 83,4 gam muối của một axit béo no. Axit béo no là: A. Axit panmitic. B. Axit stearic. C. Axit oleic. D. Axit linoleic. Câu 43. Thủy phân hoàn toàn chất béo E bằng dung dịch NaOH thu được 1,84 gam glixerol và 18,24 gam muối của axit béo duy nhất. Chất béo đó là A. (C17H33COO)3C3H5. B. (C17H35COO)3C3H5. C. (C15H31COO)3C3H5. D. (C15H29COO)3C3H5 Câu 44. Đun sôi a gam triglixerit X với dung dịch KOH đến khi phản ứng hoàn toàn được 0,92 gam glixerol và hỗn hợp Y gồm m gam muối oleat với 3,18 gam muối linoleat. Giá trị của m là A. 3,2. B. 6,4. C. 3,22. D. 6,44. Câu 45. Khi thuỷ phân chất béo X trong dung dịch NaOH, thu được hỗn hợp hai muối C17H35COONa, C15H31COONa có khối lượng hơn kém nhau 1,817 lần và glixerol. Trong phân tử X có A. 3 gốc C17H35COO. B. 2 gốc C17H35COO. C. 2 gốc C15H31COO. D. 3 gốc C15H31COO. Câu 46. Thuỷ phân hoàn toàn một lipit trung tính bằng NaOH thu được 46 gam glixerol (glixerin) và 429 gam hỗn hợp hai muối. Hai loại axit béo đó là A. C15H31COOH và C17H35COOH. B. C17H33COOH và C15H31COOH. C. C17H31COOH và C15H31COOH. D. C17H33COOH và C17H35COOH.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

N Ơ H

Câu 47. Thuỷ phân hoàn toàn 444 gam một lipit thu được 46 gam glixerol và hai loại axit béo. Hai loại axit béo đó là A. C15H31COOH và C17H33COOH. B. C17H33COOH và C15H31COOH. C. C17H31COOH và C17H33COOH. D. C17H33COOH và C17H35COOH. Câu 48. Xà phòng hóa hoàn toàn 89 gam chất béo X bằng dung dịch KOH thu được 9,2 gam glixerol và m gam xà phòng. Giá trị của m là A. 96,6. B. 85,4. C. 91,8. D. 80,6. Câu 49. Đốt cháy hoàn toàn 1 mol một loại chất béo X thu được CO2 và H2O hơn kém nhau 6 mol. Mặt khác a mol chất béo trên tác dụng tối đa với 3,36 lít dung dịch Br2 0,5M. Giá trị của a gần nhất với A. 0,245 B. 0,285 C. 0,335 D. 0,425

UY

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

1 3 +

B ÁN & LỜI GIẢI CHI TIẾT 0ĐÁP 0 0 Câu 1: B Quy hỗn hợp X về axit RCOOH

Có MRCOOH = (46+60)/2= 53 → R = 8 RCOOH + C2H5OH ⇄ RCOOC2H5 + H2O Có nX = 0,1 < nC2H5OH= 0,125 mol → hiệu suất được tính theo axit meste = 0,1.0,8. ( 8 + 44 + 29) = 6.48 gam. Câu 2: A Câu 3: A

Chất hữu cơ thu được không làm mất màu nước Brom nên nó phải là xeton. Vậy, công thức của X là HCOOC(CH3)=CHCH3. Câu 4: C

=> Este 3 chức tạo 1 ancol và muối của 2 axit cacboxylic đơn chức. Gọi đó là R1 và R2

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

R2: CH3 , R1: H

16a + 18b + 18c =

= 0,85

Câu 5: C nNaOH = naxit = 0,04 (mol) panmitic và steraic là axit no . oleic là k no → noleic = 0,7 - 0,69 = 0,01 → % số mol acid oleic là : 0,01 : 0,04 × 100% = 25%

16a + 18b + 16c =

= 0,82

=>a = 0,025 mol; b = 0,01 mol; c = 0,015 mol.

Câu 6: B Nhận thấy nCO2 = nCO2 = 1,05 mol → X là este no đơn chức

%nC17H31COOH =

= 0,3

Câu 10: B Bảo toàn nguyên tố O → nX =

= 0,35 mol

→ C= 1,05 : 0,35 = 3 → X có công thức C3H6O2 . Các đồng phân của X là CH3COOCH3: x mol và HCOOC2H5 : y mol

0 00

Vì MY < MZ → Y là HCOONa : 0,2 mol và Z là CH3COONa : 0,15 mol → a : b= 4:3. Câu 7: A Ta có nNaOH = 0,3 mol Nhận thấy nX : nNaOH = 1:2 mà X là este đơn chức → X là este của phenol → nH2O = nX = 0,15 mol Bảo toàn khối lượng → mX = 29,7 + 0,15.18 - 12 = 20,4 gam → MX = 136 (C8H8O2) Các đồng phân thỏa mãn là HCOOC6H4CH3 (o,p,m) và CH3COOC6H5 Câu 8: A Dễ dàng tìm được

N Á O

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 11: B Nhận thấy đốt cháy hoàn toàn m2 gam Y bằng oxi dư thu được nH2O > nCO2 → nY = nH2O - nCO2 = 0,1 mol → nC = 0,3 : 0,1= 3 → C3H8O hoặc CH2OH-CH2-CH2OH ( do Y không có khả năng tham gia phản ứng Cu(OH)2)

Ta có hệ

UY

N Ơ H

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

TH1: Nếu là C3H8O → nNaOH = nC3H8O= 0,1 mol

Bảo toàn khối lượng → meste = 15 + 0,1. 60 - 0,1. 40 = 17 gam TH2: Nếu là C3H8O2→ nNaOH = 2nC3H8O2= 0,2 mol Bảo toàn khối lượng → meste = 15 + 0,1. 76 - 0,2. 40 = 14,6 gam Câu 12: D Gọi công thức của axit là CnH2nO2 và của ancol là CmH2m+2O2 Ta có nancol = nH2O - nCO2 = 1,05 - 0,9 = 0,15 mol

mặt khác X được tạo ra từ phản ứng este hóa giữa ancol Y và axit hữu cơ Z=> X có 2 CTCT:

ƯỠ

NG

T

Câu 9: B Đặt nC15H31COOH = a mol, nC17H35COOH = b mol, nC17H31COOH = c mol. Lập hpt: a + b + c = 0,05 ;

D I BỒ

Sưu tầm bởi GV. Nguyễn Thanh Tú

Bảo toàn khối lượng → mO2 = 0,9.44 + 18,9 - 21,7 = 36,8 gam → nO2 = 1,15 mol

Bảo toàn nguyên tố O → naxit =

= 0,2 mol

→ 0,2m + 0,15n = 0,9 → 4n + 3m = 18 → n = 3, m= 2 Vậy axit là C2H5COOH : 0,2 mol và ancol là C2H5OH : 0,15 mol Vì naxit > nancol → hiệu suất tính theo ancol → nC2H5COOC2H5 = 0,15. 0,6 = 0,09 mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Este X có CTPT là C2H4O2 chỉ có một CTCT là HCOOCH3. → m= 9,18 gam. Câu 13: A Câu 14: C Thủy phân 0,5 mol hai este có cùng CTPT C3H6O2 + NaOH dư → ancol Y + rắn Z.

C2H4O2 + NaOH→HCOONa + CH3OH

UY

nHCOONa= nC2H4O2 = 0,15 mol.

Đun nóng Y với H2SO4 đặc ở 140oC → 14,3 gam hh ete.

.Q P T

Vậy khối lượng muối thu được là: mHCOONa= 0,15.68=10,2 (g). Câu 20: D Dựa đáp án tất cả đều là este đơn chức.X thủy phân tạo ancol etylic. Đặt CT este dạng RCOOC2H5.

• Theo BTKL mY = mete + mH2O = 14,3 + 0,25 x 18 = 18,8 gam.

O Ạ Đ

Theo BTKL mZ = 37 + 0,5 x 40 - 18,8 = 38,2 gam Câu 15: B nCO2 - nH2O = 6 x nchất béo.

ROOC2H5 + NaOH → RCOONa + C2H5OH

→ số liên kết π trong chất béo = 6 + 1 = 7

Chất rắn khan gồm RCOONa 0,1 mol và NaOH dư 0,035 mol.

→ Số liên kết π trong mạch cacbon (trừ đi liên kết π trong 3 nhóm R-COO): 7 - 3 = 4.

→ mchất rắn= mRCOONa + mNaOH → 9,6 = 0,1( MR + 67)+ 0,035. 40→ MR= 15 (CH3).

→ a = 0,6 : 4 = 0,15 mol Câu 16: B

Vậy CTCT CH3COOC2H5. Câu 21: B Nhận thấy các đáp án đều là este no, đơn chức có dạng CnH2nO2

Z hòa tan được

N

G N Ư

nX= 0,1 mol< nNaOH= 0,135 mol. Vậy sau phản ứng NaOH còn dư.

cho dung dịch màu xanh lam nên

Nhận thấy chỉ có este ở phương án B thỏa mãn

P Ấ C

2+

Câu 17: A nX,Y = 0,05 < nNaOH = 0,06 . =>Có một este của phenol. Giả sử X có dạng RCOOR1 và R'COOC6H4R2. Lập hệ tính được nX = 0,04 mol và nY = 0,01 mol,

Í -L

-

A Ó H

31

0 00

B

N Ầ TR

H

Có neste = nO2 = 1,6 : 32 = 0,05 mol → Meste = 88 → 14n + 32 = 88 → n = 4 Có nRCOONa = nX = 11: 88 = 0,125 → MRCOONa= 10,25 :0,125 = 88 ( CH3COONa) Vậy X có công thức CH3COOC2H5. Câu 22: C Câu 23: C Gọi công thức X là CxHyO2

Ta có mR1OH = mX,Y + mNaOH - mmuối - mH2O = 6,8 + 0,06 × 40 - 4,7 - 0,01 × 18 = 4,32 gam. MR1OH = = 108. =>C6H5CH2OH. =>X là HCOOCH2C6H5 =>Y là CH3COOC6H5 (Do thu được 3 muối khác nhau) mCH3COONa = 0,01 × 82 = 0,82 gam. Câu 18: A

Ư D I Ồ B

G N Ỡ

N Á O

T

Khối lượng muối sinh ra: Câu 19: A

Sưu tầm bởi GV. Nguyễn Thanh Tú

TH1: Nếu X có 1 liên kết π → y = 2x Từ (1) => x = 3 => y = 6 TH2: Nếu X có 2 liên kết π → y = 2x - 2 Từ (1) => x = 4,5 (loại)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

→ X là C3H6O2

Câu 27: C + R = 1 → nKOH pu = 0,18 > 0,14 → loại.

.Q P T %

+ R = 15 → nKOH pu = 0,12 mol → m = 0,12 x 74 = 8,88 gam Câu 24: B

Câu 28: D

Nếu chỉ có 1 chất (Y hoặc Z) tác dụng với AgNO3:

Nếu cả Y và Z đều tác dụng

N Ầ TR

H

G N Ư

O Ạ Đ

UY

N

Câu 29: B

0 00

Do cả 2 chất đều tác dụng nên CTCT của X là: Câu 25: D Hòa tan este chỉ thu được 2 muối với số mol bằng nhau thì este đó là este của phenol

A Ó H

Do mỗi muối đều có khối lượng phân tử lớn hơn 68 nên không thể là HCOONa Như vậy, X chỉ có thể là CH3COOC6H5 Câu 26: A Từ 4 đáp án, nhận thấy không có este 2 chức

N Á O

Mặt khác

Í -L

-

T

P Ấ C

2

Như vậy, có 1 este là este của phenol (sẽ là este Y vì MX <my).

G N Ỡ

Thủy phân chỉ thu được 2 muối (trong đó có 1 muối của phenol) nên 2 este tạo thành từ 1 gốc axit, trong 4 đáp án thì axit đều là CH3COOH.

Ư D I Ồ B

1 3 +

B

% Câu 30: A Câu 31: A Gọi 2 axit có CT chung là RCOOH. nhhX = 2 x nH2 = 2 x 0,3 = 0,6 mol Vì các chất trong hỗn hợp phản ứng vừa đủ với nhau nên: nCH3OH = nR-COOH = 0,03 mol

→ 2 axit đó là: CH3COOH và C2H5COOH Câu 32: C Câu 33: D Câu 34: B

Như vậy, muối thu được sẽ gồm 0,08 mol CH3COONa và 0,03 mol muối của phenol

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Vì nX > nY thì hiệu suất được tính Y → neste = 0,75. 0,2 = 0,15 mol Câu 35: A Câu 36: B Ta có nCO2 = 0,55, nH2O = 0,49 mol

→ m = 0,15 .( 8 + 44+ 20,6) = 10,89 gam Câu 39: C Câu 40: D Câu 41: C Câu 42: A Câu 43: A Câu 44: B Câu 45: C Câu 46: C Câu 47: D Câu 48: A Câu 49: D nBr2 = 3,36 x 0,5 = 1,68 mol.

Gọi số liên kết đôi C=C trong gốc axit là k → ak = nBr2 = 0,04 mol Tổng số liên kết π trong X là π C=C + π C=O = k + 3 Luôn có nCO2 - nH2O = (k + 3-1)a → 0,06 = 0,04+ 2a → a = 0,01 , k= 4 Vì cứ 1 mol X phản ứng với 4 mol Br2 → trong có 2 gốc axit chứa 2 nối đôi ( axit linoleic) và 1 axit no ( Axxit pamitic hoặc axit steatic) → loại A, D Nhẩm số C = 0,55: 0,01 = 55 = 3 (C3H5) + 16 (C15H31COO)+ 2. 18 (C17H31COO) Vậy 2 axit béo thu được là axit pamitic và axit linoleic. Câu 37: A Vì Z/Y = 0,7 → Z là anken.

N Ầ TR

H

G N Ư

UY

O Ạ Đ

.Q P T

N

=>số liên kết pi trong chất béo: 6+1=7

0 00

B

Số liên kết pi trong mạch cacbon( trừ đi lk pi trong 3 nhóm R-COO):7-3=4

Giả sử ancol Y có dạng CnH2n + 2O → anken tương ứng là CnH2n.

→ n = 3 → Ancol là C3H7OH.

Ta có:

hh hai chất hữu cơ + NaOH → hh muối + 1ancol là C3H7OH. → hh ban đầu gồm C3H7COOH và HCOOC3H7 Đặt nC3H7COOH = a mol; nHCOOC3H7 = b mol.

N Á O

Ta có hpt: → m = 0,1 x 60 = 6 gam Câu 38: B

Ỡ Ư D

NG

Coi hỗn hợp X thành RCOOH với MRCOOH=

I Ồ B

Coi hỗn hợp Y thành R'OH với MR'OH =

Í -L

-

A Ó H

P Ấ C

2

1 3 +

T

= 53 → MR = 8. nX = 11,13: 53= 0,21 mol

= 37,6 → MR' = 20,6. nY = 7,52: 37,6 = 0,2 mol

RCOOH + R'OH RCOOR' + H2O

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

4. Các dạng bài tập về phản ứng điện phân (Đề 1)

Câu 1. Điện phân có màng ngăn 500 ml dung dịch chứa hỗn hợp gồm CuCl2 0,1M và NaCl 0,5M (điện cực trơ, hiệu suất điện phân 100%) với cường độ dòng điện 5A trong 3860 giây. Dung dịch thu được sau điện phân có khả năng hoà tan m gam Al. Giá trị lớn nhất của m là: A. 4,05 gam B. 2,70 gam C. 1,35 gam D. 5,40 gam Câu 2. Điện phân nóng chảy Al2O3 với anot than chì (hiệu suất điện phân 100 %) thu được m kg Al ở catot và 67,2 m3 (ở đktc) hỗn hợp khí X có tỉ khối so với hiđro bằng 16. Lấy 2,24 lít (ở đktc) hỗn hợp khí X sục vào dung dịch nước vôi trong (dư) thu được 2 gam kết tủa. Giá trị của m là: A. 54,0 kg B. 75,6 kg C. 67,5 kg D. 108,0 kg Câu 3. Điện phân dung dịch chứa a mol CuSO4 và b mol NaCl (với điện cực trơ, có màng ngăn xốp). Để dung dịch sau điện phân làm phenolphtalein chuyển sang màu hồng thì điều kiện của a và b là (biết ion SO4 2- không bị điện phân trong dung dịch) A. b > 2a. B. b = 2a. C. b < 2a. D. 2b = a. Câu 4. Điện phân nóng chảy m kg Al2O3 với anot bằng than chì thu được 358,4 m3 (đktc) hỗn hợp khí X gồm CO, CO2 và O2 dư trong đó thể tích O2 nhiều gấp đôi thể tích CO. Cho hỗn hợp khí X vào một bình kín rồi bật tia lửa điện để đốt cháy hoàn toàn hỗn hợp thì thấy thể tích khí trong bình giảm đi 44,8 m3 (thể tích khí đo ở cùng nhiệt độ và áp suất). Giá trị của m là A. 952. B. 544. C. 816. D. 986. Câu 5. Điện phân (điện cực trơ) dung dịch X chứa 0,2 mol CuSO4 và 0,12 mol NaCl bằng dòng điện có cường độ 2A. Thể tích khí (đktc) thoát ra ở anot sau 9650 giây điện phân là: A. 2,240 lít B. 2,912 lít C. 1,792 lít D. 1,344 lít Câu 6. Khi điện phân Al2O3 nóng chảy với điện cực than chì để điêù chế Al, người ta thấy khí thoát ra tại anot chứa 70% CO2, 20% CO, 10% O2 về thể tích (hiệu suất 100%). Vậy nếu điều chế 2,7 tấn Al thì lượng than (tấn) đã tiêu thụ tại anot là A. 0,9 B. 1,2 C. 0,6

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 1,5 Câu 7. Phát biểu nào dưới đây không đúng về bản chất quá trình hóa học ở điện cực trong quá trình điện phân ? A. Xảy ra sự nhường electron ở anot. B. Xảy ra sự nhận electron ở catot. C. Sự oxi hóa xảy ra ở catot. D. Sự oxi hóa xảy ra ở anot. Câu 8. Khi điện phân NaCl nóng chảy (điện cực trơ), tại catot xảy ra A. sự oxi hoá ion Cl-. B. sự oxi hoá ion Na+. C. sự khử ion Cl-. D. sự khử ion Na+. Câu 9. Điện phân (với điện cực trơ) một dung dịch gồm NaCl và CuSO4 có cùng số mol, đến khi ở catot xuất hiện bọt khí thì dừng điện phân. Trong cả quá trình điện phân trên, sản phẩm thu được ở anot là A. khí Cl2 và H2 B. khí Cl2 và O2. C. chỉ có Cl2. D. khí H2 và O2. Câu 10. Tiến hành điện phân (với điện cực trơ) V lít dung dịch CuCl2 0,5M. Khi dừng điện phân thu được dung dịch X và 1,68 lít khí Cl2 (đktc) duy nhất ở anot. Toàn bộ dung dịch X tác dụng vừa đủ với 12,6 gam Fe. Giá trị của V là A. 0,60. B. 0,15. C. 0,45. D. 0,80. Câu 11. Điện phân dung dịch chứa m gam hỗn hợp CuSO4 và NaCl. Khi thấy ở cả 2 điện cực trơ đều xuất hiện bọt khí thì ngừng điện phân. Kết quả ở Anot có 0,02 mol khí thoát ra, còn dung dịch sau điện phân có thể hòa tan tối đa 0,005 mol Fe3O4. Giá trị của m là A. 5,64 B. 7,98 C. 5,97 D. 6,81 Câu 12. Điện phân (với điện cực trơ) 200 ml dung dịch CuSO4 nồng độ x mol/l, sau một thời gian thu được dung dịch Y vẫn còn màu xanh, có khối lượng giảm 8 gam so với dung dịch ban đầu. Cho 16,8 gam bột Fe vào Y, sau khi các phản ứng xảy ra hoàn toàn, thu được 12,4 gam kim loại. Giá trị của x là A. 2,25. B. 1,5. C. 1,25. D. 3,25. Câu 13. Điện phân dung dịch gồm 7,45 gam KCl và 28,2 gam Cu(NO3)2 (điện cực trơ, màng ngăn xốp) đến khi khối lượng dung dịch giảm đi 10,75 gam thì ngừng điện phân (giả thiết lượng nước bay hơi không đáng kể). Tất cả các chất tan trong dung dịch sau điện phân là: A. KNO3 và KOH. B. KNO3, HNO3 và Cu(NO3)2. C. KNO3, KCl và KOH.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. KNO3 và Cu(NO3)2. Câu 14. Phản ứng điện phân dung dịch CuCl2 (với điện cực trơ) và phản ứng ăn mòn điện hoá xảy ra khi nhúng hợp kim Zn-Cu vào dung dịch HCl có đặc điểm là: A. Phản ứng ở cực âm có sự tham gia của kim loại hoặc ion kim loại. B. Phản ứng ở cực dương đều là sự oxi hoá Cl-. C. Đều sinh ra Cu ở cực âm. D. Phản ứng xảy ra luôn kèm theo sự phát sinh dòng điện. Câu 15. Điện phân dung dịch CuCl2 với điện cực trơ, sau một thời gian thu được 0,32 gam Cu ở catot và một lượng khí X ở anot. Hấp thụ hoàn toàn lượng khí X trên vào 200 ml dung dịch NaOH (ở nhiệt độ thường). Sau phản ứng, nồng độ NaOH còn lại là 0,05M (giả thiết thể tích dung dịch không thay đổi). Nồng độ ban đầu của dung dịch NaOH là A. 0,15M. B. 0,2M. C. 0,1M. D. 0,05M. Câu 16. Điện phân 150 ml dung dịch AgNO3 1M với điện cực trơ trong t giờ, cường độ dòng điện không đổi 2,68A (hiệu suất quá trình điện phân là 100%), thu được chất rắn X, dung dịch Y và khí Z. Cho 12,6 gam Fe vào Y, sau khi các phản ứng kết thúc thu được 14,5 gam hỗn hợp kim loại và khí NO (sản phẩm khử duy nhất của N+5). Giá trị của t là A. 0,8 B. 0,3 C. 1,0 D. 1,2 Câu 17. Tiến hành điện phân dung dịch chứa m gam hỗn hợp CuSO4 và NaCl ( hiệu suất 100%, điện cực trơ, màng ngăn xốp), đến khi nước bắt đầu bị điện phân ở cả hai điện cực thì ngừng điện phân, thu được dung dịch X và 6,72 lít khí (đktc) ở anot. Dung dịch X hòa tan tối đa 20,4 gam Al2O3. Giá trị của m là: A. 23,5. B. 25,6. C. 50,4 D. 51,1 Câu 18. Điện phân nóng chảy Al2O3 với các điện cực bằng than chì, thu được m kilogam Al ở catot và 89,6 m3 (đktc) hỗn hợp khí X ở anot. Tỉ khối của X so với H2 bằng 16,7. Cho 1,12 lít X (đktc) phản ứng với dung dịch Ca(OH)2 dư, thu được 1,5 gam kết tủa. Giá trị của m là: A. 115,2 B. 104,4 C. 82,8 D. 144 Câu 19. Dãy các kim loại đều có thể được điều chế bằng phương pháp điện phân dung dịch muối (với điện cực trơ) là: A. Ni, Cu, Ag. B. Li, Ag, Sn. C. Ca, Zn, Cu. D. Al, Fe, Cr. Câu 20. Điện phân dung dịch hỗn hợp HCl, NaCl, FeCl3, CuCl2. Trình tự điện phân ở catot là A. Cu2+ > Fe3+ > H+ (axit) > Na+ > H+ (H2O).

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. Fe3+ > Cu2+ > H+ (axit) > Fe2+ > H+ (H2O). C. Fe3+ > Cu2+ > H+ (axit) > H+ (H2O). D. Cu2+ > Fe3+ > Fe2+ > H+ (axit) > H+ (H2O). Câu 21. Người ta điều chế H2 và O2 bằng phương pháp điện phân dung dịch NaOH với điện cực trơ, cường độ dòng điện 0,67A trong thời gian 40 giờ. Dung dịch thu được sau điện phân có khối lượng 100 gam và nồng độ NaOH là 6%. Nồng độ dung dịch NaOH trước điện phân là (giả thiết lượng nước bay hơi không đáng kể) A. 5,08% B. 6,00% C. 5,50% D. 3,16% Câu 22. Dung dịch X chứa hỗn hợp các muối: NaCl, CuCl2, FeCl3 và ZnCl2. Kim loại cuối cùng thoát ra ở catot khi điện phân dung dịch X là A. Na. B. Zn. C. Fe. D. Cu. Câu 23. Điện phân dung dịch hỗn hợp gồm 0,1 mol FeCl3, 0,2 mol CuCl2 và 0,1 mol HCl (điện cực trơ). Khi ở catot bắt đầu thoát khí thì ở anot thu được V lít khí (đktc). Biết hiệu suất của quá trình điện phân là 100%. Giá trị của V là A. 4,48. B. 5,60. C. 11,20. D. 22,40. Câu 24. Điện phân bằng điện cực trơ dung dịch muối sunfat của kim loại hoá trị II với dòng điện cường độ 6A. Sau 29 phút điện phân thấy khối lượng catot tăng 3,45 gam. Kim loại đó là: A. Zn. B. Cu. C. Ni. D. Sn. Câu 25. Hòa tan 13,68 gam muối MSO4 vào nước được dung dịch X. Điện phân X (với điện cực trơ, cường độ dòng điện không đổi) trong thời gian t giây, được y gam kim loại M duy nhất ở catot và 0,035 mol khí ở anot. Còn nếu thời gian điện phân là 2t giây thì tổng số mol khí thu được ở cả hai điện cực là 0,1245 mol. Giá trị của y là A. 4,788. B. 1,680. C. 4,480. D. 3,920. Câu 26. Dãy gồm các kim loại được điều chế trong công nghiệp bằng phương pháp điện phân hợp chất nóng chảy của chúng là A. Na, Ca, Al. B. Na, Ca, Zn. C. Na, Cu, Al. D. Fe, Ca, Al. Câu 27. Điện phân dung dịch có màng ngăn xốp hỗn hợp CuSO4 (0,05 mol) và NaCl bằng dòng điện có cường độ không đổi 2A (điện cực trơ, màng ngăn xốp). Sau thời gian t giây thì ngừng điện phân, thu được

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

dung dịch Y và khí ở hai điện cực có tổng thể tích là 2,24 lít (đktc). Dung dịch Y hòa tan tối đa 0,8 gam MgO. Biết hiệu suất điện phân 100%, các khí sinh ra không tan trong dung dịch. Giá trị của t là A. 6755 B. 7720 C. 8685 D. 4825 Câu 28. Viết phương trình điện phân tại các điện cực và phản ứng tổng cộng của các dung dịch: HCl, H2SO4, NaOH, NaCl, K2SO4, CuCl2, CuSO4. Số dung dịch có pH giảm dần theo thời gian là A. 1 B. 2 C. 3 D. 4 Câu 29. Điện phân 400ml dung dịch CuSO4 0,5M (điện cực trơ) cho đến khi ở catot thu được 6,4 gam kim loại thì thể tích khí (đktc) thu được ở anot là A. 2,24 lít. B. 4,48 lít. C. 0,56 lít. D. 1,12 lít.

N Ơ H

Tính trong 0,1 mol hỗn hợp X đem thử trước, gọi số mol CO, O2 lần lượt là x, y mol. Dễ thấy từ 2 gam kết tủa → số mol CO2 = 0,02 mol. Theo đó, nX = 0,02 + x + y = 0,1 → x + y = 0,08 mol.

UY

.Q P T

N

Từ tỉ khối so với H2 dX/H2 = 16 → 44 × 0,02 + 28x + 32y = 1,6 × 2 → 28x + 32y = 2,32.

O Ạ Đ

Giải hệ tìm được x = 0,06 mol và y = 0,02 mol. __________________________________________________

G N Ư

►Nhanh hơn có thể để ý tỉ khối so với H2 bằng 16 mà tỉ khối của O2 so với H2 cũng bằng 16 nên

H

tỉ khối của X so với H2 cũng chính là của hh CO, CO2 so với H2, dùng sơ đồ đường chéo tìm ra tỉ lệ CO ÷ CO2 → ok!.

N Ầ TR

Bảo toàn O, ta có số mol O2 sinh ra ở phản ứng điện phân là (0,02 + 0,03 + 0,02) × 30 = 2,1 mol.

0 00

B

Cũng từ phương trình điện phân → nAl = 2,1 × 4 ÷ 3 = 2,8 mol → mAl = 2,8 × 27 = 75,6 kg.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B

bên catot sẽ xảy ra sự điện phân nước: Bảo toàn e:

Câu 2: B Quá trình phản ứng xảy ra như sau:

Ỡ Ư D

NG

TO

ÁN

.

I Ồ B

-L

Í-

A Ó H

P Ấ C

2

1 3 +

Vậy đáp án đúng là B. ♦♦♦ Câu 3: A Câu 4: A Thể tích khí giảm chính là thể tích O2 phản ứng (do thể tích O2 nhiều hơn CO nên CO phản ứng hết)

Số mol nguyên tử Oxi có trong Al2O3 là

.

Câu 5: C Câu 6: A Sau đó, Oxi sinh ra tác dụng với Cacbon tạo thành CO2, CO và O2 dư. Khi điều chế 2,7 tấn Al thì số Mmol O2 thu được là 0,075 Mmol Đặt số mol O2 dư là x => số mol CO2 là 7x và CO là 2x. Bảo toàn oxi Khối lượng than: Câu 7: C Câu 8: D Câu 9: B

Sau đó, do điện cực bằng than chì nên: → Như vậy, hỗn hợp X có thể gồm CO2, CO, O2.

Sưu tầm bởi GV. Nguyễn Thanh Tú

nên

còn dư, tiếp tục điện phân

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Catot xuất hiện bọt khí có nghĩa là bắt đầu quá trình điện phân nước ở cả 2 điện cực thì dừng điện phân

♦ Xét trong 89,6 m3:

UY

Vậy trong quá trình điện phân, sản phẩm thu được ở anot là khí Câu 10: A Câu 11: C Câu 12: C Câu 13: B Câu 14: A Câu 15: C Câu 16: C Nhận xét được lượng chất rắn > bột Fe nên sau phản ứng điện phân thì AgNO3 còn dư và chất rắn này

0 00

Sau đó: 3Fe + 8HNO3 → 3Fe(NO3)2 + 2NO↑ + 4.H2O. || Fe + 2AgNO3 → Fe(NO3)2 + 2Ag↓. Quan trọng tiếp theo là chọn ẩn sao cho tính toán nhanh:

Số mol sắt phản ứng: y = (0,15 - x ) ÷ 2 + 3x ÷ 8 → x ÷ 8 + y = 0,075 mol.

Vậy thời gian điện phân t = 96500 × 0,1 ÷ 2,68 = 3600 s = 1h Câu 17: D Câu 18: B Khí thu được ở anot gồm CO, CO2 và O2 Xét trong 0,05 lít hỗn hợp khí X:

D I BỒ

ƯỠ

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

G N Ư

như Zn, Fe, Ni, Sn, Pb, Cu, Ag,.. Câu 20: B Câu 21: C Câu 22: B Câu 23: B Khi catot bắt đầu có khí, có nghĩa là bắt đầu điện phân

Cả quá trình: điện phân: 2AgNO3 + H2O → 2Ag + 2HNO3 + ½.O2↑ .

Khối lượng chất rắn: 14,5 = ( 0,225 - y) × 56 + (0,15 - x ) × 108 → 108x + 56y = 14,3 gam.

N

Câu 19: A Phương pháp điện phân dung dịch muối(với điện cực trơ) dùng để điều chế các kim loại có tính khử trung bình và yếu

cũng có thể gồm Fe dư ( nếu không dư thì trong quá trình tính toán số mol nó = 0 thôi ).

gọi số mol AgNO3 bị điện phân là x mol, số mol sắt bị hoà tan là y mol thì ta có:

O Ạ Đ

.Q P T

N Ơ H

2

1 3 +

B

N Ầ TR

H

đã điện phân hết

Câu 24: B Câu 25: C Câu 26: A Các kim loại mạnh tử Al trở lên được điều chế trong công nghiệp bằng phương pháp điện phân hợp chất nóng chảy của chúng Vậy các kim loại thỏa mãn là Na, Ca, Al. Câu 27: C Nhận thấy dung dịch Y hòa tan tối đa 0,02 mol MgO → trong Y chứa H+ = 2nMgO = 0,04 mol → nO2 = 0,01 mol Vì khí sinh ra ở 2 điện cực. Bên catot điện phân Cu2+ : 0,05 mol và điện phân nước sinh ra x mol H2 Bên anot điện phân Cl- sinh ra Cl2 : y mol và điện phân nước sinh ra O2 : 0,01 + 0,5x. Chú ý khi điện phân hết Cu2+ thì quá trình điện phân chỉ là điện phân nước : 2H2O → 2H2 + O2. Vậy cứ x mol H2 sinh ra bên catot thì bên anot có 0,5x mol O2 → ∑ nO2 = 0,01 + 0,5x

Khi đó ta có hệ

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Vậy ne trao đổi = 2nCu + 2nH2 = 2. 0,05 + 2. 0,04 = 0,18 mol

Có ne = = Câu 28: B Câu 29: D

UY

= 0,18 → t = 8685 giây.

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

5. PP giải các dạng toán trọng tâm Cacbohiđrat - Polime (Đề 1) Câu 1. Clo hoá PVC thu được một polime chứa 63,96% clo về khối lượng, trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC. Giá trị của k là (cho H = 1, C = 12, Cl = 35,5) A. 3 B. 6 C. 4 D. 5 Câu 2. Cho 18,0 gam một cacbohiđrat X tác dụng hết với dung dịch AgNO3/NH3 thu được 25,92 gam Ag. Biết X có khả năng làm mất màu dung dịch Br2. X là chất nào dưới đây ? CH 2 − CH − CH − CH − C − CH 2 A.

| | | | || | OH OH OH OH O OH CH 2 − CH − CH − CH − CH − CHO

B.

| | | | | OH OH OH OH OH CH 2 − CH − CH − C − CH 2

C.

| | | || | OH OH OH O OH CH 2 − CH − CH − CH − CHO

D.

| | | | OH OH OH OH Câu 3. Cacbohiđrat X có phản ứng tráng gương. Đun nóng a mol X trong dung dịch HCl loãng dư để các phản ứng xảy ra hoàn toàn thu được dung dịch Y. Trung hoà axit còn dư, sau đó cho AgNO3 dư trong NH3 vào Y, đồng thời đun nóng, sau khi phản ứng hoàn toàn thu được 4a mol Ag. X có thể là cacbohiđrat nào sau đây ? A. Xenlulozơ. B. Mantozơ. C. Saccarozơ. D. Glucozơ. Câu 4. Một đoạn mạch xenlulozơ có khối lượng là 48,6 mg. Số mắt xích glucozơ (C6H10O5) có trong đoạn mạch đó là: A. 1,626.1023 B. 1,807.1023. C. 1,626.1020 D. 1,807.1020. Câu 5. Lượng glucozơ cần dùng để tạo ra 1,82 gam sobitol với hiệu suất 80% là A. 1,44 gam B. 1,80 gam. C. 1,82 gam D. 2,25 gam Câu 6. Thuỷ phân hoàn toàn 3,42 gam saccarozơ trong môi trường axit, thu được dung dịch X. Cho toàn bộ dung dịch X phản ứng hết với lượng dư dung dịch AgNO3 trong NH3, đun nóng, thu được m gam Ag. Giá trị của m là A. 2,16.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 4,32. C. 21,60. D. 43,20. Câu 7. Chia 200 gam dung dịch hỗn hợp glucozơ và fructozơ thành hai phần bằng nhau. Phần 1 tác dụng hết với lượng dư dung dịch AgNO3 trong NH3 được 86,4 gam Ag. Phần 2 tác dụng vừa hết với 35,2 gam Br2. Nồng độ % của fructozơ trong dung dịch ban đầu là A. 16,2%. B. 32,4%. C. 39,6%. D. 40,5%. Câu 8. Chia một hỗn hợp gồm tinh bột và glucozơ thành hai phần bằng nhau. Cho phần thứ nhất vào nước dư rồi cho phản ứng hoàn toàn với AgNO3 trong NH3 dư thì được 2,16 gam Ag. Đun phần thứ hai với HCl loãng đến phản ứng hoàn toàn, sau đó trung hòa bằng NaOH rồi cũng cho tác dụng với lượng dư dung dịch AgNO3 trong NH3 thì được 6,48 gam Ag. Khối lượng tinh bột trong hỗn hợp đầu là A. 3,24 gam. B. 4,86 gam. C. 6,48 gam. D. 9,72 gam. Câu 9. Thủy phân hỗn hợp gồm 0,01 mol saccarozơ và 0,02 mol mantozơ trong môi trường axit, với hiệu suất đều là 60% theo mỗi chất, thu được dung dịch X. Trung hòa dung dịch X, thu được dung dịch Y, sau đó cho toàn bộ Y tác dụng với lượng dư dung dịch AgNO3 trong NH3, thu được m gam Ag. Giá trị của m là A. 6,480. B. 7,776. C. 8,208. D. 9,504. Câu 10. Thủy phân hỗn hợp gồm 0,02 mol saccarozơ và 0,01 mol mantozơ một thời gian thu được dung dịch X (hiệu suất phản ứng thủy phân mỗi chất đều là 75%). Khi cho toàn bộ X tác dụng với một lượng dư dung dịch nước brom thì số mol Br2 đã phản ứng tối đa là A. 0,025. B. 0,0325. C. 0,04. D. 0,0475. Câu 11. Khối lượng của tinh bột cần dùng trong quá trình lên men để tạo thành 5 lít ancol etylic 46º là (biết hiệu suất của cả quá trình là 72% và khối lượng riêng của ancol etylic nguyên chất là 0,8 g/ml) A. 5,0 kg. B. 5,4 kg. C. 6,0 kg. D. 4,5 kg. Câu 12. Số mắt xích vinyl clorua có trong 100 gam poli(vinyl clorua) là A. 9,63.1024. B. 9,63.1023 C. 9,63.1022. D. 9,63.1021 Câu 13. Cao su lưu hóa chứa khoảng 2% lưu huỳnh. Cứ k mắt xích isopren có một cầu nối đisunfua –S–S–, biết rằng S đã thay thế cho H ở nhóm metylen trong mạch cao su. Giá trị của k là

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. 23 B. 24 C. 46 D. 48 Câu 14. Cứ 42,7 gam cao su buna-N phản ứng vừa hết với 48 gam brom trong benzen. Tỉ lệ mắt xích butađien và acrilonitrin trong cao su buna-N trên là: A. 1 : 2 B. 3 : 5 C. 3 : 4 D. 2 : 3 Câu 15. Đồng trùng hợp buta–1,3–đien với acrilonitrin(CH2=CH–CN) theo tỉ lệ tương ứng x : y, thu được một loại polime. Đốt cháy hoàn toàn một lượng polime này, thu được hỗn hợp khí và hơi (CO2, H2O, N2) trong đó có 58,065 % CO2 về thể tích. Tỉ lệ x : y khi tham gia trùng hợp là bao nhiêu ? x 1 A. = y 3 B.

x 2 = y 3

C.

x 3 = y 2

x 3 = y 5 Câu 16. Khi cho một loại cao su buna-S tác dụng với brom (tan trong CCl4) thì cứ 2,1 gam cao su đó có thể làm mất màu hoàn toàn 1,6 gam brom. Tỉ lệ mắt xích butađien và stiren trong cao su buna-S là A. 1 : 3. B. 1 : 2. C. 2 : 3. D. 3 : 5. Câu 17. Đun hỗn hợp gồm acrilonitrin và ankađien liên hợp X (tỉ lệ mol 1:1) thu được polime Y. Trong Y có 78,505% khối lượng cacbon. Công thức của Y là A. –[–CH2–C(CH3)=CH–CH2–CH2–CH(CN)–]–n B. –[–CH2–CH=CH–CH2–CH2–CH(CN)–]–n C. –[–CH2–C(CH3)=C(CH3)–CH2–CH2–CH(CN)–]–n D. –[–CH2–CH2–CH2–CH2–CH2–CH(CN)–]–n Câu 18. Polime X chứa 38,4% C, 4,8% H, còn lại là Cl về khối lượng. Công thức phân tử của X là A. (C2HCl3)n. B. (C2H3Cl)n. C. (CHCl)n. D. (C3H4Cl2)n. Câu 19. Thủy phân hoàn toàn m gam hỗn hợp X gồm saccarozơ và mantozơ thu được dung dịch Y. Cho Y tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 0,2 mol Ag. Mặt khác, thủy phân m gam hỗn hợp X một thời gian (hiệu suất thủy phân mỗi chất đều là 80%) thu được dung dịch Z. Cho Z tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 0,188 mol Ag. Thành phần %về khối lượng của saccarozơ trong hỗn hợp là: A. 60%.

UY

0 00

D.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

1 3 +

N Ơ H

B. 55%. C. 40%. D. 45%. Câu 20. Cho 50ml dung dịch glucozơ chưa rõ nồng độ tác dụng với một lượng dư AgNO3 trong dung dịch NH3 thu được 2,16 gam Ag kết tủa. Nồng độ mol của dung dịch glucozơ đã dùng là A. 0,20M. B. 0,10M. C. 0,02M. D. 0,01M. Câu 21. Dung dịch X chứa m gam hỗn hợp glucozơ và saccarozơ. - Thực hiện phản ứng tráng gương hoàn toàn dung dịch X thu được 0,02 mol Ag. - Đun nóng X với HCl loãng đến phản ứng hoàn toàn, trung hòa axit dư thu được dung dịch Y. Đun nóng Y với lượng dư dung dịch AgNO3 trong NH3 thì thu được tối đa 0,06 mol Ag. Giá trị của m là A. 5,22. B. 3,60. C. 10,24. D. 8,64. Câu 22. Từ 180 gam glucozơ, bằng phương pháp lên men rượu, thu được a gam ancol etylic (hiệu suất 80%). Oxi hoá 0,1a gam ancol etylic bằng phương pháp lên men giấm, thu được hỗn hợp X. Để trung hoà hỗn hợp X cần 720 ml dung dịch NaOH 0,2M. Hiệu suất quá trình lên men giấm là A. 90%. B. 10%. C. 80%. D. 20%. Câu 23. Lên men m gam glucozơ với hiệu suất 90%, lượng khí CO2 sinh ra hấp thụ hết vào dung dịch nước vôi trong, thu được 10 gam kết tủa. Khối lượng dung dịch sau phản ứng giảm 3,4 gam so với khối lượng dung dịch nước vôi trong ban đầu. Giá trị của m là A. 20,0. B. 30,0. C. 13,5. D. 15,0. Câu 24. Để điều chế 53,46 kg xenlulozơ trinitrat (hiệu suất 60%) cần dùng ít nhất V lít axit nitric 94,5% (D = 1,5 g/ml) phản ứng với xenlulozơ dư. Giá trị của V là A. 60. B. 24 C. 36. D. 40. Câu 25. Khối lượng của một đoạn mạch tơ nilon-6,6 là 27346 đvC và của một đoạn mạch tơ capron là 17176 đvC. Số lượng mắt xích trong đoạn mạch nilon-6,6 và capron nêu trên lần lượt là A. 113 và 152. B. 113 và 114. C. 121 và 152. D. 121 và 114.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 26. Đun nóng 8,55 gam cacbohiđrat X với dung dịch HCl đến phản ứng hoàn toàn. Cho dung dịch sau phản ứng tác dụng với lượng dư AgNO3/NH3, kết tủa thu được có 10,8 gam Ag. X có thể là chất nào dưới đây (biết MX < 400 đvC)? A. Glucozơ. B. Fructozơ. C. Saccarozơ. D. Xenlulozơ. Câu 27. Đốt cháy hoàn toàn 2,7 gam X (chứa C, H, O) rồi dẫn toàn bộ sản phẩm cháy vào 100 ml dung dịch chứa 0,065 mol Ca(OH)2 thì thu được 4 gam kết tủa và dung dịch Y, khối lượng bình tăng 5,58 gam. Đun nóng dung dịch Y lại thấy xuất hiện kết tủa. Mặt khác, 13,5 gam X phản ứng với lượng dư Cu(OH)2/NaOH (đun nóng) được 10,8 gam kết tủa. Chất X là: A. HCHO. B. (CHO)2. C. C6H12O6. D. HO-C4H8-CHO. Câu 28. Từ 1,0 tấn tinh bột có thể điều chế được bao nhiêu tấn cao su buna (gồm 80% là poli(buta-1,3-đien)) biết hiệu suất cả quá trình là 30% ? A. 0,5 tấn. B. 0,33 tấn. C. 0,125 tấn. D. 0,1 tấn Câu 29. Tinh bột được tạo thành trong cây xanh nhờ quá trình quang hợp từ CO2 và hơi nước. Biết rằng CO2 chiếm 0,03% thể tích không khí. Muốn có 40,5 gam tinh bột thì thể tích không khí (đktc) cần dùng để cung cấp lượng CO2 cho phản ứng quang hợp là A. 112000,0 lít. B. 18666,7 lít. C. 112,0 lít. D. 186,7 lít. Câu 30. Lên men m gam glucozơ để tạo thành ancol etylic (hiệu suất phản ứng bằng 90%). Hấp thụ hoàn toàn lượng khí CO2 sinh ra vào dung dịch Ca(OH)2 dư, thu được 15 gam kết tủa. Giá trị của m là A. 45,0 B. 18,5 C. 7,5 D. 15,0 Câu 31. Cho m gam tinh bột lên men thành ancol etylic với hiệu suất 81%. Toàn bộ lượng CO2 sinh ra được hấp thụ hoàn toàn vào dung dịch Ca(OH)2, thu được 550 gam kết tủa và dung dịch X. Đun kỹ dung dịch X thu thêm được 100 gam kết tủa. Giá trị của m là A. 550. B. 810. C. 650. D. 750. Câu 32. Cho xenlulozơ phản ứng với anhiđrit axetic (có H2SO4 đặc làm xúc tác, to) thu được 12,0 gam hỗn hợp X (gồm xenlulozơ triaxetat, xenlulozơ điaxetat và 4,2 gam CH3COOH). Thành phần % theo khối lượng của xenlulozơ triaxetat và xenlulozơ điaxetat trong X lần lượt là A. 48,0 và 20,5%.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 24,0% và 41,0%. C. 39,87% và 25,13%. D. 45,26% và 34,06%. Câu 33. Phản ứng tổng hợp glucozơ trong cây xanh như sau: 6CO2 + 6H2O → C6H12O6 + 6O2 (∆H = 2813 kJ). Nếu trong mỗi phút, mỗi cm2 trên bề mặt trái đất nhận được khoảng 2,09 J năng lượng mặt trời, nhưng chí sử dụng 10% vào phản ứng tổng hợp glucozơ. Với một ngày nắng (từ 6h00 đến 17h00) diện tích lá xanh là 1m2 thì lượng glucozơ tổng hợp được là A. 88,27 gam. B. 88,32 gam. C. 90,26 gam. D. 90,32 gam. Câu 34. Đun nóng 34,2 gam mantozơ trong dung dịch axit sunfuric loãng. Trung hòa dung dịch thu được sau phản ứng bằng dung dịch NaOH rồi cho tác dụng hoàn toàn với dung dịch AgNO3/NH3 dư, đun nóng thu được 37,8 gam Ag. Hiệu suất của phản ứng thủy phân mantozơ A. 87,5% B. 69,27% C. 62,5% D. 75,0% Câu 35. Phân tử khối trung bình của PE, nilon-6 và xenlulozơ lần lượt là: 420000; 1582000 và 2106000. Hệ số polime hóa của chúng không thể đạt giá trị nào ? A. 15000. B. 14000. C. 13000. D. 12456. Câu 36. Polime X có khối lượng mol phân tử là 400.000 gam/mol và hệ số trùng hợp là n = 4000. X là polime nào dưới đây?

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

A. B.

C.

D. Câu 37. Khi tiến hành đồng trùng hợp buta-1,3-đien và acrilonitrin với xúc tác Na thu được một loại cao su buna-N chứa 10,44 % nitơ về khối lượng. Tỉ lệ số mol buta-1,3-đien và acrilonitrin trong cao su trên là A. 2 : 3. B. 2 : 1. C. 3 : 2. D. 4 : 3.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 38. Khi clo hóa PVC ta thu được một loại tơ clorin X. Biết trung bình một phân tử clo tác dụng với 4 mắt xích PVC. Tính % khối lượng clo trong tơ clorin X ? A. 73,20% B. 66,77% C. 63,96% D. 62,39% Câu 39. Một loại cao su Buna–S có phần trăm khối lượng cacbon là 90,225%; m gam cao su này cộng tối đa với 9,6 gam brom. Giá trị của m là A. 5,32. B. 6,36. C. 4,80. D. 5,74. Câu 40. Khi tiến hành phản ứng trùng ngưng giữa axit ađipic và hexametylenđiamin ta thu được một tơ nilon6,6 chứa 12,39% nitơ về khối lượng. Tỉ lệ số mắt xích giữa axit ađipic và hexametilenđiamin trong mẫu tơ trên là: A. 1:3 B. 1:1 C. 2:3 D. 3:2

Câu 7: A Câu 8: C Câu 9: D C12H22O11 (sac) + H2O

0,01------------------------0,01 x 60%--------0,01 x 60% C12H22O11 (man) + H2O

Câu 1: A Câu 2: Câu 3: B Câu 4: D Số mắt xích: Câu 5: D Câu 6: B C12H22O11 + H2O

C6H12O6 (glu) + C6H12O6 (fru)

N Á O

nglu = nfru = 3,42 : 342 = 0,01 mol → nglu = nfru = 0,01 mol. Glu

2Ag↓

0,01-----------------0,02 Fru

Ỡ Ư D

NG

T

Í -L

-

A Ó H

P Ấ C

3 2+

2C6H12O6 (glu)

0,02-----------------------0,02 x 2 x 60%

G N Ư

O Ạ Đ

UY

.Q P T

N

Sau phản ứng thu được nglu = 0,01 x 60% + 0,02 x 2 x 60% = 0,03 mol; nfru = 0,01 x 60% = 0,006 mol; nsac = 0,01 - 0,01 x 60% = 0,004 mol; nman = 0,02 - 0,02 x 60% = 0,008 mol. 1Glu

2Ag↓

N Ầ TR

0,03-------------------0,06

0B 1Fru

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

C6H12O6 (glu) + C6H12O6 (fru)

N Ơ H

0 0 1

H

2Ag↓

0,006------------------0,012 1Man

2Ag↓

0,008------------------0,016 → ∑nAg = 0,06 + 0,012 + 0,016 = 0,088 mol → m = 0,088 x 108 = 9,504 gam Câu 10: B Câu 11: D Câu 12: B Số mắt xích vinyl clorua có trong 100 gam poli(vinyl clorua) là Câu 13: C Phương trình :C5kH8k + 2S → C5kH8k-2S2

×6,02×1023= 9,63.1023

Ta có %S = ×100% = 2% → k≈ 46,15 Câu 14: B Gọi số mol mắt xích butadien là x, số mol mắt xích acrilonitrin là y

2Ag↓

I Ồ B

0,01-----------------0,02

=> =>

→ ∑nAg = 0,04 mol → m = 0,04 x 108 = 4,32 gam

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 15: C Cứ x mol butadien thì có y mol acrilonitrin. Khi đốt cháy thì

Số mol HNO3 cần dùng là n =

→V=

=

UY

= 40000 ml = 40 L.

=> =>

N Ơ H

=900 mol

.Q P T

N

Câu 25: C Câu 26: C Câu 27: C +)Nhận thấy sản phẩm cháy gồm CO2 và H2Odẫn vàodung dịch Ca(OH)2 tạo kết tủa và dung dịch đun nóng lại thu được kết tủa → phản ứng tạo ra đồng thời hai muối gồm CaCO3,Ca(HCO3)2.

Câu 16: C Cao su buna-S có dạng (C4H6)a.(C8H8)b. 2,1 gam (C4H6)a.(C8H8)b + 0,01 mol Br2

Ta có : X

CO2 + H2O

• n(-C4H6-) = nBr2 = 0,01 mol → m(-C8H8-) = 2,1 - m(-C4H6-) = 2,1 - 0,01 × 54 = 1,56 gam

N Ầ TR

G N Ư

O Ạ Đ

CaCO3 + Ca(HCO3)2.

H

Bảo toàn nguyên tố Ca, C ta có : → n(-C8H8-) = 1,56 : 104 = 0,015 mol → a : b = 0,01 : 0,015 = 2 : 3 Câu 17: B Đun hỗn hợp acrilonitrin và ankađien CnH2n - 2 → polime Y.

nCa(OH)2= nCaCO3 + nCa(HCO3)2 → n nCa(HCO3)2 = 0,065 - 0,04 = 0,025 ( mol).

B

nCO2= nCaCO3 + 2n Ca(HCO3)2= 0,09 (mol).

0 00

Polime Y có dạng (CnH2n-2)a.(C3H3N)a.

→ n ≈ 4 → ankađien là C4H6 → Polime Y là -(-CH2-CH=CH-CH2-CH2-CH(CN)-)nCâu 18: B Câu 19: A 2 sản phẩm thủy phân ở mỗi chất đều tráng bạc nên

Í -L

Nhận thấy, chênh lệch số mol Ag là do 1 phần saccarozo không thủy phân

NG

N Á O

T

Câu 20: A Câu 21: A Câu 22: A Câu 23: D Câu 24: D [C6H7O2(OH)3]n + 3nHNO3 → [C6H7O2(ONO2)3]n + 3nH2O

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

-

A Ó H

P Ấ C

2

1 3 +

mbình tăng = mCO2 + mH2O → nH2O = 0,09 (mol). mX = m C + mH + mO 2,7= 0,09× 12 + 0,18× 1+ nO ×16 → nO =0,09 mol nC : nH : nO =1:2:1 → loại B,D.

+) Khi X phản ứng với Cu(OH)2 tạo Cu2O↓thì nX = nCu2O=0,075 → MX = 180. Vậy X có CTPT C6H12O6. Câu 28: C Câu 29: A Câu 30: D Câu 31: D Câu 32: B Câu 33: A Câu 34: D Câu 35: D M-(CH2-CH2-)n- = 420000 → 28n = 420000 → n = 15000. M-(NH[CH2]5CO-)n- = 1582000 → 113n = 1582000 → n = 14000. M(C6H10O5)n = 2106000 → 162n = 2106000 → n = 13000. Câu 36: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn Ta có MX = Câu 37: Câu 38: D

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

=100 (CF2=CF2)

%

UY

%

Câu 39: A Cao su buna-S có dạng (C4H6)a.(C8H8)b

→ a ≈ 3b → a : b ≈ 3 : 1 → caosu có dạng (C4H6)3b.(C8H8)b. • (C4H6)a.(C8H8)b + tối đa 9,6 gam Br2. (C4H6)3b.(C8H8)b + 3bBr2 → (C4H6Br2)3b.(C8H8)b

→ m(C4H6Br2)3b.(C8H8)b

0 00

→ mcaosu = 14,92 - 9,6 = 5,32 gam

P Ấ C

2

Câu 40: B Nhận thấy có 3 đáp án A,B, C số mol nước do quá trình trùng ngưng tính theo axit ađipic → Giả sử nước tính theo số mol của axit ađipic

A Ó H

Gọi số mol mắt xích của axit ađipic (HOOC-[CH2]4-COOH) là x mol, số mol mắt xích của hexametylenđiamin (H2N-[CH2]6-NH2) là y mol

Í -L

-

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Bảo toàn khối lượng → mtơ = mađipic + mhexametylenđiamin - mH2O = 146x + 116y - 36x= 110x +116y

N Á O

Ta có nN= 2nhexametylenđiamin = 2y

NG

T

×100% = 12,39% → x: y= 1:1

%N =

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

6. Các dạng bài tập về phản ứng điện phân (Đề 2)

Câu 1. Tiến hành điện phân với điện cực trơ, màng ngăn xốp dung dịch chứa m gam hỗn hợp CuSO4 và NaCl cho tới khi nước bắt đầu bị điện phân ở catot thì dừng điện phân. Ở anot thu được 0,448 lít khí (ở đktc). Dung dịch sau điện phân có thể hoà tan tối đa 1,16 gam Fe3O4. Giả sử nước bay hơi không đáng kể trong quá trình điện phân. Độ giảm khối lượng của dung dịch sau điện phân so với dung dịch đầu là A. 1,92 gam. B. 2,95 gam. C. 1,03 gam. D. 2,63 gam. Câu 2. Điện phân 100ml dung dịch chứa: FeCl3 1M, FeCl2 2M, CuCl2 1M và HCl 2M với điện cực trơ, màng ngăn xốp, I = 5A trong 2 giờ 40 phút 50 giây thì ở catot tăng m gam. Giá trị của m là A. 5,6. B. 6,4. C. 2,8. D. 12. Câu 3. Điện phân dung dịch chứa 0,2 mol FeSO4 và 0,06 mol HCl với I = 1,34A trong 2 giờ (điện cực trơ, màng ngăn xốp). Bỏ qua sự hòa tan của clo trong nước, coi hiệu suất của phản ứng điện phân là 100%. Khối lượng kim loại thoát ra ở catot và thể tích khí (đktc) thoát ra ở anot lần lượt là: A. 11,2 gam; 8,96 lít. B. 5,6 gam; 4,48 lít. C. 1,12 gam; 0,896 lít. D. 0,56 gam; 0,448 lít. Câu 4. Điện phân 100ml dung dịch X gồm KCl 0,1M và Cu(NO3)2 0,2M với cường độ dòng điện 5A trong 579 giây, điện cực trơ, màng ngăn xốp. Giả sử nước bay hơi không đáng kể. Độ giảm khối lượng của dung dịch sau khi điện phân là: A. 1,475 gam. B. 1,59 gam. C. 1,67 gam. D. 1,155 gam. Câu 5. Điện phân dung dịch chứa 0,02 mol FeSO4 và 0,06 mol HCl với cường độ dòng điện I = 1,34A trong 2 giờ (điện cực trơ có màng ngăn). Bỏ qua sự hoà tan của khí clo trong H2O, coi hiệu suất điện phân là 100%. Khối lượng kim loại thoát ra ở catot và thể tích khí (đktc) thoát ra ở anot là A. 1,12 gam và 0,896 lít. B. 0,56 gam và 0,448 lít. C. 5,6 gam và 4,48 lít. D. 11,2 gam và 8,96 lít. Câu 6. Để sản xuất H2 và O2 người ta tiến hành điện phân 5000 gam dung dịch KOH 14% (điện cực trơ) với cường độ dòng điện 268A trong 10 giờ (giả sử hiệu suất điện phân 100% và ở nhiệt độ điện phân, nước bay hơi không đáng kể). Nồng độ % của KOH trong dung dịch sau điện phân là: A. 20,02% B. 17,07% C. 23,14% D. 15,8%

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Dung dịch X chứa HCl, CuSO4, Fe2(SO4)3. Lấy 400 ml dung dịch X đem điện phân với điện cực trơ, I = 7,72A đến khi ở catot thu được 5,12 gam Cu thì dừng lại. Khi đó chỉ thu được 0,1 mol một chất khí duy nhất thoát ra ở anot. Thời gian điện phân và nồng độ [Fe2+] sau điện phân lần lượt là A. 2300 s và 0,1M. B. 2500 s và 0,1M. C. 2300 s và 0,15M. D. 2500 s và 0,15M. Câu 8. Điện phân 200 ml dung dịch CuSO4 với các điện cực trơ, I = 9,65A. Khi thể tích các khí thoát ra ở cả 2 điện cực đều bằng 1,12 lít (ở đktc) thì ngừng điện phân. Khối lượng kim loại sinh ra ở catot và thời gian điện phân là A. 6,4 ; 2000 s. B. 3,2 ; 2000 s. C. 3,2 ; 1000 s. D. 6,4 ; 1000 s. Câu 9. Điện phân dung dịch X gồm 0,04 mol AgNO3 và 0,06 mol Fe(NO3)3 với I = 5,36A bằng điện cực trơ, sau t giây thấy catot tăng 5,44 gam. Giá trị của t là A. 2520,5. B. 1440. C. 1800. D. 1440,5. Câu 10. Điện phân 500 ml dung dịch hỗn hợp FeSO4 0,1M, Fe2(SO4)3 0,2M và CuSO4 0,1M với điện cực trơ. Điện phân cho đến khi khối lượng catot tăng 8,8 gam thì ngừng điện phân. Biết cường độ dòng điện đem điện phân là 10A. Thời gian điện phân là: A. 4583,75 giây. B. 3860 giây. C. 4825 giây. D. 2653,75 giây. Câu 11. Điện phân 100 ml dung dịch CuSO4 0,2 M và AgNO3 0,1 M với cường độ dòng điện I = 3,86A. Thời gian điện phân để thu được 1,72 gam kim loại bám trên catot là: A. 1000 giây. B. 250 giây. C. 750 giây. D. 500 giây. Câu 12. Điện phân dung dịch chứa hỗn hợp hai muối CuCl2 và Cu(NO3)3 một thời gian, ở anot của bình điện phân thoát ra 448 ml hỗn hợp khí (đktc) có tỉ khối so với H2 bằng 25,75 và có m gam kim loại Cu bám trên catot (biết trên catot không có khí thoát ra). Giá trị của m là: A. 0,64 gam. B. 1,28 gam. C. 1,92 gam. D. 2,56 gam. Câu 13. Điện phân dung dịch hỗn hợp gồm 0,1 mol FeCl3, 0,2 mol CuCl2 và 0,1 mol HCl (điện cực trơ). Khi ở catot bắt đầu thoát khí thì ở anot thu được V lít khí (đktc). Biết hiệu suất của quá trình điện phân là 100%. Giá trị của V là A. 4,48. B. 5,60.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 11,20. D. 22,40. Câu 14. Điện phân 200 ml dung dịch hỗn hợp gồm HCl 0,1M và CuSO4 0,5M bằng điện cực trơ. Khi ở catot có 3,2 gam Cu thì thể tích khí thoát ra ở anot A. 0,672 lít. B. 0,84 lít. C. 6,72 lít. D. 0,448 lít. Câu 15. Điện phân 200 ml dung dịch CuSO4 với I = 1,93A tới khi catot bắt đầu có bọt khí thoát ra thì dừng lại, cần thời gian là 250 giây. Thể tích khí thu được ở anot (đktc) là A. 28 ml. B. 14 ml. C. 56 ml. D. 42 ml. Câu 16. Điện phân dung dịch hỗn hợp chứa 0,1 mol FeCl3, 0,2 mol CuCl2 và 0,1 mol HCl (điện cực trơ, màng ngăn xốp). Khi ở catot bắt đầu sủi bọt khí thì dừng điện phân. Tại thời điểm này khối lượng catot đã tăng A. 0,0 gam. B. 5,6 gam. C. 12,8 gam. D. 18,4 gam. Câu 17. Có hai bình điện phân mắc nối tiếp nhau. Bình 1 chứa dung dịch CuCl2, bình 2 chứa dung dịch AgNO3. Tiến hành điện phân với điện cực trơ, kết thúc điện phân thấy catot của bình 1 tăng lên 1,6 gam. Khối lượng catot của bình 2 tăng lên là A. 10,80 gam. B. 5,40 gam. C. 2,52 gam. D. 3,24 gam. Câu 18. Điện phân 100ml dung dịch CuSO4 nồng độ 0,5M với điện cực trơ một thời gian thì thấy khối lượng catot tăng 1 gam. Nếu dùng dòng điện một chiều có cường độ 1A, thì thời gian điện phân tối thiểu là A. 0,45 giờ. B. 40 phút 15 giây. C. 0,65 giờ. D. 50 phút 15 giây. Câu 19. Có 2 bình điện phân mắc nối tiếp bình 1 chứa CuCl2, bình 2 chứa AgNO3. Khi ở anot của bình 1 thoát ra 22,4 lít một khí duy nhất thì ở anot của bình 2 thoát ra bao nhiêu lít khí ? (Biết các thể tích đo ở cùng điều kiện) A. 11,2 lít. B. 22,4 lít. C. 33,6 lít. D. 44,8 lít. Câu 20. Điện phân 100 ml dung dịch CuSO4 0,2M và AgNO3 0,1M với cường dòng điện I = 3,86A. Tính thời gian điện phân để được một khối lượng kim loại bám bên catot là 1,72 gam. A. 250 s. B. 1000 s. C. 500 s.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 750 s. Câu 21. Điện phân 200ml dung dịch CuSO4 với điện cực trơ bằng dòng điện một chiều I = 9,65A. Khi thể tích khí thoát ra ở cả hai điện cực đều là 1,12 lít (đktc) thì dừng điện phân. Khối lượng kim loại sinh ra ở catot và thời gian điện phân là: A. 3,2 gam và 2000s. B. 2,2 gam và 800s. C. 6,4 gam và 3600s. D. 5,4 gam và 800s. Câu 22. Điện phân dung dịch X chứa 0,4 mol M(NO3)2 (với điện cực trơ) trong thời gian 48 phút 15 giây, thu được 11,52 gam kim loại M tại catot và 2,016 lít khí (đktc) tại anot. Tên kim loại M và cường độ dòng điện là A. Fe và 24A. B. Zn và 12A. C. Ni và 24A. D. Cu và 12A. Câu 23. Điện phân 400ml dd AgNO3 0,2M và Cu(NO3)2 0,1M với cường độ dòng điện I = 10A, anot bằng Pt. Sau thời gian t, ta ngắt dòng điện, thấy khối lượng catot tăng thêm m gam trong đó có 1,28 gam Cu. Thời gian điện phân t là (hiệu suất điện phân là 100%) A. 116 s. B. 1158 s. C. 772 s. D. 193 s. Câu 24. Điện phân 100 ml dung dịch chứa CuSO4 0,2M và AgNO3 0,1M, với cường độ dòng điện I = 1,93A. Tính thời gian điện phân để được một khối lượng kim loại bám trên catot là 1,72 gam. A. 1500 s. B. 1250 s. C. 750 s. D. 2500 s. Câu 25. Mắc nối tiếp 2 bình điện phân: -Bình 1: chứa 800ml dung dịch muối MCl2 a (M) và HCl 4a (M). - Bình 2: chứa 800ml dung dịch AgNO3. Sau 3 phút 13 giây điện phân thì ở catot bình 1 thoát ra 1,6 gam kim loại, còn ở catot bình 2 thoát ra 5,4 gam kim loại. Sau 9 phút 39 giây điện phân thì ở catot bình 1 thoát ra 3,2 gam kim loại, còn ở catot bình 2 thoát ra 16,2 gam kim loại. Biết hiệu suất điện phân là 100%. Kim loại M là (biết tại catot nước chưa bị điện phân) A. Fe. B. Zn. C. Cu. D. Ni. Câu 26. Hòa tan 4,41 gam tinh thể MSO4.5H2O vào nước được dung dịch X. Điện phân dung dịch X với điện cực trơ, I = 1,93A. - Nếu thời gian điện phân là t giây thì thu được kim loại tại catot và 0,007 mol khí tại anot. - Nếu thời gian điện phân là 2t giây thì thu được 0,024 mol khí. Kim loại M và thời gian t là A. Cu; 1400 s. B. Ni; 1400 s. C. Fe; 2800 s.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. Cu; 2800 s. Câu 27. Điện phân 200ml dung dịch Cu(NO3)2 đến khi bắt đầu có khí thoát ra ở catot dừng lại. Để yên dung dịch sau khi điện phân đến khi khối lượng catot không đổi thì thấy có 3,2 gam kim loại bám vào catot. Nồng độ mol của dung dịch Cu(NO3)2 ban đầu là A. 1M B. 2,5M C. 0,5M D. 3M Câu 28. Điện phân dung dịch CuSO4 với điện cực trơ, cường độ dòng 5A. Khi ở anot có 4 gam khí oxi bay ra thì ngưng. Điều nào sau đây luôn đúng ? A. Khối lượng đồng thu được ở catot là 16 gam. B. Thời gian điện phân là 9650 giây. C. pH của dung dịch trong quá trình điện phân luôn giảm. D. Không có khí thoát ra ở catot. Câu 29. Tiến hành điện phân (với điện cực Pt) 200 gam dung dịch NaOH 10 % đến khi dung dịch NaOH trong bình có nồng độ 25 % thì ngừng điện phân. Thể tích khí (ở đktc) thoát ra ở anot và catot lần lượt là: A. 149,3 lít và 74,7 lít. B. 156,8 lít và 78,4 lít. C. 78,4 lít và 156,8 lít. D. 74,7 lít và 149,3 lít. Câu 30. Hòa tan hoàn toàn m gam MSO4 (M là kim loại) vào nước thu được dung dịch X. Điện phân dung dịch X (điện cực trơ, hiệu suất 100%) với cường độ dòng điện 7,5A không đổi, trong khoảng thời gian 1 giờ 4 phút 20 giây, thu được dung dịch Y và khối lượng catot tăng a gam. Dung dịch Y tác dụng vừa đủ với 200 ml dung dịch chứa KOH 1M và NaOH 1M, sinh ra 4,9 gam kết tủa. Coi toàn bộ lượng kim loại sinh ra đều bám hết vào catot. Giá trị của (m + a) gần nhất với A. 33. B. 36. C. 39. D. 42.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

N Á O

Câu 1: B Catot Anot

I Ồ B

Ỡ Ư D

NG

Í -L

T

-

A Ó H

P Ấ C

2

Câu 2: B

UY

Thứ tự điện phân:

hết, điện phân dừng lại khi

nên

Câu 3: C

N Ầ TR

H

O Ạ Đ

.Q P T

G N Ư

Số electron trao đổi trong quá trình điện phân là ne =

=

N Ơ H

N

hết

= 0,1 mol

Nhận thấy ne = 0,1 < nH+ + 2nFe2+ → bên catot H+ điện phân hết, Fe2+ điện phân một phần

1 3 +

0 00

B

Số mol Fe2+ bị điện phân là

= 0,02 mol

→ mFe = 0,02. 56 = 1,12 gam ne > nCl- → bên anot xảy ra quá trình điện phân hết Cl- sinh Cl2 : 0,03 mol, điện phân tiếp nước sinh ra O2

nO2 =

= 0,01 mol

→ ∑nkhí = 0,01 + 0,03 = 0,04 mol → V = 0,896 lít Câu 4: A

nên ở anot có sự điện phân nước

Độ giảm khối lượng của dung dịch sau điện phân so với dung dịch đầu là

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 5: A Số electron trao đổi trong quá trình điện phân là ne =

=

= 0,1 mol Bên anot điện phân nước sinh ra O2 : 0,05 mol

UY

Nhận thấy ne = 0,1 < nH+ + 2nFe2+ → bên catot H+ điện phân hết, Fe2+ điện phân một phần Bảo toàn electron có nCu = Số mol Fe2+ bị điện phân là

=

→ mFe = 0,02. 56 = 1,12 gam

Thời gian điện phân là t= = 0,01 mol

N Ầ TR

Câu 9: A → ∑nkhí = 0,01 + 0,03 = 0,04 mol → V = 0,896 lít Câu 6: B Điện phân dung dịch KOH chính là điện phân nước

0 00

%

%

Câu 7: B Thứ tự phản ứng:

N Á O

Chất khí thoát ra duy nhất chính là

I Ồ B

Ỡ Ư D

NG

T

Í -L

-

A Ó H

P Ấ C

O Ạ Đ

N

Số electron trao đổi trong quá trình điện phân là ne = 4nO2 = 0,2 mol

ne > nCl- → bên anot xảy ra quá trình điện phân hết Cl- sinh Cl2 : 0,03 mol, điện phân tiếp nước sinh ra O2

Sau khi điện phân:

.Q P T

= 0,05 mol

= 0,02 mol → mCu = 0,05. 64 = 3,2 gam

nO2 =

N Ơ H

Điện phân đến khi có khí thoát ra ở cả hai điện cực → chứng tỏ bên catot xảy ra quá trình điện phân nước sinh ra H2 : 0,05 mol

2

1 3 +

B

H

G N Ư = 2000s

nên có cả Fe

Các ion đã điện phân ở catot:

Câu 10: C

Các ion đã điện phân ở catot:

1 phần

Câu 11: C Nhận thấy khi điện phân hỗn hợp dung dịch CuSO4 và AgNO3 thì Ag+ bị điện phân trước Có mAg < 1, 72 < mAg + mCu → Ag+ bị điện phân hết, Cu2+ điện phân một phần tạo Cu

Câu 8: B Gọi số mol CuSO4 là x mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

Sô mol Cu2+ bị điện phân là

= 0,01 mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Thời gian điện phân là t =

UY

Câu 20: D Câu 21: A

= 750 giây

Câu 12: C

Câu 22: D Câu 13: B Khi catot bắt đầu có khí, có nghĩa là bắt đầu điện phân

đã điện phân hết

0 00

Câu 14: A nên ở anot, đã có sự điện phân nước tạo ra oxi

Câu 15: A Số electron trao đổi là ne =

N Á O

= 0,005 mol

T

Í -L

→Bên anot sinh khí O2 → nO2 = ne:4 =1,25.10-3 → V = 0,028 lit = 28 ml Câu 16: C Câu 17: B Bảo toàn e, ta có:

I Ồ B

Câu 18: D Câu 19: A

Ỡ Ư D

NG

Sưu tầm bởi GV. Nguyễn Thanh Tú

-

A Ó H

N Ơ H

Vì 2 bình mắc nối tiếp nên:

Số electron trao đổi trong quá trình điện phân là ne = nAg+ + 2nCu2+ = 0,01 + 2. 0,01 = 0,03 mol

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 23: B Câu 24: A Câu 25: C

nên

ở lần 2 đã hết, ở lần 1 vẫn còn

Câu 26: B Khi tăng thời gian lên gấp đôi nhưng số mol khi thoát ra nhiều hơn 2 lần số mol khí thoát ra ở anot ở thời gian t nên ở thời gian 2t, có khí thoát ra cả catot.nên thời gian điện phân 2t thi ion

đã bị điện phân hết

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 27: A

N Ơ H

Câu 30: D Số electron trao đổi là ne =

=

= 0,3 mol

UY

Bên anot xảy ra quá trình điện phân nước → nH+ = 0,3 mol Dung dịch sau điện phân chứa M2+: x mol, H2+ : 0,3 mol, SO42-

.Q P T

N

Khi thêm 0,2 mol NaOH và 0,2 mol KOH thì H+ tham gia phản ứng trước, sau đó đến M2+ hình thành M(OH)2

→ nM(OH)2 =

O Ạ Đ

= 0,05 mol → M = 4,9 : 0,05 = 98 (Cu(OH)2)

G N Ư

Bên catot điện phân ion Cu2+ → nCu2+ điện phân = 0,3 : 2 = 0,15 mol → a = 0,15. 64 = 9,6 gam

Câu 28: C Ở anot luôn điện phân nước tạo ra

N Ầ TR

H

∑ nCuSO4 = 0,15 + 0,05 = 0,2 mol → m = 32 gam → m + a= 41,6 gam. A sai vì có thể điện phân hết, rồi điện phân nước tạo ra

nên chưa chắc

0 00

B sai vì còn dựa vào hiệu suất, có thể lượng oxi thu được là thấp hơn lý thuyết D sai vì có thể có khí C Nếu chưa hết lúc này số mol nhẹ

thoát ra ở catot ; ở anot điện phân tạo ra

2

hết thì điện phân nước ở cả 2 cực.

nên pH giảm.Còn khi

A Ó H

P Ấ C

1 3 +

B

không đổi nhưng nước bị điện phân nên thể tích giảm làm nồng độ tăng, do đo pH tiếp tục giảm

Câu 29: D Điện phân dung dịch NaOH thực chất là quá trình điện phân nước 2H2O

N Á O

Gọi số mol nước bị điện phân là x mol

Í -L

-

O2 +2H2

T

Sau khi điện phân khối lượng dung dịch còn lại là 200- 18x

Ỡ Ư D

NG

Nồng độ NaOH sau khi điện phân là 25% →

I Ồ B

Thể tích khí (ở đktc) thoát ra ở anot là VO2 = 0,5.22,4.

Thể tích khí (ở đktc) thoát ra ở Catot là VH2 = 22,4.

. 100% = 25% → x =

mol

= 74, 67 lít

= 149, 3 lít

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

7. PP giải các dạng toán trọng tâm về phản ứng nhiệt luyện (Đề 1)

Câu 1. Cho luồng khí CO(dư) qua hỗn hợp các oxit CuO,ZnO, Fe2O3,MgO nung ở nhiệt độ cao.Sau phản ứng hỗn hợp rắn còn lại là: A. Cu,FeO,ZnO,MgO B. Cu,Fe,Zn,MgO C. Cu,Fe,Zn,Mg D. Cu,Fe,ZnO,MgO Câu 2. Cho 4,48 lít CO (ở đktc) từ từ đi qua ống sứ nung nóng đựng 8 gam một oxit sắt đến khi phản ứng xảy ra hoàn toàn. Khí thu được sau phản ứng có tỉ khối so với hiđro bằng 20. Công thức của oxit sắt và phần trăm thể tích của khí CO2 trong hỗn hợp khí sau phản ứng là A. FeO; 75%. B. Fe2O3; 75%. C. Fe2O3; 65%. D. Fe3O4; 65%. Câu 3. Cho khí CO (dư) đi vào ống sứ nung nóng đựng hỗn hợp X gồm Al2O3, MgO, Fe3O4, CuO thu được chất rắn Y. Cho Y vào dung dịch NaOH (dư) khuấy kĩ, thấy còn lại phần không tan Z. Giả sử các phản ứng xảy ra hoàn toàn. Phần không tan Z gồm A. Mg, Fe, Cu B. MgO, Fe, Cu C. Mgo, Fe3O4, Cu D. Mg, Al, Fe, Cu Câu 4. Cho luồng khí CO (dư) đi qua 9,1 gam hỗn hợp gồm CuO và Al2O3 nung nóng đến khi phản ứng hoàn toàn, thu được 8,3 gam chất rắn. Khối lượng CuO có trong hỗn hợp ban đầu là A. 0,8 gam. B. 8,3 gam. C. 2,0 gam. D. 4,0 gam Câu 5. Dẫn luồng khí CO đi qua hỗn hợp gồm CuO và Fe2O3 nung nóng, sau một thời gian thu được chất rắn X và khí Y. Cho Y hấp thụ hoàn toàn vào dung dịch Ba(OH)2 dư, thu được 29,55 gam kết tủa. Chất rắn X phản ứng với dung dịch HNO3 dư thu được V lít khí NO (sản phẩm khử duy nhất ở đktc). Giá trị của V là A. 2,24 B. 4,48 C. 6,72 D. 3,36. Câu 6. Phương pháp nhiệt nhôm dùng để: A. điều chế các kim loại đứng sau H. B. điều chế các kim loại đứng sau Al C. điều chế các kim loại dể nóng chảy. D. điều chế các kim loại khó nóng chảy. Câu 7. Phản ứng hoá học xảy ra trong trường hợp nào dưới đây không thuộc loại phản ứng nhiệt nhôm? A. Al tác dụng với Fe3O4 nung nóng. B. Al tác dụng với axit H2SO4 đặc, nóng C. Al tác dụng với CuO nung nóng.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. Al tác dụng với Fe2O3 nung nóng. Câu 8. Đốt nóng một hỗn hợp Al và Fe3O4 trong môi trường không có không khí. Sau khi phản ứng xảy ra hoàn toàn thu được hỗn hợp X. Cho X tác dụng với dung dịch NaOH dư thu được khí H2 bay ra. Các chất có trong hỗn hợp X là A. Al, Fe, Al2O3. B. Al, Fe, Fe2O3, Al2O3. C. Al, Fe, Fe3O4, Al2O3. D. Al, Fe, FeO, Al2O3. Câu 9. Trộn 10,8 gam bột Al với 34,8 gam bột Fe3O4 rồi tiến hành phản ứng nhiệt nhôm trong điều kiện không có không khí. Hoà tan hoàn toàn hỗn hợp rắn sau phản ứng bằng dung dịch H2SO4 loãng (dư) thu được 10,752 lít khí H2 (đktc). Hiệu suất của phản ứng nhiệt nhôm là A. 80%. B. 90%. C. 70%. D. 60%. Câu 10. Hỗn hợp X gồm Al và Fe3O4. Nung hỗn hợp X ở nhiệt độ cao thu được hỗn hợp Y. Chia Y làm 2 phần bằng nhau: • Phần 1 cho vào dung dịch NaOH lấy dư, sau phản ứng thu được 1,344 lít khí (đktc). • Phần 2 hòa tan hết trong 310 ml dung dịch H2SO4 1M (loãng) thu được 3,36 lít khí (đktc). Hiệu suất của phản ứng nhiệt nhôm là ( Giả sử Fe3O4 chỉ bị khử về Fe) A. 60%. B. 66,67%. C. 75%. D. 80%. Câu 11. Khi cho 41,4 gam hỗn hợp X gồm Fe2O3, Cr2O3 và Al2O3 tác dụng với dung dịch NaOH đặc (dư), sau phản ứng thu được chất rắn có khối lượng 16 gam. Để khử hoàn toàn 41,4 gam X bằng phản ứng nhiệt nhôm, phải dùng 10,8 gam Al. Thành phần phần trăm theo khối lượng của Cr2O3 trong hỗn hợp X là (Hiệu suất của các phản ứng là 100% ) A. 50,67%. B. 20,33%. C. 66,67%. D. 36,71%. Câu 12. Để thu được 78 gam Cr từ Cr2O3 bằng phản ứng nhiệt nhôm (H = 90%) thì khối lượng nhôm tối thiểu cần dùng là A. 12,5 gam. B. 27 gam. C. 40,5 gam. D. 45 gam. Câu 13. Cho dòng khí CO đi qua ống sứ đựng 0,12 mol hỗn hợp X gồm FeO và Fe2O3 nung nóng, thu được 14,352 gam hỗn hợp rắn Y và 0,138 mol CO2. Hòa tan hết Y vào dung dịch HNO3 dư được V lít khí NO (sản phẩm khử duy nhất, ở đktc). Giá trị của V là A. 0,224. B. 0,672. C. 2,285. D. 6,857.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 14. Cho hơi nước đi qua than nóng đỏ, thu được 15,68 lít hỗn hợp khí X (đktc) gồm CO, CO2 và H2. Cho toàn bộ X tác dụng hết với CuO (dư) nung nóng, thu được hỗn hợp chất rắn Y. Hòa tan toàn bộ Y bằng dung dịch HNO3 (loãng, dư) được 8,96 lít NO (sản phẩm khử duy nhất, ở đktc). Phần trăm thể tích khí CO trong X là: A. 18,42% B. 28,57% C. 14,28% D. 57,15% Câu 15. Dãy gồm các oxit đều bị Al khử ở nhiệt độ cao là A. FeO, CuO, Cr2O3. B. PbO, K2O, SnO. C. FeO, MgO, CuO. D. Fe3O4, SnO, BaO. Câu 16. Khử hoàn toàn m gam oxit MxOy cần vừa đủ 17,92 lít khí CO (đktc), thu được a gam kim loại M. Hòa tan hết a gam M bằng dung dịch H2SO4 đặc nóng (dư), thu được 20,16 lít khí SO2 (sản phẩm khử duy nhất, ở đktc). Oxit MxOy là A. Cr2O3. B. FeO. C. Fe3O4. D. CrO Câu 17. Nung hỗn hợp gồm 0,12 mol Al và 0,04 mol Fe3O4 một thời gian, thu được hỗn hợp rắn X. Hoà tan hoàn toàn X trong dung dịch HCl dư, thu được 0,15 mol khí H2 và m gam muối. Giá trị của m là A. 33,39. B. 32,58. C. 34,10. D. 31,97. Câu 18. Dẫn từ từ V lít khí CO (ở đktc) đi qua một ống sứ đựng lượng dư hỗn hợp rắn gồm CuO, Fe2O3 (ở nhiệt độ cao). Sau khi các phản ứng xảy ra hoàn toàn, thu được khí X. Dẫn toàn bộ khí X ở trên vào lượng dư dd Ca(OH)2 thì tạo thành 4 gam kết tủa. Giá trị của V là A. 1,120. B. 0,896. C. 0,448. D. 0,224. Câu 19. Hỗn hợp X gồm CuO và Fe2O3. Hoà tan hoàn toàn 44 gam X bằng dung dịch HCl (dư), sau phản ứng thu được dung dịch chứa 85,25 gam muối. Mặt khác, nếu khử hoàn toàn 22 gam X bằng CO (dư), cho hỗn hợp khí thu được sau phản ứng lội từ từ qua dung dịch Ba(OH)2 (dư) thì thu được m gam kết tủa. Giá trị của m là A. 76,755. B. 73,875. C. 147,750. D. 78,875. Câu 20. Khử hoàn toàn một oxit sắt X ở nhiệt độ cao cần vừa đủ V lít khí CO (ở đktc), sau phản ứng thu được 0,84 gam Fe và 0,02 mol khí CO2. Oxit X và giá trị V lần lượt là A. Fe3O4 và 0,224. B. Fe3O4 và 0,448. C. FeO và 0,224. D. Fe2O3 và 0,448.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 21. Thổi rất chậm 2,24 lít (đktc) một hỗn hợp khí gồm CO và H2 qua một ống sứ đựng hỗn hợp Al2O3, CuO, Fe3O4, Fe2O3 có khối lượng là 24 gam dư đang được đun nóng. Sau khi kết thúc phản ứng khối lượng chất rắn còn lại trong ống sứ là bao nhiêu? A. 21,6 gam. B. 22,4 gam. C. 23,2 gam. D. 20,8 gam Câu 22. Cho V lít hỗn hợp khí (ở đktc) gồm CO và H2 phản ứng với một lượng dư hỗn hợp rắn gồm CuO và Fe3O4 nung nóng. Sau khi các phản ứng xảy ra hoàn toàn, khối lượng hỗn hợp rắn giảm 0,32 gam. Giá trị của V là A. 0,112. B. 0,560. C. 0,224. D. 0,448. Câu 23. Thổi hơi nước qua than nóng đỏ thu được hỗn hợp khí X khô (H2, CO, CO2). Cho X qua dung dịch Ca(OH)2 thì còn lại hỗn hợp khí Y khô (H2, CO). Một lượng khí Y tác dụng vừa hết 8,96 gam CuO thấy tạo thành 1,26 gam nước. Thành phần % thể tích CO2 trong X là A. 20%. B. 11,11%. C. 30,12%. D. 29,16%. Câu 24. Cho hơi nước đi qua than nóng đỏ thu được 0,8 mol hỗn hợp khí X gồm CO, CO2 và H2. Cho toàn bộ X phản ứng hết với CuO dư, đun nóng thu được hỗn hợp chất rắn Y. Hòa tan hết Y bằng dung dịch HNO3 loãng, dư thu được 0,4 mol khí NO (sản phẩm khử duy nhất). Tỉ khối của X so với H2 là A. 7,875. B. 10,0 C. 3,9375. D. 13,375 Câu 25. Nung hỗn hợp bột gồm Al và Fe2O3 (trong điều kiện không có oxi), thu được hỗn hợp chất rắn X. Chia X thành 2 phần bằng nhau: - Cho phần 1 vào dung dịch HCl (dư) thu được 7,84 lít khí H2 (đktc); - Cho phần 2 vào dung dịch NaOH (dư) thu được 3,36 lít khí H2 (đktc). Biết rằng các phản ứng đều xảy ra hoàn toàn. Phần trăm khối lượng của Fe trong X là A. 42,32%. B. 46,47%. C. 66,39%. D. 33,61%. Câu 26. Hỗn hợp X gồm Fe3O4 và Al có tỉ lệ mol tương ứng 1 : 3. Thực hiện phản ứng nhiệt nhôm X (không có không khí) đến khi phản ứng xảy ra hoàn toàn thu được hỗn hợp gồm A. Al2O3 và Fe. B. Al, Fe và Al2O3. C. Al, Fe, Fe3O4 và Al2O3. D. Al2O3, Fe và Fe3O4.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 27. Đốt nóng một hỗn hợp gồm Al và 16 gam Fe2O3 (trong điều kiện không có không khí) đến khi phản ứng xảy ra hoàn toàn, thu được hỗn hợp rắn X. Cho X tác dụng vừa đủ với V ml dung dịch NaOH 1M sinh ra 3,36 lít H2 (đktc). Giá trị của V là A. 150. B. 100. C. 200. D. 300. Câu 28. Nung nóng m gam hỗn hợp gồm Al và Fe3O4 trong điều kiện không có không khí. Sau khi phản ứng xảy ra hoàn toàn, thu được hỗn hợp rắn X. Cho X tác dụng với dung dịch NaOH (dư) thu được dung dịch Y, chất rắn Z và 3,36 lít khí H2 (ở đktc). Sục khí CO2 (dư) vào dung dịch Y, thu được 39 gam kết tủa. Giá trị của m là A. 45,6. B. 48,3. C. 36,7. D. 46,7. Câu 29. Cho một luồng khí CO đi qua ống sứ đựng 0,04 mol hỗn hợp X gồm FeO và Fe2O3 đốt nóng. Sau khi kết thúc thí nghiệm thu được Y gồm 4 chất nặng 4,784 gam. Khí đi ra khỏi ống sứ cho hấp thụ vào dung dịch nước vôi trong dư thì thu được 4,6 gam kết tủa. % khối lượng FeO trong hỗn hợp X là A. 13,04% B. 15,05% C. 18,91% D. 81,09% Câu 30. Cho luồng khí H2 (dư) qua hỗn hợp các oxit CuO, Al2O3, ZnO, Fe3O4, MgO nung ở nhiệt độ cao. Sau phản ứng hỗn hợp rắn còn lại chứa số oxit kim loại là A. 1. B. 2. C. 3. D. 4. Câu 31. Hỗn hợp X gồm FeO, Fe2O3 và Fe3O4. Cho khí CO qua m gam X nung nóng, sau một thời gian thu được hỗn hợp chất rắn Y và hỗn hợp khí Z. Cho toàn bộ Z vào dung dịch Ca(OH)2 dư, đến khi phản ứng hoàn toàn, thu được 4 gam kết tủa. Mặt khác, hòa tan hoàn toàn Y trong dung dịch H2SO4 đặc, nóng (dư), thu được 1,008 lít khí SO2 (đktc, sản phẩm khử duy nhất) và dung dịch chứa 18 gam muối. Giá trị của m là A. 7,12. B. 13,52. C. 6,8. D. 5,68. Câu 32. Hỗn hợp X gồm Al, Fe3O4 và CuO, trong đó oxi chiếm 25% khối lượng hỗn hợp. Cho 1,344 lít khí CO (đktc) đi qua m gam X nung nóng, sau một thời gian thu được chất rắn Y và hỗn hợp khí Z có tỉ khối so với H2 bằng 18. Hòa tan hoàn toàn Y trong dung dịch HNO3 loãng (dư), thu được dung dịch chứa 3,08m gam muối và 0,896 lít khí NO (ở đktc, là sản phẩm khử duy nhất). Giá trị m gần giá trị nào nhất sau đây ? A. 8,0 B. 9,5 C. 8,5 D. 9,0 Câu 33. Hỗn hợp Tecmit dùng để vá nhanh đường ray tàu hoả, gồm Al và

Ư D I Ồ B

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

A. CrO. B. FeO. C. Fe2O3. D. Fe3O4.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B Câu 2: B Câu 3: B Câu 4: D Chỉ có CuO phản ứng với CO tạo thành Cu. Theo tăng giảm khối lượng: .

1 3 +

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

UY

.Q P T

N Ơ H

N

Câu 5: A Ta có nCO = nCO2 = nBaCO3 = 29,55 : 197 = 0,15 mol.

Theo Bte: 2 x nCO = 3 x nNO → nNO = 2 x 0,15 : 3 = 0,1 mol → V = 0,1 x 22,4 = 2,24 lít Câu 6: B Câu 7: B Câu 8: A Câu 9: A 0,4 mol Al + 0,15 mol Fe3O4 rồi tiến hành nhiệt nhôm 8Al + 3Fe3O4

4Al2O3 + 9Fe

Giả sử có 8x mol Al phản ứng → sau phản ứng thu được (0,4 - 8x) mol Al; 9x mol Fe; Fe3O4 dư và Al2O3 Cho hh + H2SO4 loãng dư → 0,48 mol H2 nH2 = 1,5(0,4 - 8x) + 9x = 0,48 → x = 0,04 mol → nAl phản ứng = 0,04 x 8 = 0,32 mol.

→ Câu 10: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 14: B

Al + Fe3O4 –––to–→ Y Phần 1 : Vì hỗn hợp Y tác dụng với NaOH sinh khí → chứng tỏ Y chứa Al dư → nAl = 2nH2 : 3 = 0,04 mol

UY

Bt e:

Phần 2: Chất tác dụng với H2SO4 sinh khí gồm Fe và Al Bảo toàn electron → 2nH2 = 3nAl + 2nFe → 2. 0,15 = 3. 0,04 + 2nFe → nFe = 0,09 mol 8Al + 3Fe3O4 –––to–→ 9Fe + 4Al2O3

G N Ư

O Ạ Đ

.Q P T

N

% % Câu 15: A Đáp án B loại vì K là kim loại có độ hoạt động mạnh nên K2O không bị Al khử ở nhiệt độ cao.

Có nFe = 0,09 mol → nAl2O3 = 0,04 mol Có nH2SO4 = 4nFe3O4 + 3nAl2O3 + 1,5nAl + nFe

N Ầ TR

H

Đáp án C loại vì Mg là kim loại hoạt động mạnh nên MgO không bị Al khử ở nhiệt độ cao. → nFe3O4 dư =

= 0,01 mol

Bảo toàn nguyên tố Fe → nFe3O4 ban đầu =

0 00

+ 0,01 = 0,04 mol

Bảo toàn nguyên tố Al → nAl ban đầu = 0,04 + 3. 0,04 = 0,16 mol

>

→ hiệu suất phản ứng tính theo Fe3O4

→H= . 100% = 75%. Câu 11: D

Khi thực hiện nhiệt nhôm, Al sẽ tác dụng với Ta có: % Câu 12: D

D I BỒ

%

ƯỠ

NG

TO

ÁN

Câu 13: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

Đáp án D loại vì Ba là kim loại hoạt động mạnh nên BaO không bị Al khử ở nhiệt độ cao. Câu 16: C Giả sử hõn hợp ban đầu gồm M và O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

Ta có nO = nCO = 17,92 : 22,4 = 0,8 mol. • a gam M + H2SO4 đặc, nóng → 0,9 mol.

Giả sử n là số mol e nhường của M → n x nM = 0,9 x 2 = 1,8 mol → TH1: n = 1 → nM = 1,8 → x : y = 1,8 : 0,8 = 9 : 4 → loại. TH2: n = 2 → nM = 0,9 → x : y = 0,9 : 0,8 = 9 : 5 → loại. TH3: n = 3 → nM = 0,6 → x : y = 0,6 : 0,8 = 3 : 4 → M3O4 Câu 17: D 8Al + 3Fe3O4 9Fe + 4Al2O3 0,12 ---0,04 --------------------------- (Ban đầu) 8a -------3a ------------9a ----------4a (Phản ứng) (0,12-8a)---(0,04 - 3a) ----9a ----------4a (Sau phản ứng) Sau phản ứng có (0,12 - 8a) Al dư và 9a mol Fe tác dụng với HCl giải phóng H2

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Bảo toàn e : 3 x (0,12 - 8a) + 2 × 9a = 2 × 0,15 → a = 0,01 → X gồm Al dư 0,04 mol; Fe3O4 0,01 mol; Fe 0,09 mol; Al2O3 0,04 mol

% Câu 25: B Câu 26: B 3Fe3O4 + 8Al

→ m = 0,12 × 27 + 0,12 × 56 + (0,12 × 3 + 0,01 × 2 + 0,02 × 3 + 0,09 x 2) x 35,5 = 31,97 gam Câu 18: B Câu 19: B Câu 20: B Câu 21: B Vì lượng oxit dư nên toàn bộ lượng CO và H2 đều phản ứng hết

0 00

B

Al2O3 + 2NaOH → 2NaAlO2 + H2O

Cu + CO2 : x mol + H2O : x+ 2y

Có nCuO = nCO +nH2O → x = 0,112 - 0,07 = 0,042 mol Có nH2O = x + 2y = 0,07 → y = 0,014

. 100% = 11,11%

N Á O

Câu 24: A •

I Ồ B

H

→ hh rắn có Al dư.

Gọi số mol của CO và CO2 lần lượt là x, y mol → số mol của H2 là x + 2y

N Ầ TR

hh rắn + NaOH → 0,15 mol H2

H2O + C→ H2 + CO và 2H2O + C → 2H2 + CO2

G N Ỡ

G N Ư

.Q P T

N

nAl2O3 = nFe2O3 = 16 : 160 = 0,1 mol.

Câu 22: D Câu 23: B Khi cho hơi nước qua than nóng đỏ xảy ra các phương trình

Bt e:

O Ạ Đ

Vậy hh thu được sau phản ứng gồm Al dư, Fe, Al2O3 Câu 27: D 2Al + Fe2O3 Al2O3 + 2Fe

Sử dụng tăng giảm khối lượng → m chất rắn = mhỗn hợp - mO = 24- 16. 0,1 = 22, 4 gam

%CO2 =

UY

9Fe + 4Al2O3

Vì nFe3O4 : nAl = 1 : 3 → Al dư.

Mỗi phân tử CO và H2 đều nhận thêm 1 nguyên tử O hình thành CO2 và H2O → nO = nH2 + nCO2 = 0,1 mol

Khí Y

%

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

1 3 +

0,1-------0,2

2Aldư + 2NaOH + 2H2O → 2NaAlO2 + 3H2 -----------0,1-------------------------------------0,15 → ∑nNaOH = 0,3 mol → V = 0,3 : 1 = 0,3 lít = 300 ml Câu 28: B Câu 29: A Khí đi ra khỏi ống sứ cho hấp thụ vào dung dịch nước vôi trong dư → nCaCO3 = nCO2 = 0,046 mol Bảo toàn nguyên tố C → nCO= nCO2 = 0,046 mol Bảo toàn khối lương → mFeO + mFe2O3 = 4,784 + 0,046. 44 - 0,046.28= 5,52 gam Gọi số mol của FeO và Fe2O3 lần lượt là x, y mol

Ta có hệ:

→ %FeO = Câu 30: B

×100% = 13,04% .

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Do đó thu được 3 kim loại và 2 oxit kim loại

UY

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

8. PP Giải các dạng toán trọng tâm về Amin – Amino axit – Peptit (Đề 1)

Câu 1. Trong phân tử aminoaxit X có một nhóm amino và một nhóm cacboxyl. Cho 15,0 gam X tác dụng vừa đủ với dung dịch NaOH, cô cạn dung dịch sau phản ứng thu được 19,4 gam muối khan. Công thức của X là: A. H2NC4H8COOH B. H2NC3H6COOH C. H2NC2H4COOH D. H2NCH2COOH Câu 2. Cho 10 gam amin đơn chức X phản ứng hoàn toàn với HCl dư, thu được 15 gam muối. Số đồng phân cấu tạo của X là: A. 4 B. 8 C. 5 D. 7 Câu 3. Cho 0,02 mol amino axit X tác dụng vừa đủ với 200 ml dung dịch HCl 0,1M thu được 3,67 gam muối khan. Mặt khác 0,02 mol X tác dụng vừa đủ với 40 gam dung dịch NaOH 4%. Công thức của X là: A. (H2N)2C3H5COOH B. H2NC2H3(COOH)2 C. H2NC3H5(COOH)2 D. H2NC3H6COOH Câu 4. Cho 1 mol amino axit X phản ứng với dung dịch HCl (dư), thu được m1 gam muối Y. Cũng 1 mol amino axit X phản ứng với dung dịch NaOH (dư), thu được m2 gam muối Z. Biết m2 - m1 = 7,5. Công thức phân tử của X là A. C5H9O4N. B. C4H10O2N2. C. C5H11O2N D. C4H8O4N2. Câu 5. Chất X có công thức phân tử C4H9O2N. Biết: Y + HCl (dư) → Z + NaCl X + NaOH → Y + CH4O; Công thức cấu tạo của X và Z lần lượt là A. H2NCH2CH2COOCH3 và CH3CH(NH3Cl)COOH. B. CH3CH(NH2)COOCH3 và CH3CH(NH3Cl)COOH. C. H2NCH2COOC2H5 và ClH3NCH2COOH. D. CH3CH(NH2)COOCH3 và CH3CH(NH2)COOH. Câu 6. Cho chất hữu cơ X có công thức phân tử C3H12O3N2 tác dụng với dung dịch NaOH (dư) sau đó cô cạn dung dịch thu được phần hơi chỉ chứa một chất hữu cơ đơn chức Y và hơi nước, và phần chất rắn chỉ chứa các chất vô cơ. Nếu cho X tác dụng với dung dịch HCl dư sau đó cô cạn dung dịch thì được phần chất rắn và giải phóng khí Z. Phân tử khối của Y và Z lần lượt là: A. 31; 46 B. 31; 44 C. 45; 46 D. 45; 44

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Hai hợp chất hữu cơ mạch hở có công thức phân tử lần lượt là C2H8O3N2 và C3H7O2N đều tác dụng với dung dịch NaOH đun nóng, cho hai amin đơn chức bậc 1 thoát ra. Nhận xét nào sau đây đúng về hai hợp chất hữu cơ trên? A. Chúng đều tác dụng với dung dịch brom B. Chúng đều là chất lưỡng tính C. Phân tử của chúng đều có liên kết ion D. Chúng đều tác dụng với H2 (xúc tác Ni, đun nóng) Câu 8. Cho 20 gam hỗn hợp gồm hai amin no, đơn chức, mạch hở tác dụng vừa đủ với V ml dung dịch HCl 1M, thu được dung dịch chứa 31,68 gam hỗn hợp muối. Giá trị của V là A. 200 B. 100 C. 320 D. 50 Câu 9. Cho 2,1 gam hỗn hợp X gồm 2 amin no, đơn chức, kế tiếp nhau trong dãy đồng đẳng phản ứng hết với dung dịch HCl (dư), thu được 3,925 gam hỗn hợp muối. Công thức của 2 amin trong hỗn hợp X là A. CH3NH2 và C2H5NH2. B. C2H5NH2 và C3H7NH2. C. C3H7NH2 và C4H9NH2. D. CH3NH2 và (CH3)3N. Câu 10. Trung hòa hoàn toàn 8,88 gam một amin (bậc một, mạch cacbon không phân nhánh) bằng axit HCl, tạo ra 17,64 gam muối. Amin có công thức là A. H2NCH2CH2CH2CH2NH2 B. CH3CH2CH2NH2 C. H2NCH2CH2CH2NH2 D. H2NCH2CH2NH2 Câu 11. Cho 0,15 mol H2NC3H5(COOH)2 (axit glutamic) vào 175 ml dung dịch HCl 2M, thu được dung dịch X. Cho NaOH dư vào dung dịch X. Sau khi các phản ứng xảy ra hoàn toàn, số mol NaOH đã phản ứng là A. 0,70. B. 0,50. C. 0,65. D. 0,55. Câu 12. Cho 26,7 gam hỗn hợp X gồm hai amino axit là NH2CH2CH2COOH và CH3CH(NH2)COOH tác dụng với V ml dung dịch NaOH 1M thu được dung dịch Y. Biết dung dịch Y tác dụng vừa đủ với 500 ml dung dịch HCl 1M. Giá trị của V là A. 500 B. 300 C. 200 D. 150 Câu 13. Chất X có công thức phân thử C8H15O4N. X tác dụng với NaOH tạo Y, C2H6O và CH4O. Y là muối natri của α-amino axit Z mạch hở không phân nhánh. Số công thức cấu tạo của X thỏa mãn yêu cầu của đề là: A. 1 B. 2 C. 3 D. 4

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 14. Chất hữu cơ X có công thức phân tử C3H7O2N. Cho 17,8 gam X phản ứng hoàn toàn với dung dịch NaOH, đun nóng thu được 18,8 gam muối khan. Công thức cấu tạo thu gọn của X là A. H2NCOOCH2CH3 B. CH2=CHCOONH4 C. H2NC2H4COOH. D. H2NCH2COOCH3. Câu 15. Cho 20,6 gam hợp chất hữu cơ X có công thức phân tử C4H9O2N tác dụng với 100ml dung dịch NaOH 2,5M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được 24,2 gam chất rắn. Công thức cấu tạo thu gọn của X là A. HCOOH3NC3H5. B. CH3COOH3NC2H3. C. H2NCH2COOC2H5. D. H2NC2H4COOCH3. Câu 16. Hợp chất thơm X có công thức phân tử C6H8N2O3. Cho 28,08 gam X tác dụng với 200 ml dung dịch KOH 2M sau phản ứng thu được dung dịch Y. Cô cạn dung dịch Y được m gam chất rắn khan. Giá trị của m là: A. 21,5 gam B. 38,8 gam C. 30,5 gam D. 18,1 gam Câu 17. Hợp chất X có công thức phân tử CH8O3N2. Cho 9,6 gam X tác dụng với 300 ml dung dịch NaOH 1M đun nóng đến phản ứng hoàn toàn được dung dịch Y. Để tác dụng với các chất trong Y cần tối thiểu 200 ml dung dịch HCl a (mol/l) được dung dịch Z. Biết Z không tác dụng với dung dịch Ba(OH)2. Giá trị của a là A. 1,5 B. 1 C. 0,75 D. 0,5 Câu 18. Ứng với công thức phân tử C2H7O2N có bao nhiêu chất vừa phản ứng được với dung dịch NaOH vừa phản ứng được với dung dịch HCl ? A. 1 B. 3 C. 2 D. 4 Câu 19. Cho 0,76 gam hỗn hợp X gồm hai amin đơn chức, có số mol bằng nhau, phản ứng hoàn toàn với dung dịch HCl dư, thu được 1,49 gam muối. Khối lượng của amin có phân tử khối nhỏ hơn trong 0,76 gam X là A. 0,45 gam. B. 0,31 gam. C. 0,38 gam. D. 0,58 gam. Câu 20. Amino axit X có công thức H2NCxHy(COOH)2. Cho 0,1 mol X vào 0,2 lít dung dịch H2SO4 0,5M, thu được dung dịch Y. Cho Y phản ứng vừa đủ với dung dịch gồm NaOH 1M và KOH 3M, thu được dung dịch chứa 36,7 gam muối. Phần trăm khối lượng của nitơ trong X là A. 11,966%. B. 10,526%. C. 9,524%. D. 10,687%.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 21. Cho m gam hỗn hợp X gồm axit glutamic và lysin tác dụng với dung dịch HCl (dư), sau phản ứng hoàn toàn làm bay hơi cẩn thận dung dịch, thu được (m + 18,25) gam muối khan. Nếu cho m gam X tác dụng với dung dịch NaOH (dư), kết thúc phản ứng tạo ra (m + 8,8) gam muối. Giá trị của m là A. 43,9. B. 44,0. C. 58,5. D. 58,7. Câu 22. Hợp chất hữu cơ X có công thức phân tử C2H8O3N2. Cho 16,2 gam X phản ứng hết với 200 ml dung dịch NaOH 1,5M. Làm khan cẩn thận dung dịch sau phản ứng, tách thu được m gam muối vô cơ. Giá trị lớn nhất của m là A. 12,75. B. 15,90. C. 18,60. D. 18,75. Câu 23. Hỗn hợp X gồm alanin và axit glutamic. Cho m gam X tác dụng hoàn toàn với dung dịch NaOH (dư), thu được dung dịch Y chứa (m + 30,8) gam muối. Mặt khác, nếu cho m gam X tác dụng hoàn toàn với dung dịch HCl, thu được dung dịch Z chứa (m + 36,5) gam muối. Giá trị của m là A. 112,2. B. 165,6. C. 123,8. D. 171,0. Câu 24. X là este tạo bởi α-amino axit Y (chứa 1 nhóm -COOH và 1 nhóm -NH2) với ancol đơn chức Z. Thủy phân hoàn toàn 0,1 mol X trong 200 ml dung dịch NaOH 1M, cô cạn dung dịch thu được 13,7 gam chất rắn và 4,6 gam ancol Z. Vậy công thức của X là: A. CH3-CH(NH2)-COOC2H5 B. CH3-CH(NH2)-COOCH3 C. H2N-CH2-COOC2H5 D. H2N-CH2-COOCH2-CH=CH2 Câu 25. Cho 1,82 gam hợp chất hữu cơ đơn chức, mạch hở X có công thức phân tử C3H9O2N tác dụng vừa đủ với dung dịch NaOH, đun nóng thu được khí Y và dung dịch Z. Cô cạn Z thu được 1,64 gam muối khan. Công thức cấu tạo thu gọn của X là A. CH3CH2COONH4. B. CH3COONH3CH3. C. HCOONH2(CH3)2. D. HCOONH3CH2CH3. Câu 26. Chất hữu cơ Y mạch thẳng có công thức phân tử C3H10O2N2. Y tác dụng với NaOH tạo khí NH3; Mặt khác, Y tác dụng với axit tạo muối của amin bậc 1, nhóm amino nằm ở vị trí α. Công thức cấu tạo đúng của Y là: A. NH2CH2-CH2-COONH4 B. CH3-NH-CH2-COONH4 C. NH2-CH2¬-COONH3CH3 D. CH3CH(NH2)COONH4 Câu 27. Hợp chất hữu cơ X có công thức C2H8N2O4. Khi cho 12,4 gam X tác dụng với 200 ml dung dịch NaOH 1,5M thu được 4,48 lít (đktc) khí Y làm xanh quỳ tím ẩm. Cô cạn dung dịch sau phản ứng thu được m gam chất rắn khan. Giá trị của m là:

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. 13,4. B. 16,2. C. 17,2. D. 17,4. Câu 28. Hợp chất mạch hở X là một muối có công thức phân tử C2H8N2O3. X tác dụng được với dung dịch KOH tạo ra một bazơ hữu cơ và các chất vô cơ. Số công thức cấu tạo có thể có của X là A. 1. B. 2. C. 3. D. 4. Câu 29. X có công thức C4H14O3N2. Khi cho X tác dụng với dung dịch NaOH thì thu được hỗn hợp Y gồm 2 khí ở điều kiện thường và đều có khả năng làm xanh quỳ tím ẩm. Số CTCT phù hợp của X là: A. 5. B. 3. C. 4. D. 2. Câu 30. Cho 0,2 mol chất X (CH6O3N2) tác dụng với dung dịch chứa 200ml NaOH 2M đun nóng thu được chất khí làm xanh quỳ tím ẩm và dung dịch Y. Cô cạn dung dịch Y thu được m gam chất rắn. Giá trị của m là: A. 25. B. 8. C. 17. D. 21,2. Câu 31. Hợp chất hữu cơ X có công thức phân tử C2H8O3N2. Cho 0,15 mol X phản ứng hết với dung dịch chứa 0,2 mol NaOH tạo một bazơ hữu cơ đơn chức. Cô cạn dung dịch sau phản ứng thu được m gam chất rắn chỉ gồm các chất vô cơ. Giá trị của m là A. 14,30. B. 12,75. C. 20,00. D. 14,75. Câu 32. Một muối X có công thức C3H10O3N2. Lấy 17,08 gam X cho phản ứng hết với 200 ml dung dịch KOH 2M. Cô cạn dung dịch sau phản ứng thu được phần hơi và chất rắn. Trong phần hơi có một chất hữu cơ Y (đơn chức, bậc 1), trong phần rắn chỉ là hỗn hợp các chất vô cơ. Khối lượng của phần rắn là: A. 16,16 gam. B. 28,7 gam. C. 16,6 gam. D. 11,8 gam. Câu 33. Hợp chất hữu cơ X có công thức phân tử C3H12O3N2 khi tác dụng với dung dịch NaOH đun nóng thu được hai khí làm xanh quỳ tím tẩm nước cất. X có bao nhiêu công thức cấu tạo thỏa mãn điều kiện trên ? A. 2. B. 3. C. 4. D. 1. Câu 34. Cho 0,1 mol axit α-aminopropionic tác dụng vừa đủ với dung dịch HCl, thu được dung dịch X. Cho X tác dụng với 200 ml dung dịch NaOH 1M, thu được dung dịch chứa m gam muối. Giá trị của m là A. 11,10

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 16,95 C. 11,70 D. 18,75 Câu 35. Amino axit X có công thức (H2N)2C3H5COOH. Cho 0,02 mol X tác dụng với 200 ml dung dịch hỗn hợp H2SO4 0,1M và HCl 0,3M, thu được dung dịch Y. Cho Y phản ứng vừa đủ với 400 ml dung dịch NaOH 0,1M và KOH 0,2M, thu được dung dịch chứa m gam muối. Giá trị của m là A. 10,43. B. 6,38. C. 10,45. D. 8,09. Câu 36. Cho m gam hỗn hợp X gồm hai amino axit là NH2CH2CH(CH3)COOH và CH3CH2CH(NH2)COOH tác dụng với 250 ml dung dịch HCl 1M thu được dung dịch Y. Biết dung dịch Y tác dụng vừa đủ với 200 ml dung dịch NaOH 2M. Giá trị của m là A. 20,60. B. 25,75. C. 41,20. D. 15,45. Câu 37. Cho 100 ml dung dịch amino axit X nồng độ 0,2M phản ứng vừa đủ với 80 ml dung dịch NaOH 0,25M, thu được dung dịch Y. Biết Y phản ứng tối đa với 120 ml dung dịch HCl 0,5M, thu được dung dịch chứa 4,71 gam hỗn hợp muối. Công thức của X là A. (H2N)2C2H3COOH B. (H2N)2C3H5COOH C. H2NC3H5(COOH)2 D. H2NC3H6COOH Câu 38. Cho m gam hỗn hợp X gồm lysin và valin tác dụng với HCl dư, sau phản ứng hoàn toàn làm bay hơi cẩn thận dung dịch thu được (m + 23,725) gam muối khan. Nếu cho m gam X tác dụng với dung dịch NaOH dư, kết thúc phản ứng tạo ra (m + 9,9) gam muối. Giá trị của m là A. 52,60 B. 65,75 C. 58,45 D. 59,90 Câu 39. Hợp chất hữu cơ X có công thức phân tử C3H9O2N. Biết X tác dụng với NaOH và HCl. Số công thức cấu tạo thỏa mãn là A. 4 B. 3 C. 1 D. 2 Câu 40. Hỗn hợp X gồm 2 chất có công thức phân tử là C3H12N2O3 và C2H8N2O3. Cho 3,40 gam X phản ứng vừa đủ với dung dịch NaOH (đun nóng), thu được dung dịch Y chỉ gồm các chất vô cơ và 0,04 mol hỗn hợp 2 chất hữu cơ đơn chức (đều làm xanh giấy quỳ tím ẩm). Cô cạn Y, thu được m gam muối khan. Giá trị của m là: A. 3,12 B. 2,76 C. 3,36 D. 2,97

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Vì sp phần hơi chỉ có 1 chất hữu cơ đơn chức Y, phần chất rắn chỉ có các chất vô cơ

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

-> X:

UY

Câu 1: D Theo tăng giảm khối lượng:

= 0,2 mol

Câu 7: C

→ MX = 15,0 : 0,2 = 75 → X là H2N-CH2-COOH Câu 2: B mHCl = 15 - 10 = 5 gam → nHCl ≈ 0,137 mol → MX = 73 → C4H11N

Do đó X và Y đều có liên kết ion

Câu 8: C 20 gam hai amin no, đơn chức, hở + V ml HCl 1M → 31,68 g hh muối.

Có 8 CTCT thỏa mãn là CH3CH2CH2CH2NH2, CH3CH2CH(NH2)CH3, (CH3)2-CH-CH2NH2, (CH3)3-C-NH2, CH3-NH-CH2CH2CH3, CH3-NH-CH(CH3)2, CH3CH2-NH-CH2CH3, (CH3)2-N-CH2CH3 Câu 3: C 0,02 mol X phản ứng vừa đủ với 0,02 mol HCl → X có 1 nhóm -NH2

0 00

Mmuối = 52,5 + R + 90 = 3,67 : 0,02 → R = 41 → R là C3H5 → X là H2NC3H5(COOH)2 Câu 4: A Gọi a, b lần lượt là số nhóm NH2, COOH trong phân tử amino axit X.

- Cho X + dd NaOH: m2 = m + 22b

N Á O

Mà: m2 - m1 = 7,5 → 22b - 36,5a = 7,5 → a = 1, b = 2 → X có 2 nhóm chức COOH, 1 nhóm NH2 Câu 5: B Chú ý câu hỏi về cấu tạo X và Z

Ỡ Ư D

NG

-

T

CH3CH(NH2)COOCH3 (X ) + NaOH → CH3NH(NH2)COONa (Y) + CH3OH

I Ồ B

CH3NH(NH2)COONa (Y) + 2HCl → CH3NH(NH3Cl)COOH (Z) + NaCl

H

→ VHCl = 0,32 : 1 = 0,32 lít = 320 ml Câu 9: A Áp dụng định luật bảo toàn khối lượng: mHCl phản ứng = mmuối - mX = 3,925 - 2,1 = 1,825 gam

Vậy X có dạng H2N-R-(COOH)2 → muối ClH3N-R-(COOH)2

- Cho X + dd HCl: m1 = m + 36,5a

N Ầ TR

• Theo BTKL mHCl = 31,68 - 20 = 11,68 gam → nHCl = 11,68 : 36,5 = 0,32 mol

0,02 mol X phản ứng vừa đủ với 0,04 mol NaOH → X có 2 nhóm -COOH

Gọi nX = 1 mol.

G N Ư

O Ạ Đ

.Q P T

N

A Ó H

P Ấ C

2

1 3 +

B

=>nHCl phản ứng =

= 0,05 mol =>nX = nHCl phản ứng = 0,05 mol

=>MX = = 42 Mà 2 amin là đồng đẳng kế tiếp nên công thức của 2 amin trong hỗn hợp X là: CH3NH2 và C2H5NH2 Câu 10: C Nhận thấy đáp án có 3 đáp án A, C, D là amin 2 chức . Giả sử amin là 2 chức,no có công thức CnH2n+4N2 Bảo toàn khối lượng → mHCl = 17,64- 8,88 = 8,76 gam → nHCl = 0,24 mol → nX = 0,24 : 2= 0,12 mol → M = 74 → n= 3 Vậy X có công thức H2N-CH2-CH2-CH2-NH2 Câu 11: C Số mol NaOH phản ứng với ddX bằng số mol NaOH phản ứng với HCl và axit glutamic ban đầu. → nNaOH = 2 x naxit glutamic + nHCl = 2 x 0,15 + 2 x 0,175 = 0,65 mol Câu 12: C Có nX = 26,7: 89 =0,3 mol Coi NaOH tác dụng với HCl trước, sau đó HCl tác dụng với X Có nHCl = nNaOH + nX → 0,5 = nNaOH + 0,3

Câu 6: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Bảo toàn khối lượng → mHCl = 1, 49 - 0,76 = 0,73 gam → nHCl = 0,02 mol → nNaOH = 0,2 mol → V = 0,2 lít = 200ml. Câu 13: B Số công thức cấu tạo của X thỏa mãn yêu cầu là: C2H5OOC-CH2-CH2-CH(NH2)-COOCH3, C2H5OOCCH(NH2)-CH2-CH2-COOCH3

Vì amin đơn chức và có số mol bằng nhau→ nA = nB = 0,01 mol

.Q P T

→ mCH3NH2 = 0,01. 31 = 0,31 gam. Câu 20: B Ta có nH2O = nNaOH + nKOH = 2nH2SO4 + 2nX= 0,2 + 0,2 = 0,4 mol

Chú ý vì Z mạch hở không phân nhánh nên các cấu tạo C2H5OOC-CH(CH3)-CH(NH2)-COOCH3, C2H5OOCCH2-C(CH3)(NH2)-COOCH3, C2H5OOC-C(CH3)(NH2)-CH2-COOCH3 ... không thỏa mãn Câu 14: B Có nXX = nmuối = 17,8 : 89 = 0,2 mol →Mmuối = 94 ( CH2=CHCOONa)

→ nNaOH = 0,1 mol và nKOH = 0,3 mol Vậy công thức cấu tạo của X là CH2=CHCOONH4. Câu 15: D Có nX = 20,6 : 103 = 0,2 mol

G N Ư

O Ạ Đ

N

Bảo toàn khối lượng mX = 36,7 + 0.4. 18- 0,1. 98 - 0,3. 56- 0,1. 40 = 13,3 gam

N Ầ TR

H

→ MX = 133 → %N= ×100% = 10,526%. Câu 21: A Gọi x, y lần lượt là số mol axit glutamic và lysin.

Có nX = nNaOH pư = 0,2 mol → chất rắn gồm 0,2 mol muối và NaOH dư :0,05 mol

→ Mmuối =

UY

→ Mtb = 0,76 : 0,02 = 38 > 31 → X chứa CH3NH2

= 111 ( H2NC2H4COONa)

0 00

B

m gam hhX + HCl dư → (m + 18,25) gam muối khan.

Vậy cấu tạo của X là H2NC2H4COOCH3. Câu 16: C Cấu tạo thỏa mãn X là C6H5NH3NO3 Có

mol

Câu 17: A

G N Ỡ

Z không tác dụng với dung dịch

Ư D I Ồ B

N Á O

T

nên Z chỉ gồm NaCl

Câu 18: C Có 2 chất thỏa mãn là H2N-CH2-COOH và CH3COONH4 Câu 19: B Gọi hai amin đơn chức lần lượt là A, B

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

1 3 +

Theo BTKL: mHCl = (m + 18,25) - m = 18,25 gam → nHCl = x + 2y = 18,25 : 36,5 (*)

• m gam X + NaOH → (m + 8,8) gam muối

Theo tăng giảm khối lượng:

→ 2x + y = 0,4 (**)

Từ (*), (**) → x = 0,1; y = 0,2 → m = 0,1 x 147 + 0,2 x 146 = 43,9 gam Câu 22: B Đối với công thức phân tử C2H8O3N2 có thể có 2 dạng công thức cấu tạo thỏa mãn:

♦ Xét công thức (1): Dễ thấy, sẽ có 0,15 mol X phản ứng tạo thành NaNO3 Đề bài hỏi muối khan nên ta có khối lượng là ♦ Xét công thức (2) Lượng NaOH sẽ phản ứng hết tạo thành 0,15 mol Na2CO3.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

=>mchất rắn = m(COONa)2 + mNaOH dư = 134.0,1 + 40.0,1 = 17,4 gam

Câu 28: C Các cấu tạo có thể của X gồm : CH3-CH2-NH3-NO3, (CH3)2-NH2-NO3 , H2N-CH2-NH3HCO3.

Vậy, khối lượng lớn nhất là 15,9. Câu 23: A Alanin có công thức NH2-CH(CH3)-COOH : x mol, axit gluctamic có công thức HOOC-CH2-CH2 -CH(NH2)COOH : y mol

CH3-CH2-NH3-NO3 + KOH → CH3-CH2-NH2 + KNO3 + H2O (CH3)2-NH2-NO3 + KOH → (CH3)2-NH + KNO3 + H2O

Khi đó ta có hệ

N Ầ TR +

+

[(CH3)3NH ].(NH4 ).CO3 → công thức của X là H2N-CH2-COOC2H5. Câu 25: B

Câu 26: D Nhận thấy đáp án C + NaOH giải phóng ra CH3NH3 → loại Đáp án A NH2 ở vị trí β → loại

N Á O

Đáp án B tác dụng với NaOH tạo muối của amin bậc 2 → loại B Câu 27: D

T

= 0,1 mol, nNaOH = 0,2.1,5 = 0,3 mol, nY =

Ư D I Ồ B

B

2-

Câu 30: A Ta có 0,2 mol X ( CH6Ở3N2) + 0,4 mol NaOH → dung dịch Y + khí làm xanh quỳ

nNaOH phản ứng = 2nX = 2.0,1 = 00,2 mol => nNaOH dư = 0,3 - 0,2 = 0,1 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

H Í

-L

= 0,2 mol = 2nX

ÓA

P Ấ C

0 00

31

G N Ỡ

H

(CH3NH3+).[(CH3)2NH2+)].CO32-

Bảo toàn khối lượng → mX = 13,7+ 4,6 - 0,2.40 = 10,3 → MX = 103 → R= 103- 29-44-16 = 14 (CH2)

, Y là

G N Ư

(CH3NH3+). (CH3-CH2-NH3+).CO32-.

Có nNaOH = nX = 0,1 mol → MZ = 46 (C2H5OH) → R' = C2H5

=>CTCT của X là

.Q P T

N

H2N-CH2-NH3HCO3 + KOH → H2N-CH2-NH2 + KHCO3 + H2O Câu 29: B Các công thức cấu tạo thỏa mãn của X là

→ m = 0,6. 89 + 0,4. 147 = 112,2gam. Câu 24: C Gọi công thức của X là NH2RCOOR'

Có nX =

O Ạ Đ

UY

2+

Vậy X ở dạng muối amoni của amin : CH3NH3NO3

CH3NH3NO3 + NaOH → CH3NH2 + NaNO3 + H2Ở Vì nCH6Ở3N2 < nNaOH → dung dịch Y gồm NaNO3 0,2 mol và NaOH dư 0,2 mol Vậy mchất rắn = 0,2×85 + 0,2×40 = 25 gam. Câu 31: D Nhận thấy cấu tạo thỏa mãn X gồm C2H5NH3NO3 hoặc (CH3)2NH2NO3 Vì nX < nNaOH → sau phản ứng còn NaOH dư 0,05 mol

0,15------------------0,2............0,15 Khối lượng các chất rắn vô cơ → m = 0,15. 85 + 0,05. 40 = 14,75 gam. Câu 32: B X tác dụng với KOH thu được hợp chất hữu cơ bậc 1 và các chất vô cơ, vậy X có dạng : C3H7-NH3-NO3 (muối amoni nitrat của C3H7-NH2 và HNO3) Phương trình phản ứng : C3H7-NH3-NO3 + KOH → C3H7-NH2 + KNO3 + H2O

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta có nX= 0,14 mol< nKOH= 0,4 mol nên chất rắn sau phản ứng gồm : KNO3 0,14 mol, KOH còn dư : 0,26 mol

CH3-CH2-COONH4, CH3COONH3CH3, HCOONH3-CH2-CH3, HCOONH2(CH3)2

Vậy mchất rắn = 0,14 ×101 + 0,26 ×56= 28,7 gam. Câu 33: A Các công thức thỏa mãn điều kiện là (C2H5NH3+)(CO32-)NH4+, [(CH3)2NH2+](CO32-)NH4+ Câu 34: B Số mol NaOH phản ứng vừa đủ với HCl và 0,1 mol axit α-aminopropionic

Câu 40: B Khi cho X tác dụng với NaOH thu được dung dịch Y chỉ gồm các chất vô cơ và 0,04 mol hỗn hợp 2 chất hữu cơ đơn chức (đều làm xanh giấy quỳ tím ẩm)→ công thức cấu tạo thỏa mãn là (CH3NH3)2CO3 : x mol và C2H5NH3NO3 : y mol

CH3-CH(NH2)-COOH + NaOH → CH3-CH(NH2)COONa + H2O

Ta có hệ

0,1---------------------------0,1-----------------0,1

(CH3NH3)2CO3 + 2NaOH → 2CH3NH2 + Na2CO3 + 2H2O

HCl + NaOH → NaCl + H2O

C2H5NH3NO3 + NaOH → NaNO3 + C2H5NH2+ H2O

0,1-------0,1-------0,1

mmuối = 0,01. 106 + 0,02. 85 = 2,76 gam.

UY

Vậy m = 0,1 x 111 + 0,1 x 58,5 = 16,95 gam Câu 35: A Nhận thấy nH2O = nNaOH + nKOH = 0,12 mol

0 00

Bảo toàn khối lượng → mmuối = 0,02. 118 + 0,02. 98 + 0,06. 36,5 + 0,04. 40 + 0,08. 56- 0,12. 18 = 10,43 gam Câu 36: D Hỗn hợp X gồm 2 amino axit là đồng phân của nhau có M =103 Coi NaOH tác dụng với HCl trước, sau đó NaOH tác dụng với X Có nNaOH = nHCl + nX → 0,2.2 = nX + 0,25

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

→ nX = 0,15 mol →m = 0,15. 103 = 15,45 Câu 37: A Câu 38: C Gọi số mol của lysin (NH2-[CH2]4-CH(NH2)-COOH) và valin ((CH3)2CH-CH(NH2)-COOH) lần lượt là x, y

N Á O

Sử dụng tăng giảm khối lượng ta có hệ

Ỡ Ư D

NG

Í -L

-

T

→ m = 0,2. 146 + 0,25. 117 = 58,45 gam

I Ồ B

Câu 39: A Các công thức cấu tạo thỏa mãn gồm

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

9. PP Giải các dạng toán trọng tâm về Amin – Amino axit – Peptit (Đề 2)

Câu 1. Trùng ngưng glixin thu được tripeptít X. Đốt cháy m gam X được 1,05 gam nitơ. m có giá trị là : A. 4,725 B. 5,275 C. 5,125 D. 4,275 Câu 2. Thủy phân hết hỗn hợp gồm m gam tetrapeptit Ala-Ala-Ala-Ala (mạch hở) thu được hỗn hợp gồm 28,48 gam Ala, 32 gam Ala - Ala và 27,72 gam Ala - Ala - Ala. Giá trị của m là : A. 90,6 gam B. 66,44 gam C. 111,74 gam D. 81,54 gam Câu 3. Thủy phân hoàn toàn 500 gam protein X thu được 14,85 gam glyxin. Nếu phân tử khối của X là 500.000 thì số mắt xích glyxin trong X là: A. 166 B. 198 C. 209 D. 261 Câu 4. Phân tử khối của một pentapeptit bằng 373. Biết pentapeptit này được tạo nên từ một amino axit X mà trong phân tử chỉ có chứa một nhóm amino và một nhóm cacboxyl. Khối lượng mol của X là A. 57,0. B. 60,6. C. 75,0. D. 89,0. Câu 5. Cho 15 gam glyxin tác dụng vừa đủ với 8,9 gam alanin thu được m gam hỗn hợp tripeptit mạch hở. Giá trị của m là A. 22,10. B. 23,9. C. 18,5. D. 20,3. Câu 6. Thủy phân hoàn toàn 60 gam hỗn hợp hai đipeptit thu được 63,6 gam hỗn hợp X gồm các amino axit (các amino axit chỉ có một nhóm amino và một nhóm cacbonyl trong phân tử). Nếu cho 1/10 hỗn hợp X tác dụng với dung dịch HCl (dư), cô cạn cẩn thận dung dịch, thì lượng muối khan thu được là A. 7,09 gam. B. 16,30 gam. C. 8,15 gam. D. 7,82 gam. Câu 7. Đun nóng m gam hỗn hợp gồm a mol tetrapeptit mạch hở X và 2a mol tripeptit mạch hở Y với 600 ml dung dịch NaOH 1M (vừa đủ). Sau khi các phản ứng kết thúc, cô cạn dung dịch thu được 72,48 gam muối khan của các amino axit đều có một nhóm -COOH và một nhóm -NH2 trong phân tử. Giá trị của m là A. 51,72 B. 54,30

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. 66,00 D. 44,48 Câu 8. Cho 20,3 gam Gly-Ala-Gly tác dụng với 500ml dung dịch KOH 1M. Cô cạn dung dịch sau phản ứng thu được m gam chất rắn. Giá trị của m là: A. 48,3. B. 11,2. C. 35,3. D. 46,5. Câu 9. Tripeptit mạch hở X và tetrapeptit mạch hở Y đều được tạo nên từ một α-aminoaxit (no, mạch hở, trong phân tử chứa một nhóm -NH2 và một nhóm -COOH). Đốt cháy hoàn toàn 0,2 mol Y thu được tổng khối lượng CO2 và H2O bằng 95,6 gam. Đốt cháy hoàn toàn 0,1 mol X, sản phẩm thu được cho hấp thụ vào dung dịch Ba(OH)2 dư, sau phản ứng khối lượng dung dịch này A. giảm 81,9 gam B. Giảm 89 gam C. Giảm 91,9 gam D. giảm 89,1 gam Câu 10. Tripeptit mạch hở X và tetrapeptit mạch hở Y đều được tạo ra từ một amino axit no, mạch hở có 1 nhóm –COOH và 1 nhóm –NH2. Đốt cháy hoàn toàn 0,2 mol X thu được sản phẩm gồm CO2, H2O, N2 trong đó tổng khối lượng CO2, H2O là 109,8 gam. Nếu đốt cháy hoàn toàn 0,3 mol Y cần số mol O2 là: A. 4,5 B. 9 C. 6,75 D. 3,375 Câu 11. Polipeptit X chỉ chứa 2 nguyên tử S, chiếm hàm lượng 0,32%. Phân tử khối gần đúng của X là A. 10.000 đvC. B. 15.000 đvC. C. 20.000 đvC. D. 45.000 đvC. Câu 12. Thủy phân hết một lượng pentapeptit X (xúc tác enzim) thu được 32,88 gam Ala–Gly–Ala–Gly; 10,85 gam Ala–Gly–Ala; 16,24 gam Ala–Gly–Gly; 26,28 gam Ala–Gly; 8,9 gam Alanin còn lại là Gly–Gly và Glyxin. Tỉ lệ số mol Gly–Gly : Gly là 10 : 1. Tổng khối lượng Gly–Gly và Glyxin trong hỗn hợp sản phẩm là A. 27,9 gam. B. 29,7 gam. C. 13,95 gam. D. 28,8 gam. Câu 13. Thủy phân hoàn toàn 7,55 gam Gly-Ala-Val-Gly trong dung dịch chứa 0,02 mol NaOH đun nóng, thu được dung dịch X. Cho X tác dụng với 100 ml dung dịch HCl 1M. Sau khi kết thúc các phản ứng thu được dung dịch Y. Cô cạn cẩn thận dung dịch Y thu được m gam chất rắn khan. Giá trị của m là A. 11,21. B. 12,72. C. 11,57. D. 12,99. Câu 14. Đipeptit mạch hở X và tripeptit mạch hở Y đều được tạo nên từ một aminoaxit (no, mạch hở, trong phân tử chứa một nhóm –NH2 và một nhóm –COOH). Đốt cháy hoàn toàn 0,1 mol Y, thu được tổng khối lượng

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

CO2 và H2O bằng 54,9 gam. Đốt cháy hoàn toàn 0,2 mol X, sản phẩm thu được cho lội từ từ qua nước vôi trong dư, tạo ra m gam kết tủa. Giá trị của m là A. 120. B. 60. C. 30. D. 45. Câu 15. Thủy phân hoàn toàn m gam đipeptit Gly-Ala (mạch hở) bằng dung dịch KOH vừa đủ, thu được dung dịch X. Cô cạn toàn bộ dung dịch X thu được 2,4 gam muối khan. Giá trị của m là A. 1,22 B. 1,46 C. 1,36 D. 1,64 Câu 16. Một α-aminoaxit có công thức phân tử là C2H5NO2, khi đốt cháy 0,1 mol oligopeptit X tạo nên từ αaminoaxit đó thì thu được 12,6 gam nước. Vậy X là A. đipeptit. B. tetrapeptit. C. tripeptit. D. pentapeptit. Câu 17. Đun nóng hỗn hợp gồm: 22,5 gam glyxin ; 17,8 gam alanin ; 11,7 gam valin, với xúc tác thích hợp, sau khi phản ứng xảy ra hoàn toàn thu được m gam hỗn hợp X gồm 6 tripeptit. Giá trị của m là: A. 44,8 gam. B. 52 gam. C. 43 gam. D. 41,2 gam. Câu 18. X là tetrapeptit Ala–Gly–Val–Ala; Y là tripeptit Val–Gly–Val. Đun nóng m gam hỗn hợp chứa X và Y (trong đó tỉ lệ mol của X và Y tương ứng là 1 : 3) với dung dịch NaOH vừa đủ. Phản ứng hoàn toàn thu được dung dịch Z, cô cạn dung dịch Z thu được 25,328 gam chất rắn khan. Giá trị của m là A. 19,455 gam B. 34,105 gam C. 18,160 gam D. 17,025 gam Câu 19. Một protein chứa 0,312% Kali. Biết một phân tử protein có chứa 1 nguyên tử Kali. Phân tử khối gần đúng nhất của protein này là: A. 12.500 B. 13.500 C. 14.000 D. 15.400 Câu 20. Thủy phân hoàn toàn 500 gam protein X thu được 178 gam alanin. Phần trăm về khối lượng của gốc alanyl trong X là: A. 37,6% B. 28,4% C. 30,6% D. 31,2% Câu 21. Peptit X do các gốc glyxyl và alanyl tạo nên có khối lượng phân tử là 345. X là A. tripeptit.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. tetrapeptit. C. pentapeptit. D. hexapeptit. Câu 22. Một peptit X chứa n gốc glyxyl và n gốc alanyl có khối lượng phân tử là 274 đvC. Số đồng phân X là ? A. 7 B. 4 C. 6 D. 12 Câu 23. Thực hiện tổng hợp tetrapeptit từ 3,0 mol glyxin; 4,0 mol alanin và 6,0 mol valin. Biết phản ứng xảy ra hoàn toàn. Khối lượng tetrapeptit thu được là A. 1120,5 gam. B. 1510,5 gam. C. 1049,5 gam. D. 1107,5 gam. Câu 24. Thủy phân m gam peptit X có công thức Gly-Gly-Gly-Gly-Gly thu được hỗn hợp Y gồm 3,0 gam Gly; 0,792 gam Gly-Gly; 1,701 gam Gly-Gly-Gly; 0,738 gam Gly-Gly-Gly-Gly; và 0,303 gam X. Giá trị của m là A. 8,5450. B. 6,672. C. 5,8345. D. 5,8176. Câu 25. Đun nóng 0,1 mol một pentapeptit X (được tạo thành từ một amino axit Y chỉ chứa một nhóm -NH2 và một nhóm -COOH) với 700ml dung dịch NaOH 1M, đến phản ứng hoàn toàn cô cạn dung dịch thu được 63,5 gam chất rắn khan. Tên gọi của Y là: A. Axit α-aminoaxetic B. Axit α-aminopropionic C. Axit α-amino-β-phenylpropionic D. Axit α-aminoisovaleric Câu 26. Tripeptit M và tetrapeptit Q đều được tạo ra từ một amino axit X mạch hở, phân tử có một nhóm -NH2. Phần trăm khối lượng của N trong X là 18,667%. Thuỷ phân không hoàn toàn m gam hỗn hợp M, Q (tỉ lệ mol 1 : 1) thu được 0,945 gam M; 4,62 gam đipeptit và 4,125 gam X. Giá trị của m là A. 7,80. B. 18,72. C. 9,69. D. 8,70. Câu 27. Cho 33,1 gam một peptit X có công thức: Ala-Gly-Ala-Gly-Gly tác dụng với một lượng dung dịch HCl vừa đủ. Cô cạn dung dịch thu được sau phản ứng thì thu được m gam muối khan. Khối lượng m là A. 58,55 gam B. 51,35 gam C. 60,35 gam D. 47,7 gam Câu 28. Thủy phân không hoàn toàn a gam tetrapeptit Gly-Ala-Gly-Val trong môi trường axit thu được 0,2 mol Gly-Ala, 0,3 mol Gly-Val, 0,3 mol Ala và m gam hỗn hợp 2 aminoaxit Gly và Val. Giá trị của m A. 57,2 B. 82,1 C. 60,9

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 65,2

Câu 8: D Câu 9: A Tetrapeptit mạch hở Y có công thức Đốt Y:

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A

Tripeptit mạch hở X Thay n=2 nên X: Đốt 0,1 mol X

Câu 2: D Ta có 28,48 gam Ala-> n Ala=0,32 32 gam Ala - Ala -> n Ala-Ala=0,2 27,72 gam Ala - Ala - Ala--> n Ala-Ala-Ala=0,12 --> n tetrapeptit= (0,32+0,2.2+0,12.3)/4.(89.4-18.3)=81,54 Câu 3: B Câu 4: D Có M pentapeptit = 5M X - 4MH2O = 373

→ nđipeptit = 0,2 mol.

H Í

• A-A + 2HCl + H2O → muối

NG

-L

ÓA

P Ấ C

T

2

1 3 +

B

N Ầ TR

Câu 12: A Câu 13: D Câu 14: A Gọi công thức của X : C2nH4nN2O3 và công thức của Y : C3nH6n-1N2O3

0 00

Theo BTKL: mH2O = 63,6 - 60 = 3,6 gam → nH2O = 0,2 mol

N Á O

H

Câu 10: A Câu 11: C Ta có : MX = 2 × 32 : 0,32% = 20 000

Câu 5: D Câu 6: D A-A + 1H2O → 2A

Theo BTKL: mmuối = 6 + 0,04 x 36,5 + 0,02 x 18 = 7,82 gam Câu 7: A Cần để ý rằng:

O Ạ Đ

.Q P T

N

=>khối lượng dung dịch giảm 81,9

MX=

0,02-----0,04-----0,02

G N Ư

UY

N Ơ H

Khi đốt 0,1 mol Y sinh ra 0,1.3n mol CO2 và 0,1. (3n- 0,5) mol H2O → 0,3n. 44 + 18. 0,1. (3n- 0,5) = 54,9 → n= 3 Khi đốt 0,2 mol X sinh ra 0,2. 2.3 = 1,2 mol CO2 → m↓ = 1,2. 100 = 120 gam Câu 15: B Câu 16: B Câu 17: A Câu 18: C Câu 19: A Protein chưa 0,312% Kali, mà trong phân tử có 1 nguyên tử Kali → Câu 20: B

tetrapeptit + 4.NaOH → muối + 1.H2O và tripeptit + 3.NaOH → muối + 1.H2O.

Ỡ Ư D

► chú ý tỉ lệ, theo đó, số mol NaOH cần vừa đủ = 4a + 3 × 2a = 10a = 0,6 mol → a = 0,06 mol.

I Ồ B

Cũng từ phương trình → ∑ n H2O = a + 2a = 0,18 mol.

%

%

Câu 21: C Peptit X tạo từ a glyxin và b alanin

Áp dụng bảo toàn khối lượng ta có: m + 0,6 × 40 = 72,48 + 0,18 × 18 → m = 51,72 gam.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 22: C X tạo bới n gốc glyxyl và n gốc alanyl → X có dạng {n[C2H5O2N]+n[C3H7O2N]-(2n - 1)[H2O]

UY

• MX = 75n + 89n - (2n - 1) × 18 = 274 → n = 2 → X có các đồng phân là A-A-G-G, A-G-A-G, A-G-G-A, G-A-A-G, G-A-G-A, GG-AA Câu 23: D Dựa vào tỷ lệ số mol ta thu được tetrapeptit trung bình gồm có

glyxin,

alani, valin có số mol là 3,25

Câu 24: D Gly-Gly-Gly-Gly-Gly là C10H17O6N5 (M = 303); Gly-Gly-Gly-Gly là C8H14O5N4 (M = 246); Gly-Gly-Gly là C6H11O4N3 (M = 189); Gly-Gly là C4H6O2N2 (M = 132)

0 00

• nC2H5O2N = 3 : 75 = 0,04 mol; nC4H6O2N2 = 0,792 : 132 = 0,006 mol; nC6H11O4N3 = 1,701 : 189 = 0,009 mol; nC8H14O5N4 = 0,738 : 246 = 0,003 mol; nC10H17O6N5 dư = 0,303 : 303 = 0,001 mol

2

• Theo bảo toàn nguyên tố N 5 × nC10H17O6N5 = 5 × nC10H17O6N5 dư + 4 × nC8H14O5N4 + 3 × nC6H11O4N3 + 2 × nC4H6O2N2 + 1 × nC2H5O2N = 5 × 0,001 + 4 × 0,003 + 3 × 0,009 + 2 × 0,006 + 0,04 → nC10H17O6N5 = 0,0192 mol → mC10H17O6N5 = 0,0192 × 303 = 5,8176 gam Câu 25: B Với 1 mol X thì mất 4 mol nước để thủy phân thành amino axit, và tạo ra 5 mol nước khi amino axit tác dụng với NaOH vậy nên cuối cùng là tạo ra 1 mol nước

Bảo toàn khối lượng

Ỡ Ư D

NG

N Ơ H

Câu 27: A Câu 28: C

nên X là pentapeptit

N Á O

Í -L

-

A Ó H

P Ấ C

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

X là pentapeptit của Alanin

I Ồ B

Vậy Y là axit

aminopropionic ( alanin)

Câu 26: D

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

10. Phân biệt một số chất vô cơ (Đề 1)

Câu 1. Có 5 lọ được đánh số, mỗi lọ có chứa một dung dịch trong các dung dịch sau: Na2SO4, Ca(CH3COO)2, Cr2(SO4)3, NaOH và BaCl2. Tiến hành các thí nghiệm sau: • Rót dung dịch từ lọ 4 vào lọ 3 thì có kết tủa trắng xuất hiện. • Rót dung dịch từ lọ 2 vào lọ 1 thì có kết tủa xuất hiện, tiếp tục rót thêm thì kết tủa đó bị tan. • Rót dung dịch từ lọ 4 vào lọ 5 ban đầu chưa có kết tủa, rót thêm thì có lượng nhỏ kết tủa. Khẳng định nào sau đây là đúng ? A. Lọ 1 chứa dung dịch NaOH. B. Lọ 2 chứa dung dịch Cr2(SO4)3. C. Lọ 3 chứa dung dịch Ca(CH3COO)2. D. Lọ 4 chứa dung dịch Na2SO4. Câu 2. Để nhận biết ba axit đặc, nguội: HCl, H2SO4, HNO3 đựng riêng biệt trong ba lọ bị mất nhãn, ta dùng thuốc thử là A. Fe B. CuO. C. Al. D. Cu. Câu 3. Có hai ống nghiệm, một ống đựng dung dịch Na2SO4, một ống đựng dung dịch Na2CO3. Chỉ dùng một hóa chất trong số các chất sau: dung dịch HCl, dung dịch BaCl2, dung dịch NaHSO4, dung dịch NaHSO3, dung dịch AlCl3, khí SO3, khí clo, thì số hóa chất có thể phân biệt hai dung dịch trên là A. 5. B. 6. C. 4. D. 7. Câu 4. X, Y, Z là các dung dịch muối (trung hòa hoặc axit) ứng với 3 gốc axit khác nhau, thỏa mãn điều kiện: X tác dụng với Y có khí thoát ra; Y tác dụng với Z có kết tủa; X tác dụng với Z vừa có khí vừa tạo kết tủa. X, Y, Z lần lượt là A. NaHSO4, Na2CO3, Ba(HSO3)2. B. CaCO3, NaHSO4, Ba(HSO3)2. C. Na2CO3, NaHSO3, Ba(HSO3)2. D. NaHSO4, CaCO3, Ba(HSO3)2. Câu 5. (Đề NC) Để nhận biết các chất rắn riêng rẽ: Zn, ZnO, Al, Al2O3 có thể dùng (theo thứ tự) nhóm hóa chất A. Dung dịch KOH và CO2. B. Dung dịch HCl và dung dịch KOH. C. Dung dịch KOH và dung dịch NH3. D. Dung dịch HCl và dung dịch NH3. Câu 6. Những dụng cụ bằng Ag sẽ chuyển thành màu đen trong không khí có H2S là do Ag tác dụng với: A. H2S B. H2S và H2O C. H2S và O2 D. H2S và N2

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Có năm dung dịch đựng riêng biệt trong năm ống nghiệm: CuCl2, Ni(NO3)2, CrCl2, Al(NO3)3, NaHCO3, Zn(HSO4)2. Cho dung dịch Ba(OH)2 đến dư vào năm dung dịch trên. Sau khi phản ứng kết thúc, số ống nghiệm có kết tủa là A. 2 B. 3 C. 4 D. 5 Câu 8. Để nhận biết một anion X– người ta cho dung dịch AgNO3 vào dung dịch mẫu thử, thấy xuất hiện kết tủa, lấy kết tủa cho vào dung dịch NH3 thấy kết tủa tan. Vậy X– là A. F–. B. I–. C. Cl–. D. Br–. Câu 9. (Đề NC) Khí X (lượng dư) thỏa mãn tất cả các tính chất: tạo kết tủa với dung dịch AgNO3, làm mất màu dung dịch KMnO4, không tồn tại trong một hỗn hợp với SO2, tác dụng được với nước clo. Khí X là A. C2H2. B. H2S. C. NH3. D. HCl. Câu 10. Có thể dùng dung dịch NH3 để phân biệt 2 dung dịch muối nào sau đây? A. CuSO4 và ZnSO4. B. NH4NO3 và KCl. C. MgCl2 và AlCl3. D. NaCl và KNO3. Câu 11. Khi điều chế C2H4 từ C2H5OH và H2SO4 đặc ở 170oC thì thu được khí C2H4 lẫn CO2 và SO2. Muốn thu được khí C2H4 tinh khiết có thể cho hỗn hợp khí trên lội từ từ qua một dung dịch sau: KMnO4, Ca(OH)2, Br2, NaOH. Số dung dịch có thể dùng để loại bỏ cả CO2 và SO2 là A. 4 B. 2 C. 3 D. 1 Câu 12. Có 4 dung dịch muối riêng biệt: CuCl2, ZnCl2, FeCl3, AlCl3. Nếu thêm dung dịch KOH (dư) rồi thêm tiếp dung dịch NH3 (dư) vào 4 dung dịch trên thì số chất kết tủa thu được là A. 4. B. 1. C. 3. D. 2. Câu 13. Hòa tan một oxit kim loại trong dung dịch H2SO4 loãng dư thu được dung dịch X. Dung dịch X tác dụng với H2S được kết tủa màu vàng. Dung dịch X không làm mất màu dung dịch KMnO4. Công thức phân tử của oxit kim loại trên là A. Fe2O3 B. Fe3O4 C. FeO D. CuO

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 14. Có 6 dung dịch đựng trong 6 bình riêng biệt mất nhãn, mỗi bình chứa một trong các dung dịch NaHCO3, Na2CO3, NaHSO4, BaCl2, Ba(OH)2, H2SO4. Không dùng thêm bất kì hóa chất nào khác làm thuốc thử, kể cả quỳ tím và đun nóng, thì số bình có thể nhận biết là: A. 2. B. 4. C. 6. D. 3. Câu 15. Khi sản xuất C2H4 từ C2H5OH và H2SO4 đặc, nóng trong sản phẩm khí tạo ra có lẫn 2 tạp chất là CO2 và SO2. Hóa chất được chọn để loại bỏ hai tạp chất khí đó là A. nước vôi trong dư. B. dung dịch KMnO4 dư. C. dung dịch NaHCO3 dư. D. nước brom dư. Câu 16. Trong công nghiệp luyện kim thường sinh ra khí ô nhiễm X khi đốt các quặng kim loại. Dẫn X qua dung dịch Pb(NO3)2 thấy xuất hiện kết tủa màu đen. X là khí nào sau đây ? A. SO2 B. H2S C. CO2 D. HCl Câu 17. Ba dung dịch X, Y, Z thoả mãn: X + Y → (có kết tủa xuất hiện). Y + Z → (có kết tủa xuất hiện). X + Z → (có kết tủa xuất hiện đồng thời có khí thoát ra) X, Y, Z lần lượt là A. NaHSO4, BaCl2, Na2CO3. B. NaHCO3, NaHSO4, BaCl2. C. FeCl2, Ba(OH)2, AgNO3. D. Al2(SO4)3, BaCl2, Na2CO3. Câu 18. Ba dung dịch X, Y, Z thoả mãn: - X tác dụng với Y có kết tủa T xuất hiện; - Y tác dụng với Z có khí E thoát ra; - X tác dụng với Z vừa có kết tủa T' xuất hiện, vừa có khí E' thoát ra. X, Y, Z lần lượt là A. FeCl3, AgNO3, Na2CO3. B. Ba(OH)2, H2SO4, (NH4)2CO3. C. Al(NO3)3, HCl, K2S. D. PbCO3, Na2S, HCl. Câu 19. (Đề NC) Có 3 dung dịch muối X, Y, Z ứng với 3 gốc axit khác nhau, thoả mãn các điều kiện sau: X + Y → có khí thoát ra Y + Z → có kết tủa xuất hiện X + Z → vừa có kết tủa, vừa có khí thoát ra X, Y, Z lần lượt là A. NaHSO4, Na2SO4, Ba(HCO3)2. B. Ba(HCO3)2, NaHSO4, Na2SO3. C. NaHSO4, Na2SO3, Ba(HCO3)2.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. Na2SO4, Na2SO3, Ba(HCO3)2. Câu 20. Cho dung dịch Na2CO3 vào dung dịch Ca(HCO3)2 thấy A. có kết tủa trắng và bọt khí B. không có hiện tượng gì C. có kết tủa trắng D. có bọt khí thoát ra Câu 21. Cho từ từ dung dịch NaOH đến dư vào dung dịch AlCl3 thấy xuất hiện A. Kết tủa màu nâu đỏ. B. Kết tủa keo trắng, sau đó kết tủa không tan. C. kết tủa màu xanh. D. Kết tủa keo trắng, sau đó kết tủa tan dần. Câu 22. Cho từ từ tới dư dung dịch chất X vào dung dịch AlCl3 thu được kết tủa keo trắng. Chất X là A. NH3. B. HCl C. NaOH. D. KOH. Câu 23. Sản phẩm tạo thành có chất kết tủa khi dung dịch Na2CO3 tác dụng với dung dịch A. CaCl2. B. KCl. C. KOH. D. NaNO3. Câu 24. Sản phẩm tạo thành có chất kết tủa khi dung dịch Ba(HCO3)2 tác dụng với dung dịch A. HCl. B. HNO3. C. KNO3. D. Na2CO3. Câu 25. Dung dịch nào sau đây phản ứng được với dung dịch CaCl2 ? A. NaNO3. B. HCl. C. NaCl. D. Na2CO3. Câu 26. Dung dịch nào sau đây dùng để phân biệt dung dịch KCl với dung dịch K2SO4 ? A. HCl. B. BaCl2. C. NaOH. D. NaCl. Câu 27. Thuốc thử nào sau đây dùng để phân biệt khí H2Svới khí CO2 ? A. Dung dịch Pb(NO3)2 B. Dung dịch HCl C. Dung dịch NaCl. D. Dung dịch K2SO4 Câu 28. Khi nhiệt phân hoàn toàn từng muối X, Y thì đều tạo ra số mol khí nhỏ hơn số mol muối tương ứng. Đốt một lượng nhỏ tinh thể Y trên đèn khí không màu, thấy ngọn lửa có màu vàng. Hai muối X, Y lần lượt là: A. KMnO4, NaNO3. B. Cu(NO3)2, NaNO3.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. CaCO3, NaNO3. D. NaNO3, KNO3. Câu 29. Sục khí nào sau đây vào dung dịch Ca(OH)2 dư thấy xuất hiện kết tủa màu trắng ? A. O2. B. HCl. C. H2. D. CO2. Câu 30. Dẫn mẫu khí thải của một nhà máy qua dung dịch Pb(NO3)2 dư thì thấy xuất hiện kết tủa màu đen. Hiện tượng đó chứng tỏ trong khí thải nhà máy có khí nào sau đây? A. SO2 B. CO2 C. H2S D. NH3 Câu 31. Một mẫu khí thải được sục vào dung dịch CuSO4, thấy xuất hiện kết tủa màu đen. Hiện tượng này do chất nào có trong khí thải gây ra ? A. H2S B. NO2 C. SO2 D. CO2 Câu 32. Cho dãy các chất: NH4Cl, (NH4)2SO4, NaCl, MgCl2, FeCl2, AlCl3. Số chất trong dãy tác dụng với lượng dư dung dịch Ba(OH)2 tạo thành kết tủa là A. 5 B. 4 C. 1 D. 3 Câu 33. Cho dãy các chất: KOH, Ca(NO3)2, SO3, NaHSO4, Na2SO3, K2SO4. Số chất trong dãy tạo thành kết tủa khi phản ứng với dung dịch BaCl2 là A. 4 B. 6 C. 3 D. 2 Câu 34. Chỉ dùng dung dịch KOH để phân biệt được các chất riêng biệt trong nhóm nào sau đây ? A. Zn, Al2O3, Al B. Mg, K, Na C. Mg, Al2O3, Al D. Fe, Al2O3, Mg Câu 35. Chất khí X tan trong nước tạo ra một dung dịch làm chuyển màu quỳ tím thành đỏ và có thể được dùng làm chất tẩy màu. Khí X là A. NH3 B. O3 C. SO2 D. CO2 Câu 36. Hoà tan hoàn toàn một lượng bột Zn vào một dung dịch axit X. Sau phản ứng thu được dung dịch Y và khí Z. Nhỏ từ từ dung dịch NaOH (dư) vào Y, đun nóng thu được khí không màu T. Axit X là A. H2SO4 đặc

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. H3PO4 C. H2SO4 loãng D. HNO3. Câu 37. Thuốc thử dùng để phân biệt 3 dung dịch riêng biệt : NaCl, NaHSO4, HCl là A. NH4Cl B. (NH4)2CO3 C. BaCl2 D. BaCO3 Câu 38. Có 4 ống nghiệm được đánh số theo thứ tự 1, 2, 3, 4. Mỗi ống nghiệm chứa một trong các dung dịch AgNO3, ZnCl2, HI, Na2CO3. Biết rằng: - Dung dịch trong ống nghiệm 2 và 3 tác dụng được với nhau sinh ra chất khí. - Dung dịch trong ống nghiệm 2 và 4 không phản ứng được với nhau. Dung dịch trong các ống nghiệm 1, 2, 3, 4 lần lượt là A. AgNO3, Na2CO3, HI, ZnCl2. B. ZnCl2, HI, Na2CO3, AgNO3. C. ZnCl2, Na2CO3, HI, AgNO3. D. AgNO3, HI, Na2CO3, ZnCl2. Câu 39. Cho Cu và dung dịch H2SO4 loãng tác dụng với chất X (một loại phân bón hoá học), thấy thoát ra khí không màu hoá nâu ngoài không khí. Mặt khác, khi X tác dụng với dung dịch NaOH thì có khí mùi khai thoát ra. Chất X A. ure. B. amoni nitrat. C. amophot. D. natri nitrat. Câu 40. Cho 4 dung dịch: H2SO4 loãng, AgNO3, CuSO4, AgF. Chất không tác dụng được với cả 4 dung dịch trên là A. NH3. B. KOH. C. NaNO3. D. BaCl2. Câu 41. Một mẫu khí thải có chứa CO2, NO2, N2 và SO2 được sục vào dung dịch Ca(OH)2 dư. Trong bốn khí đó, số khí bị hấp thụ là A. 3 B. 4 C. 1 D. 2 Câu 42. Hòa tan một khí X vào nước, thu được dung dịch Y. Cho từ từ dung dịch Y đến dư vào dung dịch ZnSO4, ban đầu thấy có kết tủa trắng, sau đó kết tủa tan ra. Khi X là: A. SO2 . B. NH3 C. NO2. D. HCl. Câu 43. Cho muối X tác dụng với dung dịch NaOH dư, thu được dung dịch chứa hai chất tan. Mặt khác, cho a gam dung dịch muối X tác dụng với a gam dung dịch Ba(OH)2, thu được 2a gam dung dịch Y. Công thức của X là

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. KHS. B. NaHSO4. C. NaHS. D. KHSO3. Câu 44. Khi đốt cháy than đá, thu được hỗn hợp khí trong đó có khí X (không màu, không mùi, độc). X là khí nào sau đây? A. CO2. B. CO. C. SO2. D. NO2. Câu 45. Ba dung dịch A, B, C thoả mãn: - A tác dụng với B thì có kết tủa xuất hiện; - B tác dụng với C thì có kết tủa xuất hiện; - A tác dụng với C thì có khí thoát ra. A, B, C lần lượt là: A. Al2(SO4)3, BaCl2, Na2SO4. B. FeCl2, Ba(OH)2, AgNO3.NaHCO3, NaHSO4, BaCl2. C. NaHSO4, BaCl2, Na2CO3. D. NaHCO3, NaHSO4, BaCl2. Câu 46. Có 6 dung dịch riêng rẽ sau: BaCl2, MgCl2, FeCl2, FeCl3, NH4Cl, (NH4)2SO4. Có thể nhận biết 6 dung dịch trên bằng kim loại: A. Al. B. Na. C. Mg. D. Cu. Câu 47. Dung dịch X gồm các chất tan: AgNO3, Al(NO3)3, Cu(NO3)2, Zn(NO3)2. Chia dung dịch X làm hai phần rồi thực hiện hai thí nghiệm sau: - Cho dung dịch NaOH dư vào phần 1. - Cho dung dịch NH3 dư vào phần 2. Số chất kết tủa có trong cả 2 ống nghiệm sau khi các phản ứng xảy ra hoàn toàn là A. 4. B. 5. C. 2. D. 3. Câu 48. Có thể phân biệt 3 dung dịch: KOH, HCl, H2SO4 (loãng) bằng một thuốc thử là A. Zn. B. Al. C. giấy quỳ tím. D. BaCO3. Câu 49. Khi cho lượng dư dung dịch KOH vào ống nghiệm đựng dung dịch kali đicromat, dung dịch trong ống nghiệm A. Chuyển từ màu da cam sang màu xanh lục. B. Chuyển từ màu da cam sang màu vàng. C. Chuyển từ màu vàng sang màu đỏ. D. Chuyển từ màu vàng sang màu da cam.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 50. Hiện tượng xảy ra khi nhỏ vài giọt dung dịch H2SO4 vào dung dịch Na2CrO4 là: A. Dung dịch chuyển từ màu vàng sang màu da cam. B. Dung dịch chuyển từ màu da cam sang màu vàng. C. Dung dịch chuyển từ màu vàng sang không màu. D. Dung dịch chuyển từ không vàng sang màu da cam. Câu 51. Cho bột nhôm dư vào axit X loãng, to được khí Y không màu, nhẹ hơn không khí và dung dịch Z. Cho dung dịch NaOH đến dư vào dung dịch Z, to. Sau phản ứng hoàn toàn, thấy thoát ra khí T (không màu, đổi màu quỳ tím ẩm sang xanh). Axit X và khí Y là: A. H2SO4 và H2S. B. HCl và H2. C. HNO3 và N2. D. HNO3 và N2O. Câu 52. Có thể dùng NaOH (ở thể rắn) để làm khô các chất khí A. NH3, SO2, CO, Cl2. B. N2, NO2, CO2, CH4, H2. C. NH3, O2, N2, CH4, H2. D. N2, Cl2, O2, CO2, H2. Câu 53. Chất dùng để làm khô khí Cl2 ẩm là A. dung dịch H2SO4 đậm đặc B. Na2SO3 khan C. CaO D. dung dịch NaOH đặc Câu 54. Để nhận biết các khí: CO2, SO2, H2S, N2 cần dùng các dung dịch: A. Nước brom và Ca(OH)2 B. NaOH và Ca(OH)2 C. KMnO4 và HCl D. Nước brom và NaOH Câu 55. Để phân biệt SO2 và SO3 (hơi) bằng phản ứng trao đổi ta có thể dùng chất nào sau đây? A. Dd BaCl2 B. dd Br2 C. Dd Ba(OH)2 D. Dd KMnO4 Câu 56. Để loại bỏ Al, Fe, CuO ra khỏi hỗn hợp gồm Ag, Al, Fe và CuO, có thể dùng lượng dư dung dịch nào sau đây? A. Dung dịch Fe(NO3)3. B. Dung dịch NaOH. C. Dung dịch HNO3. D. Dung dịch HCl. Câu 57. Để bảo quản natri, người ta phải ngâm natri trong A. phenol lỏng. B. dầu hỏa. C. nước. D. ancol etylic. Câu 58. Có các bình mất nhãn riêng biệt chứa các khí sau: CO2, SO2, C2H4, C2H2, SO3. Có thể sử dụng dãy các thuốc thử nào dưới đây để nhận biết các khí đó ?

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. dd NaOH, dd H2SO4, dd Ca(OH)2 và AgNO3/NH3. B. dd HCl, dd Na2SO4, nước brom và AgNO3/NH3. C. dd Ba(OH)2, dd Na2SO4, nước brom và AgNO3/NH3. D. dd Ba(OH)2, dd H2SO4, nước brom và AgNO3/NH3. Câu 59. Để phân biệt SO2 và SO3 (hơi) bằng phản ứng trao đổi ta có thể dùng chất nào sau đây? A. Dd BaCl2 B. dd Br2 C. Dd K2Cr2O7. D. Dd KMnO4 Câu 60. Không thể dùng chất nào sau đây để phân biệt CO2 và SO2 ? A. Dung dịch KMnO4 B. Khí H2S C. dung dịch Br2. D. Ba(OH)2. Câu 61. Cho bốn dung dịch: Br2, Ca(OH)2, BaCl2, KMnO4. Số dung dịch có thể làm thuốc thử để phân biệt hai chất khí SO2 và C2H4 là A. 1. B. 2. C. 3. D. 4. Câu 62. Cho các thuốc thử sau đây: (2). Dung dịch Br2 trong nước. (1). Dung dịch Ba(OH)2. (3). Dung dịch H2S. (4). Dung dịch KMnO4. Để phân biệt hai khí SO2 và CO2 riêng biệt, số thuốc thử có thể sử dụng là A. 1. B. 3. C. 2. D. 4. Câu 63. Thuốc thử nào sau đây không phân biệt được hai dung dịch FeSO4 và Fe2(SO4)3? A. Fe. B. KMnO4/H2SO4. C. Ag. D. Cu. Câu 64. Để nhận biết các dung dịch riêng biệt, không màu: NH3, NaOH, BaCl2, NaCl, cần chọn thuốc thử là A. FeCl3. B. CuSO4. C. AgNO3. D. H2SO4. Câu 65. Để nhận biết các khí: CO2, SO2, H2S, N2 cần dùng các dung dịch: A. Nước brom và Ca(OH)2 B. Nước brom và NaOH C. KMnO4 và NaOH D. NaOH và Ca(OH)2 Câu 66. Có 6 dung dịch không màu, đựng trong các cốc không có nhãn: AlCl3; NH4NO3; KNO3; ZnCl2; (NH4)2SO4; K2SO4. Chỉ cần dùng một chất có thể nhận biết các dung dịch này. Chất đó có thể là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. NH3. B. Ba. C. Pb(NO3)2. D. NaOH. Câu 67. Bằng phương pháp hóa học, có thể phân biệt 3 dung dịch không màu: HCl loãng, KNO3, Na2SO4 đựng trong 3 lọ mất nhãn chỉ với thuốc thử là A. Quỳ tím. B. BaCl2. C. Na2CO3. D. Bột Fe. Câu 68. Thuốc thử duy nhất để phân biệt 5 dung dịch không màu đựng riêng biệt trong các lọ mất nhãn: AlCl3, Fe2(SO4)3, Mg(NO3)2, KCl, NH4NO3 là dung dịch A. HCl. B. NaOH. C. BaCl2. D. NH3. Câu 69. Chỉ dùng thêm chất chỉ thị phenolphtalein thì có thể phân biệt được bao nhiêu dung dịch trong số các dung dịch sau đây: Na2CO3, NaHSO4, AlCl3, Fe(NO3)3, NaCl, Mg(NO3)2, Ba(NO3)2. A. 6. B. 7. C. 4. D. 5. Câu 70. Hợp chất X có các tính chất: (1) Là chất khí ở nhiệt độ thường, nặng hơn không khí. (2) Làm nhạt màu dung dịch thuốc tím. (3) Bị hấp thụ bởi dung dịch Ba(OH)2 dư tạo kết tủa trắng. X là chất nào trong các chất sau ? A. NO2 B. SO2 C. CO2 D. H2S

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: D "Rót dung dịch từ lọ 2 vào lọ 1 thì có kết tủa xuất hiện, tiếp tục rót thêm thì kết tủa đó bị tan": nên lọ 2 chứa NaOH và lọ 1 chứa Cr2(SO4)3 "Rót dung dịch từ lọ 4 vào lọ 3 thì có kết tủa trắng xuất hiện" 4 và 3 là Na2SO4 và BaCl2 "Rót dung dịch từ lọ 4 vào lọ 5 ban đầu chưa có kết tủa, rót thêm thì có lượng nhỏ kết tủa": 5 là Ca(CH3COO)2, nên 4 là Na2SO4 Vậy, 4 là Na2SO4

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 2: D Cho Cu vào 3 axit: + HCl đặc không phản ứng với Cu + HNO3 phản ứng tạo ra khí NO2 màu nâu đỏ + H2SO4 phản ứng tạo khí SO2 không màu

+ Tan, không tạo khí: ZnO và Al2O3 Cả 2 nhóm sau phản ứng đều thu được Al3+ và Zn2+ * Cho NH3 lần lượt vào từng nhóm:

Câu 3: C *HCl: khi cho HCl vào 2 dung dịch thì dung dịch nào có khí thoát ra là Na2CO3, dung dịch còn lại không có hiện tượng là Na2SO4

+ Chất tạo kết tủa là Al3+ + Chất tạo kết tủa và tan khi NH3 dư là Zn2+ Câu 6: C 4Ag + 2H2S + O2 → 2Ag2S↓ + 2H2O Câu 7: D *

*BaCl2: Khi cho BaCl2 vào cả 2 dung dịch thì cả 2 dung dịch đều cho kết tủa BaSO4 và BaCO3 => không phân biệt được *NaHSO4 Cho 2 dd trên vào NaHSO4, dung dịch nào phản ứng tạo khí thoát ra là Na2CO3, dung dịch còn lại là Na2SO4

*

Y tác dụng với Z có kết tủa -> Loại D

G N Ỡ

TO

ÁN

X tác dụng với Z vừa có khí vừa tạo kết tủa -> Loại B

Ư D I Ồ B

Vậy A thỏa mãn

Câu 5: D Cho HCl vào 4 chất trên, ta thu được 2 nhóm:

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

2

0 00

1 3 +

*Khí SO3: Phân biệt giống trường hợp của HCl cũng như NaHSO4 *Khí Clo. Cho Clo vào 2 dung dịch trên: + Na2CO3 có phản ứng với HCl, sinh ra khí ( lưu ý khí gồm CO2 và Cl2 do phản ứng của Clo với H2O là thuận nghịch) + Na2SO4 không phản ứng được nhưng vẫn có khí Clo thoát ra Do 2 khí này không thể phân biệt được nên khí clo không thể phân biệt được 2 dung dịch trên Như vậy, có 4 dung dịch có thể phân biệt được là HCl; NaHSOichjAlCl3; Khí SO3

P Ấ C

N Ầ TR

=>CuCl2 có tạo kết tủa .

*NaHSO3 Khi cho cả dung dịch tren vào NaHSO3 thì cả 2 không phản ứng nên không thể phân biệt được. *AlCl3. Cho AlCl3 vào 2 dung dịch trên, dung dịch nào tạo kết tủa và có khí thoát ra là Na2CO3 Phương trình:

Câu 4: A X, Y, Z ứng với 3 gốc axit khác nhau -> Loại C

N Ơ H

+ Tan, tạo khí: Zn và Al

B

H

G N Ư

O Ạ Đ

.Q P T

UY

N

=>Ni(NO3)2 có tạo kết tủa . * =>CrCl2 có tạo kết tủa . *

=>Al(NO3)3 không tạo kết tủa . * =>NaHCO3 có tạo kết tủa . *

=>CuCl2 có tạo kết tủa

[TEX]\RightarrowZn(HSO4)2 có tạo kết tủa . [TEX]\RightarrowCó 5 chất tạo kết tủa Câu 8: C Ta có AgF tan → loại A.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta dùng nước vôi trong dư để loại bỏ hai tạp chất vì

Có 3 kết tủa AgCl, AgBr, AgI thì chỉ có AgCl mới tan hoàn toàn trong NH3, AgBr tan một phần AgI hầu như không tan

Ca(OH)2 + CO2 → CaCO3↓ + H2O Ag+ + Cl- → AgCl↓ và AgCl + 2NH3 → [Ag(NH3)2]Cl

UY

Ca(OH)2 + SO2 → CaSO3↓ + H2O Câu 9: B Đáp án A: Sai, do C2H2 có thể tồn tại cùng với SO2 (do không phản ứng với SO2) Đáp án B: đúng

Ca(OH)2 là hóa chất hiệu quả lại an toàn, dễ kiếm, rẻ Câu 16: B Khí đi qua Pb(NO3)2 có kết tủa màu đen -> Khí phù hợp là

Đáp án C: Sai do NH3 không tạo kết tủa với AgNO3

+ SO2 và CO2 không phản ứng với Pb(NO3)2

Đáp án D: sai, do không tác dụng với nước Clo. Câu 10: A Dùng NH3 để phân biệt CuSO4 và ZnSO4

+ HCl phản ứng với Pb(NO3)2 cho kết tủa PbCl2 màu trắng Câu 17: D Quan sát đáp án loại trừ:

- CuSO4 + 2NH3 + 2H2O → Cu(OH)2↓xanh + (NH4)2SO4

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

♦ A: cho X + Z chỉ có có khí CO2 mà không có tủa ||→ loại.! Cu(OH)2 + 4NH3 → [Cu(NH3)4](OH)2 (màu xanh)

0 00

B

♦ B: X + Z không có hiện tượng gì xảy ra ||→ loại.

- ZnSO4 + 2NH3 + 2H2O → Zn(OH)2↓trắng + (NH4)2SO4 Zn(OH)2 + 4NH3 → [Zn(NH3)4](OH)2 (không màu) Câu 11: B Có 2 dung dịch có thể loại bỏ cả SO2 và CO2 là Ca(OH)2 và NaOH Câu 12: B

do

tạo phức với

Câu 13: A MxOy + H2SO4 loãng → dung dịch X.

ÁN

-

A Ó H

P Ấ C

2

1 3 +

♦ C: cho X + Z chỉ có tủa AgCl và Ag nhưng không có khí ||→ loại

||→ chỉ có D thỏa mãn: X + Y cho tủa BaSO4; Y + Z cho tủa BaCO3 và X + Z cho tủa Al(OH)3 và khí CO2↑. Câu 18: B X tác dụng với Y có kết tủa T xuất hiện -> Loại C, D vì C k tạo kết tủa còn D k phản ứng với nhau Y tác dụng với Z có khí E thoát ra -> Loại A vì phản ứng tạo kết tủa k tan và k có khí

Đáp án B thỏa mãn Câu 19: C X + Y → có khí thoát ra -> Loại A, D k thỏa mãn

Dung dịch X + H2S → ↓ vàng. DdX không làm mất màu KMnO4. → Oxit kim loại là Fe2O3.

NG

TO

• Fe2O3 + 3H2SO4 → Fe2(SO4)3 + 3H2O

ƯỠ

Y + Z → có kết tủa xuất hiện -> Loại B k thỏa mãn Đáp án C. Ta thấy đáp án C thỏa mãn cả đk thứ 3

Fe2(SO4)3 + H2S → 2FeSO4 + S↓ + H2SO4

Câu 20: C Na2CO3 + Ca(HCO3)2 → CaCO3↓ + 2NaHCO3

Câu 14: B Câu 15: A

Hiện tượng có kết tủa trắng Câu 21: D

D I BỒ

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

3NaOH + AlCl3 → Al(OH)3↓ + 3NaCl

Đáp án A thỏa mãn.

NaOHdư + Al(OH)3 → NaAlO2 + 2H2O

Đáp án B loại vì nhiệt phân Cu(NO3)2 thu được hai khí NO2 và O2 có tổng số mol lớn hơn số mol của muối.

Hiện tượng: ban đầu kết tủa keo trắng, sau đó kết tủa tan dần Câu 22: A X không thể là HCl vì AlCl3 không phản ứng với HCl.

Đáp án C loại vì CaCO3 khi nhiệt phân thu được số mol khí bằng số mol muối.

X không thể là NaOH và KOH vì khi đấy kết tủa keo trắng xuất hiện, sau đó tan trong dung dịch kiềm dư.

Câu 29: D Ca(OH)2 + CO2 → CaCO3↓ + H2O Câu 30: C Hiện tượng này chứng tỏ trong khí thải nhà máy có H2S:

UY

Đáp án D loại vì đốt một lượng nhỏ KNO3 trên đèn khí không màu, thấy ngọn lửa màu tím.

X là NH3 AlCl3 + 3NH3 + 3H2O → Al(OH)3↓ + 3NH4Cl Câu 23: A Sản phẩm tạo thành có chất kết tủa khi cho dung dịch Na2CO3 phản ứng với CaCl2

0 00

Ba(HCO3)2 + KNO3 → không phản ứng. Ba(HCO3)2 + Na2CO3 → 2NaHCO3 + BaCO3↓ Câu 25: D CaCl2 + Na2CO3 → CaCO3↓ + 2NaCl Câu 26: B Ta dùng BaC2 để phân biệt KCl và K2SO4 Nếu xuất hiện kết tủa trắng là K2SO4

N Á O

BaCl2 + K2SO4 → BaSO4↓ + 2KCl

T

Câu 27: A Để phân biệt H2S vào CO2 ta dùng dung dịch Pb(NO3)2

D I BỒ

N Ầ TR

CuSO4 + H2S → CuS↓đen + H2SO4

Ba(HCO3)2 + 2HNO3 → Ba(NO3)2 + 2CO2↑ + 2H2O

ƯỠ

H

Câu 31: A Hiện tượng này là do H2S trong khí thải gây ra

Câu 24: D Ba(HCO3)2 + 2HCl → BaCl2 + 2CO2↑ + 2H2O

NG

G N Ư

O Ạ Đ

Pb(NO3)2 + H2S → PbS↓đen + 2HNO3

CaCl2 + Na2CO3 → CaCO3↓ + 2NaCl

Nếu không có hiện tượng gì là KCl.

.Q P T

N

-

A Ó H

P Ấ C

2

1 3 +

B

Câu 32: D Có 1 chất tác dụng với lượng dư dung dịch Ba(OH)2 tạo thành kết tủa là (NH4)2SO4, MgCl2, FeCl2 Câu 33: D Số chất trong dãy tạo thành kết tủa khi phản ứng với dung dịch BaCl2 là SO3, NaHSO4, Na2SO3 và K2SO4 Câu 34: C Dùng KOH phân biệt được Mg, Al2O3 và Al. - Nếu có hiện tượng chất rắn tan ra và sủi bọt khí → Al

2NaOH + 2Al + 2H2O → 2NaAlO2 + 3H2↑ - Nếu chỉ có hiện tượng chất rắn tan ra → Al2O3 2NaOH + Al2O3 → NaAlO2 + H2O - Nếu không có hiện tượng gì → Mg. Câu 35: C Đáp án A loại vì NH3 tan trong nước tạo ra một dung dịch chuyển màu quỳ tím thành xanh. Đáp án B loại vì O3 tan trong nước tạo dung dịch không làm mất màu quỳ.

Pb(NO3)2 + H2S → PbS↓đen + 2HNO3 Pb(NO3)2 + CO2 → không phản ứng. Câu 28: A

Sưu tầm bởi GV. Nguyễn Thanh Tú

Đáp án C thỏa mãn. Đáp án D loại vì CO2 tan trong nước tạo dung dịch không làm chuyển màu quỳ. Câu 36: D

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

UY

hợp chất của Na - Nếu có ↓ trắng xuất hiện và khí không màu bay ra → NaHSO4 nên X tác dụng với Vậy X là NaHS - Nếu thấy có khí không màu bay ra → HCl Chú ý BaS tan được trong nước BaCO3 + 2HCl → BaCl2 + CO2↑ + H2O

N Ầ TR

Đáp án B thỏa mãn.

Đáp án B loại vì HI (2) và AgNO3 (4) phản ứng với nhau.

H

O Ạ Đ

Đáp án C và D loại vì SO2 và NO2 đều có mùi hắc.

0 00

B

Câu 45: C Đáp án A loại vì Al2(SO4)3 (A) tác dụng với Na2SO4 (C) không có khí thoát ra.

Đáp án C loại vì Na2CO3 (2) và AgNO3 (4) phản ứng với nhau. Câu 39: B X là NH4NO3 3Cu + 2NO3- + 8H+ → 3Cu2+ + 2NO↑ + 4H2O NH4NO3 + NaOH → NaNO3 + NH3↑ + H2O Câu 40: C Đáp án A loại vì NH3 phản ứng với H2SO4, AgNO3, CuSO4, AgF.

H Í

Đáp án B loại vì KOH phản ứng với H2SO4, AgNO3, CuSO4, AgF

ÁN

G N Ư

Câu 44: B Đáp án A loại vì CO2 không độc.

- Nếu không có hiện tượng gì → NaCl Câu 38: D Đáp án A loại vì Na2CO3 (2) và ZnCl2 (4) phản ứng với nhau.

.Q P T

N

chỉ tạo dung dịch mà không tạo kết tủa hay khí

BaCO3 + 2NaHSO4 → BaSO4↓ + Na2SO4 + CO2↑ + H2O

Đáp án C thỏa mãn.

N Ơ H

Câu 43: C X tác dụng với NaOH dư thu được 2 chất tan, mà có 1 chất tan là NaOH dư nên phản ứng chỉ tạo ra 1 chất tan, nên đó là

Nhỏ dung dịch NaOH vào Y, đun nóng thu được khí không màu nên trong Y có NH4NO3 được tạo ra nhờ Zn tác dụng với axit HNO3. Câu 37: D Ta dùng BacO3 để phân biệt ba dung dịch: NaCl, NaHSO4 và HCl

-L

ÓA

P Ấ C

2+

31

Đáp án B loại vì NaHCO3 (A) tác dụng với BaCl2 (C) không có khí thoát ra. Đáp án C thỏa mãn.

Đáp án D loại vì NaHCO3 (A) tác dụng với BaCl2 (C) không có khí thoát ra. Câu 46: B Để phân biệt 6 dung dịch trên ta có thể dùng kim loại Na. Đầu tiên khi cho Na vào các dung dịch đều có hiện tượng sủi bọt khí: 2Na + 2H2O → 2NaOH + H2↑ - Nếu có hiện tượng ↓ trắng → MgCl2

Đáp án D loại vì BaCl2 phản ứng với H2SO4, AgNO3, CuSO4, AgF. Câu 41: A Có 3 khí bị hấp thụ là CO2, NO2 và SO2 Câu 42: B Khí X là NH3

D I BỒ

ƯỠ

NG

TO

MgCl2 + 2NaOH → Mg(OH)2↓ + 2NaCl - Nếu có ↓ trắng xanh, để một lúc trong không khí thì thấy ↓ đỏ nâu → FeCl2 FeCl2 + 2NaOH → Fe(OH)2↓ + 2NaCl

ZnSO4 + 2NH3 + 2H2O → Zn(OH)2↓ + (NH4)2SO4

4Fe(OH)2 + O2 + 2H2O → 4Fe(OH)3↓

Zn(OH)2 + 4NH3 → [Zn(NH3)4](OH)2

- Nếu có ↓ đỏ nâu → FeCl3

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

FeCl3 + 3NaOH → Fe(OH)3↓ + 3NaCl

Zn(OH)2 + 4NH3 → [Zn(NH3)4](OH)2

- Nếu có khí không màu, mùi khai bay ra → NH4Cl và (NH4)2SO4

Câu 48: D Có thể phân biệt ba dung dịch: KOH, HCl, H2SO4 bằng BaCO3

UY

NaOH + NH4Cl → NaCl + NH3↑ + H2O - Nếu xuất hiện ↓trắng và có ↑ khí không màu → H2SO4 2NaOH + (NH4)2SO4 → Na2SO4 + 2NH3↑ + 2H2O BaCO3 + H2SO4 → BaSO4↓ + CO2↑ + H2O - Nếu không có hiện tượng gì → BaCl2 - Nếu chỉ có khí không màu thoát ra → HCl + Dùng BaCl2 phân biệt NH4Cl và (NH4)2SO4 BaCO3 + 2HCl → BaCl2 + CO2↑ + H2O Nếu có ↓ trắng → (NH4)2SO4. Nếu không có hiện tượng gì → NH4Cl

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

- Nếu không có hiện tượng gì → KOH BaCl2 + (NH4)2SO4 → BaSO4↓ + 2NH4Cl

Al(NO3)3 + 3NaOH → Al(OH)3↓ + 3NaNO3 Al(OH)3 + NaOH → NaAlO2 + 2H2O Cu(NO3)2 + 2NaOH → Cu(OH)2↓ + 2NaNO3 Zn(NO3)2 + 2NaOH → Zn(OH)2↓ + 2NaNO3 Zn(OH)2 + 2NaOH → Na2ZnO2 + 2H2O • Khi cho dung dịch NH3 dư vào thu được 1↓

N Á O

AgNO3 + NH3 + H2O → AgOH↓ + NH4NO3

G N Ỡ

T

Í -L

-

A Ó H

P Ấ C

2

1 3 +

N Ầ TR

→ Khi cho lượng dư dung dịch KOH vào ống nghiệm đựng dung dịch K2Cr2O7, dung dịch trong ống nghiệm chuyển tử màu da cam sang màu vàng Câu 50: A 2CrO42- (màu vàng) + 2H+ <=> Cr2O72- (màu da cam) + H2O

0 00

AgNO3 + NaOH → AgOH↓ + NaNO3

AgOH + 2NH3 → [Ag(NH3)2](OH)

H

Câu 49: B 2CrO42- (màu vàng) + 2H+ <=> Cr2O72- (màu da cam) + H2O

Câu 47: D Khi cho NaOH dư vào phần 1 thu được 2↓

B

Khi cho H2SO4 vào dung dịch Na2CrO4 dung dịch chuyển từ màu vàng sang màu da cam Câu 51: C

Câu 52: C Nguyên tắc làm khô các khí là chất làm khô không tương tác được với chất khí. Nhận thấy NaOH tương tác với CO2 và SO2 → Loại B, C, D NaOH(rắn)

dung dịch NaOH

Al(NO3)3 + 3NH3 + 2H2O → Al(OH)3↓ + 3NH4NO3

NaOH (dung dịch) + CO2 → Na2CO3 + H2O

Cu(NO3)2 + 2NH3 + 2H2O → Cu(OH)2↓ + 2NH4NO3

I Ồ B

NaOH (dung dịch) + SO2 → Na2SO3 + H2O

Cu(OH)2 + 4NH3 → [Cu(NH3)4](OH)2

Zn(NO3)2 + 2NH3 + 2H2O → Zn(OH)2↓ + 2NH4NO3

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 53: A

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn Chất dùng để làm khô khí

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

ẩm là chất hút nước mạnh và không tác dụng với BaSO3 + 2HCl → BaCl2 + SO2 + H2O

Cả 4 chất trên đều hút nước nhưng

đặc,

đều tác dụng được với Nếu xuất hiện ↓, ↓ không tan là SO3 BaCl2 + SO3 + H2O → BaSO4↓ + 2HCl Câu 56: D Để loại bỏ Al, Fe, CuO ra khỏi hỗn hợp ta dùng HCl

Do đó chỉ có thể dùng dung dịch

2Al + 6HCl → 2AlCl3 + 3H2↑

đặc

Câu 54: A Để nhận biết CO2, SO2, H2S và N2 ta dùng dung dịch Br2 và dung dịch Ca(OH)2

Fe + 2HCl → FeCl2 + H2↑

H

CuO + 2HCl → CuCl2 + H2O Đầu tiên khi cho Br2 vào các dung dịch, dung dịch nào mất màu Br2 → SO2 và H2S

0 00

H2S + 4Br2 + 4H2O → H2SO4 + 8HBr Nếu không có hiện tượng gì → CO2 và N2 • Ta cho dung dịch Ca(OH)2 đến dư vào SO2 và H2S Nếu xuất hiện ↓ → SO2 Ca(OH)2 + SO2 → CaSO3↓ + H\2O

H Í

Nếu không có hiện tượng gì → H2S. Ta cho dung dịch Ca(OH)2 dư tác dụng với CO2 và N2

N Á O

Nếu xuất hiện ↓ → CO2

G N Ỡ

Nếu không có hiện tượng gì → N2

T

Câu 55: A Để nhận biết SO2 và SO3 ta dùng BaCl2

Ư D I Ồ B

N

Ag không phản ứng nên tách ra Câu 57: B Do Natri dễ dàng tác dụng với nước, phenol hay ancol etylic, do đó để bảo quản Na, người ta ngâm Na trong dầu hỏa

SO2 + Br2 + 2H2O → 2HBr + 2H2SO4

Ca(OH)2 + CO2 → CaCO3↓ + H2O

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

UY

Nếu xuất hiện ↓ → SO2, sau đó ↓ tan. SO2 + H2O + BaCl2 → BaSO3 + 2HCl

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

ÓA

P Ấ C

2

1 3 +

B

Câu 58: D B1: Dùng Ba(OH)2 thiếu - Nếu xuất hiện ↓, sau đó ↓ tan → CO2 và SO2. - Nếu xuất hiện ↓ → SO3. - Nếu không có hiện tượng gì → C2H4 và C2H2 • B2: cho C2H4 và C2H2 phản ứng với H2O trong môi trường H2SO4 loãng CH2=CH2 + H2O CH≡CH + H2O

CH3CH2OH CH3CHO

- Sản phẩm cho phản ứng với AgNO3/NH3. Nếu thấy ↓Ag xuất hiện → CH≡CH. Nếu không có hiện tượng gì → CH2=CH2. • B3: Cho SO2 và CO2 phản ứng với nước Brom Nếu nước brom mất màu → SO2

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta không dùng Ag để phân biệt FeSO4 và Fe2(SO4)3 vì khi Ag vào không có hiện tượng gì xảy ra cả. Nếu không có hiện tượng gì → CO2. Câu 59: A Để nhận biết SO2 và SO3 ta dùng BaCl2

Câu 64: B Để nhận biết các dung dịch không màu này, ta dùng CuSO4

Nếu xuất hiện ↓ → SO2, sau đó ↓ tan.

- Nếu xuất hiện ↓xanh, sau đó ↓ tan tạo màu xanh → NH3

SO2 + H2O + BaCl2 → BaSO3 + 2HCl

CuSO4 + 2NH3 + 2H2O → Cu(OH)2↓xanh + (NH4)2SO4

BaSO3 + 2HCl → BaCl2 + SO2 + H2O

Cu(OH)2 + 4NH3 → [Cu(NH3)4](OH)2 (màu xanh)

Nếu xuất hiện ↓, ↓ không tan là SO3

- Nếu chỉ có ↓ xanh → NaOH

BaCl2 + SO3 + H2O → BaSO4↓ + 2HCl

CuSO4 + 2NaOH → Cu(OH)2↓ + Na2SO4

Câu 60: D Khi cho KMnO4 vào dung dịch SO2 thì dung dịch mất màu tím.

- Nếu có ↓ trắng → BaCl2

N Ầ TR

H

G N Ư

O Ạ Đ

UY

.Q P T

N

CuSO4 + BaCl2 → BaSO4↓ + CuCl2 Khi cho khí H2S vào dung dịch SO2 thì xuất hiện ↓ vàng.

0 00

B

- Nếu không có hiện tượng gì → NaCl

Khi cho dung dịch Br2 vào SO2 thì dung dịch Br2 mất màu. Khi cho ba dung dịch trên vào CO2 thì không có hiện tượng gì → phân biệt được.

2

Ta không thể dùng Ba(OH)2 để phân biệt CO2 và SO2 vì đều xuất hiện ↓ trắng và kết tủa tan trong môi trường khí dư. Câu 61: C Có 3 thuốc thử có thể phân biệt SO2 và C2H4: Br2 : C2H4 cho dung dịch phân lớp; SO2 cho dung dịch đồng nhất. Ca(OH)2: SO2 tạo tủa, tủa tan nếu khí sunfuro dư. KMnO4: SO2 tạo dung dịch đồng nhất; C2H4 cho tủa MnO2

N Á O

-L

H Í

ÓA

P Ấ C

Câu 62: B Để phân biệt hai khí SO2 và CO2 riêng biệt ta có thể dùng 3 thuốc thử là (2), (3), (4) Câu 63: C Khi cho Fe vào Fe2(SO4)3 thì Fe tan ra, dung dịch có màu xanh. Còn khi cho vào FeSO4 không có hiện tượng gì.

G N Ỡ

T

Khi cho FeSO4 vào dung dịch KMnO4/H2SO4 thì dung dịch mất màu tím; còn khi cho Fe2(SO4)4 vào dung dịch KMnO4 thì không có hiện tượng gì.

I Ồ B

Khi cho Cu vào dung dịch FeSO4 không có hiện tượng gì xảy ra. Còn khi cho vào dung dịch Fe2(SO4)3 thì Cu tan ra, dung dịch mất màu nâu.

Sưu tầm bởi GV. Nguyễn Thanh Tú

1 3 +

Câu 65: A Để nhận biết CO2, SO2, H2S và N2 ta dùng dung dịch Br2 và dung dịch Ca(OH)2 Đầu tiên khi cho Br2 vào các dung dịch, dung dịch nào mất màu Br2 → SO2 và H2S

SO2 + Br2 + 2H2O → 2HBr + 2H2SO4 H2S + 4Br2 + 4H2O → H2SO4 + 8HBr Nếu không có hiện tượng gì → CO2 và N2 • Ta cho dung dịch Ca(OH)2 đến dư vào SO2 và H2S Nếu xuất hiện ↓ → SO2 Ca(OH)2 + SO2 → CaSO3↓ + H\2O Nếu không có hiện tượng gì → H2S. Ta cho dung dịch Ca(OH)2 dư tác dụng với CO2 và N2 Nếu xuất hiện ↓ → CO2 Ca(OH)2 + CO2 → CaCO3↓ + H2O

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

+ KNO3 và Na2SO4 không có hiện tượng gì. Nếu không có hiện tượng gì → N2

+ Nhưng nếu cho thêm vào 2 bình trên một ít HCl thì 1 dung dịch sẽ có khí không màu, hóa nâu trong không khí sinh ra, dung dịch dó là KNO3 (do phản ứng của H+ + NO3-).

Câu 66: B Ta dùng Ba để phân biệt 6 dung dịch.

UY

Khi cho Ba vào thì đầu tiên: Ba + 2H2O → Ba(OH)2 + H2↑

Câu 68: B Ta dùng NaOH để phân biệt 5 dung dịch

- Nếu dung dịch xuất hiện ↓ huyền phù sau đó ↓ tan → AlCl3

- Nếu xuất hiện ↓ huyền phù sau đó ↓ tan → AlCl3

- Nếu có ↑ mùi khai → NH4NO3

- Nếu xuất hiện ↓ đỏ nâu → Fe2(SO4)3

- Nếu dung dịch xuất hiện ↓ trắng sau đó ↓ tan → ZnCl2

- Nếu xuất hiện ↓ trắng → Mg(NO3)2

- Nếu dung dịch xuất hiện ↓ trắng và có ↑ mùi khai → (NH4)2SO4

- Nếu xuất hiện ↑ mùi khai → NH4NO3

- Nếu không có hiện tượng gì → KNO3.

- Nếu không có hiện tượng gì → KCl. Câu 69: B B1: Cho dung dịch phenolphtalein vào các dung dịch

Câu 67: D ♦ Nếu sử dụng quỳ tím:

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

- Nếu dung dịch chuyển màu hồng → Na2CO3.

31

Cho vào thì chỉ phân biệt được HCl (quỳ đổi màu đỏ), còn 2 chất kia không làm quỳ đổi màu ♦ Nếu dùng Na2CO3: Cho vào cả ba chất trên: + Chất phản ứng có bọt khí thoát ra là HCl

H Í

+ Còn lại 2 chất kia không có hiện tượng nên cũng không phân biệt được ♦ Nếu dùng BaCl2:

N Á O

+ HCl: không hiện tượng + KNO3: không hiện tượng + Na2SO4: tạo kết tủa → Không phân biệt được

I Ồ B

G N Ỡ

T

-L

ÓA

P Ấ C

2+

- Còn lại 6 dung dịch không chuyển màu. • B2: Cho từ từ Na2CO3 vào các dung dịch không chuyển màu - Nếu xuất hiện ↑ không màu → Na2CO3 2NaHSO4 + Na2CO3 → 2Na2SO4 + CO2↑ + H2O - Nếu xuất hiện ↓ huyền phù và có khí không màu → AlCl3

2AlCl3 + 3Na2CO3 + 3H2O → 2Al(OH)3↓ + 3CO2↑ + 6NaCl - Nếu xuất hiện ↓ đỏ nâu và có khí không màu → Fe(NO3)3 3Na2CO3 + 2Fe(NO3)3 + 3H2O → 2Fe(OH)3↓ + 6NaCl + 3CO2↑ - Nếu xuất hiện ↓ trắng → Mg(NO3)2 và Ba(NO3)2 • B3: Cho Mg(NO3)2 và Ba(NO3)2 phản ứng với NaHSO4

♦ Dùng bột Fe: cho vào cả 3 dung dịch.

Nếu xuất hiện ↓ trắng → Ba(NO3)2

+ HCl: có bọt khí sinh ra

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Nếu không có hiện tượng gì → Mg(NO3)2 Câu 70: B Đáp án C loại vì CO2 không làm nhạt màu dung dịch thuốc tím.

UY

Đáp án A loại vì NO2 bị hấp thụ bởi Ba(OH)2 nhưng không tạo kết tủa trắng. Đáp án D loại vì H2S bị hấp thụ bởi Ba(OH)2 nhưng không tạo kết tủa trắng.

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

11. Phân bón hoá học (Đề 1)

Câu 1. Phân bón nitrophotka (NPK) là hỗn hợp của A. (NH4)2HPO4 và KNO3. B. NH4H2PO4 và KNO3. C. (NH4)3PO4 và KNO3. D. (NH4)2HPO4 và NaNO3. Câu 2. Loại phân bón nào dưới đây phù hợp với đất chua ? A. Supephotphat đơn. B. Supephotphat kép. C. Amophot. D. Phân lân nung chảy. Câu 3. Hoà tan m(g) hỗn hợp X gồm đạm Urê và NH4NO3 vào lượng dư dung dịch Ca(OH)2 đun nóng. Sau khi kết thúc phản ứng thu được 9 gam kết tủa và thoát ra 4,256 lít khí. Phần trăm khối lượng của Urê trong X là A. 12,91%. B. 83,67%. C. 91,53%. D. 87,09%. Câu 4. Phân đạm 2 lá là A. NH4Cl B. NH4NO3 C. (NH4)2SO4 D. NaNO3 Câu 5. Cho Cu và dung dịch H2SO4 loãng tác dụng với chất X (một loại phân bón hóa học), thấy thoát ra khí không màu hóa nâu trong không khí. Mặt khác, khi X tác dụng với dung dịch NaOH thì có khí mùi khai thoát ra. Chất X là A. amophot. B. ure. C. natri nitrat. D. amoni nitrat. Câu 6. Thành phần chính của quặng photphorit là A. CaHPO4. B. Ca3(PO4)2. C. Ca(H2PO4)2. D. NH4H2PO4. Câu 7. Amophot có thành phần chính là A. NH4H2PO4 và H3PO4. B. (NH4)2HPO4 và NH4H2PO4. C. (NH4)3PO4 và (NH4)2HPO4. D. NH3 và (NH4)3PO4. Câu 8. Thành phần của phân supephotphat là: A. Ca3(PO4)2. B. CaHPO4.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. Ca(H2PO4)2. D. Ca(H2PO4)2 và Ca3(PO4)2. Câu 9. Phân bón nào sau đây làm tăng độ chua của đất ? A. KCl. B. NH4NO3. C. NaNO3. D. K2CO3. Câu 10. Khi trồng trọt phải bón phân cho đất để A. Làm cho đất tơi xốp. B. Bổ sung nguyên tố dinh dưỡng cho đất. C. Giữ độ ẩm cho đất. D. A và B. Câu 11. Chất nào dưới đây có thể dùng làm phân đạm A. NH4Cl. B. NH4NO3. C. (NH2)2CO. D. Cả A, B, C. Câu 12. Để đánh giá chất lượng phân đạm, người ta dựa vào chỉ số A. % khối lượng NO có trong phân. B. % khối lượng HNO3 có trong phân. C. % khối lượng N có trong phân. D. % khối lượng NH3 có trong phân. Câu 13. Đạm urê có công thức là A. NH4NO3. B. NaNO3. C. (NH4)2SO4. D. (NH2)2CO. Câu 14. Muốn tăng cường sức chống bệnh, chống rét và chịu hạn cho cây người ta dùng loại phân bón nào? A. NH4Cl. B. Amophot. C. KCl. D. Supephotphat. Câu 15. Độ dinh dưỡng của phân lân được đánh giá bằng hàm lượng của A. P. B. P2O5. C. PO43D. H3PO4. Câu 16. Thành phần hoá học của supephotphat đơn là A. Ca3(PO4)2. B. Ca(H2PO4)2. C. CaHPO4. D. Ca(H2PO4)2 và CaSO4. Câu 17. Thành phần hoá học của supephotphat kép là A. Ca3(PO4)2. B. Ca(H2PO4)2.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. CaHPO4. D. Ca(H2PO4)2 và CaSO4. Câu 18. Tro thực vật cũng là một loại phân kali vì có chứa A. KNO3. B. KCl. C. K2CO3. D. K2SO4. Câu 19. Độ dinh dưỡng của phân kali được đánh giá bằng chỉ số nào sau đây? A. Hàm lượng % về khối lượng K trong phân. B. Hàm lượng % về khối lượng K2O trong phân. C. Số nguyên tử K trong phân. D. Hàm lượng % về khối lượng KOH trong phân. Câu 20. Khẳng định nào dưới đây không đúng? A. Phân đạm cung cấp N cho cây. B. Phân lân cung cấp P cho cây. C. Phân kali cung cấp K cho cây. D. Phân phức hợp cung cấp O cho cây. Câu 21. Chọn nhận xét đúng? A. Thành phần chính của supephotphat đơn là Ca(H2PO4)2. B. Amophot là hỗn hợp gồm (NH4)2HPO4 và NH4H2PO4. C. Thành phần chính của supephotphat kép là Ca(H2PO4)2 và CaSO4. D. Nitrophotka là hỗn hợp gồm KNO3 và NH4H2PO4. Câu 22. Khi bón đạm ure cho cây người ta không bón cùng với A. NH4NO3 B. phân kali C. phân lân D. vôi Câu 23. Phát biểu không đúng là: A. Phân supephotphat kép có độ dinh dưỡng cao hơn supephotphat đơn. B. Độ dinh dưỡng phân kali được đánh giá theo tỉ lệ % khối lượng K2O tương ứng với lượng K có trong thành phần của nó. C. Trong phòng thí nghiệm NH3 được điều chế bằng cách cho NH4Cl tác dụng với Ca(OH)2 đun nóng. D. Khi đốt NH3 bằng O2 trong Pt ở 850oC thu được N2. Câu 24. Phân bón hoá học: Đạm, Lân, Kali lần lượt được đánh giá theo chỉ số nào: A. Hàm lượng % số mol: N, P2O5, K2O. B. Hàm lượng %m: N, P2O5, K2O. C. Hàm lượng % m: N2O5, P2O5, K2O. D. Hàm lượng %m: N, P, K. Câu 25. Trong các loại phân bón sau: NH4Cl, (NH2)2CO, (NH4)2SO4, NH4NO3; loại có hàm lượng đạm cao nhất là A. (NH4)2SO4. B. NH4Cl. C. NH4NO3. D. (NH2)2CO. Câu 26. Urê được điều chế từ :

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. khí amoniac và khí cacbonic. B. khí cacbonic và amoni hiđroxit. C. axit cacbonic và amoni hiđroxit. D. supephotphat đơn và supephotphat kép đều sản xuất qua 2 giai đoạn. Câu 27. Không nên bón phân đạm cùng với vôi vì ở trong nước A. phân đạm làm kết tủa vôi. B. phân đạm phản ứng với vôi tạo khí NH3 làm mất tác dụng của đạm. C. phân đạm phản ứng với vôi và toả nhiệt làm cây trồng bị chết vì nóng. D. cây trồng không thể hấp thụ được đạm khi có mặt của vôi. Câu 28. Loại phân bón hoá học có tác dụng làm cho cành lá khoẻ, hạt chắc, quả hoặc củ to là A. phân đạm. B. phân lân. C. phân kali. D. phân vi lượng. Câu 29. Muốn tăng cường sức chống bệnh, chống rét và chịu hạn cho cây người ta dùng A. phân đạm. B. phân kali. C. phân lân. D. phân vi lượng. Câu 30. Phát biểu nào sau đây không đúng ? A. Phân đạm cung cấp nitơ hóa hợp cho cây dưới dạng ion nitrat và ion amoni. B. Supephotphat đơn chứa hàm lượng P2O5 cao hơn supephotphat kép vì thành phần của nó chỉ chứa Ca(H2PO4)2. C. Phân lân cung cấp photpho cho cây dưới dạng ion photphat. D. Phân amophot thuộc loại phân phức hợp. Câu 31. Cho các loại phân đạm sau: amoni sunfat, amoni clorua, natri nitrat. Có thể dùng thuốc thử nào sau đây để nhận biết các phân đạm trên: A. dung dịch NaOH B. dung dịch NH3 C. dung dịch Ba(OH)2 D. dung dịch BaCl2 Câu 32. Khi bón supephotphat người ta không trộn với vôi vì: A. tạo khí PH3 B. tạo muối CaHPO4 C. tạo muối Ca3(PO4)2 kết tủa D. tạo muối CaHPO4 và Ca3(PO4)2 Câu 33. X là một loại phân bón hóa học. Hòa tan X vào nước thu được dung dịch Y. Cho từ từ dung dịch NaOH vào Y rồi đun nóng có khí thoát ra và thu được dung dịch Z. Cho dung dịch AgNO3 vào Z có kết tủa màu vàng. Công thức của X là A. NH4Cl. B. (NH4)2HPO4. C. Ca(H2PO4)2. D. (NH4)2SO4. Câu 34. Cho sơ đồ phản ứng sau:

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ X  → Y  → Z → Supephotphat kep Photpho  ց Amophot X, Y, Z tương ứng với nhóm các chất là: A. PH3, P2O5, H3PO4 B. P2O5, HPO3, H4P2O7 C. P2O5, H3PO4, HPO3 D. P2O5, H3PO4, H4P2O7 Câu 35. Một loại supephotphat kép chứa 70% canxi đihiđrophotphat về khối lượng. Hàm lượng P2O5 trong loại phân bón đó là bao nhiêu ? A. 47,65%. B. 45,26%. C. 40,00%. D. 42,48%. Câu 36. Cho 13,44 m3 khí NH3 (đktc) tác dụng với 49 kg H3PO4. Thành phần khối lượng của amophot thu được là A. NH4H2PO4: 60 kg; (NH4)2HPO4: 13,2 kg. B. NH4H2PO4: 46 kg; (NH4)2HPO4: 13,2 kg. C. NH4H2PO4: 13,2 kg; (NH4)2HPO4: 20 kg; (NH4)3PO4: 26 kg. D. kết quả khác. Câu 37. Khi cho khí NH3 tác dụng vừa đủ với 1,96 tấn axit photphoric khan theo tỉ lệ mol tương ứng là 3 : 2. Khối lượng phân amophot thu được là A. 24,7 tấn. B. 2,47 tấn. C. 1,15 tấn. D. 1,32 tấn. Câu 38. Hàm lượng (%) của KCl trong một loại phân bón có %K2O = 50 là A. 79,26% B. 72,68% C. 80,63% D. 74,75% Câu 39. Cho 10 tấn H2SO4 98% tác dụng hết với 1 lượng vừa đủ Ca3(PO4)2 thì thu được bao nhiêu tấn supephotphat đơn, biết hiệu suất điều chế là 80%. A. 18,15 tấn B. 20,24 tấn C. 36,88 tấn D. 40,48 tấn Câu 40. Quá trình tổng hợp supephotphat kép diễn ra theo sơ đồ: + Ca3 ( PO4 ) 2 + H 2 SO4 Ca3 ( PO4 ) 2   → H 3 PO4   → Ca ( H 2 PO4 ) 2

Ỡ Ư D

NG

N Á O

Í

-L

-H

ÓA

P Ấ C

2

T

Tính khối lượng dung dịch H2SO4 70% đã dùng để điều chế được 351 kg Ca(H2PO4)2 theo sơ đồ biến hóa trên. Biết hiệu suất của quá trình là 70%. A. 800 kg B. 600 kg C. 500 kg D. 420 kg

I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

UY

0 00

1 3 +

N Ơ H

Câu 41. Cho chất X vào dung dịch NaOH đun nóng thu được khí Y; cho chất rắn X vào dung dịch HCl sau đó cho Cu vào thấy Cu tan ra và có khí không màu hóa nâu trong không khí. Nhiệt phân X trong điều kiện thích hợp thu được một oxit phi kim. Vậy X là chất nào sau đây? A. NH4NO3 B. NH4NO2 C. (NH4)2S D. (NH4)2SO4 Câu 42. Cho các phát biểu sau: a) Có ba loại phân bón hoá học chính là phân đạm, phân lân, phân kali. (b) Thành phần chính của supephotphat kép là Ca(H2PO4)2 và CaSO4. (c) Cần bón vôi cho đất chua ngay trước khi bón đạm amoni. (d) Phân lân nung chảy chỉ thích hợp cho đất chua. (e) Thành phần chính của nitrophotka gồm KNO3 và NH4H2PO4. (g) Amophot là hỗn hợp chứa nitơ, photpho, kali nên còn được gọi là phân NPK. (h) Phân ure có ưu điểm là dễ bảo quản và hàm lượng đạm lớn. (i) Để cây sinh trưởng và phát triển tốt, cần bón nhiều phân vi lượng. Số phát biểu đúng là A. 3. B. 4. C. 5. D. 6. Câu 43. Một loại phân lân có thành phần chính Ca(H2PO4)2.2CaSO4 và 10,00% tạp chất không chứa photpho. Hàm lượng dinh dưỡng trong loại phân lân đó là A. 25,26%. B. 36,42%. C. 28,40%. D. 31,00%. Câu 44. Phát biểu nào sau đây là đúng ?

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

A. Phân lân cung cấp nitơ hoá hợp cho cây dưới dạng ion nitrat ( NO3− ) và ion amoni ( NH 4 + ). B. Amophot là hỗn hợp các muối (NH4)2HPO4 và KNO3. C. Phân hỗn hợp chứa nitơ, photpho, kali được gọi chung là phân NPK. D. Phân urê có công thức là (NH4)2CO3. Câu 45. Chọn câu đúng: A. Phân đạm là những hợp chất cung cấp N cho cây trồng. B. Phân đạm là những hợp chất cung cấp P và N cho cây trồng. C. Phân lân là những hợp chất cung cấp K cho cây trồng. D. Phân kali là những hợp chất cung cấp K và P cho cây trồng. Câu 46. Hầu hết phân đạm amoni : NH4NO3, NH4Cl, (NH4)2SO4 thích hợp cho các loại đất ít chua là do các muối amoni này A. bị thủy phân tạo môi trường bazơ. B. bị thủy phân tạo môi trường axit. C. bị thủy phân tạo môi trường trung tính. D. không bị thủy phân. Câu 47. Trong các loại phân bón: NH4Cl, (NH2)2CO, (NH4)2SO4, NH4NO3. Phân nào có hàm lượng đạm cao nhất ?

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. (NH2)2CO. B. (NH4)2SO4. C. NH4Cl. D. NH4NO3. Câu 48. Urê được điều chế từ A. khí amoniac và khí cacbonic. B. khí cacbonic và amoni hiđroxit. C. axit cacbonic và amoni hiđroxit. D. khí cacbon monoxit và amoniac. Câu 49. Cho các phát biểu sau: (1) Độ dinh dưỡng của phân kali được đánh giá theo tỉ lệ phần trăm khối lượng K trong phân kali. (2) Amophot là hỗn hợp các muối (NH4)2HPO4 và (NH4)3PO4. (3) Nitrophotka là hỗn hợp của (NH4)2HPO4 và KNO3. (4)Phân phức hợp là loại phân chứa đồng thời cả nitơ, photpho, kali. (5) Phân đạm cung cấp nitơ hóa hợp cho cây dưới dạng ion NO3- và ion NH4+. (6) Thành phần chính của phân lân nung chảy là hỗn hợp photphat và silicat của canxi và magie. Số phát biểu đúng là: A. 1. B. 4. C. 2. D. 3. Câu 50. Tỉ lệ khối lượng các nguyên tố dinh dưỡng cần bón cho đất thường là mN:mP:mK=10:8:6. Tính tỉ lệ khối lượng phân bón m(NH4)2SO4: mCa(H2PO4)2: mKCl cần dùng để đảm bảo tỉ lệ khối lượng các nguyên tố N, P, K trên? A. 30: 47: 11,5 B. 47: 30:11,5 C. 35: 49: 9,5 D. 49: 35: 9,5 Câu 51. Supephotphat đơn được điều chế từ một loại bột quặng có chứa 73% Ca3(PO4)2, 26% CaCO3, 1% SiO2. Tính khối lượng dung dịch H2SO4 65% đủ để tác dụng với 100 kg bột quặng đó? A. 110 kg B. 115 kg C. 120 kg D. 125 kg Câu 52. Cho từ từ 62 gam Ca3(PO4)2 vào 100 ml dung dịch H2SO4 5M. Khối lượng muối (khan) thu được là A. 111,0 gam. B. 91,4 gam. C. 43,0 gam. D. 23,4 gam. Câu 53. Một loại phân đạm ure có hàm lượng đạm vào khoảng 46%. Khối lượng ure đủ để cung cấp 70 kg N dinh dưỡng cho cây trồng là A. 50,9 kg B. 145,5 kg. C. 152,2 kg. D. 200 kg.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 54. Khối lượng NH3 và dung dịch HNO3 45% đủ để điều chế 100 kg phân đạm có 34% N là A. 20,6 kg và 76,4 kg. B. 7,225 kg và 26,775 kg. C. 20,6 kg và 170 kg. D. 7,75 kg và 59,5 kg. Câu 55. Một loại phân urê có 15% tạp chất trơ không chứa N. Độ dinh dưỡng của phân này là A. 19,83% B. 39,67% C. 42% D. 23,33% Câu 56. Đạm urê được điều chế bằng cách cho amoniac tác dụng với CO2 ở nhiệt độ 180 – 200oC, dưới áp suất khoảng 200 atm. Để thu được 6 kg đạm urê thì thể tích amoniac (đktc) đã dùng (giả sử hiệu suất đạt 80%) là A. . 2800 lít. B. 4480 lít. C. 5600 lít. D. 3584 lít. Câu 57. Một loại phân urê chứa 95% (NH2)2CO, còn lại là (NH4)2CO3. Độ dinh dưỡng của loại phân này là: A. 46,00% B. 43,56% C. 44,33% D. 45,79% Câu 58. Một loại phân supephotphat kép có chứa 69,62% muối canxi đihiđrophotphat, còn lại gồm các chất không chứa photpho. Độ dinh dưỡng của loại phân lân này là A. 48,52%. B. 42,25%. C. 39,76%. D. 45,75%. Câu 59. Phân supephotphat kép thực tế sản xuất được thường chỉ có 40% P2O5. Thành phần % khối lượng Ca(H2PO4)2 trong phân bón đó là A. 78,56%. B. 56,94%. C. 65,92%. D. 75,83%. Câu 60. Một mẫu supephotphat đơn khối lượng 15,55 gam chứa 35,43% Ca(H2PO4)2 còn lại là CaSO4. Độ dinh dưỡng của loại phân bón trên là A. 21,5%. B. 61,20%. C. 16%. D. 45,81%. Câu 61. Một loại phân kali có thành phần chính là KCl (còn lại là các tạp chất không chứa kali) được sản xuất từ quặng xinvinit có độ dinh dưỡng 55%. Phần trăm khối lượng của KCl trong loại phân kali đó là A. 95,51%. B. 87,18%. C. 65,75%. D. 88,52%.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 62. Phân kali (KCl) sản xuất được từ quặng xinvinit thường chỉ có 50% K2O. Hàm lượng (%) của KCl trong phân bón đó là A. 39,6. B. 69,3. C. 72,9. D. 79,3. Câu 63. Một loại tro thực vật có chứa 68,31% K2CO3 (còn lại là các tạp chất không chứa kali). Độ dinh dưỡng của loại tro này là A. 38,61%. B. 46,53%. C. 56,52%. D. 68,12%. Câu 64. Cho m kg một loại quặng apatit (chứa 93% khối lượng Ca3(PO4)2, còn lại là tạp chất trơ không chứa photpho) tác dụng vừa đủ với dung dịch H2SO4 đặc để sản xuất supephotphat đơn. Độ dinh dưỡng của supephotphat thu được sau khi làm khô hỗn hợp sau phản ứng là A. 26,83%. B. 42,60%. C. 53,62%. D. 34,20%. Câu 65. . Để điều chế được 24,7 kg amophot (tỉ lệ số mol các muối trong amophot là 1:1) thì khối lượng H3PO4 nguyên chất cần dùng là A. 9,8 kg. B. 14,7 kg. C. 16,8 kg. D. 19,6 kg.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A Phân bón nitrophotka(NPK) là hỗn hợp của

N Á O

Í -L

-H

ÓA

P Ấ C

; còn Amophot là hỗn hợp các muối

T

Câu 2: D Thành phần chính của phân lân nóng chảy là hỗn hợp photphat và silicat của canxi và magie. Các muối này không tan

Ỡ Ư D

NG

trong nước, chỉ thích hợp với loại đất chua

I Ồ B

Còn các muối trên đều tan trong nước, và là muối axit nên dễ tác dụng với

Câu 3: D

Sưu tầm bởi GV. Nguyễn Thanh Tú

2

N Ơ H

Giả sử hhX gồm a mol (NH2)2CO và b mol NH4NO3 Bảo toàn C → n(NH2)2CO = a = 0,09 mol.

UY

Bảo toàn N → 2a + b = 0,19 → b = 0,01

.Q P T

N

→ m = 0,09 x 60 + 0,01 x 80 = 6,2 gam → Câu 4: B Đạm 2 lá , gọi là đạm 2 lá vì có chứa 2 N ở 2 gốc khác nhau, 3 chất còn lại đều là đạm 1 lá Câu 5: D

G N Ư

khí mùi khai nên X có:

H

O Ạ Đ

khí không màu hóa nâu trong không khí nên X có X là

N Ầ TR

amoni nitrat

Câu 6: B Thành phần quặng photphorit là Ca3(PO4)2.

1 3 +

0 00

B

Thành phần quặng apatit là 3Ca3(PO4)2.CaF2

Câu 7: B Amophot có thành phần là Câu 8: C Phân supephotphat có thành phần là

bằng cách cho

phản ứng với

, nếu trong phân supephotphat đơn có thêm

, còn trong

phân supephophat kép thì không có

Câu 9: B có gốc axit sẽ bị thủy phân tạo ra môi trường axit, làm tăng độ chua của đất Câu 10: B Khi trồng trọt phải bón phân cho đất để bổ sung nguyên tố dinh dưỡng cho đất, từ đó được cây hấp thụ, giúp cho cây trồng phát triển.

Câu 11: D Cả NH4Cl, NH4NO3, (NH2)2CO khi hòa tan vào nước đều cung cấp nitơ hóa hợp cho cây dưới dạng NO3- hoặc NH4+ nên đều có thể dùng làm phân đạm Câu 12: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Độ dinh dưỡng của phân đạm được đánh giá bằng hàm lượng của N trong phân, phân kali là hàm lượng của ,

Câu 21: B A sai, thành phần chính của supephotphat đơn là

phân lân là hàm lượng

Câu 13: D NH4NO3; (NH4)2SO4 là đạm amoni.

UY

B đúng C sai, thành phần chính của supephotphat kép là

NaNO3 là đạm nitrat. D sai, Nitrophotka là hỗn hợp gồm

(NH2)2CO là đạm ure. Câu 14: C Phân kali giúp cho cây hấp thụ được nhiều đạm hơn, cần cho việc tạo ra chất đường, chất bột, chất xơ và chất dầu, tăng

G N Ư

Câu 22: D Khi urê gặp nước sẽ tác dụng với nước:

H

cường sức chống bệnh, chống rét và chịu hạn của cây

Vôi khi gặp nước sẽ tác dụng với nước:

KCl thuộc loại phân kali

Khi bón đạm urê với vôi thì:

Câu 15: B Độ dinh dưỡng của phân đạm được đánh giá bằng hàm lượng củaN, phân kali là hàm lượng của là

%

% thành phần là Câu 17: B Phân supephotphat đơn có thành phần là thành phần là

%

TO

ÁN

-L

H Í %

P Ấ C

, phân supephotphat kép có

Câu 18: C Tro thực vật có chứa , nên cũng được dùng để cung cấp kali cho cây trồng như phân kali Câu 19: B Độ dinh dưỡng của phân đạm được đánh giá bằng hàm lượng % của N trong phân, phân kali là hàm lượng % của

G N Ỡ

, phân lân là hàm lượng % của

I Ồ B

Câu 20: D

Sưu tầm bởi GV. Nguyễn Thanh Tú

0 00

31

2+

, phân supephotphat kép có

ÓA

B

N Ầ TR

O Ạ Đ

.Q P T

N

Vậy nên không bón đạm urê với vôi, vì sẽ làm mất tác dụng của đạm

, phân lân

hàm lượng

Câu 16: D Phân supephotphat đơn có thành phần là

N Ơ H

Phân phức hợp cung cấp hai hoặc ba nguyên tố dinh dưỡng N,P,K cho cây

Câu 23: D D sai, đốt khí

bằng

ở nhiệt độ cao nếu có xúc tác thì thu được NO, nếu không có xúc tác sẽ thu được

Câu 24: B Độ dinh dưỡng của phân đạm được đánh giá bằng hàm lượng % khối lượng của N trong phân, phân kali là hàm lượng % khối lượng của

, phân lân là hàm lượng % khối lượng của

Câu 25: D Hàm lượng đạm trong các phân: % % % % Câu 26: A Urê được điều chế bằng cách cho amoniac tác dụng với CO2 ở nhiệt độ 180-200oC, dưới áp suất ≈ 200 atm:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

CO2 + 2NH3 → (NH2)2CO + H2O Việc tạo ra ion

Câu 27: B Khi urê gặp nước sẽ tác dụng với nước:

của phân

Vôi khi gặp nước sẽ tác dụng với nước:

Câu 33: B

sẽ kết hợp với

để tạo kết tủa

UY

khí nên Y có thể có là Khi bón đạm urê với vôi thì: có kết tủa vàng nên Z có thể có Vậy nên không bón đạm urê với vôi, vì sẽ làm mất tác dụng của đạm Câu 28: B Phân lân cần thiết cho cây ở thời kì sinh trưởng do thúc đẩy các quá trình sinh hóa, trao đổi chất và năng lượng của thực

Nên X có thể là A,C,D đều không thõa mãn

Câu 34: A 2P + 3H2 –––to–→ 2PH3

vật. Phân lân có tác dụng làm cho cành lá khỏe, hạt chắc, quả hoặc củ to. Câu 29: B Phân đạm có tác dụng kích thích quá trình sinh trưởng của cây, làm tăng tỉ lệ của protein thực vật. Có phân đạm, cây trồng sẽ phát triển nhanh, cho nhiều hạt, củ hoặc quả.

Phâm kali giúp cho cây hấp thụ được nhiều đạm hơn, cần cho việc tạo ra chất đường, chất bột, chất xơ và chất dầu, tăng cường sức chống bệnh, chống rét và chịu hạn của cây.

- Có kết tủa và có khí bay ra là

N Á O

- Chỉ có khí là: - Không có hiện tượng là:

Câu 32: D Nếu bón supephotphat với vôi

I Ồ B

Ỡ Ư D

NG

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

H

G N Ư

O Ạ Đ

.Q P T

N

2PH3 + 4O2 –––to–→ P2O5 + 3H2O

Phân lân cần thiết cho cây ở thời kì sinh trưởng do thúc đẩy các quá trình sinh hóa, trao đổi chất và năng lượng của thực vật. Phân lân có tác dụng làm cho cành lá khỏe, hạt chắc, quả hoặc củ to.

Câu 30: B B sai, hàm lượng trong supephotphat kép cao hơn supephotphat đơn Câu 31: C Cho các phân vào dung dịch dư, nếu:

N Ầ TR

làm mất tác dụng

0 00

B

P2O5 + 4H2O → 2H3PO4

2+

31

4H3PO4 + Ca3(PO4)2 → 3Ca(H2PO4)2 ( supephotphat kép) 2H3PO4 + 3NH3 → NH4H2PO4 + (NH4)2HPO4 (amophot)

Câu 35: D

% % khối lượng

%

Câu 36: B

tạo 2 muối:

với số mol a,b

Ta có hệ:

Câu 37: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Nhiệt phân X được một oxit phi kim nên X là

Câu 42: A (b) sai vì thành phần chính của supephotphat đơn là Ca(H2PO4)2 và CaSO4.

( tấn)

Câu 38: A

(e) sai vi thành phần chính của nitrophotka gồm (NH4)2HPO4 và KNO3. (g) sai vì amophot gồm NH4H2PO4 và (NH4)2HPO4.

O Ạ Đ

UY

.Q P T

N

(h) sai vì phân ure dễ bị phân hủy và bay hơi nên phải bảo quản trong túi polietilen.

% % khối lượng

(i) sai vì để cây sinh trưởng và phát triển tốt cần đưa vào đất phân vi lượng cùng với phân vô cơ và hữu cơ.Phân vi lượng chỉ thích hợp cho từng loại cây và từng loại đất.

%

Câu 39: B

H

G N Ư

→ Có 3 phát biểu đúng là (a), (c), (d) Câu 43: A Câu 44: C Đáp án A sai vì phân đạm cung cấp nitơ hóa hợp cho cây dưới dạng ion NO3- và NH4+

0 00

B

N Ầ TR

Đáp án B sai vì amophot là hh các muối NH4H2PO4 và (NH4)2HPO4

Khối lượng phân thu được:

Câu 40: B

Số mol

thực tế dùng:

Câu 41: A

Ư D I Ồ B

G N Ỡ

N Á O

T

-L

H Í

ÓA

P Ấ C

2

1 3 +

Đáp án C đúng.

Đáp án D sai vì phân ure có công thức là (NH2)2CO.

Câu 45: A Phân đạm là những hợp chất cung cấp N cho cây trồng. Phân lân là những hợp chất cung cấp P cho cây trồng. Phân kali là những hợp chất cung cấp K cho cây trồng.

Câu 46: B Khi tan trong nước, muối amoni bị thủy phân tạo ra môi trường axit, nên chỉ bón phân NH4+ cho các loại đất ít chua hoặc đất đã được khử chua trước bằng vôi (CaO). Câu 47: A

: khí nên X có

khí không màu hóa nâu nên X có

Sưu tầm bởi GV. Nguyễn Thanh Tú

hoặc

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com Câu 59: Câu 60: Câu 61: Câu 62: Câu 63: Câu 64: Câu 65:

→ Phân có hàm lượng đạm cao nhất là (NH2)2CO Câu 48: A Urê được điều chế bằng cách cho amoniac tác dụng với CO2 ở nhiệt độ 180-200oC, dưới áp suất ≈ 200 atm:

C A B D B A D

UY

CO2 + 2NH3 → (NH2)2CO + H2O

Câu 49: D (1) sai vì Độ dinh dưỡng của phân kali được đánh giá theo tỉ lệ phần trăm khối lượng K2O trong phân kali. (2) sai vì Amophot là hỗn hợp các muối (NH4)2HPO4 và NH4HPO4. (4) sai vì phân phức hợp là hỗn hợp các chất được tạo ra đồng thời bằng tương tác hóa học của các chất. VD amophot. Có 3 phát biểu đúng là (3), (5), (6) Câu 50: B mN : mP : mN = 10 : 8 : 6 → nN : nP : nK = 5/7 : 8/31 : 6/39.

≈ 47 : 30 : 11,5

m(NH4)2SO4 : mCa(H2PO4)2 : mKCl = Câu 51: A

Ca3(PO4)2 + 2H2SO4 → Ca(H2PO4)2 + 2CaSO4 0,235------0,47 CaCO3 + H2SO4 → CaSO4 + CO2 + H2O

N Á O

0,26--------0,26

NG

mH2SO4 = 98 x (0,47 + 0,26) = 71,54 kg → Câu 52: B Câu 53: C Câu 54: C Câu 55: B Câu 56: C Câu 57: D Câu 58: B

I Ồ B

Ỡ Ư D

0 00

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

12. Bài tập có yếu tố thực hành (Đề 1)

UY

Câu 1. (Đề NC) Muốn đinh đóng lâu ngày vẫn không bị long khi đóng, người ta thường nhúng đầu đinh vào nước muối trước khi đóng. Điều này được giải thích là do A. Giúp đinh trơn hơn để khi đóng vào tường tường không bị lủng nên lâu ngày vẫn không bị long. B. Đinh bị ăn mòn hóa học, tạo thành lớp oxit sần sùi, lớp oxit này giúp đinh bám chắc vào tường. C. Đinh bị ăn mòn điện hóa, tạo thành lớp oxit sần sùi, lớp oxit này giúp đinh bám chắc vào tường. D. Xung quanh đinh có một lớp dung dịch nước muối, giúp đinh cố định, khó bị rơi ra. Câu 2. Cho hình vẽ mô tả thí nghiệm điều chế khí Y từ dung dịch X (chỉ chứa một chất tan duy nhất):

G N Ư

O Ạ Đ

.Q P T

N

Biết mỗi dung dịch chỉ chứa một chất tan duy nhất. X, Y không phải cặp chất nào dưới đây ? A. NH3 và HCl. B. CH3NH2 và HCl. C. (CH3)3N và HCl. D. Benzen và Cl2. Câu 5. Cho hình vẽ mô tả thí nghiệm điều chế khí Cl2 từ MnO2 và dung dịch HCl: Trong số các chất: Na2CO3, H2O2, NH4Cl, NH4NO2, số chất thoả mãn điều kiện về chất tan trong X là A. 1. B. 2. C. 3. D. 4. Câu 3. Cho X, Y, Z, T là các chất khác nhau trong số 4 chất: CH3OH, HCHO, HCOOH, NH3 và các tính chất được ghi trong bảng sau: Chất X Y Z T 64,7 -19,0 100,8 -33,4 Nhiệt độ sôi( 0 C ) pH(dung dung dịch nồng độ 0,001M)

7,00

7,00

3,47

Í -L

A Ó H 10,12

-

Nhận xét nào sau đây đúng ? A. Y là NH3. B. Z là HCOOH. C. T là CH3OH. D. X là HCHO. Câu 4. Cho hình vẽ mô tả thí nghiệm tạo “khói trắng” từ hai dung dịch X và Y:

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

P Ấ C

2

1 3 +

0 00

B

N Ầ TR

H

Khí Cl2 đi ra thường lẫn hơi nước và hiđro clorua. Để thu được khí Cl2 khô thì bình (1) và bình (2) lần lượt đựng A. Dung dịch NaOH và dung dịch H2SO4 đặc. B. Dung dịch H2SO4 đặc và dung dịch NaCl. C. Dung dịch H2SO4 đặc và dung dịch AgNO3 D. Dung dịch NaCl và dung dịch H2SO4 đặc. Câu 6. Cho vài giọt chất lỏng X tinh khiết vào ống nghiệm có sẵn 2 ml nước, lắc đều sau đó để yên một thời gian thấy xuất hiện chất lỏng phân thành hai lớp. Cho 1,0 ml dung dịch HCl vào và lắc mạnh thì thu được một dung dịch đồng nhất. Cho tiếp vài ml dung dịch NaOH vào lắc, sau đó để yên lại thấy xuất hiện chất lỏng phân thành hai lớp. X là A. axetanđehit B. anilin. C. benzen. D. phenol lỏng.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 7. Quan sát sơ đồ thí nghiệm sau:

UY

B.

Phát biểu nào sau đây là không đúng về quá trình điều chế HNO3 trong phòng thí nghiệm theo sơ đồ trên ? A. Bản chất của quá trình điều chế là một phản ứng trao đổi ion. B. HNO3 sinh ra trong bình cầu ở dạng hơi nên cần làm lạnh để ngưng tụ C. Quá trình phản ứng là một quá trình thuận nghịch, trong đó chiều thuận là chiều toả nhiệt D. Do HNO3 có phân tử khối lớn hơn không khí nên mới thiết kế ống dẫn hướng xuống Câu 8. Cho những nguyên tử của các nguyên tố sau:

C.

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

D. Câu 11. Xét các nguyên tử các nguyên tố X, Y, Z, T. Bán kính nguyên tử của các nguyên tử các nguyên tố đó tăng theo thứ tự: X, Z, Y, T. Vị trí tương đối của chúng trong bảng tuần hoàn là

0 00

Những nguyên tử nào sau đây là đồng vị của nhau ? A. 1 và 2 B. 2 và 3 C. 1, 2 và 3 D. Cả 1, 2, 3, 4 Câu 9. Cho các hình vẽ sau là 1 trong các nguyên tử Na, S, Cl, K.

H Í

ÓA

1, 2, 3, 4 tương ứng theo thứ tự sẽ là: A. K, Na, S, Cl B. Na, S, Cl, K C. Cl, S, Na, K D. K, Cl, S, Na Câu 10. Sự phân bố electron vào các obitan nào sau đây thỏa mãn nguyên lí vững bền.

A.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

P Ấ C

2

1 3 +

A.

B

Z T

X Y

B.. Y T

X Z

C.. X Y

Z T

D.. Z X

T Y

Câu 12. Xét các nguyên tử các nguyên tố X, Y, Z, T. Độ âm điện của các nguyên tử các nguyên tố đó giảm theo thứ tự: T, Y, Z, X. Vị trí của chúng trong bảng tuần hoàn là: A. T

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn Z X

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. Y T

UY

X Z

Z T

D. Z T

X Y

Câu 13. Xét các nguyên tử các nguyên tố X, Y, Z, T. Năng lượng ion hóa thứ nhất của các nguyên tử các nguyên tố đó giảm theo thứ tự: Z, X, Y, T. Vị trí của chúng trong bảng tuần hoàn là: A. Z Y X T B. Y T

X Z

C. X Y

Z T

N Á O

D. Z T

Ỡ Ư D

X Y

NG

.Q P T

N

Các nguyên tố L, M, R A. Cùng thuộc 1 chu kì. B. Cùng thuộc 1 nhóm A. C. Cùng là kim loại. D. Cùng là phi kim. Câu 15. Sự biến đổi giá trị của I1 theo Z của 1 số nguyên tử các nguyên tố nhóm A được thể hiện như sau:

C. X Y

N Ơ H

Y

Í -L

-

A Ó H

P Ấ C

0 00

2

1 3 +

T

B

N Ầ TR

H

G N Ư

O Ạ Đ

Từ đồ thị trên thì nhận định nào sau đây không đúng ? A. Trong một chu kì, theo chiều tăng của Z thì nhìn chung I1 tăng. B. Trong 1 chu kì, kim loại kiềm có I1 thấp nhất. C. Trong một nhóm A, khi Z giảm thì thì I1 tăng. D. Trong 1 chu kì, halogen có I1 thấp nhất. Câu 16. Nguyên tố A có số hiệu nguyên tử là 11. Cách biểu diễn sự phân bố electron trong nguyên tử nào sau đây là gần đúng nhất?

A.

Câu 14. Sự biến đổi độ âm điện theo số hiệu nguyên tử Z của 3 nguyên tố L, M, R (đều là nguyên tố nhóm A) được thể hiện như sau:

I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

B.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 19. Cấu hình electron lớp ngoài cùng của các nguyên tử các nguyên tố X, Y, Z là:

UY

C.

Nhận xét nào sau đây không đúng A. Tính kim loại tăng dần theo thứ tự X, Z, Y. B. X, Y, Z có tính chất hóa học tương tự nhau. C. X có năng lượng ion hóa thứ nhất lớn nhất D. Z có độ âm điện nhỏ nhất. Câu 20. Cho mô hình mạng tinh thể NaCl:

D. Câu 17. Sự phân bố electron trong nguyên tử của các nguyên tố M, R, X, L như sau:

Nguyên tố có tính kim loại lớn nhất là: A. X B. R C. M D. L Câu 18. Sự phân bố electron trong nguyên tử của các nguyên tố M, R, X, L như sau:

Nguyên tố có độ âm điện nhỏ nhất là: A. R B. M C. X D. L

I Ồ B

Ỡ Ư D

NG

N Á O

-L

H Í

ÓA

0 00

P Ấ C

2

1 3 +

N Ầ TR

B

H

G N Ư

O Ạ Đ

.Q P T

N

Biết ZNa = 11, ZCl = 17. Quả cầu màu đen đại diện cho A. 1 Ion Cl−. B. 1 Ion Na+. C. 1 Nguyên tử Na. D. 1 Nguyên tử Cl. Câu 21. Công thức electron của HCl là ••

A.. H

• •

• •

Cl ••

••

B.. H ••

Cl

• •

••

••

C.. H •• •• Cl ••

• •

D.. H

• •

Cl

• •

• •

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 22. Mô hình mạng tinh kim cương như sau: Các nguyên tử C trong mạng tinh thể liên kết với mấy nguyên tử C khác: A. 4 B. 2 hoặc 4

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 1 hoặc 2 hoặc 4 D. 1 hoặc 2 hoặc 3 hoặc 4 Câu 23. Cho các hình vẽ sau là 1 trong các nguyên tử Na, Mg, Al, K.

UY

Độ âm điện của chúng giảm dần theo thứ tự là A. (1) > (2) > (3) > (4) B. (4) > (3) > (2) > (1) C. (1) > (3) > (2) > D D. (4) > (2) > (1) > (3) Câu 25. Cho các nguyên tử sau cùng thuộc một chu kì trong bảng tuần hoàn:

0 00

A Ó H

P Ấ C

Tính kim loại giảm dần theo thứ tự nào sau đây? A. a > b > c > d B. d > c > b > a C. a > c > b > d D. d > b > c > a Câu 26. Thực hiện 2 thí nghiệm theo hình vẽ sau. Ở thí nghiệm nào có kết tủa xuất hiện trước?

I Ồ B

Ỡ Ư D

NG

T

.Q P T

N

Tính phi kim tăng dần theo thứ tự nào sau đây? A. (1) < (2) < (3) < (4) B. (4) < (3) < (2) < (1) C. (4) < (2) < (3) < (1) D. (1) < (3) < (2) < (4) Câu 28. Thực hiện 2 thí nghiệm như hình vẽ sau. Ở thí nghiệm nào có kết tủa xuất hiện trước?

a, b, c, d tương ứng theo thứ tự sẽ là: A. Na, Mg, Al, K B. K, Na, Mg, Al C. Al, Mg, Na, K D. K, Al, Mg, Na Câu 24. Cho các nguyên tử sau cùng chu kỳ và thuộc nhóm A:

N Á O

N Ơ H

D. Không có kết tủa xuất hiện. Câu 27. Cho các nguyên tử sau đây:

Í -L

-

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

A. TN2 có kết tủa xuất hiện trước. B. TN1 có kết tủa xuất hiện trước. C. Kết tủa xuất hiện đồng thời. D. Không có kết tủa xuất hiện. Câu 29. Cho nguyên tử của nguyên tố X có cấu tạo như sau:

Vị trí của nguyên tố trên trong bảng tuần hoàn là: A. Ô số 7, chu kì 2, nhóm VIIA. B. Ô số 7, chu kì 2, nhóm VA C. Ô số 5, chu kì 2, nhóm VA D. Ô số 5, chu kì 7, nhóm VIIA. Câu 30. Có 3 cốc chứa 20ml dung dịch H2O2 cùng nồng độ. Tiến hành 3 thí nghiệm như hình vẽ sau:

A. TN1 có kết tủa xuất hiện trước. B. TN2 có kết tủa xuất hiện trước. C. Kết tủa xuất hiện đồng thời.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com A. 2,929.10−4 mol.(l.s)−1 B. 5,858.10−4 mol.(l.s)−1 C. 4,667.10−4 mol.(l.s)−1 D. 2,333.10−4 mol.(l.s)−1 Câu 34. Cho cấu tạo mạng tinh thể NaCl như sau:

TN1: Ở nhiệt độ thường TN2: Đun nóng TN3: Thêm ít bột MnO2 Ở thí nghiệm nào có bọt khí thoát ra chậm nhất? A. Thí nghiệm 1 B. Thí nghiệm 2 C. Thí nghiệm 3 D. 3 thí nghiệm như nhau Câu 31. Hình vẽ sau mô tả thí nghiệm tìm ra một hạt cấu tạo nên nguyên tử:

Đó là: A. Thí nghiệm tìm ra electron. B. Thí nghiệm tìm ra nơtron. C. Thí nghiệm tìm ra proton. D. Thí nghiệm tìm ra hạt nhân. Câu 32. Đây là thí nghiệm tìm ra hạt nhân nguyên tử. Hiện tượng nào chứng tỏ điều đó?

N Á O

-L

Í-

A Ó H

P Ấ C

A. Chùm α truyền thẳng B. Chùm α bị lệch hướng. C. Chùm α bị bật ngược trở lại. D. Cả B và C đều đúng. Câu 33. Ở 30oC sự phân hủy H2O2 xảy ra theo phản ứng: 2H2O2 → 2H2O + O2↑ Dựa vào bảng số liệu sau, hãy tính tốc độ trung bình của phản ứng trong khoảng 120 giây đầu tiên: Thời gian (s) 0 60 120 240 Nồng độ H2O2 0,3033 0,2610 0,2330 0,2058 (mol/l)

D I BỒ

ƯỠ

NG

2+

.Q P T

N

Phát biểu nào sau đây là đúng trong tinh thể NaCl: A. Các ion Na+ và ion Cl- góp chung cặp electron hình thành liên kết. B. Các nguyên tử Na và Cl góp chung cặp e hình thành liên kết. C. Các nguyên tử Na và Cl hút nhau bằng lực hút tĩnh điện. D. Các ion Na+ và ion Cl- hút nhau bằng lực hút tĩnh điện. Câu 35. Sự biến thiên tốc độ phản ứng thuận và nghịch theo thời gian của phản ứng:  → 2HI (k) H2 (k) + I2 (k) ← 

0 00

31

H

G N Ư

O Ạ Đ

UY

N Ơ H

B

N Ầ TR

được biểu diễn theo đồ thị nào sau đây là đúng ?

A.

.

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

B.

.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com D. Cả 3 có màu như nhau Câu 38. Cho cân bằng sau: CuO(r) + CO(k) → Cu(r) + CO2(k) Đồ thị nào sau đây biểu diễn đúng sự phụ thuộc tốc độ phản ứng vào áp suất:

C.

.

A.

D. . Câu 36. Cho hỗn hợp khí gồm NO2 và N2O4 có tỉ lệ số mol là 1:1 vào 2 ống nghiệm nối với nhau. Đóng khóa K và ngâm ống 1 vào cốc nước đá. Màu của hỗn hợp khí trong ống 1 và ống 2 là:

P Ấ C

2+

A. Ống 1 có màu nhạt hơn. B. Ống 1 có màu đậm hơn C. Cả 2 ống đều không có màu D. Cả 2 ống đều có màu nâu Câu 37. Có 3 xilanh kín, nạp vào mỗi xilanh cùng 1 lượng NO2, giữ cho 3 xilanh cùng ở nhiệt độ phòng và di chuyển pittông của 3 xilanh như hình vẽ. Hỏi ở xilanh nào hỗn hợp khí có màu đậm nhất?

I Ồ B

A. Xilanh 2 B. Xilanh 1 C. Xilanh 3

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

31

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

UY

N Ơ H

N

B.

C.

D. Câu 39. Sục từ từ CO2 vào dung dịch Ba(OH)2 ta có đồ thị sau:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

D. Có bọt khí bay ra, kết tủa vàng. Câu 42. Cho từ từ dung dịch NaOH 1,5M phản ứng với 1 lít dung dịch Al(NO3)3 Khối lượng kết tủa thu được có quan hệ với thể tích dung dịch NaOH như hình vẽ:

UY

Đồ thị biểu diễn sự phụ thuộc của khối lượng kết tủa và thể tích CO2 Thể tích dung dịch Ba(OH)2 0,1M tham gia phản ứng là: A. 1 lít B. 0,5 lít C. 0,25 lít D. 0,75 lít Câu 40. Cho dung dịch AgNO3 vào 4 ống nghiệm chứa NaF, NaCl, NaBr, NaI. ?

A Ó H

P Ấ C

Hiện tượng xảy ra trong các ống 1,2,3,4 là: A. Không có hiện tượng, có kết tủa trắng, có kết tủa vàng, có kết tủa vàng đậm. B. Có kết tủa trắng, có kết tủa vàng, có kết tủa vàng đậm, không có hiện tượng. C. Không có hiện tượng, có kết tủa trắng, có kết tủa vàng đậm, có kết tủa vàng. D. Không có hiện tượng, có kết tủa trắng, có kết tủa trắng, không có hiện tượng. Câu 41. Cho thí nghiệm như hình vẽ. Khi cho Na2CO3 dư, hiện tượng xảy trong ống nghiệm là:

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

2

H

Nồng độ dung dịch Al(NO3)3 ban đầu là: A. 0,1M B. 0,08M C. 0,12M D. 0,05M Câu 43. Cho sơ đồ thí nghiệm như hình vẽ

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N

B

Hiện tượng xảy ra trong ống nghiệm là: A. Quỳ tím chuyển sang màu đỏ rồi mất màu. B. Quỳ tím mất màu rồi chuyển sang màu đỏ. C. Quỳ tím chuyển sang màu xanh rồi mất màu. D. Quỳ tím mất màu rồi chuyển sang màu xanh. Câu 44. Cho hình vẽ mô tả thí nghiệm điều chế clo trong phòng thí nghiệm như sau:

T

A. Có kết tủa keo trắng, bọt khí bay ra. B. Không có hiện tượng gì. C. Có kết tủa keo trắng.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Hóa chất không được dùng trong bình cầu (1) là A. H2O2 B. KMnO4 C. KClO3 D. MnO2

UY

A. Rót từ từ và khuấy nhẹ

Câu 45. Cho thí nghiệm như hình vẽ: Hiện tượng trong xảy ra trong ống nghiệm là: A. có kết tủa trắng. B. có bọt khí. C. không có hiện tượng. D. có kết tủa vàng. Câu 46. Cho thí nghiệm như hình vẽ:

B. Rót từ từ và khuấy nhẹ

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

C. Rót và không khuấy

0 00

Hiện tượng xảy ra là A. Đường bị hóa đen và sủi lên cao. B. Có khí bay ra. C. Có khói trắng xuất hiện. D. Đường bị hóa đen. Câu 47. Cho thí nghiệm như hình vẽ:

NG

N Á O

T

Khi cho mẩu Na vào thì có hiện tượng trong ống là: A. mẩu Na tan, có bọt khí, xuất hiện kết tủa. B. xuất hiện đồng bám vào mẩu Na. C. mẩu Na tan, xuất hiện kết tủa rồi kết tủa tan ra. D. mẩu Na tan và dung dịch sủi bọt khí. Câu 48. Cách pha loãng axit H2SO4 đặc nào sau đây là đúng ?

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

1 3 +

D. Rót mạnh và khuấy Câu 49. Tiến hành 3 thí nghiệm như hình vẽ sau:

Đinh sắt trong cốc nào sau đây bị ăn mòn nhanh nhất? A. Cốc 2 B. Cốc 1 C. Cốc 3 D. Tốc độ ăn mòn như nhau Câu 50. Tiến hành thí nghiệm như hình sau:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

UY

NG

N Á O

T

-L

Í-

A Ó H

P Ấ C

2

1 3 +

N Ầ TR

H

G N Ư

pH=7 (2)

N

pH ≥ 8 (3) pH ≥ 8,3 (5)

A. đỏ, tím, xanh, không màu, hồng. B. xanh, đỏ, không màu, hồng, không màu. C. đỏ, xanh, tím, hồng, không màu. D. đỏ, xanh, không màu, không màu, hồng. Câu 55. Làm thí nghiệm như hình vẽ:

0 00

Vậy khí sục vào ống nghiệm 2 là: A. but-2-in B. propin C. but-1-in D. axetilen Câu 52. Chất lỏng trong eclen là chất lỏng:

O Ạ Đ

Phương pháp chưng cất dùng để: A. Tách các chất lỏng có nhiệt độ sôi khác nhau nhiều. B. Tách các chất lỏng có nhiệt độ sôi gần nhau. C. Tách các chất lỏng có độ tan trong nước khác nhau. D. Tách các chất lỏng không trộn lẫn vào nhau. Câu 54. Màu trong các ô 1, 2, 3, 4, 5 lần lượt là: Qùy tím pH ≤ 6 (1) Phenolphtalêin pH ≤ 8,3 (4)

Các tinh thể màu đỏ ở đáy bình là: A. FeCl3 B. FeCl2 C. Fe2O3 D. Fe3O4 Câu 51. Có 4 bình khí mất nhãn là: axetilen, propin, but-1-in, but-2-in. Người ta làm thí nghiệm với lần lượt các khí, hiện tượng xảy ra như hình vẽ sau:

.Q P T

N Ơ H

B

Hiện tượng xảy ra trong ống nghiệm 1 là: A. có bọt khí. B. có kết tủa. C. không có hiện tượng gì. D. có bọt khí và kết tủa. Câu 56. Cũng thí nghiệm như trên:

A. nặng hơn. B. nhẹ hơn. C. hỗn hợp cả hai chất. D. dung môi. Câu 53. Cho bộ dụng cụ chưng cất thường như hình vẽ:

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

Hiện tượng xảy ra trong ống nghiệm 2 là:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. có kết tủa vàng. B. có kết tủa trắng. C. không có hiện tượng gì. D. có bọt khí Câu 57. Làm thí nghiệm như hình vẽ:

UY

0 00

P Ấ C

2

1 3 +

A. tím B. đỏ C. xanh D. hồng Câu 59. Có 4 ống nghiệm chứa Cu(OH)2. Thêm vào các ống nghiệm lượng dư của 4 dung dịch etan-1,2-điol, propan-1,3-điol, propan-1,2-điol, propan-1,2,3-triol. Hiện tượng xảy ra như hình sau:

I Ồ B

Ỡ Ư D

N Á O

Í -L

G N Ư

A. ống 1 B. cả 2 ống C. ống 2 D. không ống nghiệm nào Câu 61. Làm thí nghiệm như hình vẽ:

Hiện tượng xảy ra trong ống nghiệm khi cho dư glixerol, lắc đều là gì? A. kết tủa tan, dung dịch có màu xanh lam. B. không có hiện tượng gì. C. kết tủa vẫn còn, dung dịch có màu trong suốt. D. kết tủa không tan, dung dịch có màu xanh. Câu 58. Màu của quỳ tím là gì?

NG

N Ơ H

D. propan-1,2,3-triol Câu 60. Ở ống nghiệm nào có phản ứng xảy ra:

-

A Ó H

B

N Ầ TR

H

O Ạ Đ

.Q P T

N

Sau khi kết thúc thí nghiệm ta thu được 11,04 gam hỗn hợp rắn B ở bình 2. Hiệu suất của phẩn ứng cộng nước ở bình 1 là: A. 80% B. 70% C. 20% D. 100% Câu 62. Cho các chất sau: axit etanoic; etanal; etanol; etan. Nhiệt độ sôi của các chất được biểu diễn như sau:

T

Vậy dung dịch cho vào ống nghiệm 4 là A. propan-1,3-điol B. propan-1,2-điol C. etan-1,2-điol

Sưu tầm bởi GV. Nguyễn Thanh Tú

Chất (1) là A. Etanal

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. Etan C. Etanol D. Axit etanoic Câu 63. Cho các chất sau: axit etanoic; etanal; etanol; etan. Độ tan của chúng trong nước được biểu diễn như sau:

A. 1. B. 3. C. 2. D. 4. Câu 66. Cách pha loãng axit H2SO4 đặc nào sau đây là đúng ?

A. Rót từ từ và khuấy nhẹ

Hỏi chất 3 là gì: A. Etan B. Etanol C. Axit etanoic D. Etanal Câu 64. Ở ống nghiệm nào không có phản ứng xảy ra:

A. 1. B. 3. C. 2. D. 4.

I Ồ B

Ỡ Ư D

NG

N Á O

N Ầ TR

H

G N Ư

O Ạ Đ

UY

.Q P T

N Ơ H

N

B. Rót từ từ và khuấy nhẹ

0 00

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

C. Rót và không khuấy

D. Rót mạnh và khuấy

T

Câu 65. Phản ứng ở ống nghiệm nào khác với các phản ứng khác:

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 67. Cho sơ đồ thí nghiệm như hình vẽ: Hiện tượng xảy ra trong ống nghiệm là A. Quỳ tím chuyển sang màu xanh rồi mất màu. B. Quỳ tím mất màu rồi chuyển sang màu đỏ. C. Quỳ tím chuyển sang màu đỏ rồi mất màu. D. Quỳ tím mất màu rồi chuyển sang màu xanh. Câu 68. Cho hình vẽ mô tả thí nghiệm điều chế clo trong phòng thí nghiệm như sau:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

UY

Hóa chất không được dùng trong bình cầu (1) là A. MnO2. B. KMnO4. C. KClO3. D. H2O2. Câu 69. Cho hình vẽ mô tả thí nghiệm điều chế clo trong phòng thí nghiêm như sau:

N

Vai trò của dung dịch NaCl là: A. Hòa tan khí Clo. B. Giữ lại khí hiđroclorua. C. Giữ lại hơi nước D. Cả 3 đáp án trên đều đúng. Câu 71. Cho hình vẽ mô tả sự điều chế clo trong phòng thí nghiệm như sau:

0 00

A Ó H

O Ạ Đ

.Q P T

N Ơ H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

Để phản ứng xảy ra được nhất thiết phải đun nóng. Trong số các chất: MnO2, KMnO4, KClO3, K2Cr2O7, số chất có thể được dùng trong bình cầu (1) là A. 1. B. 2. C. 3. D. 4. Câu 70. Cho Hình vẽ mô tả sự điều chế Clo trong phòng Thí nghiệm như sau:

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

Nhận định nào sau đây là không đúng ? A. Có thể thay MnO2 bằng KMnO4, K2Cr2O7, KClO3 hoặc PbO2. B. Không thể thay HCl đặc bằng HCl loãng. C. Bình H2SO4 có thể thay bằng P2O5 khan hoặc CaO rắn. D. Có thể dùng dung dịch NaCl loãng hoặc bão hoà. Câu 72. Cho Hình vẽ mô tả sự điều chế Clo trong phòng Thí nghiệm như sau:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com A. Do khí HCl tác dụng với nước kéo nước vào bình. B. Do HCl tan mạnh làm giảm áp suất trong bình. C. Do trong bình chứa khí HCl ban đầu không có nước. D. Tất cả các nguyên nhân trên đều đúng Câu 75. Cho hình vẽ mô tả quá trình điều chế dung dịch HCl trong phòng thí nghiệm:

UY

Phát biểu nào sau đây không đúng: A. Dung dịch H2SO4 đặc có vai trò hút nước, có thể thay H2SO4 bằng CaO. B. Khí Clo thu được trong bình eclen là khí Clo khô. C. Có thể thay MnO2 bằng KMnO4 hoặc KClO3 D. Không thể thay dung dịch HCl bằng dung dịch NaCl. Câu 73. Cho Hình vẽ mô tả sự điều chế Clo trong phòng Thí nghiệm như sau:

A Ó H

P Ấ C

2

Khí Clo thu được trong bình eclen là: A. Khí clo khô B. Khí clo có lẫn H2O C. Khí clo có lẫn khí HCl D. Cả B và C đều đúng. Câu 74. Khí hidro clorua là chất khí tan rất nhiều trong nước tạo thành dung dịch axit clohiđric:

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

T

Trong thí nghiệm thử tính tan của khí hidroclorua trong nước, có hiện tượng nước phun mạnh vào bình chứa khí như hình vẽ mô tả dưới đây. Nguyên nhân gây nên hiện tượng đó là

Sưu tầm bởi GV. Nguyễn Thanh Tú

H

N

Phát biểu nào sau đây là không đúng: A. NaCl dùng ở trạng thái rắn B. H2SO4 phải đặc C. Phản ứng xảy ra ở nhiệt độ phòng. D. Khí HCl thoát ra hòa tan vào nước cất tạo thành dung dịch axit clohiđric. Câu 76. Cho hình vẽ mô tả quá trình điều chế dung dịch HCl trong phòng thí nghiệm:

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N Ơ H

B

Phải dùng NaCl rắn, H2SO4 đặc và phải đun nóng vì: A. Khí HCl tạo ra có khả năng tan trong nước rất mạnh. B. Đun nóng để khí HCl thoát ra khỏi dung dịch C. Để phản ứng xảy ra dễ dàng hơn D. Cả 3 đáp án trên.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 77. Cho thí nghiệm sau:

UY

Hãy cho biết hiện tượng quan sát được trong ống nghiệm 2 là: A. Có kết tủa đen của PbS B. Dung dịch chuyển sang màu vàng do S tan vào nước. C. Có kết tủa trắng của PbS D. Có cả kết tủa trắng và dung dịch vàng xuất hiện. Câu 81. Cho thí nghiệm như hình vẽ:

Hiện tượng xảy ra trong thí nghiệm bên là: A. Có khí màu vàng sinh ra, đồng thời có kết tủa B. Chỉ có khí màu vàng thoát ra C. Chất rắn MnO2 tan dần D. Cả B và C Câu 78. Cho phản ứng của oxi với Na:

0 00

Phát biểu nào sau đây không đúng? A. Na cháy trong oxi khi nung nóng. B. Lớp nước để bảo vệ đáy bình thuỷ tinh. C. Đưa ngay mẩu Na rắn vào bình phản ứng D. Hơ cho Na cháy ngoài không khí rồi mới đưa nhanh vào bình. Câu 79. Cho phản ứng của Fe với Oxi như hình vẽ sau:

N Á O

T

Í -L

-

A Ó H

P Ấ C

Vai trò của lớp nước ở đáy bình là: A. Giúp cho phản ứng của Fe với Oxi xảy ra dễ dàng hơn. B. Hòa tan Oxi để phản ứng với Fe trong nước. C. Tránh vỡ bình vì phản ứng tỏa nhiệt mạnh D. Cả 3 vai trò trên. Câu 80. Cho phản ứng giữa lưu huỳnh với Hidro như hình vễ sau, trong đó ống nghiệm 1 để tạo ra H2, ống nghiệm thứ 2 dùng để nhận biết sản phẩm trong ống.

I Ồ B

Ỡ Ư D

NG

Sưu tầm bởi GV. Nguyễn Thanh Tú

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Phản ứng xảy ra trong ống nghiệm 1 là: A. Zn + 2HCl → ZnCl2 + H2 B. H2 + S → H2S C. H2S + Pb(NO3)2 → PbS↓ + 2HNO3 D. 2HCl + Pb(NO3)2 → PbCl2↓ + 2HNO3 Câu 82. Cho thí nghiệm như hình vẽ sau:

Phản ứng xảy ra trong ống nghiệm nằm ngang là: A. Zn + 2HCl → ZnCl2 + H2 B. H2 + S → H2S C. H2S + Pb(NO3)2 → PbS↓ + 2HNO3 D. 2HCl + Pb(NO3)2 → PbCl2↓ + 2HNO3

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 83. Cho hình vẽ thu khí như sau:

N Ơ H

Câu 86. Cho hình vẽ sau:

UY

Những khí nào trong số các khí H2, N2, NH3 ,O2, Cl2, CO2,HCl, SO2, H2S có thể thu được theo cách trên? A. Chỉ có khí H2 B. H2, N2, NH3, C. O2, N2, H2,Cl2, CO2 D. Tất cả các khí trên. Câu 84. Cho thí nghiệm về tính tan của khi HCl như hình vẽ. Trong bình ban đầu chứa khí HCl, trong nước có nhỏ thêm vài giọt quỳ tím.

Hiện tượng xảy ra trong bình khi cắm ống thủy tinh vào nước là A. Nước phun vào bình và chuyển sang màu đỏ. B. Nước phun vào bình và chuyển sang màu xanh. C. Nước phun vào bình và vẫn có màu tím. D. Nước phun vào bình và chuyển thành không màu. Câu 85. Cho TN như hình vẽ, bên trong bình có chứa khí NH3, trong chậu thủy tinh chứa nước có nhỏ vài giọt phenolphtalein:

N Á O

-L

Í-

A Ó H

P Ấ C

2

G N Ư

O Ạ Đ

.Q P T

N

Hiện tượng xảy ra trong bình eclen chứa Br2: A. Có kết tủa xuất hiện B. Dung dịch Br2 bị mất màu C. Vừa có kết tủa vừa mất màu dung dịch Br2 D. Không có phản ứng xảy ra Câu 87. Cho hình vẽ sau:

1 3 +

0 00

B

N Ầ TR

H

Cho biết phản ứng nào xảy ra trong bình cầu: A. SO2 + Br2 + 2H2O → 2HBr + H2SO4 B. Na2SO3 + H2SO4 → Na2SO4 + SO2 + H2O C. 2SO2 + O2 → 2SO3 D. Na2SO3 + Br2 + H2O → Na2SO4 + 2HBr

Hiện tượng xảy ra trong thí nghiệm là A. Nước phun vào bình và chuyển thành màu xanh. B. Nước phun vào bình và chuyển thành màu hồng. C. Nước phun vào bình và không có màu. D. Nước phun vào bình và chuyển thành màu tím.

I Ồ B

Ỡ Ư D

NG

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 88. Cho hình vẽ sau:

Hãy cho biết thí nghiệm bên dùng để xác định nguyên tố nào trong hợp chất hữu cơ. A. Xác định C và H. B. Xác định H và Cl. C. Xác định C và N. D. Xác định C và S. Câu 91. Cho hình vẽ mô tả qua trình xác định C và H trong hợp chất hữu cơ:

UY

Cho biết phản ứng xảy ra trong eclen? A. SO2 + Br2 + 2H2O → 2HBr + H2SO4 B. Na2SO3 + H2SO4 → Na2SO4 + SO2 + H2O C. 2SO2 + O2 → 2SO3 D. Na2SO3 + Br2 + H2O → Na2SO4 + 2HBr Câu 89. Cho hình vẽ thiết bị chưng cất thường:

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í-

-L

Vai trò của nhiệt kế trong khi chưng cất là A. Đo nhiệt độ của ngọn lửa. B. Đo nhiệt độ của nước sôi. C. Đo nhiệt độ sôi của chất đang chưng cất. D. Đo nhiệt độ sôi của hỗn hợp chất trong bình cầu. Câu 90. Cho hình vẽ thí nghiệm dùng để phân tích hợp chất hữu cơ.

A Ó H

P Ấ C

2

N

Vai trò của CuSO4 (khan) và biến đổi của nó trong thí nghiệm trên là A. Xác định C và màu CuSO4 từ màu trắng sang màu xanh. B. Xác định H và màu CuSO4 từ màu trắng sang màu xanh. C. Xác định C và màu CuSO4 từ màu xanh sang màu trắng. D. Xác định H và màu CuSO4 từ màu xanh sang màu trắng. Câu 92. Cho hình vẽ mô tả qua trình xác định C và H trong hợp chất hữu cơ.Hãy cho biết hiện tượng xảy ra trong ống nghiệm chứa Ca(OH)2.

0 00

1 3 +

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

B

N Ầ TR

A. Có kết tủa trắng xuất hiện B. Có kết tủa đen xuất hiện C. Dung dịch chuyển sang màu xanh D. Dung dịch chuyển sang màu vàng. Câu 93. Mùi thơm trong nhiều loại hoa quả, tinh dầu thực vật, ... là mùi của este. Để có este dùng làm nguyên liệu - hương liệu, trước hết người ta thu hái, đem thái nhỏ và ngâm với nước. Cần sử dụng phương pháp nào sau đây để tách riêng este ra khỏi hỗn hợp ? A. Chưng cất B. Chiết C. Kết tinh D. Lọc Câu 94. Quan sát hình vẽ 01:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Hình vẽ trên minh họa cho phản ứng nào sau đây ? 0

t → NaHSO4 + HCl↑. A. NaCl (rắn) + H2SO4 đặc  0

t B. NaOH + NH4Cl (rắn)  → NH3↑ + NaCl + H2O.

UY

0

t C. Zn + H2SO4 (loãng)  → ZnSO4 + H2↑. 0

N

t D. K2SO3 (rắn) + H2SO4  → K2SO4 + SO2↑ + H2O. Câu 97. Hình bên minh họa cho thí nghiệm xác định sự có mặt của C và H trong hợp chất hữu cơ. Chất X và dung dịch Y (theo thứ tự) là:

Có các thao tác cần làm khi tiến hành thí nghiệm điều chế clo và thử tính tẩy màu của clo ẩm (sắp xếp ngẫu nhiên): (1) Lấy kẹp gỗ hoặc giá gỗ kẹp ống nghiệm. (2) Đậy miệng ống nghiệm bằng nút cao su có kèm ống hút nhỏ giọt dung dịch HCl đặc vào ống nghiệm đựng KMnO4. (3) Lấy một lượng nhỏ KMnO4 cho vào ống nghiệm. (4) Kẹp một mảnh giấy màu ẩm, một mảnh giấy màu khô ở miệng ống nghiệm. (5) Bóp nhẹ đầu cao su của ống hút cho 3 - 4 giọt dung dịch HCl đặc vào KMnO4. Thứ tự thao tác hợp lý là A. 1, 2, 3, 4, 5. B. 1, 3, 4, 2, 5. C. 1, 2, 3, 5, 4. D. 1, 5, 2, 3, 4. Câu 95. Cho X, Y, Z, T là các chất khác nhau trong số 4 chất: CH3COOH, C6H5COOH (axit benzoic), C2H5COOH, HCOOH và giá trị nhiệt độ sôi được ghi trong bảng sau: Chất X Y Z T 100,5 118,2 249,0 141,0 Nhiệt độ sôi ( 0 C )

A Ó H

Nhận xét nào sau đây là đúng ? A. T là C6H5COOH. B. X là C2H5COOH. C. Y là CH3COOH. D. Z là HCOOH. Câu 96. Cho hình vẽ mô tả thí nghiệm điều chế khí Z từ dung dịch X và chất rắn Y:

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

P Ấ C

2

H

A. CaO, H2SO4 đặc. B. Ca(OH)2, H2SO4 đặc. C. CuSO4 khan, Ca(OH)2. D. CuSO4.5H2O, Ca(OH)2. Câu 98. Cho hình vẽ thu khí như sau:

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

B

Những khí nào trong số các khí H2, N2, NH3 ,O2, Cl2, CO2, HCl, SO2, H2S có thể thu được theo cách trên? A. H2, NH3, N2, HCl, CO2. B. H2, N2, NH3, CO2. C. O2, Cl2, H2S, SO2, CO2, HCl. D. Tất cả các khí trên. Câu 99. Trong phòng thí nghiệm bộ dụng cụ vẽ dưới đây có thể dùng để điều chế bao nhiêu khí trong số các khí sau: Cl2, NO, NH3, SO2, CO2, H2, C2H4?

A. 2.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 4. C. 1. D. 3. Câu 100. Khi tiến hành thí nghiệm điều chế khí Clo, một học sinh đã lắp đặt dụng cụ như sau:

UY

Tác dụng của bình (B) là A. Giữ khí HCl. B. Giữ hơi nước. C. Giữ MnCl2. D. Giữ khí Cl2. Câu 101. Mặt nạ phòng độc là một thiết bị rất quan trọng trong quân đội và các lực lượng vũ trang.Trong điều kiện không khí bị nhiệm độc các chiến sĩ đeo mặt nạ vào sẽ không bị nhiễm độc là trong mặt nạ có :

N Á O

Í -L

-

A Ó H

P Ấ C

2

O Ạ Đ

Nguyên nhân gây nên hiện tượng đó là A. Do khí HCl tác dụng với nước kéo nước vào bình. B. Do HCl tan mạnh làm giảm áp suất trong bình. C. Do trong bình chứa khí HCl ban đầu không có nước. D. Do HCl là khí nặng hơn không khí nhưng dễ bay hơi. Câu 103. Cho 3 thí nghiệm sau: (1) Cho từ từ dung dịch AgNO3 đến dư vào dung dịch Fe(NO3)2 (2) Cho bột sắt từ từ đến dư vào dd FeCl3 (3) cho từ từ AgNO3 vào dd FeCl3 Thí nghiệm nào ứng với sơ đồ sau:

1 3 +

0 00

B

N Ầ TR

H

G N Ư

.Q P T

N Ơ H

N

A. 1-a, 2-c, 3-b B. 1-a, 2-b, 3-c C. 1-b, 2-a, 3-c D. 1-c, 2-b, 3-a Câu 104. Hình bên mô tả thí nghiệm điều chế Cl2 trong phòng thí nghiệm, dung dịch X và Y lần lượt là:

A. Chất giải độc. B. Than hoạt tính. C. Dung dịch Ca(OH)2. D. CaO. Câu 102. Khí hiđro clorua là chất khí tan rất nhiều trong nước tạo thành dung dịch axit clohiđric. Trong thí nghiệm thử tính tan của khí hiđroclorua trong nước, có hiện tượng nước phun mạnh vào bình chứa khí như hình vẽ mô tả dưới đây:

I Ồ B

Ỡ Ư D

NG

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

A. NaCl và NaOH B. NaCl và Na2CO3 C. NaOH và Na2CO3. D. NaOH và NaCl

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 105. Cho sơ đồ điều chế khí Cl2 trong phòng thí nghiệm từ MnO2 và dung dịch HCl đặc (như hình vẽ bên). Nếu không dùng đèn cồn thì có thể thay MnO2 bằng hóa chất nào (các dụng cụ và hóa chất khác không thay đổi) sau đây?

UY

A. NaCl hoặc KCl B. CuO hoặc PbO2 C. KClO3 hoặc KMnO4 D. KNO3 hoặc K2MnO4 Câu 106. Tiến hành thí nghiệm như hình vẽ. Ban đầu trong cốc chứa nước vôi trong. Sục rất từ từ khí CO2 vào cốc cho tới dư .Hỏi độ sáng của bóng đèn thay đổi như thế nào?

Y là kim loại A. Ag. B. Cu. C. Al. D. Fe.

Ư D I Ồ B

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

1 3 +

.Q P T

N

A. Hidro clorua (HCl). B. Metylamin (CH3NH2). C. Amoniac (NH3). D. Cacbonic (CO2). Câu 109. Tinh dầu bạc hà có trong cây bạc hà có tác dụng giảm đau, điều trị mệt mỏi và trầm cảm, lại có giá trị kinh tế cao nên trước đây được người nông dân xã Bình Minh, huyện Khoái Châu trồng trên diện tích rộng. Để thu được tinh dầu bạc hà thì người nấu bạc hà làm như sau: “Trong nồi cất, lá bạc hà được bố trí bên trên và không tiếp xúc với nước bên dưới, đậy kín nồi rồi nâng nhiệt độ nước sôi. Từ nồi cất, hơi tinh dầu đi qua ống dẫn vào thùng lạnh, hơi dầu ngưng tụ lại và chảy vào bình hứng”. ở đây người nấu bạc hà đã dùng phương pháp tách biêt và tinh chế nào dưới đây ? A. Chưng cất thường. B. Chưng cất lôi cuốn hơi nước. C. Kết tinh. D. Chiết tách. Câu 110. Cho mô hình thí nghiệm điều chế và thu khí như hình vẽ sau:

0 00

A. Mờ dần đi rồi sau đó tắt hẳn. B. Ban đầu mờ dần đi rồi lại sáng dần lên. C. Mờ dần đi sau đó vẫn mờ mờ. D. Ban đầu không đổi, sau đó sáng dần lên. Câu 107. Điện trở suất đặc trưng cho khả năng cản trở dòng điện. điện trở suất càng lớn thì khả năng dẫn điện của kim loại càng giảm. X, Y, Z, T là một trong 4 kim loại: Ag, Al, Fe, Cu. Cho bảng giá trị điện trở suất của các kim loại như sau X Y Z T Kim loại Điện trở suất 1,72. 10−8 1,00. 10−7 1,59. 10−8 2,82. 10−8 ( Ω m)

N Ơ H

Câu 108. Khí X ở hình vẽ bên là

B

N Ầ TR

H

G N Ư

O Ạ Đ

Phương trình hóa học nào sau đây không phù hợp với hình vẽ trên?

A. CaC2 + 2 H 2O  → Ca (OH) 2 + C2 H 2 B. CaCO3 + HCl  → CaCl2 + CO2 + H 2O C. NH 4Cl + NaNO2  → NaCl + N 2 + H 2O → 4 Al (OH )3 + 3CH 4 D. Al4C3 + 12 H 2O 

Câu 111. Hình vẽ nào sau đây biểu diễn trạng thái cân bằng hoá học?

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. Hình A. B. Hình C. C. Hình D. D. Hình B. Câu 112. Phát biểu nào không đúng ? A. Khi bị ong đốt có thể dùng vôi bôi vào vết đốt sẽ bớt đau hơn. B. Ủ quả chín vào giữa các quả xanh sẽ làm các quả chín nhanh hơn. C. Khi khê cơm có thể dùng than củi xốp cho vào cơm để bớt mùi khê. D. Sắn có chứa HCN đây là chất cực độc có thể gây tử vong, để không bị ngộ độc do sắn có thể rửa qua sắn bằng nước vôi rồi mới đem luộc. Câu 113. Trong phòng thí nghiệm, cách xử lí một số tình huống bất ngờ xảy ra nào sau đây không hợp lí ? A. Dùng bột lưu huỳnh để thu hổi thủy ngân khi làm vỡ nhiệt kế thủy ngân. B. Dùng nước vôi trong để xử lí brom lỏng khi làm đổ bình chứa ra phòng thí nghiệm. C. Phun nước vôi trong vào phòng thí nghiệm khi sơ suất để khí Cl2 thoát ra khỏi bình chứa. D. Khi bị bỏng nhẹ do phenol, axit cần dùng nước và cồn để xử lí ngay vết bỏng. Câu 114. Để tiêu huỷ kim loại kiềm dư thừa trong quá trình làm thí nghiệm một cách an toàn, em nên dùng hoá chất nào sau đây ? A. Dầu hoả. B. Nước vôi. C. Giấm loãng. D. Cồn 96o. Câu 115. Cho sơ đồ thiết bị tổng hợp amoniac trong công nghiệp:

NG

N Á O

T

Í -L

-

A Ó H

P Ấ C

2

UY

Phát biểu nào sau đây là đúng khi nói về quá trình tổng hợp NH3 ? A. Vì phản ứng là thuận nghịch nên cần dùng chất xúc tác để tăng hiệu suất tổng hợp. B. Phản ứng tổng hợp xảy ra ở điều kiện áp suất cao, nhiệt độ thích hợp và có xúc tác. C. Trong thực tế, phương án tối ưu để tách riêng NH3 từ hỗn hợp với H2 và N2 là dẫn qua dung dịch HCl dư. D. Lượng H2 và N2 còn dư sau mỗi vòng phản ứng được chuyển về máy bơm tuần hoàn để đưa trở lại máy nén. Câu 116. Kết tinh là một trong những phương pháp phổ biến đề tách biệt và tinh chế hợp chất hữu cơ. Hình bên mô tả các bước tiến hành kết tinh:

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

H

N

a) Hoà tan bão hoà hỗn hợp chất rắn ở nhiệt độ sôi của dung môi b) Lọc nóng loại bỏ chất không tan. c) Để nguội cho kết tinh. d) Lọc hút để thu tinh thể. Trình tự các bước tiến hành kết tinh đúng là A. a, b, c, d. B. a, c, b, d. C. b, a, c, d. D. b, c, a, d. Câu 117. Hình ảnh mô tả quá trình ăn mòn điện hóa:

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N Ơ H

B

Nhận định nào sau đây là đúng ? A. Thanh Zn đóng vai trò là anot, xảy ra quá trình oxi hóa. B. Thanh Cu đóng vai trò là catot, xảy ra quá trình oxi hóa. C. Thanh Zn đóng vai trò là catot, xảy ra quá trình quá khử. D. Thanh Cu đóng vai trò là anot, xảy ra quá trình khử.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Khí X được thu bằng phương pháp đẩy khí nên khí Y không tan trong nước. Có 2 chất thỏa mãn là H2O2 và NH4NO2

UY

2H2O2 (to) → 2H2O + O2 NH4NO2 (to) → N2 + 2H2O

Câu 3: B T là NH3 do có tính bazo, Z là HCOOH do có tính axit. Vì CH3OH có liên kết hidro liên phân tử nên nhiệt độ sôi cao hơn HCHO -> X là CH3OH, Y là HCHO

Câu 118. Hình vẽ trên minh họa phản ứng nào sau đây? 0

t A. Na2SO3 + H2SO4  → Na2SO4 + SO2 + H2O 0

t B. NaNO3 rắn + H2SO4 đặc  → HNO3 + NaHSO4

t0

D. MnO2 + 4HClđ  → MnCl2 + Cl2 + 2H2O Câu 119. Dùng ba ống nghiệm đánh số 1, 2, 3 cho hóa chất vào các ống nghiệm theo bảng sau: Thể tích chung Ống nghiệm Thời gian kết tủa Na2 S 2O3 H 2O H 2 SO4 1

4 giọt

8 giọt

1 giọt

13 giọt

t1

2 3

12 giọt 8 giọt

0 giọt 4 giọt

1 giọt 1 giọt

13 giọt 13 giọt

t2 t3

NG

Ỡ Ư D

-L

Í-

A Ó H

I Ồ B

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

0 00

31

2+

Câu 1: C Đinh làm từ thép (hợp kim của Fe-C), nên khi nhúng vào dung dịch NaCl sẽ xuất hiện ăn mòn điện hóa, tạo lớp oxit sần sùi, giúp đinh bám chắc vào tường. Câu 2: B

H

Câu 5: D 1, Làm khô luôn là bước cuối cùng nên loại B, C 2,

P Ấ C

N Ầ TR

D sai vì benzen ít bay hơi, muốn có phản ứng phải trộn 2 chất lại với nhau

Bằng đồng hồ bấm giây, người ta đo khoảng thời gian từ lúc bắt đầu trộn dung dịch đến khi xuất hiện kết tủa, đối với kết quả ở ba ống nghiệm 1, 2, 3 người ta thu được ba giá trị t1, t2, t3. Khẳng định nào sau đây đúng? A. t1 > t2 > t3 B. t1 < t2 < t3 C. t1 > t3 > t2 D. t1 < t3 < t2 Câu 120. Để làm mất mùi tanh của cá đồng (gây ra do một số amin) khi kho cá ta có thể sử dụng loại củ, quả nào sau đây ? A. Cà rốt. B. Củ cải. C. Dưa chuột. D. Khế chua.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

G N Ư

O Ạ Đ

Câu 4: D A, B, C thỏa mãn, tương tự thí nghiệm bốc khói của NH3 với HCl tạo NH4Cl

0

t C. NaClkhan + H2SO4 đặc  → NaHSO4 + 2HCl

N Á O

.Q P T

N

B

NaCl giúp hấp thụ HCl do HCl tan tốt trong nước. Cl2 ít tan trong nước do phương trình trên, có NaCl thêm Cl-> cân bằng chuyển dịch theo chiều nghịch -> Cl2 tan ít. Thêm nữa NaOH tác dung với Cl2 nên loại A

Câu 6: B X là chất k tan trong nước, không phản ứng với NaOH và có phản ứng với HCl tạo muối tan -> Alinin thỏa mãn -> B

A, C, D sai vì đều không phản ứng với HCl

Câu 7: C A đúng vì: Phương trình phản ứng đổi ion

thực chất là 1 quá trình trao

B đúng C sai vì đây là không phải quá trình thuận nghịch mà chỉ xảy ra theo 1 chiều thuận D đúng

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Trong cùng một chu kì, theo chiều tăng dần của điện tích hạt nhân, độ âm điện của nguyên tử các nguyên tố thường tăng dần.

Câu 8: C Các đồng vị của cùng một nguyên tố hóa học là những nguyên tử có cùng số proton nhưng khác nhau về số notrơn.

N

- Trong cũng một nhóm A, theo chiều tăng của điện tích hạt nhân, độ âm điện của nguyên tử các nguyên tố thường giảm dần.

UY

Các nguyên tử 1, 2, 3 đều có 1 proton trong nguyên tử nên là đồng vị của nhau.

.Q P T

• Xét trong sơ đồ, độ âm điện của L < M < R → L, M, R thuộc cùng một chu kì Câu 15: D là năng lượng tối thiểu để tách e thứ nhất ra khỏi nguyên tử ở trạng thái cơ bản.

4 có 2 proton trong nguyên tử.

O Ạ Đ

Câu 9: A K thuộc chu kì 4, nhóm IA.

Trên đồ thị là các nguyên tố chu kì 1, 2, 3

Na thuộc chu kì 3, nhóm IA.

A đúng. Trong 1 chu kì, theo chiều tăng Z thì nhìn chung I1 tăng (đường từ Li đến Ne, từ Na đến Ar)

S thuộc chu kì 3, nhóm VIA.

B đúng

Cl thuộc chu kì 3, nhóm VIIA.

C đúng. Ta nhìn Li, Na, K là rõ nhất, Z càng tăng thì giá trị I1 càng giảm

Trong một chu kì đi từ trên xuống dưới bán kính tăng dần, đi từ trái sang phải bán kính giảm dần.

D sai vì nguyên tố kiềm mới có I1 thấp nhất

0 00

→ Ta có thứ tự: rK > rNa > rS >rCl → 1, 2, 3, 4 tương ứng thứ tự sẽ là K, Na, S, Cl Câu 10: A Nguyên lí bền vững: ở trạng thái cơ bản, trong nguyên tử các electron chiếm lần lượt những obitan có mức năng lượng từ thấp đến cao.

A Ó H

P Ấ C

2

Câu 11: B Ta thấy trong 1 nhóm, bán kính nguyên tử tăng dần, trong 1 chu kỳ bk nguyên tử giảm dần theo chiều tăng của đt hạt nhân

Í -L

-

1 3 +

B

N Ầ TR

H

G N Ư

Câu 16: A 2 2 6 1 11A: 1s 2s 2p 3s

Vậy lớp thứ nhất A có 2e, lớp thứ 2 A có 8e và lớp thứ 3 A có 1e Câu 17: A M thuộc chu kì 3, nhóm IA. R thuộc chu kì 3, nhóm IIA.

X thuộc chu kì 4, nhóm IA. L thuộc chu kì 4, nhóm IIIA.

A thì X < Y < Z < T. B thì X < Z < Y < T. C thì Z < X < T < Y. D thì T < Y < Z < X

N Á O

Câu 12: A Trong 1 chu kỳ, độ âm điện tăng dần, trong 1 nhóm A độ âm điện giảm dần theo chiều tăng của điện tích hạt nhân. Vì độ âm điện của các chất T > Y > Z > X nên ta chọn A

NG

T

Câu 13: A Trong một chu kì, đi từ trái sang phải năng lượng ion hóa thứ nhất tăng dần.

D I BỒ

ƯỠ

→ X là nguyên tố có tính kim loại lớn nhất Câu 18: D M thuộc chu kì 3, nhóm VIIA. R thuộc chu kì 3, nhóm IIA. X thuộc chu kì 2, nhóm VIIA.

Trong một nhóm, đi từ trên xuống dưới năng lượng ion hóa thứ nhất giảm dần

L thuộc chu kì 4, nhóm IA.

A thì T < Y < X < Z; B thì T < Y < Z < X; D thì T < Z < Y < X Câu 14: A

→ Nguyên tố có độ âm điện lớn nhất là L Câu 19: A

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

X thuộc chu kì 2, nhóm IA. Y thuộc chu kì 3, nhóm IA.

Câu 27: A Tính phi kim của biến đổi ngược lại so với bán kính của nguyên tử.

Z thuộc chu kì 4, nhóm IA.

Ta có bán kính giảm dần theo thứ tự (1) > (2) > (3) > (4)

Đáp án A sai vì tính kim loại tăng dần theo thứ tự X, Y, Z. Câu 20: A Ta thấy trong tinh thể NaCl, Na và Cl tồn tại dưới dạng ion Na+ và Cl-

Câu 21: A Trong phân tử HCl mối nguyên tử H và Cl đều góp chung 1 electrong tạo thành 1 cặp e dùng chung, tạo nên một liên kết cộng hóa trị → C sai ( do có 2 liên kết cộng hóa trị)

→ rAl < rMg < rNa < rK → a, b, c, d tương ứng với K, Na, Mg và Al Câu 24: B Bán kính nguyên tử càng lớn thì độ âm điện càng nhỏ

H Í

mà bán kính nguyên tử giảm dần theo thứ tự: (1) > (2) > (3) > (4)

→ độ âm điện tăng dần theo thứ tự (1) < (2) < (3) < (4) Câu 25: A Bán kính nguyên tử kim loại càng lớn, tính kim loại càng mạnh.

N Á O

-L

ÓA

P Ấ C

T

Ta có bán kính giảm dần theo thứ tự a > b > c > d → Tính kim loại giảm dần theo thứ tự a > b > c > d Câu 26: A Ta thấy tốc độ phản ứng phụ thuộc vào nồng độ, nhiệt độ, diện tích tiếp xúc, áp suất và chất xúc tác.

Ư D I Ồ B

G N Ỡ

Ở đây cả 2 phản ứng có cùng lượng axit, vì vậy dung dịch hiện trước -> TN1 Đáp án A

Sưu tầm bởi GV. Nguyễn Thanh Tú

nào có nồng độ lớn hơn thì kết tủa xuất

2

N

→ Tính phi kim tăng dần theo thứ tự (1) < (2) < (3) < (4) Câu 28: A Khi tăng nhiệt độ, tốc độ phản ứng tăng nên ở TN2 sẽ xuất hiện kết tủa trước Câu 29: B Câu 30: A Khi tăng nồng độ chất phản ứng và khi có sự có mặt của chất xúc tác thì tốc độ phản ứng tăng.

Cl- có 3 lớp e, Na+ có 2 lớp e nên Cl- có bán kính lớn hơn Na+. Vậy nên quả cầu đen (to hơn) đại diện cho Cl-

Vì Cl có độ âm điện lớn hơn H nên cặp e dùng chung bị Cl hút lệch về phía clo. Câu 22: A Mạng tinh thể kim cương được tạo bởi các nguyên tử cacbon. Trong tinh thể kim cương, mỗi nguyên tử cacbon ở trạng thái lai hóa sp3 liên kết cộng hóa trị với bốn nguyên tử cacbon gần nhất nằm ở bốn đỉnh của một tứ diện đều bằng bốn cặp electron chung. Mỗi nguyên tử cacbon ở đỉnh lại liên kết với các nguyên tử cacbon khác Câu 23: B Trong một chu kì, đi từ trái sang phải, bán kính nguyên tử giảm dần. Trong một nhóm, đi từ trên xuống dưới, bán kính nguyên tử tăng dần.

.Q P T

UY

H

→ Cốc 1 bọt khí xuất hiện chậm nhất. Câu 31: A Đây là thí nghiệm tìm ra electron: Tôm-xơn cho phóng điện với hiệu điện thế 15 000 vôn qua hai điện cực gắn vào đầu của một ống kín đã rút gần hết không khí (áp suất chỉ còn 0,001 mmHg) thì thấy màn huỳnh quang trong ống thủy tinh phát sáng. Màn huỳnh quang phát sáng do sự xuất hiện của các tia không nhìn thấy được đi từ cực âm đến cực dương. Tia này được gọi là tia âm cực, tia âm cực bị lệch về phía cực dương khi đặt ống thủy tinh trong một điện trường. Tia âm cực là chùm hạt mang điện tích âm và mỗi hạt đều có khối lượng được gọi là electron, kí hiệu là e.

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

B

Câu 32: D Câu 33: A vtrung bình = ∆C/∆t = (0,3033 - 0,2330) : (2 x 120) ≈ 2,929 x 10-4 mol.(l.s)-1 Câu 34: D Mạng tinh thể NaCl có cấu trúc hình lập phương. Các ion Na+ và Cl- nằm ở các nút của mạng tinh thể một cách luân phiên. Trong tinh thể NaCl, cứ một ion Na+ được bảo quanh bởi 6 ion Cl-. Ngược lại, một ion Cl- được bao quanh bởi 6 ion Na+. Do đó, các ion Na+ và ion Cl- hút nhau bằng lực hút tĩnh điện Câu 35: A Ban đầu, nồng độ H2, I2 là lớn nhất, nồng độ HI=0 nên tốc độ phản ứng thuận là lớn nhất, tốc độ phản ứng nghịch bằng 0 Khi phản ứng bắt đầu, nồng độ H2 và I2 giảm dần nên tốc độ phản ứng thuận giảm, nồng độ HI tăng nên tốc độ phản ứng nghịch tăng Khi tốc độ phản ứng thuận bằng tốc độ phản ứng nghịch thì phản ứng ở trạng thái cân bằng, khi đó nồng độ các chất trong dung dịch được giữ nguyên nếu nhiệt độ k đổi Khi phản ứng đạt cân bằng, phản ứng vẫn diễn ra theo cả 2 chiều thuận nghịch, với tốc độ bằng nhau -> Cân bằng là cân bằng động

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta thấy đồ thị A là chính xác nOH- = 4b - 0,04 = 0,36 → b = 0,1 mol → CM Al(NO3)3 = 0,1M Câu 43: A Cl2 + H2O → HCl + HClO

Câu 36: A Ta có N2O4 (không màu, k) <=> 2NO2 (màu nâu đỏ, k) ∆H = 58kJ > 0 Khi ngâm ống 1 trong nước đá → giảm nhiệt độ → cân bằng chuyển dịch theo chiều nghịch (chiều phản ứng tỏa nhiệt)

→ Ống 1 có màu nhạt hơn Câu 37: A N2O4 (không màu, k) <=> 2NO2 (màu nâu đỏ, k) Hình 2 biểu thị việc kéo xi lanh lên nghĩa là làm giảm áp suất của hệ → cân bằng chuyển dịch theo chiều làm tăng số mol khí → màu đậm lên.

Câu 38: C Chú ý câu hỏi sự phụ thuộc của tốc độ phản ứng vào áp suất. Khi áp suất tăng thì tốc độ phản ứng tăng. Câu 39: A Câu 40: A AgNO3 + NaF → không phản ứng nên ống nghiệm 1 không có hiện tượng gì.

AgNO3 + NaBr → AgBr↓vàng + NaNO3 AgNO3 + NaI → AgI↓vàng đậm + NaNO3

Câu 41: A 3Na2CO3 + 2AlCl3 + 3H2O → 2Al(OH)3↓ + 3CO2↑ + 6NaCl

N Á O

-L

Câu 42: A Tại thời điểm nNaOH = 0,24 x 1,5 = 0,36 mol thì nAl(OH)3 = 0,04 mol.

Al3+ + 3OH- → Al(OH)3↓

D I BỒ

ƯỠ

b------------3b-------------b

NG

T

Al(OH)3 + OH- → AlO2- + 2H2O

H Í

ÓA

P Ấ C

N

N Ầ TR

H

Giải thích: Hợp chất gluxit tác dụng với H2SO4 đặc bị biến thành C (than)

0 00

2

G N Ư

.Q P T

Hiện tượng xảy ra trong ống nghiệm là có kết tủa trắng Câu 46: A Hiện tượng xảy ra hiện tượng đường hóa đen và sủi lên cao

Hình e biểu thị việc nén xi lanh xuống nghĩa là làm tăng áp suất của hệ → cân bằng chuyển dịch theo chiều làm giảm số mol khí → màu nhạt đi.

Giả sử số mol của AlCl3 là b

O Ạ Đ

Câu 45: A C6H5NH2 + 3Br2 → (2,4,6)-Br3C6H2OH↓trắng + 3HBr

AgNO3 + NaCl → AgCl↓trắng + NaNO3

UY

Đầu tiên quỳ tím chuyển sang màu đỏ, sau đó do HClO có tính oxi mạnh nên làm quỳ tím mất màu Câu 44: A Hóa chất ở bình cầu 1 có khả năng phản ứng với HCl đặc tạo khí Clo. Vậy chọn A là H2O2

1 3 +

B

Một phần sản phẩm C bị H2SO4 đặc oxh thành khí CO2 cùng với khí SO2 gây hiện tượng sủi bọt đẩy C trào ra ngoài cốc

Câu 47: A Khi cho mẩu Na vào ống nghiệm đựng dung dịch CuSO4 thì lần lượt xảy ra các phản ứng hóa học: 2Na + 2H2O → 2NaOH + H2↑ CuSO4 + 2NaOH → Cu(OH)2↓ + Na2SO4 Câu 48: A là ta rót từ từ axit vào nước và khuấy nhẹ bằng đũa thủy tinh. Nếu làm ngược lại, đổ Cách pha loãng nước vào axit dễ xảy ra hiện tượng axit bắn ra xung quanh gây nguy hiểm

Câu 49: A Ở cốc 2 hình thành pin điện hóa Fe-Cu. Trong đó Fe có tính khử mạnh hơn nên đóng vai trò là cực âm và bị ăn mòn. Ở cốc 3 hình thành pin điện hóa Zn-Fe. Trong đó, Zn có tính khử mạnh hơn nên đóng vai trò là cực âm và bị ăn mòn. Câu 50: A 2Fe + 3Cl2 (to) → 2FeCl3

(b - 0,04)-------(b - 0,04)

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 51: A Ống nghiệm (1), (3), (4) đều tạo kết tủa vàng nên chứng tỏ khí dẫn vào đều có nối ba ở đầu mạch.

→ Kết tủa tan, dung dịch có màu xanh lam Câu 58: A Phenol có tính axit rất yếu nên không làm đổi màu quỳ tím

Ống nghiệm (2) khi dẫn khí vào dung dịch AgNO3/NH3 không có hiện tượng gì → khí không có nối ba ở đầu mạch Câu 52: A Phương pháp chiết được dùng để tách hai chất lỏng có không tan vào nhau và có khối lượng riêng khác nhau

Câu 53: A Khi đun sôi một hỗn hợp chất lỏng, chất nào có nhiệt độ sôi thấp hơn sẽ chuyển thành hơi sớm hơn và nhiều hơn. Khi gặp lạnh, hơi sẽ ngưng tụ thành dạng lỏng chứa chủ yếu là chất có nhiệt độ sôi thấp hơn. Quá trình đó gọi là sự chưng cất.

pH ≤ 8,3; dung dịch có tính axit hoặc trung tính, bazơ yếu nên phenol phtalein không đổi màu.

N Á O

NG

Ống nghiệm (2) xuất hiện kết tủa màu vàng:

D I BỒ

ƯỠ

T

CH≡CH + 2AgNO3 + 2NH3 → AgC≡CAg↓ + 2NH4NO3

Câu 57: A

Sưu tầm bởi GV. Nguyễn Thanh Tú

N Ầ TR

G N Ư

B

Câu 61: A CaC2 + 2H2O → Ca(OH)2 + C2H2

• Phenolphtalein:

CH≡CH + 2AgNO3 + 2NH3 → AgC≡CAg↓ + 2NH4NO3 Câu 56: A Ống nghiệm (1) có hiện tượng sủi bọt khí: CaC2 + 2H2O → Ca(OH)2 + C2H2↑

O Ạ Đ

C6H5OH + NaOH → C6H5ONa + H2O

pH ≥ 8 → dung dịch có môi trường bazơ → quỳ tím chuyển màu xanh.

-L

H

Câu 60: A Chỉ có ống 1 xảy ra phản ứng:

0 00

pH = 7 → dung dịch có môi trường trung tính → quỳ tím không đổi màu.

Ống nghiệm (2) xuất hiện kết tủa màu vàng:

N

Dung dịch (4) không hòa tan được Cu(OH)2 nên ancol (4) không có nhiều nhóm -OH cạnh nhau → (4) là propan-1,3-điol

Để tách các chất có nhiệt độ sôi khác nhau nhiều, người ta dùng cách chưng cất thường Câu 54: A Quỳ tím: pH ≤ 6 → dung dịch có tính axit → quỳ tím chuyển hồng.

H Í

.Q P T

UY

→ Màu quỳ tím là màu tím Câu 59: A Tất cả ống nghiệm (1), (2), (3) dung dịch đều có màu xanh → 3 dung dịch (1), (2), (3) đều chứa ancol có nhiều nhóm -OH đính vào các nguyên tử C cạnh

Trong phiễu chiết gồm hỗn hợp hai chất lỏng, chất có khối lượng riêng nhỏ hơn ở bên trên, chất có khối lượng riêng lớn hơn nằm phía dưới. Khi mở khóa thì chất có khối lượng riêng lớn hơn dần dần chảy xuống eclen

pH ≥ 8,3 → dung dịch có môi trường bazơ nên phenolphtalein đổi màu hồng Câu 55: A Ống nghiệm (1) có hiện tượng sủi bọt khí: CaC2 + 2H2O → Ca(OH)2 + C2H2↑

N Ơ H

2C3H8O3 + Cu(OH)2↓ → (C3H7O3)2Cu + 2H2O

ÓA

P Ấ C

2+

31

CH≡CH + H2O (HgSO4, H2SO4) → CH3CHO

CH3CHO + 2[Ag(NH3)2]OH → CH3COONH4 + 2Ag↓ + 3NH3 + H2O mCH3CHO + CH≡CH dư = 2,02 gam; mAg + C2Ag2 = 11,04 gam Gọi số mol của CH3CHO và CH≡CH dư lần lượt là x, y Ta có: 44x + 26y = 2,02 Mà 2x x 108 + 240y = 11,04 → x = 0,04; y = 0,01 → H = 0,04 : (0,04 + 0,01) = 80% Câu 62: A Trong 4 chất có cùng số C, axit có nhiệt độ sôi cao nhất, r đến ancol (do chúng có lk Hidro), r đến andehit, thấp nhất là ankan (do andehit có M lớn hơn ankan) -> 4 là axit etanoic, 2 là ancol etylic, 1 là etanal, 3 là etan

Câu 63: A Ta có độ linh động của nguyên tử H được sắp xếp theo thứ tự: CH3-CH3 < CH3-CHO < CH3-CH2OH < CH3COOH → Độ mạnh của liên kết H được sắp xếp theo thứ tự: CH3-CH3 < CH3-CHO < CH3-CH2OH < CH3-COOH

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ Độ tan trong nước được sắp xếp theo thứ tự: CH3-CH3 < CH3-CHO < CH3-CH2OH < CH3-COOH

N Ơ H

không thỏa mãn

Chất 3 có độ tan nhỏ nhất → 3 là CH3-CH3 Câu 64: A CH3CHO + AgNO3/NH3 → không phản ứng.

Chọn D

UY

CH≡CH + 2AgNO3 + 2NH3 → AgC≡CAg↓ + 2NH4NO3

.Q P T

N

Câu 69: A Các chất phù hợp là các chất có khả năng phản ứng với HCl đặc tạo khí Clo.

CH≡C-CH3 + AgNO3 + NH3 → AgC≡C-CH3↓ + NH4NO3 HCHO + 4AgNO3 + 6NH3 + 2H2O → (NH4)2CO3 + 4Ag↓ + 4NH4NO3

Ta thấy cả 4 chất đều phù hợp

→ Ống nghiệm 1 không có phản ứng xảy ra Câu 65: D CH≡C-CH2-CH3 + AgNO3 + NH3 → AgC≡C-CH2-CH3↓ + NH4NO3

G N Ư

O Ạ Đ

Tuy nhiên để phản ứng xảy ra nhất thiết phải đun nóng, chỉ có MnO2 là thỏa mãn

H

CH≡CH + 2AgNO3 + 2NH3 → AgC≡CAg↓ + 2NH4NO3

Câu 70: B hh khí bay ra gồm khí HCl và Cl2.

CH≡C-CH3 + AgNO3 + NH3 → AgC≡C-CH3↓ + NH4NO3

Để giữ lại khí HCl người ta cho hh khí trên đi qua dung dịch NaCl

0 00

HCHO + 4AgNO3 + 6NH3 + 2H2O → (NH4)2CO3 + 4Ag↓ + 4NH4NO3 Phản ứng ở ống nghiệm (1), (2), (3) đều là phản ứng thế bằng ion kim loại. Phản ứng ở ống nghiệm (4) là phản ứng oxi hóa của anđehit.

P Ấ C

2

Câu 66: B H2SO4 đặc là chất hút nước mạnh và tỏa nhiều nhiệt. Nếu rót nước vào axit khiến nước sôi đột ngột và kéo theo axit bắn ra ngoài gây nguy hiểm

H Í

ÓA

Để pha loãng axit cần đổ từ từ axit H2SO4 vào nước và khuấy nhẹ bằng đũa thủy tinh. Đáp án B

-L

1 3 +

B

N Ầ TR

Câu 71: C A đúng vì các chất trên đều có tính oxh mạnh, khi tác dụng với HCl đặc đều sinh ra khí Clo.

B đúng vì phản ứng chỉ phản ứng khi HCl đặc C sai vì nếu là CaO rắn thì khi tx với nước tạo Ca(OH)2 tác dụng với Clo sinh ra D đúng vì đều giữ được HCl

Câu 72: A Đáp án A sai vì nếu thay H2SO4 đặc bằng CaO:

Chú ý khi đổ H2SO4 dọc theo đũa thủy tinh sẽ tránh bị tràn và rơi axit ra ngoài.

N Á O

Câu 67: C Hiện tượng xảy ra là quỳ tím chuyển sang màu đỏ rồi mất màu Nguyên nhân là do phản ứng

Ỡ Ư D

NG

T

HCl là axit mạnh làm cho quỳ tím chuyển sang đỏ. Đồng thời HClO là chất oxi hóa mạnh, có tính tẩy màu làm cho quỳ tím mất màu

I Ồ B

Câu 68: D Sản phẩm thu được là khí Clo vậy nên hóa chất trong bình 1 phải tác dụng được với HCl tạo khí Clo

Sưu tầm bởi GV. Nguyễn Thanh Tú

CaO + H2O → Ca(OH)2 Ca(OH)2 + Cl2 → CaOCl2 + H2O

Câu 73: A hh khí bay ra gồm Cl2, HCl và hơi H2O Khi đi qua dd NaCl thì HCl bị giữ lại, hh hơi còn hơi H2O và Cl2 Sau khi đi qua bình đựng dung dịch H2SO4 thì hơi H2O bị giữ lại. Cuối cùng bình eclen thu được khí clo khô

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 74: B Khí HCl tan nhiều trong nước, làm giảm áp áp suất trong bình do đó có hiện tượng nước phu mạnh vào bình chứa khí.

Câu 82: B Ống nghiệm 1: Zn + 2HCl → ZnCl2 + H2

" Nhớ": khí cũng có hiện tượng tương tự HCl là NH3.

H2 + S (to) → H2S↑

Câu 75: C Đáp án C sai vì phản ứng xảy ra khi có mặt của nhiệt độ:

Ống nghiệm 2: H2S + Pb(NO3)2 → PbS↓đen + 2HNO3 Câu 83: B Các khí được thu theo phương pháp đẩy khí trên có đăc điểm nhẹ hơn không khí.

NaCl + H2SO4 (< 250oC) → NaHSO4 + HCl

Câu 76: A Vì khí HCl tan rất mạnh trong nước nên nếu ta không dùng NaCl rắn hoặc H2SO4 đặc thì HCl thu được sẽ tan ngay vào trong dung dịch chất phản ứng Câu 77: D MnO2 + 4HCl → MnCl2 + Cl2↑ + 2H2O Hiện tượng là chất rắn MnO2 tan dần và có khí màu vàng thoát ra Câu 78: C Phản ứng Na cháy trong Oxi tỏa nhiều nhiệt nên đề phòng trường hợp bình thủy tinh nứt gây nguy hiểm ta không nên đưa ngay mẩu Na rắn vào bình phản ứng Câu 79: C Đáp án A sai vì than mới giúp cho phản ứng của Fe với Oxi xảy ra dễ dàng hơn.

A Ó H

P Ấ C

Phản ứng của sắt với oxi xảy ra rất mãnh liệt và tỏa nhiểu nhiệt nên phải có lớp nước ở đáy bình để tránh tình trạng bình nứt.

Câu 80: A Zn + 2HCl → ZnCl2 + H2 H2 + S (to) → H2S↑

NG

H2S + Pb(NO3)2 → PbS↓đen + 2HNO3

Ỡ Ư D

Câu 81: A Zn + 2HCl → ZnCl2 + H2

I Ồ B

H2 + S (to) → H2S↑

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

O Ạ Đ

.Q P T

N

1 3 +

N Ầ TR

H

G N Ư

Nguyên nhân: Do NH3 tan nhiều trong nước, áp suất khí NH3 giảm đột ngột, nước trong cốc bị hút vào bình do ống thủy tinh. Trong MT bazo, phenolphtalein từ k màu chuyển hồng nên tia nước có màu hồng Câu 86: B Na2SO3 + H2SO4 → Na2SO4 + SO2↑ + H2O

0 00

2

UY

Có 3 khí thỏa mãn là H2, N2 và NH3 Câu 84: A HCl tan trong nước, áp suất trong bình giảm đột ngột, nước trong cốc bị hút vào bình qua ống thủy tinh, phun thành các tia nước có màu đỏ. Màu đỏ ở đây do quỳ tím chuyển đỏ trong MT axit Câu 85: B Hiện tượng xảy ra là nước phun vào bình và chuyển thành màu hồng

2NaCl + H2SO4 (> 400oC) → Na2SO4 + 2HCl.

Đáp án B sai vì oxi ít tan trong nước.

N Ơ H

H2S + Pb(NO3)2 → PbS↓đen + 2HNO3

B

SO2 + Br2 + 2H2O → 2HBr + H2SO4 Do đó, bình eclen chứa dung dịch Br2 bị mất màu Câu 87: B Phản ứng trogn bình cầu: Na2SO3 + H2SO4 → Na2SO4 + SO2↑ + H2O Phản ứng trong bình eclen: SO2 + Br2 + 2H2O → 2HBr + H2SO4 Câu 88: B Phản ứng trogn bình cầu: Na2SO3 + H2SO4 → Na2SO4 + SO2↑ + H2O Phản ứng trong bình eclen: SO2 + Br2 + 2H2O → 2HBr + H2SO4

Câu 89: C Phương pháp chưng cất dùng để tách các chất lỏng có nhiệt độ sôi khác nhau nhiều Khi đun sôi 1 hh lỏng, chất nào có nhiệt độ sôi thấp sẽ chuyển thành hơi sớm hơn và nhiều hơn. Ta dùng nhiệt kế đo nhiệt độ sôi của chất đang chưng cất, phát hiện thời điểm thích hợp để thu chất Câu 90: A Bông và CuSO4 khan dùng để nhận biết H2O. Nếu có nước CuSO4 sẽ chuyển từ trắng sang xanh -> Xác định H

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Ca(OH)2 dùng để nhận biết CO2 do phản ứng tạo kết tủa trắng CaCO3 -> Xác định C

A sai vì HCl tan trong nước nên k thu được bằng cách đẩy nước

Câu 91: B CuSO4 được dùng trong việc xác định sự có mặt của nước. Ở dạng tinh thể CuSO4 có màu trắng, nếu có nước nó sẽ chuyển sang dạng dung dịch màu xanh

B sai vì NH3 cũng tan trong nước nên k thu được bằng cách đẩy nước C thỏa mãn

Vì vậy trong Tn này, CuSO4 dùng để phát hiện H từ màu trắng sang xanh

D sai vì SO2 tan trong nước

Câu 92: A Hợp chất hữu cơ chứa C và H khi đốt cháy sinh ra CO2 và H2O

Đáp án C

UY

Khí CO2 thoát ra hấp thụ vào ống nghiệm đựng dung dịch Ca(OH)2:

H

C6H12O6 –––to–→ CO2 + H2O CO2 + Ca(OH)2 → CaCO3↓trắng + H2O Câu 93: A Este thường là chất lỏng, nhẹ hơn nước và rất ít tan trong nước, có nhiệt độ sôi thấp, nên khi ngâm este với nước, để tách este ra khỏi hh ta dùng phương pháp chưng cất

CO2 + Ca(OH)2 → CaCO3 ↓ + H2O

0 00

Câu 94: B Thứ tự thao tác hợp lý là: (1) Lấy kẹp gỗ hoặc giá gỗ kẹp ống nghiệm. (3) Lấy một lượng nhỏ KMnO4 cho vào ống nghiệm (4) Kẹp một mảnh giấy màu ẩm, một mảnh giấy màu khô ở miệng ống nghiệm

A Ó H

P Ấ C

2

(2) Đậy miệng ống nghiệm bằng nút cao su có kèm ống hút nhỏ giọt dung dịch HCl đặc vào ống nghiệm đựng KMnO4

-

(5) Bóp nhẹ đầu cao su của ống hút cho 3 - 4 giọt dung dịch HCl đặc vào KMnO4

T

Khi đó HCl phản ứng với KMnO4 tạo khí Cl2 bay lên, sẽ làm mất màu mảnh giấy màu ẩm, còn mảnh giấy màu khô sẽ không đổi màu Câu 95: C Nhận thấy nhiệt độ sôi của các chất được sắp xếp theo chiều tăng dần khối lượng phân tư

Ư D I Ồ B

Vậy X là HCOOH, Y là CH3COOH, T là C2H5COOH, Z là C6H5COOH

Câu 96: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

N Ầ TR

G N Ư

H2O + CuSO4 ( trắng) → CuSO4.5H2O ( xanh)

Phương pháp chưng cất dùng để tách các chất lỏng có nhiệt độ sôi khác nhau

G N Ỡ

N

Câu 97: C Để nhận biết sự có mặt H trong trong hợp chất hữu cơ dùng bông tẩm CuSO4 khan, để nhận biết sự có mặt C trong trong hợp chất hữu cơ người ta dẫn sản phẩm cháy qua dung dịch Ca(OH)2

CuSO4 (trắng) + 5H2O → CuSO4.5H2O (màu xanh)

N Á O

O Ạ Đ

.Q P T

N Ơ H

1 3 +

B

Câu 98: C Nhận thấy khí thu được bằng phương pháp trên là khí phải có phân tử khối lớn hơn không khí ( ống nghiệm ngửa lên phía trên) Vậy các khí thỏa mãn gồm : O2, Cl2, H2S, SO2, CO2, HCl.

Câu 99: D 6HCl (B) + KClO3 (A) → KCl + 3Cl2 + 3H2O Na2SO3 (A) + H2SO4 (B) → Na2SO3 + SO2 + H2O Na2CO3 (A) + H2SO4 (B) → Na2CO3 + CO2 + H2O Với NO, H2, C2H4 , NH3 là các khí nhẹ hơn không khí nếu thu bằng pp đẩy không khí phải úp ống nghiệm xuống.

Câu 100: A Các khí thoát ra cùng ở (1) là HCl, Cl2, H2O Bình B chứa NaCl để giữa HCl, bình chứa H2SO4 đặc để giữ nước

Câu 101: B Than hoạt tính có diện tích bề mặt khá lớn làm tăng khả năng hấp phụ mạnh khí độc nên được dùng nhiều trong mặt nạ phòng độc, trong công nghiệp hóa chất và trong y học

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 102: B Khí hidrua clorua tan rất nhiều trong nước làm giảm áp suất trong bình so với áp suất bên ngoài bình. Do sự chênh lệch áp suất khiến nước bị hút vào bình đựng khí. Đáp án B.

N Ơ H

Vậy Z là Ag, T là Cu, Y là Cu, X là Al, Z là Fe

N

Câu 108: A Nhận thấy khí X làm nước pha quỳ tím chuyển sang đỏ → khí X mang tính axit → loại B, C

UY

Câu 103: B (1) Cho từ từ AgNO3 + Fe(NO3)2 → Fe(NO3)3 + Ag

.Q P T

Khí X phải là khí tan rất tốt trong nước, khi đó do sư chênh lệch áp suất nước trong chậu mới bị hút ngược vào bình chứa khí → loại D

Thấy hàm lượng Fe3+ tăng dần đến khi Fe2+ phản ứng hết với AgNO3 → ứng với đồ thị (a)

O Ạ Đ

Câu 109: B Tinh dầu bạc hà là hợp dễ bay hơi cùng nước nên đươc thu bằng cách chưng cất lôi cuốn hơi nước Câu 110: B Nhận thấy khí thu được bằng phương pháp đẩy nước → khí thu được không tan trong nước

(2) Cho từ từ Fe đến dư vào dung dịch FeCl3 → Fe + 2FeCl3 → 3FeCl2 Như vậy hàm lượng Fe3+ giảm dần → ứng với đồ thị (b) (3) 3AgNO3 + FeCl3 → 3AgCl + Fe(NO3)3

H

G N Ư

Thấy khí N2.,C2H2, CH4 đều không tan trong nước nên thu được bằng phương pháp đẩy nước Thấy hàm lượng Fe3+ không đổi → ứng với đồ thị (c)

N Ầ TR

CO2 tan một phần trong nước tạo H2CO3 → CO2 không thu được phương pháp đẩy nước.

Câu 104: A Khí Cl2 sinh ra thường lẫn HCl dư, và hơi nước

Câu 111: B Trạng thái cân bằng hóa học là khi tốc độ phản ứng thuận bằng tốc độ phản ứng nghịch

0 00

Để thu được Cl2 tinh khiết và khô người ta dẫn hỗn hợp khí qua dung dịch NaCl để loại bỏ HCl dư, dẫn qua H2SO4 đặc để loại bỏ hơi nước Bình thu khí Cl2 dùng bông tẩm NaOH để tránh Cl2 độc bay ra

P Ấ C

Câu 105: C Nhận thấy HCl không tác dụng với NaCl,KNO3 → loại A, D. HCl tác dụng với CuO sinh khí Cl2 → loại B.

A Ó H

Điều chế khí Cl2 dùng HCl tác dụng với chất oxi hóa mạnh như KClO3, KMnO4,KCr2O7, MnO2..

Í-

Câu 106: B Độ sáng của bóng đèn phụ thuộc vào hàm lượng các ion có trong dung dịch

N Á O

Phương trình phản ứng : CO2 + Ca(OH)2 → CaCO3↓ + H2O (1) CO2 + CaCO3 + H2O → Ca(HCO3)2 (2)

G N Ỡ

-L

T

Như vậy sau (1) thì hàm lượng ion giảm đi → đền mờ dần đi.

Tiếp tục sục CO2 thì pư (2) xảy ra → hàm lượng ion tăng → đèn lại sáng trở lại

Ư D I Ồ B

Câu 107: B Nhận thấy kim loại dẫn điện càng tốt thì điện trở suất càng nhỏ

2

1 3 +

B

Ban đầu tốc độ phản ứng thuận là tối đa, tốc độ phản ứng nghịch là 0. Tốc độ phản ứng nghịch tăng dần, thuận giảm dần đến khi vận tốc 2 quá trình là như nhau thì phản ứng đạt trạng thái cân bằng động Hình vẽ C là phù hợp

Câu 112: D Trong nọc ong có HCOOH, HCl và H3PO4 ,histamin, cholin, tritophan... nên khi bị ong đốt thì ta bôi vôi vào vết ong đốt để xảy ra phản ứng trung hòa giữa vôi và axit. • Quả chín thường thoát ra khí etilen. Nó có tính hoạt động hóa học tương đối mạnh, xúc tiến hoạt động hô hấp của cây, khiến ôxy dễ lọt qua lớp vỏ vào quả hơn, và quả cũng chín nhanh hơn. • Khi khê cơm có thể dùng than củi xốp cho vào cơm để bớt mùi khê vì than củi xốp có tính hấp phụ nên hấp phụ mùi khét của cơm làm cho cơm đỡ mùi khê. • Sắn có chứa HCN là chất cực độc có thể gây tử vong vì vậy khi ăn sắn bị ngộ độc, người ta thường giải độc bằng nước đường.

Câu 113: C A đúng vì lưu huỳnh phản ứng với Hg ngay nhiệt độ thường tạo muối B đúng vì chiều thuận, lượng Brom giảm đi

phản ứng chuyển dịch theo

Thứ tự độ dẫn điện của các kim loại sắp xếp theo chiều Ag > Cu > Al > Fe

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D đúng vì phenol và axit tan nhiều trong etanol nên dùng etanol và nước rửa sẽ kéo phenol và axit ra ngoài

→ t1 > t3 > t2 → Chọn C.

Câu 115: B A sai vì xúc tác k làm chuyển dịch cân bằng nên k thể làm tăng hiệu suất, xúc tác để phản ứng xảy ra nhanh hơn

RNH2 + H+ → RNH3+ B đúng nhiệt độ 450-500 độ C, áp suất 200-300 atm, xúc tác là Fe trộn Al2O3, K2O C sai vì pp tối ưu là hóa lỏng NH3, còn H2 và N2 được đưa trở lại tổng hợp D sai vì nhìn trên sơ đồ, H2, N2 được đưa tới máy bơm tuần hoàn để tiếp tục tổng hợp NH3 chứ k trở về máy nén

a. Hòa tan bão hòa hỗn hợp chất rắn ở nhiệt độ sôi của dung môi b. Lọc nóng loại bỏ chất k tan c. Để nguội cho kết tinh

N Á O

d. Lọc hút tinh thể

Í -L

-

A Ó H

P Ấ C

2

N

O Ạ Đ

.Q P T

Câu 120: D Trong cá có các loại amin như: đimetyl amin, trimetyl amin là những chất tạo ra mùi tanh của cá. Khi cho thêm chất chua tức là cho thêm axit để chúng tác dụng với amin trên tạo muối làm giảm độ tanh cho cá:

Vậy nên để an toàn ta xài cồn 96 độ

Câu 116: A Đối với hỗn hợp các chất rắn người ta thường dựa vào độ tan khác nhau và sự thay đổi độ tan theo nhiệt độ của chúng để tách biệt và tinh chế chúng

UY

Ở ống nghiệm 1, H2O nhiều nhất nên Na2S2O3 và H2SO4 bị pha loãng nhiều nhất → nồng độ của Na2S2O3 và H2SO4 nhỏ nhất → t1 lớn nhất.

Câu 114: D Để hủy kim loại kiềm dư ta nên dùng cồn bởi vì phản ứng của ancol với cồn xảy ra êm đềm hơn so với nước và axit. Phản ứng của kiềm với nước và axit đều tỏa nhiệt và phản ứng mãnh liệt

Các bước tiến hành kết tinh là

N Ơ H

Câu 119: C Ở ống nghiệm 2, số giọt nước bằng 0 nên nồng độ của H2SO4 và Na2S2O3 giữ nguyên, không bị pha loãng nên thời gian xuất hiện kết tủa sớm nhất → t2 nhỏ nhất.

C sai vì nước vôi là dd nên rất khó khử cl2 là chất khí. Thực tế phải dùng KHÍ thì phản ứng mới xảy ra hiệu quả, cụ thể là dùng NH3

1 3 +

0 00

B

N Ầ TR

H

G N Ư

Câu 117: A Trong ăn mòn điện hóa cực dương là catot (Cu) tại đây xảy ra quá trình khử → B , Dsai

NG

T

Trong ăn mòn điện hóa cực âm là anot (Zn) tại đây xảy ra quá trình oxi hóa → C sai

Ỡ Ư D

Câu 118: A Nhận thấy HCl, HNO3 bay ra dưới dạng hơi muốn thu được HCl và HNO3 cần làm lạnh → loại B, C

I Ồ B

Khí thoát ra không có màu → loại D

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 3. Sục CO2 vào dung dịch Ba(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Giá trị của x là :

13. Phương pháp giải các dạng bài tập có sử dụng đồ thị (Đề 1)

UY

Câu 1. Sục CO2 vào 200 gam dung dịch Ca(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Nồng độ % chất tan trong dung dịch sau phản ứng là :

G N Ư

O Ạ Đ

.Q P T

N

A. 1,8(mol) B. 2,2(mol) C. 2,0(mol) D. 2,5(mol) Câu 4. Sục CO2 vào dung dịch Ba(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Giá trị của x là : A. 30,45% B. 34,05% C. 35,40% D. 45,30% Câu 2. Sục CO2 vào dung dịch Ba(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Giá trị của x là :

A. 0,55(mol) B. 0,65(mol) C. 0,75(mol) D. 0,85(mol)

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

0 00

2

1 3 +

B

N Ầ TR

H

A. 0,1(mol) B. 0,15(mol) C. 0,18(mol) D. 0,20(mol) Câu 5. Sục CO2 vào dung dịch Ba(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Giá trị của x là :

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

A. 0,60(mol) B. 0,50(mol)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 0,42(mol) D. 0,62(mol) Câu 6. (Đề NC) Dung dịch X chứa a mol Ba(OH)2. Cho m gam NaOH vào X sau đó sục từ từ đến dư CO2 vào ta thấy lượng kết tủa biên đổi theo đồ thị:

Giá trị của (a + m) là A. 20,8. B. 20,5. C. 20,4. D. 20,6. Câu 7. Sục CO2 vào dung dịch chứa hỗn hợp gồm Ca(OH)2 và NaOH ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Giá trị của x là :

N Á O

Í -L

-

A Ó H

P Ấ C

2

A. 0,64(mol) B. 0,58(mol) C. 0,68(mol) D. 0,62(mol) Câu 8. Sục CO2 vào dung dịch chứa hỗn hợp gồm Ca(OH)2 và KOH ta quan sát hiện tượng theo đồ thị hình bên (số liệu tính theo đơn vị mol):

I Ồ B

Ỡ Ư D

NG

UY

O Ạ Đ

.Q P T

N Ơ H

N

Giá trị của x là A. 0,12 (mol). B. 0,11 (mol). C. 0,13 (mol). D. 0,10 (mol). Câu 9. Sục CO2 vào dung dịch chứa hỗn hợp gồm Ca(OH)2 và KOH ta quan sát hiện tượng theo đồ thị hình bên (số liệu tính theo đơn vị mol).Giá trị của x là :

0 00

1 3 +

B

N Ầ TR

H

G N Ư

A. 0,45(mol) B. 0,42(mol) C. 0,48(mol) D. 0,60(mol) Câu 10. Sục CO2 vào 200 ml dung dịch X gồm Ba(OH)2 1M và NaOH 1M. Sau phản ứng thu được 19,7 gam kết tủa.Trong các đồ thị hình vẽ dưới đây.Đồ thị nào thể hiện đúng theo kết quả của thí nghiệm trên (số liệu tính theo đơn vị mol):

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

A.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

UY

B. B.

C.

P Ấ C

A.

I Ồ B

Ỡ Ư D

NG

N Á O

-L

Í-

C.

H

N

2+

D. Câu 11. Cho 8,96 lít khí CO2 (ở đktc) hấp thụ hết vào 500 ml dung dịch chứa hỗn hợp KOH 0,24M và Ba(OH)2 0,48M.Trong các đồ thị sau,trường hợp nào thể hiện đúng quá trình thí nghiệm trên (số liệu tính theo đơn vị mol).

A Ó H

0 1 3

B 00

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N Ơ H

D. Câu 12. Cho KOH vào dung dịch chứa ZnCl2 ta thấy hiện tượng thi nghiệm theo hình vẽ bên. (số liệu tính theo đơn vị mol).Giá trị x là :

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

A. 0,3 B. 0,4 C. 0,2

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 0,25 Câu 13. Cho KOH vào dung dịch chứa ZnCl2 ta thấy hiện tượng thi nghiệm theo hình vẽ bên. (số liệu tính theo đơn vị mol).Giá trị x là :

UY

A. 3,4 B. 3,2 C. 2,8 D. 3,6 Câu 14. Cho NaOH vào dung dịch chứa ZnCl2 ta thấy hiện tượng thi nghiệm theo hình vẽ bên. (số liệu tính theo đơn vị mol).Giá trị x là :

2

A. 0,32 B. 0,42 C. 0,35 D. 0,40 Câu 15. Cho NaOH vào dung dịch chứa ZnSO4 ta thấy hiện tượng thi nghiệm theo hình vẽ bên.(số liệu tính theo đơn vị mol) .Giá trị x là :

A. 0,5 B. 0,4 C. 0,6 D. 0,7

I Ồ B

Ỡ Ư D

NG

N Á O

-L

H Í

ÓA

G N Ư

O Ạ Đ

.Q P T

N

Tổng giá trị của (a + b) là A. 1,4. B. 1,6. C. 1,2. D. 1,3. Câu 17. Khi nhỏ từ từ đến dư dung dịch KOH vào dung dịch hỗn hợp gồm a mol HCl và b mol ZnCl2, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

0 00

P Ấ C

N Ơ H

Câu 16. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch hỗn hợp gồm a mol HCl và b mol ZnCl2, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

1 3 +

B

N Ầ TR

H

Tỷ lệ a : b là A. 3 : 2. B. 2 : 3. C. 1 : 1. D. 2 : 1. Câu 18. Khi nhỏ từ từ đến dư dung dịch KOH vào dung dịch hỗn hợp gồm a mol HCl và x mol ZnSO4, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Giá trị gần nhất của a : x là A. 0,3. B. 0,4. C. 0,5. D. 0,6. Câu 19. Khi nhỏ từ từ đến dư dung dịch KOH vào dung dịch AlCl3,kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol).Giá trị của x là :

A. 0,12 B. 0,14 C. 0,15 D. 0,20 Câu 20. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3,kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol).Giá trị của x là :

-

A Ó H

P Ấ C

2

A. 0,412 B. 0,456 C. 0,515 D. 0,546 Câu 21. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3,kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol).Giá trị của x là :

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

N Ơ H

A. 0,412 B. 0,426 C. 0,415 D. 0,405 Câu 22. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

UY

H

Giá trị của x là A. 0,18. B. 0,17. C. 0,16. D. 0,15. Câu 23. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol).Giá trị của x là :

0 00

1 3 +

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N

B

A. 0,80 B. 0,84 C. 0,86 D. 0,82

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 24. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol).Biểu thức liên hệ giữa x và y là :

UY

0 00

Tỷ lệ x : y là A. 7 : 8. B. 6 : 7. C. 5 : 4. D. 4 : 5. Câu 26. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch hỗn hợp gồm a mol HCl và b mol AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau :

Tỉ lệ a : b là A. 4 : 3 B. 2 : 3 C. 1 : 1 D. 2 : 1.

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

2

O Ạ Đ

.Q P T

N

Tỉ số x : y có giá trị gần nhất với A. 0,35. B. 0,25. C. 0,65. D. 0,15. Câu 28. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch hỗn hợp gồm a mol H2SO4 và b mol AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau:

A. 3y – x = 1,44 B. 3y – x = 1,24 C. 3y + x = 1,44 D. 3y + x = 1,24 Câu 25. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

P Ấ C

N Ơ H

Câu 27. Khi nhỏ từ từ đến dư dung dịch HCl vào dung dịch hỗn hợp gồm x mol Ba(OH)2 và y mol Ba[Al(OH)4]2 (hoặc Ba(AlO2)2), kết quả thí nghiệm được biểu diễn trên đồ thị sau:

1 3 +

B

N Ầ TR

H

G N Ư

Tỉ lệ a : b có giá trị gần nhất với A. 1,50. B. 1,35. C. 0,75. D. 0,65. Câu 29. Hòa tan hoàn toàn m gam hỗn hợp X gồm Al, Al2O3 và K2O trong nước dư thu được dung dịch Y và 3,36 lít khí (đktc). Nhỏ từ từ dung dịch HCl vào Y thấy lượng kết tủa biến thiên theo đồ thị (hình vẽ ):

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Giá trị của m gần nhất với

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. 18,2. B. 20,4. C. 17,9. D. 19,1. Câu 30. Cho hỗn hợp kim loại gồm x mol Na và y mol Ba vào nước dư được V lít H2 (đktc) và dung dịch X. Khi cho CO2 hấp thụ từ từ đến dư vào dung dịch X, kết quả thí nghiệm được biểu diễn trên đồ thị sau:

UY

B.

C. Tỉ lệ x : y là: A. 2:1. B. 1:3. C. 1:1. D. 1:2. Câu 31. Khi nhỏ từ từ dung dịch NaOH đến dư vào dung dịch AlCl3, kết quả thí nghiệm được biểu diễn theo đồ thị bên (số mol các chất tính theo đơn vị mol).Tính giá trị của x?

A Ó H

P Ấ C

2

A. 0,82 B. 0,80 C. 0,78 D. 0,84 Câu 32. Phản ứng hoá học giữa khí cacbonic với vôi tôi là cơ sở sử dụng vữa vôi trong xây dựng. Tuy nhiên, khi lượng cacbonic quá nhiều công trình sẽ không bền vững vì tạo ra sản phẩm Ca(HCO3)2. Cho khí CO2 tác dụng với dung dịch chứa a mol Ca(OH)2. Đồ thị nào sau đây biểu diễn mối quan hệ giữa số mol Ca(HCO3)2 với số mol CO2?

A.

D I BỒ

ƯỠ

NG

N Á O

Í -L

-

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

D. Câu 33. Rót từ từ dung dịch HCl vào một dung dịch A, thấy số mol kết tủa thu được phụ thuộc số mol HCl như đồ thị sau:

1 3 +

0 00

B

Dung dịch A có thể chứa A. NaOH và NaAl(OH)4. B. Na2Zn(OH)4. C. AgNO3. D. NaOH và Na2Zn(OH)4. Câu 34. Hòa tan hoàn toàn 11,2 gam CaO và H2O thu được dung dịch A. Sục khí CO2 vào dung dịch A, qua quá trình khảo sát người ta lập đồ thị của phản ứng như sau:

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Giá trị của x là A. 0,04. B. 0,05. C. 0,025. D. 0,2. Câu 35.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Do vậy khi tăng lượng CO2 sẽ có phản ứng làm giảm kết tủa

Câu 9: D n↓ max = nCa2+ = a → nCa(OH)2 = a

Nhỏ từ từ đến dư KOH vào dung dịch hỗn hợp gồm x mol ZnSO4 và y mol H2SO4 ta quan sát hiện tượng theo đồ thị hình bên (số liệu tính theo đơn vị mol). Giá trị của x : y gần nhất với A. 2,5. B. 5,0. C. 1,25. D. 3,75.

O Ạ Đ

Ta có 2a = nCa(OH)2 + nKOH → nKOH = 2a - a = a mol. ∑nOH- = 3 → 2a + a = 3 → a = 1 → x = 0,6 Câu 10: A Câu 11: D Câu 12: C Giả sử số mol của ZnCl2 lần lượt là a

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

N Ầ TR

H

G N Ư

.Q P T

N

Ta có: Zn2+ + 2OH- → Zn(OH)2↓

Câu 1: A Câu 2: B Câu 3: C Câu 4: D Câu 5: A Câu 6: C

B

---a-------2a--------------a

0 00

P Ấ C

Khi kết tủa tan hết thì chỉ có muối hidrocacbonat tức là lượng CO2 phản ứng cũng chính bằng số mol OH-

A Ó H

Khi lượng kết tủa bắt đầu giảm tức là CO2 đã phản ứng với OH- tạo a mol BaCO3 và còn lại là muối hirdocacbonat

Câu 7: A Câu 8: D

UY

Ỡ Ư D

NG

N Á O

-L

Í-

T

2

1 3 +

Zn(OH)2 + 2OH- → ZnO22- + 2H2O a---------2a

Vậy ∑nOH- = 4a = 3 → a = 0,75 mol. Tại thời điểm n↓ = x mol thì nOH- = 0,75 x 4 - 2x = 2,6 → x = 0,2 Câu 13: B Giả sử số mol của ZnCl2 là a Zn2+ + 2OH- → Zn(OH)2↓ a---------2a---------a Zn(OH)2 + 2OH- → ZnO22- + 2H2O a----------2a ∑nOH- = 4a = 4 → a = 1.

Ta thấy lượng kết tủa cao nhất và không đổi trong khoảng CO2 từ 0,15 đến 0,45 nên

I Ồ B

Khi CO2 được 0,45 mol thì trong dung dịch chứa

Sưu tầm bởi GV. Nguyễn Thanh Tú

Tại thời điểm x mol OH- thì n↓ = 0,4 → x = 4 - 0,4 x 2 = 3,2 mol Câu 14: D Tại 1,3 mol NaOH chưa xảy ra sự hào tan kết tủa → nZn(OH)2 = 0,3 : 2 = 0,15 mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Tại 1,3 mol NaOH thu được 0,15 mol kết tủa và xảy ra sự hòa tan kết tủa → nAl(OH)3 = nOH- : 3 = 0,24 : 3 = 0,08 mol → 4nZnCl2 = nNaOH + 2.n↓ → nZn(OH)2 = (1,3 + 2.0,15) : 4 = 0,4 mol Khi thêm 0,64 mol OH- vào AlCl3 xảy ra sự hòa tan kết tủa Câu 15: C Câu 16: C Khi kết tủa cực đại rồi tan 1 phần, lượng OH- phản ứng là

→ 4nAlCl3 = nAl(OH)3 + nOH- → nAlCl3=

= 0,18 mol

UY

.Q P T

N

Câu 23: D Khi cho 0,42 mol NaOH vào AlCl3 chưa xảy ra sự hòa tan kết tủa → nAl(OH)3 = 0,42 : 3= 0,14 mol

O Ạ Đ

Tại x mol NaOH thu được 0,14 mol kết tủa và xảy ra sự hòa tan kết tủa → 4nAlCl3= nNaOH + n↓ Câu 17: C

G N Ư

→ x = 4. 0,24 - 0,14 = 0,82 mol Câu 24: C Câu 25: B

B

N Ầ TR

H

Lượng kết tủa lớn nhất là

Câu 18: B Khi nhỏ từ từ đến dư dung dịch KOH vào dung dịch hỗn hợp gồm a mol HCl và x mol ZnSO4 thì KOH tham gia phản ứng hết với HCl trước, sau đó mới phản ứng với ZnSO4 → nHCl = a= 0,25 mol Nhận thấy ở thời điểm 0,45 mol và 2,45 mol KOH thì lượng kết tủa thu được là như nhau

→ tại 0,45 mol KOH chưa xảy ra kết tủa → n↓ =

= 0,1 mol

-H

Tại 2,45 mol KOH xảy ra sự hòa tan kết tủa →4nZnSO4 = (nOH--nHCl )+ 2.n↓

→ nZnSO4 = x=

= 0,6

→ a: x= 0,25: 0,6 = 0,416 Câu 19: C Câu 20: B Câu 21: D Câu 22: A Nhận thấy n↓ max = nAlCl3

I Ồ B

G N Ỡ

TO

ÁN

Í

-L

ÓA

P Ấ C

Khi cho 0,24 mol OH- hoặc 0,64 mol OH- vào cùng lượng dung dịch AlCl3 đều thu được lượng kết tủa như nhau

2

1 3 +

0 00

Khi kết tủa tan trở lại 1 phần là 0,5a, lượng OH- phản ứng là

Câu 26: A Tại thời điểm nNaOH = 0,8 mol bắt đầu xuất hiện kết tủa → nHCl = a = 0,8 mol. Tại thời điểm nNaOH = 2,0 mol và 2,8 mol đều thu được 0,4 mol Al(OH)3 Al3+ + 3OH- → Al(OH)3 b-------------3b------------b Al(OH)3 + OH- → AlO2- + 2H2O (b-0,4)-------(b-0,4) nOH- = 3b + (b - 0,4) = 2,8 - 0,8 → b = 0,6. a : b = 0,8 : 0,6 = 4 : 3 Câu 27: A

Khi thêm vào 0,24 mol OH- vào AlCl3 thì chưa xảy ra sự hòa tan kết tủa

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Sau khi dùng hết 2a mol CO2 thì số mol Ca(HCO3)2 mới đạt cực đại

Câu 33: A Từ đồ thị thấy sau 1 khi thêm 1 lượng HCl mới xuất hiện kết tủa → chứng tỏ dung dịch A phải chứa dung dịch kiềm → loại C,B

UY

Khi kết tủa đạt cực đại số mol HCl phản ứng là

.Q P T

N

Nhận thấy từ điểm xuất hiện kết tủa cực đại đến khi kết tủa bị hòa tan hoàn toàn thì lượng HCl cần thêm vào tỉ lệ theo tỉ lệ 1 : 4 → chứng tỏ A chứa NaAl(OH)4

Khi kết tủa tan 1 phần đến khi còn lại 0,2 mol thì lượng HCl phản ứng là:

O Ạ Đ

Các phương trình phản ứng : NaOH + HCl → NaCl + H2O HCl + NaAl(OH)4 → NaCl + Al(OH)3 + H2O

Câu 28: D

G N Ư

4HCl + NaAl(OH)4 → NaCl + AlCl3 + 4H2O

H

Câu 34: C Câu 35: B Khi cho KOH vào dung dịch thì KOH phản ứng với H2SO4 trước, sau đó mới phản ứng với ZnSO4

Khi kết tủa tan 1 phần đến còn 0,4 mol

0 00

B

N Ầ TR

→ 2y = 0,25 → y = 0,125 mol

Câu 29: D

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

Tại 0,45 mol và 2,45 mol OH- đều thu được lượng kết tủa như nhau

→ Tại 0,45 mol OH- thì ZnSO4 dư →nZn(OH)2 =

= 0,1 mol

Tại 2,45 mol OH- xảy ra sự hòa tan kết tủa → 4nZnSO4 = (nNaOH - 2nH2SO4) + 2nZn(OH)2

→x=

= 0,6

→ x : y = 0,6 : 0,125 = 4,8.

Câu 30: C Câu 31: A Câu 32: B Chú ý câu hỏi đồ thị biểu diễn mối quan hệ giữa số mol Ca(HCO3)2 với số mol CO2

Ỡ Ư D

NG

T

CO2 + Ca(OH)2 → CaCO3 + H2O (1)

I Ồ B

CO2 + CaCO3 + H2O → Ca(HCO3) (2)2 Như vậy sau khi xảy ra (1) hết a mol CO2 mới sinh ra Ca(HCO3)2

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

14. Bài tập có sử dụng Bảng - Biểu đồ - Hình vẽ (Đề 1)

UY

Câu 1. Cho X, Y, Z, T là các chất khác nhau trong số 4 chất: CH3OH, HCHO, HCOOH, NH3 và các tính chất được ghi trong bảng sau: Chất X Y Z T 64,7 -19,0 100,8 -33,4 Nhiệt độ sôi( 0 C ) pH(dung dung dịch nồng độ 0,001M)

7,00

7,00

3,47

10,12

Nhận xét nào sau đây đúng ? A. Y là NH3. B. Z là HCOOH. C. T là CH3OH. D. X là HCHO. Câu 2. Cho hình vẽ mô tả thí nghiệm điều chế khí Cl2 từ MnO2 và dung dịch HCl:

A Ó H

Để lượng kết tủa không đổi thì thể tích dung dịch Ba(OH)2 nhỏ nhất cần dùng là A. 0,24 lít B. 0,30 lít C. 0,32 lít D. 0,40 lít Câu 4. Xét các nguyên tử các nguyên tố X, Y, Z, T. Bán kính nguyên tử của các nguyên tử các nguyên tố đó tăng theo thứ tự: X, Z, Y, T. Vị trí tương đối của chúng trong bảng tuần hoàn là

P Ấ C

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-

0 00

31

2+

Khí Cl2 đi ra thường lẫn hơi nước và hiđro clorua. Để thu được khí Cl2 khô thì bình (1) và bình (2) lần lượt đựng A. Dung dịch NaOH và dung dịch H2SO4 đặc. B. Dung dịch H2SO4 đặc và dung dịch NaCl. C. Dung dịch H2SO4 đặc và dung dịch AgNO3 D. Dung dịch NaCl và dung dịch H2SO4 đặc. Câu 3. Nhỏ từ từ dung dịch Ba(OH)2 0,5M vào ống nghiệm chứa V lít dung dịch Al2(SO4)3 x mol/lit. Quá trình phản ứng được biểu diễn trên đồ thị sau:

Í -L

G N Ư

O Ạ Đ

.Q P T

N

A.

B

N Ầ TR

Z T

H

X Y

B.. Y T

X Z

C.. X Y

Z T

D.. Z X

T Y

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 5. Thực hiện 2 thí nghiệm theo hình vẽ sau. Ở thí nghiệm nào có kết tủa xuất hiện trước?

Câu 8. Màu trong các ô 1, 2, 3, 4, 5 lần lượt là: Qùy tím pH ≤ 6 (1) Phenolphtalêin pH ≤ 8,3 (4) A. đỏ, tím, xanh, không màu, hồng. B. xanh, đỏ, không màu, hồng, không màu. C. đỏ, xanh, tím, hồng, không màu. D. đỏ, xanh, không màu, không màu, hồng. Câu 9. Làm thí nghiệm như hình vẽ:

A. TN1 có kết tủa xuất hiện trước. B. TN2 có kết tủa xuất hiện trước. C. Kết tủa xuất hiện đồng thời. D. Không có kết tủa xuất hiện. Câu 6. Có 3 xilanh kín, nạp vào mỗi xilanh cùng 1 lượng NO2, giữ cho 3 xilanh cùng ở nhiệt độ phòng và di chuyển pittông của 3 xilanh như hình vẽ. Hỏi ở xilanh nào hỗn hợp khí có màu đậm nhất?

A. Xilanh 2 B. Xilanh 1 C. Xilanh 3 D. Cả 3 có màu như nhau Câu 7. Cho dung dịch AgNO3 vào 4 ống nghiệm chứa NaF, NaCl, NaBr, NaI. ?

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

T

P Ấ C

2

H

UY

O Ạ Đ

N Ơ H

pH ≥ 8 (3) pH ≥ 8,3 (5)

.Q P T

N

Hiện tượng xảy ra trong ống nghiệm 1 là: A. có bọt khí. B. có kết tủa. C. không có hiện tượng gì. D. có bọt khí và kết tủa. Câu 10. Cho các chất sau: axit etanoic; etanal; etanol; etan. Nhiệt độ sôi của các chất được biểu diễn như sau:

0 00

1 3 +

N Ầ TR

G N Ư

pH=7 (2)

B

Chất (1) là A. Etanal B. Etan C. Etanol D. Axit etanoic

Hiện tượng xảy ra trong các ống 1,2,3,4 là: A. Không có hiện tượng, có kết tủa trắng, có kết tủa vàng, có kết tủa vàng đậm. B. Có kết tủa trắng, có kết tủa vàng, có kết tủa vàng đậm, không có hiện tượng. C. Không có hiện tượng, có kết tủa trắng, có kết tủa vàng đậm, có kết tủa vàng. D. Không có hiện tượng, có kết tủa trắng, có kết tủa trắng, không có hiện tượng.

I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 11. Cho thí nghiệm như hình vẽ sau:

UY

Phản ứng xảy ra trong ống nghiệm nằm ngang là: A. Zn + 2HCl → ZnCl2 + H2 B. H2 + S → H2S C. H2S + Pb(NO3)2 → PbS↓ + 2HNO3 D. 2HCl + Pb(NO3)2 → PbCl2↓ + 2HNO3 Câu 12. Cho hình vẽ sau:

Hiện tượng xảy ra trong bình eclen chứa Br2: A. Có kết tủa xuất hiện B. Dung dịch Br2 bị mất màu C. Vừa có kết tủa vừa mất màu dung dịch Br2 D. Không có phản ứng xảy ra Câu 13. Cho hình vẽ thí nghiệm dùng để phân tích hợp chất hữu cơ.

I Ồ B

Ỡ Ư D

G N Ư

O Ạ Đ

.Q P T

N

A. 30,45% B. 34,05% C. 35,40% D. 45,30% Câu 15. Sục CO2 vào dung dịch Ba(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Giá trị của x là :

0 00

NG

N Ơ H

D. Xác định C và S. Câu 14. Sục CO2 vào 200 gam dung dịch Ca(OH)2 ta quan sát hiện tượng theo đồ thị hình bên(số liệu tính theo đơn vị mol).Nồng độ % chất tan trong dung dịch sau phản ứng là :

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

A. 1,8(mol) B. 2,2(mol) C. 2,0(mol) D. 2,5(mol) Câu 16. (Đề NC) Dung dịch X chứa a mol Ba(OH)2. Cho m gam NaOH vào X sau đó sục từ từ đến dư CO2 vào ta thấy lượng kết tủa biên đổi theo đồ thị:

T

Hãy cho biết thí nghiệm bên dùng để xác định nguyên tố nào trong hợp chất hữu cơ. A. Xác định C và H. B. Xác định H và Cl. C. Xác định C và N.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Giá trị của (a + m) là A. 20,8. B. 20,5. C. 20,4. D. 20,6. Câu 17. Cho KOH vào dung dịch chứa ZnCl2 ta thấy hiện tượng thi nghiệm theo hình vẽ bên. (số liệu tính theo đơn vị mol).Giá trị x là :

UY

A. 3,4 B. 3,2 C. 2,8 D. 3,6 Câu 18. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch hỗn hợp gồm a mol HCl và b mol ZnCl2, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

-L

H Í

ÓA

P Ấ C

2

I Ồ B

Ỡ Ư D

NG

N Á O

N

Giá trị của x là A. 0,18. B. 0,17. C. 0,16. D. 0,15. Câu 20. Khi nhỏ từ từ đến dư dung dịch KOH vào dung dịch hỗn hợp chứa AlCl3 và HCl, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

0 00

1 3 +

Tổng giá trị của (a + b) là A. 1,4. B. 1,6. C. 1,2. D. 1,3. Câu 19. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau (số liệu tính theo đơn vị mol):

O Ạ Đ

.Q P T

N Ơ H

B

N Ầ TR

H

G N Ư

Tỷ lệ x : a là A. 4,8. B. 5,0. C. 5,2. D. 5,4. Câu 21. Khi nhỏ từ từ đến dư dung dịch HCl vào dung dịch hỗn hợp gồm x mol Ba(OH)2 và y mol Ba[Al(OH)4]2 (hoặc Ba(AlO2)2), kết quả thí nghiệm được biểu diễn trên đồ thị sau:

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Tỉ số x : y có giá trị gần nhất với A. 0,35.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 0,25. C. 0,65. D. 0,15. Câu 22. Hình bên minh họa cho thí nghiệm xác định sự có mặt của C và H trong hợp chất hữu cơ. Chất X và dung dịch Y (theo thứ tự) là:

A. CaO, H2SO4 đặc. B. Ca(OH)2, H2SO4 đặc. C. CuSO4 khan, Ca(OH)2. D. CuSO4.5H2O, Ca(OH)2. Câu 23. Khi nhỏ từ từ đến dư dung dịch NaOH vào dung dịch hỗn hợp gồm a mol H2SO4 và b mol AlCl3, kết quả thí nghiệm được biểu diễn trên đồ thị sau:

A Ó H

P Ấ C

2

Ư D I Ồ B

G N Ỡ

N Á O

T

Nguyên nhân gây nên hiện tượng đó là

Sưu tầm bởi GV. Nguyễn Thanh Tú

-

1

4 giọt

8 giọt

1 giọt

2 3

12 giọt 8 giọt

0 giọt 4 giọt

1 giọt 1 giọt

O Ạ Đ

.Q P T

UY

13 giọt 13 giọt 13 giọt

N t1 t2 t3

Bằng đồng hồ bấm giây, người ta đo khoảng thời gian từ lúc bắt đầu trộn dung dịch đến khi xuất hiện kết tủa, đối với kết quả ở ba ống nghiệm 1, 2, 3 người ta thu được ba giá trị t1, t2, t3. Khẳng định nào sau đây đúng? A. t1 > t2 > t3 B. t1 < t2 < t3 C. t1 > t3 > t2 D. t1 < t3 < t2 Câu 26. Điện trở suất đặc trưng cho khả năng cản trở dòng điện. điện trở suất càng lớn thì khả năng dẫn điện của kim loại càng giảm. X, Y, Z, T là một trong 4 kim loại: Ag, Al, Fe, Cu. Cho bảng giá trị điện trở suất của các kim loại như sau X Y Z T Kim loại Điện trở suất ( Ω m) 2,82. 10−8 1,72. 10−8 1,00. 10−7 1,59. 10−8

0 00

1 3 +

Tỉ lệ a : b có giá trị gần nhất với A. 1,50. B. 1,35. C. 0,75. D. 0,65. Câu 24. Khí hiđro clorua là chất khí tan rất nhiều trong nước tạo thành dung dịch axit clohiđric. Trong thí nghiệm thử tính tan của khí hiđroclorua trong nước, có hiện tượng nước phun mạnh vào bình chứa khí như hình vẽ mô tả dưới đây:

Í -L

N Ơ H

A. Do khí HCl tác dụng với nước kéo nước vào bình. B. Do HCl tan mạnh làm giảm áp suất trong bình. C. Do trong bình chứa khí HCl ban đầu không có nước. D. Do HCl là khí nặng hơn không khí nhưng dễ bay hơi. Câu 25. Dùng ba ống nghiệm đánh số 1, 2, 3 cho hóa chất vào các ống nghiệm theo bảng sau: Ống nghiệm Thể tích chung Thời gian kết tủa Na2 S 2O3 H 2O H 2 SO4

B

N Ầ TR

H

G N Ư

Y là kim loại A. Ag. B. Cu. C. Al. D. Fe. Câu 27. Khí X ở hình vẽ bên là

A. Hidro clorua (HCl). B. Metylamin (CH3NH2). C. Amoniac (NH3). D. Cacbonic (CO2). Câu 28. Hình ảnh mô tả quá trình ăn mòn điện hóa:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com A. C2H5OH, CH3CHO, CH3COOH. B. CH3CHO, C2H5OH, CH3COOH. C. CH3CHO, CH3COOH, C2H5OH. D. CH3COOH, C2H5OH, CH3CHO.

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

O Ạ Đ

UY

.Q P T

N Ơ H

N

Câu 1: B T là NH3 do có tính bazo, Z là HCOOH do có tính axit. Vì CH3OH có liên kết hidro liên phân tử nên nhiệt độ sôi cao hơn HCHO -> X là CH3OH, Y là HCHO

Nhận định nào sau đây là đúng ? A. Thanh Zn đóng vai trò là anot, xảy ra quá trình oxi hóa. B. Thanh Cu đóng vai trò là catot, xảy ra quá trình oxi hóa. C. Thanh Zn đóng vai trò là catot, xảy ra quá trình quá khử. D. Thanh Cu đóng vai trò là anot, xảy ra quá trình khử. Câu 29. Khi sục từ từ đến dư CO2 vào dung dịch có chứa 0,1 mol NaOH, x mol KOH và y mol Ba(OH)2. Kết quả thí nghiệm thu được biểu diễn trên đồ thị sau:

H

G N Ư

Câu 2: D 1, Làm khô luôn là bước cuối cùng nên loại B, C 2,

0 00

B

N Ầ TR

NaCl giúp hấp thụ HCl do HCl tan tốt trong nước. Cl2 ít tan trong nước do phương trình trên, có NaCl thêm Cl-> cân bằng chuyển dịch theo chiều nghịch -> Cl2 tan ít.

Giá trị của x, y, z lần lượt là

A. 0,6; 0,4 và 1,5 B. 0,2; 0,6 và 1,25 C. 0,3; 0,3 và 1,2 D. 0,3; 0,6 và 1,4 Câu 30. Cho đồ thị biểu diễn nhiệt độ sôi của một số chất sau:

D I BỒ

ƯỠ

NG

N Á O

T

Chất A, B, C lần lượt là

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

2+

31

Thêm nữa NaOH tác dung với Cl2 nên loại A

Câu 3: D Khối lượng kết tủa cuối cùng chính là BaSO4: 0,15 mol. Khi đó Ba 2+ dư, SO4 2- hết

Để lượng kết tủa k đổi thì Al(OH)3 vừa tan hết, khi đó

Câu 4: B Ta thấy trong 1 nhóm, bán kính nguyên tử tăng dần, trong 1 chu kỳ bk nguyên tử giảm dần theo chiều tăng của đt hạt nhân A thì X < Y < Z < T. B thì X < Z < Y < T. C thì Z < X < T < Y. D thì T < Y < Z < X Câu 5: A Ta thấy tốc độ phản ứng phụ thuộc vào nồng độ, nhiệt độ, diện tích tiếp xúc, áp suất và chất xúc tác.

Ở đây cả 2 phản ứng có cùng lượng axit, vì vậy dung dịch hiện trước -> TN1

nào có nồng độ lớn hơn thì kết tủa xuất

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Đáp án A

N Ơ H

-> 4 là axit etanoic, 2 là ancol etylic, 1 là etanal, 3 là etan

Câu 11: B Ống nghiệm 1: Zn + 2HCl → ZnCl2 + H2 Câu 6: A N2O4 (không màu, k) <=> 2NO2 (màu nâu đỏ, k)

UY

H2 + S (to) → H2S↑

Hình 2 biểu thị việc kéo xi lanh lên nghĩa là làm giảm áp suất của hệ → cân bằng chuyển dịch theo chiều làm tăng số mol khí → màu đậm lên.

Ống nghiệm 2: H2S + Pb(NO3)2 → PbS↓đen + 2HNO3 Câu 12: B Na2SO3 + H2SO4 → Na2SO4 + SO2↑ + H2O

Hình e biểu thị việc nén xi lanh xuống nghĩa là làm tăng áp suất của hệ → cân bằng chuyển dịch theo chiều làm giảm số mol khí → màu nhạt đi.

G N Ư

O Ạ Đ

.Q P T

N

SO2 + Br2 + 2H2O → 2HBr + H2SO4

Câu 7: A AgNO3 + NaF → không phản ứng nên ống nghiệm 1 không có hiện tượng gì. AgNO3 + NaCl → AgCl↓trắng + NaNO3

0 00

AgNO3 + NaBr → AgBr↓vàng + NaNO3 AgNO3 + NaI → AgI↓vàng đậm + NaNO3

Câu 8: A Quỳ tím: pH ≤ 6 → dung dịch có tính axit → quỳ tím chuyển hồng. pH = 7 → dung dịch có môi trường trung tính → quỳ tím không đổi màu. pH ≥ 8 → dung dịch có môi trường bazơ → quỳ tím chuyển màu xanh.

Í-

• Phenolphtalein:

-L

N Ầ TR

H

Do đó, bình eclen chứa dung dịch Br2 bị mất màu Câu 13: A Bông và CuSO4 khan dùng để nhận biết H2O. Nếu có nước CuSO4 sẽ chuyển từ trắng sang xanh -> Xác định H

A Ó H

P Ấ C

2

1 3 +

B

Ca(OH)2 dùng để nhận biết CO2 do phản ứng tạo kết tủa trắng CaCO3 -> Xác định C Câu 14: A Câu 15: C Câu 16: C

Khi kết tủa tan hết thì chỉ có muối hidrocacbonat tức là lượng CO2 phản ứng cũng chính bằng số mol OH-

Khi lượng kết tủa bắt đầu giảm tức là CO2 đã phản ứng với OH- tạo a mol BaCO3 và còn lại là muối hirdocacbonat

pH ≤ 8,3; dung dịch có tính axit hoặc trung tính, bazơ yếu nên phenol phtalein không đổi màu.

N Á O

pH ≥ 8,3 → dung dịch có môi trường bazơ nên phenolphtalein đổi màu hồng Câu 9: A Ống nghiệm (1) có hiện tượng sủi bọt khí: CaC2 + 2H2O → Ca(OH)2 + C2H2↑

NG

Ống nghiệm (2) xuất hiện kết tủa màu vàng:

Ỡ Ư D

T

Câu 17: B Giả sử số mol của ZnCl2 là a

CH≡CH + 2AgNO3 + 2NH3 → AgC≡CAg↓ + 2NH4NO3

I Ồ B

Câu 10: A Trong 4 chất có cùng số C, axit có nhiệt độ sôi cao nhất, r đến ancol (do chúng có lk Hidro), r đến andehit, thấp nhất là ankan (do andehit có M lớn hơn ankan)

Sưu tầm bởi GV. Nguyễn Thanh Tú

Zn2+ + 2OH- → Zn(OH)2↓ a---------2a---------a

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Zn(OH)2 + 2OH- → ZnO22- + 2H2O

N Ơ H

Khi kết tủa đạt cực đại số mol HCl phản ứng là

a----------2a

Khi kết tủa tan 1 phần đến khi còn lại 0,2 mol thì lượng HCl phản ứng là:

UY

∑nOH- = 4a = 4 → a = 1. Tại thời điểm x mol OH- thì n↓ = 0,4 → x = 4 - 0,4 x 2 = 3,2 mol Câu 18: C Vì từ 0,6 mol OH- bắt đầu có kết tủa nên lượng HCl là 0,6 mol tức a=0,6

.Q P T

N

Câu 22: C Để nhận biết sự có mặt H trong trong hợp chất hữu cơ dùng bông tẩm CuSO4 khan, để nhận biết sự có mặt C trong trong hợp chất hữu cơ người ta dẫn sản phẩm cháy qua dung dịch Ca(OH)2

Khi kết tủa cực đại rồi tan 1 phần, lượng OH- phản ứng là C6H12O6 –––to–→ CO2 + H2O

G N Ư

O Ạ Đ

H2O + CuSO4 ( trắng) → CuSO4.5H2O ( xanh)

Câu 19: A Nhận thấy n↓ max = nAlCl3

Khi thêm vào 0,24 mol OH- vào AlCl3 thì chưa xảy ra sự hòa tan kết tủa

→ nAl(OH)3 = nOH- : 3 = 0,24 : 3 = 0,08 mol Khi thêm 0,64 mol OH- vào AlCl3 xảy ra sự hòa tan kết tủa

→ 4nAlCl3 = nAl(OH)3 + nOH- → nAlCl3= Câu 20: C

I Ồ B

H

0 00

G N Ỡ

= 0,18 mol

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

B

Khi kết tủa tan 1 phần đến còn 0,4 mol

Khi cho 0,24 mol OH- hoặc 0,64 mol OH- vào cùng lượng dung dịch AlCl3 đều thu được lượng kết tủa như nhau

Câu 21: A

N Ầ TR

CO2 + Ca(OH)2 → CaCO3 ↓ + H2O Câu 23: D

2

1 3 +

Câu 24: B Khí hidrua clorua tan rất nhiều trong nước làm giảm áp suất trong bình so với áp suất bên ngoài bình. Do sự chênh lệch áp suất khiến nước bị hút vào bình đựng khí. Câu 25: C Câu 26: B Nhận thấy kim loại dẫn điện càng tốt thì điện trở suất càng nhỏ Thứ tự độ dẫn điện của các kim loại sắp xếp theo chiều Ag > Cu > Al > Fe Vậy Z là Ag, T là Cu, Y là Cu, X là Al, Z là Fe

Câu 27: A Nhận thấy khí X làm nước pha quỳ tím chuyển sang đỏ → khí X mang tính axit → loại B, C Khí X phải là khí tan rất tốt trong nước, khi đó do sư chênh lệch áp suất nước trong chậu mới bị hút ngược vào bình chứa khí → loại D

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 28: A Trong ăn mòn điện hóa cực dương là catot (Cu) tại đây xảy ra quá trình khử → B , Dsai Trong ăn mòn điện hóa cực âm là anot (Zn) tại đây xảy ra quá trình oxi hóa → C sai

UY

Câu 29: D Nhận thấy kết tủa cực đại khi toàn bộ Ba2+ đi hết vào BaCO3 → nBa2+ = y= 0,6 mol Khi số mol CO2 là 1,6 mol thì không có lượng kết tủa khi đó xảy ra phương trình CO2 + OH- → HCO3-

→ nOH- = nSO2 = 1,6→ 0,1+ x + 2y =1,6 → x = 0,3 Khi số mol kết tủa là 0,2 mol thì xảy ra hiện tượng hòa tan kết tủa khi đó nOH-- n↓= nCO2 → 1,6-0,2= 1, 4 =z

Câu 30: B Nhận thấy CH3COOH và C2H5OH đều là hợp chất chứa liên kết hidro nên có nhiệt độ sôi cao hơn hợp chât không có chứa liên kết hidro CH3CHO Trong COOH có chứa nhóm CO làm tăng mật độ điện tích âm trên nguyên tố O → làm bền liên kết hidro nên ts(CH3COOH) > ts (C2H5OH) Vậy ts(CH3COOH) > ts (C2H5OH) > ts (CH3CHO).

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

15. Hoá học với vấn đề Kinh tế – Xã hội – Môi trường (Đề 1)

Câu 1. (Đề NC) Chất khí X được dùng để tẩy trắng giấy và bột giấy, chất chống nấm mốc lương thực, thực phẩm; chất khí Y gây ra hiện tượng mưa axit; chất khí Z trong y học dùng để chữa sâu răng. X, Y và Z theo thứ tự là A. SO2, NO2, CO2. B. SO2, NO2, O3. C. Cl2, SO2, O3. D. Cl2, NO2, CO. Câu 2. Trong các vấn đề về môi trường, kinh tế, xã hội thì nhận xét nào sau đây không đúng: A. Nguyên nhân gây mưa axi chủ yếu là do SO2 và NO2 B. Nguyên nhân gây hiệu ứng nhà kính là CH4, CO2 và O3,… C. Hiện tượng mù quang hóa là do Ozon và các hợp chất halogen ( flo, clo ) gọi chung là freon gây ra D. Một trong những nguyên nhân làm suy giảm tầng ozon là do sử dụng hợp chất CFC (cloflocacbon) như CCl2F2, CCl3F,…. Câu 3. Nước ngầm thường chứa nhiều ion kim loại độc như Fe2+ dưới dạng muối sắt (II) hiđrocacbonat và sắt (II) hiđroxit. Nước sinh hoạt có chứa Fe2+ ảnh hưởng xấu đến sức khoẻ con người. Dùng phương pháp nào sau đây đơn giản nhất, tiện lợi nhất có thể áp dụng ở quy mô hộ gia đình để làm nước sạch: A. Dùng giàn phun mưa để các ion tiếp xúc với không khí. B. Dùng Na2CO3 C. Phương pháp trao đổi ion. D. Dùng lượng NaOH vừa đủ. Câu 4. Trong phòng thí nghiệm, để xử lí sơ bộ số chất thải ở dạng dung dịch chứa ion Fe3+ và Cu2+ ta dùng lượng dư A. nước vôi trong. B. ancol etylic. C. giấm ăn. D. dung dịch muối ăn. Câu 5. Tỉ lệ số người chết về bệnh phổi do hút thuốc lá gấp hàng chục lần số người không hút thuốc lá. Chất gây nghiện và gây ung thư có trong thuốc lá là A. aspirin. B. moocphin. C. nicotin. D. cafein. Câu 6. Tác nhân chủ yếu gây mưa axit là A. CO và CO2. B. SO2 và NO2. C. CH4 và NH3. D. CO và CH4. Câu 7. Dãy gồm các chất và thuốc đều có thể gây nghiện cho con người là A. Penixilin, parađol, cocain. B. Heroin, seduxen, erythromixin. C. Cocain, seduxen, cafein. D. Ampixilin, erythromixin, cafein.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 8. Cho một số nhận định về nguyên nhân gây ô nhiễm môi trường không khí như sau : (1) Do hoạt động của núi lửa (2) Do khí thải công nghiệp, khí thải sinh hoạt (3) Do khí thải từ các phương tiện giao thông (4) Do khí sinh ra từ quá trình quang hợp cây xanh (5) Do nồng độ cao của các ion kim loại : Pb2+, Hg2+, Mn2+, Cu2+ trong các nguồn nước Những nhận định đúng là : A. (1), (2), (3). B. (2), (3), (5). C. (1), (2), (4). D. (2), (3), (4). Câu 9. Phèn chua được dùng trong ngành công nghiệp thuộc da, công nghiệp giấy, chất cầm màu trong ngành nhuộm vải, chất làm trong nước. Công thức hóa học của phèn chua là: A. Li2SO4.Al2(SO4)3.24H2O. B. Na2SO4.Al2(SO4)3.24H2O. C. K2SO4.Al2(SO4)3.24H2O. D. (NH4)2SO4.Al2(SO4)3.24H2O. Câu 10. Hợp chất nào của canxi được dùng để đúc tượng, bó bột khi gãy xương? A. Thạch cao nung (CaSO4.H2O). B. Thạch cao sống (CaSO4.2H2O). C. Đá vôi (CaCO3). D. Vôi sống (CaO). Câu 11. Quặng sắt manhetit có thành phần là A. FeS2. B. Fe2O3. C. Fe3O4. D. FeCO3. Câu 12. Nhóm những chất khí (hoặc hơi) nào dưới đây đều gây hiệu ứng nhà kính khi nồng độ của chúng trong khí quyển vượt quá tiêu chuẩn cho phép ? A. CH4 và H2O. B. CO2 và O2. C. CO2 và CH4. D. N2 và CO. Câu 13. Trong quả gấc chín rất giàu hàm lượng: A. ete của vitamin A. B. este của vitamin A. C. β-caroten. D. vitamin A. Câu 14. Quặng nào sau đây giàu sắt nhất? A. Pirit sắt. B. Hematit đỏ. C. Manhetit. D. Xiđerit. Câu 15. Thí nghiệm với HNO3 thường sinh ra khí độc NO2. Để hạn chế khí NO2 sinh thoát ra từ ống nghiệm, người ta nút ống nghiệm bằng:

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

(a) Bông khô. (b) bông có tẩm nước. (c) bông có tẩm nước vôi. (d) bông tẩm giấm ăn. Trong 4 biện pháp trên, biện pháp có hiệu quả nhất là A. (c). B. (d). C. (a). D. (b). Câu 16. Các khí là tác nhân chính làm phá hủy tầng ozon, gây hiệu ứng nhà kính, gây mưa axit lần lượt là A. CF2Cl2, CH4, SO2. B. CF2Cl2, CO2, NO2. C. CF2Cl2, CO2, SO2. D. CH4, CO2, SO2. Câu 17. Trong y học, hợp chất nào sau đây của natri được dùng làm thuốc trị bệnh dạ dày A. Na2SO4. B. NaHCO3. C. Na2CO3. D. NaI. Câu 18. Phát biểu nào sau đây không đúng? A. Các anion NO3-, PO43- ,SO42- ở nồng độ cao không gây ô nhiễm môi trường nước. B. Các chất khí gây ô nhiễm không khí là: CO, CO2, SO2, H2S, NOx, CFC... C. Các chất khí gây hiện tượng mưa axit là: NOx, SO2... D. Hiệu ứng nhà kính gây ra do sự tăng nồng độ các khí CO2, CH4, CFC... Câu 19. Phát biểu nào sau đây không đúng ? A. Hóa chất 3-MCPD (3-monoclopropan-1,2-điol) có trong nước tương có thể gây hại cho sức khỏe con người. B. Saccarin (C7H5NO3S) là một loại đường hóa học có giá trị dinh dưỡng cao và độ ngọt gấp 500 lần saccarozơ nên có thể dùng cho người mắc bệnh tiểu đường. C. Dầu mỡ qua sử dụng ở nhiệt độ cao (rán, quay) nếu tái sử dụng có nguy cơ gây ung thư. D. Melamine (công thức C3H6N6) không có giá trị dinh dưỡng trong sữa, ngược lại có thể gây ung thư, sỏi thận. Câu 20. Tác nhân chủ yếu gây mưa axit là A. CO và CH4. B. CO và CO2. C. SO2 và NO2. D. CH4 và NH3. Câu 21. Các khí thải công nghiệp và của các động cơ ô tô, xe máy... là nguyên nhân chủ yếu gây ra mưa axit. Thành phần hóa học chủ yếu trong các khí thải trực tiếp gây ra mưa axit là: A. NO2, CO2, CO. B. SO2, CO, NO2. C. SO2, CO, NO. D. NO, NO2, SO2. Câu 22. Phòng thí nghiệm bị ô nhiễm lượng nhỏ khí Cl2. Phương pháp tốt nhất dùng để loại bỏ khí độc này là A. phun dung dịch KBr. B. để hở lọ đựng dung dịch NH3 đặc. C. phun dung dịch NaOH. D. phun dung dịch Ca(OH)2.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 23. X là một chất khí rất độc, nó gây ra ngạt do kết hợp với hồng cầu tạo ra hợp chất bền, làm cho hồng cầu mất khả năng vận chuyển oxi đến các tế bào. Y là khí gây ra mưa axit, mưa axit là hiện tượng mưa mà nước mưa có độ pH dưới 5,6, gây tác hại rất lớn đến con người và môi trường sống. Hai khí X và Y lần lượt là A. CO2 và NO2. B. CO và SO2. C. CO2 và SO2. D. CO và CO2. Câu 24. Để xử lý sơ bộ nước thải có chứa các ion kim loại nặng, người ta thường sử dụng A. nước clo. B. giấm ăn. C. nước vôi trong. D. ancol etylic. Câu 25. Khí CO2 được coi là ảnh hưởng đến môi trường vì A. tạo bụi cho môi trường. B. làm giảm lượng mưa axit. C. gây hiệu ứng nhà kính. D. rất độc. Câu 26. Cho một số nhận định về nguyên nhân gây ô nhiễm môi trường không khí như sau: (a). Do hoạt động của núi lửa (b). Do khí thải công nghiệp, sinh hoạt (c). Do khí thải từ các phương tiện giao thông (d). Do khí thải từ quá trình quang hợp của cây xanh (e). Do nồng độ cao của các ion kim loại: Pb2+, Hg2+, Mn2+, Cu2+ trong các nguồn nước Số nhận định đúng là: A. 2. B. 3. C. 4. D. 5. Câu 27. Chất khí nào sau đây được tạo ra từ bình chữa cháy và dùng để sản xuất thuốc giảm đau dạ dày? A. N2. B. CO. C. CH4. D. CO2. Câu 28. Trái cây được bảo quản lâu hơn trong môi trường vô trùng. Trong thực tế, người ta sử dụng nước ozon để bảo quản trái cây. Ứng dụng trên dựa vào tính chất nào sau đây? A. Ozon không tác dụng được với nước. B. Ozon là chất khí có mùi đặc trưng. C. Ozon là chất có tính oxi hoá mạnh. D. Ozon trơ về mặt hoá học. Câu 29. Khí X làm đục nước vôi trong và được dùng làm chất tẩy trắng bột gỗ trong công nghiệp giấy. Chất X là A. CO2 B. O3 C. Cl2 D. SO2

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 30. Không khí trong phòng thí nghiệm bị ô nhiễm bởi khí clo. Để khử độc, có thể xịt vào không khí dung dịch nào sau đây? A. Dung dịch H2SO4 loãng. B. Dung dịch NaCl. C. Dung dịch NaOH. D. Dung dịch NH3. Câu 31. Hơi thuỷ ngân rất độc, bởi vậy khi làm vỡ nhiệt kế thuỷ ngân thì chất bột được dùng để rắc lên thuỷ ngân rồi gom lại là A. vôi sống. B. cát. C. muối ăn. D. lưu huỳnh. Câu 32. Phân bón nào sau đây làm tăng độ chua của đất ? A. KCl. B. NH4NO3. C. NaNO3. D. K2CO3. Câu 33. Không nên hút thuốc lá vì tỉ lệ số người chết về bệnh phổi do hút thuốc lá gấp hàng chục lần số người không hút thuốc là. Chất gây nghiện và gây ung thư có trong thuốc lá là A. nicotin B. cafein C. heroin D. moocphin Câu 34. Trước đây CFC được sử dụng làm chất sinh hàn trong các thiết bị làm lạnh, nhưng hiện nay chất này đã bị cấm do gây phá huỷ tầng ozon. Chất sinh hàn trong các thiết bị làm lạnh hiện nay là A. freon B. metan C. tuyết cacbonic D. amoniac Câu 35. Trong y học, hợp chất nào sau đây được dùng làm thuốc trị bệnh dạ dày A. NaCl B. NaHCO3 C. Fe(OH)3 D. Na2CO3 Câu 36. Một mẫu khí thải có chứa CO2, NO2, N2 và SO2 được sục vào dung dịch Ca(OH)2 dư. Trong bốn khí đó, số khí bị hấp thụ là A. 3 B. 4 C. 1 D. 2 Câu 37. Khi đốt cháy than đá, thu được hỗn hợp khí trong đó có khí X (không màu, không mùi, độc). X là khí nào sau đây? A. CO2. B. CO. C. SO2.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. NO2. Câu 38. Khi bị ốm, mất sức, nhiều người bệnh thường được truyền dịch đường để bổ sung nhanh năng lượng. Chất trong dịch truyền có tác dụng trên là A. Glucozơ. B. Saccarozơ. C. Fructozơ. D. Mantozơ. Câu 39. Để khử chua cho đất người ta thường sử dụng chất nào sau đây ? A. Muối ăn B. Thạch cao C. Phèn chua D. Vôi sống Câu 40. Chất được dùng để tẩy trắng giấy và bột giấy trong công nghiệp là A. NO2. B. SO2. C. CO2. D. N2O. Câu 41. Nguyên liệu chính dùng để sản xuất nhôm là A. quặng manhetit. B. quặng boxit. C. quặng đôlômit. D. quặng pirit. Câu 42. Ứng dụng nào sau đây không phải của ozon ? A. Chữa sâu răng B. Tẩy trắng tinh bột, dầu ăn C. Điều chế oxi trong phòng thí nghiệm D. Sát trùng nước sinh hoạt Câu 43. Phát biểu nào sau đây là sai ? A. Clo được dùng để diệt trùng nước trong hệ thống cung cấp nước sạch. B. Amoniac được dùng để điều chế nhiên liệu cho tên lửa. C. Lưu huỳnh đioxit được dùng làm chất chống thấm nước. D. Ozon trong không khí là nguyên nhân chính gây ra sự biến đổi khí hậu. Câu 44. Phát biểu nào sau đây là sai ? A. CFC (freon) giúp bảo vệ tầng Ozon. B. CO2 và CH4 là nguyên nhân gây ra biến đổi khí hậu. C. Amoniac là nguyên liệu dùng để điều chế nhiên liệu cho tên lửa. D. SO2 và NO2 là nguyên nhân chính gây ra mưa axit. Câu 45. Phát biểu nào sau đây là sai ? A. Clo được dùng để diệt trùng nước trong hệ thống cung cấp nước sạch. B. Lưu huỳnh đioxit được dùng làm chất tẩy trắng. C. Amoniac được dùng để điều chế nhiên liệu cho tên lửa. D. Cacbon đioxit trong không khí là nguyên nhân chính gây ra hiện tượng mưa axit. Câu 46. Những nguồn năng lượng nào sau đây là nguồn năng lượng sạch không gây ô nhiễm môi trường? A. Năng lượng hạt nhân, năng lượng mặt trời. B. Năng lượng than đá, dầu mỏ, năng lượng thuỷ lực.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. Năng lượng thuỷ lực, năng lượng gió, năng lượng mặt trời. D. Năng lượng than đá, năng lượng mặt trời, năng lượng hạt nhân. Câu 47. Để làm mềm nước có tính cứng vĩnh cửu có thể dùng dung dịch nào sau đây ? A. CaCl2 B. Na2CO3 C. Ca(OH)2 D. KCl Câu 48. Để loại bỏ lớp cặn trong ấm đun nước lâu ngày, người ta có thể dùng dung dịch nào sau đây? A. Giấm ăn. B. Nước vôi. C. Muối ăn. D. Cồn 700. Câu 49. Một số axit cacboxylic như axit oxalic, axit tactric… gây ra vị chua cho quả sấu xanh. Trong quá trình làm món sấu ngâm đường, người ta sử dụng dung dịch nào sau đây để làm giảm vị chua của quả sấu? A. Nước vôi trong. B. Giấm ăn. C. Phèn chua. D. Muối ăn.

N Ơ H

Fe3+ + 3OH- → Fe(OH)3↓ Cu2+ + 2OH- → Cu(OH)2↓

UY

N

Mặt khác, nước vôi trong dễ kiếm, hiệu quả và rẻ tiền Câu 5: C Nicotin có nhiều trong thuốc là. Nó là chất lỏng sánh như dầu, không màu có mùi thuốc lá, tan được trong nước. Khi hút thuốc lá, nicotin đi vào phổi, thấm vào máu. Nicotin là một trong những chất độc mạnh (từ 1 đến 2 giọt nicotin có thể giết chết một con chó), tính độc của nó có thể sánh với HCN. Nicotin chỉ là một trong số các chất độc hại có trong khói thuốc lá. Dung dịch nicotin trong nước được dùng làm thuốc trừ sâu cho cây trồng. Những người nghiện thuốc lá thường mắc bệnh ung thư phổi và những bệnh ung thư khác.

G N Ư

O Ạ Đ

.Q P T

Câu 6: B Quá trình đốt cháy lưu huỳnh trong khí oxi sẽ sinh ra SO2.

N Ầ TR

SO2 + OH. → HOSO2.

H

HOSO2. + O2 → HO2. + SO3

0 00

B

SO3 (k) + H2O (l) → H2SO4(l)

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B Chất dùng để tẩy trắng giấy, bột giấy là SO2( có thể xem lại trong phần ứng dụng của SO2) Chất khí gây ra hiện tượng mưa axit là NO2;

H Í

chất khí trong y học dùng để chữa sâu răng là O3

-L

ÓA

P Ấ C

2+

31

Đây chính là thành phần chủ yếu của mưa axít.

• 4NO2(k) + 2H2O(l) + O2(k) → 4HNO3 HNO3 chính là thành phần của mưa axít. Câu 7: C A sai vì penixilin, paradol B sai vì erythromixin

Câu 2: C C là phát biểu không đúng, hiện tượng mù quang hóa do nhóm khí quang hóa gây ra gồm: O3;

C đúng

NOx ( các oxit của Nito ), FAN, andehit, etilen,...

D sai vì ampixilin, erythromixin

NG

N Á O

T

các freon gây thủng tầng ozon Câu 3: A Khi đó, oxi không khí sẽ oxi hóa ion Fe2+lên Fe3+=> Không độc hại

I Ồ B

Ỡ Ư D

Câu 4: A Trong phòng thí nghiệm, để xử lí sơ bộ số chất thải ở dạng dung dịch chứa ion Fe3+ và Cu2+ ta dùng lượng dư nước vôi trong:

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 8: A (4) sai vì khí sinh ra từ quá trình quang hợp cây xanh là O2 không gây ô nhiễm môi trường. (5) sai vì nồng độ cao của các ion kim loại: Pb2+, Hg2+, Mn2+ và Cu2+ trong các nguồn nước là nguyên nhân gây ô nhiễm môi trường nước. → Có 3 nhận định đúng là (1), (2), (3) Câu 9: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Muối nhôm có nhiều ứng dụng quan trọng là muối sunfat kép kali và nhôm ngậm nước, trên thị trường có tên là phèn chua. Công thức hóa học là K2SO4.Al2(SO4)3.24H2O, viết gọn là KAl(SO4)2.12H2O.

Khi đó NO2 bị mất hẳn tính độc Câu 16: C Đáp án A sai vì CH4 không phải là tác nhân chính gây hiệu ứng nhà kính.

• Phèn chua được dùng trong ngành thuộc da, công nghiệp giấy (làm cho giấy không thấm nước), chất cầm màu trong công nghiệp nhuộm vải, chất làm trong nước đục ...

Đáp án B sai vì NO2 không phải là tác nhân chính gây mưa axit. Câu 10: A Thạch cao nung (CaSO4.H2O) thường được đúc tượng, đúc các mẫu chi tiết tinh vi dùng trang trí nội thật, làm phấn

Đáp án C đúng.

O Ạ Đ

UY

.Q P T

N Ơ H

N

Đáp án D sai vì CH4 không phải là tác nhân làm phá hủy tấng ozon. viết bảng, bó bột khi gãy xương,..

Câu 17: B Người bị bênh dạ dày là do trong dạ dày có pH nhỏ hơn so với quy định.

Câu 11: C FeS2. pirit sắt

H

G N Ư

Để khỏi bệnh thì người ta phải dùng thuốc có tính bazơ → loại Na2SO4. Fe2O3hematit

N Ầ TR

NaI và Na2CO3 có pH quá cao nên cũng không hợp lí khi cho vào cơ thể người. Fe3O4. : manhetit

NaHCO3 là hợp chất được dùng làm thuốc trị bệnh dạ dày: H+ + HCO3- → CO2 + H2O

0 00

FeCO3xiđerit Câu 12: C Nhóm CO2 và CH4 đều gây ra hiệu ứng nhà kính khi nống độ của chúng trong khí quyển vượt quá tiêu chuẩn cho phép.

P Ấ C

2

- CO: là khí độc. Nếu trong không khí có CO nồng độ khoảng 250 ppm sẽ khiến con người bị tử vong vù ngộ độc.

A Ó H

- CO2: Nếu lượng CO2 tăng quá nhiều sẽ phá vỡ cân bằng tự nhiên, gây hiệu ứng nhà kính.

-

- CH4: Nồng độ trong không khí đạt tới 1,3 ppm thì không khí bị coi là ô nhiễm. CH4 trong không khí góp phần gây nên hiệu ứng nhà kính lám cho Trái Đất bị nóng lên và dẫn theo nhiều vấn đề khác như băng tan. - O2, H2O và N2 không độc.

TO

ÁN

Í -L

1 3 +

B

Câu 18: A Nhận thấy ô nhiễm môi trường nước khi nước chứa các ion của kim loại nặng Pb2+, As3+, Cd2+... và các anion NO3-, PO43- ,SO42- ở nồng độ cao Câu 19: B Saccarin : đường hóa học là loại đường không có giá trị về mặt dinh dưỡng, nếu lượng lớn có thể gây hại cho sức khỏe con người Câu 20: C CH4 và CO2 là các hợp chất chủ yếu gây hiện tượng hiệu ứng nhà kính → Loại A, B, D Các khí gây hiệu ứng mưa axit gồm SO2 và NO2. Câu 21: D Các khí gây hiện tượng mưa axit chủ yếu là hợp chât NxOy và SO2 Câu 22: B Nhận thấy phun dung dịch KBr (NaOH hoặc Ca(OH)2) để loại bỏ Cl2 quy trình đều phức tạp hơn và gây bẩn nhất là với dung dịch nước vôi trong

Câu 13: C Quả gấc chứa dầu màu đỏ của lycopen, với thành phần chủ yếu là β-carotene hay còn gọi là tiền sinh tố A. Khi vào cơ thể sẽ chuyển thành vitamin A Câu 14: C Quặng giàu sắt nhất là quặng: manhetit Fe3O4 với hàm lượng sắt khoảng 72,4% Câu 15: A Biện pháp hiệu quả nhất là (c) bông có tẩm nước vôi vì:

Câu 23: B CO là một khí độc, không màu, không mùi. CO gây ra ngạt do tạo phức với Fe trong hồng cầu tạo ra hợp chất bền, làm cho hồng cầu mất khả năng vận chuyển oxi đến các tế bào → Loại A, C

4NO2 + 2Ca(OH)2 → Ca(NO2)2 + Ca(NO3)2 + 2H2O

CO2 gây hiện tượng hiệu ứng nhà kính, SO2 là khí gây hiệu ứng ra mưa axit. → loại D

D I BỒ

ƯỠ

NG

Sưu tầm bởi GV. Nguyễn Thanh Tú

Để hở lọ đựng dung dịch NH3 là phương pháp đơn giản nhất để loại bỏ Cl2: 3Cl2 + 2NH3 → N2 + 6HCl

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 24: C Hầu hết các hidroxit của các kim loại nặng đều là hợp chất không tan

Câu 33: A Chất gây nghiện và ung thư có trong thuốc lá là nicotin.

Để xử lý sơ bộ nước thải có chứa các ion kim loại nặng, người ta thường sử dụng nước vôi trong tạo các hidroxit không tan, lọc lấy phần dung dịch. Câu 25: C Khí CO2 là nguyên nhân hiệu ứng nhà kính làm nhiệt độ trái đất tăng lên gây lên hiện tượng băng tan, cháy rừng, đất đai thu hẹp ... Câu 26: B Chú ý câu hỏi nguyên nhân gây ô nhiễm môi trường không khí

Câu 34: D Hiện nay, chất sinh hàn trong các tủ lạnh là

0 00

Thuốc giảm đau dạ dày là NaHCO3 → khí X được dùng sản xuất thuốc giảm đau dạ dày là CO2

Câu 29: D Khí X làm đục nước vôi trong → loại Cl2 và O3

H Í

ÓA

2

Khí X được dùng làm tẩy trắng bột gỗ trong công nghiệp giấy → X phải có tính oxi hóa và tẩy màu → loại CO2

-L

Câu 30: D Không khí trong PTN bị ô nhiễm bởi khí clo. Để khử độc, có thể xịt vào không khí dd NH3 vì 2NH3 + 3Cl2 → N2 + 6HCl

G N Ỡ

NH3 + HCl → NH4Cl Câu 31. D Ở nhiệt độ thường, Hg + S → HgS

Ư D I Ồ B

N Á O

T

N Ầ TR

H

G N Ư

Câu 36: A Có 3 khí bị hấp thụ là CO2, NO2 và SO2 Câu 37: B Đáp án A loại vì CO2 không độc.

Câu 27: D Chất khí trong bình chữa cháy phải là chất khí không duy trì sự cháy → loại C, B

P Ấ C

O Ạ Đ

Câu 35: B Trong dạ dày chứa một lượng nhỏ axit HCl, khi bị đau dạ dày thì hàm lượng HCl tăng cao người ta dùng NaHCO3 để trung hòa lượng HCl dư

Nồng độ cao của các ion kim loại: Pb2+, Hg2+, Mn2+, Cu2+ trong các nguồn nước → làm ô nhiễm môi trường nước → (e) sai

bảo quản trái cây

.Q P T

N

Nguyên nhân: Amoniac nặng gần bằng nửa không khí. Sau khi nén và làm lạnh nó sẽ biến thành chất lỏng giống như nước nhưng sôi ở nhiệt độ . Khi bị nén xong, amoniac sẽ bay hơi. Lúc này nó hấp thụ nhiều nhiệt.

Nhận thấy quá trình quang hợp của cây xanh lấy CO2 và sinh ra O2 → không làm ô nhiễm không khí → (d) sai

Câu 28: C Ozon là chất khí có tính oxi hóa mạnh, có tác dụng khử trùng và các chất gây ô nhiễm, từ đó người ta dùng nước ozon để

UY

N Ơ H

1 3 +

B

Đáp án B thỏa mãn.

Đáp án C và D loại vì SO2 và NO2 đều có mùi hắc. Câu 38: A Glucozơ là chất dinh dưỡng có giá trị của con người, nhất là người già và trẻ em vì nó bổ sung năng lượng cho cơ thể rất nhanh. Chất trong dịch truyển có tác dụng trên là glucozơ Câu 39: D Đất bị chua là do đất có tính axit nên khi bón vôi thì xảy ra các phản ứng: CaO + H2SO4 → CaSO4 + H2O CaO + H2O → Ca(OH)2 Fe2(SO4)4 + Ca(OH)2 → 2Fe(OH)3↓ + 3CaSO4 Câu 40: B Chất được dùng để tẩy trắng giấy và bột giấy trong công nghiệp phải là chất có tính oxi hóa mạnh, có khả năng làm mất màu

HgS là chất rất bền, khó tan trong axit nên thu gom lại được dễ dàng Câu 32: B NH4NO3.có gốc axit

Nhận thấy trong 4 đáp án chỉ có SO2 có tính oxi hóa Câu 41: B

sẽ bị thủy phân tạo ra môi trường axit, làm tăng độ chua của đất

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Quặng manhetit : Fe2O3, quặng đolomit : CaCO3.MgCO3, quăng boxit là Al2O3. 2H2O, quặng pirit là : FeS2 Thấy chỉ có quặng boxit mới chứa Al nên được dùng sản xuất nhôm bằng phương pháp điện phân nóng chảy.

UY

Câu 42: C Ozon có tính oxi hóa mạnh nên được dùng tẩy trắng tinh bột, dầu ăn, sát trùng nước sinh hoạt .Ngoài ra ozon còn được dùng để chữa sâu răng. Ozon không được dùng để điều chế O2 vì O2 và O3 đêu ơ thể khí khó tách riêng. Câu 43: D Câu 44: A CFC là hợp chất xúc tác cho quá trình phân hủy tằng ozon → gây phá hủy tầng ozon Câu 45: D Nguyên nhân chính gây hiện tượng mưa axit là hợp chất dạng NxOy và SO2 Câu 46: C Năng lượng sạch là nguồn năng lượng không sinh ra các sản phẩm gây ô nhiễm Nhận thấy năng lượng hạt nhận sinh ra các sản phẩm phóng xạ độc, năng lượng than đá sinh ra CO2 là các sản phẩm gây ô nhiễm môi trường → loại A, B, D Câu 47: B Nguyên tắc làm mềm nước cứng là loại bỏ ion Ca2+, Mg2+ dưới dạng kết tủa Khi thêm Na2CO3 dư thì toàn bộ lượng Ca2+ và Mg2+ kết tủa dưới dạng MgCO3, CaCO3

P Ấ C

Chú ý nước cứng vĩnh cửu không chứa ion HCO3- nên không thể làm mềm nước cứng bằng Ca(OH)2 được Câu 48: A Lớp cặn trong ấm đun nước lâu ngày là hợp chất cacbonat dạng MCO3

Í -L

-

A Ó H

2

1 3 +

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Dùng giấm ăn CH3COOH để hòa tan căn cacbonat thành các muối tan và bị rửa trôi.

N Á O

2CH3COOH + MCO3 → M(CH3COO)2 + 2H2O

Câu 49: A Để làm giảm vị chua của quả sấu và làm quả sấu giòn hơn người ta ngâm sấu với nước vôi trong loãng. Khi đó một phần axit sẽ bị trung hòa bởi Ca(OH)2

Ỡ Ư D

NG

T

R(COOH)n + nOH- → nH2O + R(COO-) n

I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

16. Một số Bài tập HAY - LẠ - KHÓ về Hiđrocacbon (Đề 1)

Câu 1. Hòa tan hết hỗn hợp rắn gồm CaC2, Al4C3 và Ca vào nước thu được 3,36 lít hỗn hợp khí X có tỉ khối với hiđro là 10. Dẫn X qua Ni đun nóng thu được hỗn hợp khí Y. Tiếp tục cho Y vào bình đựng nước brom dư thì có 0,784 hỗn hợp khí Z (tỉ khối với heli là 6,5). Các khí đo ở đktc. Khối lượng bình brom tăng là A. 2,09 B. 3,45 C. 3,91 D. 1,35 Câu 2. Một bình kín chứa 0,07 mol axetilen; 0,09 mol vinylaxetilen; 0,18 mol H2 và một ít bột Ni. Nung hỗn hợp X thu được hỗn hợp Y gồm 7 hiđrocacbon (không có etylaxetilen) có tỉ khối hơi đối với H2 là 21,4375. Cho toàn bộ hỗn hợp Y đi qua bình đựng dung dịch AgNO3/NH3 dư, thu được m gam kết tủa vàng nhạt và 2,24 lít hỗn hợp khí Z (đktc) gồm 5 hiđrocacbon thoát ra khỏi bình. Để làm no hoàn toàn hỗn hợp Z cần vừa đúng 80 ml dung dịch Br2 1M. Các phản ứng xảy ra hoàn toàn. Giá trị của m gần nhất với A. 12,5 B. 11,5 C. 12,0 D. 13,5 Câu 3. Trong một bình kín có chứa khí C2H2 và chất xúc tác Cu2Cl2, NH4Cl. Nung nóng bình một thời gian thu được hỗn hợp khí X chứa 2 hiđrocacbon với hiệu suất phản ứng là 60%. Cho X hấp thụ hết vào dung dịch AgNO3/NH3 thu được 43,11 gam kết tủa. Khối lượng C2H2 ban đấu là A. 5,85 gam. B. 7,8 gam C. 11,7 gam D. 11,75 gam Câu 4. Hỗn hợp X gồm axetilen và vinylaxetilen có tỉ khối hơi đối với H2 là 19,5. Thực hiện phản ứng đime hỗn hợp X thu được 9,36 gam hỗn hợp khí Y (giả sử chỉ xảy ra phản ứng đime axetilen). Cho Y tác dụng với một lượng dư dung dịch AgNO3/NH3 thu được 38,25 gam kết tủa. Hiệu suất phản ứng đime là A. 16,41%. B. 25,00%. C. 32,81%. D. 50,00%. Câu 5. Một bình kín chứa hỗn hợp X gồm 0,06 mol axetilen; 0,09 mol vinylaxetilen; 0,16 mol H2 và một ít bột Ni. Nung hỗn hợp X thu được hỗn hợp Y gồm 7 hiđrocacbon (không chứa etylaxetilen) có tỉ khối hơi đối với H2 là 328/15. Cho toàn bộ hỗn hợp Y đi qua bình đựng dung dịch AgNO3/NH3 dư, thu được m gam kết tủa vàng nhạt và 1,792 lít hỗn hợp khí Z thoát ra khỏi bình. Để làm no hoàn toàn hỗn hợp Z cần vừa đúng 50 ml dung dịch Br2 1M. Các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 28,71 B. 14,37 C. 13,56 D. 15,18 Câu 6. Một hỗn hợp X gồm 0,07 mol axetilen, 0,05 mol vinylaxetilen, 0,1 mol H2 và một ít bột Ni trong một bình kín. Đun nóng bình một thời gian thu được hỗn hợp Y gồm 7 hiđrocacbon có tỉ khối hơi so với H2 là 19,25. Cho toàn bộ hỗn hợp Y qua bình đựng dung dịch AgNO3/NH3 dư, thu được m gam kết tủa màu vàng nhạt và

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

1,568 lít hỗn hợp khí Z (đktc) gồm 5 hiđrocacbon thoát ra khỏi bình. Để làm no hoàn toàn Z cần dùng vừa đúng 60 ml dung dịch Br2 1M. Giá trị của m là: A. 11,97 B. 9,57 C. 16,8 D. 12 Câu 7. Cho m gam hỗn hợp H gồm Al4C3 và CaC2 vào nước dư thu được dung dịch X; a gam kết tủa Y và khí hỗn hợp khí Z. Lọc bỏ kết tủa. Đốt cháy hoàn toàn khí Z rồi dẫn sản phẩm cháy vào dung dịch X thu được thêm a gam kết tủa nữa. Hỏi trong hỗn hợp X, Al4C3 và CaC2 được trộn với tỉ lệ mol thế nào: A. 1: 3 B. 1:1 C. 1:2 D. 2:1 Câu 8. Tiến hành đime hóa 1 mol axetilen thu được hỗn hợp X. Trộn X với H2 theo tỉ lệ 1:2 về số mol rồi nung nóng với bột Ni đến phản ứng hoàn toàn thu được hỗn hợp Y. Y làm mất màu vừa đủ dung dịch chứa 0,15 mol Br2. Hiệu suất phản ứng đime hóa là : A. 70%. B. 15%. C. 85%. D. 30%. Câu 9. Hỗn hợp X gồm 0,15 mol propin, 0,1 mol axetilen, 0,2 mol etan và 0,6 mol H2. Nung nóng hỗn hợp X (xúc tác Ni) một thời gian, thu được hỗn hợp Y có tỷ khối so với H2 bằng M. Cho Y tác dụng với AgNO3 dư trong NH3 thu được kết tủa và 15,68 lít hỗn hợp khí Z (đktc). Sục khí Z qua dung dịch brom dư thấy có 8,0 gam brom phản ứng. Giá trị của m gần nhất với A. 10,0 B. 10,5 C. 9,5 D. 9,0 Câu 10. Trong một bình kín chứa 0,4 mol axetilen; 0,3 mol metylaxetilen; 0,8 mol H2 và một ít bột Ni. Nung nóng bình một thời gian, thu được hỗn hợp khí X có tỉ khối so với H2 bằng 12. Sục khí X vào lượng dư dung dịch AgNO3 trong NH3 đến phản ứng hoàn toàn, thu được m gam hỗn hợp kết tủa và có 10,1 gam hỗn hợp khí Z thoát ra. Hỗn hợp khí Z phản ứng vừa đủ với 0,1 mol Br2 trong CCl4. Giá trị của m là A. 77,40. B. 72,75. C. 86,70. D. 82,05. Câu 11. Hỗn hợp X gồm 0,2 mol axetilen, 0,1 mol but-1-in, 0,15 mol etilen, 0,1 mol etan và 0,85 mol H2. Nung nóng hỗn hợp X (xúc tác Ni) một thời gian, thu được hỗn hợp Y có tỷ khối so với H2 bằng x. Cho Y tác dụng với AgNO3 dư trong NH3 thu được kết tủa và 19,04 lít hỗn hợp khí Z (đktc). Sục khí Z qua dung dịch Brom dư thấy có 8,0 gam brom phản ứng. Giá trị của gần nhất của x là A. 9,0 B. 10,0 C. 10,5 D. 11,0

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 12. Hỗn hợp X gồm các chất C3H6, C2H2, C2H6, C4H10 và H2. Nung nóng m gam X với xúc tác Ni trong bình kín thu được hỗn hợp Y. Đốt cháy hoàn toàn Y cần vừa đủ V lit O2(đktc). Sản phẩm cháy hấp thụ hết vào nước vôi trong dư thu được một dung dịch có khối lượng giảm 17,16 gam. Nếu cho Y đi qua bình đựng lượng dư dung dịch Brom trong CCl4 thì có 19,2 gam brom tham gia phản ứng. Mặt khác cho 0,5 mol hỗn hợp X đi qua bình đựng lượng dư dung dịch Brom trong CCl4 thì có 64 gam brom tham gia phản ứng. Biết các phản ứng xảy ra hoàn toàn. V có giá trị gần với giá trị nào nhất sau đây: A. 17 B. 11,5 C. 8,5 D. 22,4 Câu 13. Hỗn hợp X gồm 0,01 mol etilen ; 0,02 mol axetilen ; 0,01 mol vinylaxetilen và 0,04 mol H2. Đun nóng hỗn hợp X với Ni, sau một thời gian thu được hỗn hợp Y, tỉ khối của Y so với X là 1,6. Lấy toàn bộ Y cho đi từ từ qua dung dịch nước brom dư vơi dung môi là nước, thu được 0,224 lít khí thoát ra ở điều kiện tiêu chuẩn và m gam sản phẩm Z chỉ chứa (C, H, Br). Lấy Z đốt cháy hoàn toàn trong oxi dư, lấy sản phẩm cháy tác dụng với dung dịch AgNO3 dư chỉ thu được 15,04 gam kết tủa. Giá trị của m là A. 7,8 B. 7,78 C. 14,18 D. 9,38 Câu 14. Một bình kín chứa hỗn hợp X gồm hiđro (0,195 mol), axetilen (0,150 mol), vinyl axetilen (0,12 mol) và một ít bột Ni. Nung nóng bình một thời gian, thu được hỗn hợp khí Y có tỉ khối hơi so với hidro bằng 19,5. Khí Y phản ứng vừa đủ với dung dịch chứa 0,21 mol AgNO3 trong NH3, thu được m gam kết tủa và 3,024 lít hỗn hợp khí Z (đktc). Khí Z phản ứng tối đa với 0,165 mol Br2 trong dung dịch. Giá trị của m là A. 55,2. B. 52,5. C. 27,6. D. 82,8. Câu 15. Hỗn hợp X gồm propin (0,15 mol), axetilen (0,1 mol), etan (0,2 mol) và hiđro (0,6 mol). Nung nóng X với xúc tác Ni một thời gian, thu được hỗn hợp khí Y. Sục Y vào dung dịch AgNO3 trong NH3 dư, thu được a mol kết tủa và 15,68 lít (đktc) hỗn hợp khí Z. Khí Z phản ứng tối đa với 8 gam Br2 trong dung dịch. Giá trị của a là A. 0,16. B. 0,18. C. 0,10. D. 0,12. Câu 16. Hỗn hợp X gồm metan, etilen, propin, vinylaxetilen và hiđro. Dẫn X qua Ni nung nóng, sau phản ứng hoàn toàn thu được hỗn hợp Y có tỉ khối so với khí nitơ đioxit là 1. Biết 5,6 lít hỗn hợp Y (đktc) làm mất màu vừa đủ 72 gam brom trong dung dịch. Nếu lấy 5,6 lít hỗn hợp X (đktc) làm mất màu vừa đủ bao nhiêu gam brom trong dung dịch? A. 48 B. 56 C. 60 D. 96 Câu 17. Cho hỗn hợp X gồm Axetilen và Vinylaxetilen có tỉ khối so vơi H2 là 19,5. Lấy 4,48 lít X (đktc) trộn với 0,09 mol H2 rồi cho vào bình kín có sẵn xúc tác Ni, đốt nóng, sau khi các phản ứng xảy ra hoàn toàn thu

I Ồ B

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-H

ÓA

P Ấ C

2

N Ơ H

được hỗn hợp Y chỉ gồm các hiđrocacbon. Dẫn Y qua dung dịch chứa 0,15 mol AgNO3 trong NH3 dư, sau khi AgNO3 hết thu được 20,77 gam kết tủa và có 2,016 lít khí Z (đktc) thoát ra. Z phản ứng tối đa với m gam brom trong dung dịch nước. Giá trị của m là A. 19,2 B. 20,8 C. 22,4 D. 24,0

UY

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A CaC2, Al4C3, Ca

H

G N Ư

khí X ( CH4, C2H2,H2 )

N Ầ TR

Y

0,035 mol Z (MZ = 26)

Nhận thấy mX = mY = mbình tăng + mZ

B

→ 0,15×20 = mbình tăng + 0,035 ×26 → mbình tăng= 2,09 gam

1 3 +

0 00

Câu 2: C Chú ý đề bài cho X gồm 7 hiđrocacbon và sau khi hấp thụ vào AgNO3/NH3 dư khí Z bay ra có 5 hiđrocacbon→ có 2 khí bị hấp thụ bởi AgNO3/NH3 Chất tạo kết tủa với AgNO3/NH3 gồm C2H2 : x mol, CH≡C-CH=CH2 : y mol

Luôn có mX = mY → nY =

= 0,16 mol

Ta có nH2 pư = nliên kết π phá vỡ= nX - nY = 0,07 + 0,09 + 0,18- 0,16 = 0,18 mol Bảo toàn liên kết π có : 2 nC2H2 + 3nC4H4 = nH2 pư + 2x + 3y + nBr2 → 2. 0,07 + 3. 0,09 = 0,18 + 2x + 3y + 2z + 0,08 → 2x + 3y = 0,15 Lại có x+ y = nY - nZ = 0,16- 0,1 = 0,06 Giải hệ → x = y = 0,03 Vậy m↓ = 0,03. 240 + 0,03. 159= 11,97 gam. Câu 3: B C2H2

CH≡C-CH=CH2 + C2H2 dư

Gọi số mol C2H2 ban đầu là x,

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com Luôn có mX = mY → nY =

Với H= 60% nên số mol C4H4 là

Ta có nH2 pư = nliên kết π phá vỡ= nX - nY = 0,07 + 0,05 + 0,1- 0,12 = 0,1 mol Khi tham gia phản ứng với AgNO3/NH3 sinh ra kết tủa chứa CAg≡C-CH=CH2: 0,3x mol; CAg≡ CAg : 0,4 x mol

Bảo toàn liên kết π có : 2 nC2H2 + 3nC4H4 = nH2 pư + 2x + 3y + nBr2

→ 159. 0,3x + 0,4x . 240 = 43,11 → x = 0,3 mol

→ 2. 0,07 + 3. 0,05 = 0,1 + 2x + 3y + 2z + 0,06 → 2x + 3y = 0,13

Vậy ∑ m = 0,3. 26 = 7,8 gam. Câu 4: D Gọi số mol của C2H2 và C4H4 lần lượt là x, y mol.

Lại có x+ y = nY - nZ = 0,12- 0,07 = 0,05

Bảo toàn khối lượng → mX = mY = 9,36 gam

Vậy m↓ = 0,02. 240 + 0,03. 159= 9,57 gam. Câu 7: B Gọi số mol của Al4C3 và CaC2 lần lượt là x, y

Giải hệ → x =0,02 và y = 0,03

Ta có hệ

N Ầ TR

N Ơ H

= 0,12 mol

= 0,2x mol, số mol C2H4 dư là 0,4x

H

G N Ư

O Ạ Đ

.Q P T

UY

N

Hỗn hợp khí Z thu được chứa CH4: 3x mol và C2H2 : y mol Giả sử chỉ có x mol C2H2 tham gia phản ứng đime hóa sau phản ứng sinh ra C2H2 : 0,12-x mol, C4H4: 0,5x + 0,12 mol

0 00

Khi tác dụng với AgNO3/NH3 sinh ra kết tủa chứa CAg≡CAg : 0,12-x mol, C4H3Ag: 0,12 + 0,5x mol → 240.( 0,12-x ) + 159( 0,12 + 0,5x) = 38,25 → x = 0,06 mol

→H= .100% = 50 %. Câu 5: C

G N Ỡ

N Á O

H Í

-L

ÓA

P Ấ C

B

Khi đốt cháy hỗn hợp Z thu được CO2 : 3x + 2y mol

2

T

1 3 +

Vì khi hòa tan H vào nước thu được kết tủa , khi dẫn CO2 vào dung dich X lại thu được kết tủa → chứng tỏ dung dịch X chỉ chứa Ca(AlO2)2. Và Ca(OH)2 phản ứng hết. Al4C3 + 12H2O → 4Al(OH)3 + 3CH4 CaC2 + 2H2O → Ca(OH)2 + C2H2

2Al(OH)3 + Ca(OH)2 → Ca(AlO2)2 + 4H2O Dung dịch X chỉ chứa Ca(AlO2)2 : y mol Bảo toàn nguyên tố Al → nY = 4nAl4C3 - 2nCa(AlO2)2 = 4x- 2y Khi hấp thụ CO2 vào dung dịch X thì xảy ra phản ứng Ca(AlO2)2 + 2CO2 + 4H2O → Ca(HCO3)2 + 2Al(OH)3 Nhận thấy nCa(AlO2)2 = y < nCO2 = 3x + 2y → nAl(OH)3 = 2nCa(AlO2)2 = 2y mol

Câu 6: B Chú ý đề bài cho X gồm 7 hiđrocacbon và sau khi hấp thụ vào AgNO3/NH3 dư khí Z bay ra có 5 hiđrocacbon→ có 2 khí bị hấp thụ bởi AgNO3/NH3

Theo đề bài lượng kết tủa ở 2 thí nghiệm là như nhau → 4x- 2y = 2y → x = y

Chất tạo kết tủa với AgNO3/NH3 gồm C2H2 : x mol, CH≡C-CH=CH2 : y mol

Câu 8: D

I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

hhX gồm C2H2 và C4H4.

Mà nπ dư sau phản ứng = 2 x n↓ + nBr2 → n↓ = (0,9 - 0,1) : 2 = 0,4 mol.

Về phản ứng cộng H2 thì ta thấy H2 phản ứng hết.

Giả sử số mol của AgC≡CAg và AgC≡C-CH3 lần lượt là x, y mol

UY

Gọi số mol C2H2 phản ứng là 2x → C4H4 x mol Ta có hpt: → hhX có (1 - 2x) mol C2H2 và x mol C4H4 → m = 0,15 x 240 + 0,25 x 147 = 72,75 gam Câu 11: B

→ nH2phản ứng = 2(1 - 2x) + 2x = (2 - 2x) mol. Ta có 2 x nC2H2 + 3 x nC4H4 = 1 x nH2 + 1 x nBr2 → 2(1 - 2x) + 3x = (2 - 2x) + 0,15 → x = 0,15 → H = 30% Câu 9: A

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

Khi tham gai phản ứng với AgNO3 sinh kết tủa gồm C2H2 dư: a mol và C4H6 dư : b mol Gọi số mol H2 phản ứng là c mol

0 00

B

Bảo toàn liên kết π có 0,2. 2 + 0,1.2 + 0,15 = c+ 0,05 + 2a + 2b

hhY + AgNO3/NH3 → ↓ + 0,7 mol hhZ. hhY + 0,05 mol Br2 • nBr2 = nC2H4 + nC3H6 = a + x = 0,05.

A Ó H

nankan + nH2du = (b + y + 0,2) + (0,6 - a - 2b - x - 2y) = 0,7 - 0,05 → b + y = 0,1 mol.

-

P Ấ C

Ta có ∑nY = (0,15 - a - b) + a + b + (0,1 - x - y) + x + (y + 0,2) + (0,6 - a - 2b - x - 2y) = 0,8 mol.

Í -L

Theo bảo toàn khối lượng: mY = mX = 0,15 x 40 + 0,1 x 26 + 0,2 x 30 + 0,6 x 2 = 15,8 gam.

N Á O

→ Câu 10: C Theo BTKL: mX = 0,04 x 26 + 0,03 x 40 + 0,8 x 2 = 24 gam → nX = 24 : 24 = 1 mol.

G N Ỡ

T

2

1 3 +

Bảo toàn số mol → a + b = ( 0,2 + 0,1 + 0,15 + 0,1 + 0,85)-c - 0,85 → a + b= 0,15 và c = 0,4

MY =

= 19,5

→ dY/H2 = 19,5 : 2 = 9,75. Câu 12: A Nhận thấy C2H6 = (C4H10 + H2) : 2 , C3H6 = ( C2H2 + C4H10) : 2 Vậy quy hỗn hợp X thành C2H2: x mol, C4H10 : y mol và H2 : z mol Vì dung dịch Y còn khả năng làm mất màu dung dịch brom → H2 phản ứng hết Bảo toàn liên kết π → nBr2 = 2x - z = 0,12

Ta có nH2phản ứng = nhh ban đầu - nX = (0,4 + 0,3 + 0,8) - 1 = 0,5 mol.

Ư D I Ồ B

nπ trước phản ứng = 2 x nCH≡CH + 2 x nCH≡C-CH3 = 2 x 0,4 + 2 x 0,3 = 1,4 mol.

Theo đầu bài ta có hệ

→ nπ dư sau phản ứng = nπ trước phản ứng - nH2 = 1,4 - 0,5 = 0,9.

Có nCO2 = 2. 0,12 + 0,06. 4 = 0,48 mol, nH2O = 0,54 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Thấy a mol kết tủa chính là tổng số mol của C2H2 dư và C3H4 dư Bảo toàn nguyên tố O → nO2 = ( 0,48.2 + 0,54) : 2= 0,75 mol → V = 16,8 lít. Câu 13: B

Gọi số mol H2 tham gia phản ứng là b

UY

→ nY = nX - nH2 pử = 1,05 - b X

Y

Có nY= nC2H2 dư + nC3H4 dư + nZ → 1,05-b = a +0,7

15,04 gam ↓AgBr(0,08 mol)

Z ( C, H, Br)

Bảo toàn liên kết π → 0,15.2 + 0,1.2 = b + 2a + 0,05

Bảo toàn nguyên tố Br2 → nBr2 = 0,5nAgBr = 0,04 mol

=

Giải hệ → a = 0,1 và b = 0,25. Câu 16: C

= 1,6 → nY = 0,05 mol

Có nH2pư = nX - nY = 0,03 mol → nH2 dư = 0,04 - 0,03 = 0,01 → lượng khí thoát ra chỉ chứa H2 :0,01 mol X Có mZ = mX +mBr2 - mH2 dư = (0,01. 28 + 0,02. 26 + 0,01. 52 + 0,04. 2) + 0,04. 160 - 0,01. 2= 7,78 gam. Câu 14: C

Có nY =

= 0,27 mol, nH2phản ứng = nX- nY = 0,195 mol

0 00

P Ấ C

2

Chất tham gia phản ứng với AgNO3/NH3 lần lượt là C2H2 dư : amol, C4H4 : b mol và CH≡C-CH2-CH3: c mol Có 2a + b + c = 0,21 nY=a +b +c + nZ → a+b +c =0,135

Í -L

Bảo toàn liên kết π → 2a + 3b + 2c = ( 0,15.2+ 0,12. 3) - 0,195 - 0,165

N Á O

Giải hệ → a = 0,075; b = 0,03 và c = 0,03

G N Ỡ

-

A Ó H

T

m↓ =0,075. 240 + 0,03. 159 + 0,03, 161 = 27,6 gam Câu 15: C

X

Ư D I Ồ B Y

H

0,25 mol Y + 0,45 mol Br2

Chú ý đề bài nói phản ứng xảy ra hoàn toàn, mà Y vẫn có khả năng làm mất màu brom → Y chỉ chứa các hidrocacbon( không còn H2)

↓ + 0,135 mol Z ( Z phản ứng với 0,165 mol Br2)

Y

X

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N

1 3 +

B

→ ∑nCH4 + C2H4+ C3H4 + C4H4 = nY = 0,25 mol

Gọi số mol H2 trong X là a mol

Nhận thấy để làm no hóa hoàn toàn Y thì cần 0,45 mol H2 0,25 mol Y + 0,45 mol H2 → 0,25 mol CnH2n+2 Bảo toàn khối lượng → mCnH2n+2 =0,25. 46 + 0,45.2 = 12,4 gam → MCnH2n+2 = 49,6 → n = 3,4

→a=

Vậy X gồm

= 0,15 mol

Để làm no hóa C3,4H4 cần H2 C3,4H4 + 2,4 H2 → C3,4H8,8 → nH2 cần dùng = 2,4. 0,25 = 0,6 mol Vậy ( 0,25 +0,15) mol X thì cần 0,6 mol Br2

0,7 mol Z ( Z làm mất màu 0,05 mol Br2)

Chất tạo kết tủa với AgNO3/NH3 gồm C2H2 dư và C3H4 dư đều chứa 2 liên kết π

Sưu tầm bởi GV. Nguyễn Thanh Tú

→ 0,25 mol X thì cần 0,375 mol Br2 → m = 60 gam. Câu 17: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Gọi số mol của C2H2 và C4H4 trong hỗn hợp lần lượt là x, y

Ta có hệ

UY

Sau khi các phản ứng xảy ra hoàn toàn thu được hỗn hợp Y chỉ gồm các hiđrocacbon → nY = nX = 0,2 mol Các khí tác dụng với AgNO3/NH3 gồm C2H2 dư :a mol, C4H4 dư : b mol. CH≡C-CH2-CH3 : c mol

Ta có hệ

Bảo toàn liên kết π → nBr2 = ( 0,1. 2 + 0,1. 3) - 0,09 - 0,04.2 - 0,05. 3 - 0,02.2 = 0,14 mol → m = 22,4 gam.

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

17. Luyện tập phương pháp giải bài toán đốt cháy hỗn hợp hữu cơ (Đề 1)

Câu 1. Hỗn hợp khí và hơi X gồm: hơi metanol, hơi etanol và khí metan. Đem đốt cháy hoàn toàn 20 cm3 hỗn hợp X thì thu được 32 cm3 khí CO2. Thể tích các khí, hơi đo trong cùng điều kiện về nhiệt độ và áp suất. Chọn kết luận đúng về khối lượng giữa X và không khí A. Hỗn hợp X nặng hơn không khí. B. Hỗn hợp X nhẹ hơn không khí. C. Hỗn hợp X và không khí nặng bằng nhau. D. Không so sánh được. Câu 2. Hỗn hợp khí X gồm etilen, metan, propin và vinylaxetilen có tỉ khối so với H2 là 17. Đốt cháy hoàn toàn 0,1 mol hỗn hợp X rồi hấp thụ toàn bộ sản phẩm cháy vào bình dung dịch Ca(OH)2 (dư) thì khối lượng dung dịch thay đổi A. giảm 10,4 gam. B. tăng 7,8 gam. C. giảm 7,8 gam. D. tăng 14,6 gam. Câu 3. Cho m gam hỗn hợp X gồm axit acrylic, ancol anlylic, axit ađipic và hiđroquinon (benzen-1,4-điol) tác dụng với kali dư thu được 6,72 lít H2 (đktc). Nếu đốt cháy hoàn toàn m gam hỗn hợp X trên thì thể tích khí CO2 (đktc) thu được tối đa là V lít. Giá trị của V gần nhất với A. 10 B. 20 C. 40 D. 50 Câu 4. Hỗn hợp X gồm axit fomic, axit acrylic, axit oxalic và axit axetic. Cho m gam X phản ứng hết với dung dịch NaHCO3 thu được 0,672 lít CO2 (đktc). Đốt cháy hoàn toàn m gam X cần 1,008 lít O2 (đktc); thu được 2,42 gam CO2 và a gam H2O. Giá trị của a là A. 1,44. B. 1,80. C. 0,72. D. 1,62. Câu 5. Một hỗn hợp X gồm các ancol: metylic, anlylic, etylic và glixerol. Cho 25,4 gam hỗn hợp X tác dụng với Na dư thu được 5,6 lít H2 (đktc). Mặt khác, đem đốt cháy hoàn toàn 25,4 gam hỗn hợp X thu được a mol CO2 và 27 gam H2O. Giá trị của a là A. 1,4 B. 1 C. 1,2 D. 1,25 Câu 6. Hỗn hợp X gồm propan-1-ol, propan-2-ol; ancol anlylic; etyl metyl ete; metyl vinyl ete, glixerol. Đốt m gam hỗn hợp X cần V lít oxi (đktc), thu được 5,2416 lít CO2 (đktc). Mặt khác, m gam hỗn hợp X làm mất màu tối đa 4,48 gam brom hay hòa tan tối đa 0,686 gam Cu(OH)2. Giá trị của V là A. 7,2352 lít. B. 7,1680 lít. C. 7,4144 lít. D. 7,3696 lít.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Đốt cháy hoàn toàn m gam hỗn hợp X gồm glucozơ, axit axetic, anđehit fomic và glixerol. Sản phẩm thu được sau phản ứng được hấp thụ hết vào 650 ml dung dịch Ba(OH)2 1M, thấy xuất hiện 68,95 gam kết tủa và thu được dung dich Y, biết khối lượng dung dịch giảm 6,45 gam. Đun sôi dung dịch Y lại xuất hiện kết tủa nữa. Thành phần % theo khối lượng của glixerol trong hỗn hợp X là A. 47,75 %. B. 98,91 %. C. 63,67 %. D. 31,83 %. Câu 8. Hỗn hợp X gồm anđehit fomic, anđehit oxalic, axit axetic, etylen glicol, glixerol. Lấy 4,52 gam X đốt cháy hoàn toàn rồi cho sản phẩm đi qua bình 1 đựng H2SO4 (đặc, dư), bình 2 đựng 600 ml dung dịch Ba(OH)2 0,2M thấy bình 1 tăng 2,88 gam, bình 2 xuất hiện m gam kết tủa. Xác định m ? A. 15,76 gam. B. 19,70 gam. C. 23,64 gam. D. 17,73 gam. Câu 9. Hỗn hợp X gồm vinyl axetat; etylen điaxetat; axit acrylic; axit oxalic. Đốt cháy m gam X cần vừa đủ 9,184 lít O2 (đktc) thu được 8,96 lít CO2 (đktc) và 5,4 gam H2O. Mặt khác để phản ứng hết với các chất trong X cần vừa đủ V ml dung dịch NaOH 1M. Giá trị của V là A. 100. B. 120. C. 140. D. 160. Câu 10. Hỗn hợp X gồm axit oxalic, axetilen, propanđial và vinyl fomat (trong đó số mol của axit oxalic và axetilen bằng nhau). Đốt cháy hoàn toàn m gam hỗn hợp X cần dùng vừa đủ 1,125 mol O2, thu được H2O và 55 gam CO2. Nếu cho m gam hỗn hợp X tác dụng với dung dịch NaHCO3 dư thì thu được tối đa bao nhiêu lít CO2 (ở đktc) ? A. 2,8 lít. B. 8,4 lít. C. 5,6 lít. D. 11,2 lít. Câu 11. Đốt cháy hoàn toàn một hỗn hợp X (gồm glucozơ, anđehit fomic, axit axetic) cần 2,24 lít O2 (đktc). Dẫn sản phẩm cháy qua bình đựng dung dịch Ca(OH)2 (dư), thấy khối lượng bình tăng m gam. Giá trị của m là A. 3,1 B. 12,4 C. 4,4 D. 6,2 Câu 12. (Đề NC) Đốt cháy hoàn toàn m gam hỗn hợp gồm anđehit fomic, axit axetic, glucozơ, glixerol thu được 29,12 lít CO2 (đktc) và 27 gam nước. Thành phần phần trăm khối lượng của glixerol trong hỗn hợp ban đầu là: A. 23,4%. B. 18,4%. C. 43,8%. D. 46,7%.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13. Hỗn hợp X gồm axit oxalic, axetilen, propanđial và vinyl fomat (số mol các chất bằng nhau). Đốt cháy hoàn toàn m gam hỗn hợp X cần dùng vừa đủ 1,125 mol O2, thu được H2O và 55 gam CO2. Nếu cho m gam hỗn hợp X tác dụng với AgNO3 trong NH3 dư thì thu được tối đa bao nhiêu gam kết tủa ? A. 81 gam. B. 111 gam. C. 135 gam. D. 165 gam. Câu 14. Hỗn hợp X gồm vinyl axetat, metyl axetat và etyl fomat. Đốt cháy hoàn toàn 3,08 gam X, thu được 2,16 gam H2O. Phần trăm số mol của vinyl axetat trong X là: A. 25%. B. 27,92%. C. 72,08%. D. 75%. Câu 15. Hỗn hợp X gồm anđehit fomic, anđehit oxalic, axit axetic, etylen glicol, glixerol. Lấy 4,52 gam X đốt cháy hoàn toàn rồi cho sản phẩm đi qua bình 1 đựng H2SO4 (đặc, dư), bình 2 đựng 600 ml dung dịch Ba(OH)2 0,2M ; thấy bình 1 tăng 2,88 gam, bình 2 xuất hiện m gam kết tủa. Giá trị của m là A. 19,70 gam. B. 23,64 gam. C. 17,73 gam. D. 15,76 gam. Câu 16. Hỗn hợp X gồm ancol metylic, etylen glicol và glixerol. Cho a gam hỗn hợp X phản ứng với Na dư thu được 3,36 lít khí H2 (đktc). Mặt khác đốt cháy hoàn toàn 2a gam hỗn hợp X cho sản phẩm cháy vào dung dịch nước vôi trong dư thu được m gam kết tủa. Giá trị của m là A. 15. B. 30. C. 40. D. 60. Câu 17. Hỗn hợp X gồm axeton, anđehit axetic, anđehit acrylic và anđehit propionic, trong đó số mol anđehit axetic bằng 1,5 lần số mol anđehit acrylic. Đốt m gam hỗn hợp X thu được 42,24 gam CO2 và 15,84 gam H2O. Phần trăm khối lượng của anđehit acrylic trong hỗn hợp X là A. 23,35% B. 23,53% C. 24,68% D. 25,33% Câu 18. Hỗn hợp X gồm 1 anđehit, 1 axit cacboxylic và 1 este, trong đó axit và este là đồng phân. Đốt cháy hoàn toàn 0,2 mol X cần 14,0 lít O2, thu được 11,76 lít CO2 và 9,45 gam H2O. Nếu đem toàn bộ lượng anđehit trong X cho phản ứng với lượng dư AgNO3/NH3 thì khối lượng Ag tạo ra là (các thể tích khí đều đo ở đktc) A. 16,2 gam. B. 27,0 gam. C. 32,4 gam. D. 54,0 gam. Câu 19. Hỗn hợp X gồm axit oxalic, axit ađipic, glucozơ, saccarozơ trong đó số mol axit ađipic bằng 3 lần số mol axit oxalic. Đốt m gam hỗn hợp X thu được hỗn hợp Y gồm khí và hơi trong đó có 16,56 gam H2O. Hấp thụ hỗn hợp Y vào dung dịch Ba(OH)2 dư thu được (m + 168,44) gam kết tủa. Giá trị của m gần nhất với A. 28,5

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. 29,5 C. 30,5 D. 31,5 Câu 20. Đốt cháy hoàn toàn a gam hỗn hợp X gồm anđehit malonic (propanđial), fomanđehit, anđehit oxalic và anđehit acrylic cần 21,84 lít O2 và thu được 20,16 lít CO2 và 11,7 gam H2O. Nếu cho a gam hỗn hợp X trên tác dụng với lượng dư dung dịch AgNO3 trong NH3 đun nóng, đến phản ứng hoàn toàn thu được m gam Ag. Các thể tích khí đều đo ở đktc; m có thể nhận giá trị nào sau đây ? A. 162,0. B. 108,0. C. 135,0. D. 216,0. Câu 21. Hỗn hợp X gồm ancol propylic, ancol metylic, etylen glicol và sobitol. Khi cho m gam X tác dụng với Na dư thì thu được 5,6 lít H2 (đktc). Nếu đốt cháy hoàn toàn m gam X cần vừa đủ 25,76 lít khí O2 (ở đktc); sau phản ứng thu được 21,6 gam H2O. % khối lượng của ancol propylic trong hỗn hợp X có giá trị gần nhất với A. 45%. B. 50%. C. 55%. D. 60%. Câu 22. Hỗn hợp X gồm axit oxalic, axetilen, propanđial và vinyl fomat (trong đó số mol của axit oxalic và axetilen bằng nhau). Đốt cháy hoàn toàn m gam hỗn hợp X cần dùng vừa đủ 1,125 mol O2, thu được H2O và 55 gam CO2. Nếu cho m gam hỗn hợp X tác dụng với dung dịch NaHCO3 thì tối đa thu được bao nhiêu lít CO2 (đktc) ? A. 2,8 lít. B. 5,6 lít. C. 8,4 lít. D. 11,2 lít. Câu 23. Đốt cháy hỗn hợp X gồm etylen glicol, metan, ancol etylic và axit no, đơn chức mạch hở Y (trong đó số mol etylen glycol bằng số mol metan) cần vừa đủ 0,7625 mol O2 thu được 0,775 mol CO2. Nếu cho t gam hỗn hợp X tác dụng với 200 ml dung dịch NaOH 2,5M, rồi cô cạn thì thu được m gam chất rắn khan. Giá trị m gần nhất với giá trị nào dưới đây ? A. 32. B. 35. C. 38. D. 40. Câu 24. Hỗn hợp X gồm axit oxalic, axit ađipic, glucozơ, saccarozơ trong đó số mol axit ađipic bằng 3 lần số mol axit oxalic. Đốt cháy hoàn toàn m gam hỗn hợp X thu được hỗn hợp Y gồm khí và hơi trong đó có 16,56 gam H2O. Hấp thụ hỗn hợp Y vào dung dịch Ba(OH)2 dư thu được (m + 168,44) gam kết tủa. Giá trị của m gần nhất với A. 28,4. B. 28,8. C. 28,6. D. 29,0. Câu 25. Hỗn hợp X có tỉ khối so với H2 là 21,2 gồm propan, propen và propin. Khi đốt cháy hoàn toàn 0,1 mol X, tổng khối lượng của CO2 và H2O thu được là A. 20,40 gam.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 18,96 gam. C. 16,80 gam. D. 18,60 gam. Câu 26. Hỗn hợp khí X gồm etilen, metan, propin và vinylaxetilen có tỉ khối so với H2 là 17. Đốt cháy hoàn toàn 0,05 mol hỗn hợp X rồi hấp thụ toàn bộ sản phẩm cháy vào bình dung dịch Ca(OH)2 (dư) thì khối lượng bình tăng thêm m gam. Giá trị của m là A. 5,85. B. 3,39. C. 6,6. D. 7,3. Câu 27. Hỗn hợp khí X gồm C2H6, C3H6 và C4H6. Tỉ khối của X so với H2 bằng 24. Đốt cháy hoàn toàn 0,96 gam X trong oxi dư rồi cho toàn bộ sản phẩm cháy vào 1 lít dung dịch Ba(OH)2 0,05M. Sau khi các phản ứng xảy ra hoàn toàn, thu được m gam kết tủa. Giá trị của m là A. 9,85 B. 7,88 C. 13,79 D. 5,91 Câu 28. Đốt cháy hoàn toàn hỗn hợp X gồm: axit axetic, etyl axetat, metyl axetat rồi cho toàn bộ sản phẩm cháy vào bình (1) đựng dung dịch H2SO4 đặc, dư,bình (2) đựng dung dịch Ba(OH)2 dư. Kết thúc thí nghiệm thấy khối lượng bình (1) tăng thêm m gam, bình (2) thu được 10,835 gam kết tủa. Giá trị của m gần nhất với A. 1,1. B. 1,0. C. 0,9. D. 0,8. Câu 29. Cho hỗn hợp X gồm C3H7COOH, C4H8(NH2)2, HO-CH2-CH=CH-CH2OH. Đốt cháy hoàn toàn m gam hỗn hợp X, sản phẩm cháy hấp thụ hoàn toàn vào dung dịch Ca(OH)2 thấy tạo ra 20 gam kết tủa và dung dịch Y. Đun nóng dung dịch Y thấy xuất hiện kết tủa. Cô cạn dd Y rồi nung chất rắn thu được đến khối lượng không đổi thu được 5,6 gam chất rắn. Giá trị của m gần nhất với A. 8,0. B. 8,5. C. 9,0. D. 9,5. Câu 30. Cho hỗn hợp X gồm ancol metylic, etylen glicol, glixerol có khối lượng m gam. Đốt cháy hoàn toàn X thu được 4,368 lít khí CO2 (đktc) và 5,04 gam H2O. Cũng m gam hỗn hợp X trên cho tác dụng vừa đủ với kali thu được x gam chất rắn. Giá trị của x là A. 13,43. B. 13,24. C. 7,49. D. 13,63. Câu 31. Hỗn hợp X gồm axit fomic, axit acrylic, axit oxalic và axit axetic. Để trung hòa m gam X cần dùng V lít dung dịch NaOH 2M. Mặt khác, để đốt cháy hoàn toàn m gam X cần 4,032 lít O2 (đktc), thu được 9,68 gam CO2 và 2,88 gam H2O. Giá trị của V là A. 180 ml. B. 120 ml. C. 90 ml.

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 60 ml. Câu 32. Hỗn hợp X gồm anđehit axetic, axit butiric, etylen glicol và axit axetic, trong đó axit axetic chiếm 27,13% khối lượng hỗn hợp. Đốt 15,48 gam hỗn hợp X thu được V lít CO2 (đktc) và 11,88 gam H2O. Hấp thụ V lít CO2 (đktc) vào 400ml dung dịch NaOH x mol/l thu được dung dịch Y chứa 54,28 gam chất tan. Giá trị của x gần nhất với A. 1,65. B. 2,45. C. 1,85. D. 2,05. Câu 33. Đốt cháy hoàn toàn m gam hỗn hợp X gồm glucozơ, axit axetic, anđehit fomic và etylen glicol. Sau phản ứng thu được 21,28 lít khí CO2 (đktc) và 20,7 gam H2O. Thành phần % theo khối lượng của etylen glycol trong hỗn hợp X gần với giá trị nào sau đây nhất? A. 63,5%. B. 42,5%. C. 41,5%. D. 47,5%. Câu 34. Đốt cháy hoàn toàn 13,36 gam hỗn hợp X gồm axit metacrylic, axit ađipic, axit axetic và glixerol (trong đó số mol axit metacrylic bằng số mol axit axetic) bằng O2 dư, thu được hỗn hợp Y gồm khí và hơi. Dẫn Y vào dung dịch chứa 0,38 mol Ba(OH)2 , thu được 49,25 gam kết tủa và dung dịch Z. Đun nóng Z lại xuất hiện kết tủa. Cho 13,36 gam hỗn hợp X tác dụng với 140 ml dung dịch KOH 1M, sau khi các phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn khan có khối lượng gần nhất với A. 19,5 gam B. 18,5 gam C. 14,5 gam D. 13,5 gam Câu 35. [PHV-FC]: Hỗn hợp X gồm etanđial, axetilen, propanđial và vinyl fomat (trong đó số mol của etanđial và axetilen bằng nhau). Đốt cháy hoàn toàn m gam hỗn hợp X cần dùng vừa đủ V lít O2 thu được 52,8 gam CO2. Mặt khác đốt cháy hoàn toàn 0,1V lít hỗn hợp etan, propan cần 0,455V lít O2 thu được a gam CO2. Giá trị của a là A. 14,344 B. 16,28 C. 14,256 D. 16,852

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A Vì thể tích cùng điều kiện nên để tính nhanh ta quy thể tích về số mol tương đương. Giả sử hỗn hợp A có 1 mol thì khí CO2 là 1,6 mol. Hỗn hợp A gồm rượu no và hiđrôcacbon no nên ta có:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Để ý dạng này không đủ giả thiết nên phải dùng đánh giá hoặc mẹo để giải quyết. Câu 6: A ► Cách 1: 3 chất chia làm 2 nhóm C và C2, dùng sơ đồ đường chéo vì đã biết số C trung bình là C1,6

UY

Suy ra có: 0,6 mol C và 0,4 mol C2 Như vậy khối lượng của hỗn hợp A: mA > 0,6 × 46 + 0,4 × 16 = 34. → MA = 34 > 29 → A nặng hơn không khí. Chọn A.♥♥♥. Nhận thấy, các chất đều có 3C trong phân tử ►Cách 2: nếu cần đánh giá mạnh hơn: Số mol O2 cần để đốt cháy sẽ nhỏ hơn: (2,6 + 1,6 × 2 - 1)/2 = 2,4 mol. Do đó: mA > 2,6 × 18 + 1,6 × 44 - 2,4 × 32 = 40,4 gam. Từ đó cũng thấy kq tương tự trên. Câu 2: A

0 00

Câu 3: C

Câu 4: C

Bảo toàn nguyên tố Oxi:

Câu 5: C

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Câu 7: C Công thức chung của glucôzơ, axit axetic và anđehit fomic là Đun sôi dung dịch Y lại xuất hiện kết tủa nên Y gồm 2 muối

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

b-------------------------------------3b-----------4b

Ta có:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 11: D bài tập này xử lí tinh tế 1 chút là không có gì khó khăn. Phần trăm khối lượng của glixerol trong X:

Để ý công thức của các chất trong hỗn hợp A:

%

Câu 8: D Nhận thấy các chất lần lượt có công thức tổng quát: CH2O, C2H2O2, C2H6O2, C3H8O3, đều có số C bằng số O. Gọi công thức chung là CxHyOx

UY

G N Ư

O Ạ Đ

Có n O2 = 2,24 ÷ 22,4 = 0,1 mol nên nCO2 = nH2O = 0,1 mol.

Phương trình:

N Ầ TR

H

Vậy khối lượng bình nước vôi trong tăng chính là khối lượng của CO2 và H2O vào:

Khối lượng bình 1 tăng là khối lượng của H2O:

m tăng = 0,1 × 44 + 0,1 × 18 = 6,2 gam. Câu 12: D để ý CTPT: andehit formic: HCHO,axit axetic

Ta có: Cho 0,15 gam CO2 tác dụng với 0,12 mol Ba(OH)2 sẽ thu được 2 muối.

0 0 1

0B

glucozo

Đề yêu cầu tính glixerol nên coi hh trên chỉ có HCHO và

Giải hệ:

Câu 9: C Bảo toàn oxi ta có:

Câu 10: C Nhận thấy 1C2H2O4+ 1C2H2=1C4H4O4

NG

TO

ÁN

H Í

-L

propanđial và vinyl fomat đều có công thưc phân tử là C3H4O2

ƯỠ

Vậy hỗn hợp X gồm C3H4O2: x mol và C4H4O2 : y mol

D I BỒ

.Q P T

Lại chú ý bài toán này chỉ quan tâm đến sản phẩm của phản ứng đốt cháy mà không quan tâm đến lượng cụ thể các chất tham gia nên để giải nhanh ta gọi CT đại diện cho hh A là (CH2O)n, do đề không cho lượng hh A nên có thể cho n = 1 để thuận tiện tính toán hơn. Phản ứng: CH2O + O2 → CO2 + H2O.

Ta có hệ

N

glucozo C6H12O6 = (CH2O)6; andehit fomic HCHO = (CH2O) và axit axetic CH3COOH = (CH2O)2.

ÓA

P Ấ C

3 2+

.

.

Đốt cháy hỗn hợp ta có hệ phương trình về số mol CO2 và H2O như sau:

Vậy thành phần phần trăm khối lượng của glixerol là:

%.

%glixerol

Câu 13: B Nhận thấy quy hỗn hợp axit oxalic HOOC-COOH và axetilen: CH≡CH thành hợp chất C2H2O4.C2H2=C4H4O4 : x mol propandial: HOC-CH2-CHO, vinyl fomat: HOOC-CH=CH2 có cùng công thức phân tử C3H4O2 : 2x mol Bảo toàn nguyên tố C → x.4 + 2x. 3 = 1,25 → x = 0,125 Khi cho X tác dụng với AgNO3 sinh ra kết tủa CAg≡CAg: 0,125 mol, Ag: 0,125.4 + 0.125.2 = 0,75 mol

Khi cho X tác dụng với NaHCO3 → nCO2 = 2nC2H2O4 = 0,25 → V = 5,6 lít.

Sưu tầm bởi GV. Nguyễn Thanh Tú

→ m = 0,125.240 + 0,75. 108 = 111 gam. Câu 14: A

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 18: A

Nhận thấy metyl axetat và etyl fomat là đồng phân của nhau đều có công thức C3H6O2. Goi số mol của vinyl axetat (C4H6O2) và C3H6O2 lần lượt là x, y mol

N

Từ số mol nước và CO2 bằng nhau suy ra andehit, axit cacboxylic, este đều là no, đơn chức, mạch hở Ta có hệ

→ %nC4H6O2 =

UY

×100% = 25%.

Câu 15: C Nhận xét: Các chất trong X đều có số C và số O là như nhau

G N Ư

O Ạ Đ

.Q P T

Câu 19: A bài tập thuần đốt cháy (theo pp định lượng).

Coi X: C a mol, H b mol, O a mol -> 28a+b=4,52

N Ầ TR

H

theo đó ta chỉ quan tâm đến số C, H, O ||→ thoải mái quy đổi. Nhận thấy rằng: điểm khác nằm ở axit oxalic và ađipic (mối quan hệ 1 : 3);

0 00

B

còn 2 chất kia là cacbo.hiđrat Cm(H2O)n ||→ nhẩm + nhận xét: 3H8O4 + 1.H2O4 = H32O16 = 16.H2O.

Câu 16: D X có dạng

N Á O

Câu 17: B

I Ồ B

Ỡ Ư D

NG

Í -L

-

A Ó H

P Ấ C

2+

31

||→ điểm chung đã rõ, quy đổi X về gồm C và H2O. đã rõ có 16,56 ÷ 18 = 0,92 mol. Gọi x là số mol C. Ta có mtủa = 197x = m + 168,44 và m = 12x + 16,56. ||→ x = 1 mol và m = 28,56 gam. Câu 20: C

Câu 21: A

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 22: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

1C2H2O4.1C2H2=1C4H4O4

N Ơ H

Nên công thức chung của hỗn hợp là:

UY

Khối lượng bình tăng: Câu 27: D Đặt CTC của hhX là CxH6

Câu 23: A 1C2H6O2.1CH4=1C2H6O.1CH4O

Mà MX = 48 → C3,5H6 C3,5H6 → 3,5CO2

H

0,02----------------------0,07 mol.

N Ầ TR

G N Ư

O Ạ Đ

.Q P T

N

Hấp thụ 0,07 mol CO2 vào 0,05 mol Ba(OH)2 CO2 + Ba(OH)2 → BaCO3↓ + H2O

Câu 24: C 1C6H10O4.3C2H2O4=C12H16O8=12C.8H2O

Câu 25: B Nhận xét: hỗn hợp X gồm các chất có 3C trong phân tử

N Á O

=>Đặt công thức chung cho X là C3Hx

G N Ỡ

T

-L

Í-

A Ó H

=>Đốt cháy 0,1 mol X thu được nCO2 = 3.0,1 = 0,3 mol, nH2O = 3,2.0,1 = 0,32 mol

Ư D I Ồ B

=>mCO2 + mH2O = 0,3.44 + 0,32.18 = 18,96 gam Câu 26: D ; metan: etilen:

; propin:

B

0,05-----------0,05--------------0,05

Cacbonhidrat=nC.mH2O

=>36 + x = 21,2.2 =>x = 6,4

0 00

; vinylaxetilen :

Sưu tầm bởi GV. Nguyễn Thanh Tú

P Ấ C

2+

31

BaCO3 + CO2 + H2O → Ba(HCO3)2 0,02-------------0,02

→ nBaCO3 = 0,05 - 0,02 = 0,03 mol → m = 0,03 x 197 = 5,91 gam Câu 28: B hhX gồm: C2H4O2, C4H8O2, C3H6O2 + O2 → CO2 + H2O. Với nCO2 = nH2O. Cho sản phẩm qua bình (1) đựng H2SO4 đặc, dư thì H2O bị giữ lại. CO2 + bình (2) đựng Ba(OH)2 dư nCO2 = nBaCO3 = 10,835 : 197 = 0,055 mol → nH2O = 0,055 mol. → mbình (1) tăng = 0,055 x 18 = 0,99 gam. Câu 29: C Nhận thấy khi đun nóng dung dịch Y thấy xuất hiện kết tủa → khi hấp thụ sản phẩm cháy vào Ca(OH)2 thu được đồng thời CaCO3 và Ca(HCO3)2 Cô cạn dung dịch Y rồi nung chất rắn thu được đến khối lượng không đổi thu được 5,6 gam chất rắn là CaO → nCaO = nCa(HCO3)2 = 0,1 mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Bảo toàn nguyên tố C → nCO2 = nCaCO3 + 2 nCa(HCO3)2= 0,2 + 2. 0,1 = 0,4 mol Luôn có nX = nCO2 : 4 = 0,1 mol

Ta có hệ Vì các hợp chất trong X đều có phân tử khối là 88 → m= 0,1. 88 =8,8 gam. Câu 30: A Đặt CTC của hhX là CnH2n + 2On

CnH2n + 2On +

UY

.Q P T

Bảo toàn nguyên tố Na → nNaOH = 0,1.2 + 0,52 = 0,72 mol → x = 1,8

→ nC2H6O2 = nH2O - nCO2 = 1,15- 0,95 = 0,2 mol

nCO2 = 0,195 mol; nH2O = 0,28 mol.

G N Ư

O Ạ Đ

m = mC + mH + mO = 0,95.12 + 1,15.2 + 0,95. 16 = 28,9 gam

Ta có: nOH- = nCO2 = 0,195 mol

N Ầ TR

H

Theo BTNT: mX = 0,195 x 12 + 0,28 x 2 + 0,195 x 16 = 6,02 gam.

→ %C2H6O2 =

Khi hhX phản ứng với K: nK = n-OH = 0,195 mol; nH2 = 0,195 : 2 mol.

Câu 34: C dạng này cần phân tích chút ở CTPT của các chất trong X: a.metacrylic C4H6O2;

m = 6,02 + 0,195 x 39 - 0,195 : 2 x 2 = 13,43 gam Câu 31: D Bảo toàn nguyên tố O → nO(X) = 2nCO2 + nH2O-2nO2 = 2. 0,22 + 0,16- 2. 0,18= 0,24 mol

0 00

→ nCOOH = 0,24: 2 = 0,12 mol Khi cho hỗn hợp X tham gia phản ứng với NaOH → nOH- = nCOOH = 0,12 mol

P Ấ C

2

→nNaOH = 0,12 mol → V = 60ml. Câu 32: C Gọi số mol anđehit axetic (C2H4O), axit butiric (C4H8O2), etylen glicol (C2H6O2) lần lượt là a, b, c

= 0,07 mol

N Á O

Ta có 44a + 88b + 62c = 15, 48 - 0,07. 60 = 11, 28(1) nH2O = 2a + 4b + 3c + 0,07. 2 = 0,66 (2)

G N Ỡ

-L

Í-

A Ó H

T

Lấy (2). 22 - (1) → 4c = 0,16 → c = 0,04 mol → 2a + 4b = 0,4

Ư D I Ồ B

N

Câu 33: B Nhận thấy hỗn hợp glucozơ, axit axetic, anđehit fomic đều có dạng CnH2nOn. Etylen glicol có công thức C2H6O2

O2 → nCO2 + (n + 1)H2O

Trong 15,48 gam X có nC2H4O2 =

N Ơ H

Vậy chất tan chứa Na2CO3: x mol và NaHCO3: y mol

1 3 +

B

× 100% = 42,9%

a.axetic C2H4O2; a.ađipic C6H10O4 và glixerol là C3H8O3. ► phân tích chút ở việc phản ứng KOH (không rõ dư đủ) thì chỉ các axit ms phản ứng → cần phải xác định glixrol để loại trừ. tính glixerol ntn o.O Để ý: số mol a.acrylic = số mol axit axetic → cộng lại 2 chất sẽ là C6H10O4 ≡ với a.ađipic luôn. Như vậy là ok rồi, X gồm C6H10O4 và C3H8O3 số mol x, y mol. Khối lượng: mX = 146x + 92y = 13,36 gam; bảo toàn C: 6x + 3y = 0,51 mol. ► tính nhanh chỗ này, do đun → xuất hiện thêm tủa nên sp CO2 + Ba(OH)2 gồm 0,25 mol BaCO3 ↓ và Ba(HCO3)2 0,13 mol (bảo toàn Ba) → nCO2 = 0,13 × 2 + 0,25 = 0,51 mol. Quay lại, giải hệ có x = 0,06 mol và y = 0,05 mol. → mC6H10O4 = 8,76 gam.

→ nCO2 = 2a + 4b + 2c+ 0,07. 2 = 0,4 + 2. 0,04 + 2. 0,07= 0,62 mol

X + KOH thì chỉ có axit phản ứng, số mol 0,06 ↔ cần 0,12 mol KOH sinh ra 0,12 mol H2O.

Khi hấp thụ 0,62 mol vào dung dịch NaOH nếu hình thành Na2CO3 : 0,62 mol và NaOH dư → mNa2CO3: 65,72 > 54,28 ( Loại)

Theo đó, X + KOH → rắn + H2O, áp dụng BTKL có: m = mX + ∑ mKOH - mH2O = 14,44 gam

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 35: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

quan sát X gồm: C2H2O2; C2H2; C3H4O2; C3H4O2. giả thiết: C2H2O2.C2H2 = C5H4O2 ||→ điểm chung X = C + H2O.

UY

♦ đốt m gam X (C + H2O) cần V lít O2 → 1,2 mol CO2 + H2O. H2O không cần O2 để đốt nên từ trên ||→ nO2 cần đốt = 1,2 mol ||→ tương quan: V lít ⇄ 1,2 mol. ♦ Đốt 0,12 mol (C2H6 và C3H8) cần 0,546 mol O2 → x mol CO2 + y mol H2O. bảo toàn O có: 2x + y = 0,546 × 2; tương quan: y – x = nankan = 0,12 mol. Giải hệ được x = 0,324 mol và y = 0,444 mol ||→ giá trị a = 44x = 14,256 gam.

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

18. Luyện tập phương pháp giải một số bài tập phi kim HAY và KHÓ (Đề 1)

Câu 1. Cho 15 gam hỗn hợp X gồm Cu và Al tác dụng vừa đủ với hỗn hợp Y gồm O2 và Cl2 (có số mol bằng nhau) được 30,45 gam hỗn hợp Z gồm oxit và muối. Nếu cho X tác dụng với dung dịch HCl dư thì thu được V lít khí H2 (đktc). Giá trị của V là A. 10,08 lít B. 7,84 lít C. 4,48 lít D. 6,72 lít Câu 2. Cho a gam hỗn hợp FeS2 và FeCO3 với số mol bằng nhau vào 1 bình kín chứa oxi dư. Áp suất trong bình là P1 atm. Nung nóng bình để phản ứng xảy ra hoàn toàn rồi đưa bình về nhiệt độ ban đầu, áp suất khí trong bình lúc này là P2 atm. Biết thể tích chất rắn trước và sau phản ứng không đáng kể. Tỉ lệ P1/P2 là: A. 0,5 B. 1 C. 2 D. 2,5 Câu 3. Cho hỗn hợp X gồm 2 chất rắn FeCO3 và FeS2. Cho X cùng một lượng O2 vào bình kín có thể tích V lít. Đốt nóng bình cho phản ứng xảy ra (giả thiết khả năng phản ứng của 2 muối là như nhau, sản phẩm phản ứng là Fe2O3), sau phản ứng đưa về điều kiện ban đầu thu được chất rắn Y và hỗn hợp Z, áp suất trong bình lúc này là P. Để hoà tan hết rắn Y cần 200 ml dung dịch HCl 0,3M, thu được khí M và sản phẩm E còn lại, nếu đưa M vào bình kín V lít cùng điều kiện với Z thì áp suất trong bình là P/2. Thêm NaOH dư vào sản phẩm E được rắn F, lọc lấy F và làm khô ngoài không khí cân được 3,85 gam. Phần trăm khối lượng muối FeS2 trong hỗn hợp ban đầu là A. 42,03% B. 50,06% C. 40,1% D. 45,45% Câu 4. (Đề NC)Cho hỗn hợp X gồm KMnO4 và MnO2 vào dung dịch HCl đặc, dư đun nóng (phản ứng hoàn toàn), thấy thoát ra khí Cl2. Xác định % khối lượng của MnO2 trong hỗn hợp X, biết rằng HCl bị khử chiếm 60% lượng HCl đã phản ứng. A. 21,6%. B. 26,2%. C. 53,55%. D. 45,24%. Câu 5. (Đề NC)Nung m gam hỗn hợp X gồm KClO3 và KMnO4 thu được chất rắn Y và O2. Biết KClO3 phân hủy hoàn toàn, còn KMnO4 chỉ bị phân hủy một phần. Trong Y có 0,894 gam KCl chiếm 8,132% theo khối lượng. Trộn lượng O2 ở trên với không khí theo tỉ lệ thể tích Voxi : Vkk = 1:3 trong một bình kín ta thu được hỗn hợp khí Z. Cho vào bình 0,528 gam cacbon rồi đốt cháy hết cacbon, phản ứng hoàn toàn, thu được hỗn hợp khí T gồm 3 khí O2, N2, CO2, trong đó CO2 chiếm 22,916% thể tích. Giá trị của m (gam) là A. 11,652 B. 12,536 C. 12,593 D. 12,708

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 6. Hỗn hợp X gồm KClO3, Ca(ClO3)2, CaCl2 và KCl có tổng khối lượng là 83,68 gam. Nhiệt phân hoàn toàn X thu được 17,472 lít O2 (đktc) và chất rắn Y gồm CaCl2 và KCl. Y tác dụng vừa đủ 0,36 lít dung dịch K2CO3 0,5M thu được dung dịch Z. Lượng KCl trong Z nhiều gấp 22/3 lần lượng KCl trong X. Phần trăm khối lượng KClO3 trong X có giá trị gần nhất với A. 58,50%. B. 58,55%. C. 58,60%. D. 58,65%. Câu 7. (Đề NC) Nung nóng hỗn hợp X chứa 15,8 gam KMnO4 và 24,5 gam KClO3 một thời gian được 36,3 gam hỗn hợp Y gồm 6 chất. Cho Y tác dụng với dung dịch HCl đặc dư đun nóng, lượng khí clo sinh ra hấp thụ hoàn toàn vào 300 ml dung dịch NaOH 5M đun nóng được dung dịch Z. Biết rằng các phản ứng xảy ra hoàn toàn. Khối lượng chất rắn khan thu được khi cô cạn Z là A. 111 gam. B. 12 gam C. 79,8 gam D. 91,8 gam. Câu 8. (Đề NC) Chia 2m gam hỗn hợp X gồm Mg, Al và Cu thành hai phần bằng nhau. Phần một tác dụng với Cl2 dư, đun nóng thu được (m + 7,1) gam hỗn hợp muối. Oxi hóa phần hai cần vừa đúng V lít hỗn hợp khí Y (đktc) gồm O2 và O3. Biết tỉ khối hơi của Y đối với H2 là 20. Các phản ứng xảy ra hoàn toàn. Giá trị của V là A. 0,448 B. 0,672 C. 0,896 D. 1,120 Câu 9. Hỗn hợp X gồm hai muối FeCO3 và FeS2 có tỉ lệ số mol 1 : 1. Đem nung hỗn hợp X trong bình có thể tích không đổi, thể tích các chất rắn không đáng kể, đựng không khí dư (chỉ gồm N2 và O2) để các muối trên bị oxi hóa hết tạo oxit sắt có hóa trị cao nhất (Fe2O3). Để nguội bình, đưa nhiệt độ bình về bằng lúc đầu (trước khi nung), áp suất trong bình sẽ như thế nào ? A. Không đổi. B. Sẽ giảm xuống. C. Sẽ tăng lên. D. Không khẳng định được. Câu 10. Nhiệt phân hoàn toàn 56,1 gam X (KClO3, KMnO4 tỉ lệ mol 1 : 1) thu được V lít khí, dẫn V lít khí này qua bình chứa m gam P (trong bình không có O2 và có áp suất p), đun nóng bình tới phản ứng hoàn toàn, hạ nhiệt độ về nhiệt độ đầu thấy áp suất bình bằng p, đồng thời thu được chất rắn Y. Hòa tan chất rắn Y trong 200ml (NaOH 0,6M; Ca(OH)2 0,9M) thu được m1 gam kết tủa và dung dịch A (sản phẩm chỉ chứa P+5). Tổng (m + m1) có giá trị gần nhất với A. 31,5. B. 31,6. C. 31,7. D. 31,8. Câu 11. Cho 69,16 gam hỗn hợp khí A gồm Clo và Oxi tác dụng vừa hết với 0,99 mol hỗn hợp B gồm Mg, Zn và Al thì thu được 105,64 gam hỗn hợp X gồm muối clorua và oxit của 3 kim loại. Cho X phản ứng vừa đủ với dung dịch HCl thì thu được dung dịch Y. Để tác dụng hết với các chất trong dung dịch Y cần dùng 715 ml Ba(OH)2 2M. Số mol Zn có trong B là: A. 0,3

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 0,25 C. 0,15 D. 0,2 Câu 12. Nung m gam hỗn hợp X gồm FeS và FeS2 trong một bình kín chứa không khí (gồm 20% thể tích O2 và 80% thể tích N2) đến khi phản ứng xảy ra hoàn toàn, thu được chất rắn và hỗn hợp khí Y có thành phần thể tích: N2 = 83,33%; SO2 = 10,42% còn lại là O2. Thành phần % theo khối lượng của FeS trong X là A. 9,29%. B. 12,67%. C. 26,83%. D. 66,52%. Câu 13. Nung hỗn hợp X gồm FeS2, FeS được trộn theo tỉ lệ mol 1:1 trong một bình kín chứa không khí (gồm 20% O2 và 80% N2) đến khi phản ứng xảy ra hoàn toàn thu được chất rắn Y và hỗn hợp khí Z gồm SO2, N2, O2. Biết thành phần phần trăm thể tích SO2 trong hỗn hợp Z là 11,25%. Thành phần phần trăm thể tích N2 trong hỗn hợp Z là: A. 74,5%. B. 84,5%. C. 64,5%. D. 94,5% Câu 14. (Đề NC) Trộn KMnO4 và KClO3 với một lượng bột MnO2 trong bình kín được hỗn hợp X. Lấy 52,550 gam X đem nung nóng, sau một thời gian thu được hỗn hợp chất rắn Y và V lít khí O2. Biết KClO3 bị nhiệt phân hoàn toàn tạo 14,9 gam KCl chiếm 36,315 % khối lượng Y. Sau đó, cho toàn bộ Y tác dụng hoàn toàn với axit HCl đặc dư đun nóng, sau phản ứng cô cạn dung dịch thu được 51,275 gam muối khan. Hiệu suất của phản ứng nhiệt phân muối KMnO4 trong X là A. 75,0 %. B. 80,0 %. C. 62,5 %. D. 91,5 %. Câu 15. Cho hỗn hợp X gồm Al và Mg tác dụng vừa đủ với 1,344 lít (ở đktc) hỗn hợp khí Y gồm O2 và Cl2, dY / H2 = 27,375 .Sau phản ứng thu được 5,055 gam chất rắn. Khối lượng của Al và Mg trong hỗn hợp ban đầu

A Ó H

P Ấ C

2

lần lượt là: A. 0,81; 0,72. B. 0,81; 0,96. C. 0,27; 0,24. D. 0,81; 0,24. Câu 16. Cho 7,84 lít hỗn hợp khí X (đktc) gồm Cl2 và O2 phản ứng vừa đủ với 11,1 gam hỗn hợp Y gồm Mg và Al, thu được 30,1 gam hỗn hợp Z. Phần trăm khối lượng của Al trong Y là A. 75,68% B. 24,32% C. 51,35% D. 48,65% Câu 17. Khi đun nóng 38,4 gam hỗn hợp KClO3 và KMnO4 thu được hỗn hợp rắn X và 2,632 lít khí (đktc). Đun nóng hỗn hợp X với dung dịch HCl đặc, dư; sau khi các phản ứng xảy ra hoàn toàn thu được V lít khí Cl2 (đktc). Biết rằng nếu đun nóng 9,6 gam hỗn hợp ban đầu đến khối lượng không đổi thì khối lượng giảm đi 2,04 gam. Giá trị của V là A. 11,2.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

UY

0 00

1 3 +

N Ơ H

B. 8,96. C. 13,44. D. 9,856. Câu 18. Nung hỗn hợp gồm x mol Fe(NO3)2, y mol FeS2 và z mol FeCO3 trong bình kín chứa một lượng dư không khí. Sau khi các phản ứng xẩy hoàn toàn đưa bình về nhiệt độ ban đầu thấy áp suất bình không đổi so với ban đầu. Mối liên hệ giữa x, y, z là A. 6x + 2z = y. B. 3x + z = y. C. 9x + 2z = 3y. D. 6x + 4z = 3y. Câu 19. Hỗn hợp X gồm a mol Mg và 2a mol Fe. Cho hỗn hợp X tác dụng với oxi, sau một thời gian thu được (136a + 11,36) gam hỗn hợp Y. Cho hỗn hợp Y tác dụng với dung dịch HNO3 dư thu được 3 sản phẩm khử có cùng số mol gồm NO, N2O và NH4NO3. Cô cạn dung dịch sau phản ứng thu được 647a gam chất rắn khan. Đốt hỗn hợp X bằng V lít hỗn hợp khí Cl2 và O2 (đktc) thu được hỗn hợp Z gồm các oxit và muối clorua (không còn khí dư). Hoà tan hỗn hợp Z cần vừa đủ 0,8 lít dung dịch HCl 2M, thu được dung dịch T. Cho dung dịch T tác dụng với dung dịch AgNO3 dư thu được 354,58 gam kết tủa. Giá trị của V gần nhất với A. 12,5. B. 14,5. C. 15,5. D. 16,5. Câu 20. Nung m gam hỗn hợp X gồm KClO3 và KMnO4 thu được chất rắn Y (KCl, K2MnO4, MnO2, KMnO4) và O2. Trong Y có 1,49 gam KCl chiếm 19,893% theo khối lượng. Trộn lượng O2 ở trên với không khí theo tỉ lệ thể tích tương ứng là 1 : 4 thu được hỗn hợp khí Z. Đốt cháy hết 0,528 gam cacbon bằng hỗn hợp Z thu được hỗn hợp khí T gồm 3 khí O2, N2, CO2, trong đó CO2 chiếm 22% về thể tích. Biết trong không khí có 80% N2 và 20% O2 theo thể tích. Giá trị của m gần nhất với A. 8,70. B. 8,75. C. 8,90. D. 8,55. Câu 21. Đốt cháy 4,16 gam hỗn hợp gồm Mg và Fe trong khí O2, thu được 5,92 gam hỗn hợp X chỉ gồm các oxit. Hòa tan hoàn toàn X trong dung dịch HCl vừa đủ, thu được dung dịch Y. Cho dung dịch NaOH dư vào Y, thu được kết tủa Z. Nung Z trong không khí đến khối lượng không đổi, thu được 6 gam chất rắn. Mặt khác cho Y tác dụng với dung dịch AgNO3 dư, thu được m gam kết tủa. Giá trị của m gần nhất với A. 33,0 B. 32,0 C. 32,5 D. 31,5 Câu 22. Cho 8,654 gam hỗn hợp khí Cl2 và O2 tác dụng vừa đủ với 0,396 mol hỗn hợp Y gồm Mg, Zn, Al thì thu được 23,246 gam hỗn hợp muối clorua và oxit của 3 kim loại. Cho Z phản ứng vừa đủ với V ml dung dịch HCl 1M thì thu được dung dịch T. Cho từ từ dung dịch Ba(OH)2 2M vào T đến khi lượng kết tủa thu được không thay đổi về khối lượng thì cần vừa đủ 286 ml. Giá trị của V là A. 780 B. 864 C. 572 D. 848

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 23. Đốt cháy hỗn hợp gồm 0,96 gam Mg và 2,24 gam Fe với hỗn hợp khí X gồm clo và oxi, sau phản ứng chỉ thu được hỗn hợp Y gồm các oxit và muối clorua (không còn khí dư). Hòa tan Y bằng một lượng vừa đủ 60 ml dung dịch HCl 2M, thu được dung dịch Z. Cho AgNO3 dư vào dung dịch Z,thu được 28,345 gam kết tủa. Phần trăm thể tích của clo trong hỗn hợp X là A. 46,15%. B. 43,64%. C. 53,85%. D. 56,36%. Câu 24. Hòa tan hết 12,96 gam hỗn hợp gồm Mg và MgCO3 trong dung dịch chứa HCl và HNO3, thu được dung dịch X chỉ chứa các muối có khối lượng m gam và 5,376 lít hỗn hợp khí Y gồm ba khí không màu có tỉ khối hơi so với He bằng 55/12. Đem toàn bộ hỗn hợp Y trộn với 1,544 lít O2, thu được 6,024 lít hỗn hợp khí Z. Các khí đều đo ở đktc và các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 41,8 B. 45, 29 C. 43,94 D. 54, 05 Câu 25. Lấy hỗn hợp X gồm Zn và 0,3 mol Cu(NO3)2 nhiệt phân một thời gian thu được hỗn hợp rắn Y và 10,08 lít hỗn hợp khí Z gồm NO2 và O2. Y tác dụng vừa đủ với dung dịch chứa 2,3 mol HCl thu được dung dịch T chỉ chứa các muối clorua và 2,24 lít hỗn hợp khí E gồm 2 đơn chất không màu. Biết các khí đo ở đktc, dE/H2 = 7,5. Tổng khối lượng muối trong dung dịch E có giá trị gần nhất với A. 154,0 B. 154,5 C. 155,0 D. 155,5

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: D Ta có: Trong Y có

Đặt

N Á O

Ỡ Ư D

NG

T

Mặt khác khi cho tác dụng với HCl chỉ có Al phản ứng

I Ồ B

Câu 2: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

N Ơ H

Giả sử số mol của 2 chất là x

UY

Bảo toàn e:

O Ạ Đ

.Q P T

N

Như vậy, trong quá trình phản ứng, có 3x mol O2 mất đi và có thêm 3x mol hỗn hợp khí tạo thành Do vậy, áp suất trong bình là không đổi.

Câu 3: B Gọi a,b lần lượt là số mol của Gọi x là hiệu suất phản ứng.

1 3 +

0 00

B

N Ầ TR ,

dư,

H

G N Ư

(Do áp suất sau bằng áp suất trước ) [TEX]n_{HCl}=0,06(mol)=6(0,5ax+0,5bx)+2a(1-x)+2b(1-x) [TEX]n_F=n_{Fe_2O_3}=0,024(mol) [TEX]\to a+b=0,024.2 (Định luật bảo toàn nguyên tố Fe) Ta có hệ pt: [TEX]a+b=0,024.2 [TEX]2(2ax+bx)=a(1-x)+b(1-x) [TEX]6(0,5ax+0,5bx)+2a(1-x)+2b(1-x)=0,06 [TEX]\to x= 0,25, a=0,024 b=0,024 %[TEX]FeS_2 =\frac{0,024.120.100}{0,024.116+0,024.120}=50,06% %[TEX]FeCO_3 =49,94%

Câu 4: A

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

UY

Bảo toàn Cl: Phản ứng:

Ta có: %

%

Câu 8: C

Câu 5: B

Ta thấy, số mol khí

chuyển thành

nên

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

Bảo toàn e:

0 00

Câu 6: B

N Á O

Câu 7: D

I Ồ B

Ỡ Ư D

NG

T

-L

H Í

ÓA

P Ấ C

2

1 3 +

B

Câu 9: A 2FeCO3 + 0,5 O2 –––to–→ Fe2O3 + 2CO2 (1)

4FeS2 +11 O2 –––to–→ 2Fe2O3 + 8SO2 Giả sử số mol của FeCO3 1 mol và FeS2 1 mol Có ∑nO2 đã dùng = 3 mol, nCO2 + nSO2 = 1 +2 = 3 mol Thấy ∑nO2 đã dùng = nCO2 + nSO2 nên tổng số mol trước phản ứng và sau phản ứng bằng nhau Trong cùng điều kiện nhiệt độ, thể tích thì tỉ lệ số mol bằng tỉ lệ về áp suất → áp suất trong bình không đổi

Câu 10: C

Vì áp suất bình k đổi nên khí O2 phản ứng hết. Vì muối chỉ tạo muối P +5 nên O2 phải phản ứng vừa đủ với P, nếu thiếu sẽ tạo cả P2O3

Bảo toàn Oxi:

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Có 4x + x - 16,875 + 11,25 = 100 → x = 21,125

% N2 = Câu 14: B

. 100 = 84,5 %.

Câu 11: A Gọi Số mol Mg, Zn và Al lần lượt là x, y, z.

Ta có hệ:

Câu 12: A

0 00

B

N Ầ TR

H

UY

G N Ư

O Ạ Đ

.Q P T

N

Câu 15: B

Câu 13: B {FeS; FeS2} + {O2; N2} –––to–→ Fe2O3 + {N2; SO2; O2}.

N Á O

4FeS +7 O2 → 2Fe2O3 +4 SO2 4FeS2 + 11O2 → 4Fe2O3 + 8SO2

G N Ỡ

Gọi số mol N2 là 4x mol → O2 : x mol

Ư D I Ồ B

-L

Í-

A Ó H

P Ấ C

T

Giả sử trong 100 mol Y thì có 11,25 mol SO2 , → nFeS = nFeS2 = nSO2 : 3 = 11,25 : 3 = 3, 75 mol

2

1 3 +

Hỗn hợp X gồm

+ 0,06 mol hỗn hợp Y

→ 5,055 gam chất rắn.

→ mAl + mMg = 27a + 24b = 5,055 - 0,06 × 27,375 × 2 (*) • 0,06 mol hỗn hợp khí Y gồm O2 và Cl2, dY/H2 = 27,375.

Ta có hpt

• Theo bảo toàn electron: 3 × nAl + 2 × nMg = 2 × nCl2 + 4 × nO2

→ 3a + 2b = 4 × 0,025 + 2 × 0,035 (**) Từ (*) và (**) → a = 0,03 mol; b = 0,04 mol

→ mAl = 0,03 × 27 = 0,81 gam; mMg = 0,04 × 24 = 0,96 gam Câu 16: B Gọi số mol của Cl2 và O2 lần lượt là x, y

→ nO2 pư = 3,75. (7/4+11/4) = 16, 875 mol → trong Y chứa N2 : 4x mol, O2 dư: x - 16,875

Sưu tầm bởi GV. Nguyễn Thanh Tú

Ta có hệ

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Gọi số mol O2 là a mol → số mol không khí cần trộn là 4a mol ( gồm 0,8a mol O2 và 3,2 mol N2) Gọi số mol của Mg và Al lần lượt là a, b

Khi cho hỗn hợp Z gồm 1,8a mol O2 và 3,2a mol N2 qua 0,044 mol C hình thành CO2: 0,044 mol, N2: 3,2a mol, O2 dư: 1,8a - 0,044 Ta có hệ

→ m= + 0,04. 32= 8,77. Câu 21: C Gọi số mol của Mg và Fe lần lượt là x, y mol

4FeS2 + 11O2 –––to–→ 2Fe2O3 + 8SO2 to

H

G N Ư

O Ạ Đ

2FeCO3 + 0,5O2––– –→ Fe2O3 + 2CO2

Ta có hệ

Áp suất trước phản ứng và sau phản ứng không đổi → số mol khí trước phản ứng = số mol khí sau phản ứng

Bảo toàn khối lượng → mO2= 1,76 gam → nO2 = 0,055 mol

→ nO2 phản ứng = nSO2 + nO2+ nNo2 + nCO2

Luôn có nHCl = 4nO2 = 0,22 mol

+

0 00

= 2y + 0,25x + 2x + z → 0,75y = 2,25x + 0,75z → 3x + z = y

Câu 19: C X + O → Y. BTKL → nO = 0,71 mol. từ khối lượng muối → mNH4NO3 = 647a – 148a – 2a × 242 = 15a ||→ ncác sp khử = 15a ÷ 80 mol.

||→ bảo toàn e cả quá trình có:

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

.Q P T

×100% = 22% → a= 0,04 mol

%CO2 = %mAl = . 100% = 24,32%. Câu 17: A Câu 18: B 2Fe(NO3)2 –––to–→Fe2O3 + 4NO2 + 0,5O2

UY

N Ầ TR

N

Vì dung dịch AgNO3 dư → dung dịch sau phản ứng chứa Fe(NO3)3 , Cu(NO3)2 Bảo toàn electron → nAg = 2nMg + 3nFe - 4nO2 = 0,01 mol

→ m↓ = mAgCl + mAg = 0,22. 143,5 + 0,01. 108 = 32,65 gam Câu 22: A

0,396 mol Y Mg(OH)2

dung dịch chứa

23, 246 g Y

+

Vừa rồi là chúng ta xử lí xong bài toán phụ. bây giờ tập trung vào BT chính + sơ đồ:

N Á O

Gộp quá trình ta có:

Ư D I Ồ B

G N Ỡ

T

Có x + y + z = 0,396 Bảo toàn khối lượng → 24x + 65y + 27z = 23, 246-8,654 Giải hệ → x = 0,22 ; y = 0,12; z = 0,056. Gọi số mol của Cl2 và O2 lần lượt là a, b

Giải hệ số mol Ag ||→ có 2,2 mol AgCl và 0,36 mol Ag, bảo toàn Cl → có 0,3 mol Cl2 Vậy V = (0,3 + 0,4) × 22,4 = 15,68 lít. Câu 20: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

Ta có hệ

Khi tham gia phản ứng với HCl thì chỉ có oxit phản ứng → nHCl = 4nO2 = 0,78 mol → V = 780ml

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 23: C Ta có hệ h ỗn h ợ p

Y

Z

+ dung dịch chứa Bảo toàn nguyên tố C → nMgCO3 = nCO2 = 0,04 mol → nMg =

Nhận thấy 2nMg = 2nH2 + 3nNO → sinh ra NH4+ → nNH4+ = Khi tác dụng với HCl chỉ có các oxit bị hòa tan

→ nHCl = 4nO2 → nO2 = 0,03 mol Dung dịch sau phản ứng chứa không chứa NO3-)

Gọi số mol của Cl2 và Ag lần lượt là x, y mol

→ 143,5( 2. x + 0,12) + 108y = 28,345

0 00

Bảo toàn electron cho toàn bộ quá trình 3nFe + 2nMg = 2nCl2 + 4nO2 + nAg

→ 3. 0,04 + 2.0,04 = 2.x + 4. 0,03 + y Giải hệ → x= 0,035 và y = 0,01

Nhận thấy MY =

.Q P T

N

=0,04 mol

( chú ý vì sinh ra H2 nên trong dung dịch

→ m muối = 0,44. 24 + 0,04. 18 + 0,92.35,5 = 43,94 gam. Câu 25: B

Bảo toàn nguyên tố Cl → nAgCl = 2nCL2 + nHCl = 2. x + 0,12

%Cl2 = Câu 24: C

NG

O Ạ Đ

UY

= 0,4 mol

. 100% = 53,85%.

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

> 2 → trong hỗn hợp 3 khí không màu chắc chắn chứa 2 khí là H2 và CO2

Một khí còn lại có thể là NO, N2, N2O.

N Á O

Í -L

-

Vì khi trộn với O2 thì thầy 5,376 + 1,544 > 6,024 → chứng tỏ thể tích giảm đi → vậy xảy ra phản ứng vối O2 trong điều kiện thường → khí đó là NO ( Các khí khác cần điều kiện nhiệt độ thường) 2NO + O2 → 2NO2

Ỡ Ư D

NG

T

Nhận thấy thể tích giảm chính là lượng oxi tham gia phản ứng

I Ồ B

→ nO2 =

= 0,04 mol → nNO = 2nO2 = 0,08 mol

Gọi số mol của H2 và CO2 lần lượt là a, b

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

19. Một số Bài tập HAY - LẠ - KHÓ về Ancol - Phenol (Đề 1)

Câu 1. Một hỗn hợp A gồm hai ancol có khối lượng 16,6 gam đun với dung dịch H2SO4 đậm đặc thu được hỗn hợp B gồm hai olefin đồng đẳng liên tiếp, ba ete và hai ancol dư có khối lượng bằng 13 gam. Đốt cháy hoàn toàn 13 gam hỗn hợp B ở trên thu được 0,8 mol CO2 và 0,9 mol H2O. CTPT và thành phần phần trăm (theo số mol) của mỗi ancol trong hỗn hợp A là A. CH3OH 50% và C2H5OH 50% B. C2H5OH 50% và C3H7OH 50% C. C2H5OH 33,33% và C3H7OH 66,67% D. C2H5OH 66,67% và C3H7OH 33,33% Câu 2. Để xác định độ rượu của một loại etylic (kí hiệu rượu X) người ta lấy 10 ml rượu X cho tác dụng hết với Na thu được 2,564 lít H2 (đktc). Độ rượu của X gần nhất với giá trị nào (biết drượu = 0,8 g/ml) A. 87,50. B. 85,70. C. 91,00. D. 92,50. Câu 3. Tách nước hoàn toàn từ 25,8 gam hỗn hợp A gồm 2 ancol X và Y (MX < MY), sau phản ứng thu được 2 olefin B kế tiếp nhau trong dãy đồng đẳng. Đốt cháy hoàn B cần vừa đủ 1,8 mol O2. Mặt khác nếu tách nước không hoàn A (ở 140oC, xúc tác H2SO4 đặc), sau phản ứng thu được 11,76 gam hỗn hợp ete. Biết hiệu suất ete hóa của Y là 50%. Hiệu suất(%) ete hóa của X là A. 40 B. 50 C. 60 D. 20 Câu 4. Đun nóng hỗn hợp hai ancol đơn chức, mạch hở với H2SO4 đặc, thu được hỗn hợp gồm các ete. Lấy 7,2 gam một trong các ete đó đem đốt cháy hoàn toàn, thu được 8,96 lít khí CO2 (ở đktc) và 7,2 gam H2O. Hai ancol đó là: A. C2H5OH và CH2=CH-CH2-OH B. C2H5OH và CH3OH C. CH3OH và C3H7OH D. CH3OH và CH2=CH-CH2-OH Câu 5. Cho các phát biểu sau về phenol (C6H5OH): (a) Phenol vừa tác dụng với dung dịch NaOH vừa tác dụng được với Na. (b) Phenol tan được trong dung dịch KOH. (c) Nhiệt độ nóng chảy của phenol lớn hơn nhiệt độ nóng chảy của ancol etylic. (d) Phenol phản ứng được với dung dịch K2CO3 tạo ra CO2. (e) Phenol là một ancol thơm. Số phát biểu đúng là A. 2 B. 3 C. 4 D. 5

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 6. Tách nước hoàn toàn 16,6 gam hỗn hợp A gồm 2 ancol X, Y (MX < MY) thu được 11,2 gam 2 anken kế tiếp nhau trong dãy đồng đẳng. Lấy hỗn hợp 2 anken đem đốt cháy hoàn toàn cần 1,2 mol oxi. Tách nước không hoàn toàn 24,9 gam hỗn hợp A (140oC, xúc tác thích hợp) thu được 8,895 gam các ete. Hiệu suất phản ứng tạo ete của X là 50%. Hiệu suất phản ứng tạo ete của Y là A. 40%. B. 50%. C. 30%. D. 60%. Câu 7. Oxi hóa m gam ancol etylic một thời gian thu được hỗn hợp X. Chia X thành 3 phần bằng nhau: - Phần 1 tác dụng vừa đủ với dung dịch NaHCO3 thoát ra 2,24 lít khí. - Phần 2 tác dụng với Na dư thoát ra 4,48 lít khí. - Phần 3 tác dụng với dung dịch AgNO3/NH3 dư tạo thành 10,8 gam Ag. Các phản ứng của hỗn hợp X đều xảy ra hoàn toàn. Thể tích khí đo ở đktc. Giá trị của m gần nhất với A. 41,0. B. 63,0. C. 48,0. D. 15,0. Câu 8. (Đề NC) Cho hỗn hợp X gồm hai ancol đơn chức kế tiếp nhau trong dãy đồng đẳng CuO dư đun nóng, sau phản ứng hoàn toàn thấy khối lượng chất rắn giảm 3,2 gam và hỗn hợp hơi sau phản ứng có tỷ khối so với H2 là 12,875. Dẫn toàn bộ hỗn hợp hơi đó vào dung dịch AgNO3 dư trong NH3 đun nóng thì khối lượng Ag tối đa thu được là A. 75,6 gam B. 43,2 gam C. 64,8 gam D. 54,0 gam Câu 9. Hỗn hợp X gồm C3H8, C2H4(OH)2 và một số ancol no, đơn chức, mạch hở (trong đó C3H8 và C2H4(OH)2 có số mol bằng nhau). Đốt cháy hoàn toàn 5,444 gam X rồi hấp thụ toàn bộ sản phẩm cháy vào dung dịch Ba(OH)2 dư thấy khối lượng bình tăng lên 16,58 gam và xuất hiện m gam kết tủa. Giá trị gần nhất của m là A. 42. B. 44. C. 48. D. 46. Câu 10. Đốt cháy hoàn toàn 0,1 mol một ancol đơn chức trong 0,7 mol O2 (dư), thu được tổng số mol các khí và hơi bằng 1 mol. Khối lượng ancol ban đầu đem đốt cháy là A. 9,0 gam. B. 8,6 gam. C. 6,0 gam. D. 7,4 gam. Câu 11. Cho 10 ml dung dịch ancol etylic 46o phản ứng hết với kim lại Na (dư), thu được V lít khí H2 (đktc). Biết khối lượng riêng của ancol etylic nguyên chất bằng 0,8 g/ml. Giá trị của V là A. 4,256. B. 0,896. C. 3,360. D. 2,128.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 12. Đốt cháy hoàn toàn 0,2 mol một ancol X no, mạch hở cần vừa đủ 17,92 lít khí O2 (ở đktc). Mặt khác, nếu cho 0,1 mol X tác dụng vừa đủ với m gam Cu(OH)2 thì tạo thành dung dịch có màu xanh lam. Giá trị của m và tên gọi của X tương ứng là A. 9,8 và propan-1,2-điol. B. 4,9 và propan-1,2-điol. C. 4,9 và propan-1,3-điol. D. Design Câu 13. Đun nóng 16,6 gam hỗn hợp X gồm 3 ancol no, đơn chức với H2SO4 đặc ở 140oC thu được 13,9 gam hỗn hợp 6 ete có số mol bằng nhau. Mặt khác, đun nóng X với H2SO4 đặc ở 170oC thu được sản phẩm chỉ gồm 2 olefin và nước. Các phản ứng xảy ra hoàn toàn. Tên gọi của 3 ancol là A. propan-1-ol, butan-1-ol và propan-2-ol. B. metanol, etanol và propan-1-ol. C. metanol, butan-1-ol và butan-2-ol. D. etanol, propan-2-ol và propan-1-ol. Câu 14. Số chất hữu cơ là đồng phân cấu tạo của nhau có công thức phân tử C7H6O3 (chứa vòng benzen), tác dụng với NaOH (dư) theo tỉ lệ mol 1 : 2 là A. 6. B. 3. C. 9. D. 7. Câu 15. Cho m gam hỗn hợp (X) gồm các ancol no mạch hở đồng đẳng của nhau cháy hoàn toàn trong O2 thì thu được 0,5 mol CO2 và 0,7 mol H2O. Cũng m gam X tác dụng với Na dư thì thu được a gam muối. Giá trị của a có thể đạt được đến giá trị lớn nhât là A. 10,6. B. 13,8. C. 15,0. D. 22,6. Câu 16. Cho các phát biểu sau về phenol: (a) Phenol tan nhiều trong nước lạnh. (b) Phenol có tính axit nhưng dung dịch phenol trong nước không làm đổi màu quỳ tím. (c) Phenol được dùng để sản xuất phẩm nhuộm, chất diệt nấm mốc. (d) Nguyên tử H trong vòng benzen của phenol dễ bị thay thế hơn nguyên tử H trong benzen. (e) Cho nước brom vào dung dịch phenol thấy xuất hiện kết tủa. Số phát biểu đúng là A. 2 B. 3 C. 4 D. 5 Câu 17. Đun ancol C6H14O với H2SO4 đặc, nóng để thực hiện phản ứng tách nước tạo anken, thấy tất cả anken tạo thành đều có đồng phân hình học. Số ancol thoả mãn là A. 1 B. 2 C. 3 D. 4 Câu 18. Hỗn hợp X gồm 2 ancol A, B mạch hở:

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

-Đun nóng hỗn hợp X với H2SO4 đặc ở 130oC thu được các ete trong đó có 1 ete có khối lượng phân tử bằng khối lượng phân tử của 1 ancol. -Đun nóng hỗn hợp X với H2SO4 đặc ở 180oC được 2 anken. -Đốt cháy hoàn toàn 0,01 mol hỗn hợp X thu được 1,408 g CO2. Tổng số nguyên tử C của hai ancol A, B lớn nhất là A. 6 B. 7 C. 9 D. 10 Câu 19. Đun nóng 66,4 gam hỗn hợp M gồm 3 ancol đơn chức no, mạch hở X, Y, Z với H2SO4 đặc ở 140oC thu được 55,6 gam hỗn hợp N gồm 6 ete có số mol bằng nhau. Mặt khác đun nóng cũng lượng hỗn hợp M trên với H2SO4 đặc ở 170oC được m gam một anken P duy nhất. Biết các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 16,8 B. 11,2 C. 28,0 D. 44,8 Câu 20. Nung 47 gam hỗn hợp X gồm 2 ancol A,B (MA < MB) với nhôm oxit thu được hỗn hợp Y gồm 3 ete (các ete có số mol bằng nhau) ; 0,33 mol hỗn hợp ancol dư, 0,27 mol hỗn hợp 2 anken và 0,42 mol nước. Biết hiệu suất anken hóa của các ancol là như nhau. Phần trăm khối lượng của A trong X là A. 48,94% B. 68,51% C. 48,94% hoặc 68,51% D. Đáp án khác Câu 21. Khi đun nóng hỗn hợp X gồm 3 ancol A, B, C (A có khối lượng mol phân tử nhỏ nhất trong 3 ancol) với H2SO4 đặc, ở 170oC để thực hiện phản ứng tách nước thu được hỗn hợp hai olefin kế tiếp nhau trong dãy đồng đẳng. Nếu đun nóng 6,45 g hỗn hợp X trên với H2SO4 đặc ở 140oC thu được 5,325 g hỗn hợp 6 ete. % khối lượng của ancol A trong X là: A. 53,49% B. 46,51% C. 62,67% D. 37,33% Câu 22. M là hỗn hợp 3 ancol đơn chức X, Y, Z có số C liên tiếp nhau, đều mạch hở (MX < MY < MZ; X, Y no; Z chưa no, có một nối đôi C=C). Chia M làm 3 phần bằng nhau: + Đốt cháy hoàn toàn phần 1 được 2,01 mol CO2 và 2,58 mol H2O. + Phần 2 làm mất màu vừa đủ dung dịch chứa 16 g Br2. + Đun nóng phần 3 với H2SO4 đặc ở 140oC được 16,41 gam hỗn hợp N gồm 6 ete. Đốt cháy hoàn toàn hỗn hợp N được 0,965 mol CO2 và 1,095 mol H2O. Hiệu suất tạo ete của X, Y, Z lần lượt là A. 60%; 50%; 35% B. 35%; 50%; 60% C. 45%; 50%; 50% D. 62%; 40%; 80% Câu 23. Hỗn hợp X gồm ancol metylic, ancol etylic, ancol anlylic và etylen glicol trong đó oxi chiếm 37,5% về khối lượng. Cho X tác dụng với Na dư thu được 1,344 lít H2 (đktc). Mặt khác oxi hóa X bằng CuO dư rồi cho

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

toàn bộ sản phẩm tạo thành tác dụng với lượng dư dung dịch AgNO3/NH3 thu được 30,24 gam Ag. Thành phần phần trăm khối lượng của ancol metylic trong hỗn hợp X có giá trị gần nhất với là A. 37,55%. B. 31,55%. C. 12,55%. D. 18,55%. Câu 24. Cho 2,75 gam hỗn hợp M gồm 2 ancol X, Y qua CuO, đốt nóng, sau phản ứng hoàn toàn thu được hỗn hợp Z gồm 2 anđehit đơn chức, đồng đẳng kế tiếp. Lấy toàn bộ lượng Z thu được ở trên thực hiện phản ứng tráng bạc thì thu được tối đa 27 gam Ag. Khẳng định không đúng là A. Từ X và Y đều có thể dùng 1 phản ứng hóa học để tạo ra axit axetic. B. X chiếm 50% số mol trong hỗn hợp M. C. Khi đốt cháy hoàn toàn hỗn hợp M thì số mol O2 cần dùng gấp 1,5 lần số mol CO2 tạo ra. D. X và Y có thể tác dụng với nhau. Câu 25. Đun nóng 41 gam hỗn hợp X gồm 2 ancol A, B biết MA < MB với nhôm oxit thu được hỗn hợp Y gồm 3 ete có số mol bằng nhau, 0,24 mol hỗn hợp ancol dư, 0,24 mol hỗn hợp hai anken và 0,4 mol nước. Biết hiệu suất ancol hóa của các ancol là bằng nhau. Phần trăm khối lượng của A trong X là A. 56,1% B. 33,7% C. 43,9% D. 66,3%

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: C Đốt cháy B thu được nH2O > nCO2 =>2 rượu no, đơn chức. Áp dụng bảo toàn khối lượng:

Í-

=>Nếu đốt cháy 16,6 gam A thì thu được

N Á O

-L

2 ancol là C2H5OH (x mol) và C3H7OH (y mol)

D I BỒ

ƯỠ

NG

T

=>% số mol của C2H5OH và C3H7OH lần lượt là 33,33% và 66,67% Câu 2: B Gọi thể tích rượu và nước trong 10 ml rượu X là x và y

Sưu tầm bởi GV. Nguyễn Thanh Tú

A Ó H

P Ấ C

UY

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

Câu 3: C F là anken, đốt F là đốt CH2 cần 1,8 mol O2 ||→ nCH2 = 1,8 ÷ 1,5 = 1,2 mol.

N Ầ TR

H

Ancol dạng (CH2)n.H2O ||→ nancol = (25,8 – 1,2 × 14) ÷ 18 = 0,5 mol. 2 anken đồng đẳng kế tiếp → 2 ancol cũng kế tiếp, mà Ctr.bình = 1,2 ÷ 0,5 = 2,4.

0 00

B

||→ 25,8 gam hỗn hợp E gồm 0,3 mol C2H5OH và 0,2 mol C3H7OH.

2+

31

Tạo ete: cứ 2ancol – 1H2O → 1.ete. gọi hiệu suất ete hóa của X là h, ta có: mete = 0,3h ÷ 2 × (46 × 2 – 18) + 0,2 ÷ 2 × 0,5 × (60 × 2 – 18) = 11,76 → h = 0,6 Câu 4: A Câu 5: B (a) Đúng (b) Đúng (c) Đúng (d) Sai vì tạo ra KHCO3 (e) Sai vì phenol KHÔNG phải ancol thơm Câu 6: A Phân tử khối trung bình của 2 anken: Vậy, 2 anken là C2H4 0,1 mol và C3H6 0,2 mol. Trong 24,9 gam A: có 0,15 mol C2H5OH và 0,3 mol C3H7OH. Ta có thể tính như sau: 0,075 ----------------------> 0,0375

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Ta có: Vậy, số mol C3H7OH đã tham gia tạo ete là 0,12 mol. Suy ra, hiệu suất:

Vậy, 2 andehit là HCHO và CH3CHO.

Câu 7: A Để ý phần 1 có tác dụng với NaHCO3 → sp có axit, phần 3 có tác dụng AgNO3/NH3

Hệ:

→ sp có anđêhit và để có câu "một thời gian" nên ancol dư.

Câu 9: D

→ n CH3CHO = 10,8 ÷ 108 ÷ 2 = 0,05 mol. Chỉ có axit axetic CH3COOH được tạo thành tác dụng được với NaHCO3: CH3COOH + NaHCO3 → CH3COONa + CO2 ↑ + H2O → số mol axit = n CO2 = 0,1 mol. ►Chú ý nhất là phần 2 này: nhiều bạn quên lượng ancol dư hay lượng nước được tạo thành.

0 00

. Các chất tác dụng Na gồm CH3CH2OH, CH3COOH, H2O đều theo tỉ lệ 1 ÷ 1 tạo 1/2 khí H2 nên ta có: ∑n H2 = ( n axit + n ancol dư + n H2O ) ÷ 2 = ( 0,25 + n ancol dư ) ÷ 2 = 0,2 mol Do đó số mol ancol dư = 0,15 mol. Để chia hh làm 3 phần nên:

Ta có:

I Ồ B

Ỡ Ư D

NG

H Í

-L

Câu 8: A Khối lượng chất rắn giảm là khối lượng của O trong CuO đã phản ứng.

N Á O

O Ạ Đ

Khi cho vào AgNO3 dư thì khối lượng Ag thu được:

do ancol là etylic nên chỉ tạo mỗi anđêhit CH3CHO tác dụng với AgNO3/NH3 → 2.Ag

m = 3 × ( 0,15 + 0,1 + 0,05 ) × 46 = 41,4 gam.

UY

ÓA

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

.Q P T

N

Câu 10: D Câu 11: A Câu 12: B Câu 13: D

Vì sp k còn ancol dư nên trong hh k có metanol -> 3 ancol là etanol, propan-2-ol và propan-1-ol thỏa mãn tách nước ở 170 độ ra 2 olefin Câu 14: C

T

Gọi công thức chung của 2 ancol là RCH2OH, công thức andehit là RCHO.

Sưu tầm bởi GV. Nguyễn Thanh Tú

p/s: trong đó chú ý: TH3 tránh quên, thiếu vị trí số 1. TH4 tránh đếm thừa do tính đối xứng. Tóm lại là có 9 đồng phân thỏa mãn Câu 15: D

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

→ nM = 1,2 mol → MCnH2n + 1OH = 66,4 : 1,2 = 55,33 → n ≈ 2,67. Vì 6ete có số mol bằng nhau → ba ancol có số mol bằng nhau = 1,2 : 3 = 0,4 mol.

UY

N

Tức là X gồm các ancol có tối đa 2 chức. Để lượng muối là tối đa thì lượng chức ancol cũng là tối đa

Giả sử ba ancol là CnH2n + 2O; CmH2m + 2O và CpH2p + 2O

Khi đó m=0,5.12+0,7.2+0,2.16.2=13,8

Ta có: 0,4(14n + 18) + 0,4(14m + 18) + 0,4(14p + 18) = 66,4 → m + n + p = 8.

Khối lượng muối tối đa là: 13,8+22.0,2.2=22,6

Mà khi tách nước chỉ thu được 1 anken duy nhất → Ba ancol thỏa mãn là CH3OH, CH3CH2OH và (CH3)3-CCH2OH.

Câu 16: C (a) Phenol tan ít trong nước lạnh và tan nhiều trong nước nóng → sai

Anken thu được là CH2=CH2 có m = 0,4 x 28 = 11,2 gam Câu 20: A nH2O = nete+ nanken → nete = 0,42- 0,27= 0,15 mol

(b) Phenol có tính axit nhưng rất yếu nên dung dịch phenol trong nước không làm đổi màu quỳ tím → đúng (c) Phenol được dùng để sản xuất phẩm nhuộm, chất diệt nấm mốc → đúng

Ta có hpt:

0,01 < x + 2y < 0,02 →

I Ồ B

-

→ 1,6 < n < 3,2 → n = 2 hoặc n = 3.

NG

Nếu n = 3 → tổng số C trong hai ancol = 9 Câu 19: B Giả sử 3 ancol có CTC là CnH2n + 1OH 2CnH2n + 1OH

N Á O

Í -L

A Ó H

Ỡ Ư D

T

(CnH2n + 1)2O + H2O

Theo BTKL: mH2O = 66,4 - 55,6 = 10,8 gam → nH2O = 0,6 mol.

Sưu tầm bởi GV. Nguyễn Thanh Tú

= 52,22 → A là C2H5OH

0 00

B

Có 46a + MB.b = 47 → 46. ( 0,9-b) + MB.b = 47 → b.(MB-46) = 5,6

Câu 17: A Câu 18: C Đun nóng hhX ở 180oC thu được hai anken → hhX gồm hai ancol no, mạch hở.

Giả sử gồm 2 ancol A, B có số mol lần lượt là x, y

H

Goi số mol của A, B lần lượt là a, b mol → a+ b = 0,9

(e) Phenol tham gia phản ứng thế Br2 hình thành C6H2Br3OH là chât kết tủa màu trắng→ (e) đúng.

Ta có M(CnH2n + 1)2O = MCmH2m + 1OH → (14n + 1) x 2 + 16 = 14m + 18 → m = 2n.

N Ầ TR

G N Ư

→ ∑ancol= 0,33 + 0,27 + 0,15.2 = 0,9 mol → Mtb =

(d) Do nhóm OH đẩy e làm mật độ electron trong vòng benzen tăng lên → làm tăng khả năng thế → đúng

Giả hhX gồm CnH2n + 1OH và CmH2m + 1OH

O Ạ Đ

.Q P T

P Ấ C

2

1 3 +

Hiệu suất tạo anken của 2 ancol là như nhau và bằng

= 0,3

Vì tạo ete có số mol bằng nhau nên hiệu suất tạo ete của ancol bằng nhau → Trong b mol B có 0,3b mol tạo anken, 0,15 mol tạo ete, còn lại b- 0,15-0,3b = 0,7b- 0,15 là ancol dư

Luôn có 0,7b- 0,15 >0 → b > 0,2413 → MB-46 <

Ta có hệ

→ MB< 69,2 → B là C3H7OH

→ %A= 48,94%. Câu 21: A Bảo toàn khối lượng → mH2O = 6,45 - 5,325= 1,125 gam → nH2O = 0,0625 mol

Luôn có nancol = 2nH2O = 0,125 mol → Mancol =

=51,6

Vì tách nước thu được 2 hai olefin kế tiếp nhau trong dãy đồng đẳng nên có 2 cặp ancol thỏa mãn: (CH3OH, CH3CH2OH, C3H7OH) và (CH3CH2OH,CH3CH2CH2OH, CH3-CH(OH)-CH3)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

→ x+ y + z= 0,125 và 46x + 60y + 60z = 6,45 → x = 0,075

→ %C2H5OH =

%CH3OH =

×100% = 12,5%. Đáp án C.

UY

Câu 24: C • nAg = 0,25 mol.

×100% = 53, 49%.

TH2: CH3OH, CH3CH2OH, C3H7OH. Không tính được cụ thế % CH3OH. Câu 22: A P1: Nhận thấy nX + nY = nH2O- nCO2 = 2,58 - 2,01 = 0,57 mol

• TH1: hhX, Y không chứa CH3OH

P2: nZ = nBr2 = 0,1 mol

• TH2: hhM gồm CH3OH x mol; C2H5OH y mol

Ta có hpt:

0 00

= 0,165 → a + b + c= 0,165. 2

Bảo toàn khối lượng 46a + 60b + 72c = 16,41+ 0,165. 18 Bảo toàn nguyên tố C → 2a + 3b + 4c = 0,965 Giải hệ → a = 0,06, b = 0,235, c = 0,035

×100% = 60%; HC3H8O =

G N Ỡ

-L

Í-

×100% = 50%; HC4H8O =

Câu 23: C Luôn có nOH = 2nH2 = 0,12 mol → m =

H

TO

B

CH3COOH + H2O; CH3OH + CO

CH3COOH

Đáp án B sai vì X chiếm 66,67% số mol trong hhM.

P3: Gọi số mol phản ứng của X, Y, Z lần lượt là a, b, c

→ H C2H5OH=

N Ầ TR

G N Ư

Đáp án A đúng vì CH3CH2OH + O2

→ nO(N) =

O Ạ Đ

.Q P T

N

→ nhhM = 0,25 : 2 = 0,125 mol → MM = 2,75 : 0,125 = 22 → loại.

→ Ctb = 2,01 :( 0, 57 + 0,1) = 3 mà X, Y, Z có số C liên liên tiếp nhau, Z là ancol không no chứa nối đôi ( CZ ≥ 3) → X, Y, Z lần lượt là C2H5OH : x mol, C3H7OH : y mol, C4H8O : 0,1 mol

Ta có hệ

N Ơ H

→ (2) - 2. (1) → 2a = 0,28 -2. 0,12 → a = 0,02 mol

TH1: CH3CH2OH : x mol ,CH3CH2CH2OH : y mol , CH3-CH(OH)-CH3 : z mol

ÁN

A Ó H

P Ấ C

2

1 3 +

Câu 25: A nH2O = nete+ nanken → nete = 0,4- 0,24= 0,16 mol

→ ∑ancol= 0,24 + 0,24 + 0,16.2 = 0,98mol → Mtb = được anken)

= 51,25 → A là C2H5OH ( chú ý CH3OH không tạo

Goi số mol của A, B lần lượt là a, b mol → a+ b = 0,8 Có 46a + MB.b = 41 → 46. ( 0,8-b) + MB.b = 41 → b.(MB-46) = 4,2

×100% = 35%

= 5,12 gam

Hiệu suất tạo anken của 2 ancol là như nhau và bằng

= 0,3

Vì tạo ete có số mol bằng nhau nên hiệu suất tạo ete của ancol bằng nhau → Trong b mol B có 0,3b mol tạo anken, 0,16 mol tạo ete, còn lại b- 0,16-0,3b = 0,7b- 0,16 là ancol dư

Gọi số mol ancol metylic, ancol etylic, ancol anlylic và etylen glicol lần lượt là a, b, c, d

→ a + b + c+ 2d = 0,12 (1)

I Ồ B

Khi oxi hóa ancol bằng CuO rồi cho toàn bộ sản phẩm tạo thành tác dụng với lượng dư dung dịch AgNO3/NH3 → 4a + 2b + 2c + 4d = 0,28 (2)

Sưu tầm bởi GV. Nguyễn Thanh Tú

Luôn có 0,7b- 0,16 >0 → b > 0,2286 → MB-46 <

Ta có hệ

→ MB< 64,375 → B là C3H7OH

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

→ %A= 56,09%.

UY

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

20. Luyện tập giải một số bài tập HAY LẠ KHÓ về điện phân (Đề 1)

Câu 1. (Đề NC) Hòa tan 11,7 gam NaCl và 48 gam CuSO4 vào nước rồi điện phân dung dịch thu được với điện cực trơ, màng ngăn xốp, cường độ dòng điện 5A. Khi khối lượng dung dịch giảm 21,5 gam thì ngừng điện phân. Thời gian điện phân là A. 7720 s. B. 9650 s. C. 5790 s. D. 11580 s. Câu 2. Hòa tan 72 gam hỗn hợp gồm Fe2(SO4)3 và CuSO4 có tỉ lệ mol tương ứng là 2 : 1 vào bình đựng 0,1 mol H2SO4 loãng thì thu được dung dịch X. Tiến hành điện phân dung dịch X (với điện cực trơ) với cường độ dòng điện 10A trong thời gian 1 giờ 4 phút 20 giây. Khối lượng dung dịch sau điện phân giảm bao nhiêu gam so với dung dịch trước điện phân? (giả sử trong quá trình điện phân nước bay hơi không đáng kể) A. 6,4 gam. B. 3,2 gam. C. 12,0 gam. D. 9,6 gam. Câu 3. Tiến hành điện phân với điện cực trơ, màng ngăn xốp dung dịch chứa m gam hỗn hợp CuSO4 và NaCl cho tới khi nước bắt đầu bị điện phân ở catot thì dừng điện phân. Ở anot thu được 0,448 lít khí (ở đktc). Dung dịch sau điện phân có thể hoà tan 1,16 gam Fe3O4. Giả sử nước bay hơi không đáng kể trong quá trình điện phân. Khối lượng dung dịch sau điện phân giảm là A. 1,92 gam. B. 2,95 gam. C. 1,03 gam. D. 2,63 gam. Câu 4. Điện phân 500 ml dung dịch hỗn hợp CuSO4 a mol/l và NaCl 1 mol/l với điện cực trơ, màng ngăn xốp, cường độ dòng điện không đổi 5A trong thời gian 96,5 phút (hiệu suất quá trình điện phân là 100%, nước bay hơi không đáng kể) thu được dung dịch có khối lượng giảm so với ban đầu là 17,15 gam. Giá trị của a là A. 0,2. B. 0,5. C. 0,3. D. 0,4. Câu 5. Điện phân 200 ml dung dịch R(NO3)2 (R có hóa trị 2 và 3, không tác dụng với H2O) với cường độ I = 1A trong 32 phút 10 giây thì thấy có khí thoát ra ở catốt, ngừng điện phân và để yên dung dịch một thời gian thu được 0,28 gam kim loại và khối lượng dung dịch giảm m gam, giá trị của m là A. 0,72 B. 0,59 C. 1,44 D. 0,16 Câu 6. Điện phân 500 ml dung dịch chứa hỗn hợp gồm CuCl2 0,06 M và Fe2(SO4)3 0,03 M với điện cực trơ, có màng ngăn với cường độ dòng điện là 5A trong thời gian 41 phút 49 giây thì dừng điện phân . Tính pH dung dịch sau điện phân và độ giảm khối lượng của dung dịch .( giả sử V dung dịch thay đổi không đáng kể) A. 1,15 ; 5,92 gam B. 1,15 ; 5,73 gam

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. 0,85 5,92 gam D. 0,85 ; 5,73 gam Câu 7. Điện phân dung dịch X chứa 0,03 mol Cu(NO3)2; 0,01 mol Fe2(SO4)3 và 0,05 mol NaCl trong thời gian 12 phút 52 giây với cường độ dòng điện 5A. Hỏi khối lượng dung dịch sau điện phân giảm bao nhiêu gam? A. 2,38 B. 14,22 C. 1,28 D. 2,06 Câu 8. (Đề NC) Điện phân dung dịch Cu(NO3)2 điện cực trơ, với cường độ dòng điện 2A, thu được dung dịch X chứa hai chất tan có cùng nồng độ mol. Nhúng một thanh Fe vào dung dịch X, đến khi phản ứng xảy ra hoàn toàn, thu được khí NO là sản phẩm khử duy nhất, rút thanh Fe ra cân lại thấy khối lượng thanh Fe giảm 1,04 gam so với ban đầu. Thời gian điện phân là A. 2895 giây. B. 7720 giây. C. 5790 giây. D. 3860 giây. Câu 9. Điện phân có màng ngăn 500 ml dung dịch chứa hỗn hợp gồm CuCl2 0,2M và NaCl 1M (điện cực trơ và hiệu suất điện phân 100% với cường độ dòng điện I = 5A trong 7720 s. Dung dịch sau điện phân có khả năng hòa tan m gam Al2O3. Giá trị lớn nhất của m là A. 10,2. B. 15,3. C. 7,65. D. 12,75. Câu 10. Điện phân 200ml dung dịch AgNO3 1M với điện cực trơ trong thời gian t giây cường độ dòng điện không đổi 2,68A ( hiệu suất quá trình điện phân 100%) thu được chất rắn X và dung dịch Y và khí Z. Cho 16,8(g) Fe vào dung dịch y sau khi phản ứng hoàn toàn thu được 22,7(g) hỗn hợp kim loại và khí NO ( sản phẩm khử duy nhất). Giá trị của t là: A. 1h. B. 1h30’. C. 1h45’. D. 2h. Câu 11. (Đề NC) Điện phân dung dịch X gồm 8,19 gam NaCl và 33,84 gam Cu(NO3)2 (với hai điện cực trơ và cường độ dòng điện 3,86 A) đến khi có khí bắt đầu thoát ra ở cả 2 điện cực thì dừng điện phân, thời gian đã điện phân là t giờ. Ngắt dòng điện nhưng vẫn giữ nguyên 2 cực trong dung dịch thì thấy có khí không màu hóa nâu trong không khí thoát ra (biết nó là sản phẩm khử duy nhất của N+5). Sau các phản ứng hoàn toàn thu được m gam Cu ở catot. Giá trị của (m + t) gần nhất với A. 8,0. B. 11,0. C. 9,0. D. 10,0. Câu 12. (Đề NC) Điện phân 100 ml dung dịch gồm hai muối Cu(NO3)2 xM và AgNO3 yM với cường độ dòng điện là 8,04A đến khi có khí thoát ra ở cả 2 điện cực thì hết thời gian là 1 giờ, đồng thời khối lượng cực âm (catot) tăng thêm 17,2 gam. Tỉ số nồng độ hai muối ban đầu x : y bằng A. 1 B. 2

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 0,5 D. 1,5 Câu 13. Điện phân với điện cực trơ dung dịch chứa 0,2 mol AgNO3 với cường độ dòng điện 2,68A, trong thời gian t giờ thu được dung dịch X (hiệu suất quá trình điện phân 100%). Cho 16,8 gam Fe và dung dịch X thấy thoát ra khí NO (sản phẩm khử duy nhất) và sau khi các phản ứng xảy ra hoàn toàn thu được 22,7 gam chất rắn và V lít khí NO (đktc). Tổng trị số (t + V) gần nhất với giá trị nào sau đây ? A. 0,8. B. 2,8. C. 1,6. D. 4,2. Câu 14. Điện phân dung dịch chứa 0,2 mol NaCl và x mol Cu(NO3)2 (điện cực trơ, màng ngăn xốp) sau một thời gian thu được dung dịch X và khối lượng dung dịch giảm 21,5 gam. Cho thanh sắt vào dung dịch X đến khi các phản ứng xảy ra hoàn toàn thấy khối lượng thanh sắt giảm 1,8 gam và thấy thoát ra khí NO duy nhất. Giá trị của x là A. 0,6. B. 0,5. C. 0,3. D. 0,4. Câu 15. Điện phân (điện cực trơ, hiệu suất điện phân 100%) dung dịch chứa đồng thời 0,15 mol Cu(NO3)2 và 0,12 mol HCl trong thời gian t giờ với cường độ dòng điện không đổi 2,68A thì ở anot thoát ra 0,672 lít khí (đktc) và thu được dung dịch X. Dung dịch X hòa tan tối đa m gam bột sắt (sản phẩm khử của NO3- là khí NO duy nhất). Giá trị của t và m lần lượt là A. 0,6 và 10,08. B. 0,6 và 8,96. C. 0,6 và 9,24. D. 0,5 và 8,96. Câu 16. Điện phân 200 ml dung dịch R(NO3)2 (R có hóa trị 2 và 3, không tác dụng với H2O) với cường độ I = 1A trong 32 phút 10 giây thì thấy có khí thoát ra ở catot, ngừng điện phân và để yên dung dịch một thời gian thu được 0,28 gam kim loại và khối lượng dung dịch giảm m gam. Giá trị của m là A. 0,72 B. 0,59 C. 1,44 D. 0,16 Câu 17. Điện phân dung dịch chứa 0,2 mol NaCl và x mol Cu(NO3)2 (điện cực trơ, màng ngăn xốp) sau một thời gian thu được dung dịch X và khối lượng dung dịch giảm 21,5 gam. Cho thanh sắt vào dung dịch X đến khi các phản ứng xảy ra hoàn toàn thấy khối lượng thanh sắt giảm 1,8 gam và thấy thoát ra khí NO duy nhất. Giá trị của x là A. 0,6. B. 0,5. C. 0,3. D. 0,4. Câu 18. Điện phân dung dịch chứa 0,6 mol Cu(NO3)2 và 0,4 mol HCl với điện cực trơ, màng ngăn xốp, sau một thời gian, dừng điện phân thu được dung dịch Y giảm 43 gam so với dung dịch ban đầu. Cho tiếp m gam Fe vào dung dịch Y, sau khi phản ứng hoàn toàn thu được khí NO (sản phẩm khử duy nhất của N+5) và 0,5m gam hỗn hợp 2 kim loại. Giá trị m là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 30,4. B. 15,2. C. 18,4. D. 36,8. Câu 19. Điện phân (với điện cực trơ, màng ngăn) dung dịch chứa m gam hỗn hợp gồm KCl và CuSO4 bằng dòng điện một chiều có cường độ 5A, sau thời gian 7720 giây thì catot bắt đầu có khí thoát ra thì dừng điện phân. Cho bột nhôm dư vào dung dịch sau điện phân, thấy thoát ra 2,24 lít khí H2 (đktc). Giá trị của m là A. 38,90. B. 54,35. C. 39,45. D. 46,90. Câu 20. Có hai bình điện phân (1) và bình điện phân (2). Trong đó bình (1) đựng 40 ml dung dịch NaOH 1,73M. Trong bình (2) có chứa dung dịch gồm 0,45 mol Cu(NO3)2 và 0,4 mol HCl. Mắc nối tiếp bình (1) và bình (2). Điện phân dung dịch một thời gian. Lấy dung dịch sau phản ứng: - Thấy nồng độ NaOH ở bình (1) là 2M. - Cho tiếp 28 gam bột Fe vào bình (2) đến khi phản ứng hoàn toàn thu được m gam hỗn hợp 2 kim loại. Biết NO là sản phẩm khử duy nhất của N+5. Giá trị m gần nhất với giá trị nào dưới đây ? A. 17. B. 18. C. 16. D. 10. Câu 21. Điện phân dung dịch X chứa a mol CuSO4 và 0,15 mol KCl (điện cực trơ, màng ngăn xốp, cường độ dòng điện không đổi) trong thời gian t giây, thu được 2,24 lít khí ở anol (đktc). Nếu thời gian là 2t thì tổng thể tích khí thu được ở 2 điện cực là 4,76 lít (đktc). Biết hiệu suất điện phân là 100%, các khí sinh ra không tan trong dung dịch. Giá trị của a là A. 0,2. B. 0,15. C. 0,25. D. 0,3. Câu 22. Hòa tan hết m gam hỗn hợp X gồm Mg, MgO, Mg(OH)2 và MgCO3 bằng một lượng dung dịch HCl 20% vừa đủ thu được 2,72 gam hỗn hợp khí và dung dịch Z chứa một chất tan có nồng độ 23,3%. Cô cạn dung dịch Z rồi tiến hành điện phân nóng chảy thu được 4,8 gam kim loại ở catot. Các phản ứng xảy ra hoàn toàn. Xem như các khí sinh ra không tan trong nước. Giá trị m gần giá trị nào nhất sau đây ? A. 9. B. 11. C. 10. D. 12. Câu 23. Điện phân dung dịch hỗn hợp CuSO4 (0,05 mol) và NaCl bằng dòng điện có cường độ không đổi 2A (điện cực trơ, màng ngăn xốp). Sau thời gian t giây thì ngừng điện phân, thu được dung dịch Y và khí ở hai điện cực có tổng thể tích là 2,24 lít (đktc). Dung dịch Y hòa tan tối đa 0,8 gam MgO. Biết hiệu suất điện phân 100%, các khí sinh ra không tan trong dung dịch. Giá trị của t là A. 6755 B. 7720 C. 8685

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 4825 Câu 24. Hòa tan hoàn toàn m gam MSO4 (M là kim loại) vào nước thu được dung dịch X. Điện phân dung dịch X (điện cực trơ, hiệu suất 100%) với cường độ dòng điện 7,5A không đổi, trong khoảng thời gian 1 giờ 4 phút 20 giây, thu được dung dịch Y và khối lượng catot tăng a gam. Dung dịch Y tác dụng vừa đủ với 200 ml dung dịch chứa KOH 1M và NaOH 1M, sinh ra 4,9 gam kết tủa. Coi toàn bộ lượng kim loại sinh ra đều bám hết vào catot. Giá trị của (m + a) gần nhất với A. 33. B. 36. C. 39. D. 42. Câu 25. Tiến hành điện phân dung dịch chứa m gam hỗn hợp CuSO4 và NaCl (hiệu suất 100%, điện cực trơ, màng ngăn xốp), đến khi nước bắt đầu bị điện phân ở cả hai điện cực thì ngừng điện phân, thu được dung dịch X và 6,72 lít khí (đktc) ở anot. Dung dịch X hòa tan tối đa 20,4 gam Al2O3. Giá trị của m gần nhất với A. 23,5. B. 25,5. C. 50,5. D. 51,5.

Khối lượng giảm:

0 00

P Ấ C

||→ ∑Cura bên catot = 0,2 mol → ne trao đổi = 0,4 mol ||→ t = 0,4 × 96500 ÷ 5 = 7720 giây. Câu 2: A Số mol e trao đổi là Catot gồm 0,3 mol Fe3+, 0,075 mol Cu2+, 0,2 mol H+, H2O 0,3 ---------- > 0,3 0,05 <--------- 0,1 Anot:

Ỡ Ư D

NG

N Á O

T

Í -L

-

A Ó H

2

N Ầ TR

Câu 4: A

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

0,1 mol CuCl2 có khối lượng 13,5 < 21,5 → dung dịch giảm là do 0,1 mol CuCl2 và 0,1 mol CuO.

UY

Như vậy, anot đã có sự điện phân H2O

nếu

Câu 1: A có số mol NaCl là 0,2 mol và CuSO4 là 0,3 mol.

N Ơ H

Dung dịch sau điện phân có thể hòa tan Fe3O4 nên đã có ion H+.

1 3 +

B

H

G N Ư

O Ạ Đ

.Q P T

N

thì khối lượng giảm chính là

Trường hợp sau không thõa mãn. Câu 5: B

................................... 0,1 <------ 0,4 Khối lượng dung dịch sau điện phân giảm:

I Ồ B

Câu 3: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Khối lượng dung dịch giảm chính là khối lượng của kim loại, khí oxi và khí NO Câu 9: A

UY

Câu 6: D Câu 7: D Trước hết cần biết, nếu thời gian điện phân đủ thì có thể xảy ra các phản ứng điện phân như sau:

Bên Catot (-):

Câu 10: A

Bên Anot (+)

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Vì thu được hỗn hợp kim loại nên Fe dư, dung dịch chỉ gồm

0 00

Theo định luật Faraday:

thay vào anot thì thấy: 0,04 < 0,05 ( Cl- trong NaCl) nên Cl- chưa phản ứng hết.

P Ấ C

2

1 3 +

Thay vào anot thấy có 0,02 mol e nhận ở pw(1). tiếp theo Cu2+ dư, chỉ phản ứng 0,01 mol ( để nhận thêm 0,02 mol e nhận ).

-

A Ó H

Vậy, sau khi điện phân, dung dịch mất đi gồm: 0,02 mol khi Clo bay ra cùng vs 0,01 mol Cu tạo thành.

N Á O

Vậy khối lượng của dung dịch X giảm: Câu 8: D

Ỡ Ư D

NG

T

Vì là thanh Fe nên Fe còn dư, sản phẩm cuối cùng là sắt(II)

I Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

Câu 11: C n NaCl = 0,14 mol và n Cu(NO3)2 = 0,18 mol. Từ số mol, ta có q.trình điện phân đến lúc ngừng là: (1). Cu(NO3)2 + 2NaCl → Cu + Cl2 + 2NaNO3 || (2). Cu(NO3)2 + H2O → Cu + 2HNO3 + ½.H2O. Do điện cực nằm trong dung dịch nên: 3Cu + 8H+ + 2NO3- → 3Cu2+ + 2NO↑ + 4H2O. Thay số mol lần lượt vào các phương trình → n Cu thu được = 0,18 do điện phân – 0,0825 bi hoa tan

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

↔ n Cu = 0,0975 mol. → m = 6,24 gam. Thời gian: t = n.ne × 96500 ÷ I ÷ 3600 = 2,5 h.

N Ơ H

Để lượng Fe là tối đa thì sản phẩm khử chỉ ra Fe II

Câu 12: A

UY

Khí thoát ra khỏi 2 điện cực nên catot là Cu và Ag Ta có 0,1x.2 + 0,1y=0,3 0,1x.64 + 0,1y.108=17,2 => x=y=1

.Q P T

N

Câu 16: B Câu 17: B Vì cho thanh sắt vào thì thấy thoát khí nên trong dung dịch X có H+ tức là Cl- điện phân hết

Câu 13: C

G N Ư

O Ạ Đ

Bài toán chia thành 2 TH là Cu 2+ hết và dư. Dạng bài này thì thường gặp là Cu 2+ dư tác dụng với Fe nên ta xét luôn TH này

0 00

Câu 14: B Vì có khí NO nên Cl- bị điên phân hết

N Á O

-L

H Í

ÓA

P Ấ C

2

1 3 +

B

N Ầ TR

H

Thanh sắt giảm tức là Fe dư, Fe phản ứng tạo Fe II

Câu 18: A Hh 2 kim loại cuối cùng. Từ đó ta suy ra trong dung dịch vẫn còn muối Cu và muối Fe thu được là Fe II Nếu Cl- bị điện phân hết thì khối lượng dung dịch giảm là bị điện phân

Ở anot nước cũng

T

Câu 15: C Ở anot thoát ra 0,03 mol khí. Đó là 0,03 mol khí Clo

I Ồ B

Ỡ Ư D

NG

Sau điện phân dung dịch gồm

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com → nHCl = 2nMgCl2 = 0,4 mol → mdd HCl =

N Ơ H

= 73 gam

UY

N

+ 2,72-73 ≈ 11,265 gam. Bảo toàn khối lượng → m= Câu 23: C Nhận thấy dung dịch Y hòa tan tối đa 0,02 mol MgO → trong Y chứa H+ = 2nMgO = 0,04 mol → nO2 = 0,01 mol 2+

O Ạ Đ

.Q P T

Vì khí sinh ra ở 2 điện cực. Bên catot điện phân Cu : 0,05 mol và điện phân nước sinh ra x mol H2 Bên anot điện phân Cl- sinh ra Cl2 : y mol và điện phân nước sinh ra O2 : 0,01 + 0,5x.

G N Ư

Chú ý khi điện phân hết Cu2+ thì quá trình điện phân chỉ là điện phân nước : 2H2O → 2H2 + O2. Vậy cứ x mol H2 sinh ra bên catot thì bên anot có 0,5x mol O2 → ∑ nO2 = 0,01 + 0,5x

Câu 19: D

N Ầ TR

Khi đó ta có hệ Khi catot bắt đầu có khí tức là Cu điện phân vừa hết

B

H

Vậy ne trao đổi = 2nCu + 2nH2 = 2. 0,05 + 2. 0,04 = 0,18 mol

Câu 20: A Câu 21: A Ở thời điểm t giây thì khí thu được gồm Cl2: 0,075 mol và O2: 0,025 mol

H Í

Số electron trao đổi ở thời điểm t giây là : 0,075. 2 + 0,025. 4= 0,25 mol → Số electron trao đổi ở thời điểm 2t giây là: 0,25.2 = 0,5 mol

ÁN

Vậy ở thời điểm 2t giây ở anot thu được 0,075 mol Cl2 và O2: → nH2 = 0,2125-0,075- 0,0875= 0,05 mol

NG

TO

-L

ÓA

P Ấ C

= 0,0875 mol

Ở thời điểm 2t giây nước ở cả 2 điện cực đều điện phân sinh khí→ bên catot Cu bị điện phân hết

D I BỒ

ƯỠ

Bảo toàn electron → 2nCu + 2nH2 = 0,5 → a = 0,2. Câu 22: B Nhận thấy kim loại thu được ở catot là Mg → nMg = nMgCl2= 0,2 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

2+

31

0 00

Có ne = = Câu 24: D

= 0,18 → t = 8685 giây.

Số electron trao đổi là ne =

=

= 0,3 mol

Bên anot xảy ra quá trình điện phân nước → nH+ = 0,3 mol Dung dịch sau điện phân chứa M2+: x mol, H2+ : 0,3 mol, SO42Khi thêm 0,2 mol NaOH và 0,2 mol KOH thì H+ tham gia phản ứng trước, sau đó đến M2+ hình thành M(OH)2

→ nM(OH)2 =

= 0,05 mol → M = 4,9 : 0,05 = 98 (Cu(OH)2)

Bên catot điện phân ion Cu2+ → nCu2+ điện phân = 0,3 : 2 = 0,15 mol → a = 0,15. 64 = 9,6 gam ∑ nCuSO4 = 0,15 + 0,05 = 0,2 mol → m = 32 gam → m + a= 41,6 gam. Câu 25: D TH1: Dung dịch sau điện phân chỉ có NaOH, anot chỉ có Cl2: 0,3 mol. nNaOH = 0,2 x 2 = 0,4 mol → nH2 = 0,2 mol.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vậy m = 0,6 x 58,5 + 0,1 x 160 = 51,1 gam.

UY

• TH2: Trong dung dịch có H+ có hai khí thoát ra ở anot Cl2: a mol và O2: b mol.

→ a = 0 mol → loại.

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

21. Phương pháp giải bài toán AgNO3 tác dụng với dung dịch (Fe2+, Cl-) (Đề 1)

Câu 1. Cho 46,4 gam hỗn hợp bột Fe, Cu tác dụng với 800 ml hỗn hợp dung dịch HCl 2M và HNO3 0,5 M thu được 12,8 gam chất rắn không tan; dung dịch A và 8,96 lít khí NO. Cho dung dịch A tác dụng với lượng dư AgNO3 thu được m gam kết tủa. Biết rằng NO là sản phẩm khử duy nhất của N+5, khí đo ở đktc. Giá trị của m là A. 294,4. B. 262. C. 64,8. D. 229,6. Câu 2. Cho 0,2 mol FeCl2 vào dung dịch chứa 0,7 mol AgNO3, sau các phản ứng xảy ra hoàn toàn thu được khối lượng kết tủa là A. 21,6 gam. B. 57,4 gam. C. 75,6 gam. D. 79,0 gam. Câu 3. Hòa tan hết 8,4 gam kim loại Fe trong 200ml dung dịch HCl 2M thu được dung dịch X. Cho dung dịch X tác dụng với dung dịch AgNO3 dư; sau khi kết thúc phản ứng thu được khí NO (duy nhất), dung dịch Y và m gam kết tủa. Giá trị của m là A. 59,25 B. 57,4 C. 73,6 D. 65,5 Câu 4. Hòa tan hết m gam Cu vào dung dịch gồm Fe(NO3)3 và HCl ( dùng dư HCl) thu được 4,48 lít khí ở đktc và dung dịch X. Cho tiếp 19,2 gam Cu vào dung dịch X, sau phản ứng hoàn toàn thấy còn dư 6,4 gam chất rắn, lọc bỏ chất rắn, đem cô cạn phần dung dịch thu được muối hỗn hợp muối Y. Hòa tan Y vào dung dịch AgNO3 dư ta thu được 183 gam kết tủa. Biết rằng sản phẩm khử duy nhất của HNO3 là khí NO. Giá trị của m là: A. 19,2 gam. B. 32,0 gam. C. 21,6 gam. D. 28,8 gam. Câu 5. Hòa tan hết m gam Cu vào dung dịch gồm Fe(NO3)3 0,1M và HCl 1,5M thu được V lít khí ở đktc và dung dịch X. Cho tiếp 19,2 gam Cu vào dung dịch X, sau phản ứng hoàn toàn thấy còn dư 6,4 gam chất rắn, lọc bỏ chất rắn, đem cô cạn phần dung dịch thu được muối hỗn hợp muối Y. Cho Y vào dung dịch AgNO3 dư ta thu được 183 gam kết tủa. Biết rằng sản phẩm khử duy nhất của HNO3 là khí NO. Giá trị của m gần nhất với A. 22. B. 21. C. 19. D. 20. Câu 6. Cho hỗn hợp gồm 25,6 gam Cu và 23,2 gam Fe3O4 tác dụng với 400 ml dung dịch HCl 2M cho đến khi phản ứng hoàn toàn thu được dung dịch X và chất rắn Y. Cho X vào dung dịch AgNO3 dư thu được m gam chất rắn Z. Giá trị của m là A. 114,8 B. 32,4 C. 147,2

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 125,6 Câu 7. Cho từ từ đến hết 100 ml dung dịch FeCl2 1,0M vào 200 ml dung dịch AgNO3 1,2M, thu được m gam kết tủa. Giá trị của m là A. 10,80. B. 20,12. C. 31,60. D. 33,02. Câu 8. Cho dung dịch X chứa x mol FeCl2 và x mol NaCl vào dung dịch chứa 3,6x mol AgNO3 thu được 96,93 gam kết tủa và dung dịch Y. Khối lượng chất tan có trong dung dịch Y là A. 33,39. B. 47,7. C. 58,86. D. 62,57. Câu 9. Hòa tan hết 2,24 gam bột Fe vào 120 ml dung dịch HCl 1M, thu được dung dịch X. Cho X tác dụng với lượng dư dung dịch AgNO3, sau khi kết thúc các phản ứng thu được V lít khí NO (sản phẩm khử duy nhất, đktc) và m gam chất rắn. Giá trị của m và V lần lượt là: A. 17,22 và 0,224 B. 1,08 và 0,224 C. 18,3 và 0,448 D. 18,3 và 0,224 Câu 10. Cho m gam kim loại R tan hoàn toàn trong 200 ml dung dịch HCl 0,5M thu được dung dịch X và 2,016 lít H2 (ở đktc). Cho dung dịch AgNO3 dư vào dung dịch X thì thu được bao nhiêu gam kết tủa ? A. 14,35 gam B. 23,63 gam C. 24,35 gam D. 28,70 gam Câu 11. Cho dung dịch X chứa x mol FeCl2 và x mol NaCl vào dung dịch chứa 3,8x mol AgNO3 thu được 61,176 gam kết tủa và dung dịch Y. Khối lượng chất tan có trong dung dịch Y là A. 38,684 B. 40,439 C. 38,258 D. 38,019 Câu 12. Hoà tan hoàn toàn hỗn hợp gồm 8,4 gam Fe và 4,8 gam Cu trong 500 ml dung dịch hỗn hợp HNO3 0,3M và HCl 1,2M, thu được khí NO (khí duy nhất) và dung dịch X. Cho X vào dung dịch AgNO3 dư thu được m gam chất rắn. Biết các phản ứng đều xảy ra hoàn toàn, NO là sản phẩm khử duy nhất của N+5. Giá trị m gần nhất với A. 60 B. 86 C. 90 D. 102 Câu 13. Nung 19,4 gam Fe(NO3)2 và AgNO3 một thời gian thu được hỗn hợp chất rắn X. Cho X vào nước đến khi các phản ứng hoàn toàn thu được chất rắn Y và dung dịch Z. Cho Y vào dung dịch HCl dư có 4,32 gam chất rắn không tan. Cho Z tác dụng với dung dịch HCl dư thì có khí không màu thoát ra hoá nâu trong không khí. Phần trăm khối lượng của AgNO3 trong hỗn hợp đầu có giá trị gần nhất với A. 34,0%.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 34,5%. C. 35,0%. D. 35,5%. Câu 14. Hòa tan hoàn toàn hỗn hợp gồm 3,36 gam Fe và 1,92 gam Cu trong 600 ml dung dịch hỗn hợp HNO3 0,1M và HCl 0,4M, thu được khí NO (khí duy nhất) và dung dịch X. Cho X vào dung dịch AgNO3 dư, thu được m gam chất rắn, Biết các phản ứng đều xảy ra hoàn toàn, NO là sản phẩm khử duy nhất của N+5 trong các phản ứng. Giá trị của m là A. 36,06. B. 40,92. C. 34,44. D. 35,10. Câu 15. Hỗn hợp X gồm Fe3O4 và Cu (tỉ lệ mol 1:2). Cho m gam X tác dụng vừa đủ với dung dịch chứa 0,08 mol HCl, kết thúc phản ứng thu được dung dịch Y và còn lại m1 gam chất rắn Z. Cho dung dịch Y tác dụng với dung dịch AgNO3 dư thu được m2 gam kết tủa. Giá trị của m1, m2 là A. 0,64 gam và 11,48 gam. B. 0,64 gam và 2,34 gam. C. 0,64 gam và 14,72 gam. D. 0,32 gam và 14,72 gam. Câu 16. [PHV-FC]: Hòa tan hết 10,8 gam hỗn hợp gồm Fe3O4 và Fe2O3 và Fe vào dung dịch chứa a mol HCl, kết thúc phản ứng thu được 0,672 lít khí H2 (đktc) dung dịch X có chứa 9,75 gam FeCl3. Cho dung dịch AgNO3 dư vào dung dịch X thấy thoát ra lít khí NO (sản phẩm khử duy nhất) và 66,38 gam kết tủa. Giá trị của a là A. 0,44. B. 0,46. C. 0,54. D. 0,50. Câu 17. Đốt cháy hỗn hợp gồm 0,96 gam Mg và 2,24 gam Fe với hỗn hợp khí X gồm clo và oxi, sau phản ứng chỉ thu được hỗn hợp Y gồm các oxit và muối clorua (không còn khí dư). Hòa tan Y bằng một lượng vừa đủ 60 ml dung dịch HCl 2M, thu được dung dịch Z. Cho AgNO3 dư vào dung dịch Z,thu được 28,345 gam kết tủa. Phần trăm thể tích của clo trong hỗn hợp X là A. 46,15%. B. 43,64%. C. 53,85%. D. 56,36%. Câu 18. Hỗn hợp X gồm Cu, FeO, Fe2O3 trong đó oxi chiếm 17,624% khối lượng hỗn hợp. Cho m gam hỗn hợp X tác dụng với dung dịch HCl dư thu được dung dịch Y có tổng khối lượng chất tan là 63,76 gam và còn 7,68 gam chất rằn không tan. Cho dung dịch Y tác dụng với dung dịch AgNO3 dư thu được a gam kết tủa và có 0,672 lít khí NO (đktc, sản phẩm khử duy nhất của N+5). Giá trị của a là A. 184,16 B. 176,24 C. 192,14 D. 164,28 Câu 19. [PHV-FC]: Đốt cháy hỗn hợp rắn X gồm Mg và Fe trong oxi một thời gian thu được 15,2 gam hỗn hợp rắn Y. Hòa tan toàn bộ Y trong dung dịch chứa 0,7 mol HCl, thu được 2,016 lít khí H2 (đktc) và dung dịch Z. Cho AgNO3 dư vào dung dịch Z thấy thoát ra 0,672 lít khí NO (sản phẩm khử duy nhất; đktc) và 103,69 gam kết tủa. Các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng của Mg trong hỗn hợp X là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 12%. B. 16%. C. 18%. D. 20%. Câu 20. [PHV-FC]: Đốt cháy hỗn hợp rắn gồm 3,36 gam Mg và 17,92 gam Fe với V lít (đktc) hỗn hợp khí gồm Cl2 và O2 thu được hỗn hợp rắn X gồm các oxit và muối clorua (không thấy khí thoát ra). Hòa tan hoàn toàn rắn X trong 550 ml dung dịch HCl 0,8M thu được dung dịch Y chỉ chứa các muối clorua. Cho AgNO3 dư vào dung dịch Y thu được 174,035 gam kết tủa. Giá trị của V là A. 7,728 lít. B. 9,296 lít. C. 10,192. D. 8,176 lít. Câu 21. Hòa tan hết 23,76 gam hỗn hợp X gồm FeCl2, Cu, Fe(NO3)2 vào 400ml dng dịch HCl 1M thu đươc dung dịch Y. Cho từ từ dung dịch chứa AgNO3 1M vào Y đến các phản ứng xảy ra hoàn toàn đã dùng hết 580ml, kết thúc thu được m gam kết tủa và thoát ra 0,448 lít khí ở đktc. Biết NO là sản phẩm khử duy nhất của N+5 trong cả quá trình, giá trị của m gần nhất với A. 80 B. 83 C. 82 D. 81 Câu 22. Hỗn hợp X gồm Fe2O3, FeO và Cu (trong đó nguyên tố Fe chiếm 52,5% khối lượng). Cho m gam X tác dụng với 84 ml dung dịch HCl 2M (dư) tới phản ứng hoàn toàn, thu được dung dịch Y và còn lại 0,2m gam chất rắn không tan. Cho dung dịch AgNO3 dư vào Y thu được khí NO và 28,32 gam kết tủa. Giá trị của m là A. 8,0 B. 6,4 C. 8,8 D. 9,6 Câu 23. [PHV-FC]: Cho m gam bột Fe vào bình kín chứa đồng thời 0,06 mol O2 và 0,03 mol Cl2, rồi đốt nóng. Sau khi các phản ứng xảy ra hoàn toàn chỉ thu được hỗn hợp chất rắn chứa các oxit sắt và muối sắt. Hòa tan hết hỗn hợp này trong một lượng dung dịch HCl (lấy dư 25% so với lượng cần phản ứng) thu được dung dịch X. Cho dung dịch AgNO3 dư vào X, sau khi kết thúc các phản ứng thì thu được 53,28 gam kết tủa (biết sản phẩm khử của N+5 là khí NO duy nhất). Giá trị của m là (Chuyên Nguyễn Huệ - Hà Nội) A. 6,44. B. 6,72. C. 5,88. D. 5,60. Câu 24. Hỗn hợp X gồm FeO, Fe2O3, Fe3O4. Hoà tan hết m gam hỗn hợp X trong 1,9 lít dung dịch HCl 2M (dư) thu được dung dịch Y chứa 2,062m gam chất tan. Cho dung dịch Y tác dụng với dung dịch AgNO3 dư thu được p gam kết tủa Z và có 2,016 lít NO (đktc, sản phẩm khử duy nhất) sinh ra. Giá trị của p là A. 568,2. B. 572,3. C. 579,6. D. 589,8.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 25. Cho 30,88 gam hỗn hợp Cu, Fe3O4 vào V ml dung dịch HCl 2M được dung dịch X và thấy còn 1,28 gam chất rắn. Cho AgNO3 dư tác dụng với dung dịch X được 0,56 lít khí không màu hoá nâu ngoài không khí và m gam kết tủa. Giá trị của m là A. 153,45. B. 100,45. C. 143,5. D. 114,8.

UY

Vì dư HCl nên NO3- phản ứng hết, Cu dư nên toàn bộ

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B Do còn kim loại dư nên Fe tạo thành Fe2+.

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

Câu 5: A Xét toàn bộ quá trình, gọi tổng lượng Cu phản ứng là x mol, số mol Fe(NO3)3 là y mol.

Gọi số mol Fe và Cu phản ứng là x và y. Ta có hệ

N Ầ TR

H

Trong Y chắc chắn là x mol CuCl2 và y mol FeCl2 (do HCl dư ↔ H+ dư, NO3- hết không thể có Fe3+ được). Cho e: Cu → Cu2+ + 2e. Nhận e: Fe3+ + e → Fe2+ và 4H+ + NO3- + 3e → NO + 2H2O.

Trong A có 0,6 mol Fe2+, 1,6 mol Cl- và 0,4 mol H+. Cho vào AgNO3 dư: 0,4 ----------------------> 0,3

31

Câu 2: D Ag+ + Fe2+ → Fe3+ + Ag↓(1), và Ag+ + Cl- → AgCl↓ (2) Sau (1) và (2) thì Ag+ luôn dư Vậy mkết tủa = mAg + mAgCl = 0,2. 108 + 0,4.143,5 = 79 gam. Câu 3: D

I Ồ B

Câu 4: A

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

0 00

2+

B

để ý H+ dư nên số mol e tính theo NO3- . → 2x = y + 9y ↔ x = 5y. Cho Y vào AgNO3/NH3 dư thì kết tủa sẽ gồm y mol Ag (do Ag+ + Fe2+ → Ag↓ + Fe3+ )

và (2x + 2y) mol AgCl ↔ 12y mol AgCl. → m↓ = 108y + 12y × 143,5 = 183 → y = 0,1 mol → x = 0,5 mol ↔ 32 gam Cu. Tuy nhiên, thật chú ý rằng: 32 gam = m + (19,2 – 6,4) → m = 19,2 gam. Câu 6: C Nhận thấy sau phản ứng thu được chất rắn Y là Cu → dung dịch X chứa FeCl2 và CuCl2

Cu + Dd X

chất rắn

Bảo toàn nguyên tố Cl → nAlCl = nHCl = 0,8 mol Chỉ có FeCl2 phản ứng với AgNO3 sinh Ag Có nAg = nFeCl2 = 0,3 mol → m = mAg + mAgCl = 0,3. 108 + 0,8. 143, 5 = 147, 2 gam. Câu 7: C Câu 8: D Câu 9: D

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Vì NO3- dư (AgNO3 dư)→ nNO= nH+ : 4 = 0,075 mol Bảo toàn electron cho toàn bộ quá trình → 3nFe + 2nCu= nAg + 3nNO→ nAg=0,015 mol

UY

Vậy m= 0,015.108 + 0,24.143,5= 36,06 gam. Câu 15: C Giả sử có x mol Fe3O4 và 2x mol Cu. Fe3O4 + 8HCl → FeCl2 + 2FeCl3 + 4H2O x--------8x 2FeCl3 + Cu → 2FeCl2 + CuCl2 2x-------x Câu 10: B Câu 11: C Câu 12: C

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Ta có 8x = 0,08 → x = 0,01 mol. → nCu dư = x mol = 0,01 mol → m1 = 0,01 x 64 = 0,64 gam.

0 00

B

• ddY gồm 0,03 mol FeCl2; 0,01 mol CuCl2

H Í

ÓA

P Ấ C

2+

Câu 13: C Vì Z tác dụng với dung dịch HCl dư thì có khí không màu thoát ra hoá nâu trong không khí nên trong Z còn Fe II tức là Ag+ đã phản ứng hết tạo Ag

Câu 14: A

D I BỒ

ƯỠ

NG

N Á O

-L

31

Ag+ + Cl- → AgCl↓ --------0,08-----0,08 Fe2+ + Ag+ → Fe3+ + Ag↓ 0,03-------------------------0,03

→ m2 = 0,08 x 143,5 + 0,03 x 108 = 14,72 gam Câu 16: A Quy đổi hỗn hợp đầu gồm 0,03 mol Fe; 0,03 mol Fe2O3 và 0,06 mol FeO. ||→ X chứa 0,06 mol FeCl3; 0,09 mol FeCl2 và 4x mol HCl còn dư.

T

NO + Dung dịch X

m gam

Quan sát:

Bảo toàn nguyên tố Cl → nAgCl = nCl- = 0,24 mol

(4x HCl suy ra x mol NO; còn lại các giả thiết được ban bật cơ bản).

4H+ + NO3- + 3e → NO + 2H2O

||→ mtủa = mAg + mCl = 108 × (0,45 + x) + 35,5 × (0,36 + 4x) = 66,38 gam ||→ x = 0,02 mol.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vậy giá trị của a = 0,36 + 4x = 0,44 mol. Câu 17: C

hỗn hợp

Y

N Ơ H

||→ có ngay hệ:

Z

Yêu cầu: %mMg trong X = 0,08 × 24 ÷ 12 = 16%. Câu 20: C Đọc thật kĩ quá trình để gộp được sơ đồ như sau:

+ dung dịch chứa

Khi tác dụng với HCl chỉ có các oxit bị hòa tan

G N Ư

UY

O Ạ Đ

.Q P T

N

→ nHCl = 4nO2 → nO2 = 0,03 mol

(► cần chú ý chỗ nào? X chỉ gồm muối Clorua và oxit nên không có H2; Y chỉ chứa các muối tức không dư H+ → không có NO trong sơ đồ).

Gọi số mol của Cl2 và Ag lần lượt là x, y mol

Vẫn như cũ: nếu có được sơ đồ như trên rồi thì mọi chuyện lại trở nên rất đơn giản.! Thật vậy:

Bảo toàn nguyên tố Cl → nAgCl = 2nCL2 + nHCl = 2. x + 0,12

0,44 mol HCl → 0,22 mol H2O → 0,11 mol O2.

0 00

→ 143,5( 2. x + 0,12) + 108y = 28,345

→ 3. 0,04 + 2.0,04 = 2.x + 4. 0,03 + y Giải hệ → x= 0,035 và y = 0,01

%Cl2 = . 100% = 53,85%. Câu 18: B Câu 19: B Gộp quá trình, xử lí nhanh giả thiết + quá trình:

ƯỠ

H

0,14 mol Mg và 0,32 mol Fe → ∑nNO3– = 0,32 × 3 + 0,14 × 2 = 1,24 mol = nAgNO3.

Bảo toàn electron cho toàn bộ quá trình 3nFe + 2nMg = 2nCl2 + 4nO2 + nAg

NG

B

N Ầ TR

N Á O

-L

Í-

A Ó H

T

P Ấ C

2

1 3 +

||→ trong 174,035 gam kết tủa gồm 1,24 mol Ag và đương nhiên còn lại là 1,13 mol Cl.

Trừ đi lượng Cl trong HCl là 0,44 mol thì còn lại là của 0,345 mol khí Cl2. Vậy ∑nhỗn hợp khí Cl2 và O2 = 0,11 + 0,345 = 0,455 mol ||→ V = 10,192 lít. Câu 21: B Nhận thấy khi thêm AgNO3 vào dung dịch Y sinh 0,01 mol NO chứng tỏ dung dịch Y chứa muối Clorua và HCl dư → nHCl dư = 4nNO = 4. 0,02 = 0,08 mol → nHCl pư = 0,4 - 0,08 = 0,32 mol Vì HCl còn dư nên toàn bộ lượng NO3- trong Fe(NO3)2 chuyển hết thành khí NO → 2nFe(NO3)2 = nHCl pư : 4 → nFe(NO3)2 = 0,32 :4:2 = 0,04 mol Gọi số mol FeCl2, Cu và Ag lần lượt là x, y,z mol Vì AgNO3dư nên ∑ nNO = nHCl : 4 = 0,1 mol

♦ Ghép cụm: nO trong oxit = nH2O – 2nNO = 0,2 mol (hoặc có thể dùng bảo toàn electron kiểu mới:

D I BỒ

nO trong oxit = (∑nNO3– trong dung dịch – 3nNO) ÷ 2 = 0,2 mol).

Bảo toàn electron cho toàn bộ quá trình : nFeCl2 + 2nCu + nFe(NO3)2 = 3∑nNO + nAg → x+ 2y + 0,04.= 0,1. 3 + z Kết tủa sinh ra gồm AgCl : 2x + 0,4 và Ag : z mol. Bảo toàn nguyên tố Ag → 2x+ 0,4 + z= 0,58

||→ mMg + Fe = 15,2 – mO trong oxit = 12 gam.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com ||→ Yêu cầu m = mFe = 0,12 × 56 = 6,72 gam. Câu 24: B Câu 25: A

Ta có hệ

UY

→ m↓ = 143,5. ( 2. 0,0 8+ 0,2) + 0,02. 108 = 82,52 gam. Câu 22: B Gọi số mol của Fe2O3, FeO lần lượt là x, y

% Fe =

.100% =52,5% (1)

Vì sau phản ứng còn 0,2m gam Cu dư nên dung dịch Y chứa Có 64z = 0,2m + 64x → 64z =0,2. (160x + 72y + 64z) + 64x (2)

NO + 28,32 gam

+ Cu : z- x mol

Vì AgNO3 dư → 4nNO = nH+ = 0,042- 1,5x - 0,5y Bảo toàn electron → nFe2+ = 3nNO + nAg → 2x + y = 3. (0,042- 1,5x - 0,5y) + 0,039 (3) Giải hệ (1), (2), (3) → x = 0,01 , y = 0,04 , z= 0,03 mol → m = 0,01. 160 + 0,04. 72 + 0,03. 64 = 6,4 gam. Câu 23: B nHCl cần = 2nO trong oxit = 0,24 mol → nHCl đã dùng (dư 25%) = 0,3 mol.

Gộp quá trình:

Ỡ Ư D

NG

N Á O

0 00

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

T

Ghép cụm có nH2O = nO trong oxit + 2nNO ||→ nNO = 0,015 mol. ∑nCl = 0,36 mol đi hết vào 53,28 gam tủa → về nguyên tố nAg trong tủa = 0,375 mol

I Ồ B

Bảo toàn N có nFe(NO3)3 = (0,375 – 0,015) ÷ 3 = 0,12 mol.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

22. Một số Bài tập HAY - LẠ - KHÓ về Anđehit - Axit cacboxylic (Đề 1)

Câu 1. Đem đốt cháy m gam hỗn hợp X gồm 0,01 mol HCOONa và 2 muối natri của hai axit cacboxylic no đơn chức mạch hở đồng đẳng liên tiếp thu được 2,65 gam Na2CO3 và khối lượng CO2 lớn hơn khối lượng nước là 3,51 gam. Vậy m có giá trị là: A. 5,20 gam B. 4,94 gam C. 5,02 gam D. 4,49 gam Câu 2. Hợp chất hữu cơ X có công thức là C8H6O2 với các nhóm thế trên các nguyên tử cacbon liên tiếp trong vòng benzen. X vừa tác dụng được với dung dịch NaOH vừa tác dụng được với dung dịch AgNO3/NH3. Số công thức cấu tạo thoả mãn với điều kiện của X là A. 1 B. 2 C. 3 D. 4 Câu 3. Đốt cháy hoàn toàn 0,1 mol hỗn hợp X gồm một anđehit A và một axit cacboxylic B( A hơn B một nguyên tử cacbon trong phân tử) thu được 3,36 lít khí CO2 (ở đktc) và 1,8 gam nước. Khi cho 0,2 mol X tham gia phản ứng tráng gương hoàn toàn với dung dịch AgNO3 dư trong NH3 thu được m gam kết tủa. Giá trị của m là A. 86,4. B. 32,4. C. 43,2. D. 64,8 Câu 4. Đốt cháy hòan tòan 16,08 gam chất X thu được 12,72 gam Na2CO3 và 5,28 gam CO2. Cho X tác dụng với dung dịch HCl thu được axit cacboxylic 2 lần axit Y. Hãy chọn công thức phân tử đúng của axit Y. A. H4C3O4 ; B. H4C4O4 ; C. H2C4O4 ; D. H2C2O4. Câu 5. Cho m gam hỗn hợp M gồm hai axit X, Y (Y nhiều hơn X một nhóm -COOH) phản ứng hết với dung dịch NaOH tạo ra (m + 8,8) gam muối. Nếu cho toàn bộ lượng M trên tác dụng với lượng dư dung dịch AgNO3 trong NH3, sau phản ứng kết thúc thu được 43,2 gam Ag và 13,8 gam muối amoni của axit hữu cơ. Công thức của Y và giá trị của m lần lượt là : A. HOCO-COOH và 18,1 B. HOCO-CH2-COOH và 30,0 C. HOCO-CH2-COOH và 19,6 D. HOCO-COOH và 27,2 Câu 6. Hỗn hợp M gồm anđehit X, xeton Y ( X, Y có cùng số nguyên tử cacbon) và anken Z. Đốt cháy hoàn toàn m gam M cần dùng 8,848 lít O2 (đktc) sinh ra 6,496 lít CO2 (đktc) và 5,22 gam H2O. Công thức của anđehit X là : A. C2H5CHO B. CH3CHO

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. C3H7CHO D. C4H9CHO Câu 7. Hỗn hợp A gồm 6 gam chất X có công thức R-COOH và 0,1mol chất Y có công thức HO-R’-COOH, trong đó R, R’ là gốc hiđrocacbon no hở. Cho hỗn hợp A vào bình kín B dung tích 5,6 lít không đổi chứa oxi ở 0oC và 2atm. Đốt cháy hết X, Y và đưa về nhiệt độ ban đầu thấy áp suất vẫn 2atm. Khí trong bình qua dung dịch NaOH bị hấp thụ hoàn toàn. % khối lượng của Y trong A là: A. 75% B. 40% C. 50% D. 60% Câu 8. X là một anđehit mạch hở có số nguyên tử C trong phân tử nhỏ hơn 4. Cho 1 mol X tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 2 mol Ag; mặt khác 1 mol X phản ứng tối đa 2 mol H2. Phân tử khối của X là A. 56 B. 44 C. 54 D. 72 Câu 9. Một anđehit X mạch hở có tỉ khối so với H2 nhỏ hơn 30. X phản ứng tối đa với H2 theo tỉ lệ mol 1 : 3. Cho 0,1 mol X tác dụng với dd AgNO3/NH3 dư thì thu được bao nhiêu gam chất rắn ? A. 39,3 gam. B. 21,6 gam. C. 41 gam. D. 19,4 gam. Câu 10. Hỗn hợp X gồm hai anđehit là đồng đẳng kế tiếp. Khử hoàn toàn X cần x mol H2, được hỗn hợp Y. Cho Y phản ứng với Na dư thu được x gam H2. Mặt khác cho lượng hỗn hợp X trên phản ứng với lượng dư AgNO3 trong NH3 thì thu được 378x gam Ag. Phần trăm khối lượng của anđehit có khối lượng phân tử nhỏ hơn trong hỗn hợp X là A. 67,164 %. B. 48,64 %. C. 54,124 %. D. 75 %. Câu 11. Cho hỗn hợp X gồm hidro, propen, propanal, ancol anlylic. Đốt cháy hoàn toàn 0,5 mol X thu được 20,16 lít CO2 (đktc). Đun X với bột Ni một thời gian thu được hỗn hợp Y có dX/Y = 0,8. Nếu lấy 0,2 mol Y tác dụng vừa đủ với V lít dung dịch nước Br2 0,1M. Giá trị của V là A. 1,2 lít B. 0,8 lít C. 1,0 lít D. 0,4 lít Câu 12. Cho 13,6 gam một chất hữu cơ X ( có thành phần nguyên tố C, H, O ) tác dụng vừa đủ với dung dịch chứa 0,6 mol AgNO3 trong NH3, đun nóng, thu được 43,2 gam Ag. Công thức cấu tạo của X là A. CH≡C-CH2-CHO B. CH2=C=CH-CHO C. CH3-C≡C-CHO D. CH≡C-[CH2]2-CHO.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13. Đun nóng hỗn hợp X gồm: 0,1 mol ancol anlylic; 0,08 mol anđehit acrylic (propenal); 0,06 mol isopren và 0,32 mol hiđro có Ni làm xúc tác thu được hỗn hợp khí và hơi Y. Tỉ khối của Y so với không khí là 375/203. Số mol Br2 tối đa tác dụng với 0,14 mol Y là A. 0,05 B. 0,10 C. 0,15 D. 0,20 Câu 14. Hỗn hợp X gồm một anđehit đơn chức, mạch hở và một ankin (phân tử ankin có cùng số nguyên tử H nhưng ít hơn một nguyên tử C so với phân tử anđehit). Đốt cháy hoàn toàn 1 mol hỗn hợp X thu được 2,4 mol CO2 và 1 mol nước. Nếu cho 1 mol hỗn hợp X tác dụng với dd AgNO3/NH3 thì khối lượng kết tủa thu được tối đa là: A. 144 gam. B. 230,4 gam. C. 301,2 gam. D. 308 gam. Câu 15. Hỗn hợp X gồm 1 anđehit và 1 hiđrocacbon mạch hở (2 chất hơn kém nhau 1 nguyên tử cacbon). Đốt cháy hoàn toàn 0,4 mol hỗn hợp X thu được 1,3 mol CO2 và 0,4 mol H2O. Nếu cho 31,8 gam hỗn hợp X tác dụng với dung dịch AgNO3/NH3 thì khối lượng kết tủa thu được tối đa là A. 149,40 gam. B. 209,25 gam. C. 216,45 gam. D. 224,10 gam. Câu 16. Hỗn hợp X có số mol bằng 0,4 mol và khối lượng bằng 24,8 gam gồm hai anđehit đơn chức, mạch hở (số liên kết π trong mỗi phân tử đều nhỏ hơn 5). Cho X tác dụng với dung dịch AgNO3 dư trong NH3 thì thấy có 1,1 mol AgNO3 phản ứng. Khi đốt cháy hết hỗn hợp X thì thu được khối lượng CO2 là A. 44 gam. B. 52,8 gam. C. 61,6 gam. D. 66 gam. Câu 17. Hỗn hợp X gồm hiđro, propen, axit acrylic, ancol anlylic (C3H5OH). Đốt cháy hoàn toàn 0,75 mol X, thu được 30,24 lít khí CO2 (đktc). Đun nóng X với bột Ni một thời gian, thu được hỗn hợp Y. Tỉ khối hơi của Y so với X là 1,25. Cho 0,1 mol Y phản ứng vừa đủ với V lít dung dịch Br2 0,1 mol. Giá trị của V là A. 0,4. B. 0,6. C. 0,5. D. 0,3. Câu 18. Cho 10,2 gam một chất hữu cơ X (có thành phần nguyên tố C, H, O) tác dụng vừa đủ với dung dịch chứa 0,45 mol AgNO3 trong NH3, đun nóng, thu được 32,4 gam Ag. Công thức cấu tạo của X là A. CH≡C-[CH2]2-CHO. B. CH3-C≡C-CHO. C. CH2=C=CH-CHO. D. CH≡C-CH2-CHO. Câu 19. Cho 500 ml dung dịch X chứa RCOOH và RCOOM (M là kim loại kiềm) tác dụng với 120 ml dung dịch Ba(OH)2 0,25 M. Sau phản ứng để trung hòa dung dịch cần thêm 7,5 gam HCl 14,6%. Sau đó cô cạn dung

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

dịch thu được 10,865 gam muối khan. Nếu đem 500 ml dung dịch X ở trên tác dụng với 250 ml dung dịch NaOH 0,2M; sau phản ứng hoàn toàn, cô cạn dung dịch thì khối lượng chất rắn thu được là A. 6,38 gam. B. 6,96 gam. C. 6,78 gam. D. 7,18 gam. Câu 20. Cho 3 chất hữu cơ X, Y, Z (mạch thẳng, chỉ chứa C, H, O) đều có khối lượng mol là 82 (trong đó X và Y là đồng phân của nhau). Biết 1,0 mol X hoặc Z tác dụng vừa đủ với 3,0 mol AgNO3 trong dung dịch NH3; 1,0 mol Y tác dụng vừa đủ với 4,0 mol AgNO3 trong dung dịch NH3. Kết luận không đúng khi nhận xét về X, Y, Z là A. Số liên kết π trong X, Y và Z lần lượt là 4, 4 và 3. B. Phần trăm khối lượng của hiđro trong X là 7,32% và trong Z là 2,44%. C. Phần trăm khối lượng oxi trong X là 39,02% và trong Z là 19,51%. D. Số nhóm chức -CHO trong X, Y và Z lần lượt là 1, 2 và 1. Câu 21. Đốt cháy hoàn toàn a gam hỗn hợp X gồm anđehit malonic (propanđial), fomanđehit, anđehit oxalic và anđehit acrylic cần 21,84 lít O2 và thu được 20,16 lít CO2 và 11,7 gam H2O. Nếu cho a gam hỗn hợp X trên tác dụng với lượng dư dung dịch AgNO3 trong NH3 đun nóng, đến phản ứng hoàn toàn thu được m gam Ag. Các thể tích khí đều đo ở đktc; m có thể nhận giá trị nào sau đây ? A. 162,0. B. 108,0. C. 135,0. D. 216,0. Câu 22. Axit no, mạch hở X có công thức đơn giản nhất là C2H3O2. Số đồng phân axit tối đa có thể có của X là A. 1. B. 2. C. 3. D. 4. Câu 23. Hỗn hợp Q gồm 1 axit no đơn chức mạch hở (X) và 1 axit không no mạch hở 2 chức có 1 nối đội C=C (Y) với số mol bằng nhau. Đốt a mol hỗn hợp Q thu được 3a mol CO2 và 2a mol H2O. Cho m gam hỗn hợp Q tác dụng với 400 ml dung dịch NaOH 1M (dư) thu được dung dịch chứa (m + 10,06) gam chất tan. Giá trị của m gần nhất với A. 19,30 B. 19,40 C. 19,45 D. 19,35 Câu 24. Cho 2,75 gam hỗn hợp M gồm 2 ancol X, Y qua CuO, đốt nóng, sau phản ứng hoàn toàn thu được hỗn hợp Z gồm 2 anđehit đơn chức, đồng đẳng kế tiếp. Lấy toàn bộ lượng Z thu được ở trên thực hiện phản ứng tráng bạc thì thu được tối đa 27 gam Ag. Khẳng định không đúng là A. Từ X và Y đều có thể dùng 1 phản ứng hóa học để tạo ra axit axetic. B. X chiếm 50% số mol trong hỗn hợp M. C. Khi đốt cháy hoàn toàn hỗn hợp M thì số mol O2 cần dùng gấp 1,5 lần số mol CO2 tạo ra. D. X và Y có thể tác dụng với nhau. Câu 25. Hỗn hợp X chứa ba axit cacboxylic đều đơn chức, mạch hở, gồm một axit no và hai axit không no đều có một liên kết đôi (C = C). Cho m gam X tác dụng vừa đủ với 150 ml dung dịch NaOH 2M, thu được 25,56 gam hỗn hợp muối. Đốt cháy hoàn toàn m gam X, hấp thụ toàn bộ sản phẩm cháy bằng dung dịch NaOH dư,

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

khối lượng dung dịch tăng thêm 40,08 gam. Tổng khối lượng của hai axit cacboxylic không no trong m gam X có giá trị gần nhất với A. 12,1 gam B. 15,5 gam C. 10,0 gam D. 19,0 gam. Câu 26. Cho 8,64 gam hỗn hợp X gồm axit axetic và phenol tác dụng với một lượng dung dịch Br2 vừa đủ thu được 19,86 gam kết tủa và dung dịch Y. Trung hòa dung dịch Y cần vừa đúng V ml dung dịch NaOH 0,5M. Các phản ứng xảy ra hoàn toàn. Giá trị của V là A. 100. B. 220. C. 340. D. 460. Câu 27. Cho m gam hỗn hợp X gồm hai ancol đơn chức X1, X2 đồng đẳng kế tiếp (MX1 < MX2), phản ứng với CuO nung nóng, thu được 0,25 mol H2O và hỗn hợp Y gồm hai anđehit tương ứng và hai ancol dư. Đốt cháy hoàn toàn Y thu được 0,5 mol CO2 và 0,65 mol H2O. Mặt khác, cho toàn bộ lượng Y trên tác dụng với lượng dư dung dịch AgNO3 trong NH3 đun nóng, kết thúc các phản ứng thu được 0,9 mol Ag. Hiệu suất tạo anđehit của X1, X2 lần lượt là A. 50,00% và 66,67%. B. 33,33% và 50,00%. C. 66,67% và 33,33%. D. 66,67% và 50,00%. Câu 28. Hỗn hợp X gồm hidro, propen, propanal, ancol anlylic (CH2=CH-CH2OH). Đốt 1 mol hỗn hợp X thu được 40,32 lít CO2 (đktc). Đun X với bột Ni một thời gian thu được hỗn hợp Y có dY/X = 1,25. Nếu lấy 0,1 mol hỗn hợp Y thì tác dụng vừa đủ với V lít dung dịch Br2 0,2M. Giá trị của V là A. 0,1. B. 0,25. C. 0,3. D. 0,2. Câu 29. X, Y là hai anđehit đơn chức, mạch hở. Lấy 3,4 gam hỗn hợp E chứa X, Y tác dụng với dung dịch AgNO3 trong NH3 dư, đun nóng thu được 34,64 gam kết tủa. Cho dung dịch HCl dư vào dung dịch sau phản ứng thấy thoát ra 1,344 lít khí không màu (đktc). Cho 0,2 mol hỗn hợp E tác dụng vừa đủ với V ml dung dịch Br2 1M. Giá trị của V là A. 500 ml. B. 350 ml. C. 400 ml. D. 450 ml. Câu 30. Hỗn hợp X gồm 0,1 mol anđehit metacrylic và 0,3 mol khí hiđro. Nung nóng hỗn hợp X một thời gian, có mặt chất xúc tác Ni thu được hỗn hợp hơi Y có tỉ khối hơi so với He bằng 95/12. Dẫn toàn bộ hỗn hợp Y qua dung dịch brom dư thì thấy hết a mol Br2. Giá trị của a là A. 0,04. B. 0,02. C. 0,20. D. 0,08.

D I BỒ

ƯỠ

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

UY

Câu 1: B

.Q P T

N Ơ H

N

X gồm các muối của axit no, đơn chức mạch hở nên khi đốt thu được nCO2 = nH2O

G N Ư

O Ạ Đ

Áp dụng bảo toàn nguyên tố O có:

N Ầ TR

H

Áp dụng bảo toàn khối lượng có: m = 2,65 + (44 + 18).0,135 - 32.0,19 = 4,94 gam

1 3 +

0 00

B

Câu 2: C Câu 3: D nCO2 = 0,15 mol; nH2O = 0,1 mol.

hhX có số C trung bình = 0,15 : 0,1 = 1,5 → B là HCOOH số H trung bình = 0,1 x 2 : 0,1 = 2. B có 2H → A có 2H trong phân tử → A là OHC-CHO. Giả sử số mol của HCOOH và OHC-CHO lần lượt là x, y

Ta có hpt: • 0,2 mol hhX chứa 0,1 mol HCOOH và 0,1 mol OHC-CHO → nAg = 0,1 x 2 + 0,1 x 4 = 0,6 mol → m = 0,6 x 108 = 64,8 gam Câu 4: D

X tác dụng với HCl được axit cacboxylic 2 lần axit Y chứng tỏ X là muối 2 chức.

=>X là (COONa)2 =>Y là (COOH)2 (CTPT: H2C2O4)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 5: C M là hỗn hợp của 2 axit mà tác dụng với dd AgNO3/NH3 thu được Ag => M có axit HCOOH Mặt khác: Y nhiều hơn X một nhóm -COOH => X là HCOOH;Y:R(COOH)2 nHCOOH=1/2nAg=0,2mol Ta có:m gam M + NaOH -->(m+8,8) Muối Theo tăng giảm khối lượng thì:nX+2nY=8,8/22=0,4 =>nY=0,1mol PT: R(COOH)2 + 2NH3 --> R(COONH4)2 M của R(COONH4)2=13,8/0,1=138 ==>R=14 => Y: CH2(COOH)2 =>m=0,2.46+0,1.104=19,6gam

N Ơ H

Câu 9: C

X có 3 liên kết pi Nếu X có 2 hoặc 3 nhóm -CHO loại vì không có chất nào thỏa mãn Nếu X có 1 nhóm -CHO, tìm được X là

O Ạ Đ

UY

.Q P T

N

0,1 ___________________________________0,1___________0,2 Câu 6: A Vì Y là xeton có tối thiểu là 3C → loại B

G N Ư

-> Khối lượng kết tủa: 0,1.194+0,2.108=41 gam

H

Câu 10: A Do khi khử cần x mol H2 và khi tác dụng với Na thu được x/2 mol H2 nên A là andehit no, trong A có x mol CHO

Nhận thấy khi đốt M sinh ra nCO2 = nH2O → X, Y đều là hợp chất no, đơn chức Bảo toàn nguyên tố O → nX + nY = 0,29. 2 + 0,29 - 0,395. 2 = 0,08

N Ầ TR

2 andehit là đơn chức và có 1 chất là HCHO, chất còn lại là CH3CHO

Bảo toàn khối lượng → mM = 0,29. 44 + 0,29. 18 - 0,385. 32 = 5, 34

0 00

Nếu X và Y đều có công thức C5H10O → mX + mY = 0,08. 86 = 6,88 > 5,34 → loại D Nếu X và Y đều có công thức C4H8O → mX + mY = 0,08. 72 = 5,76 > 5,34 → loại B Câu 7: D đặt công thức X:

;

Đề x ---------------------------x(1,5n -1)-----------------------------xn------------xn

H Í

ÓA

P Ấ C

2

y----------------------------y(1,5m-1,5)--------------------------------ym-------------------ym Đốt cháy hết hỗn hợp rồi đưa về nhiệt độ ban đầu, áp suất không đổi (1) Khí qua NaOH bị hấp thụ hoàn toàn nên phản ứng hết (2) Từ (1) và (2) ta được Công thức Y: %Y=60%

ƯỠ

NG

TO

ÁN

-L

Câu 8: A 1 mol X -> 2 mol Ag -> X là andehit đơn chức k phải HCHO

D I BỒ

1 mol X + 2 mol H2 -> X có 2 nối đôi, 1 ở chức CHO, 1 ở mạch C. Mà số C của X < 4 nên X: CH2=CH-CHO

Sưu tầm bởi GV. Nguyễn Thanh Tú

1 3 +

B

Ta có hệ:

Câu 11: C Nhận thấy propen, propanal, ancol anlylic đều có công thức là C3H6On → nC3H6O = nCO2 : 3 = 0,3 mol Coi hỗn hợp gồm H2 : 0,2 mol và C3H6On: 0,3 mol

Bảo toàn khối lượng → mX = mY → nY =

= 0,5. 0,8= 0,4 mol

Có nH2 pư = 0,5 - 0,4 = 0,1 mol Bảo toàn liên kết π → nBr2 = 0,3 - 0,1 = 0,2 mol Trong 0,4 mol Y thì số mol Br2 pư là 0,2 mol, Nếu lấy 0,2 mol Y thì số mol Br2 pư là 0,1 mol → V = 1 lít. Câu 12: A Nhận thấy dựa vào đáp án và nAg = 0,4 mol < nAgNO3 = 0,6 mol → X chứa liên kết 3 đầu mạch sinh ra sản phẩm kết tủa ( loại B, C)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Có n↓ = nX = 0,6- 0,4 = 0,2 mol . Có nAg : nX = 0,4 : 0,2 = 2 → X chứa 1 nhóm CHO

N

Vậy X có dạng CH≡C-R-CHO

, mà Y tác udnjg với AgNO3 theo tỷ lệ 1:3 Vì Y và X là đồng phân nên X cũng là nên , tỷ lệ % các nguyên tố giống như Y

MX = 13,6 : 0,2 = 68 → 13 + 12 + R + 29 = 68 → R = 14 ( CH2)

Z mạch thẳng, tác dụng với AgNO3 tỷ lệ 1:3 nên có 1 chức andehit và có 1 nối 3 đầu mạch

UY

X có công thức CH≡CH-CH2-CHO. Câu 13: A Câu 14: D Có nH = 2nH2= 2 mol

Câu 21: C

Số nguyên tử H trong phân tử ankin là 2 → ankin có công thức là C2H2: x mol → andehit có công thức C3H2O ( CH≡C-CHO) : y mol

Ta có hệ

H

0 00

Câu 15: D Câu 16: C Câu 17: C Câu 18: D Nhận thấy nAg = 0,3 mol < nAgNO3 = 0,45 mol → X vừa chứa nhóm CHO vừa chứa liên kết ba đầu mạch → X có cấu tạo CH≡C-R-CHO Có nX = nAg : 2 = 0,15 mol → M X = 68 → R = 14( CH2)

N Á O

Cấu tạo của X là CH≡C-CH2-CHO. Câu 19: D

T

Câu 20: B

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

B

→ n = 2 → X là C4H6O4

X có 2 đồng phân là HOOC-CH2-CH2-COOH, HOOC-CH(CH3)-COOH.

31

→ m= 0,6. 240 + 0,8.108 + 0,4. ( 108 + 12+ 12 + 44 + 18) = 308 gam.

I Ồ B

N Ầ TR

Ta có: số liên kết π = số nhóm -COOH →

Khi cho X tác dụng với AgNO3/ NH3 sinh ra CAg≡CAg: 0,6 mol và CAg≡C-COONH4: 0,4 mol và Ag: 0,8 mol

G N Ư

O Ạ Đ

.Q P T

Câu 22: B Đặt CTPT của X là (C2H3O2)n = C2nH3nO2n

G N Ỡ

N Ơ H

1 mol Y tác dụng với 4 mol AgNO3 -> Y là anđehit 2 chức

2+

Câu 23: D Gọi công thức của X và Y lần lượt là CnH2nO2 và CmH2m-4O2 ( m ≥ 4)

Luôn có nX = nY = 0,5a mol → 0,5an + 0,5am = 3a → n + m = 6 → n= 1 , m= 5 hoặc n= 2 ; m= 4 TH1: Vậy X là C2H4O2, Y là C4H4O4 hoặc HCOOOH và C4H6O4. Gọi số mol của X, Y trong m gam hỗn hợp lần lượt là a, a mol → nH2O = 3a mol Bảo toàn khối lượng → m + 0, 4. 40 = m + 10, 06 + 3a. 18 → a = 0,11 mol → m = 0,11. 60 + 0,11. 116 = 19,36 gam Câu 24: B nAg = 0,25 mol. • TH1: hhX, Y không chứa CH3OH → nhhM = 0,25 : 2 = 0,125 mol → MM = 2,75 : 0,125 = 22 → loại. • TH2: hhM gồm CH3OH x mol; C2H5OH y mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

→ Số nguyên tử C trung bình = 0,5 : 0,4 = 1,25 → Hai ancol lần lượt là CH3OH và C2H5OH Giả sử số mol của CH3OH và C2H5OH trong hhX lần lượt là x, y mol.

Ta có hpt:

UY

nhhX = x + y = 0,4 mol. Đáp án A đúng vì CH3CH2OH + O2

CH3COOH + H2O; CH3OH + CO

CH3COOH nCO2 = x + 2y = 0,5 → x = 0,3 mol; y = 0,1 mol

Đáp án B sai vì X chiếm 66,67% số mol trong hhM. • CH3OH → HCHO → 4Ag Đáp án C đúng. a---------------------------4a Đáp án D đúng vì C2H5OH + CH3OH

C2H5-O-CH3 + H2O. C2H5OH → CH3CHO → 2Ag

G N Ư

O Ạ Đ

.Q P T

N

Câu 25: A Theo BTNT: mX = 25,56 - 0,15 x 2 x 22 = 18,96 gam.

b------------------------------2b

Đặt nCO2 = x mol; nH2O = y mol

Ta có hệ: a + b = 0,25; 4a + 2b = 0,9 → a = 0,2; b = 0,05.

Ta có hpt:

Hiệu suất tạo anđehit của X1 là 0,2 : 0,3 ≈ 66,67%; của X2 là 0,05 : 0,1 = 50% Câu 28: B Nhận thấy propen, propanal, ancol anlylic đều có công thức là C3H6On → nC3H6On = nCO2 : 3 = 0,6 mol

→ naxit không no = 0,69 - 0,54 = 0,15 mol → nHCOOH = 0,3 - 0,15 = 0,15 mol. → maxit không no = 18,96 - 0,15 x 46 = 12,06 gam Câu 26: D C6H5OH + 3Br2 → (2,4,6)-Br3C6H2OH↓ + 3HBr nphenol = n↓ = 19,86 : 331 = 0,06 mol → nHBr = 0,18 mol. mCH3COOH = 8,64 - 0,06 x 94 = 3 gam → nCH3COOH = 0,05 mol. ddY gồm 0,18 mol HBr và 0,05 mol CH3COOH

TO

ÁN

Í -L

Vậy nNaOH = 0,18 + 0,05 = 0,23 mol → V = 0,23 : 0,5 = 0,46 lít = 460 ml Câu 27: D Y + O2 thu được nCO2 < nH2O

Ư D I Ồ B

G N Ỡ

-

A Ó H

P Ấ C

0 00

31

Ta có số C trung bình = 0,54 : 0,3 = 1,8 → Có HCOOH

2+

B

N Ầ TR

H

Coi hỗn hợp gồm H2 : 0,4 mol và C3H6On: 0,6 mol

Bảo toàn khối lượng → mX = mY → nY =

=

= 0,8 mol

Có nH2 pư = 1 - 0,8 = 0,2 mol Bảo toàn liên kết π → nBr2 = 0,6 - 0,2 = 0,4 mol Trong 0,8 mol Y số mol Br2 phản ứng là 0,4 mol Nếu lấy 0,1 mol X thì số mol H2 pư là 0,05 mol → V = 0,05 : 0,2 = 0,25 lít Câu 29: A Vì cho thêm HCl vào dung dịch sinh khí không màu → chứa (NH4)2CO3 → X là HCHO: 0,06 mol Y chỉ chứa nhóm chức andehit thì kết tủa sinh ra chỉ chứa Ag:

→ Hai ancol ban đầu no đơn chức, hai anđehit cũng no, đơn chức. nancol dư trong Y = 0,65 - 0,5 = 0,15 mol → nY =

=

→ MY =

= 6,6 ( loại)

nancol phản ứng = nanđehit phản ứng = 0,25 mol → ∑nancol = 0,15 + 0,25 = 0,4 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

Vậy Y sẽ có cấu tạo dạng CH≡C-R-CHO : x mol. Khi đó kết tủa sinh ra chứa Ag: 0,06.4 + 2x mol và CAg≡C-

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

R-COONH4 : x mol

Ta có hệ

UY

Vậy Y có công thức CH≡C-CH=CH-CHO : 0,02 mol Trong 0,08 mol hỗn hợp chứa 0,06 mol HCHO và 0,02 mol CH≡C-CH=CH-CHO → 0,2 mol hỗn hợp chứa 0,15 mol HCHO và 0,05 mol CH≡C-CH=CH-CHO nBr2 = 2nHCHO + 4nCH≡C-CH=CH-CHO = 2. 0,15 + 4. 0,05 = 0,5 mol → V = 0,5 lít. Câu 30: A X

Y

Có mX = mY → nY =

= 0,24 mol

0 00

Có nH2 pư = nX - nY = 0,4- 0,24 = 0,16 mol bảo toàn liên kết π nBr2 = 0,1. 2- 0,16 = 0,04 mol .

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

23. Luyện tập giải một số bài tập đốt cháy muối (Đề 1)

Câu 1. Đun nóng 0,15 mol este X đơn chức mạch hở phản ứng hết với 50,4 gam dung dịch MOH 20% thu được dung dịch A và 8,7 gam hơi một ancol. Cô cạn A rồi đốt cháy hoàn toàn chất rắn thu được 12,42 gam muối M2CO3 và 13,56 gam hỗn hợp CO2 và H2O. Công thức của este và tên kim loại kiềm là: A. CH3COOCH2-CH=CH2 và K B. CH3COOCH=CH2-CH3 và Na C. C2H5COOCH2-CH=CH2 và K D. CH3COOCH2CH2CH3 và Na Câu 2. Đốt cháy hoàn toàn 5,8 gam chất X thu được 2,65 gam Na2CO3; 2,25 gam H2O và 12,1 gam CO2. Công thức phân tử của X là A. C6H5O2Na. B. C6H5ONa. C. C7H7O2Na. D. C7H7ONa. Câu 3. Đốt cháy hoàn toàn 0,1 mol muối natri của một axit cacboxylic, thu được Na2CO3, hơi nước và 3,36 lít khí CO2 (đktc). Công thức cấu tạo thu gọn của muối là A. C2H5COONa. B. HCOONa. C. CH3COONa. D. CH2(COONa)2. Câu 4. Oxi hóa hoàn toàn 4,02 gam một hợp chất hữu cơ X chỉ thu được 3,18 gam Na2CO3 và 0,672 lít khí CO2. CTĐGN của X là A. CO2Na. B. CO2Na2. C. C3O2Na. D. C2O2Na Câu 5. X là este mạch hở tạo bởi axit cacboxylic 2 chức và hai ancol đơn chức. Đốt cháy 12,64 gam este X thu được 12,544 lít CO2 (đktc) và 7,2 gam nước. Mặt khác đun nóng 0,12 mol este X với 400 dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng thu được phần rắn Y và hỗn hợp gồm 2 ancol kế tiếp. Đun nóng toàn bộ rắn Y có mặt CaO làm xúc tác thu được m gam khí Z. Giá trị của m là. A. 4,48 gam B. 3,36 gam C. 6,72 gam D. 2,24 gam Câu 6. Xà phòng hoá hoàn toàn m gam một este mạch hở E bằng 100 gam dung dịch MOH 25,2% (M là kim loại kiềm) được a gam ancol X và dung dịch Y. Cô cạn dung dịch Y được 44,2 gam hỗn hợp rắn khan Z. Đốt cháy hoàn toàn Z thu được sản phẩm gồm CO2, nước và 31,05 gam muối cacbonat khan. Mặt khác, cho a gam X tác dụng với Na dư, thu được 4,2 lít khí H2 (đktc). Các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng muối trong Y là: A. 92,3%. B. 85,8%. C. 90,5%. D. 86,7%.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Z là este tạo bởi ancol metylic và axit cacboxylic Y đơn chức, mạch hở, có mạch cacbon phân nhánh. Xà phòng hoá hoàn toàn 0,6 mol Z trong 300 ml dung dịch KOH 2,5M đun nóng, được dung dịch E. Cô cạn dung dịch E được chất rắn khan F. Đốt cháy hoàn toàn F bằng oxi dư, thu được 45,36 lít khí CO2 (đktc), 28,35 gam H2O và m gam K2CO3. Công thức cấu tạo của Y và giá trị của m là A. CH3CH(CH3)COOH ; m = 51,75. B. CH3CH(CH3)COOH ; m = 41,40. C. CH2=C(CH3)COOH ; m = 51,75. D. CH2=C(CH3)COOH ; m = 41,40. Câu 8. Hỗn hợp X gồm 2 chất hữu cơ đơn chức A và B (chứa C, H, O và đều có phân tử khối lớn hơn 50). Lấy m gam X tác dụng vừa đủ với dung dịch NaOH, sau phản ứng hoàn toàn thu được sản phẩm là dung dịch Y chỉ chứa hai muối, trong đó có một muối chứa 19,83% natri về khối lượng. Chia dung dịch Y thành 2 phần bằng nhau. Phần 1 đem thực hiện phản ứng tráng bạc, thu được tối đa 16,2 gam Ag. Phần 2 đem cô cạn rồi đốt cháy hoàn toàn thu được CO2, H2O và 10,6 gam Na2CO3. Giá trị m là A. 13,85. B. 30,40. C. 41,80. D. 27,70. Câu 9. Cho 15,2 gam chất hữu cơ X phản ứng vừa đủ với 300 ml dung dịch NaOH 1M thu được dung dịch Y. Cô cạn dung dịch Y chỉ thu được hơi nước và 23,6 gam hỗn hợp muối khan Z. Đốt cháy hoàn toàn Z thu được Na2CO3, 14,56 lít CO2 (đkc) và 6,3 gam H2O (biết X có công thức phân tử trùng với công thức đơn giản nhất). Công thức phân tử của X là A. C8H10O3. B. C8H8O3. C. C8H8O. D. C9H8O2. Câu 10. Thủy phân hết m gam hỗn hợp X gồm một số este được tạo bởi axit đơn chức và ancol đơn chức bằng một lượng dung dịch NaOH vừa đủ rồi cô cạn thu được a gam muối và b gam hỗn hợp ancol. Đốt cháy a gam hỗn hợp muối thu được hỗn hợp khí Y và 7,42 gam Na2CO3. Cho toàn bộ hỗn hợp khí Y sinh ra qua bình đựng dung dịch Ca(OH)2 dư thu được 23 gam kết tủa đồng thời thấy khối lượng bình tăng 13,18 gam so với ban đầu. Đun b gam hỗn hợp ancol sinh ra với H2SO4 đặc ở 140oC thu được 4,34 gam hỗn hợp các ete. Các phản ứng xảy ra hoàn toàn. Giá trị m gần giá trị nào nhất sau đây? A. 10. B. 11. C. 13. D. 12. Câu 11. Chất hữu cơ A chỉ chứa C, H, O có công thức phân tử trùng công thức đơn giản nhất. Cho 2,76 gam A tác dụng với một lượng vừa đủ dung dịch NaOH, chưng khô thì phần bay hơi chỉ có H2O, phần chất rắn khan chứa 2 muối có khối lượng 4,44 gam. Đốt cháy hoàn toàn hai muối này được 3,18 gam Na2CO3; 2,464 lít CO2 (đktc) và 0,9 gam H2O. Nếu đốt cháy 2,76 gam A thì khối lượng H2O thu được là A. 0,9 gam B. 1,08 gam. C. 0,36 gam. D. 1,2 gam. Câu 12. Hợp chất hữu cơ X (thành phần nguyên tố gồm C, H, O) có công thức phân tử trùng với công thức đơn giản nhất. Cho 27,6 gam X phản ứng được tối đa 0,6 mol NaOH trong dung dịch, thu được dung dịch Y. Cô cạn

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Y, thu được 44,4 gam muối khan Z và phần hơi chỉ có H2O. Nung nóng Z trong O2 dư, thu được hỗn hợp sản phẩm gồm 1,1 mol CO2; 0,5 mol H2O và Na2CO3. Số công thức cấu tạo của X là A. 6. B. 3. C. 4. D. 5. Câu 13. Hợp chất hữu cơ A gồm ba nguyên tố C, H, O tác dụng vừa đủ với dung dịch KOH 11,666%. Sau phản ứng thu được dung dịch X, cô cạn dung dịch X thì phần hơi chỉ có H2O với khối lượng là 86,6 gam, còn lại là chất rắn Y có khối lượng 23 gam. Đốt cháy hoàn toàn Y thu được 13,8 gam K2CO3 và 38 gam hỗn hợp CO2 và H2O. Toàn bộ lượng CO2 này cho vào dung dịch Ca(OH)2 dư thu được 70 gam kết tủa. Biết A là hợp chất hữu cơ đơn chức, công thức cấu tạo của A là A. CH3COOC6H5. B. HCOOC6H5. C. CH3CH2COOC2H3. D. C2H3COOCH3CH2. Câu 14. X là este đơn chức, mạch hở tác dụng vừa đủ với dung dịch KOH 11,666%. Sau phản ứng thu được dung dịch Y. Cô cạn Y thì phần hơi chỉ có H2O với khối lượng 88,4 gam, còn lại chất rắn Z có khối lượng là 23 gam. Có bao nhiêu đồng phân cấu tạo của X thoả mãn tính chất trên ? A. 1. B. 2. C. 3. D. 4. Câu 15. Xà phòng hoá hoàn toàn m gam một este no, đơn chức, mạch hở E bằng 28 gam dung dịch KOH 28%. Cô cạn hỗn hợp sau phản ứng thu được 25,68 gam chất lỏng X và chất rắn khan Y. Đốt cháy hoàn toàn Y, thu được sản phẩm gồm CO2, H2O và K2CO3, trong đó tổng khối lượng của CO2 và H2O là 18,34 gam. Mặt khác, cho X tác dụng với Na dư, thu được 13,888 lít khí H2 (đktc). Giá trị m gần nhất với A. 11. B. 10. C. 14. D. 12. Câu 16. Xà phòng hoá hoàn toàn m gam một este mạch hở E bằng 100 gam dung dịch MOH 25,2% (M là kim loại kiềm) được a gam ancol X và dung dịch Y. Cô cạn dung dịch Y được 44,2 gam hỗn hợp rắn khan Z. Đốt cháy hoàn toàn Z thu được sản phẩm gồm CO2, nước và 31,05 gam muối cacbonat khan. Mặt khác, cho a gam X tác dụng với Na dư, thu được 4,2 lít khí H2 (đktc). Các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng muối trong Z có giá trị gần nhất với A. 92,2%. B. 85,8% C. 90,4% D. 86,6% Câu 17. Đun nóng 0,1 mol este no, đơn chức E với 30 ml dung dịch 28% (d = 1,2 g/ml) của một hiđroxit kim loại kiềm M. Sau khi kết thúc phản ứng xà phòng hoá, cô cạn dung dịch thì thu được chất rắn A và 4,6 gam ancol B. Đốt cháy chất rắn A thì thu được 12,42 gam muối cacbonat, 8,26 gam hỗn hợp CO2 và hơi nước. Tên gọi của E: A. Metyl fomat. B. Etyl fomat.

Ư D I Ồ B

G N Ỡ

TO

ÁN

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. Etyl axetat. D. Metyl propionat. Câu 18. Cho 11,84 gam este E đơn chức (không tham gia phản ứng tráng bạc, có số nguyên tử cacbon nhỏ hơn 4) phản ứng hoàn toàn với 30 ml dung dịch MOH 20% (D = 1,2 g/ml, với M là kim loại kiềm). Sau khi phản ứng hoàn toàn, cô cạn dung dịch thu được chất rắn X. Đốt cháy hoàn toàn X trong oxi dư thu được 9,54 gam M2CO3 và m gam hỗn hợp gồm CO2, H2O. Giá trị gần đúng nhất với m là A. 14,625. B. 14,875. C. 14,445. D. 29,775. Câu 19. Chất hữu cơ X (chỉ chứa C, H, O và có công thức phân tử trùng với công thức đơn giản nhất). Cho 5,52 gam X tác dụng với dung dịch NaOH vừa đủ, sau đó chưng khô thì thu được hơi nước, phần chất rắn chứa hai muối của natri có khối lượng 8,88 gam. Đốt cháy hoàn toàn 4,44 gam hỗn hợp hai muối này trong oxi thì thu được 3,18 gam Na2CO3, 2,464 lít CO2 (đktc) và 0,9 gam nước. Phần trăm khối lượng của nguyên tố O trong X gần nhất với giá trị nào sau đây? A. 45%. B. 30%. C. 40%. D. 35%. Câu 20. Hỗn hợp X gồm 2 este đơn chức Y, Z. Cho 0,05 mol X tác dụng vừa đủ với dung dịch NaOH thu được hỗn hợp sản phẩm hữu cơ T. Đốt cháy hết toàn bộ T thu được 2,688 lít CO2; 3,18 gam Na2CO3. Khi làm bay hơi T thu được m gam chất rắn. Giá trị của m gần nhất với A. 4,5. B. 3,5. C. 6,0. D. 5,5.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A Thử muối Số mol rất chẵn Vậy Hơi ancol là Mặt khác 12,42 gam muối Ta có như sau Gọi muối A là

và 13,56 gam hỗn hợp

0,15----------------------0,075------0,15(n-0,5)----0,15(n+0,5) Mặt khác có

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

dư Nên

Có nO =

0,03------0,015------------0,015 Vậy sau các phản ứng

→ C : H :O = 0,56:0,8 :0,32 = 7 :10 : 4

= 0,32 mol

UY

N

Vì X là este mạch hở tạo bởi axit cacboxylic 2 chức và hai ancol đơn chức → X có 4 O , công thức phân tử là C7H10O4

.Q P T

Thủy phân tạo 2 ancol kế tiếp nhau → X có cấu tạo C2H5OOC-CH=CH-COOCH3

O Ạ Đ

Câu 2: B Có nNa2CO3 = 0,025 mol và nH2O = 0,125 mol,nCO2 = 0,275 mol

C2H5OOC-CH=CH-COOCH3 + 2NaOH → C2H5OH + NaOOC-CH=CH-COONa + CH3OH

Có nO(X) =

Có 2nX < nNaOH → sau phản ứng thu được NaOOC-CH=CH-COONa :0,12 mol và NaOH dư : 0,4- 0,12.2 = 0,16 mol

=0,05 mol

N Ầ TR

H

G N Ư

Nhận thấy các đáp án đều chứa 1 Na → nX = 2nNa2CO3 = 0,05 mol

NaOOC-CH=CH-COONa +2NaOH → CH2=CH2 + 2Na2CO3

→ C = ( 0,025 + 0,275): 0,05 = 6

Thấy 2nNaOOC-CH=CH-COONa > nNaOH = 0,16 mol → số mol khí CH2=CH2 được tính theo NaOH → nCH2=CH2 = 0,08 mol → m = 2,24 gam.

0 00

→ H = 0,125.2 : 0,05 = 5

Công thức của X là C6H5ONa. Câu 3: C Nhận thấy 3 đáp án A,B,C đều là muối natri của axit cacboxylic no, đơn chức có dạng CnH2n-1O2Na Bảo toàn nguyên tố Na → nNa2CO3 =0,5 . nX= 0,05 mol Bảo toàn nguyên tố C → nC (X) = nNa2CO3 + nCO2 = 0,05 + 0,15 = 0,2 mol → C = 0,2 : 0,1 = 2 → X có công thức CH3COONa. Câu 4: A Khi đốt cháy X không thu được nước → X chứa C, O, Na Có nNa2CO3 = 0,03 mol, nCO2 = 0,03 mol

Có nO(X) =

Ư D I Ồ B

B

Câu 6: C

31

→ O = 0,05 : 0,05 = 1

G N Ỡ

TO

ÁN

=0,12 mol

→ C : O : Na= 0,06:0,12 : 0,06 = 1: 2: 1→ CTDGN là CO2Na. Câu 5: D Có nCO2 = 0,56 mol, nH2O = 0,4 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2+

Ta có nMOH =

mol

31, 05 gam muối cacbonat khan có công thức M2CO3

Bảo toàn nguyên tố M →

= 2×

→ M = 39 (K) → nKOH = 0,45 mol

Khi cho a gam ancol tham gia phản ứng với Na dư → nOH = 2nH2 = 0,375 mol Luôn có nKOH phản ứng = nOH = 0,375 mol → KOH dư : 0,45- 0,375 = 0,075 mol 44,2 gam chất rắn khan gồm KOH dư : 0,075 mol và muối → mmuối = 44,2 - 0,075. 56 = 40 gam

→ % muối = ×100% = 90,498%. Câu 7: C Có nKOH = 0,75 mol, nCO2 = 2.025 mol và nH2O = 1,575 mol Bảo toàn nguyên tố K → nK2CO3 = 0,375 mol → m = 51,75 gam Bảo toàn nguyên tố C → n C(Z) = 2,025 + 0,375 = 2,4 mol Nguyên tố H → nH(Z0 = 2.1,575 - 0,75 = 2,4 mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Vì Z là este đơn chức → nO = 2nZ = 1,2 mol

Có mBình tăng = mCO2 +mH2O → nH2O =

→ C: H : O = 2,4 : 2,4: 1,2 =2:2:1 mà Z là este đơn chức → công thức phân tử của Z là C4H4O2

Có nNa2CO3 = 0,07 mol → nNaOH = 0,14 mol

Z là este tạo bởi ancol metylic và axit cacboxylic Y đơn chức, mạch hở, có mạch cacbon phân nhánh → cấu tạo của Z là CH2=C(CH3)-COOCH3

Muối thu được dạng RCOONa: 0,14 mol →mmuối = mC +mH + mO+ mNa =12.( 0,23 +0,07) + 0,17.2 + 0,14.2.16 + 0,14.23 = 11,64 gam

→ cấu tạo của Y là CH2=C(CH3)-COOH. Câu 8: D Muối Y có khả năng tham gia phản ứng tráng gương → Y chứa HCOONa → nHCOONa = 0,5nAg= 0,075 mol

Vì este đơn chức nên nancol =naxit = 0,14mol

Vì HCOOH có M = 46 < 50 mà khi thủy phân chỉ sinh ra muối → A phải là dạng este của phenol và axit fomic : HCOO-C6H4-R'

→ mancol =mete+ mH2O =4,34 + 0,07.18 =5,6 gam

Muối HCOONa có %Na =33, 8% → muối còn lại RONa có % Na = 19,83% → MR =

-16-23= 77 (C6H5)

→ m = 2.(0,05.94 + 0,075. 122)=27,7 gam. Câu 9: B Có nCO2 = 0,65 mol, nH2O = 0,35 mol, nNa2CO3 = 0,5nNaOH = 0,15 mol

A Ó H

Bảo toàn khối lượng → mH2O = 15,2 + 0,3. 40 - 23,6 = 3,6 gam → nH2O = 0,2 mol bảo toàn nguyên tố C → nC (X) = 0,15 +0,65 =0,8 mol nH= 2.0,35 + 2. 0,2 - 0,3 = 0,8 mol

0 00

N Á O

-L

Í-

P Ấ C

T

C: H : O = 0,8 : 0,8 : 0,3 → Công thức phân tử X là C8H8O3

ƯỠ

H

N Ầ TR

2

1 3 +

B

Bảo toàn nguyên tố H → nH(X) = 0,05.2 + 0,04.2 - 0,06 = 0,12 mol Vây nếu đốt 2,76 gam X sinh ra 0,06 mol H2O → m=1,08 gam. Câu 12: B Có nNa2CO3 =0,5nNaOH= 0,3 mol → nCO2 = 1,1 mol, nH2O = 0,5 mol

Bảo toàn khối lượng cho phản ứng thủy phân trong kiềm → mH2O = 27,66 + 0,6. 40 - 44,4 = 7,2 gam → nH2O= 0,4 mol Bảo toàn nguyên tố C → nC(X) = 1,1 + 0,3 = 1,4 Bảo toàn nguyên tố H → nH(X) = 0,5.2 + 0,4.2 - 0,6 = 1,2 mol

nO(X) =

= 0,6 mol

→ C : H : O = 1,4: 1,2 :0,6 =7: 6:3 → X có công thức là C7H6O3

Câu 10: D Thủy phân hết m gam hỗn hợp X gồm một số este được tạo bởi axit đơn chức và ancol đơn chức → gọi công thức của X là RCOOR'

Có nX : nNaOH = 0,2 :0,6= 1:3

Vì Ca(OH)2 dư nên nCO2 = n↓ = 0,23 mol

Câu 13: A

D I BỒ

G N Ư

Bảo toàn khối lượng cho phản ứng thủy phân trong kiềm → mH2O = 2.76 + 0,06. 40 - 4,44 = 0,72 gam → nH2O= 0,04 mol

Vì hỗn hợp chia thành hai phần bằng nhau

NG

O Ạ Đ

.Q P T

N

Bảo toàn khối lượng→ meste = mmuối +mancol-mNaOH = 11,64 + 5,6- 0,14. 40=11,64 gam. Câu 11: B Có nNa2CO3 = 0,03 mol → nNaOH = 0,06 mol, nCO2 = 0,11 mol, nH2O = 0,05 mol

Có nNaOH = 2nNa2CO3 = 0,2 = nC6H5OH + 2nHCOOC6H5 :0,075mol → nC6H5OH = 0,05 mol

= 0,3 mol

UY

Khi tham gia phản ứng tạo ete luôn có nH2O =0,5 ∑nanccol =0,07 mol

Vậy X gồm C6H5OH và HCOOC6H5

nO(X) =

= 0,17 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

các công thức cấu tạo của X thỏa mãn là : o- HCOOC6H4(OH) , m- HCOOC6H4(OH) , p- HCOOC6H4(OH)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Có nKOH = 2nK2CO3 = 0,2 mol Bảo toàn khối lượng → m X = 23 + 88,4 mdd KOH =

= 96 gam

= 13,6 → M= 136 (C8H8O2)

Các công thức este thỏa mãn gồm o,p,m- HCOO-C6H4CH3, CH3COOC6H5

Trong 96 gam dung dịch KOh có 11,2 gam KOH và 84,8 gam H2O

Câu 15: D

Vậy nước do quá trình thủy phân gây ra là 86,6- 84,8 = 1,8 gam ( 0,1 mol)

Có nKOH =

Bảo toàn khối lượng mA = 23+ 86,6 - 96 = 13,6gam

Trong 28 gam dung dịch chứa 20,16 gam nước

Khi hấp thụ vào dung dịch Ca(OH)2 dư thì nCaCO3 = nCO2 = 0,7 mol

Gọi công thức của este no đơn chức mạch hở là RCOOR'

= 0,14 mol → nK2CO3 =0,07 mol

G N Ư

O Ạ Đ

UY

.Q P T

N

25,68 gam chất lỏng X gồm H2O : 20,16 gam (1,12 mol) ,R'OH : 5,52 gam Có mbình tăng =mCO2 + mH2O → nH2O =

= 0,4 mol

Bảo toàn nguyên tố C → nC(A) = 0,7 + 0,1 =0,8 mol

N Ầ TR

H

Có nH2O + nR'OH = 2nH2 → nR'OH = 0,12 mol → naxit = nKOH pư = 0,12 mol→ MR'OH = Chất rắn Y gồm axit nH2n+1COOK :0,12 mol và KOH dư :0,14 - 0,12 =0,02 mol

bảo toàn nguyên tố H → nH(A) = 0,1.2 + 0,4.2 - 0,2 = 0,8 mol

0 00

B

= 46 → C2H5OH

2CnH2n+1COOK + (3n+1) O2 → (2n+1) CO2 + (2n+1) H2O + K2CO3 (1)

nO(A) =

= 0,2 mol

C: H : O = 0,8 :0,8 : 0,2 = 4:4:1 Nhận tháy các đáp án đều chứa 2 nguyên tố O → CTPT của A là C8H8O2 A tác dụng với KOH theo tỉ lệ 0,1 : 0,2 = 1:2 Công thức cấu tạo của A thỏa mãn là Cj3COOC6H5 , o,p,m- HCOOC6H4(CH3) Câu 14: D Gọi số mol của X là a mol

N Á O

-L

Í-

A Ó H

P Ấ C

2

1 3 +

2 KOH + CO2 → K2CO3 + H2O (2)

Từ (1) → nCO2 = nH2O = 0,12.

mol

Từ (2) → nCO2 pư = nH2O = 0,5nKOH dư =0,5.0,02= 0,01 mol → nCO2 còn lại =0,12

→ 44. ( 0,12

- 0,01) + 18.0,12

- 0,01 mol

+18.0,01 = 18,34→ n = 2 (C2H5COOK)

Vậy X là C2H5COOC2H5 : 0,12 mol → m = = 12,24. Câu 16: C

Vì X là este đơn chức, mạch hở khi thủy phân trong kiềm thu được chất rắn Z và nước → X là este của phenol

T

Ta có nMOH =

mol

Có nH2O do phản ứng thủy phân sinh ra = a mol, nKOH = 2a mol

Ỡ Ư D

NG

Lượng nước trong dung dịch KOH → mH2O =

I Ồ B

Có 88,4 =

.

.

31, 05 gam muối cacbonat khan có công thức M2CO3

gam

+ 2a. 18 → a = 0,1 mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

Bảo toàn nguyên tố M →

= 2×

→ M = 39 (K) → nKOH = 0,45 mol

Khi cho a gam ancol tham gia phản ứng với Na dư → nOH = 2nH2 = 0,375 mol Luôn có nKOH phản ứng = nOH = 0,375 mol → KOH dư : 0,45- 0,375 = 0,075 mol

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Đốt cháy 4,44 gam muối sinh ra 0,03 mol Na2CO3, 0,11 mol CO2 và 0,05 mol H2O 44,2 gam chất rắn khan gồm KOH dư : 0,075 mol và muối → mmuối = 44,2 - 0,075. 56 = 40 gam → đốt chấy 8,88 gam sinh ra 0,06 mol Na2CO3, 0,22 mol CO2 và 0,1 mol H2O → % muối = Câu 17: C

UY

Bảo toàn nguyên tố Na → nNaOH = 0,06. 2 =0,12mol

×100% = 90,498%.

.Q P T

Bảo toàn khối lượng → mH2O = 5,52 +0,12.40 - 8,88 = 1,44 gam (0,08 mol) Bảo toàn nguyên tố M → nMOH = 2nM2CÓ3 →

→ M = 39 (K) → nKOH = 0,18 mol

= 2.

Bảo toàn nguyên tố C → CnC(X) = 0,06 +0,22 = 0,28 mol Vì este đơn chức nên nancol= neste = 0,1 mol → Mancol = 46 (C2H5OH)

O Ạ Đ

N

Bảo toàn nguyên tố H → nH(X) = 2. 0,08 + 2.0,1 - 0,12 = 0,24 mol A gồm muối là CnH2n+1COOK :0,1 mol và KOH dư :0,18 - 0,1 =0,08 mol

G N Ư

Có mO(X) =5,52- 0,28.12-0,24. = 1,92 gam 2CnH2n+1COOK + (3n+1) O2 → (2n+1) CO2 + (2n+1) H2O + K2CO3 (1) 2 KOH + CO2 → K2CO3 + H2O (2)

N Ầ TR

H

% mO = .100% = 34,78%. Câu 20: A Có nCO2 = 0,12 mol, nNa2CO3 = 0,03 mol

Từ (1) → nCO2 = nH2O = 0,1

0 00

B

Có nNaoH = 2nNa2CO3 = 0,06 mol

Từ (2) → nCO2 pư = nH2O = 0,5nKOH dư =0,5.0,08= 0,04 mol → nCO2 còn lại =0,1

→ 44. ( 0,1

- 0,04) + 18.0,1

+18.0,04 = 8,26 → n = 1 (CH3COOK)

Vậy X là CH3COOC2H5 (Etyl axetat.). Câu 18: A Bảo toàn nguyên tố M → nMOH = 2nM2CO3 →

= 2.

Có nNaOH = 0,18 mol Luôn có nE ≤ nNaOH = 0,18 mol → ME ≥ 65,7

TO

ÁN

A Ó H

P Ấ C

2+

→ M = 23 (Na)

Í -L

-

Thấy 1< = chức Z : b mol

Ta có hệ

< 2 mà X là hỗn hợp este đơn chức → X chứa este của phenol Y : a mol và este đơn

→ ∑ nCO2 = 0,15 mol → Ctb =0,15: 0,05 =3 >2 → Z phải là HCOOCH3: 0,04 mol

Bảo toàn nguyên tố C → nC (Y) =

E là este đơn chức, không tham gia phản ứng tráng bạc, số nguyên tử C nhỏ hơn 4 →E là CH3COOCH3

G N Ỡ

31

- 0,04

= 7 → Y là HCOOC6H5

Khi làm bay hơi T thu được chất rắn gồm :HCOONa :0,01 + 0,04 = 0,05 mol,C6H5ONa :0,01 mol → m = 4,56 gam

TH1: Nếu CH3COOCH3 : 0,16 mol → chất rắn X gồm CH3COONa : 0,16 mol, NaOH dư :0,02 mol

Khi đốt cháy X sinh ra Na2CO3 :0,09 mol, CO2 :0,16.2 - 0,09 = 0,23 mol, H2O : = 14,62 gam

I Ồ B

Câu 19: D

Sưu tầm bởi GV. Nguyễn Thanh Tú

= 0,25 mol → m

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

24. Luyện tập giải một số bài tập hỗn hợp ANCOL – AXIT – ESTE (Đề 1)

Câu 1. Hỗn hợp X gồm một axit cacboxylic đơn chức Y, một ancol đơn chức Z, một este tạo ra từ Y và Z. Khi đốt cháy hoàn toàn 6,2 gam X thì thu được 0,31 mol CO2 và 0,28 mol H2O. Còn khi cho 6,2 gam X phản ứng vừa đủ với 50 ml dung dịch NaOH 1M, đun nóng, thì thu được 0,04 mol Z. Thành phần % số mol của axit Y trong hỗn hợp X là A. 36,72%. B. 42,86%. C. 57,14%. D. 32,15%. Câu 2. Hỗn hợp R chứa các hợp chất hữu cơ đơn chức gồm axit (X), ancol (Y) và este (Z) (được tạo thành từ X và Y). Đốt cháy 2,15 gam este (Z) rồi hấp thụ sản phẩm cháy vào dung dịch Ba(OH)2 dư được 19,7 gam kết tủa và khối lượng dung dịch giảm 13,95 gam. Mặt khác, 2,15 gam Z tác dụng vừa đủ với NaOH được 1,7 gam muối. Axit X và ancol Y tương ứng là A. HCOOH và C3H5OH. B. HCOOH và C3H7OH. C. CH3COOH và C3H5OH. D. C2H3COOH và CH3OH. Câu 3. X, Y là hai axit cacboxylic đều hai chức, mạch hở thuộc cùng dãy đồng đẳng kế tiếp; Z và T là hai este thuần chức hơn kém nhau 14 đvC, đồng thời Y và Z là đồng phân của nhau (MX < MY < MT). Đốt cháy 11,52 gam hỗn hợp E chứa X, Y, Z, T cần dùng 7,168 lít O2 (đktc). Mặt khác, để tác dụng hết với 11,52 gam E cần dùng 200 ml dung dịch NaOH 1M thu được 2,8 gam hỗn hợp gồm 3 ancol có cùng số mol. Số mol của X trong E có giá trị gần nhất với A. 0,022. B. 0,044. C. 0,055. D. 0,033. Câu 4. Cho hỗn hợp X gồm 1 este no, đơn chức Y và 1 ancol đơn chức Z tác dụng vừa đủ với 200 ml dung dịch NaOH 1M, thu được 0,35 mol ancol Z. Cho Z tách nước ở điều kiện thích hợp thu được chất hữu cơ T có tỉ khối hơi so với Z là 1,7. Mặt khác, đốt cháy hoàn toàn X cần dùng 44,24 lít O2 (đktc). Công thức phân tử của axit tạo Y là A. C5H10O2. B. C4H8O2. C. C3H6O2. D. C2H4O2. Câu 5. Hỗn hợp A gồm một axit đơn chức, một ancol đơn chức và 1 este đơn chức (các chất trong A đều có nhiều hơn 1C trong phân tử). Đốt cháy hoàn toàn m gam A rồi hấp thụ sản phẩm cháy vào bình đựng dung dịch Ca(OH)2 dư thấy có 135 gam kết tủa xuất hiện, đồng thời khối lượng dung dịch giảm 58,5 gam. Biết số mol ancol trong m gam A là 0,15. Cho Na dư vào m gam A thấy có 2,8 lít khí (đktc) thoát ra. Mặt khác, m gam A tác dụng vừa đủ dung dịch chứa 12 gam NaOH. Cho m gam A vào dung dịch nước brom dư. Hỏi số mol brom phản ứng tối đa là A. 0,4. B. 0,6. C. 0,75.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

D. 0,7. Câu 6. Cho hỗn hợp X gồm một axit cacboxylic đơn chức, một ancol đơn chức và este tạo bởi axit và ancol đó. Đốt cháy hoàn toàn 1,55 gam hỗn hợp X thu được 1,736 lít CO2 (ở đktc) và 1,26 gam H2O. Mặt khác khi cho 1,55 gam hỗn hợp X tác dụng vừa hết với 125 ml dung dịch NaOH 0,1 M. Sau phản ứng tổng số gam ancol thu được là 0,74 gam và ứng với 0,01 mol. Công thức cấu tạo của este là A. C2H5COOC3H7 B. CH2=CHCOOC4H9 C. C2H5COOC4H9 D. CH2=CHCOOC3H7 Câu 7. Cho hỗn hợp X gồm một axit cacboxylic đơn chức, một ancol đơn chức và este tạo bởi axit và ancol đó. Đốt cháy hoàn toàn 1,55 gam hỗn hợp X thu được 1,736 lít CO2 (ở đktc) và 1,26 gam H2O. Mặt khác khi cho 1,55 gam hỗn hợp X tác dụng vừa hết với 125 ml dung dịch NaOH 0,1M tạo ra m gam muối. Sau phản ứng tổng số gam ancol thu được là 0,74 gam và ứng với 0,01 mol. Vậy giá trị của m là: A. 1,205 gam B. 1,175 C. 1,275 gam D. 1,305 gam Câu 8. Hỗn hợp E gồm một ancol đơn chức X, một axit cacboxylic Y và một este Z tạo bởi X và Y. Lấy 0,13 mol hỗn hợp E cho phản ứng hết với 70 ml dung dịch KOH 1M đun nóng được p gam ancol X và dung dịch A. Để trung hoà hoàn toàn A thì cần 20 ml dung dịch HCl 1M. Cô cạn dung dịch sau trung hoà thu được 7,09 gam muối khan. Hoá hơi p gam X rồi dẫn vào ống đựng CuO dư đun nóng, thu được anđehit F. Cho toàn bộ F tác dụng hết với lượng dư AgNO3 trong dung dịch NH3 đun nóng, thu được 43,2 gam Ag. Nếu đốt cháy hoàn toàn 9,81 gam hỗn hợp E thì thể tích CO2 thu được ở đktc là A. 11,20 lít. B. 5,60 lít. C. 8,40 lít. D. 7,392 lít. Câu 9. Cho X, Y là hai chất thuộc dãy đồng đẳng của axit acrylic và MX < MY; Z là ancol có cùng số nguyên tử cacbon với X (MZ < 100); T là hợp chất chứa hai chức este tạo bởi X, Y và Z. Đốt cháy hoàn toàn 64,6 gam hỗn hợp E gồm X, Y, Z, T cần vừa đủ 59,92 lít khí O2 (đktc), thu được khí CO2 và 46,8 gam nước. Mặt khác, 64,6 gam E tác dụng tối đa với dung dịch chứa 0,2 mol Br2. Khối lượng muối thu được khi cho cùng lượng E trên tác dụng với KOH dư là A. 21,6 gam. B. 23,4 gam. C. 32,2 gam D. 25,2 gam. Câu 10. X, Y, Z là ba axit cacboxylic đơn chức cùng dãy đồng đẳng (MX < MY < MZ), T là este tạo bởi X, Y, Z với một ancol no, ba chức, mạch hở E. Đốt cháy hoàn toàn 26,6 gam hỗn hợp M gồm X, Y, Z, T (trong đó Y và Z có cùng số mol) bằng lượng vừa đủ khí O2, thu được 22,4 lít CO2 (đktc) và 16,2 gam H2O. Mặt khác, đun nóng 26,6 gam M với lượng dư dung dịch AgNO3/NH3, sau khi các phản ứng xảy ra hoàn toàn thu được 21,6 gam Ag. Mặt khác, cho 13,3 gam M phản ứng hết với 400ml dung dịch NaOH 1M và đun nóng, thu được dung dịch N. Cô cạn dung dịch N thu được m gam chất rắn khan. Giá trị m gần nhất với A. 24,74. B. 38,04. C. 16,74.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 25,10. Câu 11. X, Y là 2 axit cacboxylic đều mạch hở; Z là ancol no; T là este hai chức, mạch hở được tạo bởi X, Y, Z. Đun nóng 37,36 gam hỗn hợp E chứa X, Y, Z, T với 400 ml dung dịch NaOH 1M (vừa đủ), thu được ancol Z và hỗn hợp F gồm 2 muối có tỉ lệ mol 1 : 1. Dẫn toàn bộ Z qua bình đựng Na dư thấy khối lượng bình tăng 19,24 gam; đồng thời thu được 5,824 lít khí H2 (đktc). Đốt cháy hoàn toàn F cần dùng 0,5 mol O2, thu được CO2, Na2CO3 và 0,4 mol H2O. Phần trăm khối lượng của T trong hỗn hợp E là: A. 39,08%. B. 48,56%. C. 56,56%. D. 40,47%. Câu 12. X, Y là hai chất hữu cơ kế tiếp thuộc dãy đồng đẳng ancol anlylic; Z là axit no hai chức; T là este tạo bởi X, Y, Z. Đốt cháy 17,12 gam hỗn hợp E chứa X, Y, Z, T (đều mạch hở) cần dùng 10,864 lít O2 (đktc) thu được 7,56 gam nước. Mặt khác 17,12 gam E làm mất màu vừa đủ dung dịch chứa 0,09 mol Br2. Nếu đun nóng 0,2 mol E với 450 ml dung dịch KOH 1M, cô cạn dung dịch sau phản ứng, lấy phần lỏng chứa các chất hữu cơ đi qua bình đựng Na dư thấy khối lượng bình tăng m gam. Giá trị của m là A. 11,34 B. 7,50 C. 10,01 D. 5,69 Câu 13. Hỗn hợp X gồm một axit cacboxylic no hai chức, mạch hở; hai ancol no đơn chức kế tiếp nhau trong dãy đồng đẳng và một đieste tạo bởi axit và cả 2 ancol đó. Đốt cháy hoàn toàn 4,84 gam X trên thu được 7,26 gam CO2 và 2,70 gam H2O. Mặt khác, đun nóng 4,84 gam X trên với 80 ml dung dịch NaOH 1M, sau phản ứng thêm vừa đủ 10 ml dung dịch HCl 1M để trung hòa lượng NaOH dư. Cô cạn phần dung dịch thu được m gam muối khan, đồng thời thu được 896 ml hỗn hợp ancol (đktc) có tỉ khối hơi so với H2 là 19,5. Giá trị của m là A. 4,595 B. 5,765 C. 5,180. D. 4,990. Câu 14. Hỗn hợp M gồm CH3CH2OH, CH2=CHCH2OH, CH3COOH, CH2=CHCOOH, HCOOCH3. Đốt cháy hoàn toàn m gam M cần dùng vừa đủ 0,4 mol O2, thu được 0,35 mol CO2 và 0,35 mol H2O. Mặt khác, cho m gam M trên tác dụng vừa đủ với 50 gam dung dịch Ba(OH)2 nồng độ C%. Giá trị của C là A A. 68,40. B. 17,10. C. 34,20 D. 8,55. Câu 15. Hỗn hợp E gồm este X đơn chức và axit cacboxylic Y hai chức (đều mạch hở, không no có một liên kết đôi C = C trong phân tử). Đốt cháy hoàn toàn một lượng E thu được 0,43 mol khí CO2 và 0,32 mol hơi nước. Mặt khác, thủy phân 46,6 gam E bằng lượng NaOH vừa đủ rồi cô cạn dung dịch thu được 55,2 gam muối khan và phần hơi có chứa chất hữu cơ Z. Biết tỉ khối của Z so với H2 là 16. Phần trăm khối lượng của Y trong hỗn hợp E có giá trị gần nhất với A. 46,5 %. B. 48,0 %. C. 43,5 %. D. 41,5 %.

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 16. Đốt cháy hoàn toàn 0,05 mol hỗn hợp M gồm anđehit X và este Y, cần dùng vừa đủ 0,155 mol O2, thu được 0,13 mol CO2 và 2,34 gam H2O. Mặt khác, cho 0,1 mol M phản ứng với lượng dư dung dịch AgNO3 trong NH3, kết thúc các phản ứng thu được 21,6 gam Ag. Công thức cấu tạo thu gọn của X, Y lần lượt là A. CH3CHO và HCOOCH3 B. CH3CHO và HCOOC2H5. C. HCHO và CH3COOCH3. D. CH3CHO và CH3COOCH3. Câu 17. Đốt cháy hoàn toàn hỗn hợp X gồm: axit axetic, etyl axetat, metyl axetat rồi cho toàn bộ sản phẩm cháy vào bình (1) đựng dung dịch H2SO4 đặc, dư; bình (2) đựng dung dịch Ba(OH)2 dư. Kết thúc thí nghiệm thấy khối lượng bình (1) tăng thêm m gam, bình (2) thu được 10,835 gam kết tủa. Giá trị của m gần nhất với A. 1,1 B. 1,0. C. 0,9. D. 0,8. Câu 18. Hỗn hợp X gồm một anđehit, một axit cacboxylic và một este (trong đó axit và este là đồng phân của nhau). Đốt cháy hoàn toàn 0,2 mol X cần 0,625 mol O2, thu được 0,525 mol CO2 và 0,525 mol nước. Nếu đem toàn bộ lượng anđehit trong X phản ứng với dung dịch AgNO3 dư trong NH3 thì khối lượng Ag tạo ra là A. 32,4 gam. B. 64,8 gam. C. 16,2 gam D. 21,6 gam. Câu 19. Hỗn hợp X gồm anđehit Y, axit cacboxylic Z, este T. Đốt cháy hoàn toàn 0,2 mol X cần 0,625 mol O2, thu được 0,525 mol CO2 và 0,525 mol nước. Cho Y trong 0,2 mol X tác dụng với dung dịch AgNO3 dư trong NH3, đun nóng sau phản ứng được m gam Ag ( hiệu suất phản ứng 100%). Giá trị lớn nhất của m là A. 32,4 B. 10,8 C. 16,2 D. 21,6 Câu 20. Hỗn hợp X gồm anđehit Y, axit cacboxylic Z, este T. Đốt cháy hoàn toàn 0,2 mol X cần 0,625 mol O2, thu được 0,525 mol CO2 và 0,525 mol nước. Cho 0,2 mol X tác dụng với dung dịch AgNO3 dư trong NH3, đun nóng sau phản ứng được m gam Ag ( hiệu suất phản ứng 100%). Giá trị lớn nhất của m là A. 32,4 B. 59,4 C. 43,2 D. 21,6

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com → nZ = n T =

Gọi số mol của X, Y lần lượt là a,b

UY

Ta có hệ Câu 4: D Câu 2: A Nhận thấy khi đốt cháy Z hấp thụ sản phẩm cháy vào Ba(OH)2 dư → nBaCO3 = nCO2 = 0,1 mol

= 1,7 > 1→ T là ete dạng ROR

mdd giảm = mBaCO3 - mCO2 - mH2O → nH2O = 0,075 mol

= 0,05 mol

0 00

Vậy Z có cấu tạo HCOOC3H5, axit X có công thức HCOOH, ancol có công thức CH2=CH-CH2-OH Câu 3: B Ta có Y, Z là đồng phân nên Z, T là este có 2 chức Luôn có nNaOH = nCOO = 0,2 mol, nX + nY + nZ + nT = 0,1 mol Gọi số mol của CO2 và H2O lần lượt là x, y

N Á O

-L

H Í

ÓA

T

= 115,2 → X, Y là axit 2 chức, và Y là đồng phân của nhau nên tối thiểu Y phải có 4 C

Ỡ Ư D

→ X, Y, Z lần lượt là CH2(COOH)2 và HOOC-CH2-CH2-COOH, HCOO-CH2-CH2-OOCH mà T lại hơn Z 14dvc → T phải có cấu tạo CH3OOC-COOC2H5

I Ồ B

P Ấ C

Để thu được 3 ancol có mol bằng nhau CH3OH, C2H5OH, HO-CH2-CH2-OH → nT = nZ

Sưu tầm bởi GV. Nguyễn Thanh Tú

B

Khi X tác dụng với NaOH chỉ có este tham gia phản ứng → b= 0,2 , ∑nancol = a +b = 0,35 → a =0,15 mol

31

→ Mmuối = 1,7 : 0,025 = 68 (HCOONa)

NG

H

Khi thủy phân chỉ sinh ra ancol C3H7OH nên Y được tạo bởi axit và C3H7OH

Khi cho 2,15 gam Z ( 0,025 mol) tham gia phản ứng vừa đủ với NaOH thu được 0,025 mol muối

Ta có Mtb =

N Ầ TR

Gọi số mol của ancol C3H7OH, este: CnH2nO2 lần lượt là a, b

C: H: O = 0,1 : 0,15 : 0,05 = 2:3:1 vì Z là hợp chất hữu cơ đơn chức → CTPT C4H6O2

Ta có hệ

G N Ư

O Ạ Đ

.Q P T

N

= 1,7 → R = 43 (C3H7)

Có → nO (Z) =

N Ơ H

= 0,02 mol

2+

Có nO2 = 0,15. 1,5. 3 +0,2.

= 1,975→ n= 5 → este là CH3COOC3H7

Công thức phân tử của axit tạo Y là CH3COOH. Câu 5: C Ta có Ca(OH)2 dư nên nCO2 = n↓ = 1,35 mol Có mdd giảm = m↓ - mH2O -mCO2 → nH2O = 0,95 mol Có 2nH2 = nancol + naxit → naxit = 2.0,125-0,15 = 0,1 mol Giả sử este khác este của phenol → nNaOH = naxit + neste → neste =0,2 mol

Có nCO2 - nH2O = 0,4 = (k-1). ( 0,1 +0,15 + 0,2) → k =

( với k là số liên kết π trung bình trong A)

Để lượng Br2 phản ứng là lớn nhất thì este phải ở dạng HCOOR', lượng liên kết π trong COOH không tham gia phản ứng

Khi đó nBr2= nsố liên kết π - naxit 0,45.

- 0,1 = 0,75 mol

Câu 6: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

0,13 mol E phản ứng vừa đủ 0,07- 0,02.1 = 0,05 mol KOH. Y và Z đều phản ứng với KOH theo tỉ lệ 1 ÷ 1 7,09 gam muối khan gồm KCl : 0,02 mol và RCOOK : 0,05 mol

→ MR =

= 29 (C2H5)

X không phản ứng với KOH. → n X = 0,13 - 0,05 = 0,08 mol. Có nNaOH = nCOO = naxit + neste = 0, 125mol

O Ạ Đ

UY

.Q P T

N

Gọi x là số mol este Z thì lượng ancol sau khi phản ứng + KOH xong bằng (0,08 + x) mol

G N Ư

→ (0,08 + x) mol andehit T. Lại có n Ag↓ = 0,4 mol

Số mol ancol trong hỗn hợp X:

+ TH 1: T là HCHO thì n T = 0,4 ÷ 4 = 0,1 =0,08 +x → x = 0,02 mol → axit :0,05- 0,02 =0,03 mol

N Ầ TR

H

E gồm CH3OH: 0,08 mol, C2H5COOH:0,03 mol, C2H5COOCH3: 0,02 mol → mE =6,54 gam

X gồm R1COOH : 0,0075, C4H9OH : 0,005 mol, R1COOC4H9: 0,005 mol

→ Đốt cháy 6,54 gam E sinh ra 0,08.1 + 0,03. 3 + 0,02. 4 = 0,25 mol CO2 → R1 =

= 27 (C2H3)

0 00

Công thức cấu tạo của este là CH2=CH-COOC4H9. Câu 7: B trước hết ta tính được ngay Mancol = 0,74 ÷ 0,01 = 74 → ancol là C4H9OH. Xét phản ứng đốt cháy: {axit, este, ancol} + O2 → CO2 + H2O.

P Ấ C

2

BTKL: mO2 = mCO2 + mH2O - mhh = 0,0775 × 44 + 0,07 × 18 - 1,55 = 3,12 gam → nO2 = 0,0975 mol.

A Ó H

Để ý xử lí tinh tế 1 tí: este + H2O → axit + ancol → cộng 2 vế pư đốt cháy trên với cùng lượng nước rồi quy đổi este + nước = axit vs ancol thì hỗn hợp X sẽ gồm 0,01 mol ancol và 0,0125 mol axit ( do naxit + este = nNaOH = 0,0125 ở pư sau ).

Í -L

-

→ phản ứng đốt cháy mới: { 0,0125 axit; 0,01 ancol } + 0,195 O → 0,0775 CO2 + ( 0,07 + x ) H2O.

N Á O

B

→ Đốt cháy 9,81 gam hỗn hợp E sinh ra 9,81.0,25: 6,54 = 0,375 mol → V = 8,4 lit.

1 3 +

+ TH 2:: T khác HCHO → nT = 0,4 ÷ 2 = 0,2 mol → x = 0,12 mol → loại vì x + n Y = 0,05. Câu 9: B Câu 10: A nH2O =0,9 mol, nCO2 = 1 mol

Có nO(M) =

=0,8 mol

Do M tham gia phản ứng tráng bạc → X là HCOOH. Hỗn hợp X, Y, Z là axit no đơn chức mạch hở. E có dạng (R1COO)2-R-OOH Gọi số mol HCOOH: a mol, số mol của Y là b mol, số mol của Z là b mol , este T là c

Bảo toàn oxi tìm x, ta có: x + 0,07 + 0,0775 × 2 = 0,195 + 0,0125 × 2 + 0,01 → x = 0,005 mol.

T

→ mhh { 0,0125 axit; 0,01 ancol } = 1,55 + 0,005 × 18 = 1,64 gam → maxit = 0,9 gam.

Ta có hệ

Có thể tìm được CTCT của axit là C2H3COOH nhưng không cần thiết.

Luôn có CY ≥ 2, CZ ≥ 3 ( vậy Ctrung bình của Y, Z > 2) CE ≥ 3, CT ≥ 2 + 3 + 3 +1 =9

Tiếp phản ứng sau: axit + NaOH → muối + nước.

Có nCO2 = 1 mol ≥ 0,05.1 +Ctrung bình của Y, Z .0,2 +0,05. 9 → Ctrung bình của Y, Z ≤ 2,5 → Y phải là CH3COOH

Vậy mmuối = 0,9 + 0,0125 × 22 = 1,175 gam. Câu 8: C

Vì Y, Z có cùng số mol mà Y là CH3COOH, Ctrung bình của Y, Z ≤ 2,5 → Ctrung bình của Y, Z = 2,5 và Z là C2H5COOH

Ư D I Ồ B

G N Ỡ

Sưu tầm bởi GV. Nguyễn Thanh Tú

bảo toàn nguyên tố C → 1 = 0,05 + 0,1.2 + 0,1.3 + 0,05.CE→ CE = 9 → ancol E phải là C3H5(OH)3

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Có Cancol ≥ 3, Caxit≥ 2, Ceste ≥ 3+ 4+ 2=9 Trong 26,6 gam M thì có HCOOH: 0,05mol, CH3COOH: 0,1mol, C2H5COOH : 0,1 mol, este: 0,05 mol Trong 13,3 gam M thì có HCOOH: 0,025mol, CH3COOH: 0,05 mol, C2H5COOH : 0,05 mol, este: 0,025 mol

Có Ctb =

Có nNaOH pư = 0,025 +0,05 + 0,05 + 0,025.3 = 0,2 mol →NaOh còn dư

Trong 17,12 gam E tổng số mol các chất là 0,07 +0,12+ 0,01 = 0,2 mol

= 2,85 → Y là HOOC-COOH

Bảo toàn khối lượng → m = 13,3 + 0,4. 40 -18. ( 0,025 +0,05 + 0,05) -92. 0,025 = → m = 24,75 gam. Câu 11: A T là este 2 chức tạo bởi X, Y thủy phân trong NaOH thu được 2 muối có tỉ lệ mol 1 : 1 → Z phải là ancol no, 2 chức. X,Y có số mol bằng nhau

0,2 molE đi qua 0,45 mol KOH thì tạo ra

G N Ư

O Ạ Đ

.Q P T

UY

N

Bảo toàn khối lượng → mR-CH=CH-CH2OH = 17,12 + 045. 56 -( 0,13. 166+ 0,19. 56+ 0,24. 18) = 5,78 gam

Có nZ = nH2 = 0,26 mol,m bình tăng = mancol - mH2 → mancol = 19,76 → M ancol= 19,76 :0,26 = 76 (C3H8O2)

H

Phần chất lỏng chứa chất hữu cơ R-CH=CH-CH2OH :0,09 mol ( 5,78 gam) tác dụng với Na dư sinh ra H2: 0,045 mol

Có nCOO ( muối) = nNaOH = 0,4 mol

N Ầ TR

mbình = mR-CH=CH-CH2OH - mH2 = 5,78- 0,045.2 = 5,69 gam Bảo toàn Na → nNa2CO3 = 0,2 mol

Bảo toàn nguyên tố O → nCO2 =

0 00

=0,4 mol

Vì nCO2 = nH2O → muối F là muối của axit no đơn chức mạch hở dạng CnH2n-1COONa : 0,4 mol

P Ấ C

Có mmuối = 0,4. 44 + 0,4. 18 + 0,2. 106 -0,5. 32 = 30 gam → Mmuối = 75 → hai muối có số mol bằng nhau là ∑HCOONa: 0,2 mol và ∑CH3COONa: 0,2 mol

A Ó H

2

Bảo toàn khối lượng → mH2O = 37,36 + 0,4. 40 - 19,76- ( 0,4. 44 + 0,4. 18 + 0,2. 106 -0,5. 32) = 3,6 gam → naxit =nH2O = 0,2 mol → HCOOH 0,1 mol, CH3COOH : 0,1 mol, (HCOO-C3H6-OOCCH3 : 0,1 mol, C3H8O2 :0,26 0,1 = 0,16 mol

Phần trăm khối lượng của T trong hỗn hợp E là: Câu 12: D Có O2 : 0,485 mol, H2O : 0,42 mol

G N Ỡ

ÁN

Í -L

-

. 100% = 39,08%.

TO

1 3 +

B

Câu 13: B Phân tích nhanh các giả thiết có: 2 ancol có M = 19,5 × 2 = 39 → là CH3OH và C2H5OH.

Để tiện hơn, ta nên lấy công thức đại diện là C1,5H5O, số mol là 0,04 mol.

Có 2 hướng giải quyết cho bài toán này: ♦ 1 (quen thuộc) là gọi số mol 3 chất ban đầu là x, y, z. lập hệ gồm: số mol ancol, số mol tác dụng NaOH và bảo toàn O → giải ra x, y, z. công việc sau đó không có gì khó khăn. ♦ 2. Có thể đi theo hướng suy luận sau: đốt X → CO2 + H2O. cộng thêm 2 vế với 2x mol H2O (với x là số mol este) → vế trái sẽ gồm: 0,035 mol axit 2 chứ, no mạch hở và 0,04 mol ancol C1,5H5O. vế phải gồm: 0,165 mol CO2 và (0,15 + 2x) mol H2O. chú ý: đốt cùng số mol axit 2 chức, no mạch hở với ancol no mạch hở sẽ cho nCO2 = nH2O → hiệu: nH2O – nCO2 = (0,15 + 2x) – 0,165 = đốt 0,05 mol ancol no hở = 0,05 → x = 0,01 mol.

Bảo toàn khối lượng → mCO2 =17,12 +0,485.32- 0,42.18 =25,08 gam → nCO2 = 0,57 mol do đó phản ứng với NaOH, sau thêm HCl sẽ thu được 0,035 mol muối axit và 0,01 mol NaCl.

Gọi số mol của ancol, axit, este lần lượt là a, b, c

Ư D I Ồ B

Ta có hệ

Bảo toàn khối lượng có maxit = 4,84 + 0,02 × 18 – 0,04 × 39 = 3,64 gam. Tác dụng NaOH thì 1 H đổi 1Na nên tiếp tục bảo toàn ta có: →

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

m = 3,64 + 0,07 × (23 – 1) + 0,01 × 58,5 = 5,765 gam. Câu 14: B Gọi số mol của C2H5OH , CH2=CHCH2OH, CH3COOH, CH2=CHCOOH, HCOOCH3 lần lượt là a, b, c,d ,e .

UY

Vì số mol của CO2 bằng số mol của H2O nên nC2H5OH = nCH2=CHCOOOH → a= d Bảo toàn nguyên tố O → a + b + 2c + 2d + 2e = 0,35.2+ 0,35 - 0,4.2 = 0,25 (1) Bảo toàn nguyên tố C → 2a + 3b + 2c + 3d + 2e = 0,35 (2)

O Ạ Đ

.Q P T

N

Câu 17: B Hỗn hợp X gồm: C2H4O2, C4H8O2, C3H6O2 + O2 → CO2 + H2O. Với nCO2 = nH2O.

Lấy (2) - (1) → a + 2b + d =0,1 → a + 2b + a = 0,1 → a + b =0,05 → c +d + e = 0,1 Có nBa(OH)2 = 0,5. ( c +d + e ) = 0,05 mol

H

G N Ư

Cho sản phẩm qua bình (1) đựng H2SO4 đặc, dư thì H2O bị giữ lại. → C% = .100% = 17,1%. Câu 15: A Gọi số mol của X ( CnH2n-2O2 với n ≥ 3) và Y (CmH2m-4O4 với m ≥4) lần lượt là x, y mol

nCO2 = nBaCO3 = 10,835 : 197 = 0,055 mol → nH2O = 0,055 mol.

0 00

Nhận thấy nCO2 - nH2O= x+ 2y = 0,11 mol → mE = mC + mH + mO → mE = 0,43.12 + 0,32.2 + 16.2 (x+ 2y) = 9,32 gam → Trong 46,6 ( 9,32. 5) gam E gọi số mol X, Y lần lượt là a, b → a+ 2b = 0,11.5 Ta có MZ = 16.2 → Z là CH3OH

A Ó H

Bảo toàn khối lượng → 46,6 + 40. (a+2b) = 55,2 + 32a + 18.2b → 32a + 36b= 13,4 Giải hệ → a= 0,25 và b = 0,15

Ta có Ctb =

= 5,375

TO

ÁN

Í -L

-

N Ầ TR

CO2 + bình (2) đựng Ba(OH)2 dư

P Ấ C

2

1 3 +

B

→ mbình (1) tăng = 0,055 x 18 = 0,99 gam. Câu 18: C Nhận thấy CO2 bằng số mol H2O nên một anđehit, một axit cacboxylic và một este đều no đơn chức, mạch hở Gọi số mol andehit CnH2nO là a, tổng số mol axit và este ( CmH2mOlà b

Ta có hệ

Có 0,075m+0,125n=0,525 → 3m+5n=21 → m = 2, n = 3 → anđehit là CH3CHO : 0,075 mol → m Ag =0,075. 2. 108 = 16,2 gam Câu 19: A Nhận thấy CO2 bằng số mol H2O nên một anđehit, một axit cacboxylic và một este đều no đơn chức, mạch hở

Sử dụng sơ đồ đường chéo và tỉ lệ nX : nY = 5:3 → X là C5H8O2 và Y là C6H8O4

→ %mY = Câu 16: B

I Ồ B

G N Ỡ

Gọi số mol andehit là a, tổng số mol axit và este là b

×100% = 46, 35%.

Ta có hệ

X và Y đều là no, đơn chức, hở

Bảo toàn oxi:

Sưu tầm bởi GV. Nguyễn Thanh Tú

Có Ctb = 0,525 : 0,2 = 2,625 Để lượng Ag là lớn nhất thì andehit phải là HCOOH :0,075 mol, axit dạng HCOOH : x mol, este dạng HCOOR' : y mol (Với số C ≥ 3 )

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Có x + y = 0,125,x + yn = 0,525- 0,075. Dễ dàng nhận thấy nếu n ≥ 3 thì x, y không có nghiệm dương → loại TH2: andehit là HCOOH, axit có số C ≥ 2 , este dạng HCOOOR. Không đủ dữ kiện để tính

UY

TH3: andehit là HCOOH :0,075 mol, axit có số C ≥ 2, este không phải dạng HCOOR → mAg = 0,075. 4 . 108 = 32,4 gam. Câu 20: A Nhận thấy CO2 bằng số mol H2O nên một anđehit, một axit cacboxylic và một este đều no đơn chức, mạch hở Gọi số mol andehit là a, tổng số mol axit và este là b

Ta có hệ Có Ctb = 0,525 : 0,2 = 2,625

Để lượng Ag là lớn nhất thì andehit phải là HCOOH :0,075 mol, axit dạng HCOOH : x mol, este dạng HCOOR' : y mol (Với số C ≥ 3 ) Có x + y = 0,125,x + yn = 0,525- 0,075. Dễ dàng nhận thấy nếu n ≥ 3 thì x, y không có nghiệm dương → loại TH2: andehit là HCOOH, axit có số C ≥ 2 , este dạng HCOOOR. Không đủ dữ kiện để tính

2

TH3: andehit là HCOOH :0,075 mol, axit có số C ≥ 2, este không phải dạng HCOOR → mAg = 0,075. 4 . 108 = 32,4 gam.

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

1 3 +

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

25. Kĩ thuật QUY VỀ ĐIPEPTIT xử lý bài toán đốt cháy peptit (Đề 1)

Câu 1. X là một α-aminoaxit no, chứa 1 nhóm -COOH và 1 nhóm -NH2. Từ m gam X điều chế được m1 gam đipeptit. Từ 2m gam X điều chế được m2 gam tripeptit. Đốt cháy m1 gam đipeptit thu được 0,3 mol nước. Đốt cháy m2 gam tripeptit thu được 0,55 mol H2O. Giá trị của m là A. 11,25 gam. B. 13,35 gam. C. 22,50 gam. D. 26,70 gam. Câu 2. Tripeptit mạch hở X được tạo nên từ một aminoaxit A (no, mạch hở, trong phân tử chứa một nhóm – NH2 và một nhóm –COOH). Thủy phân hoàn toàn m gam X trong 120 ml dung dịch NaOH 2M, rồi cô cạn thu được hỗn hợp rắn Y có khối lượng 16,44 gam gồm hai chất có cùng số mol. Đốt cháy hoàn toàn m gam X sẽ thu được tổng khối lượng CO2 và H2O là A. 9,24 B. 14,52 C. 10,98 D. 21,96 Câu 3. X là một peptit mạch hở. Nếu thủy phân không hoàn toàn m gam X chỉ thu được các tripeptit thì tổng khối lượng của tripeptit là 56,7 gam. Nếu thủy phân không hoàn toàn m gam X chỉ thu được các đipeptit thì tổng khối lượng của đipeptit là 59,4 gam. Nếu thủy phân hoàn toàn m gam X thì thu được a gam một amino axit Y (chỉ có 1 nhóm -COOH và 1 nhóm -NH2). Giá trị của a là: A. 62,1. B. 64,8. C. 67,5. D. 70,2. Câu 4. [PHV-FC]: Oligopeptit mạch hở X được tạo nên từ các α – amino axit đều có công thức dạng H2NCxHyCOOH. Đốt cháy hoàn toàn 0,05 mol X cần dùng vừa đủ 1,875 mol O2, chỉ thu được N2; 1,5 mol CO2 và 1,3 mol H2O. Mặt khác, thủy phân hoàn toàn 0,025 mol X bằng 400ml dung dịch NaOH 1M và đun nóng, thu được dung dịch Y. Cô cạn cẩn thận toàn bộ dung dịch Y thu được m gam chất rắn khan. Số liên kết peptit trong X và giá trị của m lần lượt là A. 9 và 27,75. B. 10 và 33,75. C. 9 và 33,75. D. 10 và 22,75. Câu 5. X là một peptit mạch hở. Nếu thuỷ phân không hoàn toàn m gam X trong điều kiện thích hợp chỉ thu được các tripeptit có tổng khối lượng các tripeptit là 58,5 gam. Cũng thuỷ phân không hoàn toàn m gam X trong điều kiện thích hợp khác chỉ thu được các đipeptit có tổng khối lượng các đipeptit là 62,1 gam. Thuỷ phân hoàn toàn m gam X chỉ thu được a gam hỗn hợp các aminoaxit (chỉ chứa 1 nhóm -NH2, 1 nhóm -COOH). Giá trị của a gần nhất với A. 65,0 B. 73,0 C. 67,0 D. 71,0

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 6. X là một α- amino axit no mạch hở chứa 1 nhóm COOH, 1 nhóm NH2. Từ 3m gam X điều chế được m1 gam đipeptit. Từ m gam X điều chế được m2 gam tripeptit. Đốt cháy m1 gam đipeptit thu được 1,35 mol nước Đốt cháy m2 gam tripeptit thu được 0,425 mol H2O. Giá trị của m là: A. 22,50 gam B. 13,35 gam C. 26,79 gam D. 11,25 gam Câu 7. X là một peptit mạch hở. Nếu thủy phân không hoàn toàn m gam X chỉ thu được các tripeptit thì tổng khối lượng của tripeptit là 56,7 gam. Nếu thủy phân không hoàn toàn m gam X chỉ thu được các đipeptit thì tổng khối lượng của đipeptit là 59,4 gam. Nếu thủy phân hoàn toàn m gam X thì thu được a gam một amino axit Y (chỉ có 1 nhóm -COOH và 1 nhóm -NH2). Giá trị của a là A. 62,1. B. 64,8. C. 67,5. D. 70,2. Câu 8. X là peptit có dạng CxHyOzN6; Y là peptit có dạng CnHmO6Nt (X, Y đều được tạo bởi các amino axit no chứa 1 nhóm –NH2 và 1 nhóm –COOH). Đun nóng 32,76 gam hỗn hợp E chứa X, Y cần dùng 480 ml dung dịch NaOH 1M. Mặt khác, đốt cháy 32,76 gam E thu được sản phẩm cháy gồm CO2, H2O và N2. Dẫn toàn bộ sản phẩm cháy vào nước vôi trong lấy dư thu được 123,0 gam kết tủa; đồng thời khối lượng dung dịch sau phản ứng thay đổi a gam so với dung dịch nước vôi trong ban đầu. Giá trị của a là A. 44,04 B. 46,74 C. 49,44 D. 73,56 Câu 9. X và Y lần lượt là tripeptit và tetrapeptit tạo thành từ 1 loại aminoaxit no mạch hở có 1 nhóm –NH2 và 1 nhóm –COOH. Đốt cháy 0,1 mol Y thu được CO2, H2O và N2 trong đó tổng khối lượng CO2 và H2O là 47,8 gam. Nếu đốt 0,1 mol X cần bao nhiêu mol O2? A. 0,560 mol B. 0,896 mol C. 0,675 mol D. 0,375 mol Câu 10. Hỗn hợp X gồm 0,1 mol một α-aminoaxit no mạch hở A chứa 1 nhóm –NH2, 1 nhóm –COOH và 0,025 mol pentapeptit mạch hở cấu tạo từ A. Đốt cháy hỗn hợp X cần a mol O2, sản phẩm cháy hấp thụ hết vào 1 lít dung dịch NaOH 1,2M thu được dung dịch Y. Rót từ từ dung dịch chứa 0,8a mol HCl vào dung dịch Y thu được 14,448 lít CO2 (đktc). Đốt 0,01a mol đipeptit mạch hở cấu tạo từ A cần V lít O2 (đktc). Giá trị của V là A. 2,2491 B. 2,5760 C. 2,3520 D. 2,7783 Câu 11. Thủy phân hoàn toàn 0,09 mol hỗn hợp X gồm tripeptit, tetapeptit, pentapetit với dung dịch NaOH vừa đủ thu được 16,49 gam muối của Glyxin, 17,76 gam muối của Alanin và 6,95 gam muối của Valin. Nếu đốt cháy hoàn toàn m gam hỗn hợp X thì thu được CO2, H2O và N2 trong đó tổng khối lượng của CO2 và H2O là 46,5 gam. Giá trị gần đúng của m là A. 24 B. 21

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 26 D. 32 Câu 12. X và Y lần lượt là các tripeptit và hexapeptit được tạo thành từ cùng một amoni axit no mạch hở, có một nhóm –COOH và một nhóm –NH2. Đốt cháy hoàn toàn 0,1 mol X bằng O2 vừa đủ thu được sản phẩm gồm CO2, H2O và N2 có tổng khối lượng là 40,5 gam. Nếu cho 0,15 mol Y tác dụng hoàn toàn với NaOH (lấy dư 20%), sau phản ứng cô cạn dung dịch thu được bao nhiêu gam chất rắn ? A. 9,99 gam B. 87,3 gam C. 94,5 gam D. 107,1 gam Câu 13. Đipeptit X và tetrapeptit Y đều được tạo thành từ 1 amino axit no (trong phân tử chỉ có 1 nhóm –NH2 và 1 nhóm -COOH). Cho 19,8 gam X tác dụng vừa đủ với dung dịch HCl thu được 33,45 gam muối. Để đốt cháy hoàn toàn 0,1 mol Y cần dùng số mol O2 là A. 1,15. B. 0,5 C. 0,9. D. 1,8. Câu 14. Đipeptit mạch hở X và tripeptit mạch hở Y đều được tạo nên từ một α-aminoaxit (no, mạch hở, trong phân tử chứa một nhóm -NH2 và một nhóm -COOH). Đốt cháy hoàn toàn 0,01 mol Y thu được tổng khối lượng CO2 và H2O bằng 5,49 gam. Đốt cháy hoàn toàn 0,02 mol X, sản phẩm thu được cho lội từ từ qua nước vôi trong dư, tạo ra m gam kết tủa. Giá trị của m là A. 3. B. 4,5. C. 12. D. 6. Câu 15. Tripeptit X và pentapeptit Y đều được tạo ra từ aminoaxit X no, mạch hở, có 1 nhóm amino và 1 nhóm cacboxyl. Đốt cháy hoàn toàn 0,01 mol X rồi cho sản phẩm cháy vào bình đựng dung dịch nước vôi trong dư thấy tạo thành 6 gam kết tủa. Nếu đốt cháy hoàn toàn 0,02 mol Y thì thu được N2 và m gam hỗn hợp CO2 và H2O. Giá trị của m là A. 11,86. B. 13,3. C. 5,93. D. 6,65. Câu 16. Thủy phân hoàn toàn m gam hỗn hợp gồm peptit X và peptit Y bằng dung dịch NaOH thu được 151,2 gam hỗn hợp gồm các muối natri của Gly, Ala và Val. Mặt khác, để đốt cháy hoàn toàn m gam hỗn hợp X, Y ở trên cần 107,52 lít khí O2 (đktc) và thu được 64,8 gam H2O. Giá trị của m là A. 102,4. B. 97,0. C. 92,5. D. 107,8. Câu 17. Peptit X và peptit Y có tổng liên kết peptit bằng 8. Thủy phân hoàn toàn X cũng như Y đều thu được Gly và Val. Đốt cháy hoàn toàn hỗn hợp E chứa X và Y có tỉ lệ mol tương ứng 1:3 cần dùng 22,176 lit O2 (đktc). Sản phẩm cháy gồm CO2, H2O và N2. Dẫn toàn bộ sản phẩm cháy qua bình đựng dung dịch Ca(OH)2 dư thấy khối lượng bình tăng 46,48 gam, khí thoát ra khỏi bình có thể tích 2,464 lit (đktc). Thủy phân hoàn toàn hỗn hợp E thu được a mol Gly và b mol Val. Tỉ lệ a : b có giá trị là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 1,00 B. 0,75 C. 1,25 D. 0,67 Câu 18. X và Y lần lượt là tripeptit và hexapeptit đều mạch hở và đều được tạo thành từ cùng một amoni axit no mạch hở (chứa một nhóm –COOH và một nhóm –NH2). Đốt cháy hoàn toàn 0,1 mol X bằng O2 vừa đủ thu được sản phẩm gồm CO2, H2O và N2 có tổng khối lượng là 40,5 gam. Nếu cho 0,15 mol Y tác dụng hoàn toàn với NaOH (lấy dư 20% so với lượng phản ứng), sau phản ứng cô cạn dung dịch thì thu được chất rắn khan có khối lượng là A. 87,3 gam. B. 9,99 gam. C. 107,1 gam. D. 94,5 gam. Câu 19. Đốt cháy hoàn toàn a mol một peptit X được tạo thành từ amino axit no A chỉ chứa một nhóm axit, một nhóm amin thì thu được b mol CO2 và c mol H2O. Biết b-c = 4a. Số liên kết peptit trong X là. A. 10. B. 9. C. 5 D. 6 Câu 20. Thuỷ phân không hoàn toàn m gam heptaeptit Gly-Ala-Gly-Ala-Gly-Ala-Gly thu được 153,3 gam hỗn hợpX gồm Ala, Ala-Gly, Gly-Ala, Gly-Val-Gly. Đốt cháy toàn bộ X cân vừa đủ 6,3 mol O2. Gía trị m gần giá trị nào nhất dưới đây ? A. 138,2 B. 145,7. C. 160,82. D. 130,88 Câu 21. X và Y lần lượt là tripeptit và hexapeptit đều mạch hở và đều được tạo thành từ cùng một amino axit no mạch hở (chứa một nhóm –COOH và một nhóm –NH2). Đốt cháy hoàn toàn 0,1 mol X bằng O2 vừa đủ thu được sản phẩm gồm CO2, H2O và N2 có tổng khối lượng là 40,5 gam. Nếu cho 0,15 mol Y tác dụng hoàn toàn với NaOH (lấy dư 20% so với lượng phản ứng), sau phản ứng cô cạn dung dịch thì thu được chất rắn khan có khối lượng là A. 87,3 gam. B. 9,99 gam. C. 107,1 gam. D. 94,5 gam. Câu 22. Đun nóng 4,63 gam hỗn hợp X gồm ba peptit mạch hở với dung dịch KOH (vừa đủ). Khi các phản ứng kết thúc, cô cạn dung dịch thu được 8,19 gam muối khan của các amino axit đều có dạng H2NCmHnCOOH. Đốt cháy hoàn toàn 4,63 gam X cần 4,2 lít O2 (đktc), hấp thụ hết sản phẩm cháy (CO2, H2O, N2) vào dung dịch Ba(OH)2 dư. Sau phản ứng thu được m gam kết tủa và khối lượng phần dung dịch giảm bớt 21,87 gam. Giá trị của m gần giá trị nào nhất sau đây? A. 35,0. B. 27,5. C. 32,5. D. 30,0.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 23. Hỗn hợp T gồm tetrapeptit X và pentapeptit Y (đều mạch hở, tạo bởi glyxin và alanin). Đun nóng m gam T trong dung dịch NaOH vừa đủ, thu được (m + 7,9) gam muối Z. Đốt cháy hoàn toàn Z, thu được Na2CO3 và hỗn hợp Q gồm CO2, H2O, N2. Dẫn toàn bộ Q vào bình đựng nước vôi trong dư, khối lượng bình tăng thêm 28,02 gam và còn lại 2,464 lít (đktc) một chất khí duy nhất. Phần trăm khối lượng của X trong T là A. 55,92%. B. 35,37%. C. 30,95%. D. 53,06%. Câu 24. Thủy phân hoàn toàn m gam tetrapeptit X mạch hở thu được hỗn hợp Y gồm 2 amino axit no, mạch hở, có số cacbon liên tiếp (phân tử chứa 1 nhóm COOH và 1 nhóm NH2). Đốt cháy hoàn toàn hỗn hợp Y cần vừa đủ 9 mol không khí (chứa 20% O2 về thể tích, còn lại là N2) thu được CO2, H2O và 165,76 lít khí N2 (ở đktc). Số công thức cấu tạo thỏa mãn tính chất của X là A. 4. B. 12. C. 8. D. 6. Câu 25. Hỗn hợp X gồm Gly–Ala, Ala–Ala–Val–Ala, Ala–Gly, Ala–Val–Val–Ala và Ala–Ala. Cho m gam hỗn hợp X tác dụng với lượng vừa đủ NaOH đun nóng thu được (m + 29,7) gam hỗn hợp muối của các aminoaxit. Mặt khác, nếu đốt cháy hoàn toàn m gam hỗn hợp X thu được 63,616 lít CO2 (đktc) và 49,32 gam H2O. Giá trị gần đúng của m là A. 72,30 B. 72,10 C. 74,09 D. 73,76

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A

N Á O

Í -L

-

A Ó H

P Ấ C

2

tức 1X + 1H2O → 2X2 ||→ X là X4 Câu 3: C Gọi x là số mol peptit và 6k là loại peptit của X (vì cắt thành tripeptit hay đipeptit đều được) 56,7 - 18 x (2k - 1)x = 59,4 - 18 x (3k - 1)x → kx = 0,15 a = 56,7 + 18 x 4kx = 67,5 Câu 4: C Giải BT không cần đến giả thiết 0,5 mol X.

O Ạ Đ

UY

.Q P T

N Ơ H

N

Theo bảo toàn oxi cần đốt và C, N: khi đốt đipeptit CnH2nN2O3 cần 1,875 mol O2 và

G N Ư

thu được 1,5 mol CO2 + 1,5 mol H2O → Bảo toàn oxi → nđipeptit = 0,25 mol; mđipeptit = 40 gam.

N Ầ TR

H

Số mol H2O quy đổi là 0,2 mol; phương trình quy đổi: 2Xn + (n – 2)H2O → nX2; ||→ tỉ lệ n ÷ (n – 2) = 5 ÷ 4 ||→ n = 10 → X có 9 liên kết peptit.

1 3 +

0 00

B

nX = 0,25 – 0,2 = 0,05 mol → khi nX = 0,025 mol thì nđipeptit = 0,125 mol; mđipeptit = 20 gam. Sp thủy phân X ↔ sp thủy phân đipeptit ||→ m = 20 + 0,4 × 40 – 0,125 × 18 = 33,75 gam.

Câu 5: B Gọi số aa trong X là n và số mol X là x Khi thủy phân hoàn toàn X thu được tripeptit

Khi thủy phân hoàn toàn X thu được đipeptit

T

Câu 2: A ► cách 1: X dạng CnH2n+2–mNmOm+1 ||→ b – c = a ↔ n – (2n + 2 – m) ÷ 2 = 1

ƯỠ

||→ m = 4 ||→ X là X4 (tetrapeptit)

D I BỒ

NG

Khi thủy phân hoàn toàn X thu được aa

Thủy phân dùng BTKL có: mX + 0,2 × 4 × 2 × 40 = (mX + m) + 0,2 × 18 ||→ m = 60,4 gam. Chọn A. ♥. ► cách 2: a mol X cần (b – c = a) mol H2O để chuyền thành đipeptit X2

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 6: B Ta có 3m gam X CnH2n+1NO2→ m1 gam C2nH4nN2O3 3m gam CnH2n+1NO2 → 3m2 gam C3nH6n-1N3O4

C6H11N3O4 + 6,75O2 → 6CO2+ 5,5 H2O + 1,5N2

1,35 mol H2O

N

Có nO2 = 6,75.0,1 = 0,675 mol. Câu 10: D Nhận thấy đốt X và đốt ( 0,1 + 0,025. 5) = 0,225 mol A cần lượng O2 như nhau , sinh ra lượng CO2 giống nhau

3.0,425 mol H2O

Luôn có khi đốt đipeptit thu được nCO2 = nH2O = 1,35 mol

UY

Gọi công thức của A là CnH2n+1NO2

Vì lượng CO2 không đổi nên khi đốt tripeptit cũng cho số mol CO2 là 1,35 mol → ntripeptit = 2. ( nCO2 - nH2O ) = 0,15 mol

O Ạ Đ

CnH2n+1NO2 + (1,5n-0,75)O2 → nCO2 + (n+ 0,5)H2O + 0,5N2

→ nX = 0,15. 3 = 0,45 mol → n = 1,35 : 0,45 = 3

.Q P T

Đốt cháy X cần 0,225.( 1,5n- 0,75) O2 và sinh ra 0,225n mol CO2

→ m= 0,15. 89= 13,35 gam. Câu 7: C Gọi số mol amino axit Y là x mol → số mol đipeptit là x /2 mol, số mol tripeptit là x/3

H

G N Ư

Khi cho HCl vào dung dịch Y sinh ra

N Ầ TR

+ 0,645mol CO2

Bảo toàn nguyên tố C → 1,2-0,8a + 0,645 = 0,225n → 1,2- 0,8. [0,225.( 1,5n- 0,75)] + 0,645= 0,225n → n = 4 → a = 1,18125 mol

Ta có hệ

0 00

→ m =75.0,9 = 67,5 gam. Câu 8: C

+ O2 → CO2: 1,23 mol

Coi 32,76 gam hỗn hợp peptit gồm Bảo toàn nguyên tố C → 0,48.2 + x =1,23 → x = 0,27 mol

A Ó H

Bảo toàn khối lượng → mH2O = 32,76 - 0,48. 57 - 0,27. 14 = 1,62 gam ( 0,09 mol)

Bảo toàn nguyên tố H → nH2O =

Í -L

= 1,08 mol

N Á O

Có mdd giảm = mCaCO3 - mCO2 - mH2O = 123- 1,23. 44- 1,08. 18 = 49,44. Câu 9: C Gọi công thức của amino aixt là CnH2n+1NO2

G N Ỡ

Công thức của Y là C4nH8n-2N4O5

Ư D I Ồ B

T

C4nH8n-2N4O5 + O2 → 4nCO2 + (4n-1) H2O + N2 có mCO2 +mH2O = 47, 8 → 0,1.4n. 44 + 0,1.( 4n-1) . 18 = 47,8 → n = 2 Đốt cháy 0,1 mol X có công thức C6H11N3O4

Sưu tầm bởi GV. Nguyễn Thanh Tú

-

P Ấ C

2

1 3 +

B

Đốt cháy 0,01 a đipeptit :C8H16N2O3 C8H16N2O3 + 10,5O2 → 8CO2 + 8H2O+ N2 → VO2 = 10,5. 0,01.1,18125 . 22,4 = 2.7783 lít. Câu 11: B Có nGly = 0,17 mol,nAla = 0,16 mol và nVal = 0,05 mol Có nCO2 =0,17.2 +0,16.3 + 0,05. 5 = 1,07 mol,nN2 = ( 0,17 + 0,16 + 0,05) : 2 = 0,19 mol

Coi hỗn hợp gồm 0,09 mol Bảo toàn nguyên tố C → 0,38.2 + x = 1,07 → x = 0,31 mol → nH2O = 0,38. 1,5 + 0,09+0,31 = 0,97 mol mX = 0,38.57 + 14. 0,31 + 0,09. 18 = 27,62 gam Cứ 27,62 gam X thì tạo thành 1,07. 44 + 0,97. 18 = 64,54 gam CO2 và H2O → cứ 19,89 gam X thì tạo thành 46,5 gam O2 và H2O Câu 12: C Gọi công thức của amino axit là Cn H2n+1NO2

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Gọi công thức của tripeptit là C3nH6n-1N3O4

X + 2H2O → 3CnH2n + 1O2N

Đốt cháy 0,1 mol X sinh ra 0,1.3n mol CO2, 0,1. (3n-0,5) mol H2O và 0,15 mol N2

→ X có dạng [(CnH2n + 1O2N)3 - 2H2O] ≡ C3nH6n - 1O6N3

UY

→ 0,1.3n .44 + 0,1. (3n-0,5). 18 + 0,15.28 =40.5 → n=2 C3nH6n - 1O6N3 + O2 → 3nCO2 +

H2O + 3/2N2

Nếu cho 0,15 mol Y tác dụng hoàn toàn với NaOH (lấy dư 20%) thì chất rắn thu được chứa 0,15. 6 mol nCO2= n↓ = 6 : 100 = 0,06 gam. . 20 = 0,18 mol

C2H4NO2Na và NaOH dư :

Ta có

O Ạ Đ

• Y + 4H2O → 5C2H5O2N

X + 2HCl + H2O → 2ClH3NRCOOH

→ Y có dạng [(C2H5O2N)5 - 4H2O] ≡ C10H17O6N5

Đặt nH2O = x mol → nHCl = 2x mol

C10H17O6N5 + O2 → 10CO2 + 17/2 H2O + 5/2 N2

Ta có mX + mHCl + mH2O = mClH3NRCOOH → 19,8 + 2x × 36,5 + x × 18 = 33,45 → x = 0,15 mol → nR = 0,15 × 2 = 0,3 mol → MClH3NRCOOH = 38,5 + 14 + MR + 45 = 33,45 : 0,3 → R là -CH2→ A là C2H5O2N

nCO2 = 0,02 × 10 = 0,2 mol → mCO2 = 8,8 gam.

P Ấ C

C8H14O5N4 + 9 O2 → 8 CO2 + 7 H2O + 2N2 nY = 0,1 mol → nO2 = 0,9 mol Câu 14: C Gọi aminoaxit có công thức CHNO2 →đipeptit X có công thức C2nH4nN2O3 và Y có công thức C3nH6n-1N3O4

H Í

Gọi số mol CO2 và H2O sinh ra khi đốt 0,01 mol Y là x, y mol

N Á O

Ta có hệ : → 0,01. 3n = 0,09 → n = 3

G N Ỡ

Vậy đipeptit X có công thức C6H12N2O3.

T

-L

N Ầ TR

H

G N Ư

nH2O = 0,02 × 17/2 = 0,17mol → mH2O= 0,17 × 18 = 3,06 gam

• Y + 3H2O → 4C3H7O2N → Y có dạng [(C2H5O2N)4-3H2O] ≡ C8H14O5N4

ÓA

B

N

→ n = 2 → amino axit là C2H5O2N

→ m = 0,15.6. 97 + 0,18. 40 = 94,5 gam. Câu 13: C Giả sử amino axit thu được là H2NRCOOH

0 00

.Q P T

N Ơ H

2+

31

→ mCO2 + mH2O = 8,8 + 3,06 = 11,86 gam Câu 16: A Gọi số mol NaOH phản ứng là 2x mol thì số mol đipeptit là x mol. ||→ quy đốt

x mol đipeptit dạng CnH2nN2O3 cần 4,8 mol O2 → cho cùng số mol CO2 và H2O là (x + 3,2) mol. Số mol H2O trung gian chuyển đổi = (x + 3,2) – 3,6 = (x – 0,4) mol → nhh peptit = 0,4 mol. Có mđipeptit = 14 × (x + 3,2) + 76x = 90x + 44,8 gam ||→ m = 90x + 44,8 – 18.(x – 0,4) = 72x + 52 gam. Áp dụng BTKL cho phản ứng thủy phân có: m + 80x =151,2 + 0,4 × 18. Giải ra được x = 0,7 mol và giá trị của m = 102,4 gam. Câu 17: A ► Cách 1: Quy về đốt đipeptit E2 dạng CnH2nN2O3 cần 0,99 mol O2 và 0,11 mol N2

Khi đốt 0,02 mol X sinh ra 0,02. 6 = 0,12 mol

I Ồ B

→ m↓ = 0,12. 100 = 12 gam Câu 15: A Amino axit có dạng CnH2n + 1O2N

Sưu tầm bởi GV. Nguyễn Thanh Tú

||→ bảo toàn O → nCO2 = nH2O = (0,11 × 3 + 0,99 × 2) ÷ 3 = 0,77 mol số Ctrung bình các α-amino axit = 0,77 ÷ 0,11 ÷ 2 = 3,5 || sơ đồ đường chéo → Gly = Val tức a : b = 1 : 1. p/s: đề thừa rất nhiều giả thiết → hãy nghĩ đến những câu hỏi phức tạp hơn, vận dụng hết các giả thiết: kiểu X,

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 21: D Gọi công thức của amino axit là Cn H2n+1NO2

Y là gì? .... ► Cách 2:

Gọi công thức của tripeptit là C3nH6n-1N3O4

UY

Đốt cháy 0,1 mol X sinh ra 0,1.3n mol CO2, 0,1. (3n-0,5) mol H2O và 0,15 mol N2 → 0,1.3n .44 + 0,1. (3n-0,5). 18 + 0,15.28 =40.5 → n=2

O Ạ Đ

.Q P T

N

Nếu cho 0,15 mol Y tác dụng hoàn toàn với NaOH (lấy dư 20%) thì chất rắn thu được chứa 0,15. 6 mol C2H4NO2Na và NaOH dư :

G N Ư

. 20 = 0,18 mol

→ m = 0,15.6. 97 + 0,18. 40 = 94,5 gam. Câu 22: C Đặt số mol CO2 = x; H2O = y và N = z → số mol KOH = z. Câu 18: D Gọi công thức của amino axit là Cn H2n+1NO2

H

Khối lượng dung dịch giảm = m↓ - (mCO2+mH2O) = 21,87 → 153x - 18y= 21,87.

0 00

B

Bảo toàn khối lượng phản ứng đốt cháy có: 4,63 + 6 = 44x + 18y + 14z.

Gọi công thức của tripeptit là C3nH6n-1N3O4

31

Đốt cháy 0,1 mol X sinh ra 0,1.3n mol CO2, 0,1. (3n-0,5) mol H2O và 0,15 mol N2 → 0,1.3n .44 + 0,1. (3n-0,5). 18 + 0,15.28 =40.5 → n=2

P Ấ C

Nếu cho 0,15 mol Y tác dụng hoàn toàn với NaOH (lấy dư 20%) thì chất rắn thu được chứa 0,15. 6 mol C2H4NO2Na và NaOH dư :

N Ầ TR

. 20 = 0,18 mol

→ m = 0,15.6. 97 + 0,18. 40 = 94,5 gam. Câu 19: B Gọi công thức của A là CnH2n+1NO2

N Á O

-L

Í-

A Ó H

2+

Bảo toàn khối lượng phản ứng thủy phân có: mH2O =

||→ Lượng H trong muối là =

.

.

Khối lượng muối:

.

Giải hệ tìm được Từ đó tính được m↓ = 31,52 gam.

Gọi số mắt xích của peptit là x mol → X có dạng CnxH2nx-x +2NxOx+1

T

Có b-c = 4a → nx - (nx- 0,5x+1) = 4 → x = 10

NG

Số liên kết peptit trong X là 9. Câu 20: A Gọi số mol của Gly : 4x mol và Ala: 3x mol

I Ồ B

Ỡ Ư D

Câu 23: D khí thoát ra khỏi bình là N2 : 0,11 mol → số gốc α amino axit = 0,22

Quy T về

m +7,9

Khi đốt X hay đốt các amino axit thì lượng O2 là như nhau → 2,25. 4x + 3,75. 3x = 6,3 → x = 14/45 → m=14/45.( 75. 4 + 3. 89 - 6. 18) = 142,8 gam

Sưu tầm bởi GV. Nguyễn Thanh Tú

Đốt muối

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

☆ thủy phân (m + 1,8) gam X2 cần 2x mol NaOH → (m + 29,7) gam muối + x mol H2O. Theo đề bài ta có 28,02 = 44.( 0,44 + x-0,11) + 18.( 0,22+ x) → x =0,09 =nAla ||→ BTKL có: m + 1,8 + 80x = m + 29,7 + 18x ||→ x = 0,45 mol. Bảo toàn nguyên tố N → nGly = 0,22-0,09 = 0,13 mol

UY

||→ mđipeptit X2 = 2,84 × 14 + 0,45 × 76 = 73,96 gam = m + 1,8 → m = 72,16 gam. mZ -mT = 7,9 → 0,22. 40 - 18y = 7,9 → y = 0,05 = nT Gọi số mol X và Y lân lượt là a,b

Ta có hệ

X: 0,03 mol (Gly)n(Ala)4-n, Y:0,02 mol (Gly)m(Ala)5-m Có 0,03.n +0,02m =0,13 → 3n + 2m = 13 → n= 1,m= 5 hoặc n =3 và m = 2

n= 1,m= 5 → %X =

.100% = 58,78%

n =3 và m = 2 → % X= Câu 24: B Gọi công thức của tetrapeptit X C4nH8n-2N4O5

0 00

.100% = 53,06%.

C4nH8n-2N4O5 + (4n-3)O2 → 4nCO2 + (4n-1) H2O + 2N2 Có nO2 =9 : 5 = 1,8 mol → nN2(kk)= 7,2 mol Có ∑nN2 = nN2(kk) + nN2 → nN2 = 0,2 mol

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

→ 0,2.( 4n-3) = 1,8 → n = 3 → 2 amino axit là CH2(NH2)-COOH và C5H11NO2( có 2 cấu tạo CH3-CH2-CH2CH(NH2)-COOH và Val: CH3-CH(CH3)-C(NH2)-COOOH) với số mol bằng nhau

N Á O

TH1: gồm Gly và Val

T

: Gly-Gly-Val-Val,Gly-Val-Gly-Val, Gly-Val-Val-Gly, Val-Val-Gly-Gly, Val-Gly-Val-Gly, Val-Gly-Gly-Val

NG

TH2: Gồm Gly và CH3-CH2-CH2-CH(NH2)-COOH : tương tự có 6 peptit thỏa mãn

Ỡ Ư D

Câu 25: B ☆ đốt m gam X thu được 2,84 mol CO2 và 2,74 mol H2O

I Ồ B

||→ cần 0,1 mol H2O để quy đổi hỗn hợp X về x mol X2.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

26. Kĩ thuật xử lý bài toán (H+, NO3-) tạo H2 (Đề 1)

Câu 1. Hòa tan hết 10,24 gam Cu bằng 200 ml dung dịch HNO3 3M được dung dịch A. Thêm 400 ml dung dịch NaOH 1M vào dung dịch A để làm kết tủa hết ion Cu2+. Lọc bỏ kết tủa, cô cạn dung dịch được chất rắn khan đem nung đến khối lượng không đổi thu được 26,44 gam chất rắn. Số mol HNO3 đã phản ứng với Cu là A. 0,58 mol. B. 0,4 mol. C. 0,48 mol. D. 0,56 mol. Câu 2. Cho 2,16 gam hỗn hợp Mg và MgO vào dung dịch chứa 0,07 mol H2SO4 đặc, sau phản ứng hoàn toàn thu được 0,336 lít khí SO2 duy nhất (ở đktc) và 0,8 gam hỗn hợp rắn Y. Lọc, sấy khô Y rồi đem đốt trong không khí đến phản ứng hoàn toàn thu được chất rắn có khối lượng không đổi so với Y. Phần trăm khối lượng Mg trong hỗn hợp ban đầu có giá trị gần nhất với giá trị nào sau đây ? A. 44,0 B. 43,5 C. 45,0 D. 44,5 Câu 3. Hòa tan hoàn toàn 1,28 gam Cu vào dung dịch chứa 0,12 mol HNO3 thu được dung dịch X và hỗn hợp khí Y gồm NO và NO2. Cho X tác dụng hoàn toàn với 105 ml dung dịch KOH 1M, sau đó lọc bỏ kết tủa được dung dịch Y1. Cô cạn Y1 được chất rắn Z. Nung Z đến khối lượng không đổi, thu được 8,78 gam chất rắn. Tỷ khối của khí Y so với He là A. 8. B. 9,5. C. 9. D. 10. Câu 4. Hòa tan hoàn toàn 7,68 gam Cu vào dung dịch 0,48 mol HNO3, khuấy đều thu được V lít hỗn hợp khí NO2; NO (đktc) và dung dịch X chứa hai chất tan. Cho tiếp 200ml dung dịch NaOH 2M vào dung dịch X, lọc bỏ kết tủa, cô cạn dung dịch rồi nung đến khối lượng không đổi thu được 25,28 gam chất rắn. Các phản ứng xảy ra hoàn toàn. Giá trị V gần nhất với A. 1,8 B. 2,7 C. 3,6 D. 5,4 Câu 5. Cho 82,05 gam hỗn hợp A gồm Al và Al2O3 (có tỷ lệ mol là 2,3:1) tan hoàn toàn trong dung dịch B chứa H2SO4 và NaNO3 thu được dung dịch C chỉ chứa 3 muối và m gam hỗn hợp khí D (trong D có 0,2 mol khí H2). Cho BaCl2 dư vào C thấy có 838,8 gam kết tủa xuất hiện. Mặt khác cho 23 gam Na vào dung dịch C sau khi các phản ứng xảy ra thì thấy khối lượng dung dịch giảm 3,1 gam. Giá trị của m gần nhất với A. 16 B. 13 C. 12 D. 15 Câu 6. Trộn 10,17 gam hỗn hợp X gồm Fe(NO3)2 và Al với 4,64 gam FeCO3 được hỗn hợp Y. Cho Y vào lượng vừa đủ dd chứa 0,56 mol KHSO4 được dd Z chứa 83,41 gam muối sunfat trung hòa và m gam hỗn hợp

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

khí T trong đó có chứa 0,01 mol H2. Thêm NaOH vào Z đến khi toàn bộ muối sắt chuyển hết thành hidroxit và ngừng khí thoát ra thì cần 0,57 mol NaOH, lọc kết tủa nung trong không khí đên khối lượng không đổi thu được 11,5 gam chất rắn. Giá trị của m là A. 2,52 B. 2,7 C. 3,42 D. 3,22 Câu 7. Hòa tan hết 12,96 gam hỗn hợp gồm Mg và MgCO3 trong dung dịch chứa HCl và HNO3, thu được dung dịch X chỉ chứa các muối có khối lượng m gam và 5,376 lít hỗn hợp khí Y gồm ba khí không màu có tỉ khối hơi so với He bằng 55/12. Đem toàn bộ hỗn hợp Y trộn với 1,544 lít O2, thu được 6,024 lít hỗn hợp khí Z. Các khí đều đo ở đktc và các phản ứng xảy ra hoàn toàn. Giá trị của m là A. 41,8 B. 45, 29 C. 43,94 D. 54, 05 Câu 8. Cho m gam hỗn hợp X gồm Fe, Fe3O4 và Fe(NO3)2 tan hết trong 320 ml dung dịch KHSO4 1M. Sau phản ứng thu được dung dịch Y chỉ chứa 59,04 gam muối trung hòa và 0,896 lít NO (đktc, sản phẩm khử duy nhất). Cho dung dịch NaOH dư vào Y thì có 0,44 mol NaOH phản ứng. Biết các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng của Fe trong X gần giá trị nào nhất sau đây ? A. 3,5%. B. 2,0%. C. 3,0%. D. 2,5%. Câu 9. Cho 7,65 gam hỗn hợp X gồm Al và Al2O3 (trong đó Al chiếm 60% khối lượng) tan hoàn toàn trong dung dịch Y gồm H2SO4 và NaNO3, thu được dung dịch Z chỉ chứa 3 muối trung hòa và m gam hỗn hợp khí T (trong T có 0,015 mol H2). Cho dung dịch BaCl2 dư vào Z đến khi các phản ứng xảy ra hoàn toàn, thu được 93,2 gam kết tủa. Còn nếu cho Z phản ứng với NaOH thì lượng NaOH phản ứng tối đa là 0,935 mol. Giá trị của m gần giá trị nào nhất sau đây ? A. 2,5 B. 3,0 C. 1,0 D. 1,5 Câu 10. Hòa tan hết 13,52 gam hỗn hợp X gồm Mg(NO3)2, Al2O3, Mg và Al vào dung dịch NaNO3 và 1,08 mol HCl (đun nóng). Sau khi kết thức phản ứng thu được dung dịch Y chỉ chứa các muối và 3,136 lít (đktc) hỗn hợp khí Z gồm N2O và H2. Tỷ khối của Z so với He bằng 5. Dung dịch Y tác dụng tối đa với dung dịch chứa 1,14 mol NaOH, lấy kết tủa nung ngoài không khí tới khối lượng không đổi thu được 9,6 gam rắn. Phần trăm khối lượng của Al trong hỗn hợp X có giá trị gần nhất với A. 23,90%. B. 24,00%. C. 23,95%. D. 23,85% Câu 11. Cho 23,34 gam hỗn hợp X gồm Al, Al2O3 và Al(NO3)3 (trong đó oxi chiếm 34,961% về khối lượng) vào dung dịch chứa 1,58 mol NaHSO4 và 0,04 mol NaNO3, khuấy đều cho các phản ứng xảy ra hoàn toàn, thu được dung dịch Y chỉ chứa các muối trung hòa và 0,18 mol hỗn hợp khí Z gồm N2O; N2 và H2. Để tác dụng tối

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

đa các chất tan có trong dung dịch Y cần dùng dung dịch chứa 2,04 mol NaOH. Phần trăm khối lượng của N2 có trong hỗn hợp khí Z có giá trị gần nhất với A. 21,0% B. 21,5% C. 22,0% D. 22,5% Câu 12. Cho 30,24 gam hỗn hợp rắn X gồm Mg, MgCO3 và Mg(NO3)2 (trong đó oxi chiếm 28,57% về khối lượng hỗn hợp) vào dung dịch chứa 0,12 mol HNO3 và 1,64 mol NaHSO4, khuấy đều cho các phản ứng xảy ra hoàn toàn thu được dung dịch Y chứa các muối trung hòa có khối lượng 215,08 gam và hỗn hợp khí Z gồm N2O, N2, CO2 và H2 (trong đó số mol của N2O bằng số mol của CO2). Tỉ khối hơi của Z so với He bằng a. Giá trị của a gần nhất với giá trị nào sau đây? A. 6,5 B. 7,0 C. 7,5 D. 8,0 Câu 13. Hòa tan 35,04 gam hỗn hợp X gồm Mg, MgCO3 và Al(NO3)3 vào dung dịch chứa 1,68 mol NaHSO4. Sau khi kết thúc phản ứng thu được dung dịch Y chỉ chứa các muối trung hòa và 0,2 mol hỗn hợp khí Z gồm CO2, N2O, N2 và H2. Đế tác dụng tối đa các chất tan trong dung dịch Y cần dùng dung dịch chứa 1,75 mol NaOH, thu được 40,6 gam kết tủa. Phần trăm khối lượng của N2O trong hỗn hợp Z có giá trị gần nhất với A. 47,0% B. 48,5% C. 47,5% D. 48,0% Câu 14. Cho m gam hỗn hợp Mg, Fe, Al2O3, Fe3O4 (trong đó oxi chiếm 20% về khối lượng) tan vừa đủ trong 140 gam dung dịch H2SO4 61,6% đun nóng nhẹ, sau phản ứng thoát ra 6,048 lít hỗn hợp 2 khí H2 và SO2 có tỉ khối so với He là 65/6. Phần dung dịch thu được đem cho tác dụng với dung dịch NH3 dư thu được 45,52 gam kết tủa. Giá trị của m là A. 34,40 B. 27,15 C. 32,00 D. 28,00 Câu 15. Cho m gam hỗn hợp H gồm FexOy, Fe, Cu tác dụng hết với 200 gam dung dịch chứa HCl 32,85% và HNO3 9,45%, sau phản ứng thu được 5,824 lít khí NO (đktc) là sản phẩm khử duy nhất và dung dịch X chứa (m + 60,24) gam chất tan. Cho a gam Mg vào dung dịch X, khi phản ứng kết thúc thấy thoát ra khí Y gồm 2 khí, trong đó có khí hóa nâu trong không khí; tỉ khối của Y đối với He bằng 4,7 và (m - 6,04) gam chất rắn T. Giá trị của a gần nhất với A. 21,7 B. 21,8 C. 21,6 D. 21,9

G N Ỡ

N Á O

T

Ư D I ĐÁP ÁN & LỜI GIẢI CHI TIẾT Ồ B

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

N Ơ H

Câu 1: D Nếu chất rắn chỉ chứa NaNO2 → mchất rắn = 0,4. 69 = 27,6 gam > 26,44 → chất rắn gồm NaNO2 : a mol và NaOH dư : b mol

UY

Ta có hệ

.Q P T

N

Luôn có nNaOH pư = nHNO3 dư+ 2nCu(NO3)2 → nHNO3 dư = 0,36 - 2. 0,16 = 0,04 mol → nHNO3 pư = 0,6- 0,04 = 0,56 mol. Câu 2: D

N Ầ TR

H

G N Ư

O Ạ Đ

Áp dụng BTKL có MgSO4 là 0,05 mol. Bảo toàn S → trong Y có 0,005 mol S↓. Đem đốt Y thấy khối lượng rắn sau không thay đổi chứng tỏ 0,8 gam gồm {S; Mg và MgO}.

1 3 +

0 00

B

Tuy nhiên, chắc chắn 0,8 gam cuối cùng đó chỉ có thể là MgO với 0,02 mol.

Bảo toàn Mg ||→ trong hỗn hợp đầu có 0,07 mol Mg → nO = 0,03 mol ||→ có 0,04 mol Mg và 0,03 mol MgO. ||→ %khối lượng Mg = 0,04 × 24 ÷ 2,16 = 44,44%. Gần với giá trị 44,5 nhất. Câu 3: B Nhận thấy nếu dung dịch KOH vừa đủ thì chất rắn thu được chỉ chứa KNO2: 0,105 mol → mZ = 0,105.85 = 8,925 >8,78 gam → dung dịch Y chứa KNO2 và KOH dư

0,02 mol Cu

Dd X

dd Y

8,78 gam

Bảo toàn nguyên tố K → x+ y = 0,105 Theo đề bài 85x+ 56y = 8,78 → x= 0,1 và y = 0,005 Gọi số mol của NO và NO2 lần lượt là a, b mol Bảo toàn ngyên tố N → a + b = 0,12 - 0,1= 0,02 Bảo toàn electron → 3a + b = 2. 0,02 Giải hệ : a = 0,01 và b = 0,01

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

= 9,5 dY/He = Câu 4: C X chứa hai chất tan là Cu(NO3)2 và HNO3 dư 10,17 Nếu chất rắn chỉ chứa NaNO2 : 0,4 mol→ mchất răn = 0,4. 69 27,6 > 25, 28 gam → chất rắn chứa NaNO2 : a mol và NaOH dư : b mol

N Ầ TR

Câu 5: C Ta có nAl2O3 = 0,5 mol, nAl= 1,15 mol, nBaSO4 = 3,6 mol

Ta có hệ

→ nH2SO4 = 3,6 mol

Có NH4+ =

Vì sinh ra khí H2 nên toàn bộ NO3 - đi hết vào D → Dung dịch C chỉ chứa 3 muối nên lượng H+ hết → Al3+ : 2,15 mol, Na+ : x mol, NH4+ : y mol, SO42- : 3,6 mol Bảo toàn điện tích → x+y= 3,6.2 - 2,15. 3= 0,75 mol

A Ó H

P Ấ C

ÁN

mdd giảm = mAl(OH)3 + mNH3 + mH2 - mNa → 3,1 + 23 - 0,5.2= 78.

NG

TO

Í-

-L

Vì 1 < 2,15 + y → nên lượng Al(OH)3 được tính theo OH- → nAl(OH)3 =

0 00

31

2+

Ta có nNa= nOH- = 1 mol vì dd dịch sau phản ứng không còn muối NH4+ nên lượng OH- sẽ tham gia phản ứng với NH4+ trước hết : y mol, lượng OH- còn lại sẽ tham gia phản ứng với Al3+

.Q P T

N

B

H

= 0,02 mol

Bảo toàn nguyên tố H → nH2O =

= 0,23 mol

Bảo toàn khối lượng → m = 10,17 + 4,64 + 0,56. 136-83,41-0,23. 18 = 3.42 gam. Câu 7: C Nhận thấy MY =

> 2 → trong hỗn hợp 3 khí không màu chắc chắn chứa 2 khí là H2 và CO2

Một khí còn lại có thể là NO, N2, N2O. Vì khi trộn với O2 thì thầy 5,376 + 1,544 > 6,024 → chứng tỏ thể tích giảm đi → vậy xảy ra phản ứng vối O2 trong điều kiện thường → khí đó là NO ( Các khí khác cần điều kiện nhiệt độ thường) 2NO + O2 → 2NO2

+ 17y → y = 0,1 mol → x= 0,65 Nhận thấy thể tích giảm chính là lượng oxi tham gia phản ứng

= 3,2 mol

Bảo toàn khối lượng → mD = 82,05 + 3,6.98 + 0,65. 85 - 3,6.96 - 2,15.27 -0,1.18 - 0,65.23- 3,2. 18 = 12,1. Câu 6: C

I Ồ B

G N Ư

Gọi số mol Fe(NO3)2 : x mol và Al : y mol.

Bảo toàn nguyên tố N → nNO + nNO2 = nHNO3 - nNO3 (X) = 0,48 - 0,32 = 0,16 mol → V = 3,584 lít

Ỡ Ư D

O Ạ Đ

UY

Khi thêm dung dịch NaOH vào dung dịch Z thu được dung dịch chứa K2SO4: 0,28 mol , Na2SO4 : 0,28 mol và NaAlO2 : 0,57- 0,28-0,28 = 0,01 mol

Có nNO3(X)/sub> = nNaNO2 = 0,32 mol

Bảo toàn nguyên tố H → nH2O =

+ dd Z

11,5 g

Ta có hệ

khí T

N Ơ H

Sưu tầm bởi GV. Nguyễn Thanh Tú

→ nO2 =

= 0,04 mol → nNO = 2nO2 = 0,08 mol

Gọi số mol của H2 và CO2 lần lượt là a, b

Ta có hệ

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Khi cho Z phản ứng với NaOH tạo dung dịch chứa Na2SO4 : 0,4 mol và NaAlO2: 0,23 mol Bảo toàn nguyên tố C → nMgCO3 = nCO2 = 0,04 mol → nMg =

= 0,4 mol

Bảo toàn nguyên tố Na → x + 0,935 = 0,4.2 + 0,23 → x = 0,095 mol

UY

Bảo toàn điện tích trong Z → y = 0,4.2 - 0,23.3 - 0,095 = 0,015 mol Nhận thấy 2nMg = 2nH2 + 3nNO → sinh ra NH4+ → nNH4+ =

=0,04 mol

.Q P T

Bảo toàn nguyên tố H → nH2O =( 0,4.2 - 4. 0,015- 2. 0,015 ) : 2= 0,355 mol Bảo toàn khối lượng : Dung dịch sau phản ứng chứa không chứa NO3-)

( chú ý vì sinh ra H2 nên trong dung dịch

O Ạ Đ

N

mkhí = 7,65 + 0,095. 85 + 0,4. 98 - 0,23. 27 - 0,015. 18 - 0,4. 96 - 0,095. 23 - 0,355. 18 = 1,47 gam Câu 10: C Gọi số mol của N2O và H2 lần lượt là x,y mol

→ m muối = 0,44. 24 + 0,04. 18 + 0,92.35,5 = 43,94 gam. Câu 8: C

Ta có hệ

N Ầ TR

H

G N Ư →

Do sinh khí H2 nên dung dịch Y chỉ chứa muối Clm gam

59,04 gam Y

dd

0 00

Khi cho NaOH vào Y , bảo toàn điện tích → nNO3- = 0,12 mol

bảo toàn nguyên tố N → nFe(NO3)2 =

= 0,08 mol

Vì dung dịch chỉ chứa muối trung hòa nên H+ phản ứng hết

→ nHSO4- = 8nFe3O4 + 4nNO → nFe3O4 =

= 0,02 mol

mX = 59,04 → mFe =

N Á O

Bảo toàn nguyên tố Fe → nFe = 0, 15 - 0,02. 3 - 0,08 = 0,01 mol

% Fe = Câu 9: D

Ư D I Ồ B

7,65 gam X

-L

Í-

= 0,15 mol

A Ó H

P Ấ C

13,52 g

dd Y

9,6 gam MgO ( 0,24 mol)

Bảo toàn điện tích → 3a + b + c = 1,08- 2. 0,24 (1) nNaOH pu = 4nAl3+ + 2nMg2+ + nMH4+ → 1,14 = 4a + 2. 0,24 + c (2)

Bảo toàn nguyên tố H → nH2 =

= 0,46 -2c

Bảo toàn khối lượng : 13,52 + 1,08. 36,5 + 85.b = 27a+ 23b + 18c + 0,24. 24 + 1,08 . 35,5 + 5.4.0,14 + 18. ( 0,46-2c)

T

. 100% = 2,86%

G N Ỡ

2

1 3 +

B

→ 27a -62b -18c = -2,24 (3) Giải hệ (1), (2), (3) → a = 0,16, b = 0,1, c= 0,02

khí T + dd Z

Do khí T chỉ chứa H2 → NO3- phản ứng hết → muối Z là muối SO42-.

Sưu tầm bởi GV. Nguyễn Thanh Tú

0,4 mol BaSO4↓

Bảo toàn nguyên tố N → nMg(NO3)2 =

= 0,02 mol, → nMg = 0,22 mol

Gọi số mol của Al2O3 và Al lần lượt là d, e

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

30,24g .100% = 23,96%. %Al = Câu 11: C Vì sinh khí H2 nên dung dịch Y chỉ chứa muối SO42-

+Z

Ta có hệ Bảo toàn nguyên tố N

23,34 gam

Y

= 0,12 mol → nAl(NO3)3 = 0,04 mol, nAl2O3 =

Bảo toàn nguyên tố N → a + b = ( 0,12+ 0,04- 0,04) : 2 = 0,06 mol → nH2 = 0,12 mol bảo toàn electron → 8a + 10b + 2. 0,12+ 8. 0,04 = 0,36.3 Giải hệ → a = 0,04, b = 0,02

. 100% = 21,875%.

N Á O

T

Vì sinh khí H2 nên dung dịch Y chỉ chứa muối sunfat 215,08 g

I Ồ B

G N Ỡ

.Q P T

N

= 0,04 mol

-L

H Í

ÓA

P Ấ C

2

N Ầ TR

≈ 6,958 . DZ/He = Câu 13: D Vì sinh khí H2 nên dung dịch Y chỉ chứa muối sunfat

= 0,05 mol,

Gọi số mol của N2O và N2 lần lượt là a, b mol

% N2 = Câu 12: B

=

O Ạ Đ

UY

Có nH+ = 2nH2 + 12nN2+ 10nN2O + 10nNH4+ → 1,64 + 0,12= 2nH2 + 12. 0,04 + 10. 0,06+ 10. 0,04 → nH2 = 0,14 mol

Bảo toàn điện tích trong dung dịch Y → nNH4+ = 0,04 mol

Có nN(X) = nAl= 0,36 mol

NG

→ nN2 =

dd

Bảo toàn nguyên tố Na → nNaAlO2 = ( 2,04 + 1,62) - 1,58.2 = 0,5 mol

Ta có hệ

N Ơ H

Ta có hệ

1 3 +

0 00

B

35,04 g X

↓0,7 mol Mg(OH)2

Y

Khi Y tác dụng với NaOH thì tạo ra dung dịch chứa Na2SO4 : 1,68 mol, NaAlO2: (1,75+ 1,68)-1,68. 2 = 0,07 mol Bảo toàn điện tích trong Y → nNH4+ = 0,07 mol Gọi số mol của Mg và MgCO3 lần lượt là a. b mol

Ta có hệ Gọi số mol của N2O và N2 lần lượt là a, b

→ Bảo toàn nguyên tố N → a + b = ( 0,07.3 - 0,07) : 2 = 0,07 → nH2 = 0,2- 0,0555-0,07 = 0,0745

Gọi số mol của MgCO3 và Mg(NO3)2 ;ần lượt là a, b mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

Bảo toàn electron → 8a + 10b + 2.0,0745 + 8. 0,07 = 2. 0,6445 Giải hệ → a = 0,06và b= 0,01

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Có mFe + mCu + mMg = m- 6,04 → mMg= 0,36 gam ( 0,015 mol) . 100% = 47,9%.

%mN2O = Câu 14: D Gọi số mol H2 và SO2 lần lượt là x,y

UY

Khi cho Mg + dd X → dd chứa →

Ta có hệ

Bảo toàn nguyên tố N → 3x+ y = 0,04

O Ạ Đ

.Q P T

N

nH+ dư = 4nNO + 2nH2 + 10nNh4+ → 0,26 = 4.3x + 2.2x + 10y Coi X gồm

Giải hệ → x= 0,01, y = 0,01

dd + 0,09 molH2 + 0,18 mol SO2 + (có thể có x mol S) + H2O

H

G N Ư

Bảo toàn điện tích → nMg2+ = ( 1,8- 0,01) :2 = 0,895 mol Phần kết tủa gồm các hidroxit → nOH-= 2nSO42- = ne nhường=

Luôn có nH+= 2nO + 2nH2 + 4nSO2 + 8nS → 0,88.2 =2.

Bảo toàn electron →

= 2.

+ 2. 0,09 + 4. 0,18 + 8x

0 00

+ 2. 0,09 + 2. 0,18 + 6.x

Giải hệ → m = 28 và x = 0,02. Câu 15: B

( m + 60,24) g X + NO : 0,26 mol + H2O

m gam H

N Ầ TR

→ ∑ nMg = ( 0,895 + 0,015). 24 = 21,84 gam.

-

A Ó H

P Ấ C

2

1 3 +

B

Áp dụng bảo toàn khối lượng → m + 1,8. 36,5 + 0,3. 63 = m + 60,24 + 0,26. 30+ mH2O → nH2O = 0,92 mol

Í -L

Khi cho Mg vào dung dịch X sinh ra hỗn hợp khí Y có MY = 18,8 → X chứa khí NO: 3x mol và H2 : 2x mol

→ Dd( m + 60,24) g X chứa

Ỡ Ư D

NG

N Á O

T

m- 6,04 gam chât T

Có nH+ dư = 1,8 + 0,3 - 2. 0,92 = 0,26 mol

I Ồ B

Có nH2O = nNO + nO(H) → nO(H) = 0,4 mol Có mFe + mCu = m- 0,4. 16 = m- 6,4

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

27. Kĩ thuật TRÙNG NGƯNG HOÁ trong bài toán peptit (Đề 1)

Câu 1. Hỗn hợp X gồm ba peptit đều mạch hở có tỉ lệ mol tương ứng là 1 : 4 : 1. Thủy phân hoàn toàn m gam X, thu được hỗn hợp sản phẩm gồm 6,0 gam glyxin, 9,79 gam alanin và 9,36 gam valin. Biết tổng số liên kết peptit trong phân tử của ba peptit trong X nhỏ hơn 13. Giá trị của m là A. 17,86 B. 21,37 C. 24,25 D. 25,15 Câu 2. Hỗn hợp M gồm peptit X và peptit Y chúng cấu tạo từ cùng một loại aminoaxit và có tổng số nhóm CO-NH- trong hai phân tử là 5. Với tỉ lệ nX : nY = 1 : 2, thủy phân hoàn toàn m gam M thu được 12 gam glixin và 5,34 gam alanin. Giá trị của m gần nhất với A. 14,4. B. 14,7. C. 14,5. D. 14,6. Câu 3. Hỗn hợp X gồm hai peptit mạch hở có tỉ lệ mol tương ứng là 1:3. Thủy phân hoàn toàn m gam X thu được hỗn hợp sản phẩm bao gồm 13,5 gam Gly và 7,12 gam Ala. Biết tổng số liên kết peptit trong phân tử của hai peptit bằng 5. Giá trị m là A. 19,18 B. 18,82 C. 17,38 D. 20,62 Câu 4. Hỗn hợp X gồm bốn peptit đều mạch hở có tỉ lệ mol tương ứng là 1 : 1 : 2 : 3. Thủy phân hoàn toàn m gam X, thu được hỗn hợp sản phẩm chỉ gồm 13,884 gam alanin và 13,5 gam glyxin. Biết tổng số liên kết peptit trong phân tử của bốn peptit trong X nhỏ hơn 11. Giá trị của m là A. 22,848 B. 22,632 C. 27,384 D. 22,416. Câu 5. Hỗn hợp M gồm một peptit mạch hở X và một peptit mạch hở Y (mỗi peptit đều được cấu tạo từ một loại α-aminoaxit, tổng số liên kết peptit trong 2 phân tử X, Y là 5) với tỉ lệ mol là 1 :3. Khi thủy phân m gam hỗn hợp M thu được 81 gam Glyxin và 42,72 gam Alanin. Giá trị của m là A. 104,28. B. 116,28. C. 109,50. D. 110,28. Câu 6. Hỗn hợp X gồm 4 peptit có tỷ lệ mol là 1:2:3:4. Thủy phân m gam X thì thu được hỗn hợp sản phẩm Y gồm 2,92 gam Gly-Ala; 1,74 gam Gly-Val; 5,64 gam Ala-Val; 2,64 gam Gly-Gly; 11,25 gam Glyxin; 2,67 gam Alanin và 2,34 gam Valin. Biết tổng số liên kết peptit trong X không vượt quá 13. Giá trị của m là A. 26,95. B. 26,72. C. 23,54. D. 29,2.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 7. Thủy phân không hoàn toàn tripeptit X mạch hở, thu được sản phẩm gồm Gly, Ala, Ala-Gly, Gly-Ala. Tripeptit X là A. Ala-Ala-Gly. B. Gly-Gly-Ala. C. Ala-Gly-Gly. D. Gly-Ala-Gly. Câu 8. Thủy phân hoàn toàn tetrapeptit X mạch hở, thu được sản phẩm gồm 1,50 gam glyxin và 1,78 gam alanin. Số chất X thỏa mãn tính chất trên là A. 4. B. 8. C. 6. D. 12. Câu 9. Thủy phân hoàn toàn m gam hỗn hợp oligopeptit gồm Ala-Val-Ala-Gly-Ala và Val-Gly-Gly thu được x gam Ala; 37,5 gam Gly và 35,1 gam Val. Giá trị của m, x lần lượt là A. 99,3 và 30,9. B. 84,9 và 26,7. C. 90,3 và 30,9. D. 92,1 và 26,7. Câu 10. Khi thủy phân không hoàn toàn một peptit X (MX = 293) thu được hai peptit Y và Z. Biết 0,472 gam Y phản ứng vừa đủ với 18 ml dung dịch HCl 0,222 M đun nóng và 0,666 gam Z phản ứng vừa đủ với 14,7 ml dung dịch NaOH 1,6% (d = 1,022 gam/ml) đun nóng. Biết rằng khi thủy phân hoàn toàn X thu được hỗn hợp 3 amino axit là glyxin, alanin và phenyl alanin. Công thức cấu tạo của X là A. Ala-Phe-Gly. B. Gly-Phe-Ala-Gly. C. Ala-Phe-Gly-Ala. D. Gly- Ala-Phe Câu 11. Khi tiến hành thủy phân hoàn toàn một tripeptit X với xúc tác enzim thu được duy nhất hợp chất hữu cơ Y có phần trăm về khối lượng C, H, N lần lượt là 40,45%; 7,86%; 15,73% còn lại là oxi. Biết công thức phân tử của Y trùng với công thức đơn giản nhất. Công thức phân tử của X là A. C9H17N3O4. B. C6H12N2O3. C. C9H15N3O4. D. C12H22N4O5. Câu 12. Hỗn hợp T gồm ba peptit mạch hở X, Y, Z có tỉ lệ mol tương ứng là 2 : 3 : 4. Thủy phân hoàn toàn 35,97 gam T thu được hỗn hợp sản phẩm gồm 0,29 mol A gam và 0,18 mol B. Biết tổng số liên kết peptit trong ba phân tử X, Y, Z bằng 16, A và B đều là aminoaxit no, có 1 nhóm –NH2 và 1 nhóm –COOH trong phân tử. Nếu đốt cháy 4x mol X hoặc 3x mol Y đều thu được số mol CO2 bằng nhau. Đốt cháy hoàn toàn m gam hỗn hợp T thu được N2, 0,74 mol CO2 và a mol H2O. Giá trị a gần nhất là: A. 0,65. B. 0,67. C. 0,69. D. 0,72. Câu 13. Hỗn hợp M gồm peptit X, peptit Y và peptit Z chúng cấu tạo từ cùng một loại amino axit và có tổng số nhóm -CO-NH- trong ba phân tử là 11. Với tỉ lệ nX : nY : nZ = 4 : 6 : 9, thủy phân hoàn toàn m gam M thu được 72 gam glyxin; 56,96 gam alanin và 252,72 gam Valin. Giá trị của m và loại peptit Z là

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

A. 341,36 và hexapeptit. B. 341,36 và tetrapeptit. C. 327,68 và tetrapeptit D. 327,68 và hexapeptit Câu 14. Hỗn hợp T gồm ba peptit mạch hở X, Y, Z có tỉ lệ mol tương ứng là 2 : 3 : 4. Thủy phân hoàn toàn m gam T thu được hỗn hợp sản phẩm gồm 21,75 gam Glyxin và 16,02 gam Alanin. Biết số liên kết peptit trong phân tử X nhiều hơn trong Z và tổng số liên kết peptit trong ba phân tử X, Y, Z nhỏ hơn 17. Giá trị của m là A. 30,93. B. 30,57. C. 30,21. D. 31,29. Câu 15. Hỗn hợp X gồm ba peptit đều mạch hở có tỉ lệ mol tương ứng là 1 : 1 : 3. Thủy phân hoàn toàn m gam X, thu được hỗn hợp sản phẩm gồm 14,24 gam alanin và 8,19 gam valin. Biết tổng số liên kết peptit trong phân tử của ba peptit trong X nhỏ hơn 13. Giá trị của m là A. 18,47. B. 18,83. C. 18,29. D. 19,19.

Gọi số aa trong 3 peptit là a, b, c và số mol tương ứng 3 chất là n, 4n, n

ƯỠ

Số mol aa trong 2 phân tử là 7

D I BỒ

NG

T

Gọi số mol X và Y là a và 2a

TH1: X là peptit từ Gly, Y từ Ala

Sưu tầm bởi GV. Nguyễn Thanh Tú

H

G N Ư

C1: tìm 1 cặp peptit thỏa mãn ví dụ 0,02 mol Ala-GLy-GLy -GLy và 0,06 mol Gly-GLy - Ala → m = 0,02.( 89 + 75.3- 3.18 ) + 0,06. ( 75.2 + 89-2.18) = 17,38 gam

N Ầ TR

C2 :Vì X gồm 2 peptit X1, X2 có tỉ lê 1:3 và tổng số liên kết peptit là 5 → gộp 2 peptit thành 1 peptit Y có 4 Ala- 9 GLy với số mol là 0,02 mol.

0 00

B

X1 + 3X2 → Y + 3H2O

Câu 1: B

Câu 2: C

O Ạ Đ

.Q P T

N

Câu 3: C Ta có nGly = 0,18 mol,nAla =0,08 mol → nAla : nGly= 4 : 9

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

N Á O

UY

TH2: X là peptit từ Ala, Y từ Gly

N Ơ H

Í

-L

-H

ÓA

P Ấ C

2+

31

mX = mY + mH2O = 0,02.( 4.89 + 9.75-12.18 ) + 0,02.3. 18 →mX = 17,38 gam

Câu 4: A Câu 5: A Ta có Gly = 1,08 mol và Ala= 0,48 mol → Gly: Ala = 9:4 → Tổng số mắt xích trong X là bội số của (9+4)k= 13k tổng số liên kết peptit trong 2 phân tử X, Y là 5 → k đạt giá trị lớn nhất khi Y chứa 5 mắt xích( ứng với 4 liên kết') và X chứa 2 mắt xích ( ứng với 1 liên kết) 13k ≤ 1.2 + 3. 5 → k ≤ 1,3 Quy hỗn hợp M thành peptit N gồm 9 Gly và 4 Ala và giải phóng H2O X + 3Y → 9Gly-4Ala + 3H2O Có nN = 0,48 : 9 = 0,12 mol → m = 0,12.( 9. 75 + 4.89- 12.18) + 0,12. 3. 18 = 104,28 gam. Câu 6: A Gọi X gồm peptit A, B, C, D theo tỉ lệ lần lượt 1:2:3:4

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Có ∑nGly = nGly-Ala + nGly-Val+ 2nGly-Gly + nGLy = 0,02 + 0,01 + 2 .0,02 +0,15 = 0,22 mol

→ n = 3.10-3 → M = 222 = 165+ 75-18 → Z có cấu tạo là Gly-Phe hoặc Phe-Gly Z Z

∑nAla = nGly-Ala +nAla- Val + nAla = 0,02 + + 0,03 + 0,03 = 0,08 mol

→ X có câu tạo Gly-Phe-Ala hoặc Ala-Phe- Gly

∑nVal = nGly-Val+ nAla- Val + nVal= 0,02 + 0,03 + 0,02 = 0,07 mol

Câu 11: A

Gly : Ala : Val = 22: 8 : 7

Trong Y có C :H : N : O =

→ tổng số mắt xích trong X là bội số của (22 + 8 + 7)k = 37k

→ Công thức của tripeptit X là 3C3H7NO2 - 2H2O = C9H17N3O4. Câu 12: B Ta có A : B = 29 : 18 → tổng số mắt xích của T là bội số của ( 29 + 18 )k = 47k ( với k là số nguyên dương)

số liên kết peptit trong X không vượt quá 13→ k lớn nhất khi D gồm 10 mắt xích, A, B, C đều chứa 2 mắt xích → 37k ≤ 1.2 + 2.2 + 3.2 + 4. 10 → k ≤ 1,4 → k = 1

A + 2B + 3C + 4D → 22 Gly-8 Ala-7 Val + 9H2O Bảo toàn khối lượng → m = 0,01. ( 22. 75 + 8. 89 + 7. 117- 36. 18) + 0,01. 9. 18 = 26,95 gam. Câu 7: D Thủy phân không hoàn toàn tripeptit X mạch hở, thu được sản phẩm gồm Ala, Gly, Ala-Gly, Gly-Ala → X có cấu tạo Ala-Gly-ALa hoặc Gly-Ala-Gly Câu 8: C có nGly= 0,02 mol và nAla = 0,02 → Gly : Ala= 1:1 Số chất tetrapeptit X thỏa mãn tính chất trên là: Ala-Ala-Gly-Gly, Ala-Gly-Ala-Gly, Ala-Gly-Gly-Ala, GlyGly-Ala-Ala,Gly-Ala-Gly-Ala,Gly-ALa-Ala-Gly Câu 9: B Gọi số mol của Ala-Val-Ala-Gly-Ala : a mol và Val-Gly-Gly : y mol

Câu 10: A Có MX = 293 được cấu tạo bởi Gly, Ala, Phê

TO

ÁN

H Í

-L

ÓA

P Ấ C

Thấy 293 = 75 + 89 + 165-2. 18 → X là tripeptit chứa 1Gly,1 ALa, 1 Phe

G N Ỡ

:

:

G N Ư

.Q P T

N

= 3: 7 : 1: 2 → Y có công thức C3H7NO2

O Ạ Đ

Tổng số liên kết peptit là 16 → k đạt max khi Z chứa 15 mắt xích ( ứng với 14 liên kết peptit) , Y chứa 2 mắt xích ( ứng với 1 liên kết peptit), X chứa 2 mắt xích (( ứng với 1 liên kết peptit) → 47k ≤ 2.2 + 2. 3 + 4. 15 → k ≤ 1,48 → k = 1

Quy X về peptit Z chứa 22 Gly-8 Ala-7 Val→ nZ =0,01 mol

Ta có hệ

:

UY

2

N Ầ TR

H

Quy đổi 3 peptit X, Y, Z thành một peptit G chứa 47 mắt xích gồm 29 A và 18 B, đông thời giải phóng ra 8 phân tử H2O.

0 00

B

Có nG = 0,29 : 29 = 0,01 mol

1 3 +

2X + 3Y + 4Z → 29A-18B + 8H2O

mG = mT - mH2O = 35, 97 - 0,01. 8. 18 = 34, 53

→ MG =

= 3453 = 29. MA + 18. MB - 46. 18 → 29. MA + 18. MB= 42 81

Thấy khi M = 75 ( Ala) thì M = 117 ( Val) → Vậy G là peptit chứa 29 Ala- 18 Val Trong 35,97 gam T đốt cháy sinh ra ( 0,29. 2 + 0,18. 5) = 1,48 mol CO2 và ( 0,29. 5 + 0,18. 11- 46.2. 0,01 + 0,08. 2): 2 = 1,335 mol H2O → m' gam T đốt cháy sinh ra 0,74 mol CO2 và 0,6675 mol H2O Câu 13: D Có Gly: 0,96 mol, Ala: 0,64 mol và Val: 2,16 mol → Gly : Ala: Val = 12: 8 : 27

Có nHCl = 0,222.0,018 = 3,996. 103 ≈ 4.10-3 mol

Tổng số mắt xích trong M là bội số của ( 12 + 8 + 27)k =47k

Khi thủy phân tripeptit X thu được hai đipeptit Y, Z

I Ồ B

Có nÝ = 0,5nHCl = 0,002 mol→ MÝ =236 = 165 + 89- 18 → Y có cấu tạo Ala-Phe hoặc Phe-Ala

Có nNaOH =

= 6.10-3

Sưu tầm bởi GV. Nguyễn Thanh Tú

Trong M có tổng số nhóm -CO-NH- trong ba phân tử là 11 → k đạt max khi Z chứa 10 mắt xích ( ứng với 9 liên kết peptit) , Y chứa 2 mắt xích ( ứng với 1 liên kết peptit), X chứa 2 mắt xích (( ứng với 1 liên kết peptit) → 47k ≤ 4.2 + 6. 2 + 9. 10 → k ≤ 2,34 k đặt giá trị nhỏ nhất khi Z chứa 2 mắt xích ( ứng với 1 liên kết peptit) , Y chứa 2 mắt xích ( ứng với 1 liên kết

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

peptit), X chứa 10 mắt xích (( ứng với 9 liên kết peptit) → 47k ≥ 4.10 + 6.2 + 9.2 → k ≥ 1,48 1,48 ≤ k ≤ 2,34 → k = 2

UY

Quy đổi 3 peptit X, Y, Z thành một peptit G chứa 47 mắt xích gồm 24 Gly , 16 Ala và 54 Val đông thời giải phóng ra 18 phân tử H2O. Có nG = 0,96 : 24 = 0,04 mol 4X + 6Y + 9Z → 24 Gly - 16 Ala - 54 Val + 19H2O → m = 0,04. ( 24. 75 + 16. 89 + 54. 117- 93. 18) + 18.0,04. 18 = 327,68 gam Gọi số mắt xích trong X, Y, Z lần lượt là a, b, c ( a,b,c > 1) → a + b + c= 11 + 3= 14 (1) 4a + 6b + 9c = 94 (2)

0 00

Thay c = 4 → a = 1 và b = 9 không thỏa mãn Thay c = 6 → a = b = 4 thỏa mãn Câu 14: A Ta có Gly : Ala = 29 : 18 → tổng số mắt xích của T là bội số của ( 29 + 18 )k = 47k ( với k là số nguyên dương)

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Tổng số liên kết peptit là 16 → k đạt max khi Z chứa 15 mắt xích ( ứng với 14 liên kết peptit) , Y chứa 2 mắt xích ( ứng với 1 liên kết peptit), X chứa 2 mắt xích (( ứng với 1 liên kết peptit) → 47k ≤ 2.2 + 2. 3 + 4. 15 → k ≤ 1,48 → k = 1

-

A Ó H

Quy đổi 3 peptit X, Y, Z thành một peptit G chứa 47 mắt xích gồm 29 Gly và 18 Ala, đông thời giải phóng ra 8 phân tử H2O.

N Á O

Có nG = 0,29 : 29 = 0,01 mol 2X + 3Y + 4Z → 29Gly-18Ala + 8H2O

NG

Í -L

T

m=mG + mH2O = 0,01. (29. 75 + 18. 89-46.18) +0,08. 18 = 30,93 gam. Câu 15:

I Ồ B

Ỡ Ư D

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

28. Phương pháp giải bài toán (H+, NO3-) tạo hỗn hợp khí phức tạp (Đề 1)

D. 29,0

Câu 1. Cho 7,2 gam Mg phản ứng hoàn toàn với 150 gam dung dịch HNO3 37,8% thu được dung dịch X và thoát ra các khí NO, N2, N2O. Biết rằng nếu thêm 900ml dung dịch NaOH 1M vào X (không thấy khí thoát ra), loại bỏ kết tủa thu được rồi cô cạn và nung sản phẩm thu được tới khối lượng không đổi thì được 57,75 gam chất rắn. Nồng độ % của HNO3 trong dung dịch X gần nhất với A. 6,10%. B. 6,15%. C. 6,20%. D. 6,25%. Câu 2. Hoà tan hoàn toàn 10,8 gam Ag vào 42 gam dung dịch HNO3 60% thu được dung dịch X (không có ion NH4+). Cho 5,6 gam Fe tan hoàn toàn trong dung dịch X, sau đó lọc bỏ kết tủa thu được dung dịch Y (sản phẩm khử của N+5 trong quá trình này là khí NO duy nhất). Cô cạn Y được chất rắn Z. Nung Z đến khối lượng không đổi trong không khí, thấy khối lượng Z giảm 13,1 gam. Nồng độ % của AgNO3 trong dung dịch X gần nhất với giá trị nào sau đây ? A. 32,5%. B. 33,5%. C. 34,5%. D. 35,5%. Câu 3. Hòa tan hết 24,16 gam hỗn hợp X gồm Cu và Fe3O4 trong dung dịch HCl loãng dư thấy còn lại 6,4 gam Cu không tan. Mặt khác hòa tan hết 24,16 gam hỗn hợp trên trong 240 gam dung dịch HNO3 31,5% (dùng dư) thu được dung dịch Y. Cho 600 ml dung dịch NaOH 2M vào dung dịch Y. Lọc bỏ kết tủa, cô cạn dung dịch nước lọc, sau đó nung tới khối lượng không đổi thu được 78,16 gam rắn khan. Nồng độ C% của Cu(NO3)2 trong dung dịch Y có giá trị gần nhất với A. 11,60%. B. 11,65%. C. 11,70%. D. 11,55%. Câu 4. Hòa tan hoàn toàn 11,6 gam hỗn hợp X gồm Fe và Cu vào 87,5 gam HNO3 50,4%, sau khi kim loại tan hết thu được dung dịch Y. Cho 500ml dung dịch KOH 1M vào dung dịch Y thu được kết tủa Z và dung dịch T. Lọc lấy Y rồi nung trong không khí đến khối lượng không đổi thu được 16,0 gam chất rắn. Cô cạn dung dịch T được chất rắn E. Nung E đến khối lượng không đổi thu được 41,05 gam chất rắn. Nồng độ % của muối Fe(NO3)3 có trong dung dịch Y gần nhất với giá trị nào dưới đây ? A. 12,5%. B. 13,5%. C. 13,0%. D. 14,0%. Câu 5. Hoà tan hoàn toàn 2,56 gam Cu vào 25,20 gam dung dịch HNO3 60% thu được dung dịch X (không có ion NH4+). Thêm 210 ml dung dịch NaOH 1M vào X, sau khi các phản ứng kết thúc đem cô cạn hỗn hợp thu được chất rắn Y. Nung Y đến khối lượng không đổi được 17,40 gam chất rắn Z. Nồng độ % của Cu(NO3)2 trong dung dịch X có giá trị gần nhất với A. 27,5 B. 28,0 C. 28,5

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

D I BỒ

ƯỠ

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

UY

N Ơ H

N

Câu 1: B Thêm NaOH k có khí thoát ra nên trong dung dịch k có muối amoni. Nếu NaOH phản ứng hết thì chất rắn chắc chắn có 0,9 mol NaNO2 có khối lượng là: 62,1 > 57,75. Vậy nên NaOH dư

1 3 +

0 00

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

Câu 2: D

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 3: B TN1: Fe3O4 + 8HCl → 2FeCl3 + FeCl2 + 4H2O 2FeCl3 + Cu → CuCl2 + 2FeCl2 Vì Cu còn dư 0,1 mol nên sau phản ứng chứa FeCl2 : 3a mol, CuCl2 : a mol → a. 232 + 64. ( a + 0,1)= 24,16 →

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

a = 0,06 mol Vậy X gồm Cu: 0,16 mol và Fe3O4 : 0,06 mol

Y

TN2: 24,26 g

→ nNO3- > 2nFe2+ + 2nCu2+ ( Loại)

Nếu trong Y chứa

dd

UY

78,16 gam chất rắn →

Vậy Y chứa

Nhận thấy nếu chất rắn chỉ chứa NaNO2 : 0,12 mol thì mchất rắn = 0,12. 69 > 78,16 gam → chất rắn chứa đồng thời NaNO2 : x mol và NaOH : y mol

Giả sử sản phẩm khử chứa N , O

G N Ư

O Ạ Đ

Bảo toàn nguyên tố N → nN = 0,7- 0,45= 0,25 mol

Ta có hệ

.Q P T

Giả sử sản phẩm khử chứa N và O

Bảo toàn electron → 5nN- 2nO = 2nFe2+ + 2nCu2+ + 3nFe3+ → nO=0,4 mol

Bảo toàn nguyên tố N → nN = 1,2 - 1,04 = 0,16 mol

Bảo toàn khối lượng → mdd = 11, 6 + 87,5 - 0,25.14 - 0,4. 16 = 89,2 gam

Bảo toàn electron → 2nCU + nFe3O4 = 5nN - 2nO → nO = 0,21 mol

B

N Ầ TR

% Fe(NO3)2 =

0 00

Bảo toàn khối lượng → mdd = 24,16 + 240 - 0,16.14 - 0,21. 16 = 258,56 gam

%Cu(NO3)2 = . 100% = 11,63%. Câu 4: B Nhận thấy nếu chất rắn E chỉ chứa KNO2 thì mE = 0,5. 85 > 41, 05 → E chứa KNO2 : a mol và KOH : b mol

Ta có hệ

11,6 gam

dd Y

16 gam

N Á O

Gọi số mol của Fe và Cu lần lượt là x, y

Ta có hệ

Ư D I Ồ B

Nhận thấy nếu trong Y chứa

N

G N Ỡ

-L

Í-

A Ó H

T

P Ấ C

2

1 3 +

H

. 100% = 13,56 %

Câu 5: C Nhận thấy nếu dung dịch NaOH vừa đủ thì chất rắn thu được chỉ chứa NaNO2: 0,21 mol và CuO : 0,04 → mZ = 0,21.69+ 0,04. 80 = 17,69 > 17,4 gam → Chất rắn Z chứa NaOH dư, CuO, NaNO2

0,04 mol Cu

Dd X

chất rắn Y

17,4 gam

Bảo toàn nguyên tố Na → x+ y = 0, 21 Theo đề bài 69x+ 40y + 0,04. 80 = 17,4 → x= 0,2 và y = 0,01 Gọi sản phẩm khử chứa N và O Nhận thấy toàn bộ NO3- trong dung dịch X chuyển hết về NO3- trong NaNO3 → nNO3- ( trong X) = nNaNO3= 0,2mol Bảo toàn nguyên tố N → nN(khí) = 0,24- 0,2 = 0,04 mol

→ n NO3- < 3nFe3+ + 2nCu2+ ( Loại)

Sưu tầm bởi GV. Nguyễn Thanh Tú

Bảo toàn electron cho toàn bộ quá trình → 2nO(khí)= 5nN- 2nCu → nO ( khí)= (0,04.5 - 2. 0,04) : 2=0,06 mol mdd= 2,56 + 25,2- 0,06.16 - 0,04.14= 26,24 gam

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

→ %Cu(NO3)2 =

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

×100%= 28,66%.

UY

0 00

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N Ơ H

N

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

29. Phương pháp sử dụng ĐỒNG ĐẲNG HOÁ quy đổi hỗn hợp peptit phức tạp (Đề 1)

Câu 1. Thủy phân m gam hỗn hợp X gồm một tetrapeptit A và một pentapeptit B (A và B chứa đồng thời glyxin và alanin trong phân tử) bằng một lượng dung dịch NaOH vừa đủ rồi cô cạn thu được (m + 15,8) gam hỗn hợp muối. Đốt cháy toàn bộ lượng muối sinh ra bằng một lượng oxi vừa đủ thu được Na2CO3 và hỗn hợp hơi Y gồm CO2, H2O và N2. Dẫn toàn bộ hỗn hợp hơi Y đi rất chậm qua bình đựng dung dịch NaOH đặc dư thấy khối lượng bình tăng thêm 56,04 gam so với ban đầu và có 4,928 lít một khí duy nhất (đktc) thoát ra khỏi bình. Xem như N2 không bị nước hấp thụ, các phản ứng xảy ra hoàn toàn. Thành phần phần trăm khối lượng của A trong hỗn hợp X gần nhất với A. 53,1%. B. 55,9%. C. 30,9%. D. 35,4%. Câu 2. Thủy phân hoàn toàn m gam hỗn hợp M gồm tetrapeptit X và pentapeptit Y (đều mạch hở) bằng dung dịch KOH vừa đủ, rồi cô cạn cẩn thận thì thu được (m + 11,42) gam hỗn hợp muối khan của Val và Ala. Đốt cháy hoàn toàn muối sinh ra bằng một lượng oxi vừa đủ thu được K2CO3; 2,464 lít N2 (đktc) và 50,96 gam hỗn hợp gồm CO2 và H2O. Phần trăm khối lượng của Y trong hỗn hợp M có thể là A. 55,24%. B. 54,54%. C. 45,98%. D. 64,59%. Câu 3. Đun nóng 0,16 mol hỗn hợp E gồm hai peptit X (CxHyOzN6) và Y (CnHmO6Nt) cần dùng 600 ml dung dịch NaOH 1,5M chỉ thu được dung dịch chứa a mol muối của glyxin và b mol muối của alanin. Mặt khác đốt cháy 30,73 gam E trong O2 vừa đủ thu được hỗn hợp CO2, H2O và N2, trong đó tổng khối lượng của CO2 và nước là 69,31 gam. Giá trị a : b gần nhất với A. 0,730. B. 0,810. C. 0,756. D. 0,962. Câu 4. Cho m gam hỗn hợp E gồm một peptit X và một peptit Y (Biết số nguyên tử nitơ trong X, Y lần lượt là 4 và 5, X và Y chứa đồng thời glyxin và alanin trong phân tử) bằng lượng NaOH vừa đủ, cô cạn thu được ( m + 15,8) gam hỗn hợp muối. Đốt cháy toàn bộ lượng muối sinh ra bằng một lượng O2 vừa đủ thu được Na2CO3 và hỗn hợp hơi F gồm CO2, H2O và N2. Dẫn toàn bộ hỗn hợp hơi F qua bình đựng NaOH đặc dư thấy khối lượng bình tăng thêm 56,04 gam so với ban đầu và có 4,928 lít một khí duy nhất (đktc) thoát ra, các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng của Y trong hỗn hợp E gần nhất với: A. 47%. B. 53%. C. 30%. D. 35%. Câu 5. Cho 0,7 mol hỗn hợp T gồm hai peptit mạch hở là X (x mol) và Y (y mol), đều tạo bởi glyxin và alanin. Đun nóng 0,7 mol T trong lượng dư dung dịch NaOH thì có 3,8 mol NaOH phản ứng và thu được dung dịch chứa m gam muối. Mặt khác, nếu đốt cháy hoàn toàn x mol X hoặc y mol Y thì đều thu được cùng số mol CO2. Biết tổng số nguyên tử oxi trong hai phân tử X và Y là 13, trong X và Y đều có số liên kết peptit không nhỏ hơn 4. Giá trị của m là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 396,6. B. 409,2. C. 340,8. D. 399,4. Câu 6. X, Y,Z là ba peptit đều mạch hở, có tổng số liên kết peptit là 8. Đốt cháy hoàn toàn x mol X, hoặc y mol Y cũng như z mol Z với lượng oxi dư đều thu được 0,64 mol CO2. Đun nóng 55,12 gam hỗn hợp E chứa X (x mol), Y (y mol) và Z (z mol) cần dùng dung dịch NaOH, thu được dung dịch chứa hai muối của glyxin và alanin; trong đó khối lượng muối của glyxin là 46,56 gam. Biết rằng y > z và 3x = 4(y + z). Phần trăm khối lượng của Z có trong hỗn hợp E là. A. 26,4% B. 32,3% C. 28,6% D. 30,19% Câu 7. Đun nóng 45,54 gam hỗn hợp E gồm hai peptit X (CxHyOzN6) và Y(CnHmO5Nt) cần dùng 580ml dung dịch NaOH 1M chỉ thu được dung dịch chứa muối natri của glyxin và valin. Mặt khác đốt cháy hoàn toàn cùng lượng E trên trong O2 vừa đủ thu được hỗn hợp CO2, H2O và N2, trong đó tổng khối lượng của CO2 và H2O là 115,18 gam. Công thức phân tử của peptit X là A. C17H30N6O7 B. C21H38N6O7 C. C24H44N6O7 D. C18H32N6O7 Câu 8. Đun nóng 0,045 mol hỗn hợp X chứa hai peptit Y, Z cần vừa đủ 120ml KOH 1M, thu được hỗn hợp T chứa 3 muối của Gly, Ala và Val trong đó muối của Gly chiếm 33,832% về khối lượng (biết Y hơn Z một số liên kết peptit). Mặt khác, đốt cháy hoàn toàn 13,68 gam X cần dùng 14,364 lít O2 (đktc) thu được hỗn hợp khí và hơi trong đó tổng khối lượng của CO2 và H2O là m gam. Phần trăm khối lượng muối của Ala trong T có giá trị gần nhất với A. 50% B. 51% C. 52% D. 53% Câu 9. Cho 0,7 mol hỗn hợp T gồm hai peptit mạch hở X (x mol) và Y (y mol), mỗi peptit đều tạo bởi glyxin, alanin và val. Đun 0,7 mol T trong lượng dư dung dịch NaOH thì có 3,9 mol NaOH phản ứng và thu được m gam muối. Mặt khác, nếu đốt cháy hoàn toàn 0,7 mol X thì thu được thể tích CO2 chỉ bằng ¾ lần lượng CO2 khi đốt 0,7 mol Y. Biết tổng số nguyên tử Oxi trong hai phân tử X và Y là 13, trong X và Y đều có số liên kết peptit không nhỏ hơn 4. Giá trị của m gần nhất là A. 444,0 B. 439,0 C. 438,5 D. 431,5 Câu 10. Peptit X và peptit Y có tổng số liên kết peptit bằng 8. Thủy phân hoàn toàn peptit X cũng như peptit Y đều thu được Glyxin và Valin. Đốt cháy hoàn toàn hỗn hợp E chứa X, Y có tỉ lệ mol tương ứng 1 : 3 cần dùng 44,352 lít O2 (đktc). Sản phẩm cháy gồm CO2, H2O và N2. Dẫn toàn bộ sản phẩm cháy qua bình đựng dung dịch Ca(OH)2 dư thấy khối lượng bình tăng 92,96 gam, khí thoát ra khỏi bình có thể tích 4,928 lít (đktc). Thủy phân hoàn toàn Y thu được a mol Val và b mol Gly. Tỉ lệ a : b là A. 1 : 1

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B. 2 : 1 C. 3 : 2 D. 1 : 2

UY

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: A Gọi số mol của A (CnH2n-2N4O5 với 8 ≤ n ≤ 12) và B (CmH2m-3N5O6 với 10 ≤ m ≤15 )lần lượt là x, y Bảo toàn khối lượng trong phản ứng thủy phân → m + 40. ( 4x + 5y) = m + 15,8 + 18 ( x+ y)

O Ạ Đ

.Q P T

N Ơ H

N

Bảo toàn nguyên tố N → 4x + 5y = 2. ( 4,928 : 22, 4) = 0,44

Câu 3: A Vì X và Y chỉ được cấu tạo bởi các amino axit no chứa 1 chức NH2 và 1 chức COOH → X có công thức tổng quát : CnH12n-4N6O7 và Y có công thức tổng quát C2mH10m-3N5O6

Giải hệ → x = 0,06 và y = 0,04

Gọi số mol của X và Y lần lượt là x, y mol

Hỗn hợp peptit được cấu tạo bởi các aminoaxit no chứa 1 nhóm NH2, 1 nhóm COOH → muối hình thành trong quá trình thủy phân có công thức CaH2aNO2Na : 0,44 mol . Gọi số mol CO2 và H2O lần lượt là a, b

Ta có hệ

0 00

B

N Ầ TR

H

G N Ư

→ nX : nY = 5:3

Trong 30,73 gam gọi số mol X và Y lần lượt là 5x và 3x mol, số mol CO2 là y mol, số mol H2O là z mol

Khi đó có hệ

Bảo toàn nguyên tố C → ∑ nC = nNa2CO3 + nCO2 = 0,22 + 0,84 = 1,06 mol Ta có 0,06n + 0,04m = 1,06 → 3n+ 2m = 53 Với điều kiện 10 ≤ m ≤15 thấy chỉ có 2 cặp thỏa mãn nghiệm nguyên Khi m= 10 (Gly-Gly-Gly-Gly-Gly) → n = 11 ( Ala-Ala-Ala-Gly)

→ %m Y =

×100% = 58,77%

ÁN

-L

Í-

A Ó H

P Ấ C

2

1 3 +

Ta có hệ Vậy trong 30,73 gam E thì có nX + nY = 5.0,01+ 3. 0,01 = 0,08 → 61,46 gam Ethì có nX + nY = 0,16 mol

Bảo toàn khối lượng cho thí nghiệm khi cho 0,16 mol E vào dung dịch NaOH → (75+22)a + (89+22)b = 61,46 + 0,9.40 - 0,16.18 → 99a + 111b = 94,58 lại có a+ b = 0,9 → a= 0,38 và b = 0,52

Khi m = 13 ( Gly-Gly-Ala-Ala-Ala)→ n = 9 ( Gly-GLy-GLy-Ala)

→ %mY = Câu 2: C

Ư D I Ồ B

G N Ỡ

TO

×100% = 53,06%.

Sưu tầm bởi GV. Nguyễn Thanh Tú

Vậy a: b ≈ 0,7306. Câu 4: A muối dạng CnH2nNO2Na = ½.C2n-1H4n.N2.O.Na2CO3. ||→ đốt C2n-1H4n.N2.O.Na2CO3 cho 0,33 mol N2 và ∑(CO2 + H2O) = 84,06 gam.

||→ có hệ số mol CO2 và H2O:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Số C trong X là 0,64 : 0,16 = 4 → X là Gly-Gly ||→ có hệ số mol Gly và Ala: Gọi k1 và k2 lần lượt là số C trong Y và Z Thủy phân: BTKL → nH2O = nX = (0,66 × 40 – 23,7) ÷ 18 = 0,15 mol.

UY

Vì y > z → 0,06 ≤ y ≤ 0,12→ 6 ≤ k1 ≤ 10 Thay lần lượt k1 thấy khi k1 = 8 thì y = 0,08, k2 = 16 ,z = 0,04

||→ có hệ số mol tetrapeptit Y4 và pentapeptit Z5:

Vậy Y là (Gly)2-Ala và Z là (Ala)4-(Ala)2

||→ mmuối = m + 23,7 = 0,39 × (75 + 22) + 0,27 × (89 + 22) ||→ m = 44,1 gam. Giả sử có 0,09 mol Y4 là (Gly)a-(Ala)4–a và 0,06 mol Z5 là (Gly)b(Ala)5–b

G N Ư

O Ạ Đ

.Q P T

N

.100% = 30,19%. % Z= Câu 7: B Quy hỗn hợp E về đipepit có dạng CnH2nN2O3 : 0,29 mol ,lượng nước cần thêm H2Ở : x mol

||→ có 0,09a + 0,06b = ∑Gly = 0,39 mol ↔ 3a + 2b = 13. Chỉ có cặp nghiệm a = 3; b = 2 (do thủy phân Y, Z đều cho Gly, Ala nên 1 ≤ a ≤ 3 và 1 ≤ b ≤ 4).

N Ầ TR

H

CxHyO6N7 + 2H2O → 3CnH2nN2O3 và CnHmO5N4 +H2O → 2CnH2nN2O3 ||→ Y là (Gly)3(Ala)1 → %Y trong X = 0,09 × (75 × 3 + 89 × 1 – 18 × 3) ÷ 44,1 ≈ 53,06%. → %Y = 46,94 Câu 5: A Tổng số nguyên tử oxi trong hai phân tử X và Y là 13, trong X và Y đều có số liên kết peptit không nhỏ hơn 4 → T gồm penta peptit ; x mol và hexapeptit ; y mol

Ta có hệ

Giả sử X có a Gly và (5-a) Ala.Y có b GLy và (6-b) Ala

P Ấ C

2

Nếu đốt cháy hoàn toàn x mol X hoặc y mol Y thì đều thu được cùng số mol CO2 → 0,4.[2a + 3.(5-a)] = 0,3.[2b + 3. (6-b)] → 4a- 3b = 6 → cặp nghiệm thỏa mãn là a= 3,b= 2

Í-

0,4 mol 3Gly-2Ala và 0,7mol 2Gly-4Ala

-L

→ m = ( 0,4.3 + 0,3.2). ( 75+ 22) + ( 0,4.2 + 0,3.4) .( 89 +22) = 396,6 gam Câu 6: D Có nGly = 0,48 mol

G N Ỡ

Có ∑n CO2 = 0,64. 3 = 1,92 mol → nAla =

T

N Á O

A Ó H

I Ồ B

Ta có hệ

0 00

B

Khi đốt cháy hỗn hợp đipeptit sẽ cho số mol CO2 = số mol H2Ở

1 3 +

Ta có nH2O = nCO2 = Theo đề bài có mH2O + mCO2 = 115,18 + 18x

( 44 + 18 ) = 115,18 + 18x → x = 0,18

→ nCO2 =

= 1,91 mol

Gọi số mol của CxHyO6N7 và CnHmO6N5 lần lượt là a, b

Ta có hệ

= 0,32 mol

Gọi số mol E là a mol. Bảo toàn khối lượng có → 55,12 + 40.( 0,48 + 0,32) = 111. 0,32 + 46,56 + 18a → a = 0,28

Có mđipeptit = 45,54 + x.18

Khi đó 0,07.x + 0,04. n = 1,91 → 7x + 4n = 191 Với x = 24 → n= 5,75 loại Với x= 18 → n = 16,25 loại

Sưu tầm bởi GV. Nguyễn Thanh Tú

Với n= 17 → n= 18 ( không thể phân tích thành số C của Val và Gly để thành tetrapeptit được) loại

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Với x= 21 → n= 11 ( 11= 2+2+2+5. Gly-Gly-Gly-Val) thỏa mãn

n = 18 ( GLy -2 Ala- 2Val), m = 24 (không thiết được hexa peptit được tạo bởi Ala,Val, Gly) loại

Câu 8: B Quy hỗn hợp về CH2, C2H3NO,H2O

Câu 10: A

UY

TN1: Có n C2H3NO = nKOH = 0,12 mol, nH2O = nX = 0,045 mol Quy đổi hỗn hợp E về → n C2H3NO : nH2O = 8 : 3 Có nO2 = 2,25nC2H3NO + 1,5nCH2 → x = + 0,64125 mol O2

TN2: 13,68 gam

G N Ư

O Ạ Đ

.Q P T

N

=0,66 mol

Có mtăng =mCO2 +mH2O → 92,96= 44.( 0,44.2 + 0,66) + 18. ( 1,5.0,44 + 0,66 + y) → y = 0,08 =nE

H

Hỗn hợp E chứa X, Y có tỉ lệ mol tương ứng 1 : 3 → X : 0,02 mol và Y :0,06 mol →

Ta có hệ

N Ầ TR

Gọi số mắt xích của X,Y lần lượt là n,m → n + m = 10 Có 13,68 gam thì có 0,0225. 3= 0,0675 mol X → 9,12 gam thì có 0,045 mol

Và 0,02n + 0,06m= 0,44 → n =4 và m = 6

0 00

Gọi số mol của Ala,Val khi thủy phân 27,36 gam X lần lượt là a,b bảo toàn khối lượng → mmuối = 9,12 + 0,12. 56 - 0,045. 18 = 15,03 gam → nGly = 0,33832. 33,27: 113= 0,045 mol

Ta có hệ

A Ó H

P Ấ C

2

1 3 +

B

Gọi số C trong X và Y lần lượt là x1 và y1 ( 8 ≤ x1 ≤ 20, 12≤ y1 ≤ 30) → x1.0,02 + y1.0,06 = 0,44. 2 + 0,66 → x1 + 3y1 = 77 luôn có 6.2 = 12 ≤ y1 ≤ 77 /3 = 25,5 Lập bảng chọn giá trị x1 = 14(2Gly-2Val) và y1 = 21 (3Gly-3Val) Vậy thủy phân Y thu được 3 Gly và 3 Val.

100% = 50,7%. Phần trăm khối lượng muối của Ala trong T. Câu 9: A Tổng số nguyên tử Oxi trong hai phân tử X và Y là 13, trong X và Y đều có số liên kết peptit không nhỏ hơn 4 → T gồm pentapeptit :x mol và hexapetit :y mol

Ta có hệ

NG

N Á O

Í -L

-

T

Gọi số C trong X và Y lần lượt là n,m (mỗi peptit đều tạo bởi glyxin, alanin và val nên 14 ≤ n ≤ 20, 16 ≤ m ≤ 25)

Ỡ Ư D

Nếu đốt cháy hoàn toàn 0,7 mol X thì thu được thể tích CO2 chỉ bằng ¾ lần lượng CO2 khi đốt 0,7 mol Y

I Ồ B

→ 0,7n =0,7.m.3/4 → 4n = 3m → lập bảng các giá trị thỏa mãn là n = 15 ( 2 GLy -2 Ala- Val) và m = 20 ( 2 GLy -2 Ala- 2Val) → m = 1,4.97 + 1,4.111+ 1,1. 139 = 444,1 gam.

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

30. Phương pháp giải bài toán hỗn hợp phức tạp tác dụng với dung dịch (H+, NO3-) (Đề 1)

Câu 1. Hòa tan hoàn toàn 100 gam hỗn hợp X gồm Fe, Cu , Ag trong dung dịch HNO3 (dư). Kết thúc phản ứng thu được 13,44 lít hỗn hợp khí Y gồm NO2, NO, N2O theo tỉ lệ số mol tương ứng là 3 : 2 : 1 và dung dịch Z (không chứa muối NH4NO3). Cô cạn dung dịch Z thu được m gam muối khan. Giá trị của m và số mol HNO3 đã phản ứng lần lượt là: A. 205,4 gam và 2,5 mol B. 199,2 gam và 2,4 mol C. 205,4 gam và 2,4 mol D. 199,2 gam và 2,5 mol Câu 2. Hòa tan 6,25 gam hỗn hợp Zn và Al vào 275 ml dung dịch HNO3 thu được dung dịch A, chất rắn B gồm các kim loại chưa tan hết cân nặng 2,516 gam và 1,12 lít hỗn hợp khí D (ở đktc) gồm NO và NO2. (Dung dịch không chứa muối amoni)Tỉ khối của hỗn hợp D so với H2 là 16,6. Tính nồng độ mol/l của HNO3 và tính khối lượng muối khan thu được khi cô cạn dung dịch sau phản ứng. A. 0,65M và 11,794 gam. B. 0,65M và 12,35 gam. C. 0,75M và 11,794 gam. D. 0,55M và 12.35 gam. Câu 3. Hòa tan hết 5,36 gam hỗn hợp FeO, Fe2O3. Fe3O4 trong dung dịch chứa 0,03 mol HNO3 và 0,18 mol H2SO4, kết thúc phản ứng thu được dung dịch X và 0,01 mol khí NO (sản phẩm khử duy nhất). Cho 0,02 mol Cu tác dụng hết với ½ dung dịch X, thu được dung dịch Y. Khối lượng Fe2(SO4)3 chứa trong dung dịch Y là. A. 20 B. 5 C. 24 D. 10 Câu 4. Hòa tan 6 gam hỗn hợp Mg, Al, Zn trong dung dịch HNO3 vừa đủ, sau phản ứng hoàn toàn thu được dung dịch Y và hỗn hợp gồm 0.02 mol NO, 0.02 mol N2O. Làm bay hơi dung dịch Y thu được 25,4 gam muối khan. Số mol HNO3 bị khử: A. 0,08 B. 0,06 C. 0,09 D. 0,07 Câu 5. Hòa tan hoàn toàn 31,25 gam hỗn hợp X gồm Mg, Al và Zn trong dung dịch HNO3, sau phản ứng hoàn toàn thu được dung dịch Y và hỗn hợp khí Z gồm 0,1 mol N2O và 0,1 mol NO. Cô cạn dung dịch Y thu được 157,05 gam hỗn hợp muối. Vậy số mol HNO3 đã bị khử trong phản ứng trên là: A. 0,35 mol B. 0,40 mol C. 0,45 mol D. 0,50 mol Câu 6. Hoà tan hoàn toàn 42,9 gam hỗn hợp X gồm Mg, Al, Zn trong dung dịch HNO3 thu được dung dịch Y và hỗn hợp khí Z gồm 0,15 mol N2, 0,1 mol N2O và 0,1 mol NO. Cô cạn cần thận dung dịch Y thu được 232,9 gam hỗn hợp muối. Số mol HNO3 đã tham gia phản ứng trên là A. 3,7 mol B. 6,8 mol.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. 3,2 mol D. 5,6 mol. Câu 7. Hòa tan hoàn toàn x gam hỗn hợp kim loại X trong dung dịch HNO3, sau phản ứng hoàn toàn thu được dung dịch Y và hỗn hợp gồm 0,1 mol N2O và 0,1 mol NO. Cô cạn dung dịch sau phản ứng thu được 127x/30 gam hỗn hợp muối. Vậy số mol HNO3 đã bị khử trong phản ứng trên nếu x trong đoạn [33, 41] A. 0,4 mol B. 0,325 mol C. 0,3 mol D. 0,35 mol Câu 8. (Đề NC) Hoà tan hoàn toàn 15,5 gam hỗn hợp X gồm Mg, Al, Zn trong dung dịch HNO3 thu được dung dịch Y và 2,24 lít hỗn hợp khí Z (ở đktc) gồm N2 và N2O có tỉ khối so với hiđro là 18. Cô cạn cẩn thận dung dịch Y thu được 85,7 gam hỗn hợp muối. Số mol HNO3 đã tham gia phản ứng trên là A. 2,90 mol. B. 1,35 mol. C. 1,10 mol. D. 2,20 mol. Câu 9. Lấy m gam Na cho tác dụng với 500ml HNO3 thu được dung dịch M và thoát ra 0,672 (l) hỗn hợp N (đktc) gồm 2 khí X và Y. Cho thêm vào M dung dịch NaOH dư thì thoát ra 0,336 (l) khí Y. Biết rằng quá trình khử HNO3 chỉ tạo ra sản phẩm khử duy nhất. Xác định m (g): A. 9,2 gam B. 5,75 gam C. 6,9 gam D. 8,05 gam Câu 10. Hòa tan hoàn toàn 1,44 gam Mg cần V lit dung dịch hỗn hợp NaHSO4 2M và NaNO3 0,3M thu được dung dịch X chứa m gam chất tan (không có muối amoni) ; hỗn hợp 2 khí không màu, có một khí hóa nâu trong không khí và hỗn hợp có tỉ khối so với heli là 31/6. Giá trị của V ; m lần lượt là: A. 0,1 và 27,06 B. 0,1 và 25,98 C. 0,075 và 27,96 D. 0,075 và 27,06 Câu 11. Cho 31,15 gam hỗn hợp bột Zn và Mg (tỷ lệ mol 1 : 1) tan hết trong dung dịch hỗn hợp gồm NaNO3 và NaHSO4 thu được dung dịch X chỉ chứa m gam hỗn hợp các muối và 4,48 lít (đktc) hỗn hợp khí Y gồm N2O và H2. Khí Y có tỷ khối so vơi H2 bằng 11,5. Giá trị của m gần nhất với A. 239. B. 240. C. 241. D. 242. Câu 12. (NC) Lấy m gam K cho tác dụng với 500ml dung dịch HNO3 thu được dung dịch M và thoát ra 0,336 lít hỗn hợp X (đktc) gồm 2 khí và dung dịch Y chứa 17,97 gam hỗn hợp muối. Biết rằng quá trình khử HNO3 chỉ tạo một sản phẩm duy nhất. Giá trị m gần nhất với giá trị nào dưới đây ? A. 6,8. B. 5,8. C. 6,1. D. 7,8.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13. Cho 4,44 gam bột Mg tan hết trong dung dịch hỗn hợp gồm H2SO4 (dư) và KNO3, thu được dung dịch X chứa m gam muối và 0,56 lít (đktc) hỗn hợp khí Y gồm N2 và H2 có tỉ khối so với H2 bằng 11,4. Giá trị của m là A. 28,74. B. 28,97. C. 23,52. D. 18,035. Câu 14. Hòa tan hoàn toàn 31,25 gam hỗn hợp X gồm Mg, Al và Zn trong dung dịch HNO3, sau phản ứng hoàn toàn thu được dung dịch Y và hỗn hợp khí Z gồm 0,1 mol N2O và 0,1 mol NO. Cô cạn dung dịch Y thu được 157,05 gam hỗn hợp muối. Vậy số mol HNO3 đã bị khử trong phản ứng trên là: A. 0,35 mol. B. 0,45 mol. C. 0,40 mol. D. 0,50 mol. Câu 15. Hòa tan hoàn toàn 100 gam hỗn hợp X gồm Fe, Cu, Ag trong dung dịch HNO3 (dư). Kết thúc phản ứng thu được 13,44 lít (đktc) hỗn hợp khí Y gồm NO2, NO, N2O theo tỉ lệ số mol tương ứng là 3 : 2 : 1 và dung dịch Z (không chứa muối NH4NO3). Cô cạn dung dịch Z thu được m gam muối khan. Giá trị của m và số mol HNO3 đã phản ứng lần lượt là A. 205,4 gam và 2,5 mol. B. 199,2 gam và 2,4 mol. C. 205,4 gam và 2,4 mol. D. 199,2 gam và 2,5 mol. Câu 16. Cho 4,32 gam Mg vào dung dịch hỗn hợp gồm NaNO3 và H2SO4, đun nhẹ đến khi phản ứng xảy ra hoàn toàn thu được dung dịch X, 0,896 lít hỗn hợp khí Y có khối lượng 0,92 gam gồm hai khi không màu (trong đó có một khí hóa nâu trong không khí) và còn lại 2,04 gam chất rắn không tan. Cô cạn cẩn thận dung dịch X thu được m gam muối khan. Giá trị của m là A. 18,27. B. 14,90. C. 14,86. D. 15,75 Câu 17. Hỗn hợp X gồm Mg, Al, Zn. Hòa tan hoàn toàn 15 gam X trong dung dịch HNO3, sau khi phản ứng kết thúc thu được dung dịch Y và 2,24 lít hỗn hợp khí NO và N2O có số mol bằng nhau. Cô cạn dung dịch Y thu được 63,5 gam muối. Thể tích dung dịch HNO3 1M tối thiểu để hòa tan hoàn toàn X là A. 1,9 lít B. 1,425 lít C. 0,95 lít D. 0,475 lít. Câu 18. Hòa tan hoàn toàn 25,3 gam hỗn hợp X gồm Mg, Al, Zn bằng dung dịch HNO3. Sau khi phản ứng kết thúc thu được dung dịch Y và 4,48 lít (đktc) khí Z (gồm hai hợp chất khí không màu) có khối lượng 7,4 gam. Cô cạn dung dịch Y thu được 122,3 gam hỗn hợp muối. Tính số mol HNO3 đã tham gia phản ứng. A. 0,4 mol B. 1,4 mol C. 1,9 mol D. 1,5 mol

Ư D I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

N Ơ H

Câu 19. Hoà tan hết 6,0 gam hỗn hợp X gồm Mg, Al, Zn trong dung dịch HNO3 vừa đủ, sau khi phản ứng hoàn toàn thu được dung dịch Y và hỗn hợp khí gồm 0,02 mol NO và 0,02 mol N2O. Làm bay hơi dung dịch Y thu được 25,4 gam muối khan. Tổng số mol ion nitrat bị khử trong các phản ứng trên là: A. 0,07 mol. B. 0,08 mol. C. 0,06 mol. D. 0.09 mol. Câu 20. Cho 8,64 gam Mg vào dung dịch hỗn hợp NaNO3 và H2SO4, đun nhẹ đến khi phản ứng xảy ra hoàn toàn thu được dung dịch A; 1,792 lít (đktc) hỗn hợp khí B có khối lượng B có khối lượng 1,84 gam gồm 2 khí không màu có một khí hóa nâu và còn lại 4,08 gam chất rắn không tan. Cô cạn cẩn thận dung dịch A thu được m gam muối khan. Giá trị m là A. 31,5 gam B. 29,72 gam C. 36,54 gam D. 29,80 gam

UY

G N Ư

O Ạ Đ

.Q P T

N

1 3 +

H N ĐÁP ÁN &Ầ LỜI GIẢI CHI TIẾT TR 0B 0 0

Câu 1: C ta có : số mol e nhận là : 0,1.8 cộng 0,1.2.3 cộng 0,1.3 bằng 1,7mol Khối luong m là: 100 cộng 1,7.62 bằng 205,4 gam . số mol HNO3 là: 1,7 cộng 0,1.2 cộng 0,1.2 cộng 0,1.3 bằng 2,4mol Câu 2: A Gọi số mol của NO và NO2 lần lượt là x, y

Ta có hệ

Có nHNO3 = 4nNO + 2nNO2 = 4. 0,04 + 2. 0,01 = 0,18 mol → CM = 0,65M mmuối = mkl + mNO3- = 6,25- 2,516 + 62. ( 0,04. 3 + 0,01) = 11,794 gam Câu 3: B •Qui đổi hỗn hợp sắt ban đầu về Dung dịch axit có : b----------------6b-------------2b a------------a/3------------10a/3 ----------------------------a/3 số mol khí : a/3 = 0,01 ===> a = 0,03 Ta có Dung dịch X sau phản ứng có :

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Cho Cu tác dụng với 1/2 dd X TH2: Dung dịch Y chứa y mol NH4NO3 0,015----------0,01--------0,04-----------0,015 → mmuối = (mkl + mNO3-_ + mNH4NO3→

0,05--------0,01-----------0,05-------------0,01 Khi cô cạn thu được :

UY

= x + 62.( 0,1. 8 0,1. 3+ 8y) + 80y →

Vì x trong đoạn [33,41] nên y trong (0,067;0,112)

.Q P T

N

= 68,2 + 5676y

Số mol HNO3 đã bị khử trong phản ứng trên là: 0,1 + 0,1.2 +y = 0,3 + y

Câu 4: A Gọi số mol NH4NO3 là x mol

O Ạ Đ

Số mol HNO3 đã bị khử trong phản ứng trên trong khoảng (0,367; 0,412) Có mmuối = mkl + mNO3- + mNH4NH3 → 25,4 = 6 + 62. ( 0,02. 3 + 0,02. 8+ 8x) + 80x → x = 0,01 mol

G N Ư

Câu 8: B cần chú ý 2 chỗ: đề không nói hỗn hợp khí là sản phẩm duy nhất và cho khối lượng muối

→ nNO3- bị khử = nNO + 2nN2O + nNH4+ = 0,02 + 0,02. 2 + 0,01 = 0,07 mol. Câu 5: B 31,25 gam hhX gồm Mg, Al, Zn + HNO3 → ddY + hhZ gồm 0,1 mol N2O và 0,1 mol NO.

N Ầ TR

H

→ tồn tại muối NH4NO3 có x mol. Tính nhanh: mmuối = mX + mNO3- + mNH4NO3 = 85,7 Cô cạn ddY → 157,05 gam hh muối.

↔ 15,5 + 62 × ( 8x + 0,05 × 8 + 0,05 × 10) + 80x = 85,7 → x = 0,025 mol.

0 00

• Gọi x là số mol HNO3 tham gia phản ứng.

B

Vậy nHNO3 = 0,025 × 10 + 0,05 × 10 + 0,05 × 12 = 1,35 mol.

31

Giả sử ddY có NH4NO3

mol.

mol.

Theo BTNT H:

Theo BTKL: 31,25 + 63x = 157,05 + 0,1 x 44 + 0,1 x 30 + (0,3x + 0,28) x 18 → x = 2,4 mol → nNH4NO3 = 0,1 mol.

N Á O

Í-

-L

A Ó H

P Ấ C

nHNO3 bị khử = nNH4NO3 + 2 x nN2O + nNO = 0,1 + 2 x 0,1 + 0,1 = 0,4 mol Câu 6: A Gọi số mol của NH4NO3 là x mol

G N Ỡ

T

2+

(chú ý: dùng bảo toàn e hoặc bảo toàn điện tích để nhầm nhanh các hệ số 8 hay 10 ta nhân trên). Câu 9: C Khi thêm M vào dung dịch NaOH sinh khí Y → M chứa NH4+ dư: 0,015 mol và Y là NH3 : 0,015 mol, Khí X là H2

Na + HNO3 → dd M

+

+ H2O

Na + HNO3 → NaNO3 + NH4NO3 + H2O 2 Na+ 2H2O →2 NaOH + H2 .........................2x.............x NaOH + NH4NO3 → NaNO3 + NH3 + H2O

Ta có mmuối = mkl + mNO3- + mNH4NO3 → 232,9 = 42,9 + 62. ( 0,15.10 + 0,1.8 + 0,1.3+8x) + 80x → x = 0,05

Ư D I Ồ B

Có nHNO3 pư = 12nN2 + 10 nN2O + 4 nNO + 10nNH4NO3 = 12. 0,15 + 10. 0,1 + 4. 0,1 + 10. 0,05 = 3,7 mol. Câu 7: A TH1: Dung dịch Y không chứa muối NH4NO3

-

→ mmuối = mkl + mNO3 →

2x................................................2x Ta có x + 2x = 0,03 → x = 0,01 mol Vậy nH2 = 0,01 mol ,nNH3 = 0,01.2+ 0,015 = 0,035 mol

= x + 62. ( 0,1. 8 + 0,1. 3) → x = 21,09 ( loại)

Sưu tầm bởi GV. Nguyễn Thanh Tú

Bảo toàn electron → nNa = 0,01.2 + 8. 0,035 = 0,3 mol → m = 6.9 gam.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 10: B và có một khí hóa nâu trong không khí nên có

Vì quá trình khử HNO3 chỉ tạo một sản phẩm khử duy nhất NH4NO3 nhưng lại sinh ra 2 khí → 2 khí là H2 và NH3

Mặt khác:

UY

2 K + 2H2O → 2KOH + H2 Vì có khí

N Ơ H

Y chứa 17,97 gam hỗn hợp muối → 2 muối tạo thành là KNO3: x mol và NH4NO3 : y mol hỗn hợp khí có

nên

KOH + NH4NO3 → NH3 + KNO3 + H2O

sẽ hết

O Ạ Đ

.Q P T

N

Thấy nKOH= nNH3 = 2nH2 mà nH2 + nNH3 = 0,015 mol → nH2 = 0,005 mol và nNH3 = 0,01 mol

Dung dịch X có: BT điện tích:

H

→ m = 0,17. 39 = 6,63 gam. Câu 13: A Gọi số mol của N2 và H2 lần lượt là x, y

BT S:

B 00

Ta có hệ

Câu 11: B Ta có nZn = nMg = 0,35 mol Gọi số mol của N2O và H2 lần lượt là a,b mol

Ta có hệ

N Á O

Bảo toàn electron → nNH4+ =

Í -L

-

A Ó H

P Ấ C

G N Ỡ

2+

0 1 3

N Ầ TR

T

Luôn có nHSO4- = 2nH2+10 nN2O + 10nNH4+ = 1,7 mol

Nhận thấy 2nMg > 2nH2 + 10nN2 → tạo muối NH4+ =

Bảo toàn nguyên tố N → nKNO3 = 2. 0,02 + 0,02 = 0,06 mol mmuối= mK2SO4 + mMgSO4 + m(NH4)2 SO4 = 0,03. 174 + 0,01. 132 + 0,185.120= 28,74 gam. Câu 14: C 31,25 gam hhX gồm Mg, Al, Zn + HNO3 → ddY + hhZ gồm 0,1 mol N2O và 0,1 mol NO. Cô cạn ddY → 157,05 gam hh muối. • Gọi x là số mol HNO3 tham gia phản ứng. Giả sử ddY có NH4NO3

→ m = 31,15 + 1,95. 23 + 1,7. 96 + 0,05. 18= 240,1 gam. Câu 12: A

Theo BTNT H:

Sưu tầm bởi GV. Nguyễn Thanh Tú

= 0,02 mol

Vì sinh khí H2 nên NO3- chuyển hóa thành N2, NH4+

Dung dịch X chứa Zn2+: 0,35 mol , Mg2+: 0,35 mol , Na+: 0,25 + 1,7 = 1,95 mol, SO42- : 1,7 mol, NH4+: 0,05 mol

= 0,05 mol

Do sinh ra H2 nên toàn bộ lượng NO3- chuyển hóa thành N2O và NH4+ → nNaNO3 = 0,1.2 + 0,05 = 0,25 mol

I Ồ B

G N Ư →

Ta có hệ

mol.

mol.

Theo BTKL: 31,25 + 63x = 157,05 + 0,1 x 44 + 0,1 x 30 + (0,3x + 0,28) x 18

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

→ x = 2,4 mol → nNH4NO3 = 0,1 mol.

Có mmuối = 25,3 + 62. ( 0,1. 3 + 0,1. 8 + 8z) + 80z= 122,3 → z = 0,05

nHNO3 bị khử = nNH4NO3 + 2 x nN2O + nNO = 0,1 + 2 x 0,1 + 0,1 = 0,4 mol Câu 15: C Có nN2O = 0,1 mol; nNO = 0,2 mol và nNO2 = 0,3 mol

Có nHNO3 pư = 4. 0,1 + 10. 0,1 + 10. 0,05 = 1,9 mol Câu 19: A Gọi số mol NH4NO3 là x mol

Có mmuối = mkl + mNO3- = 100 + 62. ( 0,1. 8 + 0,2. 3+ 0,3) = 205,4 gam

Có mmuối = mkl + mNO3- + mNH4NH3 → 25,4 = 6 + 62. ( 0,02. 3 + 0,02. 8+ 8x) + 80x → x = 0,01 mol

Có nHNO3 pư = 0,1.10 + 0,2. 4 + 0.3.2 = 2,4 mol Câu 16: B

→ nNO3- bị khử = nNO + 2nN2O + nNH4+ = 0,02 + 0,02. 2 + 0,01 = 0,07 mol. Đáp án A. Câu 20: D

Có MY = = 23 → Y gồm hai khi không màu (trong đó có một khí hóa nâu trong không khí) , Y gồm NO : 0,03 mol, H2 : 0,01 mol

G N Ư

O Ạ Đ

UY

.Q P T

N

= 23 → Y gồm hai khi không màu (trong đó có một khí hóa nâu trong không khí) , Y gồm NO : Có MY = 0,06 mol, H2 : 0,02 mol

Do sinh khí H2 nên dung dịch chỉ chứa muối sunfat

N Ầ TR

H

Do sinh khí H2 nên dung dịch chỉ chứa muối sunfat +

Do sau phản ứng thấy còn chất rắn không tan Mg→ H phản ứng hết

Do sau phản ứng thấy còn chất rắn không tan Mg→ H+ phản ứng hết

0 00

Có nMg phản ứng = 0,18 - 0,085 = 0,095 mol

B

Có nMg phản ứng = 0,36 - 0,17 = 0,19 mol

31

Gọi số mol của Na2SO4, (NH4)2SO4 lần lượt là a, b → nNaNO3 = 2a mol, nH2SO4 = 0,095 + a + b Bảo toàn nguyên tố N → 2a = 2b + 0,03 Có nH+ = 4nNO + 10nNH4+ + 2nH2 → 2. ( 0,095 + a+ b) = 4. 0,03 + 10. 2b+ 2. 0,01 Giải hệ a= 0,02 và b = 0,005 → mmuối = 0,095.120 + 0,02. 142+ 0,005. 132= 14,9 gam. Câu 17: C Gọi số mol của NH4NO3 là a mol

N Á O

-L

H Í

ÓA

P Ấ C

2+

Gọi số mol của Na2SO4, (NH4)2SO4 lần lượt là a, b → nNaNO3 = 2a mol, nH2SO4 = 0,19 + a + b

Bảo toàn nguyên tố N → 2a = 2b + 0,06 Có nH+ = 4nNO + 10nNH4+ + 2nH2 → 2. ( 0,19 + a+ b) = 4. 0,06 + 10. 2b+ 2. 0,01 Giải hệ a= 0,04 và b = 0,01 → mmuối = 0,19.120 + 0,04. 142+ 0,01. 132= 29,8 gam.

Có mmuối = mkl + mNO3- + mNH4NO3 → 63,5 = 15 + 62. ( 0,05. 3 + 0,05. 8+ 8a) + 80a → a = 0,025 mol

T

nHNO3 = 0,05.4 + 10. 0,05 + 10. 0,025 = 0,95 mol → V = 0,95 lít. Câu 18: C Có MZ = 7,4 : 0,2 = 37 → Z có thể chứa N2 và N2O hoặc NO và N2O

Ỡ Ư D

TH1: NO: x mol và N2O : y mol

I Ồ B

Ta có hệ

NG

Gọi số mol của NH4NO3 là z mol

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 1. Đốt cháy hoàn toàn 52,4 gam hỗn hợp X (gồm 5 chất hữu cơ no, mạch hở; các chất có số C ≤ 2 chỉ chứa các nhóm chức -CHO và –COOH; và có tổng số mol là 1 mol) trong 19,04 lít (đktc) khí O2 lấy vừa đủ. Dẫn toàn bộ hỗn hợp khí và hơi sau phản ứng qua nước vôi trong dư thu được m gam kết tủa. Giá trị m gần nhất với A. 113 B. 131 C. 141 D. 115 Câu 2. Hỗn hợp X gồm C2H4(OH)2, (COOH)2, CH2(OH)(COOH). Cho m gam X phản ứng với K dư tạo 0,3 mol khí. Biết m gam X phản ứng vừa hết với 0,3 mol NaOH. Đốt cháy hết m gam X rồi cho hấp thụ hết toàn bộ sản phẩm cháy vào 500ml dung dịch Ca(OH)2 1M thấy khối lượng dung dịch thay đổi theo hướng A. giảm 11,4 gam. B. tăng 11,4 gam. C. giảm 22,8 gam. D. giảm 2,8 gam. Câu 3. Hỗn hợp X gồm (C2H4(OH)2, (COOH)2, C3H5(OH)3, CH2(OH)COOH). Đốt m gam X thu được 0,395 mol CO2 và 0,395 mol H2O. m gam X phản ứng vừa đủ với 0,185 mol NaOH. Giá trị m là A. 11,45 B. 17,37 C. 14,41 D. 14,81 Câu 4. X là hỗn hợp gồm HOOC-COOH, OHC-COOH, OHC-C≡C-CHO, OHC-C≡C-COOH; Y là axit cacboxylic no, đơn chức, mạch hở. Đun nóng m gam X với lượng dư dung dịch AgNO3 trong NH3, thu được 23,76 gam Ag. Nếu cho m gam X tác dụng với NaHCO3 dư thì thu được 0,07 mol CO2. Đốt cháy hoàn toàn hỗn hợp gồm m gam X và m gam Y cần 0,805 mol O2, thu được 0,785 mol CO2. Giá trị của m là A. 8,8. B. 4,6. C. 6,0. D. 7,4. Câu 5. Hỗn hợp X gồm CH3CHO, OHCH2-CHO, (CHO)2, OHCH2-CHOH-CHO trong đó tỉ lệ số nhóm CHO: OH =24:11 . Cho m gam hỗn hợp X tác dụng với dung dịch AgNO3/NH3 dư thu được 103,68 gam Ag. Đốt cháy hết 16,62 gam X cần 13,272 lít O2 (đktc) thu được 9,18 gam H2O. Giá trị của m gần nhất với A. 21,5. B. 20,5. C. 22,5. D. 19,5. Câu 6. Hỗn hợp X gồm CnH2n-1CHO; CnH2n-2(CHO)2; CnH2n-2(COOH)2; CnH2n-3(CHO)(COOH)2. Cho m gam hỗn hợp X tác dụng với dung dịch AgNO3/NH3 dư thu được 56,16 gam kết tủa bạc. Trung hòa m gam hỗn hợp X cần dùng 30 gam dung dịch hỗn hợp NaOH 12% và KOH 5,6%. Đốt m gam hỗn hợp X cần dùng (m + 7,92) gam O2. Giá trị gần nhất của m là A. 19,0. B. 20,0. C. 19,5.

D I BỒ

ƯỠ

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

N Ơ H

D. 18,5.

31. Kĩ thuật QUY ĐỔI đặc biệt xử lý hỗn hợp hữu cơ phức tạp (Đề 1)

ÓA

P Ấ C

2

UY

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

.Q P T

N

Câu 1: C X gồm gồm 5 chất hữu cơ no, mạch hở; các chất có số C ≤ 2 chỉ chứa các nhóm chức -CHO và –COOH → các chất hữu cơ gồm : HCHO, HCOOH,(CHO)2, (COOH)2, HOC-COOH

Quy hỗn hợp X về

Ta có hệ

H

Vì Ca(OH)2 dư nên nCaCO3 = nCO2 = 0,7 + 0,7 = 1,4 mol → m = 140 gam. Câu 2: D Gọi số mol của C2H4(OH)2, (COOH)2, CH2(OH)(COOH) lần lượt là a, b, c

0 00

1 3 +

B

N Ầ TR

G N Ư

O Ạ Đ

Có nH2 = a + b +c = 0,3 mol, nNaOH = 2b + c = 0,3mol nCO2 = 2a + 2b + 2c = 0,6 mol,nH2O = 3a + b + 2c = 3. (a + b +c) -(2b+c) = 3.0,3- -0,3 =0,6 mol

Thấy 1 <

Ta có hệ

=

< 2 → hình thành đồng thời 2 muối CaCO3 :x mol và Ca(HCO3)2: y mol

Có mgiảm = mCaCO3 -mCO2 - mH2O =0.4. 100 - 0,6. 44 - 0,6. 18 = 2,8 gam. Câu 3: D Gọi số mol các chất lần lượt là C2H4(OH)2, (COOH)2, C3H5(OH)3, CH2(OH)COOH lần lượt là a, b, c, d Có nNaOH = 2b +d =0,185 mol Có nCO2 = 2a + 2b + 3c + 2d =0,395 nO(X) = 2a + 4b + 3c + 3d =(2a + 2b + 3c + 2d ) + ( 2b +d) = 0,58 mol m = mC + mH +mO = 0,395.12 + 0,395.2 +0,58. 16 = 14,81 gam. Câu 4: A

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Cho X tác dụng với AgNO3/NH3 thì nCHO = 0,2nAg =0,11 mol Luôn có nCO2 -nH2O = a + 2b + 2c + 3d = 0,38 → nCO2 = x + 0,38 Cho X tác dụng với NaHCO3 dư thì nCOOH = nCO2 =0,07 mol CO2 Luôn có nO(X) = nCHO + 2nCOOH = 0,26 +2. 0,12 = 0,5 mol Có mX =mC + mH + mO = 12. (x+ 0,38) + 2x +0,5. 16 = 14x + 12,56 gam và Y là CnH2nỞ2

Quy hỗn hợp X về

Có mO2= mX + 7,92 = 14x + 20,48 Có nH2O do X sinh ra = 0,5 (nCHO + nCOOH ) = 0,09 mol Bảo toàn nguyên tố O → nO2 =

Gọi số mol H2Ở đó Y sinh ra là y mol → sô mol CO2 đó Y sinh ra y mol ( do Y là axit no đơn chức

O Ạ Đ

UY

.Q P T

N

= 1,5x+ 0,13 mol

G N Ư

→ 32. (1,5x+ 0,13) = 14x + 20,48 → x = 0,48 → m = 14.0,48 + 12, 56 = 19,28 gam →

Ta có hệ → m = 0,11. 29 + 0,07. 45 + 0,205.12 = 8,8 gam Câu 5: C Trong m gam X tham gia phản ứng với AgNO3/NH3 → nCHO = 0,5nAg = 0,48 mol →

0 00

Quy hỗn hợp X về

P Ấ C

2

Trong phản ứng đốt cháy bảo toàn khối lượng mCO2 = 16,62 + 0,5925. 32 - 9,18= 26,4 gam → nCO2 = 0,6 mol Bảo toàn O → 24a + 11a + 0,5925 . 2 = 0,6.2 + 0,51 → a = 0,015 mol Trong 16,62 gam X có 0,015.24 = 0,36 mol CHO

Í -L

-

A Ó H

1 3 +

B

N Ầ TR

H

→ Trong 22,16 gam X có 0,48 mol CHO. Câu 6: C Gọi số mol của CnH2n-1CHO , Cn H2n-1(CHO)2, Cn H2n-2(COOH)2 , Cn H2n-3 (CHO)(COOH)2 lần lượt là a, b, c, d

N Á O

T

Ta có nCHO = 0,5nAg = 0,26 mol → a + 2b + d = 0,26

NG

nCOOH = nNaOH+ nKOH = 0,09 +0,03 = 0,12 mol → 2c + 2d = 0,12

Ỡ Ư D

→ a + 2b + 2c + 3d = 0,38

I Ồ B

Nhận thấy CnH2n-1CHO có 1 liên kết π; Cn H2n-1(CHO)2 và Cn H2n-2(COOH)2 có liên kết π ; Cn H2n-3 (CHO)(COOH)2 có 4 liên kết π Khi đốt cháy X giả sử sinh ra x mol H2O

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

32. Phương pháp Biện luận xác định CTPT của HCHC (Đề 1)

Câu 1. Công thức đơn giản nhất của anđehit no, mạch hở (X) có dạng C2H3O. Vậy công thức phân tử của (X) là: A. C2H3O B. C4H6O2 C. C3H9O3 D. C8H12O4 Câu 2. Axit cacboxylic no, mạch hở X có công thức thực nghiệm (C3H4O3)n, vậy công thức phân tử của X là A. C3H4O3. B. C6H8O6. C. C9H12O9. D. C12H16O12. Câu 3. X là một hợp chất hữu cơ chứa 24,24% C; 4,04% H; 71,72% Cl về khối lượng. Số CTCT có thể có của X là A. 1 B. 2 C. 3 D. 4 Câu 4. Este X có CTĐGN là C2H4O. Số đồng phân este của X là A. 2 B. 4 C. 6 D. 8 Câu 5. Hợp chất hữu cơ X có công thức đơn giản nhất C2H4Cl. Số CTCT của X là A. 7 B. 8 C. 9 D. 10 Câu 6. CTĐGN của este X là C5H8O3. Công thức phân tử của X là A. C5H8O3 B. C10H16O6 C. C15H24O9 D. C20H32O12 Câu 7. Anđehit X có công thức đơn giản nhất là C4H3O (chỉ có liên kết piC-C trong vòng benzen). Số đồng phân anđehit của X là A. 2 B. 3 C. 4 D. 5 Câu 8. Hiđrocacbon X có công thức thực nghiệm (CH)n. Cho X tác dụng với nước brom chỉ thu được một sản phẩm chứa 36,36% Cacbon (về khối lượng). Biết MX ≤ 120; phân tử X chỉ chứa tối đa 1 vòng. CTPT của X là A. C2H2 B. C4H4

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. C6H6 D. C8H8 Câu 9. Axit cacboxylic no, mạch hở X có công thức thực nghiệm (C2H3O2)n, vậy công thức phân tử của X là A. C2H3O2 B. C4H6O4 C. C6H9O6 D. C8H12O8 Câu 10. Một axit no, mạch hở có công thức CnHn+1O4. Giá trị của n là A. 3 B. 4 C. 5 D. 2 Câu 11. Một axit cacboxylic no mạch hở có công thức thực nghiệm dạng (C2H4O)n. Giá trị của n là A. 1 B. 2 C. 3 D. 4 Câu 12. Anđehit no X có công thức (C3H5O)n. Giá trị n thỏa mãn là A. 1 B. 2 C. 3 D. 4 Câu 13. Hiđrocacbon X có công thức đơn giản nhất là C3H7. Khi cho X tác dụng với Cl2 chỉ thu được 2 dẫn xuất monoclo. Thực hiện phản ứng đề hiđro từ X thì thu được tối đa bao nhiêu olefin ? A. 4 B. 3 C. 2 D. 1 Câu 14. Hai chất hữu cơ X, Y chứa các nguyên tố C, H, O và có khối lượng phân tử đều bằng 74. Biết X tác dụng được với Na; cả X, Y đều tác dụng với dung dịch NaOH và dung dịch AgNO3/NH3. Vậy X, Y có thể là A. OHC-COOH; HCOOC2H5 B. OHC-COOH; C2H5COOH C. C4H9OH; CH3COOCH3 D. CH3COOCH3; HOC2H4CHO Câu 15. Công thức đơn giản nhất của hợp chất hữu cơ X là C3H3O. Cho 5,5 gam X tác dụng với dung dịch NaOH được 7,7 gam muối Y có số nguyên tử C bằng số nguyên tử C của X. Phân tử khối của Y lớn hơn của X là 44u. Số đồng phân cấu tạo của X là A. 1 B. 2 C. 3 D. 4 Câu 16. Anđehit X có CTĐGN là C2H3O. Số công thức cấu tạo có thể có của X là A. 2 B. 3 C. 4

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. 5 Câu 17. Hợp chất X là axit no, đa chức, mạch hở, có công thức đơn giản nhất dạng CxH4Ox. Số chất thỏa mãn tính chất của X là A. 3 B. 4 C. 5 D. 6 Câu 18. Cho 0,125 mol anđehit mạch hở X phản ứng với lượng dư dung dịch AgNO3 trong NH3 thu được 27 gam Ag. Mặt khác, hiđro hóa hoàn toàn 0,25 mol X cần vừa đủ 0,5 mol H2. Dãy đồng đẳng của X có công thức chung là A. CnH2n(CHO)2 (n ≥ 0) B. CnH2n-3CHO (n ≥ 2) C. CnH2n+1CHO (n ≥ 0) D. CnH2n-1CHO (n ≥ 2) Câu 19. Cho aminoaxit no, mạch hở, có công thức CnHmO2N. Mối quan hệ giữa n với m là A. m = 2n B. m = 2n + 1 C. m = 2n + 2 D. m = 2n + 3 Câu 20. Anđehit no đơn chức mạch hở có công thức phân tử chung là A. CnH2nO2 (n ≥ 1). B. CnH2nO (n ≥ 1). C. CnH2n+2O (n ≥ 3). D. CnH2n+2O (n ≥ 1). Câu 21. Ancol no, đơn chức, mạch hở có công thức chung là A. CnH2n+1COOH (n ≥ 0). B. CnH2n+1CHO (n ≥ 0). C. CnH2n-1OH (n ≥ 3). D. CnH2n+1OH (n ≥ 1). Câu 22. Công thức chung của axit cacboxylic no, đơn chức, mạch hở là A. CnH2n+1OH. B. CnH2n+1COOH. C. CnH2n+1CHO. D. CnH2n-1COOH. Câu 23. Tỉ khối hơi của một este no, đơn chức X so với hiđro là 30. Công thức phân tử của X là A. C3H6O2. B. C5H10O2. C. C4H8O2. D. C2H4O2. Câu 24. Công thức đơn giản nhất của một hiđrocacbon là CnH2n+1. Hiđrocacbon đó thuộc dãy đồng đẳng của A. ankan. B. ankin. C. ankađien. D. anken. Câu 25. Công thức chung của amin no, đơn chức, mạch hở là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

A. CnH2n-1N (n ≥ 2). B. CnH2n-5N (n ≥ 6). C. CnH2n+1N (n ≥ 2). D. CnH2n+3N (n ≥ 1).

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B

G N Ư

O Ạ Đ

UY

.Q P T

N Ơ H

N

Vì là anđehit no, đơn chức, mạch hở nên độ bất bão hòa của X bằng số nguyên tử O

N Ầ TR

Câu 2: B Axit cacboxyl no, mạch hở:

1 3 +

0 00

B

Với Câu 3: B

H

Ta có: Các đồng phân là: Câu 4: B

Ta có: Các đồng phân este là:

Câu 5: C

Ta có:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

→n=2 Các CTCT là: Câu 12: B andehit có n nguyên tử Oxi → Độ bất bão hòa ≥n ≥n → 2 ≥n → → n = 2 ( loại n = 1 vì số hidro phải chẵn )

Câu 6: B Công thức của X : C5nH8nO3n → Độ bất bão hòa của X phải 1/2 số Oxi

X chỉ chứa liên kết pC-C trong vòng benzen

0 00

X là andehit no =>độ bội liên kết k = =>CTPT của X là C8H6O2 Các CTCT thỏa mãn là:

Í -L

-

A Ó H

P Ấ C

Câu 8: D X tác dụng nước Brom là phản ứng cộng → Cộng ít nhất là 1 phân tử Br2 → Khối lượng sản phẩm ít nhất bằng 13n + 160 Mặt khác khối lượng sản phẩm = 33n → 33n 13n + 160 → n 8 → Dựa vào đáp án → X : C8H8 Câu 9: B Độ bất bão hòa của X bằng 1/2 số Oxi = n

G N Ỡ

Ư D I Ồ B

Câu 10: A

N Á O

T

Độ bất bão hòa là 2 → =2→n=3 Câu 11: B no mạch hở → độ bất bão hòa bằng 1/2 số Oxi = n/2 →

=

Sưu tầm bởi GV. Nguyễn Thanh Tú

G N Ư

O Ạ Đ

Câu 14: A Đối với bài này, nhanh nhất là thử đáp án, chọn được A.

→ → n 2 → n = 2 ( vì số Oxi phải chẵn ) → X : C10H16O6 Câu 7: B CTTQ của X là (C4H3O)n

= n → n = 2 → X : C4H6O4

N

Câu 13: C X : C6H14 → X no X phản ứng thế Clo cho 2 dẫn xuất → X chỉ có 2 vị trí thế → X : C-C(C)-C(C)-C X đề hidro hóa : C=C(C)-C(C)-C ; C-C(C)=C(C)-C

=>9

.Q P T

UY

2

1 3 +

B

N Ầ TR

H

Câu 15: C X + NaOH → Y và số Cacbon Y bằng X → đây là phản ứng trung hòa MY - MX = 44 = 2 × ( 23 - 1 ) → X có 2 hidro của axit hoặc phenol nX = ( 7,7 - 5,5 ) : 44 = 0,05 (mol) MX = 5,5 : 0,05 = 110 → X : C6H6O2 → X là : (o,m,p) - HO-C6H4OH Câu 16: A CTTQ của X là (C2H3O)n Độ bội liên kết Mà số nguyên tử H phải chẵn =>n = 2 =>CTPT của X là C4H6O2 Các CTCT thỏa mãn:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Vậy CT chung là:

UY

X là axit no nên độ bội liên kết k =

Câu 22: B Axit cacboxylic đơn chức nên có 1 nhóm -COOH; no, mạch hở nên gốc ankyl là Vậy CT chung là:

Loại

+

N Ơ H

Câu 21: D Ancol đơn chức nên có 1 nhóm -OH; no, mạch hở nên gốc ankyl là

Câu 17: C CTTQ của X là (CxH4Ox)n

+ x=2=>n=1=>X là axit đơn chức =>Loại.

Câu 23: D

+ x=3=>n=2=>CTPT của X là C6H8O6

Câu 24: A

Các CTCT thỏa mãn:

N Ầ TR

H

Ta có: với 1 hidrocabon bất kì

0B

Vì số H phải chẵn nên

Câu 18: D là anđehit đơn chức X là anđehit không no, có 1 liên kết đôi C=C Do đó dãy đồng đẳng của X là:

Câu 19: B

Vì là aminoaxit no, mạch hở nên:

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

+3

0 0 1

Câu 25: D Amin đơn chức nên có 1 nhóm

G N Ư

O Ạ Đ

.Q P T

N

thì

hay

là ankan

; no, mạch hở nên:

T

Câu 20: B Anđehit đơn chức nên có 1 nhóm -CHO; no, mạch hở nên gốc ankyl là

I Ồ B

Nên CT là:

, viết gọn là:

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

33. Phương pháp Biện luận xác định CTPT của HCHC (Đề 2)

Câu 1. Đốt cháy hoàn toàn hợp chất hữu cơ X (phân tử chỉ chứa một loại nhóm chức, có KLPT là 46) trong không khí dư, thu được sản phẩm cháy gồm có CO2, H2O, O2 dư và N2. Số CTCT có thể có của X là A. 1 B. 2 C. 3 D. 4 Câu 2. Đốt cháy hoàn toàn hợp chất hữu cơ X (mạch hở, phân tử không chứa chức ete) trong oxi, thu được sản phẩm cháy chỉ có CO2, H2O và O2 dư. Biết tỉ khối hơi của X so với hiđro bằng 28. Số chất X có phản ứng với nước brom là A. 4 B. 5 C. 6 D. 7 Câu 3. Một hợp chất hữu cơ X mạch hở (chứa C, H, O) có khối lượng phân tử là 74. X tác dụng được với dung dịch NaOH. Số chất thoả mãn giả thiết trên là A. 3 B. 4 C. 5 D. 2 Câu 4. Số lượng hợp chất hữu cơ chứa C, H, O có khối lượng phân tử 74u, vừa có khả năng tác dụng với Na, vừa có khả năng tham gia phản ứng tráng bạc là A. 4 B. 5 C. 3 D. 2 Câu 5. Axit cacboxylic no, mạch hở X có công thức thực nghiệm (C3H4O3)n. Số đồng phân axit tối đa có thể có của X là A. 3 B. 4 C. 5 D. 6 Câu 6. Hợp chất hữu cơ X có công thức đơn giản nhất C2H5O. Số đồng phân ancol của X là A. 6 B. 7 C. 8 D. 9 Câu 7. Hiđrocacbon X có công thức thực nghiệm (C3H4)n. Biết X không làm mất màu dung dịch nước brom. Số CTCT có thể có của X là A. 8 B. 7 C. 10 D. 9

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 8. G là hợp chất hữu cơ mạch cacbon không nhánh (chứa C, H, O). Tỉ khối hơi của G so với H2 bằng 30. Khi cho 2 mol G tác dụng với Na dư thì thu được 1 mol H2. Số công thức cấu tạo của G thỏa mãn điều kiện trên A. 4 B. 3 C. 5 D. 2 Câu 9. Đốt cháy một ancol đơn chức X thu được CO2 và H2O theo tỉ lệ 6nCO2 = 5nH2O. Số đồng phân của X tác dụng với CuO cho anđehit bằng A. 2 B. 5 C. 4 D. 3 Câu 10. Chất hữu cơ X có công thức thực nghiệm là (C3H5O2)n chỉ chứa một loại nhóm chức. Đun nóng X với dung dịch NaOH dư thu được một muối của axit caboxylic Y và một ancol Z. Biết, Y có mạch cacbon không phân nhánh và không có phản ứng tráng bạc. Số công thức cấu tạo của X là A. 5 B. 3 C. 4 D. 2 Câu 11. Đốt cháy hoàn toàn hợp chất hữu cơ mạch hở X (MX = 72) trong O2, thu được sản phẩm cháy chỉ có CO2, H2O và O2 dư. Số công thức cấu tạo của X có phản ứng với AgNO3/NH3 là A. 2 B. 3 C. 4 D. 5 Câu 12. Hợp chất hữu cơ X chứa vòng benzen có CTPT là CxHyO2, trong đó oxi chiếm 25,8% về khối lượng. X tác dụng được với NaOH theo tỉ lệ mol là 1:1. Số công thức cấu tạo có thể có của X là A. 3 B. 6 C. 5 D. 4 Câu 13. Hợp chất hữu cơ X (chứa C, H, O) có tỉ khối hơi đối với H2 là 30. X có phản ứng tráng gương, số công thức cấu tạo phù hợp của X là A. 4 B. 3 C. 1 D. 2 Câu 14. Một chất hữu cơ X mạch hở, không phân nhánh, chỉ chứa C, H, O. Trong phân tử X chỉ chứa các nhóm chức có nguyên tử H linh động, X có khả năng hòa tan Cu(OH)2. Khi cho X tác dụng với Na dư thì thu được số mol H2 bằng số mol của X phản ứng. Biết X có khối lượng phân tử bằng 90 đvC. X có số công thức cấu tạo phù hợp là A. 4 B. 5 C. 6 D. 7

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 15. Hợp chất hữu cơ X mạch hở có CTPT là CxHyCl. Trong X, nguyên tố clo chiếm 46,4% về khối lượng. Số đồng phân của X là A. 2 B. 3 C. 4 D. 5 Câu 16. X là hợp chất hữu cơ, mạch hở chỉ chứa một loại nhóm chức. Đốt cháy hoàn toàn X chỉ thu được CO2 và H2O. Khi làm bay hơi hoàn toàn 4,5 gam X thu được thể tích bằng thể tích của 2,1 gam khí N2 ở cùng điều kiện. Số công thức cấu tạo của X thỏa mãn là A. 5 B. 6 C. 3 D. 4 Câu 17. Este mạch thẳng X có công thức đơn giản nhất là C3H5O2. Số đồng phân của X khi tác dụng với NaOH tạo ra một muối và một ancol là A. 5 B. 4 C. 3 D. 2 Câu 18. Cho 13,6 gam hợp chất hữu cơ X chứa C, H, O tác dụng vừa đủ với 300 ml dung dịch AgNO3 2M trong NH3 thu được 43,2 gam Ag, biết MX = 68. Nếu cho 13,6 gam X tác dụng với H2 (Ni, to) thì cần ít nhất bao nhiêu lít H2 (đktc) để chuyển hoàn toàn X thành chất hữu cơ no ? A. 13,44 lít. B. 8,96 lít. C. 4,48 lít. D. 6,72 lít. Câu 19. Hợp chất hữu cơ X có công thức đơn giản nhất là C3H6Cl; khi đun X với NaOH thu được xeton Y. Số đồng phân cấu tạo của X thỏa mãn là A. 5 B. 6 C. 7 D. 8 Câu 20. Este X không no, mạch hở, có tỉ khối hơi so với oxi bằng 2,6875. Khi X tham gia phản ứng xà phòng hoá tạo ra một anđehit và một muối của axit hữu cơ. Có bao nhiêu công thức cấu tạo phù hợp với X A. 2 B. 3 C. 4 D. 5

G N Ỡ

N Á O

T

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

I Ồ B

-L

H Í

ÓA

P Ấ C

N Ơ H

Đốt X trong k.khí → CO2, H2O, O2 dư và N2. X lại chỉ chứa 1 loại nhóm chức nên có 2 TH xảy ra: ♦ TH1: X chứa C, H, O: CxHyOz. 16 × 3 = 48 > 46 nên số O luôn ≤ 2.

UY

Với z = 1 → 12x + y = 30 ↔ C2H6 → X là C2H6O có 2 CTCT: C2H5OH và CH3OCH3.

.Q P T

N

Với z = 2 → 12x + y = 14 ↔ CH2 → X là CH2O2 có 1 CTCT HCOOH thỏa mãn.

♦ TH2: X chứa C, H, N: CxHyNz chức ở đây là amin -NH2 và M = 46 chẵn nên z phải chắn

O Ạ Đ

→ chỉ z = 2 thỏa mãn ↔ 12x + y = 18 ↔ C2H6 → X là CH2(NH2)2.

G N Ư

Vậy ∑ có 4 CTCT thỏa mãn. Câu 2: C Có M X = 28 × 2 = 56. CTPT của X là CxHyOz.

N Ầ TR

H

Ta có: 16 × 4 = 64 > 56 → z ≤ 3. ♦ z = 0 → 12x + y = 56 = 14 × 4 nên x = 4, y = 8 ↔ X là C4H8 gồm 4 chất thỏa mãn:

0 00

B

CH2=CH-CH2CH3; CH3-CH=CH-CH3 (cis-trans) và CH3C(CH3)=CH2.

2+

31

♦ z = 1 → 12x + y = 40 ↔ C3H4 → X là C3H4O ứng với 2 chất thỏa mãn:

HC≡C-CH2OH và H2C=CH-CHO (chú ý X không chứa chức ete). ♦ z = 2 ↔ 12x + y = 24 → x = 2, y = 0 → loại. ♦ z = 3 ↔ 12x + y = 8 cũng loại. Vậy ∑ chỉ có 6 chất thỏa mãn. Câu 3: C X có dạng CxHyOz. có z = 4 → 12x + y = 10 không thỏa mãn → z ≤ 3. X mạch hở tác dụng được với NaOH thì z ≥ 2. (ít nhất phải chứa -COO hoặc -COOH). Xét các TH: ♦ z = 2 → 12x + y = 42 = 14 × 3 → x = 3, y = 6. X là C3H6O2. Gồm các chất thỏa mãn là: HCOOC2H5 (1); CH3COOCH3 (2); C2H5COOH (3). ♦ z = 3 → 12x + y = 26 ↔ C2H2 → X là C2H2O3 ứng với các chất thỏa mãn là: CHO-COOH (4) (tạp chức este, andehit) và (HCO)2O (5) (anhidrit fomic) (HCO)2O + 2NaOH → 2HCOONa.

Câu 1: D

Sưu tầm bởi GV. Nguyễn Thanh Tú

Vậy ∑ có 5 chất thỏa mãn các giả thiết

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 4: C

Câu 8: A MG = 60 2 mol G tạo 1 mol H2 → G có 1 hidro linh động Các công thứccó thể có của G là : Với 1 Oxi → C3H8O → CH3CH3CH2OH ; (CH3)2CH-OH Với 2 Oxi → C2H4O2 → CH3COOH ; OHC-CH2OH

.Q P T

UY

N Ơ H

N

Câu 9: C Công thức của X : C5nH12nO → X là C5H12O → Các đồng phân ancol bậc 1 của X : C-C-C-C-C-OH ; HO-C-C(C)-C-C ; C-C(C)-C-C-OH ; (C)3C-C-OH

không có đồng phân nào tham gia phản ứng tráng bạc

O Ạ Đ

Câu 10: B X : C6H10O4 có độ bất bão hòa bằng 2 X phản ứng NaOH ra 1 muối hữu cơ và 1 ancol → X là este 2 chức của 1 axit 2 chức với 1 ancol đơn chức hoặc 1 ancol 2 chức với 1 axit đơn chức Y k phân nhánh k tráng bạc. → X có thể là : C-OOC-C-C-COO-C ; C-C-OOC-COO-C-C ; C-COO-C-C-OOC-C

Đồng phân thỏa mãn là:

Đồng phân thỏa mãn: Câu 5: C Độ bất bão hòa của X bằng 1/2 số Oxi = 3n/2 = →n=2 → → X : C6H8O6 Các công thức có thể có của X là : HOOC-C(COOH)-C-C-C-COOH ; HOOC-C-C(COOH)-C-COOH ; (HOOC)2C(C)-C-COOH ; (HOOC)2CC(C)-COOH ; (HOOC)3C-C-C

P Ấ C

Câu 6: A X có CTPT là : C4H10O2 Các đồng phân ancol của X : HO-C-C-C-C-OH ; HO-C-C-C(OH)-C ; HO-C-C(OH)-C-C ; HO-C-C(C)-C-OH ; HO-C-C(OH,C)-C ; (C)2C(OH)-C-OH

Í -L

-

A Ó H

N Ầ TR

Câu 11: D Sản phẩm gồm

3

2+

0 0 1

0B

H

G N Ư

nên X chắc chắn có C,H và có thể có O

không có đồng phân nào tác dụng được vói

Câu 7: A X không làm mất màu nước brom =>X là hidrocacbon no hoặc chứa vòng benzen.

N Á O

TH1: X là hidrocacbon no Độ bội liên kết k =

Ỡ Ư D

TH1: X chứa vòng benzen

I Ồ B

Độ bội liên kết k =

NG

T

=>5

Loại

CTPT của X là C9H12

Câu 12: B

Các CTCT thoản mãn điều kiện là:

Các CTCT thỏa mãn:

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13: D

N Ơ H

HCOO-CH2CH2CH2CH2-OOCH ; CH3COO-CH2CH2-OOCCH3 ; CH3CH2-OOC-COO-CH2CH3 ; CH3-OOC-CH2CH2COO-CH3 Câu 18: B

UY

X có liên kết 3 đầu mạch không có đồng phân nào có phản ứng tráng gương

Các CTCT thỏa mãn:

O Ạ Đ

.Q P T

N

Chú ý câu hỏi lượng H2 ít nhất để chuyển X thành chất hữu cơ no ( andehit no, rồi thành ancol no)

Câu 14: B

G N Ư

CH≡C-CH2-CHO + 2H2 → CH3-CH2-CH2-CHO. Câu 19: B

Ta có:

0 00

B

N Ầ TR

H

Các CTCT thỏa mãn là:

Câu 15: C

Các đồng phân là:

Câu 16: A

Các CTCT thỏa mãn:

I Ồ B

Ỡ Ư D

NG

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

Câu 20: A

CTCT thỏa mãn:

T

Câu 17: B X : C6H10O4 → X có độ bất bão hòa bằng 2 X là muối của axit 2 chức với ancol đơn chức hoặc của ancol 2 chức với axit đơn chức → X :

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

34. Mệnh đề tổng hợp – Đếm chất (Đề 1)

Câu 1. Cho các tơ sau: tơ xenlulozơ axetat, tơ capron, tơ nitron, tơ visco, tơ nilon-6,6. Có bao nhiêu tơ thuộc loại tơ poliamit ? A. 2 B. 1 C. 4 D. 3 Câu 2. Thí nghiệm nào sau đây chứng tỏ trong phân tử glucozơ có 5 nhóm hiđroxyl ? A. Khử hoàn toàn glucozơ thành hexan. B. Cho glucozơ tác dụng với Cu(OH)2. C. Tiến hành phản ứng tạo este của glucozơ với anhiđrit axetic. D. Thực hiện phản ứng tráng bạc. Câu 3. Phát biểu nào sau đây là sai ? A. Tripeptit Gly-Ala-Gly có phản ứng màu biure với Cu(OH)2. B. Trong phân tử đipeptit mạch hở có hai liên kết peptit. C. Protein đơn giản được tạo thành từ các gốc α-amino axit. D. Tất cả các peptit đều có khả năng tham gia phản ứng thủy phân. Câu 4. Khi nói về peptit và protein, phát biểu nào sau đây là sai ? A. Liên kết của nhóm CO với nhóm NH giữa hai đơn vị α-amino axit được gọi là liên kết peptit. B. Thủy phân hoàn toàn protein đơn giản thu được các α-amino axit. C. Protein có phản ứng màu biure với Cu(OH)2. D. Tất cả các protein đều tan trong nước tạo thành dung dịch keo. Câu 5. Phát biểu đúng là: A. Khi cho dung dịch lòng trắng trứng vào Cu(OH)2 thấy xuất hiện phức màu xanh đậm. B. Khi thuỷ phân đến cùng các protein đơn giản sẽ cho hỗn hợp các α-aminoaxit. C. Axit nucleic là polieste của axit photphoric và glucozơ. D. Enzim amilaza xúc tác cho phản ứng thuỷ phân xenlulozơ thành mantozơ. Câu 6. Phát biểu nào sau đây là đúng ? A. Tơ visco là tơ tổng hợp. B. Trùng ngưng buta-1,3-đien với acrilonitrin có xúc tác Na được cao su buna-N. C. Trùng hợp stiren thu được poli(phenol-fomanđehit). D. Poli(etylen-terephtalat) được điều chế bằng phản ứng trùng ngưng các monome tương ứng. Câu 7. Phát biểu nào sau đây là đúng ? A. Polietilen và poli(vinyl clorua) là sản phẩm của phản ứng trùng ngưng. B. Tơ visco, tơ xenlulozơ axetat đều thuộc loại tơ tổng hợp. C. Sợi bông, tơ tằm thuộc loại polime thiên nhiên. D. Tơ nilon-6,6 được điều chế từ hexametylenđiamin và axit axetic. Câu 8. Cho dãy các chất: H2NCH2COOH, C6H5NH2, C2H5NH2, CH3COOH. Số chất trong dãy phản ứng được với NaOH trong dung dịch là A. 3 B. 4 C. 1 D. 2

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 9. Cho dãy các chất: H2NCH2COOH, C6H5NH2, C2H5NH2, CH3COOH. Số chất trong dãy phản ứng được với HCl trong dung dịch là A. 3 B. 4 C. 1 D. 2 Câu 10. Cho dãy các chất: glucozơ, xenlulozơ, metyl axetat, metylamin. Số chất trong dãy tham gia phản ứng tráng bạc là A. 3 B. 4 C. 1 D. 2 Câu 11. Cho dãy các chất: CH3OH, CH3COOH, CH3CHO, CH4. Số chất trong dãy tác dụng được với Na sinh ra H2 là A. 2 B. 3 C. 4 D. 1 Câu 12. Cho dãy các chất: C2H5OH, CH3COOH, CH3CHO, C6H5OH. Số chất trong dãy tác dụng được với dung dịch NaOH là A. 4 B. 3 C. 2 D. 1 Câu 13. Cho các chất sau: CH2=CH-CH2-CH2-CH=CH2, CH2=CH-CH=CH-CH2-CH3, CH3-C(CH3)=CH-CH3, CH2=CH-CH2-CH=CH2. Số chất có đồng phân hình học là A. 3 B. 2 C. 1 D. 4 Câu 14. Cho các hợp chất sau: (b) HOCH2CH2CH2OH. (c) HOCH2-CH(OH)-CH2OH. (a) HOCH2-CH2OH. (d) CH3CH(OH)CH2OH (e) CH3-CH2OH. (f) CH3-O-CH2CH3. Các chất đều tác dụng được với Na, Cu(OH)2 là: A. (a), (b), (c). B. (c), (d), (f). C. (a), (c), (d). D. (c), (d), (e). Câu 15. Cho các chất: (1) axit picric; (2) cumen; (3) xiclohexanol; (4) 4-metylphenol; (5) 1,2-đihiđroxi-4metylbenzen; (6) α-naphtol. Các chất thuộc loại phenol là: A. (1), (3), (4), (6). B. (1), (2), (5), (6). C. (1), (2), (4), (5). D. (1), (4), (5), (6).

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 16. Dãy gồm các chất đều tác dụng với ancol etylic là: A. HBr (to), Na, CuO (to), CH3COOH (xúc tác). B. Ca, CuO (to), C6H5OH (phenol), HOCH2CH2OH. C. NaOH, K, MgO, HCOOH (xúc tác). D. Na2CO3, CuO (to), CH3COOH (xúc tác), (CH3CO)2O. Câu 17. Cho các phản ứng: 0

t HBr + C2 H 5OH  →

→ C 2 H 4 + Br2 

→ C2 H 4 + HBr 

askt (1:1) C2 H 6 + Br2 →

UY

Số phản ứng sinh ra C2H5Br là: A. 1 B. 3 C. 2 D. 4 Câu 18. Cho các hợp chất hữu cơ: (1) ankan; (2) ancol no, đơn chức, mạch hở; (3) xicloankan; (4) ete no, đơn chức, mạch hở; (5) anken; (6) ancol không no (có một liên kết đôi C=C), mạch hở; (7) ankin; (8) anđehit no, đơn chức, mạch hở; (9) axit no, đơn chức, mạch hở; (10) axit không no (có một liên kết đôi C=C), đơn chức. Số chất khi đốt cháy hoàn toàn cho số mol CO2 bằng số mol H2O là: A. 3 B. 4 C. 5 D. 6 Câu 19. Cho dãy các chất: HCHO, CH3COOH, CH3COOC2H5, HCOOH, C2H5OH, HCOOCH3. Số chất trong dãy tham gia phản ứng tráng gương là A. 3 B. 6 C. 4 D. 5 Câu 20. Cho một số tính chất: có dạng sợi (1); tan trong nước (2); tan trong nước Svayde (3); phản ứng với axit nitric đặc (xúc tác axit sunfuric đặc) (4); tham gia phản ứng tráng bạc (5); bị thuỷ phân trong dung dịch axit đun nóng (6). Các tính chất của xenlulozơ là: A. (2), (3), (4) và (5). B. (3), (4), (5) và (6). C. (1), (2), (3) và (4). D. (1), (3), (4) và (6). Câu 21. Cho dãy các chất: glucozơ, xenlulozơ, saccarozơ, tinh bột, mantozơ. Số chất trong dãy tham gia phản ứng tráng gương là A. 3 B. 4 C. 2 D. 5

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

0 00

1 3 +

N Ơ H

Câu 22. Cho các loại hợp chất: aminoaxit (X), muối amoni của axit cacboxylic (Y), amin (Z), este của aminoaxit (T). Dãy gồm các loại hợp chất đều tác dụng được với dung dịch NaOH và đều tác dụng được với dung dịch HCl là A. X, Y, Z, T. B. X, Y, T. C. X, Y, Z. D. Y, Z, T. Câu 23. Dãy gồm các chất đều có khả năng tham gia phản ứng trùng hợp là: A. stiren; clobenzen; isopren; but-1-en. B. 1,2-điclopropan; vinylaxetilen; vinylbenzen; toluen. C. buta-1,3-đien; cumen; etilen; trans-but-2-en. D. 1,1,2,2-tetrafloeten; propilen; stiren; vinyl clorua. Câu 24. Cho các loại tơ: bông, tơ capron, tơ xenlulozơ axetat, tơ tằm, tơ nitron, nilon-6,6. Số tơ tổng hợp là A. 3. B. 4. C. 2. D. 5. Câu 25. Trong các polime sau: (1) poli(metyl metacrylat); (2) polistiren; (3) nilon-7; (4) poli(etylenterephtalat); (5) nilon-6,6; (6) poli(vinyl axetat), các polime là sản phẩm của phản ứng trùng ngưng là: A. (1), (3), (6). B. (1), (2), (3). C. (1), (3), (5). D. (3), (4), (5). Câu 26. Các chất đều không bị thuỷ phân trong dung dịch H2SO4 loãng, nóng là A. tơ capron; nilon-6,6, polietilen. B. poli(vinyl axetat); polietilen, cao su buna. C. nilon-6,6; poli(etylen-terephtalat); polistiren. D. polietilen; cao su buna; polistiren. Câu 27. Các chất đều không bị thuỷ phân trong dung dịch H2SO4 loãng, nóng là A. tơ capron; nilon-6,6, polietilen. B. poli(vinyl axetat); polietilen, cao su buna. C. nilon-6,6; poli(etylen-terephtalat); polistiren D. polietilen; cao su buna; polistiren. Câu 28. Cho các polime: (1) polietilen, (2) poli(metyl metacrylat), (3) polibutađien, (4) polistiren, (5) poli(vinyl axetat) và (6) tơ nilon-6,6. Trong các polime trên, các polime có thể bị thuỷ phân trong dung dịch axit và dung dịch kiềm là: A. (2), (3), (6) B. (2), (5), (6) C. (1), (4), (5) D. (1), (2), (5) Câu 29. Cho các chất : caprolactam (1), isopropylbenzen (2), acrilonitrin (3), glyxin (4), vinyl axetat (5). Các chất có khả năng tham gia phản ứng trùng hợp tạo polime là A. (1), (2) và (3) B. (1), (2) và (5) C. (1), (3) và (5)

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

D. (3), (4) và (5) Câu 30. Cho các chất sau: phenol, khí sunfurơ, toluen, ancol benzylic, isopren, axit metacrylic, vinyl axetat, phenylamin, axit benzoic. Số chất phản ứng được với dung dịch nước brom ở nhiệt độ thường là A. 3 B. 4 C. 6 D. 5 Câu 31. Saccarozơ và glucozơ đều có A. phản ứng với dung dịch NaCl. B. phản ứng với Cu(OH)2 ở nhiệt độ thường tạo thành dung dịch xanh lam. C. phản ứng với Ag2O trong dung dịch NH3, đun nóng. D. phản ứng thuỷ phân trong môi trường axit. Câu 32. Trong thực tế, phenol được dùng để sản xuất A. nhựa poli(vinyl clorua), nhựa novolac và chất diệt cỏ 2,4-D. B. nhựa rezol, nhựa rezit và thuốc trừ sâu 666. C. poli(phenol-fomanđehit), chất diệt cỏ 2,4-D và axit picric. D. nhựa rezit, chất diệt cỏ 2,4-D và thuốc nổ TNT. Câu 33. Dãy gồm các chất đều phản ứng với phenol là: A. nước brom, anđehit axetic, dung dịch NaOH. B. dung dịch NaCl, dung dịch NaOH, kim loại Na. C. nước brom, axit axetic, dung dịch NaOH. D. nước brom, anhiđrit axetic, dung dịch NaOH. Câu 34. Trong số các phát biểu sau về phenol (C6H5OH): (1) Phenol tan ít trong nước lạnh nhưng tan nhiều trong dung dịch HCl. (2) Phenol có tính axit, dung dịch phenol không làm đổi màu quỳ tím. (3) Phenol dùng để sản xuất keo dán, chất diệt nấm mốc. (4) Phenol tham gia phản ứng thế brom và thế nitro dễ hơn benzen. Số phát biểu đúng là: A. 1 B. 2 C. 3 D. 4 Câu 35. Cho các tơ sau: tơ xenlulozơ axetat, tơ capron, tơ nitron, tơ visco, tơ nilon-6,6. Có bao nhiêu tơ thuộc loại tơ poliamit ? A. 2 B. 1 C. 4 D. 3 Câu 36. Đốt cháy hoàn toàn một lượng ancol X tạo ra 0,4 mol CO2 và 0,5 mol H2O. X tác dụng với Cu(OH)2 tạo ra dung dịch màu xanh lam. Oxi hóa X bằng CuO tạo hợp chất hữu cơ đa chức Y. Nhận xét nào sau đây đúng với X? A. X làm mất màu nước brom B. Trong X có hai nhóm –OH liên kết với hai nguyên tử cacbon bậc hai. C. Trong X có ba nhóm –CH3. D. Hiđrat hóa but-2-en thu được X.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 37. Cho phản ứng: 2C6H5-CHO + KOH → C6H5-COOK + C6H5-CH2-OH Phản ứng này chứng tỏ C6H5-CHO A. vừa thể hiện tính oxi hóa, vừa thể hiện tính khử. B. chỉ thể hiện tính oxi hóa. C. chỉ thể hiện tính khử. D. không thể hiện tính khử và tính oxi hóa. Câu 38. Mệnh đề không đúng là: A. CH3CH2COOCH=CH2 cùng dãy đồng đẳng với CH2=CHCOOCH3. B. CH3CH2COOCH=CH2 tác dụng với dung dịch NaOH thu được anđehit và muối. C. CH3CH2COOCH=CH2 tác dụng được với dung dịch Br2. D. CH3CH2COOCH=CH2 có thể trùng hợp tạo polime. Câu 39. Phát biểu đúng là: A. Phản ứng thủy phân este trong môi trường axit là phản ứng thuận nghịch. B. Phản ứng giữa axit và ancol khi có H2SO4 đặc là phản ứng một chiều. C. Tất cả các este phản ứng với dung dịch kiềm luôn thu được sản phẩm cuối cùng là muối và ancol. D. Khi thủy phân chất béo luôn thu được C2H4(OH)2. Câu 40. Phát biểu nào sau đây sai ? A. Nhiệt độ sôi của este thấp hơn hẳn so với ancol có cùng phân tử khối. B. Trong công nghiệp có thể chuyển hoá chất béo lỏng thành chất béo rắn. C. Số nguyên tử hiđro trong phân tử este đơn và đa chức luôn là một số chẵn. D. Sản phẩm của phản ứng xà phòng hoá chất béo là axit béo và glixerol. Câu 41. Phát biểu không đúng là A. Dung dịch mantozơ tác dụng với Cu(OH)2 khi đun nóng cho kết tủa Cu2O. B. Sản phẩm thủy phân xenlulozơ (xúc tác H+, to) có thể tham gia phản ứng tráng gương. C. Thủy phân (xúc tác H+, to) saccarozơ cũng như mantozơ đều cho cùng một monosaccarit. D. Dung dịch fructozơ hoà tan được Cu(OH)2. Câu 42. Este X có các đặc điểm sau: - Đốt cháy hoàn toàn X tạo thành CO2 và H2O có số mol bằng nhau; - Thuỷ phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z (có số nguyên tử cacbon bằng một nửa số nguyên tử cacbon trong X). Phát biểu không đúng là: A. Chất X thuộc loại este no, đơn chức. B. Đốt cháy hoàn toàn 1 mol X sinh ra sản phẩm gồm 2 mol CO2 và 2 mol H2O. C. Chất Y tan vô hạn trong nước. D. Đun Z với dung dịch H2SO4 đặc ở 170oC thu được anken. Câu 43. Phát biểu nào sau đây không đúng ? A. Glucozơ tác dụng được với nước brom. B. Khi glucozơ ở dạng vòng thì tất cả các nhóm OH đều tạo ete với CH3OH. C. Glucozơ tồn tại ở dạng mạch hở và dạng mạch vòng. D. Ở dạng mạch hở, glucozơ có 5 nhóm OH kề nhau. Câu 44. Phát biểu nào sau đây là đúng ? A. Saccarozơ làm mất màu nước brom. B. Xenlulozơ có cấu trúc mạch phân nhánh. C. Amilopectin có cấu trúc mạch phân nhánh. D. Glucozơ bị khử bởi dd AgNO3 trong NH3.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 45. Phát biểu nào sau đây là sai? A. Cao su buna-N thuộc loại cao su thiên nhiên. B. Lực bazơ của anilin yếu hơn lực bazơ của metylamin. C. Chất béo còn được gọi là triglixerit hoặc triaxylglixerol. D. Poli(metyl metacrylat) được dùng để chế tạo thủy tinh hữu cơ. Câu 46. Phát biểu đúng là: A. Các chất etilen, toluen và stiren đều tham gia phản ứng trùng hợp. B. Tính bazơ của anilin mạnh hơn của amoniac. C. Cao su thiên nhiên là sản phẩm trùng hợp của isopren. D. Tính axit của phenol yếu hơn của ancol. Câu 47. Phát biểu đúng là A. Phenol phản ứng được với dung dịch NaHCO3. B. Phenol phản ứng được với nước brom. C. Vinyl axetat phản ứng với dung dịch NaOH sinh ra ancol etylic. D. Thuỷ phân benzyl clorua thu được phenol. Câu 48. Phát biểu nào sau đây là đúng ? A. Các ancol đa chức đều phản ứng với Cu(OH)2 tạo dung dịch màu xanh lam. B. Etylamin phản ứng với axit nitrơ ở nhiệt độ thường, sinh ra bọt khí. C. Benzen làm mất màu nước brom ở nhiệt độ thường. D. Anilin tác dụng với axit nitrơ khi đun nóng, thu được muối điazoni. Câu 49. Phát biểu không đúng là: A. Axit axetic phản ứng với dung dịch NaOH, lấy dung dịch muối vừa tạo ra cho tác dụng với khí CO2 lại thu được axit axetic. B. Phenol phản ứng với dung dịch NaOH, lấy muối vừa tạo ra cho tác dụng với dung dịch HCl lại thu được phenol. C. Anilin phản ứng với dd HCl, lấy muối tạo ra cho tác dụng với dd NaOH lại thu được anilin. D. Dung dịch natri phenolat phản ứng với khí CO2, lấy kết tủa vừa tạo ra cho tác dụng với dung dịch NaOH lại thu được natri phenolat. Câu 50. Phát biểu đúng là: A. Enzim amilaza xúc tác cho phản ứng thủy phân xenlulozơ thành mantozơ. B. Khi thủy phân đến cùng các protein đơn giản sẽ cho hỗn hợp các α-aminoaxit. C. Khi cho dung dịch lòng trắng trứng vào Cu(OH)2 thấy xuất hiện phức màu xanh đậm. D. Axit nucleic là polieste của axit photphoric và glucozơ. Câu 51. Phát biểu nào sau đây là đúng ? A. Xenlulozơ tan tốt trong nước và etanol. B. Hiđro hóa hoàn toàn glucozơ (xúc tác Ni, đun nóng) tạo ra sobitol. C. Saccarozơ có khả năng tham gia phản ứng tráng bạc. D. Thủy phân hoàn toàn tinh bột trong dung dịch H2SO4 đun nóng, tạo ra fructozơ. Câu 52. Dãy các chất đều phản ứng được với Cu(OH)2 ở điều kiện thường là A. Etylen glicol, glixerol và ancol etylic B. Glixerol, glucozơ và etyl axetat. C. Glucozơ, glixerol và saccarozơ D. Glucozơ, glixerol và metyl axetat Câu 53. Dãy gồm các chất được sắp xếp theo thứ tự tăng dần lực bazơ từ trái sang phải là A. Etylamin, amoniac, phenylamin.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

B. Phenylamin, amoniac, etylamin. C. Etylamin, phenylamin, amoniac. D. Phenylamin, etylamin, amoniac. Câu 54. Số đồng phân chứa vòng benzen, có công thức phân tử C7H8O, phản ứng được với Na là A. 4 B. 2 C. 3 D. 5 Câu 55. Đốt cháy hoàn toàn một amin đơn chức X trong khí oxi dư, thu được khí N2; 13,44 lít khí CO2 (đktc) và 18,9 gam H2O. Số công thức cấu tạo của X là A. 2 B. 4 C. 1 D. 3 Câu 56. Số đồng phân cấu tạo, mạch hở ứng với công thức phân tử C4H6 là A. 3 B. 2 C. 5 D. 4 Câu 57. Khi xà phòng hóa triglixerit X bằng dung dịch NaOH dư, đun nóng, thu được sản phẩm gồm glixerol, natri oleat, natri stearat và natri panmitat. Số đồng phân cấu tạo thỏa mãn tính chất trên của X là A. 2. B. 1. C. 3. D. 4. Câu 58. Hợp chất X có công thức phân tử C5H8O2, khi tham gia phản ứng xà phòng hóa thu được một anđehit và một muối của axit cacboxylic. Số đồng phân cấu tạo thỏa mãn tính chất trên của X là A. 4. B. 3. C. 5. D. 2. Câu 59. Dãy các chất đều có khả năng tham gia phản ứng thủy phân trong dung dịch H2SO4 đun nóng là A. saccarozơ, tinh bột và xenlulozơ. B. fructozơ, saccarozơ và tinh bột. C. glucozơ, tinh bột và xenlulozơ. D. glucozơ, saccarozơ và fructozơ. Câu 60. Ứng với công thức phân tử C4H10O có bao nhiêu ancol là đồng phân cấu tạo của nhau ? A. 2 B. 4 C. 5 D. 3 Câu 61. Có các dd: NH2-CH2-CH(NH2)-COOH, HOOC-CH2-CH2-CH(NH2)-COOH, CH3-CH2-NH2, NH2-CH2COOH, số dung dịch làm xanh màu quỳ tím là A. 1 B. 2

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. 4 D. 3 Câu 62. Các chất trong dãy nào sau đây đều tạo kết tủa khi cho tác dụng với AgNO3 trong NH3 dư, đun nóng? A. vinylaxetilen, glucozơ, axit propionic. B. vinylaxetilen, glucozơ, đimetylaxetilen. C. glucozơ, đimetylaxetilen, anđehit axetic. D. vinylaxetilen, glucozơ, anđehit axetic. Câu 63. Trong các polime: tơ tằm, sợi bông, tơ visco, tơ nilon-6, tơ nitron, những polime có nguồn gốc xenlulozơ là A. tơ visco và tơ nilon-6 B. sợi bông và tơ visco C. sợi bông, tơ visco và tơ nilon-6 D. tơ tằm, sợi bông và tơ nitron. Câu 64. Phát biểu nào sau đây không đúng ? A. Các chất béo thường không tan trong nước và nhẹ hơn nước. B. Chất béo bị thủy phân khi đun nóng trong dung dịch kiềm. C. Chất béo là trieste của etylenglicol với các axit béo. D. Triolein có khả năng tham gia phản ứng cộng hiđro khi đun nóng có xúc tác Ni. Câu 65. Cho các phát biểu sau: (a) Số nguyên tử cacbon của chất béo là số lẻ; (b) Phản ứng xà phòng hóa chất béo là phản ứng một chiều; (c) Nguyên nhân của hiện tượng dầu mỡ động thực vật để lâu bị ôi thiu là do nối đôi C=O bị oxi hóa chậm bởi oxi không khí tạo thành sản phẩm có mùi khó chịu; (d) Trong công nghiệp, một lượng lớn chất béo dùng điều chế xà phòng, glixerol và chế biến thực phẩm; (e) Lipit bao gồm chất béo, sáp, gluxit và photpholipit. Số phát biểu đúng là A. 3 B. 2 C. 4 D. 1 Câu 66. Số đồng phân amin bậc một, chứa vòng benzen, có cùng công thức phân tử C7H9N là A. 4 B. 2 C. 5 D. 3 Câu 67. Trong các chất: stiren, axit acrylic, axit axetic, vinylaxetilen và butan. Số chất có khả năng tham gia phản ứng cộng hiđro (xúc tác Ni, đun nóng) là A. 4 B. 2 C. 3 D. 5 Câu 68. Cho các phát biểu sau: (a) Dung dịch trong nước không làm đổi màu quỳ tím. (b) Tạo kết tủa trắng khi phản ứng với dung dịch brom. (c) Nguyên tử H (trong vòng) dễ bị thay thế hơn nguyên tử H của benzen.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

(d) Để điều chế từ benzen cần ít nhất 3 phản ứng. Số phát biểu đúng cho cả phenol và anilin là A. 1 B. 2 C. 3 D. 4 Câu 69. Cho các phát biểu sau về cacbohiđrat: (a) Khi đun nóng fructozơ với Cu(OH)2/NaOH thu được kết tủa Cu2O (b) Fructozơ và saccarozơ đều là chất rắn có vị ngọt, dễ tan trong nước. (c) Glucozơ và fructozơ đều tác dụng với H2 (xúc tác Ni, đun nóng) tạo sobitol. (d) Trong dung dịch, glucozơ và saccarozơ đều hòa tan Cu(OH)2 tạo phức màu xanh lam. (e) Tinh bột và xenlulozơ đều là polisaccarit, khi đun với dung dịch H2SO4 loãng thì sản phẩm thu được đều có phản ứng tráng gương. (g) Khi thủy phân hoàn toàn hỗn hợp gồm xenlulozơ và saccarozơ trong môi trường axit, chỉ thu được một loại monosaccarit duy nhất. Số phát biểu đúng là: A. 5 B. 3 C. 6 D. 4 Câu 70. Có các phát biểu sau: (1) Muối phenylamoni clorua không tan trong nước. (2) Tất cả các peptit đều có phản ứng màu biure. (3) H2N-CH2-CH2-CO-NH-CH2-COOH là một đipeptit. (4) Ở điều kiện thường, CH5N và C2H7N là những chất khí có mùi khai. Số phát biểu đúng là: A. 1 B. 2 C. 3 D. 4 Câu 71. Cho các chất: axit glutamic, saccarozơ, metylamoni clorua, vinyl axetat, phenol, glixerol, Gly-Gly. Số chất tác dụng với dung dịch NaOH loãng, nóng là A. 3 B. 4 C. 6 D. 5 Câu 72. Cho các chất sau: etilen, axetilen, phenol (C6H5OH), buta-1,3-đien, toluen, anilin. Số chất làm mất màu nước brom ở điều kiện thường là A. 3 B. 5 C. 4 D. 2 Câu 73. Phản ứng hoá học nào sau đây không xảy ra ? A. 2C2H5OH + 2Na → 2C2H5ONa + H2. B. 2CH3COOH + 2Na →2CH3COONa + H2.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. C6H5OH + CH3COOH → CH3COOC6H5 + H2O. D. CH3COOH + NaOH → CH3COONa + H2O. Câu 74. Khi nói về protein, phát biểu nào sau đây sai? A. Protein có phản ứng màu biure. B. Tất cả các protein đều tan trong nước tạo thành dung dịch keo. C. Protein là những polipeptit cao phân tử có phân tử khối từ vài chục nghìn đến vài triệu. D. Thành phần phân tử của protein luôn có nguyên tố nitơ. Câu 75. Trong các chất: phenol, etyl axetat, ancol etylic, axit axetic; số chất tác dụng được với dung dịch NaOH là A. 3 B. 1 C. 2 D. 4 Câu 76. Cho dãy các chất: CH3OH, CH3COOH, CH3COOCH3, CH3CHO, C6H5OH. Số chất trong dãy tác dụng được với Na sinh ra H2 là A. 5 B. 2 C. 3 D. 4 Câu 77. Cho dãy các chất: CH3COOCH3, C2H5OH, H2NCH2COOH, CH3NH2. Số chất trong dãy phản ứng được với dung dịch NaOH là A. 2 B. 3 C. 4 D. 1 Câu 78. Cho dãy các chất: H2NCH(CH3)COOH, C6H5OH (phenol), CH3COOC2H5, C2H5OH, CH3NH3Cl. Số chất trong dãy phản ứng với dung dịch KOH đun nóng là A. 4 B. 2 C. 3 D. 1 Câu 79. Cho dãy các dung dịch sau: NaOH, NaHCO3, HCl, NaNO3, Br2. Số dung dịch trong dãy phản ứng được với Phenol là A. 2 B. 3 C. 4 D. 1 Câu 80. Cho dãy các chất: m-CH3COOC6H4CH3; m-HCOOC6H4OH; ClH3NCH2COONH4; p-C6H4(OH)2; pHOC6H4CH2OH; H2NCH2COOCH3; CH3NH3NO3. Số chất trong dãy mà 1 mol chất đó phản ứng tối đa được với 2 mol NaOH là A. 2 B. 3 C. 5 D. 4

D I BỒ

ƯỠ

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

P Ấ C

2

ĐÁP ÁN & LỜI GIẢI CHI TIẾT

UY

Câu 1: A Các tơ thuộc tơ poliamit: tơ capron và tơ nilo-6,6

.Q P T

Câu 2: C Tiến hành phản ứng tạo este của glucozo với anhidrit axetic thu được este chứa 5 gốc tử glucozo có 5 nhóm hidroxyl

G N Ư

O Ạ Đ

N Ơ H

N

nên trong phân

Câu 3: B B sai, trong phân tử đipeptit mạch hở chỉ có một liên kết peptit

H

Câu 4: D D sai, do chỉ có protein hình cầu tan trong nước tạo thành dung dịch keo, còn protein hình sợi hoàn toàn không tan trong

0 00

1 3 +

N Ầ TR

B

nước.

Câu 5: B A sai, khi cho lòng trắng trứng vào

B đúng, còn thủy phân protein phức tạp được

thấy xuất hiện phức màu tím aminoaxit và thành phần "phi protein"

C sai, axit nucleic là polieste của axit photphoric và pentozo D sai, enzim amilaza xúc tác cho phản ứng thủy phân tinh bột thành mantozo

Câu 6: D A sai, tơ visco là tơ bán tổng hợp B sai, trùng hợp buta-1,3-đien với acrilonitrin có xúc tác Na được cao su buna-N C sai, trùng hợp stiren thu được polistiren D đúng, poli(etylen-terephtalat) được điều chế bằng phản ứng trùng ngưng giữa etylenglicol và axit terephtalic

Câu 7: C A sai vì polietilen và poli(vinyl clorua) là sản phẩm của phản ứng trùng hợp B sai, tơ visco, tơ xenlulozo axetat đều thuộc tơ bán tổng hợp

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

không tác dụng với ancol etylic

B, C, D do C đúng

Câu 17: B D sai, tơ nilon-6,6 được điều chế từ hexametylenđiamin và axit ađipic

UY

Câu 8: D Các chất phản ứng được với NaOH là: Câu 9: A Các chất phản ứng được với HCl trong dung dịch là: Câu 10: C Chỉ có glucozo tham gia phản ứng tráng bạc Câu 11: A Các chất tác dụng với Na sinh ra H2 là

Có 3 phản ứng tạo ra

Câu 12: C Các chất tác dụng được với dung dịch NaOH là:

Câu 15: D Các chất thuộc loại phenol là: (1) axit picric

H Í

(4) 4-metylphenol

Ư D I Ồ B

0 00

có 2 hoặc nhiều hơn nhóm OH kề nhau

naphtol

Câu 16: A Các chất tác dụng với ancol etylic là:

G N Ỡ

H

là:

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

B

(9) axit no, đơn chức, mạch hở

có đồng phân hình học

(5) 1,2-đihidroxi-4-metylbenzen và

N Ầ TR

bằng số mol

(3) xicloankan, (5) anken, (6) ancol không no(có một liên kết đôi C=C),mạch hở, (8) anđehit no, đơn chức, mạch hở,

Câu 13: C Chỉ có Câu 14: C Các chất tác dụng được với

G N Ư

Câu 18: C Chất khí đốt cháy hoàn toàn cho số mol

O Ạ Đ

.Q P T

N

ÓA

P Ấ C

2

1 3 +

Câu 19: A Các chất trong dãy tham gia phản ứng tráng gương là:

Câu 20: D (2) sai do xenlulozo không tan trong nước (5) sai do xenlulozo không tham gia phản ứng tráng bạc (1),(3),(4),(6) là các tính chất của xenlulozo

Câu 21: C Các chất tham gia phản ứng tráng gương là: glucozo và mantozo Câu 22: B Các châts tác dụng được với dung dịch NaOH và HCl: aminoaxit(X) axit cacboxylic(Y)

, muối amoni của

và este của aminoaxit(T)

Câu 23: D Các chất đều có khả năng tham gia phản ứng trùng hợp là: 1,2,2,2-tetrafloeten, propilen, stiren và vinyl clorua do có liên

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

kết đôi. C sai, chỉ có glucozo phản ứng với

Câu 24: A Tơ tổng hợp là: tơ capron, tơ nitron và tơ nilon-6,6

, đun nóng

UY

bông và tơ tằm là tơ thiên nhiên tơ xenlulozo axetat là tơ bán tổng hợp Câu 25: D Polime: (1) poli(metyl metacrylat), (2) polistiren và (6) poli(vinyl axetat) là sản phẩm của phản ứng trùng hợp

(SGK 11 NC trang 232)

B sai, do poli(vinyl axetat) bị thủy phân C sai, do nilon-6,6; poli(etylen-terephtalat) bị thủy phân Câu 27: D A sai, do tơ capron, nilon-6,6 bị thủy phân

0 00

B sai, do poli(vinyl axetat) bị thủy phân C sai, do nilon-6,6; poli(etylen-terephtalat) bị thủy phân

P Ấ C

2

Câu 28: B Polime bị thủy phân trong dung dịch axit và kiềm có bản chất là este hay poliamit: (2) poli(metyl metacrylat),

H Í

(5) poli(vinyl axeat) và (6) tơ nilon-6,6

-L

ÓA

Câu 29: C Chất có khả năng tham gia phản ứng trùng hợp tạo polime là: (1) caprolactam, (3) acrilonitrin và vinyl axetat(5) do có liên

N Á O

D I BỒ

Sưu tầm bởi GV. Nguyễn Thanh Tú

H

A, B, C sai vì anđehit axetic, dd NaCl và axit axetic không tác dụng với phenol Câu 34: C (1) sai, phenol tan ít trong nước lạnh cũng như trong dung dịch HCl, tan vô hạn ở 66oC, tan tốt trong etanol, axeton,.. (2) đúng, dung dịch phenol có tính axit rất yếu, không làm đổi màu quỳ tím (3) đúng (4) đúng, do hiệu ứng liên hợp giữa vòng benzen và nhóm -OH Câu 35: A Các tơ thuộc loại tơ poliamit: tơ capron và tơ nilon-6,6

X tác dụng với

tạo ra dung dịch màu xanh lam nên X có 2 hoặc nhiều hơn nhóm OH gần nhau

, isopren,

axit metacrylic, vinyl axetat và phenylamin (anilin) Câu 31: B ở nhiệt độ thường tạo thành dung dịch xanh lam. Saccarozo và glucozo đều phản ứng với A sai, do cả 2 không phản ứng với dung dịch NaCl

1 3 +

B

N Ầ TR

Câu 36: B

T

Câu 30: C Các chất phản ứng được với dung dịch nước brom ở nhiệt độ thường: phenol, khí sunfurơ

ƯỠ

G N Ư

O Ạ Đ

Câu 33: D Phenol tác dụng được với nước brom, anhidrit axetic và dung dịch NaOH

Câu 26: D A sai, do tơ capron, nilon-6,6 bị thủy phân

NG

.Q P T

axit picric), chất kích thích sinh trưởng thực vật, chất diệt cỏ 2,4-D,chất diệt nấm mốc, chất trừ sâu bọ,..

(3)nilon-7, (4) poli(etylen-terephtalat) và (5) nilon-6,6 là sản phẩm của phản ứng trùng ngưng

kết đôi hoặc vòng

N

D sai, chỉ có saccarozo thủy phân trong môi trường axit Câu 32: C Phenol được dùng sản xuất poli(phenol-fomanđehit), điều chế dược phẩm, phẩm nhuộm, thuốc nổ (2,4,6trinitrophenol-

Oxi hóa X bằng CuO tạo HCHC đa chức Y nên 2 nhóm OH cùng bậc C Do đó X là: A sai do X không làm mất màu nước brom

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

B đúng

cacbon bằng

A sai, X có 2 nhóm –CH3

một nửa số nguyên tử cacbon trong X) nên X là:

D sai, hidart hóa but-2-en chỉ thu được butan-2-ol

A đúng

Câu 37: A

B đúng

UY

C đúng, HCOOH tan vô hạn trong nước D sai, đun Do đó

với dung dịch

vừa thể hiện tính oxi hóa, vừa thể hiện tính khử

O Ạ Đ

.Q P T

N Ơ H

N

ở 170oC không thu được anken

G N Ư

Câu 43: B A đúng, glucozo và mantozo tác dụng được với nước brom

Câu 38: A A sai,

không cùng dãy đồng đẳng với

N Ầ TR

H

B sai, khi glucozo ở dạng vòng thì chỉ có nhóm OH hemiaxetal tạo ete với

Câu 39: A A đúng

C,D đúng

0 00

B sai, là phản ứng thuận nghịch C sai, este phản ứng với dung dịch kiềm ngoài sản phẩm cuối cùng là muối và ancol, hoặc thu được anđehit, xeton hay là muối D sai, khi thủy phân chất béo luôn thu được glixerol

Câu 40: D A đúng, do ancol có liên kết hidro

-L

H Í

ÓA

P Ấ C

B đúng, chuyển hóa chất béo lỏng thành chất béo rắn bằng cách hidro hóa chất béo lỏng

N Á O

C đúng

D sai, sản phẩm của phản ứng xà phòng hóa chất béo là muối của axit béo và glixerol

NG

T

Câu 41: C C không đúng do thủy phân (xúc tác H^+, t^o), saccarozo thu được glucozo và frutozo, còn mantozo chỉ thu được glucozo Câu 42: D Đốt cháy hòa toàn X tạo thành CO2 và H2 O có số mol bằng nhau nên X là este no, đơn chức, mạch hở

I Ồ B

Ỡ Ư D

B

Chọn B

2

1 3 +

Câu 44: C A sai, saccarozo không tác dụng được với nước brom

B sai, xenlulozo có cấu trúc mạch không phân nhánh C đúng, amilopectin có cấu trúc mạch phân nhánh, amilozo mạch không phân nhánh D sai, glucozo bị oxi hóa bởi dung dịch

Câu 45: A A sai, cao su buna-N là polime tổng hợp, được tạo bởi phản ứng đồng trùng hợp giữa buta-1,3-đien và vinyl xianua

Câu 46: C A sai, toluen không tham gia phản ứng trùng hợp B sai, tính bazo của anilin yếu hơn amoniac C đúng D sai, tính axit của phenol mạnh hơn của ancol Câu 47: B

Thủy phân X trong môi trường axit được chất Y (tham gia phản ứng tráng gương) và chất Z(có số nguyên tử

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Câu 53: B ; R càng đẩy e thì tính bazo càng tăng

A sai, phenol không phản ứng với dung dịch B đúng, phenol phản ứng được với nước brom thu được kết tủa màu trắng

Khả năng đẩy e:

UY

C sai, vinyl axetat phản ứng với dung dịch NaOH sinh ra anđehit axetic Do đó lực bazo tăng dần: phenylamin < amoniac < etylamin D sai, thủy phân benzyl clorua thu được ancol benzylic

Câu 54: A Đồng phân chứa vòng benzen, có CTPT

Câu 48: B A sai, ancol có 2 hay nhiều nhóm OH kề nhau mới phản ứng với

tạo dung dịch màu xanh lam

B đúng,

Câu 55: A C sai, benzen không làm mất màu nước brom ở nhiệt độ thường D sai, anilin tác dụng với axit nitro làm lạnh mới thu được muối điazoni

Câu 49: A A sai do không phản ứng được với muối

để tạo axit axetic do axit

yếu hơn axit

0 00

B

N Ầ TR

H

G N Ư

.Q P T

N

phản ứng được với Na là:

O Ạ Đ

CTCT của X:

Câu 50: B A sai, enzim amilaza xúc tác cho phản ứng thủy phân tinh bột thành mantozo B đúng C sai, cho loàng trắng trứng vào

thấy xuất hiện phức màu tím

A Ó H

D sai, axit nucleic là polieste của axit photphoric và pentozo(monosaccarit có 5C) Câu 51: B A sai, xenlulozo không tan trong nước hay etanol B đúng,

N Á O

(sobitol)

T

Í -L

-

C sai, saccarozo không có khả năng tham gia phản ứng tráng bạc

NG

D sai, thủy phân hoàn toàn tinh bột trong dung dịch

Ỡ Ư D

Câu 52: C Glucozo, glixerol và saccarozo đều phản ứng được với

I Ồ B

đun nóng, tạo ra glucozo

2

Câu 57: C Có 3 CTCT thỏa mãn là CH2(OCOC17H33)-CH(OCOC17H35)-CH2(C15H31), CH2(OCOC17H33)CH(OCOC15H31)-CH2(C17H35), CH2(OCOC17H35)-CH(OCOC17H33)-CH2(C15H31) Câu 58: A Hợp chất X có CTPT C5H8O2. Có 4 CTCT của X thỏa mãn là HCOOCH=CH-CH2CH3, HCOOCH=C(CH3)2, CH3COOCH=CH-CH3, CH3CH2COOCH=CH2 Câu 59: A Điissaccarit(saccarozo, mantozo), polisaccarit(tinh bột và xenlulozo) có khả năng tham gia phản ứng thủy phân trong

ở điều kiện thường

A,B và D sai do ancol etylic, etyl axetat và metyl axetat không tác dụng được

Sưu tầm bởi GV. Nguyễn Thanh Tú

P Ấ C

1 3 +

Câu 56: D Đồng phân cấu tạo, mạch hở ứng với CTPT C4H6 là:

dung dịch

đun nóng

Câu 60: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn Đồng phân ancol của

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Các chất có khả năng tham gia phản hứng cộng hidro(xúc tác Ni, đun nóng là): stiren, axit acrylic và vinylaxetilen

là:

N

Câu 68: D (a) Đúng, phenol có tính axit rất yếu, còn anilin có tính bazo rất yếu nên không làm đổi màu quỳ tím Câu 61: B Các dung dịch làm xanh màu quỳ tím: Câu 62: D Chất tác dụng với

UY

.Q P T

(b) Đúng, cả phenol và anilin đều tác dụng với dung dịch brom tạo kết tủa trắng và

(c) Đúng, do hiệu ứng liên hợp của vòng với nhóm –OH hay –NH2 nên nguyên tử của H trong vòng dễ bị thay thế , đun nóng tạo kết tủa là: vinylaxetilen, glucozo và anđehit axetic hơn nguyên tử H của benzen tạo kết tủa

A,B,C sai do axit propionic, đimetylaxetilen không tác dụng với

(d) Đúng, đều chế phenol:

Câu 63: B Sợi bông và tơ visco đều có nguồn gốc xenlulozo

N Ầ TR

đều chế phenol: Câu 69: A (a) Đúng

tơ nilon-6, tơ nitron là tơ tổng hợp

0 00

B

(b) Đúng

tơ tằm là polime thiên nhiên, có bản chất là protein

Câu 64: C C sai, chất béo là trieste của glixerol với các axit béo

P Ấ C

2

Câu 65: A (a) Đúng: do số nguyên tử C của axit béo luôn chẵn nên nhân 3 được số chẵn, cộng với 3C của glixerol được số lẻ (b) Đúng

Í -L

-

A Ó H

1 3 +

H

G N Ư

O Ạ Đ

(c) Đúng (d) Đúng

(e) Đúng, khi thủy phân tinh bột và xenlulozo đều thu được glucozo, có phản ứng tráng gương (g) sai, khi thủy phân hỗn hợp xenlulozo và saccarozo trong môi trường axit thu được glucozo và fructozo

Câu 70: A (1) Sai, muối phenylamoni clorua tan được trong nước

(c) Sai, nối đôi C=C ở gốc axit không no của axit béo bị oxi hóa chậm bởi oxi không khí tạo thành peoxit, chất này bị phân

(2) Sai, đipeptit không có phản ứng màu biure, peptit có từ 2 liên kết peptit mới có phản ứng màu biure

hủy thành các sản phẩm có mùi khó chịu.

(3) Sai, không phải là đipeptit do

(d) Đúng

G N Ỡ

N Á O

T

(e) Sai, Lipit bao gồm chất béo, sáp, steroit, photpholipit,.. chứ không gồm gluxit Câu 66: A Đồng phân amin bậc một chứa vòng benzen, có CTPT là:

Ư D I Ồ B

Câu 67: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

không phải là α- amino axit

(4) Đúng

Câu 71: D Số chất tác dụng với dung dịch NaOH loãng, nóng là axit glutamic, metylamoni clorua, vinyl axetat, phenol, Gly-Gly → Có 5 chất Câu 72: B Các chất làm mất màu nước brom ở điều kiện thường là: etilen, axetilen, phenol, buta-1,3-đien và anilin(5) Câu 73: C

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn không phản ứng với

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

do đều có tính axit

Nên để điều chế thì người ta cho tác dụng với có xúc tác Câu 74: B B sai, chỉ có protein hình cầu tan trong nước tạo thành dung dịch keo, còn protein hình sợi hoàn toàn không tan trong

UY

nước.

Câu 75: A Các chất tác dụng được với dung dịch NaOH là: phenol, etyl axetat và axit axetic Câu 76: C Các chất tác dụng được với Na sinh ra Câu 77: A Chất phản ứng được với dung dịch NaOH là: Câu 78: A Các chất phản ứng với dung dịch KOH đun nóng là:

Câu 79: A Các dung dịch phản ứng được với phenol là:

NG

N Á O

N Ơ H

tác dụng với tỉ lệ 1:1

0 00

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

T

Câu 80: B Các chất trong dãy mà 1 mol chất đó phản ứng tối đa được với 2 mol NaOH là:

I Ồ B

Ỡ Ư D

tác dụng với tỉ lệ 1:3

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com Câu 8. Hiđro hoá chất hữu cơ X thu được (CH3)2CHCH(OH)CH3. Chất X có tên thay thế là A. 2-metylbutan-3-on. B. metyl isopropyl xeton. C. 3-metylbutan-2-ol. D. 3-metylbutan-2-on.

35. Phương pháp Biện luận xác định CTCT của hợp chất hữu cơ (Đề 1)

Câu 1. Số đồng phân thơm có công thức phân tử C8H10O, không tác dụng với NaOH nhưng tác dụng với Na là A. 4 B. 5 C. 2 D. 3 Câu 2. Số đipeptit tối đa có thể tạo ra từ một hỗn hợp gồm alanin và glyxin là A. 3 B. 1 C. 2 D. 4 Câu 3. Số đồng phân amin bậc một, chứa vòng benzen, có cùng công thức phân tử C7H9N là A. 4 B. 2 C. 5 D. 3 Câu 4. Cho 0,25 mol một anđehit mạch hở X phản ứng với lượng dư AgNO3 trong dung dịch NH3, thu được 54 gam Ag. Mặt khác, khi cho X phản ứng với H2 dư (xúc tác Ni, to) thì 0,125 mol X phản ứng hết với 0,25 mol H2. Chất X có công thức ứng với công thức chung là A. CnH2n(CHO)2 (n ≥ 0). B. CnH2n + 1CHO (n ≥ 0). C. CnH2n - 1CHO (n ≥ 2). D. CnH2n - 3 CHO (n ≥ 2). Câu 5. Hợp chất hữu cơ mạch hở X có công thức phân tử C6H10O4. Thuỷ phân X tạo ra hai ancol đơn chức có số nguyên tử cacbon trong phân tử gấp đôi nhau. Công thức của X là A. CH3OCO-CH2-COOC2H5. B. C2H5OCO-COOCH3. C. CH3OCO-COOC3H7. D. CH3OCO-CH2-CH2-COOC2H5. Câu 6. Cho chất X tác dụng với một lượng vừa đủ dung dịch NaOH, sau đó cô cạn dung dịch thu được chất rắn Y và chất hữu cơ Z. Cho Z tác dụng với AgNO3 trong dung dịch NH3 thu được chất hữu cơ T. Cho chất T tác dụng với dung dịch NaOH lại thu được chất Y. Chất X có thể là A. HCOOCH3. B. HCOOCH=CH2. C. CH3COOCH=CH-CH3. D. CH3COOCH=CH2. Câu 7. Thuỷ phân chất hữu cơ X trong dung dịch NaOH (dư), đun nóng, thu được sản phẩm gồm 2 muối và ancol etylic. Chất X là A. CH3COOCH2CH3. B. CH3COOCH2CH2Cl. C. CH3COOCH(Cl)CH3. D. ClCH2COOC2H5.

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

0

UY

N

+ H 2 ( du ),t , Ni + NaOH du,t + HCl → X  →  →Z Câu 9. Cho sơ đồ: Triolein  Tên của Z là A. axit oleic. B. axit linoleic. C. axit stearic. D. axit panmitic. Câu 10. Hai hợp chất X, Y có cùng công thức phân tử C4H7ClO2 tác dụng với dung dịch NaOH thu được các sản phẩm sau: X + NaOH → muối hữu cơ X1 + C2H5OH + NaCl Y + NaOH → muối hữu cơ X2 + C2H4(OH)2 + NaCl Công thức cấu tạo có thể của X, Y lần lượt là: A. CH3-CHCl-COOC2H5 và CH3COOCHCl-CH3. B. ClCH2-COOC2H5 và CH3COOCH2CH2Cl. C. ClCH2-COOC2H5 và CH3COOCHCl-CH3. D. CH3COOCHCl-CH2Cl và CH3COOCH2CH2Cl. Câu 11. Khi brom hóa một ankan chỉ thu được một dẫn xuất monobrom duy nhất có tỉ khối hơi đối với hiđro là 75,5. Tên của ankan đó là A. 3,3-đimetylhexan. B. isopentan. C. 2,2-đimetylpropan. D. 2,2,3-trimetylpentan. Câu 12. Hiđrat hóa 2 anken chỉ tạo thành 2 ancol. Hai anken đó là A. 2-metylpropen và but-1-en. B. propen và but-2-en. C. eten và but-2-en. D. eten và but-1-en. Câu 13. Cho hiđrocacbon X phản ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1, thu được chất hữu cơ Y (chứa 74,08% Br về khối lượng). Khi X phản ứng với HBr thì thu được hai sản phẩm hữu cơ khác nhau. Tên gọi của X là A. but-1-en. B. xiclopropan. C. but-2-en. D. propilen. Câu 14. Anken X hợp nước tạo thành 3-etylpentan-3-ol. Tên của X là A. 3-etylpent-3-en. B. 2-etylpent-2-en. C. 3-etylpent-2-en. D. 3-etylpent-1-en.

0 00

1 3 +

0

N Ơ H

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn Câu 15. Cho các phản ứng sau:

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

0

t C6H10O4 + 2NaOH  → X+Y+Z t

0

→ C2H6O + H2O. X + H2SO4 đặc  Tên gọi của X là: A. ancol etylic. B. ancol metylic. C. etylen glicol. D. axit axetic. Câu 16. Hai chất X và Y cùng có CTPT C9H8O2, cùng là dẫn xuất của benzen, đều làm mất màu nước Br2. X tác dụng với dung dịch NaOH cho 1 muối và 1 anđehit ; Y tác dụng với dung dịch NaOH cho 2 muối và nước. Các muối sinh ra đều có phân tử khối lớn hơn phân tử khối của CH3COONa. X và Y tương ứng là: A. C2H3COOC6H5 và HCOO-C6H4-C2H3. B. C6H5COOC2H3 và C2H3COOC6H5. C. HCOO-C2H2-C6H5 và HCOO-C6H4-C2H3. D. C6H5COOC2H3 và HCOO-C6H4-C2H3. Câu 17. Cho este X (C4H6O2) phản ứng với dung dịch NaOH theo sơ đồ sau : X + NaOH-> muối Y + anđehit Z Cho biết khối lượng phân tử của Y nhỏ hơn 70. Công thức cấu tạo đúng của X là: A. CH3-COOCH=CH2. B. HCOO-CH=CH-CH3. C. HCOOCH2-CH=CH2. D. CH2=CH-COOCH3. Câu 18. Hai hợp chất hữu cơ mạch hở có công thức phân tử lần lượt là C2H8O3N2 và C3H7O2N đều tác dụng với dung dịch NaOH đun nóng, cho hai amin đơn chức bậc 1 thoát ra. Nhận xét nào sau đây đúng về hai hợp chất hữu cơ trên ? A. Chúng đều tác dụng với dung dịch brom. B. Chúng đều là chất lưỡng tính. C. Phân tử của chúng đều có liên kết ion. D. Chúng đều tác dụng với H2 (xúc tác Ni, đun nóng). Câu 19. Chất X có công thức phân tử C3H9O2N. Khi cho X phản ứng với dung dịch NaOH, đun nhẹ thu được muối Y và khí Z (Z có khả năng tạo kết tủa khi tác dụng với dung dịch FeCl3). Nung nóng Y với hỗn hợp NaOH/CaO thu được CH4. Z có phân tử khối là A. 45. B. 32. C. 17. D. 31. Câu 20. Cho hai hợp chất hữu cơ X, Y có cùng công thức phân tử là C3H7NO2. Khi phản ứng với dung dịch NaOH, X tạo ra H2NCH2COONa và chất hữu cơ Z ; còn Y tạo ra CH2=CHCOONa và khí T. Các chất Z và T lần lượt là: A. C2H5OH và N2 B. CH3OH và NH3 C. CH3NH2 và NH3 D. CH3OH và CH3NH2

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 21. Cho X là hợp chất thơm; a mol X phản ứng vừa hết với a lít dung dịch NaOH 1M. Mặt khác, nếu cho a mol X phản ứng với Na (dư) thì sau phản ứng thu được 22,4a lít khí H2 (ở đktc). Công thức cấu tạo thu gọn của X là A. HO-C6H4-COOCH3. B. CH3-C6H3(OH)2. C. HO-CH2-C6H4-OH. D. HO-C6H4-COOH. Câu 22. Hợp chất hữu cơ X tác dụng được với dung dịch NaOH và dung dịch brom nhưng không tác dụng với dung dịch NaHCO3. Tên gọi của X là A. anilin. B. phenol. C. axit acrylic. D. metyl axetat. Câu 23. Đốt cháy hoàn toàn a mol một anđehit X (mạch hở) tạo ra b mol CO2 và c mol H2O (biết b = a + c). Trong phản ứng tráng gương, một phân tử X chỉ cho 2 electron. X thuộc dãy đồng đẳng anđehit A. không no có một nối đôi C=C, đơn chức. B. no, đơn chức. C. không no có hai nối đôi C=C, đơn chức. D. no, hai chức. Câu 24. Cho chất hữu cơ X có công thức phân tử C3H12O3N2 tác dụng với dung dịch NaOH (dư) sau đó cô cạn dung dịch thu được chất hữu cơ đơn chức Y và phần chất rắn chỉ chứa các chất vô cơ. Nếu cho X tác dụng với dung dịch HCl dư sau đó cô cạn dung dịch thì được phần chất rắn và giải phóng khí Z. Phân tử khối của Y và Z lần lượt là A. 31; 46. B. 31; 44. C. 45; 46. D. 45; 44. Câu 25. Hợp chất chứa đồng thời liên kết cộng hóa trị và liên kết ion là A. CH4ON2. B. CH8O3N2. C. C6H16N2. D. C6H7N. Câu 26. Tiến hành phản ứng đồng trùng hợp stiren với buta–1,3–đien ngoài cao su buna–S còn sinh ra sản phẩm phụ X do phản ứng giữa một phân tử stiren và một phân tử buta–1,3–đien. X là chất lỏng, có thể cộng một phân tử brom của nước brom; 1 mol X có thể tác dụng với 4 mol H2 (Ni, to) sinh ra sản phẩm chứa 2 vòng xiclohexan: C6H11–C6H11. Công thức cấu tạo của X là

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

A. B. C. D.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 27. Este X là hợp chất thơm có công thức phân tử là C9H10O2. Cho X tác dụng với dung dịch NaOH, tạo ra hai muối đều có phân tử khối lớn hơn 80. Công thức cấu tạo thu gọn của X là A. CH3COOCH2C6H5. B. HCOOC6H4C2H5. C. C6H5COOC2H5. D. C2H5COOC6H5. Câu 28. Thủy phân este có công thức phân tử C4H8O2 (với xúc tác axit), thu được 2 sản phẩm hữu cơ X và Y. Từ X có thể điều chế trực tiếp ra Y (MY > MX). Vậy chất X là A. ancol metylic. B. etyl axetat. C. axit fomic. D. ancol etylic. Câu 29. Khi cho a mol một hợp chất hữu cơ X (chứa C, H, O) phản ứng hoàn toàn với Na hoặc với NaHCO3 thì đều sinh ra a mol khí. Xét dãy các chất sau: etylen glicol, ancol o-hiđroxibenzylic, axit ađipic, axit 3hiđroxipropanoic; số chất thỏa mãn X là A. 1 B. 2 C. 3 D. 4 Câu 30. Ba chất hữu cơ mạch hở X, Y, Z có cùng công thức phân tử C3H6O và có các tính chất: X, Z đều phản ứng với nước brom; X, Y, Z đều phản ứng với H2 nhưng chỉ có Z không bị thay đổi nhóm chức; chất Y chỉ tác dụng với brom khi có mặt CH3COOH. Các chất X, Y, Z lần lượt là: A. C2H5CHO, (CH3)2CO, CH2=CH-CH2OH. B. C2H5CHO, CH2=CH-O-CH3, (CH3)2CO. C. (CH3)2CO, C2H5CHO, CH2=CH-CH2OH. D. CH2=CH-CH2OH, C2H5CHO, (CH3)2CO. Câu 31. Ancol X no, mạch hở, có không quá 3 nguyên tử cacbon trong phân tử. Biết X không tác dụng với Cu(OH)2 ở điều kiện thường. Số công thức cấu tạo bền phù hợp với X là A. 5 B. 3 C. 4 D. 2 Câu 32. Thủy phân chất X bằng dung dịch NaOH, thu được hai chất Y và Z đều có phản ứng tráng bạc, Z tác dụng được với Na sinh ra khí H2. Chất X là A. HCOO-CH2CHO. B. CH3COO-CH=CH2. C. HCOO-CH=CH2. D. HCOO-CH=CHCH3. Câu 33. Có bao nhiêu tripeptit (mạch hở) khi thuỷ phân hoàn toàn đều thu được sản phẩm gồm alanin và glyxin? A. 6 B. 8 C. 7 D. 5 Câu 34. Số hiđrocacbon là đồng phân cấu tạo của nhau, chứa vòng benzen, có cùng công thức phân tử C8H10 là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

A. 5. B. 3. C. 4. D. 2. Câu 35. Số đồng phân amin bậc một ứng với công thức phân tử C3H9N là A. 2. B. 5. C. 3. D. 4. Câu 36. Số đồng phân cấu tạo ứng với công thức phân tử C2H6O là A. 5. B. 4. C. 2. D. 3. Câu 37. Chất X có công thức phân tử C3H6O2 là este của axit axetic (CH3COOH). Công thức cấu tạo của X là A. C2H5COOH. B. CH3COOCH3. C. HCOOC2H5. D. HOC2H4CHO. Câu 38. Khi đun nóng chất X có công thức phân tử C3H6O2 với dung dịch NaOH thu được CH3COONa. Công thức cấu tạo của X là: A. CH3COOC2H5. B. HCOOC2H5. C. CH3COOCH3. D. C2H5COOH. Câu 39. Axit malic là hợp chất hữu cơ tạp chức, có mạch cacbon không phân nhánh, là nguyên nhân chính gây nên vị chua của quả táo. Biết rằng 1 mol axit malic phản ứng được với tối đa 2 mol NaHCO3. Công thức của axit malic là A. CH3OOC-CH(OH)-COOH B. HOOC-CH(OH)-CH(OH)-CHO C. HOOC-CH(OH)-CH2-COOH D. HOOC-CH(CH3)-CH2-COOH Câu 40. Có bao nhiêu amin bậc ba là đồng phân cấu tạo của nhau ứng với công thức phân tử C5H13N ? A. 3. B. 2. C. 5. D. 4.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

(nhóm ở 3 vị trí o,m,p ) tổng cộng 5 đp

Câu 10: B ♦ Để X phản ứng tạo C2H5OH thì gốc ancol của X phải không có Cl, như vậy ta loại được đáp án D.

Câu 2: D Có tối đa 4 đipeptit thỏa mãn là Ala-Ala, Gly-Gly, Ala-Gly, Gly-Ala Câu 3: A Có 4 CTCT thỏa mãn là C6H5CH2NH2; o,p,m-CH3C6H4NH2 Câu 4: C nAg = 0,5 mol = 2.nX → X là andehit đơn chức.

♦ Để Y tạo C2H4(OH)2 thì gốc ancol phải là -CH2-CH2Cl. Từ các lập luận trên, ta thấy đáp án B phù hợp. Câu 11: C Gọi công thức ankan là

X + H2 → ancol no đơn chức. n H2 = 2.n X → X chưa no, có 1 nối đôi C = C → X là CnH2n-1CHO với n ≥ 2

H

G N Ư

O Ạ Đ

.Q P T

UY

N

Do phản ứng với Br2 chỉ tạo 1 dẫn xuất monobrom nên ankan phải có công thức cấu tạo rất đối xứng. (do X nhỉ nhất phải là CH2=CH-CHO mới thỏa mãn) Câu 5: A X có độ bất bão hòa bằng 2 ; thủy phân X ra 2 ancol → X là este 2 chức 2 ancol có số cacbon gấp đôi nhau → C1 và C2 → CH3OH và C2H5OH → X : CH3OOCCH2COOC2H5 Câu 6: D

Câu 12: C

0 00

Câu 7: D Loại A vì chỉ thu được 1 muối Loại B vì không thu được ancol etylic ( tạo ra

)

Loại C vì không thu được ancol etylic (tạo ta

)

D: Câu 8: D

Vậy X là 3-metylbutan-2-on

Ư D I Ồ B

G N Ỡ

TO

ÁN

Câu 9: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

N Ầ TR

Do vậy, đáp án C thỏa mãn.

-

A Ó H

P Ấ C

2

1 3 +

B

♦ Đáp án A:

=>Tạo 4 ancol → Loại Làm tương tự với các đáp án còn lại. ♦ Đáp án B: tạo 3 ancol: 2 của propen và 1 của but-2-en. ♦ Đáp án C: tạo 2 ancol: 1 của eten và 1 của but-2-en. ♦ Đáp án D: tạo 3 ancol: 1 của eten và 2 của but-1-en Câu 13: A

Các đồng phân có thể có của X: , thỏa mãn.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

, thỏa mãn

=>Thỏa mãn.

, loại (do phản ứng với HBr chỉ tạo 1 sản phẩm)

Đáp án C:

UY

Từ 4 đáp án, ta thấy đáp án A đúng

.Q P T

N Ơ H

N

Câu 14: C

=>Loại

Theo quy tắc, ta có anken tương ứng là:

Câu 18: C Hai hợp chất hữu cơ mạch hở có công thức phân tử lần lượt là C2H8O3N2 và C3H7O2N đều tác dụng với dung dịch NaOH đun nóng, cho HAI amin đơn chức bậc 1 thoát ra:

Tên của chất này là 3-etylpent-2-en. Câu 15: B Và

N Ầ TR

H

G N Ư

O Ạ Đ

=>Phân tử của chúng đều có liên kết ion. Câu 19: D Z sẽ có dạng

Câu 16: B Xét từng đáp án:

0 00

♦ Đáp án A: Chất X là Dễ thấy X phản ứng với NaOH không tạo được andehit. =>Loại đáp án A.

H Í

♦ Đáp án B:

-L

ÓA

P Ấ C

2

Chất X là

, thỏa mãn điều kiện phản ứng với NaOH tạo muối và andehit

Chất Y là 82.

, thỏa mãn điều kiện phản ứng NaOH tạo 2 muối và phân tử khối các muối >

N Á O

T

♦ Ta không cần thử thêm các đáp án tiếp theo Câu 17: B Muối Y có phân tử khối nhỏ hơn 70 thì chỉ có 1 muối HCOONa là thỏa mãn.

Ỡ Ư D

NG

Như vậy, ta loại được đáp án A và D.

I Ồ B

Đáp án B:

Sưu tầm bởi GV. Nguyễn Thanh Tú

1 3 +

B

Y sau phản ứng vôi tôi xút thu được CH4, như vậy, Y có thể có 2 công thức:

Do chất X chỉ có 2 nguyên tử oxi nên Y phải là CH3COOH. Như vậy, X sẽ có công thức: Suy ra, công thức Z là Câu 20: B X + NaOH → H2NCH2COONa + Z → X : H2NCH2COOCH3 → Z : CH3OH Y + NaOH → CH2=CHCOONa + T → Y : CH2=CHCOONH4 → T : NH3 Câu 21: C nH2=a mol => X có 2 nhóm chức có thể tác dụng với Na nNaOH = a mol => X chỉ có 1 nhóm OH phenol hoặc 1 nhóm cacboxylic Từ đó suy ra X là C(có 2 nhóm -OH trong đó có 1 nhóm phenol) Câu 22: B Phenol tác dụng được với NaOH và dung dịch brom, nhưng không tác dụng được với dung dịch

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

♦ Đáp án A:

Câu 23: A

Loại do không tạo 2 muối.

UY

là anđehit no, 2 chức,hở hoặc anđehit đơn chức, có 1 nối đôi C=C, hở ♦ Đáp án B: Trong phản ứng tráng gương, X chỉ cho 2 electron nên X là anđehit đơn chức Vậy X thuộc dãy đồng đẵng anđehit không no có 1 nối đôi C=C, đơn chưc Loại do tạo muối có phân tử khối bé hơn 80. Câu 24: B ♦ Đáp án C:

N Ầ TR

Loại do không tạo 2 muối Câu 25: B

♦ Đáp án D:

0 00

B có chứa liên kết cộng hóa trị giữa C-O; N-H và liên kết ion giữa Câu 26: A X có thể cộng một phân tử brom nên loại B do B có thể cộng với 4 phân tử

P Ấ C

2

Khi phản ứng thì buta-1,3-đien sẽ phản ứng kiểu 1,4, nghĩa là còn 1 liên kết đôi ở giữa, do đó khi đóng vòng với stiren, liên kết đôi đó sẽ nằm ở vị trí như đáp án A

I Ồ B

Câu 27: D Xét các đáp án:

H

G N Ư

O Ạ Đ

.Q P T

N

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

Í-

A Ó H

1 3 +

B

Thỏa mãn =>Đáp án D Câu 28: D

Vậy X là ancol etylic Câu 29: A X phải có 1 nhóm -COOH và 1 nhóm -OH Các chấtthỏa mãn là: axit 3-hidroxipropanonic Câu 30: A Các đồng phân có thể có:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

♦ X, Y, Z đều phản ứng với H2 nhưng chỉ có Z không bị thay đổi nhóm chức:

Thu được muối

Ta thấy, chức andehit và xeton khi phản ứng với H2 sẽ bị thay đổi nhóm chức (tạo ancol), do vậy, Z là CH2=CH-CH2OH.

Câu 39: C 1 mol axit phản ứng được với 2 mol

♦ X, Z đều phản ứng với nước brom:

Axit malic là hợp chất hữu cơ tạp chức nên loại D là hợp chất đa chức

2 chất có thể phản ứng với nước Brom là C2H5CHO và CH2=CH-CH2OH, suy ra, X là C2H5CHO

Nên công thức của axit malic là: Câu 40: A Amin bậc ba có CTPT là:

♦ Như vậy, chất Y là Câu 31: A Có 5 CTCT thỏa mãn là CH3OH, C2H5OH, CH3CH2CH2OH, CH3CH(OH)CH3, CH2OH-CH2-CH2OH Câu 32: A Z tác dụng được với Na sinh ra khí H2 nên loại B,C và D do chỉ tạo ra muối và anđehit, không có chất nào phản ứng được với Na

0 00

Câu 33: A Có 6 CTCT thỏa mãn là Ala-Ala-Gly, Ala-Gly-Gly, Ala-Gly-Ala, Gly-Gly-Ala, Gly-Ala-Ala, Gly-Ala-Gly Câu 34: C → CTCT có 1 vòng benzen. Có 4 CTCT thỏa mãn là C6H5CH2CH3; o,p,m-CH3C6H4CH3 Câu 35: A Đồng phân amin bậc một ứng với

Câu 36: C Đồng phân cấu tạo ứng với CTPT

I Ồ B

Ỡ Ư D

NG

là:

N Á O

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

N Ơ H

nên X là este của axit axetic, do đó X là metyl axetat

N Ầ TR

H

nên X có 2 nhóm

G N Ư

O Ạ Đ

nên loại A,B

.Q P T

UY

N

T

Câu 37: B X là este của axit axetic nên X là metyl axetat Câu 38: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

36. Phương pháp Biện luận xác định CTCT của hợp chất hữu cơ (Đề 2)

Câu 1. Trung hoà 6,0g axit caboxylic no đơn chức , mạch hở cần dùng 100ml dung dịch NaOH 1M. CTCT cuả axit là: A. C2H5COOH B. CH3COOH C. CH2=CHCOOH D. HCCOH Câu 2. Đun nóng V lít hơi anđehit X với 3V lít khí H2 (xúc tác Ni) đến khi phản ứng xảy ra hoàn toàn chỉ thu được một hỗn hợp khí Y có thể tích 2V lít (các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất). Ngưng tụ Y thu được chất Z; cho Z tác dụng với Na sinh ra H2 có số mol bằng số mol Z đã phản ứng. Chất X là anđehit A. không no (chứa một nối đôi C=C), hai chức. B. no, hai chức. C. không no (chứa một nối đôi C=C), đơn chức. D. no, đơn chức. Câu 3. Chất hữu cơ X có công thức phân tử C4H6O4 tác dụng với dung dịch NaOH (đun nóng) theo phương trình phản ứng: C4H6O4 + 2NaOH-> 2Z + Y Để oxi hoá hết a mol Y thì cần vừa đủ 2a mol CuO (đun nóng), sau phản ứng tạo thành a mol chất T (biết Y, Z, T là các hợp chất hữu cơ). Khối lượng phân tử của T là A. 44 đvC. B. 58 đvC. C. 82 đvC. D. 118 đvC. Câu 4. Đun nóng hai chất hữu cơ X, Y có công thức phân tử là C5H8O2 trong dung dịch NaOH thu được hỗn hợp hai muối natri của hai axit C3H6O2 (X1) và C3H4O2 (Y1) và hai sản phẩm khác tương ứng là X2 và Y2. Tính chất hóa học nào giống nhau giữa X2 và Y2 ? A. Bị oxi hóa bởi KMnO4 trong môi trường axit mạnh. B. Tác dụng với Na. C. Bị oxi hóa bởi dung dịch AgNO3 trong NH3. D. Bị khử bởi H2. Câu 5. Este X có công thức phân tử dạng CnH2n-2O2. Đốt cháy 0,42 mol X rồi cho sản phẩm cháy hấp thụ hoàn toàn vào dung dịch nước vôi trong có chứa 68,376 gam Ca(OH)2 thì thấy dung dịch nước vôi trong vẩn đục. Thuỷ phân X bằng dung dịch NaOH thu được 2 chất hữu cơ không tham gia phản ứng tráng gương. Phát biểu nào sau đây về X là đúng: A. X là đồng đẳng của etyl acrylat. B. Thành phần % khối lượng O trong X là 36,36%. C. Không thể điều chế được từ ancol và axit hữu cơ tương ứng. D. Tên của este X là vinyl axetat. Câu 6. Cho 3,92 gam một este đơn chức X tác dụng vừa đủ với 100ml KOH 0,4M thu được 6,16 gam muối Y. Axit hóa Y thu được chất Z. Z có công thức phân tử là: A. C5H6O2 B. C5H8O3

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. C6H12O2 D. C6H12O3 Câu 7. Chất hữu cơ A (chứa 2 nguyên tố X, Y); 150 < MA < 170. Đốt cháy hoàn toàn m gam A được m gam H2O. H không tác dụng với dung dịch brom, cũng như với brom (Fe, to), nhưng tác dụng với brom (chiếu sáng) tạo thành một dẫn xuất monobrom duy nhất. Tên gọi của A là A. naphtalen. B. 1,3,5−trimetylbenzen. C. 1,3,5−trietylbenzen. D. hexametylbenzen. Câu 8. Hợp chất hữu cơ X mạch hở, phân tử chứa một loại nhóm chức có công thức phân tử C6HyOz. Trong X oxi chiếm 44,44% theo khối lượng. X tác dụng với NaOH tạo muối Y và chất hữu cơ Z. Cho Y tác dụng với dung dịch HCl tạo ra chất hữu cơ Y1 là đồng phân của Z. Công thức của Z là A. CH3-COOH. B. CH3-CHO. C. HO-CH2-CHO. D. HO-CH2-CH2-CHO. Câu 9. Thủy phân hợp chất hữu cơ X (có chứa chức este) bằng dung dịch NaOH thu được muối Y và chất Z. Biết: - Y tác dụng với dung dịch AgNO3/NH3 thu được Ag và dung dịch T. T tác dụng với dung dịch H2SO4 loãng thu được khí CO2. - Z có công thức (CH2O)n và tham gia phương trình phản ứng theo sơ đồ: + H 2 , Ni ,t 0 + HCl → E  →F Z 

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

Biết F có công thức (CH2Cl)n. CTCT của X là A. HCOOCH=CH2. B. HCOOCH2CH2CHO. C. CH3COOCH=CH2. D. HCOOCH2CHO. Câu 10. Một hỗn hợp X gồm 2 este Y và Z có cùng công thức phân tử C8H8O2 và đều chứa vòng benzen. Xà phòng hoá hết 0,2 mol X cần 0,3 mol NaOH thu được dung dịch T. Biết rằng trong T chứa 3 muối và T không có khả năng tham gia phản ứng tráng gương. Cô cạn T thu được m gam muối khan. Giá trị của m là A. 39,2 gam. B. 35,6 gam. C. 21,1 gam. D. 34,2 gam. Câu 11. Thuỷ phân hoàn toàn 444 gam một lipit thu được 46 gam glixerol và hai loại axit béo. Hai loại axit béo đó là A. C15H31COOH và C17H33COOH. B. C17H33COOH và C15H31COOH. C. C17H31COOH và C17H33COOH. D. C17H33COOH và C17H35COOH. Câu 12. Khi thủy phân chất béo X trong dung dịch NaOH thu được glixerol và hỗn hợp 2 muối C17H35COONa và C15H31COONa có khối lượng hơn kém nhau 1,817 lần. Phân tử X có chứa A. 3 gốc C17H35COO-. B. 2 gốc C17H35COO-. C. 3 gốc C15H31COO-. D. 2 gốc C15H31COO-.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 13. Hợp chất X có CTPT là C5H13N. Khi cho X tác dụng với HNO2 thu được chất Y có CTPT là C5H12O. Oxi hóa Y thu được chất hữu cơ Y1 có CTPT là C5H10O. Y1 không có phản ứng tráng bạc. Mặt khác, đề hiđrat hóa Y thu được 2 anken là đồng phân hình học của nhau. Tên gọi của X là: A. pentan-3-amin. B. pentan-2-amin. C. 3-metylbutan-2-amin. D. isopentylamin. Câu 14. Đốt cháy hoàn toàn 0,12 mol một amin no, mạch hở X bằng oxi vừa đủ thu được 0,6 mol hỗn hợp khí và hơi. Cho 9,2 gam X tác dụng với dung dịch HCl dư thì số mol HCl phản ứng là: A. 0,4 B. 0,3 C. 0,1 D. 0,2 Câu 15. Cho 0,1 mol chất X (CH6O3N2) tác dụng với dd chứa 0,2 mol NaOH đun nóng thu được chất khí làm xanh giấy quì tím ẩm và dd Y. Cô cạn dd Y thu được m gam rắn khan. Giá trị của m là: A. 8,5. B. 12,5. C. 15. D. 21,8. Câu 16. Cho 32,25 gam một muối có công thức phân tử là CH7O4NS tác dụng hết với 750 ml dung dịch NaOH 1M đun nóng thấy thoát ra chất khí làm xanh quỳ tím ẩm và thu được dung dịch X chỉ chứa các chất vô cơ. Cô cạn dung dịch X thu được bao nhiêu gam chất rắn khan? A. 45,5. B. 35,5. C. 30,0. D. 50,0. Câu 17. Cho 12,4 gam chất X có CTPT C3H12O3N2 đun nóng với 2 lít dung dịch NaOH 0,15M. Sau phản ứng hoàn toàn thu được chất khí Y làm xanh quỳ ẩm và dung dịch Z. Cô cạn Z rồi nung đến khối lượng không đổi thu được bao nhiêu gam chất rắn ? A. 14,6 B. 17,4 C. 24,4 D. 16,2 Câu 18. Hợp chất hữu cơ X có công thức C2H8N2O4. Khi cho 12,4 gam X tác dụng với 200 ml dung dịch NaOH 1,5M thu được 4,48 lít (đktc) khí Y làm xanh quỳ tím ẩm. Cô cạn dung dịch sau phản ứng thu được m gam chất rắn khan. Giá trị của m là: A. 13,4. B. 16,2. C. 17,2. D. 17,4. Câu 19. X là hợp chất hữu cơ mạch vòng chứa C, H, N trong đó N chiếm 15,054% theo khối lượng. X tác dụng với HCl tạo ra muối có dạng RNH3Cl. Cho 9,3 gam X tác dụng hết với nước brom dư thu được a gam kết tủa. Giá trị của a là: A. 30 gam B. 33 gam

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

C. 44 gam D. 36 gam Câu 20. Cho 7,7 gam chất hữu cơ X có CTPT C2H7O2N tác dụng hết với 200 ml dung dịch NaOH rồi cô cạn thu được 12,2 gam chất rắn. Nồng độ mol của dung dịch NaOH là: A. 1M ; 1,25M. B. 1,175M; 1,25M. C. 1,5M; 1M. D. 1M; 1,175M. Câu 21. Hỗn hợp G gồm hai anđehit X và Y, trong đó MX < MY < 1,6MX. Đốt cháy hỗn hợp G thu được CO2 và H2O có số mol bằng nhau. Cho 0,10 mol hỗn hợp G vào dung dịch AgNO3 trong NH3 thu được 0,25 mol Ag. Tổng số các nguyên tử trong một phân tử Y là A. 10 B. 7 C. 6 D. 9 Câu 22. Cho 0,125 mol anđehit mạch hở X phản ứng với lượng dư dung dịch AgNO3 trong NH3 thu được 27 gam Ag. Mặt khác, hiđro hóa hoàn toàn 0,25 mol X cần vừa đủ 0,5 mol H2. Dãy đồng đẳng của X có công thức chung là A. CnH2n(CHO)2 (n ≥ 0) B. CnH2n-3CHO (n ≥ 2) C. CnH2n+1CHO (n ≥ 0) D. CnH2n-1CHO (n ≥ 2) Câu 23. Tiến hành phản ứng trùng hợp buta–1,3–đien ngoài cao su Buna còn sinh ra sản phẩm phụ X. X là chất lỏng; 16,2 gam X làm mất màu vừa hết 200 ml dung dịch Br2 1,5M. Công thức cấu tạo của X là

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

A. B. C. D. Câu 24. Hiđrocacbon thơm C9H8 (X) làm mất màu nước brom, cộng hợp được với brom theo tỉ lệ mol 1:2, khi oxi hóa tạo thành axit benzoic, khi tác dụng với dung dịch AgNO3 trong NH3 tạo kết tủa đặc trưng. Phát biểu nào sau đây không đúng ? A. X có 3 công thức cấu tạo phù hợp. B. X có tên gọi là benzylaxetilen. C. X có độ bất bão hòa bằng 6. D. X có liên kết ba ở đầu mạch. Câu 25. Cho 0,02 mol α-amino axit X tác dụng vừa đủ với dung dịch chứa 0,04 mol NaOH. Mặt khác 0,02 mol X tác dụng vừa đủ với dung dịch chứa 0,02 mol HCl, thu được 3,67 gam muối. Công thức của X là A. CH3CH(NH2)-COOH. B. HOOC-CH2CH(NH2)-COOH.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

C. HOOC-CH2CH2CH(NH2)-COOH. D. H2N-CH2CH(NH2)-COOH. Câu 26. Trung hòa 10,4 gam axit cacboxylic X bằng dung dịch NaOH, thu được 14,8 gam muối. Công thức của X là A. C2H5COOH. B. HOOC-CH2-COOH. C. HOOC-COOH. D. C3H7COOH. Câu 27. Thuỷ phân hoàn toàn 0,1 mol este X bằng NaOH, thu được một muối của axit cacboxylic Y và 7,6 gam ancol Z. Chất Y có phản ứng tráng bạc, Z hoà tan được Cu(OH)2 cho dung dịch màu xanh lam. Công thức cấu tạo của X là A. HCOOCH2CH2CH2OOCH. B. HCOOCH2CH(CH3)OOCH. C. HCOOCH2CH2OOCCH3. D. CH3COOCH2CH2OOCCH3. Câu 28. Đun nóng 0,1 mol este đơn chức X với 135 ml dung dịch NaOH 1M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được ancol etylic và 9,6 gam chất rắn khan. Công thức cấu tạo của X là A. C2H5COOCH3. B. C2H3COOC2H5. C. C2H5COOC2H5. D. CH3COOC2H5. Câu 29. Cho este X có công thức phân tử C4H6O2. Biết rằng: X + NaOH → Y + Z Y + H2SO4 → Na2SO4 + T Các chất Z và T đều có khả năng tham gia phản ứng tráng bạc. Số công thức cấu tạo có thể có của X là A. 3. B. 1. C. 2. D. 4. Câu 30. Khi thủy phân este C7H6O2 trong môi trường axit thu được 2 sản phẩm hữu cơ X và Y, trong đó X cho phản ứng tráng gương, còn Y không có phản ứng tráng gương nhưng tác dụng với dung dịch Br2 cho kết tủa trắng. CTCT của este là: A. CH≡C-COOC≡C-C2H5 B. CH3COOCH=CH-C≡CH C. HCOOC6H5 D. HCOOCH=CH-C≡C-CH-CH2 Câu 31. Hợp chất hữu cơ A có công thức phân tử là C6H10O5. Khi A tác dụng với dung dịch NaHCO3 và với Na đều thu được số mol khí bằng số mol A đã phản ứng. Mặt khác, 0,1 mol A tác dụng vừa đủ với 200ml dung dịch KOH 1M. Cô cạn dung dịch sau phản ứng thu được m gam một muối khan duy nhất. Công thức của A và giá trị của m là A. HO-CH2CH2COOCH2CH2COOH; 25,6. B. HO-CH2CH2COOCH2CH2COOH; 23,8. C. HOOCCH2CHOHCH2CH2COOH; 23,8. D. HOOCCH2CHOHCH2CH2COOH; 25,6.

I Ồ B

G N Ỡ

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

-L

H Í

ÓA

P Ấ C

2

UY

0 00

1 3 +

N Ơ H

Câu 32. Chất M có công thức phân tử là C3H12N2O3. Chất Q có công thức phân tử là CH8N2O3. Cho M, Q lần lượt phản ứng với dung dịch HCl cùng cho ra một khí Z. Mặt khác khi cho M, Q tác dụng với dung dịch NaOH thì M cho khí X còn Q cho khí Y. Phát biểu đúng là A. X, Y làm quỳ ẩm hóa xanh. B. Z vừa phản ứng được với NaOH vừa phản ứng được với HCl. C. X, Y, Z phản ứng được với dung dịch NaOH. D. MZ > MY > MX. Câu 33. Cho hợp chất hữu cơ X tác dụng với dung dịch AgNO3/NH3 (dư) thu được sản phẩm Y. Cho Y tác dụng với dung dịch HCl hoặc dung dịch NaOH đều sinh ra chất khí vô cơ. X là A. CH3CHO. B. (NH4)2CO3. C. C2H2. D. HCOONH4. Câu 34. Cho các tính chất sau: (1) không làm đổi màu giấy quỳ tím ẩm; (2) tham gia phản ứng tráng bạc; (3) làm mất màu dung dịch nước brom; (4) oxi hoá hiđro; (5) có nhiệt độ sôi thấp hơn ancol etylic. Chất thoả mãn cả 5 tính chất trên là A. CH2=CHCOOH. B. H2NCH2COOH. C. HCOOCH3. D. CH3CHO. Câu 35. Cho axit hữu cơ X thoả mãn điều kiện sau: a gam X tác dụng với NaHCO3 dư thu được V lít (đktc) khí CO2. Đốt cháy hoàn toàn a gam X thu được V lít (đktc) khí CO2. X là A. axit fomic hoặc axit axetic. B. axit axetic hoặc axit stearic. C. axit oxalic hoặc axit ađipic. D. axit fomic hoặc axit oxalic.

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

ĐÁP ÁN & LỜI GIẢI CHI TIẾT Câu 1: B Câu 2: B Phân tích ngược, Z là ancol mà: Z + Na → .... + H2 ↑ với n H2 = n Z → Z là ancol 2 chức. → X + H2 → Y. mà trong Y, thể tích Z = X = V lít → phải dư 1 V H2. → Có 2 V lít H2 phản ứng với X ↔ H2 phản ứng với 2 nhóm -CHO trong X để tạo ancol → X là andehit no và 2 chức. Câu 3: B

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

X phản ứng NaOH → muối + chất hữu cơ Z và X chỉ chứa 1 nhóm chức → X là este. T là

TH1: z = 2 → M X = 32 ÷ 0,4444 = 72 loại vì C6 ↔ 72 rồi.

có khối lượng phân tử là 58

Câu 4: A

Z = 6, 8, ... lớn hơn không thỏa mãn vì X chỉ là C6. Như vậy X là este chưa no, có 1 nối đôi C = C và 2 chức -COO. đều bị oxi hóa bởi

Cả

UY

TH2: z = 4 → M X = 144 ↔ X là C6H8O4 thỏa mãn.

trong môi trường axit mạnh.

O Ạ Đ

.Q P T

N

Do Z và Y1 là đồng phân → cùng số C → Y, Y1 và Z đều có cùng 6 ÷ 3 = 2 C. Câu 5: A

G N Ư

→ Nối đôi chỉ có thể nằm ở ancol mà không thể ở axit vì C2 axit thì chỉ có CH3COOH.

Thuỷ phân X bằng dung dịch NaOH thu được 2 chất hữu cơ không tham gia phản ứng tráng gương do đó loại D, C

Câu 6: B Ta thấy : mX + mKOH = mY → X là este vòng → X : C5H6O2 → Y : C5H7O3K → Z : C5H8O3 Câu 7: D Hợp chất hữu cơ chắc chắn có C, mà khi đốt cho H2O thì sẽ có H.

N Á O

NG

T

0 00

B

Sử dụng giả thiết Z có dạng

Giả sử tạo 1 mol H2O, khối lượng chất A đã dùng là 18 gam.

Công thức đơn giản nhất là C4H6.

N Ầ TR

Câu 9: D Y là muối và tác dụng được với AgNO3/NH3 thì Y phải là HCOONa (loại được đáp án C)

B: Thành phần % khối lượng O trong X là 36,36% nên M=88 đó là C4H8O2( loại)

-L

H Í

H

Theo đó, X là : CH3COOCH=CHOCOCH3 → Y là CH3COONa và Z là HO-CH=CH-OH không bền hổ biến thành HO-CH2-CHO ứng với đáp án C.

ÓA

P Ấ C

2+

31

cho 3 đáp án còn lại

♦ Đáp án A: Z là CH3CHO, không thỏa mãn

♦ Đáp án B: Z là ♦ Đáp án D: Z là

, cũng không thỏa mãn , thỏa mãn.

Câu 10: D Y và Z đều là este đơn chức → 0,2 mol X cần 0,3 mol NaOH → có 1 chất là este của phenol ; mặt khác sản phẩm không có phản ứng tráng gương → 1 chất là C6H5OOCCH3 → muối còn lại là C6H5COOCH3 → m = 0,2 × 136 + 0,3 × 40 - 0,1 × 18 - 0,1 × 32 = 34,2 Câu 11: D

A tác dụng với Brom chiếu sáng ( A có nhánh), tạo dẫn xuất monobrom duy nhất nên A sẽ có công thức dạng đối xứng.

I Ồ B

Ỡ Ư D

Do vậy, chỉ có đáp án D thỏa mãn. Câu 8: C

Sưu tầm bởi GV. Nguyễn Thanh Tú

Câu 12: D Giả sử

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

X tác dụng với NaOH tạo ra 2 muối có khối lượng hơn kém nhau 1,817 lần

Câu 18: D X + NaOH → Y làm xanh quỳ → X : NH4OOC-COONH4 → chất rắn gồm : NaOOC-COONa và NaOH dư → m = 0,1 × 134 + 0,1 × 40 = 17,4

TH1:

Câu 19: B mN trong 9,3 gam X = 1,4 gam => nN = 0,1 mol KHi X tác dụng với Br2, thì 3 nguyên tử Br sẽ thế chỗ cho 3 nguyên tử H trong vòng. Khối lượng kết tủa tăng so với ban đầu = 0,1.(80-1).3= 23,7 gam Khối lượng kết tủa: a=23,7+9,3=33 gam

(loại) TH2:

Câu 13: A X + HNO2 → Y → X là amin bậc 1 Y oxi hóa → Y1 không có phản ứng tráng bạc → Y là ancol bậc 2 đề hidrat hóa Y → 2 anken là đồng phân hình học của nhau → Vậy Y là : C-C-C(OH)-C-C → X : C-C-C(NH2)-C-C Câu 14: A Giả sử công thức của amin là

ÓA

=>Cho 9,2 gam X tác dụng với dung dịch HCl dư thì số mol HCl phản ứng là: n_{HCl}= 0,4

ÁN

Câu 16: A chất ban đầu : CH3NH3HSO4 nmuối ban đầu = 0,25 mol ; nNaOH = 0,75 mol → sản phẩm chất rắn gồm : Na2SO4 và NaOH → khối lượng chất rắn = 0,25 × 142 + 0,25 × 40 = 45,5

Ư D I Ồ B

G N Ỡ

TO

Câu 17: A X + NaOH → Y làm xanh quỳ → Y : CH3NH3CO3NH3CH3 → chất rắn : Na2CO3 và NaOH dư khối lượng chất rắn = 0,1 × 106 + 0,1 × 40 = 14,6

Sưu tầm bởi GV. Nguyễn Thanh Tú

.Q P T

N

Câu 20: D nX=0,1 mol CTPT của X có thể là CH3COONH4 hoặc HCOONH3CH3 Nếu X là CH3COONH4 thì sau phản ứng thu được 0,1 mol CH3COONa => mNaOH = 4 g => nNaOH = 0,1 mol => tổng số mol NaOH đã dùng = 0,2 mol => Nồng độ mol = 1M Nếu X là HCOONH3CH3 thì sau phản ứng thu được 0,1 mol HCOONa => mNaOH = 5,4 => nNaOH = 0,135 = NỒng độ mol = 1,175 M

Vậy trong phân tử X có 2 gốc C15H31COO.

Câu 15: B CH6O3N2 → CH3NH3NO3 → Y gồm : 0,1 mol NaNO3 ; 0,1 mol NaOH dư → m = 12,5

O Ạ Đ

UY

N Ơ H

-L

H Í

P Ấ C

2+

31

0 00

B

N Ầ TR

H

G N Ư

Câu 21: B X và Y đều là anđehit no, đơn chức, hở phải có HCHO

Tổng số nguyên tử trong Y là: 7 Câu 22: D là anđehit đơn chức và không phải HCHO có 1 liên kết đôi ở mạch cacbon

Câu 23: D

tác dụng được với 2 phân tử

nên loại công thức A( không tác dụng với Brom do chỉ

chứa vòng 4 cạnh) và C(chỉ tác dụng với 1 phân tử brom, do chỉ chứa 1 liên kết đôi)

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

N Ơ H

Khi phản ứng sẽ theo cơ chế 1,4; do đó ta chỉ thu được D chứ không thu được B Câu 27: B

Z hòa tan được

cho dung dịch màu xanh lam nên

Nhận thấy chỉ có este ở phương án B thỏa mãn

O Ạ Đ

UY

.Q P T

N

Câu 28: D Dựa đáp án tất cả đều là este đơn chức.X thủy phân tạo ancol etylic. Đặt CT este dạng RCOOC2H5.

G N Ư

ROOC2H5 + NaOH → RCOONa + C2H5OH

H

nX= 0,1 mol< nNaOH= 0,135 mol. Vậy sau phản ứng NaOH còn dư.

N Ầ TR

Câu 24: A CTCT của A là:

Chất rắn khan gồm RCOONa 0,1 mol và NaOH dư 0,035 mol.

X chỉ có 1 CTCT phù hợp , có tên gọi là benzylaxetilen

→ mchất rắn= mRCOONa + mNaOH → 9,6 = 0,1( MR + 67)+ 0,035. 40→ MR= 15 (CH3).

0 00

độ bất bảo hòa: Câu 25: C có 2 nhóm –COOH có 1 nhóm

N Á O

Câu 26: B

ax------------------ax

Ư D I Ồ B

Khối lượng tăng: mà

G N Ỡ

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

1 3 +

B

Vậy CTCT CH3COOC2H5. Câu 29: B T có tham gia phản ứng tráng bạc nên T là axit fomic, nên X là este của axit fomic Z khả năng tham gia phản ứng tráng bạc nên Z là anđehit, chỉ có 1 CTCT của X thỏa mãn: (không tính đồng phân hình học) Câu 30: C X có phản ứng tráng gương nên X là axit fomic, Y không có phản ứng tráng gương nhưng tác dụng được với dung dịch nên Y thuộc phenol

nhưng không cho kết Loại A,B do X sẽ không có phản ứng tráng gương, loại D do Y sẽ tác dụng được với tủa. Câu 31: A Khi A tác dụng với dung dịch và với Na đều thu được số mol khí bằng số mol A nên A có 1 nhóm -COOH và 1 nhóm -OH nên loại C và D A tác dụng với KOH thu được 1 muối duy nhất nên CTCT của A là:

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

; muối duy nhất thu được là:

có đầy đủ cả 5 tính chất trên

UY

Câu 35: D

Bảo toàn khối lượng:

N Ơ H

có nhiệt độ sôi thấp hơn ancol etylic

(5)

Câu 32: A Ta có: với cùng 1 lượng X thì số mol t sẽ như nhau Tác dụng với Đốt cháy:

G N Ư

O Ạ Đ

.Q P T

N

Lượng CO2 thu được như nhau nên: A đúng,

đều làm quỳ ẩm hóa xanh chỉ phản ứng được với NaOH

B sai,

C sai, chỉ có

0 00

D sai, Câu 33: D

tác dụng với

tạo ra

NaOH mới tạo khí Với Với

là hợp chất hữu cơ

N Á O

tác dụng được với HCl tạo lại

thì tạo ra

Câu 34: D (1) không làm đổi màu quỳ tím ẩm nên loại A

Ỡ Ư D

NG

H

z=1 là axit fomic, z=2 là axit oxalic

phản ứng được với NaOH

Loại A do

N Ầ TR

hoặc

-L

H Í

ÓA

P Ấ C

2

1 3 +

B

chỉ tác dụng với

T

(2) tham gia phản ứng tráng bạc nên loại B

I Ồ B

(3)làm mất màu dung dịch nước brom: cả C và D đều được (4)oxi hóa hidro nên loại C

Sưu tầm bởi GV. Nguyễn Thanh Tú

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

37. Tổng ôn tập bài toán biện luận hữu cơ

UY

Câu 1. Hợp chất hữu cơ A có công thức phân tử C3H9O2N. Cho A phản ứng với dung dịch NaOH đun nóng nhẹ, thu được muối B và khí C làm xanh quì tím ẩm. Nung B với NaOH rắn thu được một hiđrocacbon đơn giản nhất. Công thức cấu tạo của A là: A. CH3COONH3CH3 B. CH3CH2COONH4 C. HCOONH3CH2CH3 D. HCOONH2(CH3)2 Câu 2. Cho sơ đồ phản ứng sau:

Công thức cấu tạo của X là A. CH2=C(CH3)-COOC6H5. B. CH2=CH-COOC6H5. C. C6H5COOCH=CH2. D. CH2=C(CH3)-COOCH2-C6H5. Câu 3. Chất X (C8H14O4) thoả mãn sơ đồ các phản ứng sau: a) C8H14O4 + 2NaOH → X1 + X2 + H2O. b) X1 + H2SO4 → X3 + Na2SO4 c) nX3 + nX4 → Nilon-6,6 + nH2O d) 2X2 + X3 → X5 + 2H2O Công thức cấu tạo của X (C8H14O4 ) là: A. HCOO(CH2)6 OOCH B. CH3OOC(CH2)4COOCH3 C. CH3OOC(CH2)5COOH D. CH3CH2OOC(CH2)4COOH Câu 4. Đun nóng m gam hỗn hợp X gồm các chất có cùng loại nhóm chức với 600 ml dung dịch NaOH 1,15M, thu được dung dịch Y chứa muối của một axit cacboxylic đơn chức và 15,4 gam hơi Z gồm các ancol. Cho toàn bộ Z tác dụng với Na dư, thu được 5,04 lít khí H2 (đktc). Cô cạn dung dịch Y, nung nóng chất rắn thu được với CaO cho đến khi phản ứng xảy ra hoàn toàn, thu được 7,2 gam một chất khí. Giá trị m là A. 40,6 B. 22,6 C. 34,51 D. 34,3 Câu 5. Cho sơ đồ sau: (1) X + H2 → Y; (2) X + O2 → Z ; (3) Y + Z → C4H4O4 + 2H2O. Các chất Y, Z là

I Ồ B

Ỡ Ư D

NG

N Á O

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

Í -L

-

A Ó H

P Ấ C

2

0 00

1 3 +

N Ơ H

A. Y : CH3OH ; Z : C2H2O4 B. Y : C2H4(OH)2 ; Z : H2CO2 C. Y : C2H5OH ; Z : C2H2O4 D. Y : C2H4(OH)2 ; Z : C2H2O4 Câu 6. X là một anđehit mạch hở có số nguyên tử C trong phân tử nhỏ hơn 4. Cho 1 mol X tác dụng với lượng dư dung dịch AgNO3 trong NH3 thu được 2 mol Ag; mặt khác 1 mol X phản ứng tối đa 2 mol H2. Phân tử khối của X là A. 56 B. 44 C. 54 D. 72 Câu 7. Chất hữu cơ X có công thức phân tử là C6H10O2. Cho X tác dụng với dung dịch Br2 thu được chất hữu cơ Y có công thức là C6H10O2Br2. Đun nóng Y trong NaOH dư thu được glixerol, NaBr và muối cacboxylat của axit Z. Vậy công thức cấu tạo của X là A. C2H5COOCH2-CH=CH2 B. CH3COOCH(CH3)-CH=CH2 C. CH2=CH-CH2-COOCH2CH3 D. C2H5COOCH=CH-CH3 Câu 8. Hợp chất hữu cơ A có công thức phân tử tổng quát dạng CxHyO4 và thỏa mãn các dữ kiện sau: (1) A + NaOH ->X + Y + Z (2) X + H2SO4 ->E + Na2SO4 (3) Y + H2SO4 ->F + Na2SO4 Đun F với H2SO4 đặc (170oC) thì thu được axit C3H4O2, các chất E và Z đều có phản ứng tráng gương. Các hệ số của các chất trong sơ đồ trên không nhất thiết là hệ số tối giản khi phản ứng. Giá trị nhỏ nhất của MA (gam/mol) là A. 160 B. 188 C. 112 D. 144 Câu 9. Hợp chất X có công thức phân tử C6H8O6. X phản ứng với NaOH theo tỉ lệ mol 1:3 và phản ứng với AgNO3/NH3 theo tỉ lệ mol 1 : 6. X không phản ứng với NaHCO3. Có các kết luận sau: (1) X có khả năng phản ứng với Cu(OH)2/OH- khi đung nóng. (2) X có chứa nhóm chức axit cacboxylic. (3) X có chứa nhóm chức este. (4) X có nhóm chức anđehit. (5) X là hợp chất đa chức. (6) X có chứa liên kết ba đầu mạch. Số kết luận đúng về X là A. 1 B. 2 C. 3 D. 4 Câu 10. Hợp chất hữu cơ X (mạch hở) chứa C, H, O. Lấy 0,1 mol X cho tác dụng vừa đủ với 200 ml dung dịch NaOH 1M chỉ thu được 19,6 gam chất hữu cơ Y và 6,2 gam ancol Z. Đem Y tác dụng với dung dịch HCl loãng, dư thu được hợp chất hữu cơ Y1. Khi Y1 tác dụng với Na thì số mol H2 thoát ra bằng số mol Y1 tham gia phản ứng. Có các nhận định sau về X:

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

(a) X có 2 chức este. (b) Trong X có 2 nhóm hiđroxyl. (c) X có công thức phân tử là C6H10O6. (d) X có khả năng tham gia phản ứng tráng bạc. Số nhận định đúng là A. 2. B. 4. C. 1. D. 3. Câu 11. Cho các phản ứng:

UY

0

t X + 3 NaOH  → C6 H 5ONa + Y + CH 3CHO + H 2 0 CaO ,t 0

Y + 2 NaOH → T + 2 Na2CO3 0

t CH 3CHO + 2Cu (OH ) 2 + NaOH  → Z + .... CaO ,t 0

Z+ NaOH → T + Na2CO3 Tổng số nguyên tử trong một phân tử của X là A. 28. B. 26. C. 25. D. 27. Câu 12. Cho các phản ứng sau: t X + 2NaOH  → 2Y + H2O (1) t0

2+

Y + HCl (loãng)  → Z + NaCl (2) Biết X là chất hữu cơ có công thức phân tử C6H10O5. Khi cho 0,1 mol Z tác dụng hết với Na (dư) thì số mol H2 thu được là A. 0,05 B. 0,10 C. 0,15 D. 0,20 Câu 13. (Đề NC) Hợp chất hữu cơ X có công thức phân tử C6H8O4 tham gia dãy chuyển hóa sau: (1) X + NaOH → Y + Z + T (2)Y+H 2 SO4 (loang ) → E + Na 2 SO4

(3) Z +H 2 SO4 (loang ) → F + Na 2 SO4

0

Í -L

-

A Ó H

P Ấ C

H 2 SO4 ( dac ),170 C (4)F  → I + H 2O

N Á O

Cho biết E, T đều có phản ứng tráng gương; I là axit có công thức C3H4O2. X có thể là chất nào dưới đây? A. CH2=CHCOOCH2COOCH3. B. HCOOCH2COOCH=CHCH3. C. HCOOCH=CHCOOCH2CH3. D. HCOOCH2CH2COOCH=CH2. Câu 14. Chất X là một loại thuốc cảm có công thức phân tử C9H8O4. Cho 1 mol X phản ứng hết với dung dịch NaOH thu được 1 mol chất Y, 1 mol chất Z và 2 mol H2O. Nung Y với hỗn hợp CaO/NaOH thu được parafin đơn giản nhất. Chất Z phản ứng với dung dịch H2SO4 loãng dư thu được hợp chất hữu cơ tạp chức T không có khả năng tráng gương. Có các phát biểu sau: (a) Chất X phản ứng với NaOH (t°) theo tỉ lệ mol 1 : 2. (b) Chất Y có tính axit mạnh hơn H2CO3.

I Ồ B

Ỡ Ư D

NG

T

Sưu tầm bởi GV. Nguyễn Thanh Tú

0 00

31

0

N Ơ H

(c) Chất Z có công thức phân tử C7H4O4Na2. (d) Chất T không tác dụng với CH3COOH nhưng có phản ứng với CH3OH (H2SO4 đặc, to). Số phát biểu đúng là A. 1 B. 2 C. 3 D. 4 Câu 15. Hai este X, Y có cùng công thức phân tử C8H8O2 và chứa vòng benzen trong phân tử. Cho 6,8 gam hỗn hợp gồm X và Y tác dụng với NaOH dư, đun nóng, lượng NaOH phản ứng tối đa là 0,07 mol, thu được dung dịch Z chứa 6,0 gam ba muối. Khối lượng muối của axit cacboxylic có phân tử khối lớn hơn trong Z là A. 1,64 gam. B. 2,04 gam. C. 2,32 gam. D. 2,46 gam. Câu 16. Thủy phân hoàn toàn 0,1 mol este X bằng NaOH, thu được một muối của axit cacboxylic Y và 7,6 gam ancol Z. Chất Y không có phản ứng tráng bạc, Z hòa tan được Cu(OH)2 tạo dung dịch màu xanh lam. Công thức cấu tạo của X là A. HCOOCH2CH(CH3)OOCH. B. CH3COOCH2CH2CH2OOCCH3. C. HCOOCH2CH2CH2OOCH. D. CH3COOCH2CH(CH3)OOCCH3. Câu 17. Cho các phản ứng xảy ra theo sơ đồ:

B

N Ầ TR

H

G N Ư

O Ạ Đ

.Q P T

N

0

t X + NaOH  →Y+Z 0

CaO ,t Y (rắn) + NaOH (rắn)  → CH4 + Na2CO3 0

t → CH3COONH4 + 2NH4NO3 + 2Ag. Z + 2AgNO3 + 3NH3 + H2O  Có các nhận định sau: (a) Không thể điều chế X bằng phản ứng este hoá giữa axit và ancol. (b) Cho Y vào dung dịch HCl dư thu được axit hữu cơ T. Lực axit của T mạnh hơn HCOOH. (c) Z có khả năng cộng brom làm nước brom bị mất màu. (d) X có khả năng tham gia phản ứng tráng bạc. (e) Dung dịch của Y trong nước có môi trường kiềm. (g) Z tan tốt trong nước. Số nhận định đúng là: A. 2. B. 5. C. 3. D. 4. Câu 18. Có ba chất hữu cơ thuần chức, mạch hở, thuộc các nhóm chức của chương trình phổ thông. Công thức phân tử lần lượt là C3H4O2, H2CO2, C2H4O2. Nhóm chức của mỗi chất đều khác nhóm chức của hai chất còn lại. Phát biểu nào sau đây đúng khi nói về ba chất trên A. Cả ba chất đều tham gia phản ứng tráng gương. B. Cả ba chất đều phản ứng với dung dịch NaOH đun nóng. C. C3H4O2 phản ứng với H2 dư cho sản phẩm tác dụng được với Cu(OH)2 ở nhiệt độ thường. D. C2H4O2 có mạch cacbon liên tục.

www.facebook.com/daykemquynhonofficial www.facebook.com/boiduonghoahocquynhonofficial


www.twitter.com/daykemquynhon www.google.com/+DạyKèmQuyNhơn

www.facebook.com/daykem.quynhon www.daykemquynhon.blogspot.com

Câu 19. Thủy phân hoàn toàn 1 mol oligopeptit X mạch hở, được 2 mol glyxin (Gly), 1 mol alanin (Ala), 1 mol valin (